NZ197733A - N-phenyl sulphonyl-n1-pyrimidinyl and triazinyl ureas - Google Patents
N-phenyl sulphonyl-n1-pyrimidinyl and triazinyl ureasInfo
- Publication number
- NZ197733A NZ197733A NZ197733A NZ19773381A NZ197733A NZ 197733 A NZ197733 A NZ 197733A NZ 197733 A NZ197733 A NZ 197733A NZ 19773381 A NZ19773381 A NZ 19773381A NZ 197733 A NZ197733 A NZ 197733A
- Authority
- NZ
- New Zealand
- Prior art keywords
- och3
- formula
- methoxy
- compound according
- urea
- Prior art date
Links
- -1 triazinyl ureas Chemical class 0.000 title claims abstract description 59
- 235000013877 carbamide Nutrition 0.000 title description 21
- 239000004202 carbamide Substances 0.000 claims abstract description 40
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 32
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 26
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 17
- 150000002367 halogens Chemical class 0.000 claims abstract description 17
- 150000003839 salts Chemical class 0.000 claims abstract description 13
- 230000012010 growth Effects 0.000 claims abstract description 10
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 7
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract description 7
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 3
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 182
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 96
- 150000003254 radicals Chemical class 0.000 claims description 46
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 45
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 43
- 239000000460 chlorine Substances 0.000 claims description 42
- 239000000203 mixture Substances 0.000 claims description 41
- 241000196324 Embryophyta Species 0.000 claims description 33
- 239000001257 hydrogen Substances 0.000 claims description 31
- 229910052739 hydrogen Inorganic materials 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 31
- 125000004432 carbon atom Chemical group C* 0.000 claims description 29
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 28
- 239000001301 oxygen Substances 0.000 claims description 28
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 23
- 239000011593 sulfur Chemical group 0.000 claims description 23
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 21
- 150000002431 hydrogen Chemical class 0.000 claims description 17
- 125000001424 substituent group Chemical group 0.000 claims description 14
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 13
- 239000002585 base Substances 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- 229910052731 fluorine Inorganic materials 0.000 claims description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 11
- 150000001412 amines Chemical class 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 229940124530 sulfonamide Drugs 0.000 claims description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- 230000002401 inhibitory effect Effects 0.000 claims description 9
- 150000003456 sulfonamides Chemical class 0.000 claims description 9
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 8
- 239000011737 fluorine Chemical group 0.000 claims description 8
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 7
- 239000002671 adjuvant Substances 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 239000000969 carrier Substances 0.000 claims description 7
- 230000002363 herbicidal effect Effects 0.000 claims description 7
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 7
- 244000061456 Solanum tuberosum Species 0.000 claims description 6
- 235000002595 Solanum tuberosum Nutrition 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 230000008635 plant growth Effects 0.000 claims description 6
- 235000012015 potatoes Nutrition 0.000 claims description 6
- 239000012948 isocyanate Substances 0.000 claims description 5
- 150000002513 isocyanates Chemical class 0.000 claims description 5
- OCLNXDPSSAYYNO-UHFFFAOYSA-N 1-(4-chloro-6-methylpyrimidin-2-yl)-3-[2-(difluoromethoxy)phenyl]sulfonylurea Chemical compound CC1=CC(Cl)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OC(F)F)=N1 OCLNXDPSSAYYNO-UHFFFAOYSA-N 0.000 claims description 4
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- 229920002554 vinyl polymer Polymers 0.000 claims description 4
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 claims description 3
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims description 3
- ALZKZGUTVJXYEF-UHFFFAOYSA-N benzenesulfonylcarbamic acid Chemical compound OC(=O)NS(=O)(=O)C1=CC=CC=C1 ALZKZGUTVJXYEF-UHFFFAOYSA-N 0.000 claims description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 150000002540 isothiocyanates Chemical class 0.000 claims description 3
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical compound O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 claims description 3
- 244000045561 useful plants Species 0.000 claims description 3
- ACDVCPLIMIGCQM-UHFFFAOYSA-N 1-(4-chloro-6-methoxypyrimidin-2-yl)-3-[2-(difluoromethylsulfanyl)phenyl]sulfonylurea Chemical compound COC1=CC(Cl)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)SC(F)F)=N1 ACDVCPLIMIGCQM-UHFFFAOYSA-N 0.000 claims description 2
- QQXOTCILZPQVQQ-UHFFFAOYSA-N 1-[2-(difluoromethoxy)phenyl]sulfonyl-3-(4-methoxy-6-propan-2-yloxy-1,3,5-triazin-2-yl)urea Chemical compound CC(C)OC1=NC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OC(F)F)=N1 QQXOTCILZPQVQQ-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 2
- ZACBJJDJJBGIDC-UHFFFAOYSA-N n-(sulfanylidenemethylidene)benzenesulfonamide Chemical compound S=C=NS(=O)(=O)C1=CC=CC=C1 ZACBJJDJJBGIDC-UHFFFAOYSA-N 0.000 claims description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 2
- 241000411952 Centrosema Species 0.000 claims 2
- YKHNAWWMJUREDH-UHFFFAOYSA-N 1-(2-but-2-enoxyphenyl)sulfonyl-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea Chemical compound COC1=NC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OCC=CC)=N1 YKHNAWWMJUREDH-UHFFFAOYSA-N 0.000 claims 1
- LGBFWRRYCMQYJC-UHFFFAOYSA-N 1-(2-but-2-enoxyphenyl)sulfonyl-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OCC=CC)=N1 LGBFWRRYCMQYJC-UHFFFAOYSA-N 0.000 claims 1
- FJIUIWNEXOZLCN-UHFFFAOYSA-N 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-3-[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]sulfonylurea Chemical compound COC1=NC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OC(F)(F)C(F)(F)F)=N1 FJIUIWNEXOZLCN-UHFFFAOYSA-N 0.000 claims 1
