PL105364B1 - Sposob polimeryzacji alfa-olefin zawierajacych co najmniej 3 atomy wegla - Google Patents
Sposob polimeryzacji alfa-olefin zawierajacych co najmniej 3 atomy wegla Download PDFInfo
- Publication number
- PL105364B1 PL105364B1 PL1976189597A PL18959776A PL105364B1 PL 105364 B1 PL105364 B1 PL 105364B1 PL 1976189597 A PL1976189597 A PL 1976189597A PL 18959776 A PL18959776 A PL 18959776A PL 105364 B1 PL105364 B1 PL 105364B1
- Authority
- PL
- Poland
- Prior art keywords
- aluminum
- component
- magnesium
- compound
- compounds
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 62
- 238000006116 polymerization reaction Methods 0.000 title claims description 43
- 239000004711 α-olefin Substances 0.000 title claims description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 title description 4
- 239000010936 titanium Substances 0.000 claims description 56
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 49
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 49
- 239000011777 magnesium Substances 0.000 claims description 46
- 150000001875 compounds Chemical class 0.000 claims description 41
- -1 i.e. Chemical class 0.000 claims description 41
- 229910052782 aluminium Inorganic materials 0.000 claims description 37
- 239000000047 product Substances 0.000 claims description 35
- 239000003054 catalyst Substances 0.000 claims description 32
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 21
- 229910052749 magnesium Inorganic materials 0.000 claims description 21
- 239000002879 Lewis base Substances 0.000 claims description 14
- 150000007527 lewis bases Chemical class 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 239000007795 chemical reaction product Substances 0.000 claims description 12
- 239000007788 liquid Substances 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 12
- 229910052719 titanium Inorganic materials 0.000 claims description 12
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 11
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 9
- 229910003074 TiCl4 Inorganic materials 0.000 claims description 7
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 239000000178 monomer Substances 0.000 claims description 6
- 238000006467 substitution reaction Methods 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 5
- 150000002681 magnesium compounds Chemical class 0.000 claims description 5
- 150000003609 titanium compounds Chemical class 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 claims description 4
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims description 4
- 229930195733 hydrocarbon Natural products 0.000 claims description 4
- 150000002430 hydrocarbons Chemical class 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 3
- 239000005977 Ethylene Substances 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000005234 alkyl aluminium group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 150000004985 diamines Chemical class 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 229910001629 magnesium chloride Inorganic materials 0.000 claims description 2
- 150000004703 alkoxides Chemical class 0.000 claims 3
- 150000001735 carboxylic acids Chemical class 0.000 claims 2
- 239000003085 diluting agent Substances 0.000 claims 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 2
- 150000001350 alkyl halides Chemical class 0.000 claims 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 claims 1
- 159000000003 magnesium salts Chemical class 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 113
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 23
- 229920000642 polymer Polymers 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 17
- 239000002904 solvent Substances 0.000 description 15
- 239000004743 Polypropylene Substances 0.000 description 14
- 238000009835 boiling Methods 0.000 description 14
- 238000000605 extraction Methods 0.000 description 14
- 229920001155 polypropylene Polymers 0.000 description 14
- 229910001220 stainless steel Inorganic materials 0.000 description 14
- 239000010935 stainless steel Substances 0.000 description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 12
- 239000001257 hydrogen Substances 0.000 description 12
- 229910052739 hydrogen Inorganic materials 0.000 description 12
