NZ197952A - 4-amino-1,2-dihydrocarbyl-pyrazolidines and n-(4-pyrazolidinyl)benzamides - Google Patents
4-amino-1,2-dihydrocarbyl-pyrazolidines and n-(4-pyrazolidinyl)benzamidesInfo
- Publication number
- NZ197952A NZ197952A NZ197952A NZ19795281A NZ197952A NZ 197952 A NZ197952 A NZ 197952A NZ 197952 A NZ197952 A NZ 197952A NZ 19795281 A NZ19795281 A NZ 19795281A NZ 197952 A NZ197952 A NZ 197952A
- Authority
- NZ
- New Zealand
- Prior art keywords
- pyrazolidine
- nitro
- amino
- bis
- hydrocarbyl
- Prior art date
Links
- 229940054066 benzamide antipsychotics Drugs 0.000 title claims description 6
- 150000003936 benzamides Chemical class 0.000 title claims description 6
- 238000000034 method Methods 0.000 claims description 41
- -1 nitro, amino Chemical group 0.000 claims description 27
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 14
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 9
- 150000002429 hydrazines Chemical class 0.000 claims description 8
- 125000000623 heterocyclic group Chemical group 0.000 claims description 6
- NMTDWUVFGOBBAX-UHFFFAOYSA-N 1,2-diethylhydrazine;hydron;dichloride Chemical group Cl.Cl.CCNNCC NMTDWUVFGOBBAX-UHFFFAOYSA-N 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000007868 Raney catalyst Substances 0.000 claims description 4
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 4
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- YCBOYOYVDOUXLH-UHFFFAOYSA-N 1,2-Diethylhydrazine Chemical compound CCNNCC YCBOYOYVDOUXLH-UHFFFAOYSA-N 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 3
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims 2
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims 2
- 150000008064 anhydrides Chemical class 0.000 claims 2
- 150000001450 anions Chemical class 0.000 claims 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims 2
- IOHPVZBSOKLVMN-UHFFFAOYSA-N 2-(2-phenylethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1CCC1=CC=CC=C1 IOHPVZBSOKLVMN-UHFFFAOYSA-N 0.000 claims 1
- VRAOBJDADCJSCW-UHFFFAOYSA-N COC1=C(C=CC(=C1)OC)CCNNCCC1=C(C=C(C=C1)OC)OC Chemical compound COC1=C(C=CC(=C1)OC)CCNNCCC1=C(C=C(C=C1)OC)OC VRAOBJDADCJSCW-UHFFFAOYSA-N 0.000 claims 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims 1
- 241001125671 Eretmochelys imbricata Species 0.000 claims 1
- 101100134927 Gallus gallus COR8 gene Proteins 0.000 claims 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical class ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical class CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 48
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 150000003254 radicals Chemical class 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- NYKKXRCUKXDUAL-UHFFFAOYSA-N 1,2-bis[(4-methoxyphenyl)methyl]hydrazine Chemical compound C1=CC(OC)=CC=C1CNNCC1=CC=C(OC)C=C1 NYKKXRCUKXDUAL-UHFFFAOYSA-N 0.000 description 3
- JSZOAYXJRCEYSX-UHFFFAOYSA-N 1-nitropropane Chemical compound CCC[N+]([O-])=O JSZOAYXJRCEYSX-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- SISIYJVUHSSKDF-UHFFFAOYSA-N 1-benzyl-2-ethyl-4-nitropyrazolidine Chemical compound CCN1CC([N+]([O-])=O)CN1CC1=CC=CC=C1 SISIYJVUHSSKDF-UHFFFAOYSA-N 0.000 description 2
