PH21123A - Ergoline derivatives - Google Patents
Ergoline derivativesInfo
- Publication number
- PH21123A PH21123A PH30590A PH30590A PH21123A PH 21123 A PH21123 A PH 21123A PH 30590 A PH30590 A PH 30590A PH 30590 A PH30590 A PH 30590A PH 21123 A PH21123 A PH 21123A
- Authority
- PH
- Philippines
- Prior art keywords
- ergoline derivatives
- ergoline
- derivatives
- Prior art date
Links
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical class O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/10—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hetero atoms directly attached in position 8
- C07D457/12—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB838311679A GB8311679D0 (en) | 1983-04-28 | 1983-04-28 | Ergoline derivatives |
GB838314816A GB8314816D0 (en) | 1983-05-27 | 1983-05-27 | Ergoline derivatives |
Publications (1)
Publication Number | Publication Date |
---|---|
PH21123A true PH21123A (en) | 1987-07-27 |
Family
ID=26285978
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PH30590A PH21123A (en) | 1983-04-28 | 1984-04-23 | Ergoline derivatives |
Country Status (18)
Country | Link |
---|---|
US (1) | US4690929A (en, 2012) |
EP (1) | EP0126968B1 (en, 2012) |
KR (1) | KR900008696B1 (en, 2012) |
AU (1) | AU556968B2 (en, 2012) |
CA (1) | CA1205801A (en, 2012) |
DE (1) | DE3475709D1 (en, 2012) |
DK (1) | DK162996C (en, 2012) |
ES (1) | ES8506031A1 (en, 2012) |
FI (1) | FI81349C (en, 2012) |
GR (1) | GR79575B (en, 2012) |
HU (1) | HU198713B (en, 2012) |
IE (1) | IE57240B1 (en, 2012) |
IL (1) | IL71633A (en, 2012) |
NO (1) | NO161562C (en, 2012) |
PH (1) | PH21123A (en, 2012) |
PT (1) | PT78496B (en, 2012) |
SU (1) | SU1327788A3 (en, 2012) |
YU (1) | YU43357B (en, 2012) |
Families Citing this family (17)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB8714767D0 (en) * | 1987-06-24 | 1987-07-29 | Erba Farmitalia | Egoline derivatives |
NL8400333A (nl) * | 1983-02-16 | 1984-09-17 | Sandoz Ag | Moederkoornalkaloiden, hun bereiding en hun toepassing. |
GB8501078D0 (en) * | 1985-01-16 | 1985-02-20 | Erba Farmitalia | Piperazin-1-yl-ergo-line derivatives |
GB2173189B (en) * | 1985-02-21 | 1988-04-27 | Maruko Pharmaceutical Co | Ergoline derivatives and salts thereof and pharmaceutical compositions thereof |
GB8515528D0 (en) * | 1985-06-19 | 1985-07-24 | Erba Farmitalia | Ergoline derivatives |
US4801712A (en) * | 1985-06-24 | 1989-01-31 | Eli Lilly And Company | 2-Alkyl(or phenyl)thio-6-n-alkylergolines are dopamine D-1 antagonists without D-2 agonist activity |
DE3528576A1 (de) * | 1985-08-06 | 1987-02-19 | Schering Ag | Verfahren zur herstellung von ergolin-thioharnstoffen |
DE3535929A1 (de) * | 1985-10-04 | 1987-04-09 | Schering Ag | 1,2-disubstituierte ergolinderivate |
GB8617907D0 (en) * | 1986-07-22 | 1986-08-28 | Erba Farmitalia | Tetracyclic indole derivatives |
GB8702364D0 (en) * | 1987-02-03 | 1987-03-11 | Erba Farmitalia | Ergolinyl heterocycles |