- VEQPYDLBUGUTBJ-UHFFFAOYSA-N 1-(4-chloro-6-methoxypyrimidin-2-yl)-3-[2-(1,2-dichloroethenoxy)phenyl]sulfonylurea Chemical compound COC1=CC(Cl)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OC(Cl)=CCl)=N1 VEQPYDLBUGUTBJ-UHFFFAOYSA-N 0.000 claims 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims 1
- 241001125671 Eretmochelys imbricata Species 0.000 claims 1
- 229940100389 Sulfonylurea Drugs 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical compound OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 claims 1
- XSYLPIPLYOCKKP-UHFFFAOYSA-N triazin-4-ylcarbamic acid Chemical compound OC(=O)NC1=CC=NN=N1 XSYLPIPLYOCKKP-UHFFFAOYSA-N 0.000 claims 1
- 230000000007 visual effect Effects 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 abstract description 13
- 229920000742 Cotton Polymers 0.000 abstract description 7
- 244000068988 Glycine max Species 0.000 abstract description 7
- 235000010469 Glycine max Nutrition 0.000 abstract description 7
- 240000008042 Zea mays Species 0.000 abstract description 7
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 abstract description 7
- 235000002017 Zea mays subsp mays Nutrition 0.000 abstract description 7
- 235000009973 maize Nutrition 0.000 abstract description 7
- 240000007594 Oryza sativa Species 0.000 abstract description 4
- 235000007164 Oryza sativa Nutrition 0.000 abstract description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 abstract description 4
- 125000003545 alkoxy group Chemical group 0.000 abstract description 4
- 239000004009 herbicide Substances 0.000 abstract description 4
- 235000009566 rice Nutrition 0.000 abstract description 4
- 125000004414 alkyl thio group Chemical group 0.000 abstract description 3
- 125000004644 alkyl sulfinyl group Chemical group 0.000 abstract description 2
- 235000013339 cereals Nutrition 0.000 abstract description 2
- 125000004438 haloalkoxy group Chemical group 0.000 abstract description 2
- 125000004441 haloalkylsulfonyl group Chemical group 0.000 abstract description 2
- 125000004995 haloalkylthio group Chemical group 0.000 abstract description 2
- 238000004162 soil erosion Methods 0.000 abstract description 2
- 125000006193 alkinyl group Chemical group 0.000 abstract 2
- 241000219146 Gossypium Species 0.000 abstract 1
- 125000000262 haloalkenyl group Chemical group 0.000 abstract 1
- 239000005648 plant growth regulator Substances 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 51
- 239000000243 solution Substances 0.000 description 44
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 35
- UJTMLNARSPORHR-UHFFFAOYSA-N oc2h5 Chemical compound C=C=[O+] UJTMLNARSPORHR-UHFFFAOYSA-N 0.000 description 34
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- 239000004480 active ingredient Substances 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 16
- 238000002844 melting Methods 0.000 description 16
- 230000008018 melting Effects 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 15
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 13
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical compound F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 description 13
- 108010081348 HRT1 protein Hairy Proteins 0.000 description 13
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 description 13
- 239000004094 surface-active agent Substances 0.000 description 11
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 10
- 238000009472 formulation Methods 0.000 description 10
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 239000005995 Aluminium silicate Substances 0.000 description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 8
- 241000220261 Sinapis Species 0.000 description 8
- 235000012211 aluminium silicate Nutrition 0.000 description 8
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 235000019198 oils Nutrition 0.000 description 8
- 239000012074 organic phase Substances 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 239000002202 Polyethylene glycol Substances 0.000 description 7
- 240000006694 Stellaria media Species 0.000 description 7
- 239000000839 emulsion Substances 0.000 description 7
- 229920001223 polyethylene glycol Polymers 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 244000299507 Gossypium hirsutum Species 0.000 description 6
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical group OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 241000743985 Alopecurus Species 0.000 description 5
- 235000007320 Avena fatua Nutrition 0.000 description 5
- 241000209764 Avena fatua Species 0.000 description 5
- 241000219312 Chenopodium Species 0.000 description 5
- 241000192043 Echinochloa Species 0.000 description 5
- 240000005702 Galium aparine Species 0.000 description 5
- 235000014820 Galium aparine Nutrition 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 235000021506 Ipomoea Nutrition 0.000 description 5
- 241000207783 Ipomoea Species 0.000 description 5
- 241000209140 Triticum Species 0.000 description 5
- 235000021307 Triticum Nutrition 0.000 description 5
- 244000047670 Viola x wittrockiana Species 0.000 description 5
- 235000004031 Viola x wittrockiana Nutrition 0.000 description 5
- 241001506773 Xanthium sp. Species 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 239000002736 nonionic surfactant Substances 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- XDODAVQVIOWLPT-UHFFFAOYSA-N 2-(difluoromethoxy)benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1OC(F)F XDODAVQVIOWLPT-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- 235000005781 Avena Nutrition 0.000 description 4
- 241000209761 Avena Species 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- 235000005775 Setaria Nutrition 0.000 description 4
- 241000232088 Setaria <nematode> Species 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229920000151 polyglycol Polymers 0.000 description 4
- 239000010695 polyglycol Substances 0.000 description 4
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 4
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 4
- 235000012239 silicon dioxide Nutrition 0.000 description 4
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 4
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- ZSMAHBFDTZQZRQ-UHFFFAOYSA-N 2-(1,1,2,2,2-pentafluoroethoxy)benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1OC(F)(F)C(F)(F)F ZSMAHBFDTZQZRQ-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- IGFHQQFPSIBGKE-UHFFFAOYSA-N 4-nonylphenol Chemical compound CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 101000782236 Bothrops leucurus Thrombin-like enzyme leucurobin Proteins 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- 241000234653 Cyperus Species 0.000 description 3