- SQZCNTOOLCFFEK-UHFFFAOYSA-N 1-benzyl-2-methyl-4-nitropyrazolidine Chemical compound CN1CC([N+]([O-])=O)CN1CC1=CC=CC=C1 SQZCNTOOLCFFEK-UHFFFAOYSA-N 0.000 description 2
- VFBFKWKOTGWBRW-UHFFFAOYSA-N 1-cyclohexyl-2-ethyl-4-nitropyrazolidine Chemical compound CCN1CC([N+]([O-])=O)CN1C1CCCCC1 VFBFKWKOTGWBRW-UHFFFAOYSA-N 0.000 description 2
- DJIYDGUUQZXROA-UHFFFAOYSA-N 1-cyclohexyl-2-methyl-4-nitropyrazolidine Chemical compound CN1CC([N+]([O-])=O)CN1C1CCCCC1 DJIYDGUUQZXROA-UHFFFAOYSA-N 0.000 description 2
- LZIXEBOQHPATHS-UHFFFAOYSA-N 1-ethyl-2-[(4-methoxyphenyl)methyl]-4-nitropyrazolidine Chemical compound CCN1CC([N+]([O-])=O)CN1CC1=CC=C(OC)C=C1 LZIXEBOQHPATHS-UHFFFAOYSA-N 0.000 description 2
- GBYVAMUMPLYRKT-UHFFFAOYSA-N 1-ethyl-2-methyl-4-nitropyrazolidine Chemical compound CCN1CC([N+]([O-])=O)CN1C GBYVAMUMPLYRKT-UHFFFAOYSA-N 0.000 description 2
- ATCDRMDYOXCNDU-UHFFFAOYSA-N 1-ethyl-4-nitro-2-propan-2-ylpyrazolidine Chemical compound CCN1CC([N+]([O-])=O)CN1C(C)C ATCDRMDYOXCNDU-UHFFFAOYSA-N 0.000 description 2
- CISNTTHBLABRMO-UHFFFAOYSA-N 1-methyl-4-nitro-2-propan-2-ylpyrazolidine Chemical compound CC(C)N1CC([N+]([O-])=O)CN1C CISNTTHBLABRMO-UHFFFAOYSA-N 0.000 description 2
- HSZDKPZQCXWNRJ-UHFFFAOYSA-N 4-(3-morpholin-4-yl-2-nitropropyl)morpholine Chemical compound C1COCCN1CC([N+](=O)[O-])CN1CCOCC1 HSZDKPZQCXWNRJ-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- JXYZHMPRERWTPM-UHFFFAOYSA-N hydron;morpholine;chloride Chemical compound Cl.C1COCCN1 JXYZHMPRERWTPM-UHFFFAOYSA-N 0.000 description 2
- 230000002452 interceptive effect Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 239000012454 non-polar solvent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003218 pyrazolidines Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- UQORAWUVXYYPLS-UHFFFAOYSA-N (4-chlorophenyl)methylhydrazine;dihydrochloride Chemical compound Cl.Cl.NNCC1=CC=C(Cl)C=C1 UQORAWUVXYYPLS-UHFFFAOYSA-N 0.000 description 1
- IFZHGQSUNAKKSN-UHFFFAOYSA-N 1,1-diethylhydrazine Chemical compound CCN(N)CC IFZHGQSUNAKKSN-UHFFFAOYSA-N 0.000 description 1
- NNQXUVSZVFKATP-UHFFFAOYSA-N 1,2-bis[(2,4-dimethoxyphenyl)methyl]hydrazine Chemical compound COC1=C(CNNCC2=C(C=C(C=C2)OC)OC)C=CC(=C1)OC NNQXUVSZVFKATP-UHFFFAOYSA-N 0.000 description 1
- OOVDRWJVDJZHDY-UHFFFAOYSA-N 1,2-bis[(2,4-dimethylphenyl)methyl]hydrazine Chemical compound CC1=C(CNNCC2=C(C=C(C=C2)C)C)C=CC(=C1)C OOVDRWJVDJZHDY-UHFFFAOYSA-N 0.000 description 1
- GYHKJLONOKBXGG-UHFFFAOYSA-N 1,2-bis[(4-butoxyphenyl)methyl]hydrazine;phosphoric acid Chemical compound OP(O)(O)=O.C1=CC(OCCCC)=CC=C1CNNCC1=CC=C(OCCCC)C=C1 GYHKJLONOKBXGG-UHFFFAOYSA-N 0.000 description 1
- WOEOXFDPJZLQPH-UHFFFAOYSA-N 1,2-bis[(4-chlorophenyl)methyl]pyrazolidin-4-amine Chemical compound C=1C=C(Cl)C=CC=1CN1CC(N)CN1CC1=CC=C(Cl)C=C1 WOEOXFDPJZLQPH-UHFFFAOYSA-N 0.000 description 1
- YQALJYOOPKKPRG-UHFFFAOYSA-N 1,2-bis[(4-methoxyphenyl)methyl]-4-nitropyrazolidine Chemical compound C1=CC(OC)=CC=C1CN1N(CC=2C=CC(OC)=CC=2)CC([N+]([O-])=O)C1 YQALJYOOPKKPRG-UHFFFAOYSA-N 0.000 description 1