DK338789A (da) * | 1988-07-15 | 1990-01-16 | Schering Ag | 2-substituerede ergolinylurinstofderivater og fremgangsmaade til fremstilling deraf, deres anvendelse som laegemidler samt mellemprodukter til fremstilling deraf |
AU644625B2 (en) * | 1990-01-25 | 1993-12-16 | Farmitalia Carlo Erba S.R.L. | Process for preparing ergoline derivatives |
GB9006772D0 (en) * | 1990-03-27 | 1990-05-23 | Erba Carlo Spa | 4-piperidinyl-ergoline derivatives |
UA41880C2 (uk) * | 1992-12-24 | 2001-10-15 | Фармація Енд Апджон С.П.А. | Серотонінергічні похідні ерголіну і фармацевтична композиція |
CZ305160B6 (cs) | 2001-06-08 | 2015-05-27 | Ipsen Pharma S.A.S. | Chimérické somatostatin-dopaminové analogy |
TWI523863B (zh) | 2012-11-01 | 2016-03-01 | 艾普森藥品公司 | 體抑素-多巴胺嵌合體類似物 |
HK1213486A1 (zh) | 2012-11-01 | 2016-07-08 | Ipsen Pharma S.A.S. | 促生长素抑制素类似物及其二聚体 |
Family Cites Families (11)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
BE622316A (en, 2012) * | 1961-09-11 | |||
SE393615B (sv) * | 1971-05-19 | 1977-05-16 | Sandoz Ag | Forfarande for framstellning av 6-metyl-8 beta-ureidometyl-ergolener |
US3996228A (en) * | 1973-12-21 | 1976-12-07 | Societa' Farmaceutici Italia S.P.A. | Pyrimidinoaminoethyl ergoline derivatives |
NL7416120A (nl) * | 1973-12-21 | 1975-06-24 | Farmaceutici Italia | Werkwijze voor het bereiden van pyrimidinoami- nomethylergolinederivaten. |
DE2456930A1 (de) * | 1974-12-02 | 1976-08-12 | Tesch Kg E | Elektronisches zeitspeicherrelais |
CH615181A5 (en) * | 1975-05-21 | 1980-01-15 | Sandoz Ag | Process for the preparation of novel ergolene derivatives |
GB2056437A (en) * | 1979-08-07 | 1981-03-18 | Erba Farmitalia | Secoergoline derivatives |
DE3001752A1 (de) * | 1980-01-16 | 1981-07-30 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | Verfahren zur herstellung von 8(alpha)-substituierten 6-methylergolinen |
DD154897A1 (de) * | 1980-12-02 | 1982-04-28 | Seifert Karlheinz Dipl Chem Dr | Verfahren zur herstellung von 8-substituierten ergolinen |
DE3101535A1 (de) * | 1981-01-14 | 1982-08-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue (2-halogen-ergolinyl)-n'.n'-diethyl-harnstoffderivate, verfahren zu ihrer herstellung und deren verwendung als arzneimittel |
GB2112382B (en) * | 1981-11-06 | 1985-03-06 | Erba Farmitalia | Ergoline derivatives |
-
1984
- 1984-04-23 PH PH30590A patent/PH21123A/en unknown
- 1984-04-24 DE DE8484104568T patent/DE3475709D1/de not_active Expired
- 1984-04-24 SU SU843728545A patent/SU1327788A3/ru active
- 1984-04-24 CA CA000452664A patent/CA1205801A/en not_active Expired
- 1984-04-24 EP EP84104568A patent/EP0126968B1/en not_active Expired
- 1984-04-25 ES ES531906A patent/ES8506031A1/es not_active Expired
- 1984-04-25 FI FI841631A patent/FI81349C/fi not_active IP Right Cessation
- 1984-04-25 IL IL71633A patent/IL71633A/xx not_active IP Right Cessation
- 1984-04-26 NO NO841657A patent/NO161562C/no unknown
- 1984-04-26 IE IE1018/84A patent/IE57240B1/en not_active IP Right Cessation
- 1984-04-26 US US06/604,041 patent/US4690929A/en not_active Expired - Fee Related