- 240000005979 Hordeum vulgare Species 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- 241000209510 Liliopsida Species 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 241000857233 Rottboellia Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- TXCLJVQSSVBKBY-UHFFFAOYSA-N [2-(difluoromethoxy)phenyl]sulfonyl-phenylcarbamic acid Chemical compound C=1C=CC=C(OC(F)F)C=1S(=O)(=O)N(C(=O)O)C1=CC=CC=C1 TXCLJVQSSVBKBY-UHFFFAOYSA-N 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 239000004359 castor oil Substances 0.000 description 3
- 235000019438 castor oil Nutrition 0.000 description 3
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 3
- 239000003240 coconut oil Substances 0.000 description 3
- 235000019864 coconut oil Nutrition 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 235000008504 concentrate Nutrition 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 241001233957 eudicotyledons Species 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- SMJBOENAPOXLRZ-UHFFFAOYSA-N n-(oxomethylidene)-2-(1,1,2,2,2-pentafluoroethoxy)benzenesulfonamide Chemical compound FC(F)(F)C(F)(F)OC1=CC=CC=C1S(=O)(=O)N=C=O SMJBOENAPOXLRZ-UHFFFAOYSA-N 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- BSCCSDNZEIHXOK-UHFFFAOYSA-N phenyl carbamate Chemical compound NC(=O)OC1=CC=CC=C1 BSCCSDNZEIHXOK-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229920005552 sodium lignosulfonate Polymers 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 239000004546 suspension concentrate Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 2
- OYKHTYUXQYUQAX-UHFFFAOYSA-N 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]sulfonylurea Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OC(F)(F)C(F)(F)F)=N1 OYKHTYUXQYUQAX-UHFFFAOYSA-N 0.000 description 2
- XIAQGIIHTOTNCU-UHFFFAOYSA-N 1-methyl-3-[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]sulfonylurea Chemical compound CNC(=O)NS(=O)(=O)C1=CC=CC=C1OC(F)(F)C(F)(F)F XIAQGIIHTOTNCU-UHFFFAOYSA-N 0.000 description 2
- CSAHXQVUVOUPEY-UHFFFAOYSA-N 2-(difluoromethoxy)benzenesulfonyl chloride Chemical compound FC(F)OC1=CC=CC=C1S(Cl)(=O)=O CSAHXQVUVOUPEY-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical group COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- MOXDGMSQFFMNHA-UHFFFAOYSA-N 2-hydroxybenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1O MOXDGMSQFFMNHA-UHFFFAOYSA-N 0.000 description 2
- KAVPSXHBCUWGHT-UHFFFAOYSA-N 2-prop-2-enoxybenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1OCC=C KAVPSXHBCUWGHT-UHFFFAOYSA-N 0.000 description 2
- 241000219144 Abutilon Species 0.000 description 2
- 241000219318 Amaranthus Species 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 125000006519 CCH3 Chemical group 0.000 description 2
- 229910021532 Calcite Inorganic materials 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- 241001510512 Chlamydia phage 2 Species 0.000 description 2
- 101150009410 Chp2 gene Proteins 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000209082 Lolium Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 241000219833 Phaseolus Species 0.000 description 2
- BRMDATNYMUMZLN-UHFFFAOYSA-N Piloty's Acid Chemical class ONS(=O)(=O)C1=CC=CC=C1 BRMDATNYMUMZLN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 229920001214 Polysorbate 60 Polymers 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 235000002634 Solanum Nutrition 0.000 description 2
- 241000207763 Solanum Species 0.000 description 2
- 244000061457 Solanum nigrum Species 0.000 description 2
- 235000002594 Solanum nigrum Nutrition 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- 244000062793 Sorghum vulgare Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 244000213376 Veronica sp Species 0.000 description 2
- 235000009038 Veronica sp Nutrition 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 2
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 229960000892 attapulgite Drugs 0.000 description 2
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 2
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- OOCMUZJPDXYRFD-UHFFFAOYSA-L calcium;2-dodecylbenzenesulfonate Chemical compound [Ca+2].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O.CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O OOCMUZJPDXYRFD-UHFFFAOYSA-L 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003093 cationic surfactant Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 230000001276 controlling effect Effects 0.000 description 2
- 229910000365 copper sulfate Inorganic materials 0.000 description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- VUWZPRWSIVNGKG-UHFFFAOYSA-N fluoromethane Chemical compound F[CH2] VUWZPRWSIVNGKG-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 229910052625 palygorskite Inorganic materials 0.000 description 2
- 238000003359 percent control normalization Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- 230000004580 weight loss Effects 0.000 description 2
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- KKFBZUNYJMVNFV-UHFFFAOYSA-N 1,2-bis(2-methylpropyl)naphthalene Chemical compound C1=CC=CC2=C(CC(C)C)C(CC(C)C)=CC=C21 KKFBZUNYJMVNFV-UHFFFAOYSA-N 0.000 description 1
- MZCYFEMRFUAIAD-UHFFFAOYSA-N 1-(4,6-dichloro-1,3,5-triazin-2-yl)-1-[2-(difluoromethoxy)phenyl]sulfonylurea Chemical compound C=1C=CC=C(OC(F)F)C=1S(=O)(=O)N(C(=O)N)C1=NC(Cl)=NC(Cl)=N1 MZCYFEMRFUAIAD-UHFFFAOYSA-N 0.000 description 1
- YNLPNHOFFDASIQ-UHFFFAOYSA-N 1-[2-(difluoromethoxy)phenyl]sulfonyl-3-(4-ethyl-6-methoxy-1,3,5-triazin-2-yl)urea Chemical compound COC1=NC(CC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OC(F)F)=N1 YNLPNHOFFDASIQ-UHFFFAOYSA-N 0.000 description 1
- QOJMDYFBENZQMF-UHFFFAOYSA-N 1-[2-(difluoromethoxy)phenyl]sulfonyl-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OC(F)F)=N1 QOJMDYFBENZQMF-UHFFFAOYSA-N 0.000 description 1
- WEWISYVVLDNUQR-UHFFFAOYSA-N 1-[2-(difluoromethylsulfanyl)phenyl]sulfonyl-3-(4-ethyl-6-methoxy-1,3,5-triazin-2-yl)urea Chemical compound COC1=NC(CC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)SC(F)F)=N1 WEWISYVVLDNUQR-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- NXSWESDNHZDPCW-UHFFFAOYSA-N 2-(1,1,2,2,2-pentafluoroethoxy)aniline Chemical compound NC1=CC=CC=C1OC(F)(F)C(F)(F)F NXSWESDNHZDPCW-UHFFFAOYSA-N 0.000 description 1