- BOGDCNGKLPOSPR-UHFFFAOYSA-N 1,2-bis[(4-methoxyphenyl)methyl]pyrazolidin-4-amine Chemical compound C1=CC(OC)=CC=C1CN1N(CC=2C=CC(OC)=CC=2)CC(N)C1 BOGDCNGKLPOSPR-UHFFFAOYSA-N 0.000 description 1
- HLBFSSOBHVYJQZ-UHFFFAOYSA-N 1,2-bis[[4-(trifluoromethyl)phenyl]methyl]pyrazolidin-4-amine Chemical compound C=1C=C(C(F)(F)F)C=CC=1CN1CC(N)CN1CC1=CC=C(C(F)(F)F)C=C1 HLBFSSOBHVYJQZ-UHFFFAOYSA-N 0.000 description 1
- ZAAZMYYPRQHZQS-UHFFFAOYSA-N 1,2-bis[butoxy(phenyl)methyl]pyrazolidin-4-amine Chemical compound C=1C=CC=CC=1C(OCCCC)N1CC(N)CN1C(OCCCC)C1=CC=CC=C1 ZAAZMYYPRQHZQS-UHFFFAOYSA-N 0.000 description 1
- JGTYHAPCWMRPDX-UHFFFAOYSA-N 1,2-di(propan-2-yl)hydrazine;dihydrochloride Chemical compound Cl.Cl.CC(C)NNC(C)C JGTYHAPCWMRPDX-UHFFFAOYSA-N 0.000 description 1
- IZLWSUOBGQVHJZ-UHFFFAOYSA-N 1,2-dibenzylhydrazine;dihydrochloride Chemical compound Cl.Cl.C=1C=CC=CC=1CNNCC1=CC=CC=C1 IZLWSUOBGQVHJZ-UHFFFAOYSA-N 0.000 description 1
- GMPVTBNBIHAQBI-UHFFFAOYSA-N 1,2-dicyclohexylhydrazine;dihydrochloride Chemical compound Cl.Cl.C1CCCCC1NNC1CCCCC1 GMPVTBNBIHAQBI-UHFFFAOYSA-N 0.000 description 1
- IXNFVXVYMBENNM-UHFFFAOYSA-N 1,2-dicyclohexylpyrazolidin-4-amine Chemical compound C1CCCCC1N1CC(N)CN1C1CCCCC1 IXNFVXVYMBENNM-UHFFFAOYSA-N 0.000 description 1
- KMVXDWYGRNSDPF-UHFFFAOYSA-N 1,2-diethylhydrazine hydrate dihydrochloride Chemical compound O.Cl.Cl.CCNNCC KMVXDWYGRNSDPF-UHFFFAOYSA-N 0.000 description 1
- FQWUIOJVBDSHQH-UHFFFAOYSA-N 1,2-diethylpyrazolidin-4-amine Chemical compound CCN1CC(N)CN1CC FQWUIOJVBDSHQH-UHFFFAOYSA-N 0.000 description 1
- QPTLAGDMDPVELY-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]-2-ethylpyrazolidin-4-amine Chemical compound CCN1CC(N)CN1CC1=CC=C(Cl)C=C1 QPTLAGDMDPVELY-UHFFFAOYSA-N 0.000 description 1
- QLQLOVCAKRWREX-UHFFFAOYSA-N 1-benzyl-2-ethylpyrazolidin-4-amine Chemical compound CCN1CC(N)CN1CC1=CC=CC=C1 QLQLOVCAKRWREX-UHFFFAOYSA-N 0.000 description 1
- NNRDMDHLPHFDSE-UHFFFAOYSA-N 1-benzyl-2-methylpyrazolidin-4-amine Chemical compound CN1CC(N)CN1CC1=CC=CC=C1 NNRDMDHLPHFDSE-UHFFFAOYSA-N 0.000 description 1
- YMCXGGKBIIBFEK-UHFFFAOYSA-N 1-cyclohexyl-2-ethylpyrazolidin-4-amine Chemical compound CCN1CC(N)CN1C1CCCCC1 YMCXGGKBIIBFEK-UHFFFAOYSA-N 0.000 description 1
- XYUOOPRAZMJZIY-UHFFFAOYSA-N 1-cyclohexyl-2-methylpyrazolidin-4-amine Chemical compound CN1CC(N)CN1C1CCCCC1 XYUOOPRAZMJZIY-UHFFFAOYSA-N 0.000 description 1
- OUFDLHDFCWPFKY-UHFFFAOYSA-N 1-ethyl-2-[(4-methoxyphenyl)methyl]pyrazolidin-4-amine Chemical compound CCN1CC(N)CN1CC1=CC=C(OC)C=C1 OUFDLHDFCWPFKY-UHFFFAOYSA-N 0.000 description 1
- CGKKTMUSNKEFEY-UHFFFAOYSA-N 1-ethyl-2-propan-2-ylpyrazolidin-4-amine Chemical compound CCN1CC(N)CN1C(C)C CGKKTMUSNKEFEY-UHFFFAOYSA-N 0.000 description 1
- NSHLYLMEOSXOCW-UHFFFAOYSA-N 1-methyl-2-propan-2-ylpyrazolidin-4-amine Chemical compound CC(C)N1CC(N)CN1C NSHLYLMEOSXOCW-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- FGLBSLMDCBOPQK-UHFFFAOYSA-N 2-nitropropane Chemical compound CC(C)[N+]([O-])=O FGLBSLMDCBOPQK-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- ILNGCUVXLQVDTC-UHFFFAOYSA-N 4-chloromorpholine Chemical compound ClN1CCOCC1 ILNGCUVXLQVDTC-UHFFFAOYSA-N 0.000 description 1
