NO832039L - Fremgangsmaate for fremstilling av lagringsstabile tabletter inneholdende hydrolysefoelsomme virkestoffer - Google Patents
Fremgangsmaate for fremstilling av lagringsstabile tabletter inneholdende hydrolysefoelsomme virkestofferInfo
- Publication number
- NO832039L NO832039L NO832039A NO832039A NO832039L NO 832039 L NO832039 L NO 832039L NO 832039 A NO832039 A NO 832039A NO 832039 A NO832039 A NO 832039A NO 832039 L NO832039 L NO 832039L
- Authority
- NO
- Norway
- Prior art keywords
- tablet
- active substance
- layer
- preparation
- hydroolyse
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 18
- 238000002360 preparation method Methods 0.000 title description 5
- 238000003860 storage Methods 0.000 title description 3
- 239000004615 ingredient Substances 0.000 title 1
- 239000013543 active substance Substances 0.000 claims description 18
- 239000004480 active ingredient Substances 0.000 claims description 14
- 239000000902 placebo Substances 0.000 claims description 10
- 229940068196 placebo Drugs 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 4
- 239000003826 tablet Substances 0.000 description 25
- 239000000203 mixture Substances 0.000 description 12
- 230000007062 hydrolysis Effects 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- 239000007787 solid Substances 0.000 description 5
- 238000004806 packaging method and process Methods 0.000 description 4
- 238000007906 compression Methods 0.000 description 3
- 230000006835 compression Effects 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- GSKDBLIBBOYOFU-UHFFFAOYSA-N oxadiazol-5-amine Chemical class NC1=CN=NO1 GSKDBLIBBOYOFU-UHFFFAOYSA-N 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000005469 granulation Methods 0.000 description 2
- 230000003179 granulation Effects 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229960000074 biopharmaceutical Drugs 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000007907 direct compression Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000008646 thermal stress Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2072—Pills, tablets, discs, rods characterised by shape, structure or size; Tablets with holes, special break lines or identification marks; Partially coated tablets; Disintegrating flat shaped forms
- A61K9/2086—Layered tablets, e.g. bilayer tablets; Tablets of the type inert core-active coat
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823221425 DE3221425A1 (de) | 1982-06-07 | 1982-06-07 | Hydrolyseempfindlichen wirkstoff enthaltende, lagerstabile tablette |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO832039L true NO832039L (no) | 1983-12-08 |
Family
ID=6165523
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO832039A NO832039L (no) | 1982-06-07 | 1983-06-06 | Fremgangsmaate for fremstilling av lagringsstabile tabletter inneholdende hydrolysefoelsomme virkestoffer |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4786507A (xx) |
| EP (1) | EP0096286A3 (xx) |
| JP (1) | JPS591413A (xx) |
| AU (1) | AU556373B2 (xx) |
| DE (1) | DE3221425A1 (xx) |
| DK (1) | DK257383A (xx) |
| FI (1) | FI831952L (xx) |
| GB (1) | GB2123289B (xx) |
| GR (1) | GR78281B (xx) |
| IE (1) | IE55140B1 (xx) |
| IL (1) | IL68891A0 (xx) |
| NO (1) | NO832039L (xx) |
| NZ (1) | NZ204478A (xx) |
| ZA (1) | ZA834074B (xx) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS61140520A (ja) * | 1984-12-12 | 1986-06-27 | Lion Corp | アセチルサリチル酸製剤 |
| US4898733A (en) * | 1985-11-04 | 1990-02-06 | International Minerals & Chemical Corp. | Layered, compression molded device for the sustained release of a beneficial agent |
| IT1201136B (it) * | 1987-01-13 | 1989-01-27 | Resa Farma | Compressa per uso farmaceutico atta al rilascio in tempi successivi di sostanze attive |
| HU212730B (en) * | 1990-03-28 | 1996-10-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing inclusion complexes of cyclodextrine or its derivative and 3-morpholino-sydnonimine or its salt or its tautomer and pharmaceutical compositions containing them |
| HU210921B (en) * | 1990-03-28 | 1995-09-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing inclusion complexes of n-ethoxycarbonyl-3-morpholino-sydnonimine formed with cyclodextrines and pharmaceutical compositions containing them |
| US5213807A (en) * | 1990-05-03 | 1993-05-25 | Chemburkar Pramod B | Pharmaceutical composition containing ibuprofen and a prostaglandin |
| US6981986B1 (en) | 1995-03-01 | 2006-01-03 | Boston Scientific Scimed, Inc. | Longitudinally flexible expandable stent |
| US7204848B1 (en) | 1995-03-01 | 2007-04-17 | Boston Scientific Scimed, Inc. | Longitudinally flexible expandable stent |
| US6896696B2 (en) * | 1998-11-20 | 2005-05-24 | Scimed Life Systems, Inc. | Flexible and expandable stent |