- XYYNESSXKACQSR-UHFFFAOYSA-N 2-(1,1,2,2,2-pentafluoroethoxy)benzenesulfonyl chloride Chemical compound FC(F)(F)C(F)(F)OC1=CC=CC=C1S(Cl)(=O)=O XYYNESSXKACQSR-UHFFFAOYSA-N 0.000 description 1
- CGNAIUUCOVWLLL-UHFFFAOYSA-N 2-(difluoromethoxy)aniline Chemical compound NC1=CC=CC=C1OC(F)F CGNAIUUCOVWLLL-UHFFFAOYSA-N 0.000 description 1
- VNYLLNCVORSDAC-UHFFFAOYSA-N 2-(difluoromethylsulfanyl)aniline Chemical compound NC1=CC=CC=C1SC(F)F VNYLLNCVORSDAC-UHFFFAOYSA-N 0.000 description 1
- JDSQBDGCMUXRBM-UHFFFAOYSA-N 2-[2-(2-butoxypropoxy)propoxy]propan-1-ol Chemical group CCCCOC(C)COC(C)COC(C)CO JDSQBDGCMUXRBM-UHFFFAOYSA-N 0.000 description 1
- NPTGVVKPLWFPPX-UHFFFAOYSA-N 2-amino-4-chloro-6-methylpyrimidine Chemical compound CC1=CC(Cl)=NC(N)=N1 NPTGVVKPLWFPPX-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical class CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- MKQNYQGIPARLKO-UHFFFAOYSA-N 2-methoxybenzenesulfonamide Chemical compound COC1=CC=CC=C1S(N)(=O)=O MKQNYQGIPARLKO-UHFFFAOYSA-N 0.000 description 1
- NXFQWRWXEYTOTK-UHFFFAOYSA-N 2-methyl-4-amino-6-methoxy-s-triazine Chemical compound COC1=NC(C)=NC(N)=N1 NXFQWRWXEYTOTK-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- VATNSVZJQOBOIF-UHFFFAOYSA-N 2h-triazin-1-yl carbamate Chemical compound NC(=O)ON1NN=CC=C1 VATNSVZJQOBOIF-UHFFFAOYSA-N 0.000 description 1
- FOGYNLXERPKEGN-UHFFFAOYSA-N 3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfopropyl)phenoxy]propane-1-sulfonic acid Chemical compound COC1=CC=CC(CC(CS(O)(=O)=O)OC=2C(=CC(CCCS(O)(=O)=O)=CC=2)OC)=C1O FOGYNLXERPKEGN-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- NZQFOCIYDGJNSF-UHFFFAOYSA-N 4-ethyl-6-methoxy-1,3,5-triazin-2-amine Chemical compound CCC1=NC(N)=NC(OC)=N1 NZQFOCIYDGJNSF-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 241001148727 Bromus tectorum Species 0.000 description 1
- UZDHASTULOQIDD-UHFFFAOYSA-N CC1=NC(=NC(=N1)OC)N(C(=O)N)S(=O)(=O)C2=CC=CC=C2OC(C(F)(F)F)(F)F Chemical compound CC1=NC(=NC(=N1)OC)N(C(=O)N)S(=O)(=O)C2=CC=CC=C2OC(C(F)(F)F)(F)F UZDHASTULOQIDD-UHFFFAOYSA-N 0.000 description 1
- 241000252254 Catostomidae Species 0.000 description 1
- 241001086557 Centrosema plumieri Species 0.000 description 1
- 241001098036 Centrosema pubescens Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- 244000187656 Eucalyptus cornuta Species 0.000 description 1
- 241000220485 Fabaceae Species 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 240000004296 Lolium perenne Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical group CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- 239000004113 Sepiolite Substances 0.000 description 1
- 240000006410 Sida spinosa Species 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- PRXRUNOAOLTIEF-ADSICKODSA-N Sorbitan trioleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCC\C=C/CCCCCCCC PRXRUNOAOLTIEF-ADSICKODSA-N 0.000 description 1
- 239000004147 Sorbitan trioleate Substances 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- VBIIFPGSPJYLRR-UHFFFAOYSA-M Stearyltrimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)C VBIIFPGSPJYLRR-UHFFFAOYSA-M 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- AXPGSALTLMHZMM-UHFFFAOYSA-N [2-(difluoromethylsulfanyl)phenyl]sulfonyl-phenylcarbamic acid Chemical compound C=1C=CC=C(SC(F)F)C=1S(=O)(=O)N(C(=O)O)C1=CC=CC=C1 AXPGSALTLMHZMM-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000000274 adsorptive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000005224 alkoxybenzenes Chemical class 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- BCOZLGOHQFNXBI-UHFFFAOYSA-M benzyl-bis(2-chloroethyl)-ethylazanium;bromide Chemical compound [Br-].ClCC[N+](CC)(CCCl)CC1=CC=CC=C1 BCOZLGOHQFNXBI-UHFFFAOYSA-M 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 239000011449 brick Substances 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 150000003940 butylamines Chemical class 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005957 chlorosulfonylation reaction Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 238000005661 deetherification reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 235000021186 dishes Nutrition 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000005452 ethyl sulfates Chemical class 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 125000004440 haloalkylsulfinyl group Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical class [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 150000005451 methyl sulfates Chemical class 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 239000012764 mineral filler Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- GRTPAOVVVLZLDP-UHFFFAOYSA-N n-benzylbenzenesulfonamide Chemical class C=1C=CC=CC=1S(=O)(=O)NCC1=CC=CC=C1 GRTPAOVVVLZLDP-UHFFFAOYSA-N 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- 125000006095 n-butyl sulfinyl group Chemical group 0.000 description 1
- 125000006126 n-butyl sulfonyl group Chemical group 0.000 description 1
- 125000004708 n-butylthio group Chemical group C(CCC)S* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000006093 n-propyl sulfinyl group Chemical group 0.000 description 1
- 125000006124 n-propyl sulfonyl group Chemical group 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical class CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Chemical class CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- UYDLBVPAAFVANX-UHFFFAOYSA-N octylphenoxy polyethoxyethanol Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(OCCOCCOCCOCCO)C=C1 UYDLBVPAAFVANX-UHFFFAOYSA-N 0.000 description 1
- 150000002888 oleic acid derivatives Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical class OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229940113115 polyethylene glycol 200 Drugs 0.000 description 1
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000006238 prop-1-en-1-yl group Chemical group [H]\C(*)=C(/[H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- SBYHFKPVCBCYGV-UHFFFAOYSA-N quinuclidine Chemical compound C1CC2CCN1CC2 SBYHFKPVCBCYGV-UHFFFAOYSA-N 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000004671 saturated fatty acids Chemical class 0.000 description 1
- 235000003441 saturated fatty acids Nutrition 0.000 description 1
- 229910052624 sepiolite Inorganic materials 0.000 description 1