- 208000012895 Gastric disease Diseases 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- PJYRHZIKLBWHNW-UHFFFAOYSA-N N-pyrazolidin-1-ylbenzamide Chemical class C(C1=CC=CC=C1)(=O)NN1NCCC1 PJYRHZIKLBWHNW-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 241000287433 Turdus Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- JYHYIFWDMFXPFG-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]methylhydrazine Chemical compound NNCC1=CC=C(C(F)(F)F)C=C1 JYHYIFWDMFXPFG-UHFFFAOYSA-N 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- BIVUUOPIAYRCAP-UHFFFAOYSA-N aminoazanium;chloride Chemical compound Cl.NN BIVUUOPIAYRCAP-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- UYJXRRSPUVSSMN-UHFFFAOYSA-P ammonium sulfide Chemical compound [NH4+].[NH4+].[S-2] UYJXRRSPUVSSMN-UHFFFAOYSA-P 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000030136 gastric emptying Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- ZGCHATBSUIJLRL-UHFFFAOYSA-N hydrazine sulfate Chemical compound NN.OS(O)(=O)=O ZGCHATBSUIJLRL-UHFFFAOYSA-N 0.000 description 1
- LIAWOTKNAVAKCX-UHFFFAOYSA-N hydrazine;dihydrochloride Chemical compound Cl.Cl.NN LIAWOTKNAVAKCX-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- HHFHXLJKKDXLQT-UHFFFAOYSA-N n,n,n',n'-tetramethyl-2-nitropropane-1,3-diamine Chemical compound CN(C)CC([N+]([O-])=O)CN(C)C HHFHXLJKKDXLQT-UHFFFAOYSA-N 0.000 description 1
- XIDIOIMESKWPAU-UHFFFAOYSA-N n-[4-[[2-[(4-acetamidophenyl)methyl]-4-aminopyrazolidin-1-yl]methyl]phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1CN1N(CC=2C=CC(NC(C)=O)=CC=2)CC(N)C1 XIDIOIMESKWPAU-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- BBDOMHXDXUDXPB-UHFFFAOYSA-N n-pyrazolidin-4-ylbenzamide Chemical class C=1C=CC=CC=1C(=O)NC1CNNC1 BBDOMHXDXUDXPB-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 150000002897 organic nitrogen compounds Chemical class 0.000 description 1
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 1
- JOQGJRQKCIJIDB-UHFFFAOYSA-N tin;hydrochloride Chemical compound Cl.[Sn] JOQGJRQKCIJIDB-UHFFFAOYSA-N 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/04—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Cosmetics (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/176,175 US4309552A (en) | 1980-08-07 | 1980-08-07 | Synthesis of 4-nitro-1,2-hydrocarbyl pyrazolidines and process for preparation thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ197952A true NZ197952A (en) | 1984-09-28 |
Family
ID=22643300
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ197952A NZ197952A (en) | 1980-08-07 | 1981-08-06 | 4-amino-1,2-dihydrocarbyl-pyrazolidines and n-(4-pyrazolidinyl)benzamides |
Country Status (29)
| Country | Link |
|---|---|
| US (1) | US4309552A (https=) |
| JP (2) | JPS5759868A (https=) |
| KR (1) | KR840001562B1 (https=) |
| AT (1) | AT378184B (https=) |
| AU (1) | AU539796B2 (https=) |
| BE (1) | BE889878A (https=) |