- 239000012071 phase Substances 0.000 description 8
- 239000007789 gas Substances 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 230000001105 regulatory effect Effects 0.000 description 7
- 125000004429 atom Chemical group 0.000 description 6
- 238000005452 bending Methods 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- FHUODBDRWMIBQP-UHFFFAOYSA-N Ethyl p-anisate Chemical compound CCOC(=O)C1=CC=C(OC)C=C1 FHUODBDRWMIBQP-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000000921 elemental analysis Methods 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000002685 polymerization catalyst Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000012265 solid product Substances 0.000 description 4
- 238000007792 addition Methods 0.000 description 3
- 150000001336 alkenes Chemical class 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- 241000938605 Crocodylia Species 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000010908 decantation Methods 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- NSMWYRLQHIXVAP-UHFFFAOYSA-N 2,5-dimethylpiperazine Chemical compound CC1CNC(C)CN1 NSMWYRLQHIXVAP-UHFFFAOYSA-N 0.000 description 1
- VSYZXASVWVQEMR-UHFFFAOYSA-N 2-methylbuta-1,3-dienylalumane Chemical compound CC(=C[AlH2])C=C VSYZXASVWVQEMR-UHFFFAOYSA-N 0.000 description 1
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 1
- 241000125205 Anethum Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 150000004729 acetoacetic acid derivatives Chemical class 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical compound [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- IQYKECCCHDLEPX-UHFFFAOYSA-N chloro hypochlorite;magnesium Chemical compound [Mg].ClOCl IQYKECCCHDLEPX-UHFFFAOYSA-N 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- LDCRTTXIJACKKU-ARJAWSKDSA-N dimethyl maleate Chemical compound COC(=O)\C=C/C(=O)OC LDCRTTXIJACKKU-ARJAWSKDSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- RETLCWPMLJPOTP-UHFFFAOYSA-N ethyl 2-chlorobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1Cl RETLCWPMLJPOTP-UHFFFAOYSA-N 0.000 description 1
- SOUAXOGPALPTTC-UHFFFAOYSA-N ethyl 2-methylbenzoate Chemical compound CCOC(=O)C1=CC=CC=C1C SOUAXOGPALPTTC-UHFFFAOYSA-N 0.000 description 1
- FNODWEPAWIJGPM-UHFFFAOYSA-N ethyl o-methoxybenzoate Natural products CCOC(=O)C1=CC=CC=C1OC FNODWEPAWIJGPM-UHFFFAOYSA-N 0.000 description 1
- MGDOJPNDRJNJBK-UHFFFAOYSA-N ethylaluminum Chemical compound [Al].C[CH2] MGDOJPNDRJNJBK-UHFFFAOYSA-N 0.000 description 1
- UAIZDWNSWGTKFZ-UHFFFAOYSA-L ethylaluminum(2+);dichloride Chemical compound CC[Al](Cl)Cl UAIZDWNSWGTKFZ-UHFFFAOYSA-L 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000007792 gaseous phase Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 235000015250 liver sausages Nutrition 0.000 description 1
- YZQBYALVHAANGI-UHFFFAOYSA-N magnesium;dihypochlorite Chemical class [Mg+2].Cl[O-].Cl[O-] YZQBYALVHAANGI-UHFFFAOYSA-N 0.000 description 1
- RTWNYYOXLSILQN-UHFFFAOYSA-N methanediamine Chemical compound NCN RTWNYYOXLSILQN-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- 150000008039 phosphoramides Chemical class 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- GGFBICGBDXVAGX-UHFFFAOYSA-N propylaluminum Chemical compound [Al].[CH2]CC GGFBICGBDXVAGX-UHFFFAOYSA-N 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- SQBBHCOIQXKPHL-UHFFFAOYSA-N tributylalumane Chemical compound CCCC[Al](CCCC)CCCC SQBBHCOIQXKPHL-UHFFFAOYSA-N 0.000 description 1
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- 150000003682 vanadium compounds Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/02—Carriers therefor
- C08F4/022—Magnesium halide as support anhydrous or hydrated or complexed by means of a Lewis base for Ziegler-type catalysts
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT23396/75A IT1038179B (it) | 1975-05-16 | 1975-05-16 | Procedimento di polimerizzazione di alfa olefine con almeno treatoni di carbonto |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL105364B1 true PL105364B1 (pl) | 1979-10-31 |
Family
ID=11206709
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1976189597A PL105364B1 (pl) | 1975-05-16 | 1976-05-15 | Sposob polimeryzacji alfa-olefin zawierajacych co najmniej 3 atomy wegla |
Country Status (19)
| Country | Link |
|---|---|