- 235000019355 sepiolite Nutrition 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 235000019337 sorbitan trioleate Nutrition 0.000 description 1
- 229960000391 sorbitan trioleate Drugs 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 235000020354 squash Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008117 stearic acid Chemical class 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 150000003510 tertiary aliphatic amines Chemical class 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D521/00—Heterocyclic compounds containing unspecified hetero rings
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/36—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the group >N—CO—N< directly attached to at least one heterocyclic ring; Thio analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/14—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Environmental Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Plant Pathology (AREA)
- Pest Control & Pesticides (AREA)
- Health & Medical Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Spinning Or Twisting Of Yarns (AREA)
- Amplifiers (AREA)
- Magnetic Resonance Imaging Apparatus (AREA)
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CH5481/80A CH657849A5 (en) | 1980-07-17 | 1980-07-17 | N-Phenylsulfonyl-N'-pyrimidinyl- and -triazinyl ureas |
CH821680 | 1980-11-05 | ||
CH399181 | 1981-06-17 |
Publications (1)
Publication Number | Publication Date |
---|---|
NZ197733A true NZ197733A (en) | 1984-11-09 |
Family
ID=27174660
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NZ197733A NZ197733A (en) | 1980-07-17 | 1981-07-16 | N-phenyl sulphonyl-n1-pyrimidinyl and triazinyl ureas |
Country Status (25)
Families Citing this family (128)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4452628A (en) * | 1979-07-26 | 1984-06-05 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4645531A (en) * | 1980-03-07 | 1987-02-24 | Du Pont | Alkyl sulfones |
CA1330438C (en) * | 1980-07-17 | 1994-06-28 | Willy Meyer | N-phenylsulfonyl-n'-pyrimidinyl-and-triazinylureas |
US4534789A (en) * | 1981-05-19 | 1985-08-13 | E. I. Du Pont De Nemours And Company | Herbicidal o-alkylsulfonyloxy- and o-alkylsulfonylaminobenzenesulfonamides |
US4523944A (en) * | 1981-07-16 | 1985-06-18 | Ciba-Geigy Corporation | N-Phenylsulfonyl-N'-pyrimidinylureas |
US4443243A (en) * | 1981-07-16 | 1984-04-17 | Ciba-Geigy Corporation | N-Phenylsulfonyl-N-triazinylureas |
US4545811A (en) * | 1981-08-06 | 1985-10-08 | Ciba-Geigy Corporation | N-Phenylsulfonyl-N'-triazinyl-ureas |
US4528024A (en) * | 1981-09-09 | 1985-07-09 | E. I. Du Pont De Nemours And Company | Herbicidal alkyl sulfones |
US4579584A (en) * | 1981-10-13 | 1986-04-01 | Ciba-Geigy Corporation | N-phenylsulfonyl-N'-triazinylureas |
DK536582A (da) * | 1981-12-07 | 1983-06-08 | Du Pont | Herbicide sulfonamider |
US4618363A (en) * | 1982-01-25 | 1986-10-21 | Ciba-Geigy Corporation | N-phenylsulfonyl-N'-triazinylureas |
US4537618A (en) * | 1982-05-26 | 1985-08-27 | Ciba Geigy Corporation | N-phenylsulfonyl-N'-pyrimidinylureas |
MA19797A1 (fr) * | 1982-06-14 | 1983-12-31 | Ciba Geigy Ag | N-heterocyclosulfonyl -n- pyrimidinyl et triazinylurees . |
US4584011A (en) * | 1982-07-16 | 1986-04-22 | E. I. Du Pont De Nemours And Company | Triazinyl-amino carbonyl-benzene sulfonamides |
US4518776A (en) * | 1982-07-19 | 1985-05-21 | Ciba Geigy Corporation | Process for producing sulfonylureas |
ATE32892T1 (de) * | 1982-08-23 | 1988-03-15 | Ciba Geigy Ag | Verfahren zur herstellung von herbiziden und pflanzenwuchsregulierenden sulfonylharnstoffen. |
US4780125A (en) * | 1982-09-01 | 1988-10-25 | Ciba-Geigy Corporation | N-phenylsulfonyl-N'-triazinylureas |
US4579583A (en) * | 1982-09-08 | 1986-04-01 | Ciba-Geigy Corporation | Novel sulfonylureas |
US4515626A (en) * | 1982-10-06 | 1985-05-07 | Ciba Geigy Corporation | N-(Cyclopropyl-triazinyl-n'-(arylsulfonyl) ureas having herbicidal activity |
US4521597A (en) * | 1982-10-25 | 1985-06-04 | Ciba Geigy Corporation | Process for producing sulfonylureas having a herbicidal action |
US4581059A (en) * | 1982-11-05 | 1986-04-08 | E. I. Du Pont De Nemours And Company | Herbicidal phenoxy esters of N-(heterocyclic)aminocarbonyl)sulfamic acid |
USH168H (en) | 1982-12-13 | 1986-12-02 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4562210A (en) * | 1983-01-17 | 1985-12-31 | Ciba-Geigy Corporation | Bactericides |
US4515624A (en) * | 1983-03-23 | 1985-05-07 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
EP0125205A1 (de) * | 1983-04-13 | 1984-11-14 | Ciba-Geigy Ag | N-Phenylsulfonyl-N'-pyrimidinyl- und -triazinylharnstoffe |
IT1161220B (it) * | 1983-04-21 | 1987-03-18 | Montedison Spa | Diidro-benzofurano derivati ad attivita' erbicida |
US4589911A (en) * | 1983-05-11 | 1986-05-20 | Ciba-Geigy Corporation | Fused N-phenylsulfonyl-N-triazinylureas |
DE3474447D1 (en) * | 1983-07-18 | 1988-11-10 | Ciba Geigy Ag | Process for the preparation of sulfonyl urea |
AU575335B2 (en) * | 1983-08-05 | 1988-07-28 | E.I. Du Pont De Nemours And Company | Benzene sulfonamides |
US4705556A (en) * | 1984-07-12 | 1987-11-10 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4604131A (en) * | 1983-08-05 | 1986-08-05 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4764204A (en) * | 1983-08-05 | 1988-08-16 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4639264A (en) * | 1983-08-26 | 1987-01-27 | Ciga-Geigy Corporation | Herbicidal N-arylsulfonyl-N'-(4-mercaptomethylpyrimdinyl)-ureas |
US4602936A (en) * | 1983-09-09 | 1986-07-29 | Ciba-Geigy Corporation | Herbicidal sulfonylureas |
DE3332780A1 (de) * | 1983-09-10 | 1985-03-28 | Hoechst Ag, 6230 Frankfurt | 6-sulfoxyphenolderivate, ihre herstellung und ihre verwendung als cytoprotekiva |
EP0151554A1 (de) * | 1984-02-03 | 1985-08-14 | Ciba-Geigy Ag | Neue Phenylsulfonamidderivate |
US4685961A (en) * | 1984-02-14 | 1987-08-11 | Ciba-Geigy Corporation | Herbicidal sulfonylureas |
US4588432A (en) * | 1984-02-27 | 1986-05-13 | E. I. Du Pont De Nemours And Company | Herbicidal selenylsulfonamides |
US4840963A (en) * | 1984-03-14 | 1989-06-20 | Merck & Co., Inc. | 2-Sulfamoyl-1H-indole derivatives for the treatment of elevated intraocular pressure |
JPS60215660A (ja) * | 1984-04-11 | 1985-10-29 | Nippon Tokushu Noyaku Seizo Kk | ビフエニリルスルホニルウレア誘導体の製法、その中間体及び該中間体の製法 |
EP0158600B1 (de) * | 1984-04-11 | 1991-04-03 | Ciba-Geigy Ag | Verfahren zur selektiven Unkrautbekämpfung in Nutzpflanzenkulturen |
US4637829A (en) * | 1984-04-27 | 1987-01-20 | Ciba-Geigy Corporation | Sulfonylureas |