- 1984-04-26 GR GR74511A patent/GR79575B/el unknown
- 1984-04-26 YU YU742/84A patent/YU43357B/xx unknown
- 1984-04-26 PT PT78496A patent/PT78496B/pt not_active IP Right Cessation
- 1984-04-27 DK DK212784A patent/DK162996C/da not_active IP Right Cessation
- 1984-04-27 KR KR1019840002271A patent/KR900008696B1/ko not_active Expired
- 1984-04-27 AU AU27421/84A patent/AU556968B2/en not_active Ceased
- 1984-04-27 HU HU841656A patent/HU198713B/hu not_active IP Right Cessation
Also Published As
Publication number | Publication date |
---|---|
NO161562B (no) | 1989-05-22 |
ES531906A0 (es) | 1985-06-01 |
ES8506031A1 (es) | 1985-06-01 |
IL71633A (en) | 1987-12-20 |
FI841631A7 (en, 2012) | 1984-10-29 |
CA1205801A (en) | 1986-06-10 |
US4690929A (en) | 1987-09-01 |
HUT34024A (en) | 1985-01-28 |
IL71633A0 (en) | 1984-07-31 |
DK162996C (da) | 1992-06-01 |
EP0126968B1 (en) | 1988-12-21 |
SU1327788A3 (ru) | 1987-07-30 |
PT78496B (en) | 1986-07-22 |
FI81349C (fi) | 1990-10-10 |
DK212784D0 (da) | 1984-04-27 |
DK212784A (da) | 1984-10-29 |
FI841631A0 (en, 2012) | 1984-04-25 |
GR79575B (en, 2012) | 1984-10-30 |
NO161562C (no) | 1989-08-30 |
NO841657L (no) | 1984-10-29 |
DE3475709D1 (en) | 1989-01-26 |
KR900008696B1 (ko) | 1990-11-27 |
IE57240B1 (en) | 1992-06-17 |
DK162996B (da) | 1992-01-06 |
PT78496A (en) | 1984-05-01 |
FI81349B (fi) | 1990-06-29 |
EP0126968A1 (en) | 1984-12-05 |
HU198713B (en) | 1989-11-28 |
AU556968B2 (en) | 1986-11-27 |
AU2742184A (en) | 1984-11-01 |
KR840008353A (ko) | 1984-12-14 |
YU43357B (en) | 1989-06-30 |
YU74284A (en) | 1986-10-31 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
GB2103603B (en) | Ergoline derivatives | |
EP0135177A3 (en) | Benzocycloalkane derivatives | |
PH21123A (en) | Ergoline derivatives | |
EP0129513A3 (en) | Oxamic-acid derivatives | |
GB2112382B (en) | Ergoline derivatives | |
GB8416172D0 (en) | Spirosuccinide derivatives | |
GB2145084B (en) | Fredericamycin derivatives | |
IL72157A0 (en) | 2-alkylthiopenem derivatives | |
GB8310843D0 (en) | Ergoline derivatives | |
DE3475621D1 (en) | 2-dioxacycloalkylthiopenem derivatives | |
DE3479730D1 (en) | Fluoromethylthiooxacephalosporin derivatives | |
EG16589A (en) | 2-azacycloalkylthiopenem derivatives | |
GB8423847D0 (en) | Fluorenylalkylimidazole derivatives | |
IL73223A0 (en) | 2-azacycloalkylthiopenem derivatives | |
GB2093452B (en) | Ergoline derivatives | |
DE3460649D1 (en) | Cyanotercyclohexane derivatives | |
AR243155A1 (es) | Procedimiento para la preparacion de nuevas benzamidas n-aminoetil-sustituidas. | |
ZA844923B (en) | Spirosuccinimide derivatives | |
EP0143001A3 (en) | Pyrimidoisoquinoline derivatives | |
GB8311679D0 (en) | Ergoline derivatives | |
GB2135307B (en) | Ergot derivatives | |
ZA849890B (en) | Iminomethyl-axolyl derivatives | |
GR80442B (en) | Triazolylmethyl-pyridyloxymethyl-carbinol derivatives | |
ZA844658B (en) | 2-alkylthiopenem derivatives | |
GB8314816D0 (en) | Ergoline derivatives |