| JP (1) | JPS51139887A (enExample) |
| AT (1) | AT348252B (enExample) |
| BE (1) | BE841823A (enExample) |
| BR (1) | BR7603044A (enExample) |
| CA (1) | CA1068446A (enExample) |
| DE (1) | DE2620886A1 (enExample) |
| DK (1) | DK151892C (enExample) |
| FR (1) | FR2311032A1 (enExample) |
| GB (2) | GB1538472A (enExample) |
| HU (1) | HU174358B (enExample) |
| IN (1) | IN146040B (enExample) |
| IT (1) | IT1038179B (enExample) |
| NL (1) | NL7604972A (enExample) |
| NO (1) | NO150763C (enExample) |
| PL (1) | PL105364B1 (enExample) |
| RO (1) | RO85498B (enExample) |
| SE (2) | SE7605272L (enExample) |
| TR (1) | TR19114A (enExample) |
| ZA (1) | ZA762881B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1078995B (it) * | 1977-05-24 | 1985-05-08 | Montedison Spa | Catalizzatori per la polimeriazzazione di olefine |
| JPS54135886A (en) * | 1978-04-14 | 1979-10-22 | Sumitomo Chem Co Ltd | Preparation of ethylenic copolymer |
| NO155245C (no) * | 1978-07-24 | 1987-03-04 | Phillips Petroleum Co | Fremgangsmaate til fremstilling av en polymerisasjonskatalysator og anvendelse av katalysatoren til alkenpolymerisering. |
| US4277370A (en) | 1979-02-15 | 1981-07-07 | Standard Oil Company (Indiana) | Alpha-olefin polymerization catalyst |
| US4324690A (en) | 1979-02-15 | 1982-04-13 | Standard Oil Company (Indiana) | Alpha-olefin polymerization catalyst |
| US4347157A (en) | 1979-04-25 | 1982-08-31 | Sumitomo Chemical Company, Limited | Catalysts for the polymerization of olefins |
| US4363746A (en) | 1979-05-29 | 1982-12-14 | Phillips Petroleum Company | Composition of matter and method of preparing same, catalyst, method of producing the catalyst and polymerization process employing the catalyst |
| US4394291A (en) | 1981-03-04 | 1983-07-19 | Phillips Petroleum Company | Polyolefin polymerization process and catalyst |
| AT377625B (de) * | 1981-06-29 | 1985-04-10 | Georges A Cournoyer | Vorrichtung zum lehren von musiktonleitern und -intervallen |
| JPS58189206A (ja) * | 1982-04-30 | 1983-11-04 | Chisso Corp | α−オレフイン重合用触媒成分 |
| US4529715A (en) * | 1983-10-17 | 1985-07-16 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, carbon dioxide, reducing aluminum source, transition metal compound and zinc compound |
| US4544647A (en) * | 1982-07-29 | 1985-10-01 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4426316A (en) | 1982-09-10 | 1984-01-17 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4605715A (en) * | 1982-09-20 | 1986-08-12 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from organomagnesium compound, epihalohydrin reducing halide source and transition metal compound |
| US4604374A (en) * | 1982-09-20 | 1986-08-05 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, epihalohydrin reducing halide source and transition metal compound |
| US4456547A (en) * | 1982-10-21 | 1984-06-26 | Fuentes Jr Ricardo | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and complex formed from admixture of a transition metal compound and an organozinc compound |
| US4661465A (en) * | 1985-10-31 | 1987-04-28 | The Dow Chemical Company | Method for preparing transition metal component of Ziegler-Natta catalysts |
| US5114897A (en) * | 1990-04-18 | 1992-05-19 | The Dow Chemical Company | Catalyst and process for polymerizing olefins |
| US5045612A (en) * | 1990-04-18 | 1991-09-03 | The Dow Chemical Company | Catalyst and process for polymerizing olefins |
| US6001939A (en) * | 1994-09-22 | 1999-12-14 | Solvay Polyolefins Europe-Belgium | Process for the polymerization of olefins |
| BE1008702A3 (fr) * | 1994-09-22 | 1996-07-02 | Solvay | Procede de polymerisation d'olefines. |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL136668C (enExample) * | 1969-01-24 | |||
| FR2093306A6 (fr) * | 1970-06-09 | 1972-01-28 | Solvay | Catalyseurs et procede perfectionnes pour la polymerisation et la copolymerisation des olefines |
| NL164867C (nl) * | 1971-03-11 | 1981-02-16 | Stamicarbon | Werkwijze voor het polymeriseren van alfa-alkenen. |
| NL160286C (enExample) * | 1971-06-25 | |||
| BE791676A (fr) * | 1971-12-08 | 1973-05-21 | Solvay | Procédé pour la polymérisation des oléfines |
| LU65587A1 (enExample) * | 1972-06-22 | 1973-12-27 | ||
| IT969340B (it) * | 1972-09-13 | 1974-03-30 | Montedison Spa | Catalizzatori per la polimerizza zione delle olefine a polimeri in forma sferica |