CA1229086A (en) * | 1984-05-09 | 1987-11-10 | Hugh M. Brown | Herbicidal halopyrimidines |
US4871847A (en) * | 1984-05-24 | 1989-10-03 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4710221A (en) * | 1985-04-10 | 1987-12-01 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4849010A (en) * | 1985-04-10 | 1989-07-18 | E. I. Dupont De Nemours And Company | Herbicidal sulfonamides |
US4981509A (en) * | 1984-05-24 | 1991-01-01 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4727187A (en) * | 1984-06-15 | 1988-02-23 | Ciba-Geigy Corporation | Process for the preparation of α, α-difluoroalkyl phenyl ether derivatives |
US4656273A (en) * | 1984-07-09 | 1987-04-07 | Ciba-Geigy Corporation | Process for producing sulfonylureas |
US4659369A (en) | 1984-08-27 | 1987-04-21 | E. I. Du Pont De Nemours And Company | Herbicidal acetals and ketals |
DE3431917A1 (de) * | 1984-08-30 | 1986-03-13 | Bayer Ag, 5090 Leverkusen | 1-(2-trifluormethoxy-phenylsulfonyl)-3- heteroaryl-(thio)-harnstoffe |
US4780126A (en) * | 1984-08-30 | 1988-10-25 | Bayer Aktiengesellschaft | 3-substituted 1-(2-halogenoalkoxy-benzenesulphonyl)-3-heteroaryl-(thio)ureas |
US4678855A (en) * | 1985-10-09 | 1987-07-07 | Merck & Co., Inc. | Substituted benzenesulfonamides |
US4724039A (en) * | 1985-11-22 | 1988-02-09 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
CA1230119A (en) | 1985-11-22 | 1987-12-08 | Craig L. Hillemann | N-2-carboxylphenylsulfonyl-n'-pyrimidin-2-yl or triazin-2-yl-urea compounds |
DE3601801A1 (de) * | 1986-01-22 | 1987-07-23 | Bayer Ag | Herbizide mittel |
US4709092A (en) * | 1986-03-05 | 1987-11-24 | Ciba-Geigy Corporation | Process for the preparation of 2-alkoxybenzosulfonamides |
US4798688A (en) * | 1986-03-05 | 1989-01-17 | Ciba-Geigy Corporation | 2-alkoxy-5-chloro-benzenesulfonates useful for the preparation of 2-alkoxybenzosulfonamides |
US4759792A (en) * | 1986-06-05 | 1988-07-26 | Ciba-Geigy Corporation | Phenylsulfonylureas |
EP0262096B1 (de) * | 1986-09-26 | 1992-01-02 | Ciba-Geigy Ag | Aminopyrazinone und Aminotriazinone |
US4927453A (en) * | 1986-10-17 | 1990-05-22 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US5108487A (en) * | 1986-10-17 | 1992-04-28 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US5217525A (en) * | 1986-10-22 | 1993-06-08 | Ciba-Geigy Corporation | Synergistic composition and method for selective weed control in rice |
CH668530A5 (de) * | 1986-10-22 | 1989-01-13 | Ciba Geigy Ag | Synergistisches mittel und verfahren zur selektiven unkrautbekaempfung in reis. |
US5017215A (en) * | 1987-08-07 | 1991-05-21 | E. I. Du Pont De Nemours And Company | Herbicides for weed control in rice |
US4806528A (en) * | 1987-09-04 | 1989-02-21 | Hanreich Reinhard G | Process for the preparation of 2-(2-chloroethoxy)-benzenesulfonamide |
US4959501A (en) * | 1987-09-04 | 1990-09-25 | Ciba-Geigy Corporation | Process for the preparation of 2-(2-chloroethoxy)-benzenesulfonamide |
DE3811777A1 (de) * | 1988-04-08 | 1989-10-19 | Hoechst Ag | Heterocyclisch substituierte alkyl- und alkenylsulfonylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide oder pflanzenwachstumsregulatoren |
EP0422031A1 (en) * | 1988-05-12 | 1991-04-17 | E.I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
DE3822841A1 (de) * | 1988-06-18 | 1989-12-21 | Hoechst Ag | Substituierte sulfonyldiamide, verfahren zu ihrer herstellung und ihre verwendung als herbizide und pflanzenwachstumsregulatoren |
BR8907515A (pt) | 1988-06-28 | 1991-05-28 | Du Pont | Formulacoes de pesticidas em comprimidos |
DE3831382A1 (de) * | 1988-09-15 | 1990-04-12 | Hoechst Ag | Verfahren zur herstellung von 2-alkoxy-benzolsulfonamid-verbindungen |
US5215570A (en) * | 1988-10-20 | 1993-06-01 | Ciba-Geigy Corporation | Sulfamoylphenylureas |
ATE119163T1 (de) * | 1989-01-11 | 1995-03-15 | Ciba Geigy Ag | Antidots zur verbesserung der kulturpflanzenvertäglichkeit agrochemischer wirkstoffe. |
US5272129A (en) * | 1989-03-18 | 1993-12-21 | Hoechst Aktiengesellschaft | Phenoxysulfonylureas based on 3-substituted alkyl salicylates, and their use as herbicides and plant growth regulators |
ES2060124T3 (es) * | 1989-06-06 | 1994-11-16 | Ciba Geigy Ag | Nuevas sulfonilureas. |
GR1000748B (el) * | 1989-08-07 | 1992-12-30 | Basf Ag | Αποφυλλωτικο μεσο για τη βαμβακια. |
ES2062488T3 (es) * | 1989-09-29 | 1994-12-16 | Ciba Geigy Ag | Procedimiento para la preparacion de 2-(2-halogenetiltio)-fenilsulfonamidas. |
US5062878A (en) * | 1989-11-13 | 1991-11-05 | Toby's Chemical Company | Method and apparatus for clearing flora from sewer lines |
EP0437177B1 (de) * | 1989-12-08 | 1994-07-20 | Ciba-Geigy Ag | Verfahren zur Herstellung von Phenylsulfonamiden |
ES2082175T3 (es) * | 1990-05-30 | 1996-03-16 | Ciba Geigy Ag | Sulfonilureas con actividad herbicida y utiles como reguladores del crecimiento de las plantas. |
EP0463998B1 (de) * | 1990-06-29 | 1997-01-15 | Ciba-Geigy Ag | Immunologisches Nachweisverfahren für Triasulfuron |
DE4021489A1 (de) * | 1990-07-06 | 1992-01-09 | Hoechst Ag | Substituierte sulfonalkylsulfonylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide und pflanzenwachstumsregulatoren |
DE59106466D1 (de) * | 1990-08-15 | 1995-10-19 | Ciba Geigy Ag | Sulfonylharnstoffe als Herbizide. |
MY136106A (en) * | 1990-09-06 | 2008-08-29 | Novartis Ag | Synergistic composition comprising a sulfonylurea anda thiadiazolo (3,4-a)pyridazine and method of selective weed control. |
DE4038430A1 (de) * | 1990-12-01 | 1992-06-04 | Basf Ag | Herbizide n-((1,3,5-triazin-2-yl)-aminocarbonyl) benzolsulfonamide |
EP0558448A1 (de) * | 1992-02-26 | 1993-09-01 | Ciba-Geigy Ag | 1,5-Diphenylpyrazol-3-Carbonsäure-Derivate als Antidots für Sulfonylharnstoffherbizide |
DE4206145A1 (de) * | 1992-02-28 | 1993-09-02 | Basf Ag | Herbizide n-((pyrimidin-2-yl)aminocarbonyl)benzolfulfonamide |
DE4206146A1 (de) * | 1992-02-28 | 1993-09-02 | Basf Ag | Herbizide n-((1,3,5-triazin-2-yl)aminocarbonyl)benzolsulfonamide |
US6017851A (en) * | 1992-05-06 | 2000-01-25 | Novartis Corp. | Synergistic composition and process for selective weed control |
CA2133579C (en) * | 1992-05-06 | 2003-11-11 | Hans Gut | Synergistic composition and process for selective weed control |
US5244866A (en) * | 1992-07-31 | 1993-09-14 | American Cyanamid Company | Method of inhibiting sprout growth on agronomic crops using acetohydroxy acid synthase inhibiting herbicides |