| CA (1) | CA1164001A (https=) |
| CH (1) | CH652121A5 (https=) |
| DE (1) | DE3130833A1 (https=) |
| DK (1) | DK151625C (https=) |
| EG (1) | EG16445A (https=) |
| ES (2) | ES8502096A1 (https=) |
| FI (1) | FI74952C (https=) |
| FR (2) | FR2490639A1 (https=) |
| GB (1) | GB2081713B (https=) |
| HK (1) | HK485A (https=) |
| HU (2) | HU191978B (https=) |
| IE (1) | IE51530B1 (https=) |
| IL (1) | IL63218A (https=) |
| IT (1) | IT1144824B (https=) |
| NL (1) | NL8103739A (https=) |
| NO (1) | NO156009C (https=) |
| NZ (1) | NZ197952A (https=) |
| PH (2) | PH17183A (https=) |
| PT (1) | PT73489B (https=) |
| SE (2) | SE460605B (https=) |
| SG (1) | SG62138G (https=) |
| YU (2) | YU43498B (https=) |
| ZA (1) | ZA814514B (https=) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP3065506B2 (ja) | 1995-04-03 | 2000-07-17 | 株式会社資生堂 | ピラゾリジン誘導体及びラジカルスカベンジャー、脳梗塞抑制剤、脳浮腫抑制剤 |
| EP1465869B1 (en) * | 2001-12-21 | 2013-05-15 | Exelixis Patent Company LLC | Modulators of lxr |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3660426A (en) * | 1969-06-25 | 1972-05-02 | Robins Co Inc A H | Process for the preparation of 4-pyrazolidinols |
| US4207327A (en) * | 1977-08-19 | 1980-06-10 | A. H. Robins Company, Inc. | N-(4-Pyrazolidinyl)benzamides and their amino precursors |
| PH13331A (en) * | 1977-08-19 | 1980-03-13 | Robins Co Inc A H | N-(4-pyrazolidinyl)-benzamides,composition and method of use thereof |
-
1980
- 1980-08-07 US US06/176,175 patent/US4309552A/en not_active Expired - Lifetime
-
1981
- 1981-07-01 IL IL63218A patent/IL63218A/xx unknown
- 1981-07-02 ZA ZA814514A patent/ZA814514B/xx unknown
- 1981-07-22 EG EG420/81A patent/EG16445A/xx active
- 1981-07-27 YU YU1848/81A patent/YU43498B/xx unknown
- 1981-07-28 AT AT0333181A patent/AT378184B/de not_active IP Right Cessation
- 1981-07-29 IE IE1721/81A patent/IE51530B1/en unknown
- 1981-07-31 GB GB8123470A patent/GB2081713B/en not_active Expired
- 1981-07-31 SG SG263/84A patent/SG62138G/en unknown
- 1981-08-04 DE DE19813130833 patent/DE3130833A1/de not_active Ceased
- 1981-08-04 PH PH26001A patent/PH17183A/en unknown
- 1981-08-04 SE SE8104677A patent/SE460605B/sv not_active IP Right Cessation
- 1981-08-05 DK DK348781A patent/DK151625C/da not_active IP Right Cessation
- 1981-08-05 CA CA000383277A patent/CA1164001A/en not_active Expired
- 1981-08-05 ES ES504558A patent/ES8502096A1/es not_active Expired
- 1981-08-06 HU HU844475A patent/HU191978B/hu not_active IP Right Cessation
- 1981-08-06 IT IT68098/81A patent/IT1144824B/it active
- 1981-08-06 NO NO812671A patent/NO156009C/no unknown
- 1981-08-06 FI FI812433A patent/FI74952C/fi not_active IP Right Cessation
- 1981-08-06 FR FR8115297A patent/FR2490639A1/fr active Granted
- 1981-08-06 KR KR1019810002859A patent/KR840001562B1/ko not_active Expired
- 1981-08-06 CH CH5074/81A patent/CH652121A5/fr not_active IP Right Cessation
- 1981-08-06 BE BE0/205598A patent/BE889878A/fr not_active IP Right Cessation
- 1981-08-06 PT PT73489A patent/PT73489B/pt unknown
- 1981-08-06 NZ NZ197952A patent/NZ197952A/en unknown