-
1975
- 1975-05-16 IT IT23396/75A patent/IT1038179B/it active
-
1976
- 1976-04-11 TR TR19114A patent/TR19114A/xx unknown
- 1976-05-10 NL NL7604972A patent/NL7604972A/xx not_active Application Discontinuation
- 1976-05-10 SE SE7605272A patent/SE7605272L/xx unknown
- 1976-05-10 RO RO86062A patent/RO85498B/ro unknown
- 1976-05-10 DK DK206276A patent/DK151892C/da active
- 1976-05-10 NO NO761597A patent/NO150763C/no unknown
- 1976-05-11 FR FR7614146A patent/FR2311032A1/fr active Granted
- 1976-05-11 GB GB19291/76A patent/GB1538472A/en not_active Expired
- 1976-05-11 CA CA252,281A patent/CA1068446A/en not_active Expired
- 1976-05-11 GB GB32907/78A patent/GB1539175A/en not_active Expired
- 1976-05-12 IN IN834/CAL/76A patent/IN146040B/en unknown
- 1976-05-12 DE DE19762620886 patent/DE2620886A1/de not_active Withdrawn
- 1976-05-13 JP JP51053910A patent/JPS51139887A/ja active Granted
- 1976-05-13 AT AT350576A patent/AT348252B/de not_active IP Right Cessation
- 1976-05-14 ZA ZA762881A patent/ZA762881B/xx unknown
- 1976-05-14 BE BE167022A patent/BE841823A/xx not_active IP Right Cessation
- 1976-05-14 BR BR7603044A patent/BR7603044A/pt unknown
- 1976-05-14 HU HU76MO960A patent/HU174358B/hu not_active IP Right Cessation
- 1976-05-15 PL PL1976189597A patent/PL105364B1/pl unknown
-
1980
- 1980-03-04 SE SE8001655A patent/SE434515B/sv not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| RO85498A (ro) | 1984-11-25 |
| NO150763B (no) | 1984-09-03 |
| DK206276A (da) | 1976-11-17 |
| CA1068446A (en) | 1979-12-18 |
| NO150763C (no) | 1984-12-12 |
| AU1392176A (en) | 1977-11-17 |
| ATA350576A (de) | 1978-06-15 |
| BE841823A (fr) | 1976-11-16 |
| SE8001655L (sv) | 1980-03-04 |
| NL7604972A (nl) | 1976-11-18 |
| SE7605272L (sv) | 1976-11-17 |
| ZA762881B (en) | 1977-04-27 |
| JPS5614682B2 (enExample) | 1981-04-06 |
| DE2620886A1 (de) | 1976-11-25 |
| NO761597L (enExample) | 1976-11-17 |
| JPS51139887A (en) | 1976-12-02 |
| GB1539175A (en) | 1979-01-31 |
| BR7603044A (pt) | 1977-05-31 |
| DK151892C (da) | 1988-07-18 |
| FR2311032B1 (enExample) | 1980-07-18 |
| AT348252B (de) | 1979-02-12 |
| IN146040B (enExample) | 1978-02-10 |
| IT1038179B (it) | 1979-11-20 |
| SE434515B (sv) | 1984-07-30 |
| GB1538472A (en) | 1979-01-17 |
| FR2311032A1 (fr) | 1976-12-10 |
| HU174358B (hu) | 1979-12-28 |
| DK151892B (da) | 1988-01-11 |
| TR19114A (tr) | 1978-05-25 |
| RO85498B (ro) | 1984-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL105364B1 (pl) | Sposob polimeryzacji alfa-olefin zawierajacych co najmniej 3 atomy wegla | |
| US4173547A (en) | Catalyst for preparing polyalkenes | |
| GB1589983A (en) | Catalysts for a-olefin polymerization | |
| PL168444B1 (pl) | Staly katalizator do polimeryzacji lub kopolimeryzacji olefin oraz sposób wytwarzania stalego katalizatora do polimeryzacji lub kopolimeryzacji olefin PL PL | |
| PL70285B1 (enExample) | ||
| US4204050A (en) | Polymerization of α-olefins with a dual transition metal catalyst | |
| EP1511780B1 (en) | Ziegler natta catalyst components for the polymerization of olefins | |
| EP0110608A1 (en) | Process for making olefin polymerization catalyst | |
| US4189553A (en) | High efficiency catalyst for polymerizing olefins | |
| US20010039241A1 (en) | Magnesium/titanium alkoxide compounds and method of preparation | |
| US4364851A (en) | Process for producing olefin polymers | |
| JPH05502053A (ja) | 球形粒子を有するポリオレフィンの製法 | |
| JPH0433724B2 (enExample) | ||
| KR890002926B1 (ko) | α-올레핀의 중합방법 | |
| GB1558479A (en) | Process for the production of a catalyst composition for t polymerizaton of alphaolefins | |
| EP0014337A2 (en) | Catalyst, catalyst composition and process for the polymerization of olefins | |
| US4339351A (en) | Process for producing olefin polymers | |
| JPS5846129B2 (ja) | 高結晶性オレフィン重合体の製造法 | |
| GB1570295A (en) | Process for the production of a component of an olefine polymerisation catalyst | |
| JPS63162703A (ja) | オレフイン重合用触媒成分の製造方法 | |
| US4404340A (en) | Process for polymerizing olefins in the presence of a titanium-phosphorus-chromium catalyst | |
| JP2008533226A (ja) | オレフィン類の重合触媒成分 | |
| US2939845A (en) | Polymerization catalyst | |
| JPS5846205B2 (ja) | オレフインの重合方法 | |
| JPS642127B2 (enExample) |