FR2711368B1 (fr) * | 1993-09-16 | 1996-01-05 | Roussel Uclaf | Nouveau procédé de préparation de dérivés soufrés de l'imidazole et les nouveaux intermédiaires obtenus. |
LT3943B (en) | 1993-12-23 | 1996-05-27 | Ciba Geigy Ag | Remedy for cultured plants protection, use of sulphamoyl-phenyl-carbamides for cultured plant protection, herbicidal preparation, process for preparing sulphamoyl-phenyl-carbamides |
US6656883B1 (en) | 1994-01-10 | 2003-12-02 | Syngenta Investment Corp. | Wettable powder formulations of herbicides |
JPH10501214A (ja) * | 1994-06-01 | 1998-02-03 | ヘキスト・シエーリング・アグレボ・ゲゼルシヤフト・ミツト・ベシユレンクテル・ハフツング | ホルミルアミノフェニルスルホニル尿素、それらの製造法並びに除草剤および植物生長調節物質としてのそれらの使用 |
WO1996012708A1 (en) * | 1994-10-24 | 1996-05-02 | Korea Research Institute Of Chemical Technology | Herbicidal sulfonyl urea derivatives |
DE19525162A1 (de) | 1995-07-11 | 1997-01-16 | Bayer Ag | Sulfonylamino(thio)carbonylverbindungen |
KR100188339B1 (ko) * | 1995-11-24 | 1999-06-01 | 이서봉 | 방향족 염화물의 파라-이성체 제조용 촉매 |
DE19608445A1 (de) | 1996-03-05 | 1997-09-11 | Bayer Ag | Substituierte Arylsulfonyl(thio)harnstoffe |
AU5452298A (en) * | 1996-11-22 | 1998-06-10 | E.I. Du Pont De Nemours And Company | Quarternary ammonium salts and their use in agricultural formulations |
AU744497B2 (en) * | 1996-11-22 | 2002-02-28 | E.I. Du Pont De Nemours And Company | Quaternary ammonium salts of a sulfonylurea |
US6225260B1 (en) * | 1996-11-22 | 2001-05-01 | Lonza Inc. | Quaternary ammonium salts of a sulfonylurea |
US5721364A (en) * | 1996-12-13 | 1998-02-24 | Novartis Corporation | Process for making 2-amino-4, 6-dialkoxy-1, 3, 5-triazines |
BE1012386A3 (fr) | 1999-01-15 | 2000-10-03 | Univ Liege | Derives de sulfonamides benzeniques et leurs utilisations. |
DE19963383A1 (de) | 1999-12-28 | 2001-07-05 | Aventis Cropscience Gmbh | Formulierung von Herbiziden und Pflanzenwachstumsregulatoren |
WO2000044226A1 (de) * | 1999-01-27 | 2000-08-03 | Aventis Cropscience Gmbh | Formulierung von herbiziden |
DE10111649A1 (de) * | 2001-03-12 | 2002-09-19 | Bayer Ag | Substituierte Fluoralkoxyphenylsulfonylharnstoffe |
DE10117673A1 (de) * | 2001-04-09 | 2002-10-10 | Bayer Ag | Substituierte Fluoralkoxyphenylsulfonylamino(thio)carbonyl-triazolin(thi)one |
DE102005026620B4 (de) * | 2005-06-09 | 2012-05-16 | Ab Skf | Verfahren zur Herstellung eines Dichtungselements und Dichtungselement |
EP2052604A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Salz des 2-lodo-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl] benzolsulfonamids,Verfahren zu deren Herstellung, sowie deren Verwendung als Herbizide und Pflanzenwachstumregulatoren |
EP2052606A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
EP2110019A1 (de) | 2008-04-19 | 2009-10-21 | Bayer CropScience AG | Herbizide Verbindungen auf Basis von N-Azinyl-N'-phenylsulfonylharnstoffen |
DE102008037620A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Crop Science Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
AR075465A1 (es) | 2008-10-22 | 2011-04-06 | Basf Se | Uso de herbicidas de sulfonilurea en plantas cultivadas |
EP2371823A1 (de) | 2010-04-01 | 2011-10-05 | Bayer CropScience AG | Cyclopropyl-substituierte Phenylsulfonylamino(thio)carbonyltriazolinone, ihre Herstellung und Verwendung als Herbizide und Pflanzenwachstumsregulatoren |
ES2650673T5 (es) | 2010-10-15 | 2022-03-10 | Bayer Cropscience Ag | Uso de herbicidas inhibidores de ALS para el control de vegetación indeseada en plantas Beta vulgaris tolerantes a herbicidas inhibidores de ALS |
CN102461541B (zh) * | 2010-11-19 | 2013-09-18 | 南京华洲药业有限公司 | 一种含醚磺隆、禾草敌与环庚草醚的混合除草剂及其应用 |
AU2012251597B2 (en) | 2011-05-04 | 2015-11-05 | Bayer Intellectual Property Gmbh | Use of ALS inhibitor herbicides for control of unwanted vegetation in ALS inhibitor herbicide tolerant Brassica, such as B. napus, plants |
CN103039485A (zh) * | 2011-10-17 | 2013-04-17 | 南京华洲药业有限公司 | 一种含醚磺隆与二甲戊乐灵的混合除草剂及其应用 |
CN103039482A (zh) * | 2011-10-17 | 2013-04-17 | 南京华洲药业有限公司 | 一种含醚磺隆与敌稗的混合除草剂及其应用 |
US20130102469A1 (en) | 2011-10-20 | 2013-04-25 | Swartz family dba Olvidium | Method and compound for removing flora from sewer lines |
LT2931034T (lt) | 2012-12-13 | 2018-10-10 | Bayer Cropscience Ag | Als slopinančių herbicidų panaudojimas nepageidaujamos augmenijos kontrolei augaluose beta vulgaris, kurie tolerantiški als slopinantiems herbicidams |
CN102960358A (zh) * | 2012-12-17 | 2013-03-13 | 南开大学 | 旱田除草剂组合物及其田间除草方法 |
CN103086966A (zh) * | 2012-12-28 | 2013-05-08 | 合肥久易农业开发有限公司 | 一种磺酰胺基甲酸酯的合成方法 |
EP2821388A1 (en) * | 2013-07-05 | 2015-01-07 | Solvay SA | Fluorination process |
CN103508968B (zh) * | 2013-09-12 | 2015-09-09 | 江苏长青农化股份有限公司 | 除麦田阔叶草剂醚苯磺隆的绿色合成工艺 |
JP2025524881A (ja) | 2022-07-25 | 2025-08-01 | シンジェンタ クロップ プロテクション アクチェンゲゼルシャフト | 除草性組成物 |
Family Cites Families (25)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB791923A (en) * | 1955-08-08 | 1958-03-12 | Ici Ltd | New sulphonamides |
FR1468747A (fr) * | 1965-07-19 | 1967-02-10 | Benzène-sulfonyl-1 (pyrimidyl-2)-3 urées | |
US4154753A (en) * | 1966-01-12 | 1979-05-15 | Imperial Chemical Industries Limited | Fluorinated compounds containing functional groups |
IL40344A0 (en) * | 1971-09-22 | 1972-11-28 | Du Pont | Substituted benzenesulfonamides,their preparation and their use for controlling mites |
NL7703809A (nl) * | 1976-04-07 | 1977-10-11 | Du Pont | Herbicide sulfonamiden. |
US4169719A (en) * | 1976-04-07 | 1979-10-02 | E. I. Du Pont De Nemours And Co. | Herbicidal sulfonamides |
US4190432A (en) * | 1977-08-01 | 1980-02-26 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4257802A (en) * | 1977-10-06 | 1981-03-24 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4339266A (en) * | 1977-10-06 | 1982-07-13 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
DK401978A (da) * | 1977-10-06 | 1979-04-07 | Du Pont | Herbicide sulfonamider |
US4141916A (en) * | 1978-02-13 | 1979-02-27 | The Dow Chemical Company | 3,4,5-Trichloro-N,N-Di(loweralkyl)-2-((chloromethyl)thio)benzenesulfonamides |
DK163123C (da) * | 1978-05-30 | 1992-06-09 | Du Pont | Benzensulfonylurinstoffer til anvendelse som herbicider eller plantevaekstregulatorer, praeparat indeholdende dem samt deres anvendelse |
DK349479A (da) * | 1978-09-27 | 1980-03-28 | Du Pont | Sulfonamidderivater og deres anvendelse til regulering af plantevaekst |
US4342587A (en) * | 1979-07-20 | 1982-08-03 | E. I. Du Pont De Nemours And Company | Herbicidal pyridinsulfonamides |