- 1981-08-06 HU HU812277A patent/HU187350B/hu not_active IP Right Cessation
- 1981-08-07 JP JP56123973A patent/JPS5759868A/ja active Pending
- 1981-08-07 AU AU73875/81A patent/AU539796B2/en not_active Ceased
- 1981-08-07 NL NL8103739A patent/NL8103739A/nl unknown
- 1981-11-06 FR FR8120878A patent/FR2491065A1/fr active Granted
-
1982
- 1982-07-27 ES ES514414A patent/ES514414A0/es active Granted
-
1983
- 1983-08-29 YU YU01766/83A patent/YU176683A/xx unknown
- 1983-11-11 PH PH29863A patent/PH17530A/en unknown
-
1985
- 1985-01-03 HK HK4/85A patent/HK485A/xx unknown
-
1987
- 1987-08-21 SE SE8703254A patent/SE8703254L/xx not_active Application Discontinuation
-
1990
- 1990-11-30 JP JP2337025A patent/JPH03204859A/ja active Pending
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5175296A (en) | Imidazo[4,5-c]quinolin-4-amines and processes for their preparation | |
| EP0738713B1 (en) | Process for the preparation of pesticidal 1-(chloroaryl)heterocyclic compounds | |
| SK284800B6 (sk) | Spôsob prípravy pyrazolových derivátov | |
| HUP0101094A2 (hu) | Eljárás védett 4-aminometilpirrolidin-3-on előállítására és az eljárás intermedierjei | |
| JP2004509951A (ja) | N−1保護したn環窒素含有環式ポリアミンの調製のためのプロセスおよびその生成物 | |
| NZ197952A (en) | 4-amino-1,2-dihydrocarbyl-pyrazolidines and n-(4-pyrazolidinyl)benzamides | |
| EP3891147A1 (en) | Novel procedure for the formation of 2h-benzotriazole bodies and congeners | |
| US4358599A (en) | Synthesis of 4-amino-1,2-hydrocarbyl pyrazolidines via 4-nitro analogs | |
| CA2001211A1 (en) | Preparation of 1,4-diazabicyclo ¬3.2.2.| nonane | |
| US4220788A (en) | Process for the preparation of 2-aryl-2H-benzotriazoles | |
| Katritzky et al. | Preparation of 1, 1-disubstituted hydrazines and their 2-acyl derivatives | |
| US5478947A (en) | Effective process for the production of 1,2,3-triazoles | |
| US4902831A (en) | Preparation of ethylenediamine derivatives | |
| Katritzky et al. | Monoacylaminals by the benzotriazole-assisted aminoalkylation of amides | |
| US4474987A (en) | Process for preparing N,N-disubstituted p-phenylenediamine derivatives | |
| US4948902A (en) | Process for making substituted pyrazoles | |
| US4885388A (en) | 2-methyl-4-fluoro-phenols and their preparation | |
| US4895957A (en) | Process for the preparation of 4-substituted 3-methyl-1-aryl-5-amino-pyrazoles | |
| Bernat et al. | A Novel Convenient Synthesis of 1, 3, 5, 5-Tetrasubstituted Hexahydro-Pyrimidine-4-thiones | |
| US3334114A (en) | Oxo-pentamethylene-imidazolidines | |
| CA1077949A (en) | N-alkanol substituted heterocyclic amines | |
| Radics et al. | Ring chain transformations. XIV. 3‐(ω‐Aminoalkyl)‐1, 2, 4‐triazoles by reaction of isothiosemicarbazides with lactam acetals or lactim ethers | |
| Tsolomiti et al. | REARRANGEMENT OF 5-BENZOYL-3 (2H)-ISOTHIAZOL-3-ONES TO 6-BENZOYL 2, 3-DIHYDRO-1, 3-THIAZIN-4 (2H)-ONES | |
| Katritzky et al. | Intramolecular reactions of pyridinium-2-carbonyl azides: conversion of amines into aldehydes | |
| EP0464736A1 (en) | A process for producing 5-amino-4-halogeno-1H-pyrazole compounds |