US4310346A (en) * | 1980-03-14 | 1982-01-12 | E. I. Du Pont De Nemours And Company | N(Substituted phenylsulfonyl) N'(substituted cyumidin-2-yl) ureas |
US4452628A (en) * | 1979-07-26 | 1984-06-05 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4301286A (en) * | 1979-08-20 | 1981-11-17 | E. I. Du Pont De Nemours And Company | Herbicidal O-alkyl sulfonylisoureas |
DK455480A (da) * | 1979-11-30 | 1981-05-31 | Du Pont | Fremgangsmaade til fremstilling af herbicide n- (substituerede heterocycliske aminocarbonyl)-aromatiske sulfonamider |
AU543161B2 (en) * | 1980-03-07 | 1985-04-04 | E.I. Du Pont De Nemours And Company | Pyrimidine or s.triazine derivatives |
US4370480A (en) * | 1980-07-11 | 1983-01-25 | E. I. Du Pont De Nemours And Company | Herbicidal ureas and isoureas |
US4348220A (en) * | 1980-07-11 | 1982-09-07 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4368069A (en) * | 1980-07-11 | 1983-01-11 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
CA1330438C (en) * | 1980-07-17 | 1994-06-28 | Willy Meyer | N-phenylsulfonyl-n'-pyrimidinyl-and-triazinylureas |
US4487626A (en) * | 1980-08-22 | 1984-12-11 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
US4371391A (en) * | 1980-09-15 | 1983-02-01 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
-
1980
- 1980-07-15 CA CA000381786A patent/CA1330438C/en not_active Expired - Lifetime
-
1981
- 1981-07-01 MA MA19405A patent/MA19205A1/fr unknown
- 1981-07-13 DE DE8181810283T patent/DE3160818D1/de not_active Expired
- 1981-07-13 EP EP81810283A patent/EP0044809B1/de not_active Expired
- 1981-07-13 AT AT81810281T patent/ATE16555T1/de not_active IP Right Cessation
- 1981-07-13 AT AT81810283T patent/ATE4526T1/de not_active IP Right Cessation
- 1981-07-13 AT AT81810282T patent/ATE17431T1/de active
- 1981-07-13 EP EP81810282A patent/EP0044808B1/de not_active Expired
- 1981-07-13 DE DE8181810281T patent/DE3172974D1/de not_active Expired
- 1981-07-13 EP EP81810281A patent/EP0044807B1/de not_active Expired
- 1981-07-13 DE DE8181810282T patent/DE3173493D1/de not_active Expired
- 1981-07-15 IL IL8163324A patent/IL63324A/xx not_active IP Right Cessation
- 1981-07-15 ZW ZW166/81A patent/ZW16681A1/xx unknown
- 1981-07-15 EG EG402/81A patent/EG15401A/xx active
- 1981-07-15 IL IL8179463A patent/IL79463A/xx unknown
- 1981-07-15 PH PH25917A patent/PH18233A/en unknown
- 1981-07-15 RO RO104891A patent/RO83456B/ro unknown
- 1981-07-16 AU AU73036/81A patent/AU545208B2/en not_active Expired
- 1981-07-16 DK DK318681A patent/DK163664C/da not_active IP Right Cessation
- 1981-07-16 DD DD81269168A patent/DD220601A5/de not_active IP Right Cessation
- 1981-07-16 GR GR65532A patent/GR74308B/el unknown
- 1981-07-16 NZ NZ197733A patent/NZ197733A/en unknown
- 1981-07-16 ES ES504013A patent/ES504013A0/es active Granted
- 1981-07-16 DD DD81231843A patent/DD215461A5/de not_active IP Right Cessation
- 1981-07-16 TR TR21355A patent/TR21355A/xx unknown
- 1981-07-16 KR KR1019810002603A patent/KR850000495B1/ko not_active Expired
- 1981-07-17 BR BR8104617A patent/BR8104617A/pt unknown
- 1981-07-17 BR BR8104618A patent/BR8104618A/pt unknown
- 1981-07-17 MX MX005728A patent/MX170994B/es unknown
- 1981-07-17 MX MX819558U patent/MX6981E/es unknown
- 1981-07-17 MX MX005729A patent/MX170995B/es unknown
- 1981-07-17 BR BR8104619A patent/BR8104619A/pt not_active IP Right Cessation
-
1982
- 1982-09-13 US US06/417,743 patent/US4510325A/en not_active Expired - Lifetime
- 1982-09-24 US US06/423,344 patent/US4476321A/en not_active Expired - Lifetime
- 1982-12-16 ES ES518258A patent/ES518258A0/es active Granted
-
1983
- 1983-01-17 US US06/458,696 patent/US4425154A/en not_active Expired - Lifetime
- 1983-01-17 US US06/458,691 patent/US4444583A/en not_active Expired - Lifetime
- 1983-01-17 US US06/458,695 patent/US4479821A/en not_active Expired - Lifetime
- 1983-01-17 US US06/458,693 patent/US4561878A/en not_active Expired - Lifetime
- 1983-01-17 US US06/458,584 patent/US4419121A/en not_active Expired - Lifetime
- 1983-01-17 US US06/458,594 patent/US4514212A/en not_active Expired - Lifetime
- 1983-01-17 US US06/458,694 patent/US4537619A/en not_active Expired - Lifetime
- 1983-03-23 CA CA000424330A patent/CA1205482A/en not_active Expired
-
1985
- 1985-01-22 US US06/693,481 patent/US4629810A/en not_active Expired - Lifetime
- 1985-08-02 US US06/761,941 patent/US4681619A/en not_active Expired - Lifetime
-
1986
- 1986-07-21 IL IL8679463A patent/IL79463A0/xx unknown
- 1986-12-30 MY MY581/86A patent/MY8600581A/xx unknown
-
1987
- 1987-12-30 MY MY138/87A patent/MY8700138A/xx unknown
-
1988
- 1988-05-11 KE KE3819A patent/KE3819A/xx unknown
-
1989
- 1989-03-10 CY CY1438A patent/CY1438A/xx unknown
-
1990
- 1990-06-13 DK DK144190A patent/DK165182C/da not_active IP Right Cessation
-
1991
- 1991-11-20 DK DK189391A patent/DK164901C/da not_active IP Right Cessation
-
1992
- 1992-01-08 DK DK002392A patent/DK166082C/da not_active IP Right Cessation
- 1992-06-15 BG BG096470A patent/BG61518B2/bg unknown
- 1992-06-15 BG BG096468A patent/BG60335B2/bg unknown
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NZ197733A (en) | N-phenyl sulphonyl-n1-pyrimidinyl and triazinyl ureas | |
US4487951A (en) | N-Phenylsulfonylcarbamates | |
US4579583A (en) | Novel sulfonylureas | |
US4549898A (en) | N-Heterocyclosulfonyl-N'-pyrimidinylureas and N-heterocyclosulfonyl-N'-triazinylureas | |
US4551531A (en) | 4-Difluoromethoxy-2-amino-pyrimidines | |
US4515626A (en) | N-(Cyclopropyl-triazinyl-n'-(arylsulfonyl) ureas having herbicidal activity | |
US4759793A (en) | N-phenylsulfonyl-N'-pyrimidinyl-ureas | |
US4478635A (en) | N-Arylsulfonyl-N'-pyrimidinylureas | |
US4741760A (en) | Pyrimidine derivatives having a herbicidal action and an action regulating plant growth | |
US4727186A (en) | Certain alkynyl-benzene sulfonamide intermediates useful for preparing ureas herbicides | |
US4368069A (en) | Herbicidal sulfonamides | |
US4875923A (en) | N-pyridinylsulfonyl-N'-pyrimidinylures | |
US4579584A (en) | N-phenylsulfonyl-N'-triazinylureas | |
US4443245A (en) | N-Phenylsulfonyl-N'-triazinylureas | |
JPS6245228B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
CA1261330A (en) | Substituted n-arylsulfonyl-n'-pyrimidinylureas and n-arylsulfonyl-n'-triazinylureas | |
US4523944A (en) | N-Phenylsulfonyl-N'-pyrimidinylureas | |
US4857100A (en) | Phenylsulfonylureas | |
US4582525A (en) | Herbicidal sulfonamides | |
CS224000B2 (cs) | Herbicidní prostředek a prostředek potlačující růst rostlin a způsob výroby účinné složky |