| WO1996026689A1 (en) | 1995-03-01 | 1996-09-06 | Scimed Life Systems, Inc. | Improved longitudinally flexible expandable stent |
| US6818014B2 (en) * | 1995-03-01 | 2004-11-16 | Scimed Life Systems, Inc. | Longitudinally flexible expandable stent |
| DE19524753A1 (de) * | 1995-07-07 | 1997-01-23 | Lohmann Therapie Syst Lts | Schichttablette zur kontrollierten Freisetzung von Wirkstoffen |
| US8070792B2 (en) | 2000-09-22 | 2011-12-06 | Boston Scientific Scimed, Inc. | Stent |
| US8877178B2 (en) | 2003-12-19 | 2014-11-04 | The Iams Company | Methods of use of probiotic bifidobacteria for companion animals |
| US20050158294A1 (en) | 2003-12-19 | 2005-07-21 | The Procter & Gamble Company | Canine probiotic Bifidobacteria pseudolongum |
| WO2005112897A2 (en) * | 2004-05-21 | 2005-12-01 | Accu-Break Technologies, Inc. | Immediate release pharmaceutical tablets with height greater than width |
| DK1880001T3 (da) | 2005-05-31 | 2011-09-12 | Iams Company | Feline probiotiske lactobacilli |
| AU2006253007B2 (en) | 2005-05-31 | 2012-12-20 | Alimentary Health Ltd | Feline probiotic Bifidobacteria |
| WO2008093303A2 (en) * | 2007-02-01 | 2008-08-07 | The Iams Company | Method for decreasing inflammation and stress in a mammal using glucose antimetaboltes, avocado or avocado extracts |
| US9771199B2 (en) | 2008-07-07 | 2017-09-26 | Mars, Incorporated | Probiotic supplement, process for making, and packaging |
| US10104903B2 (en) | 2009-07-31 | 2018-10-23 | Mars, Incorporated | Animal food and its appearance |
| WO2012119037A1 (en) | 2011-03-03 | 2012-09-07 | Boston Scientific Scimed, Inc. | Stent with reduced profile |
| WO2012118526A1 (en) | 2011-03-03 | 2012-09-07 | Boston Scientific Scimed, Inc. | Low strain high strength stent |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH43905A (de) * | 1908-10-13 | 1909-06-16 | Theo Dill | Zweiteilige Tabelle für gepreßte, im Wasser verteilbare Produkte |
| DE657259C (de) * | 1936-05-20 | 1938-03-01 | Ludwig Heumann & Co Chem Pharm | Pressling fuer pharmazeutische Zwecke |
| NL6601426A (xx) * | 1965-02-12 | 1966-08-15 | ||
| GB1160085A (en) * | 1965-10-23 | 1969-07-30 | Squibb & Sons Inc | Tablets |
| US3833580A (en) * | 1966-08-09 | 1974-09-03 | Boehringer Sohn Ingelheim | 3-morpholino-n6-cyclohexylcarbonyl sydnonimine |
| DE1813752A1 (de) * | 1968-12-10 | 1970-06-25 | Boehringer Sohn Ingelheim | Neue substituierte 3-Amino-sydnonimine und Verfahren zu ihrer Herstellung |
| GB1309597A (en) * | 1969-05-09 | 1973-03-14 | Colorcon | Stabilised shellac sealing coating for tablets |
| US3692562A (en) * | 1969-12-02 | 1972-09-19 | Ryuichi Kawata | Coated tablets having plastic particles dispersed in the coating |
| FR2100858B1 (xx) * | 1970-07-03 | 1975-06-06 | Daiichi Seiyaku Co | |
| JPS4837815B1 (xx) * | 1970-09-25 | 1973-11-14 | Yamanouchi Pharma Co Ltd | |
| GB1318757A (en) * | 1970-11-16 | 1973-05-31 | Yamanouchi Pharma Co Ltd | Method of sugar coating tablets |
| GB1346610A (xx) * | 1971-07-02 | 1974-02-13 | ||
| GB1456365A (en) * | 1972-10-06 | 1976-11-24 | Gist Brocades Nv | Controlled release composition |
| FR2211213B1 (xx) * | 1972-12-26 | 1976-04-23 | Montagne Noire Prod Chim | |
| JPS5315542B2 (xx) * | 1973-03-01 | 1978-05-25 | ||
| JPS5154918A (en) * | 1974-10-08 | 1976-05-14 | Nippon Kayaku Kk | Jozaino seizoho |
| US4139589A (en) * | 1975-02-26 | 1979-02-13 | Monique Beringer | Process for the manufacture of a multi-zone tablet and tablet manufactured by this process |
| DE2512247A1 (de) * | 1975-03-20 | 1976-10-14 | Thomae Gmbh Dr K | Gegen feuchtigkeit stabilisierte presslinge mit feuchtigkeitsempfindlichen inhaltsstoffen |
| JPS51123814A (en) * | 1975-04-22 | 1976-10-28 | Shin Etsu Chem Co Ltd | A process for preparing gradually releasable solid medicines |
| GB1509866A (en) * | 1975-06-10 | 1978-05-04 | Johnson & Johnson | Enteric coated digestive enzyme compositions |
| CH649216A5 (de) * | 1979-08-16 | 1985-05-15 | Sandoz Ag | Verfahren zur auftragung eines magensaftresistenten filmes auf einen heilmittelkern und feste einheitsdosierungsform mit magensaftresistentem film. |
-
1982
- 1982-06-07 DE DE19823221425 patent/DE3221425A1/de not_active Ceased
-
1983
- 1983-01-07 NZ NZ204478A patent/NZ204478A/en unknown
- 1983-05-24 EP EP83105108A patent/EP0096286A3/de not_active Withdrawn
- 1983-06-01 FI FI831952A patent/FI831952L/fi not_active Application Discontinuation
- 1983-06-03 IE IE1313/83A patent/IE55140B1/en not_active IP Right Cessation
- 1983-06-03 GR GR71562A patent/GR78281B/el unknown
- 1983-06-06 GB GB08315489A patent/GB2123289B/en not_active Expired
- 1983-06-06 JP JP58100698A patent/JPS591413A/ja active Pending
- 1983-06-06 NO NO832039A patent/NO832039L/no unknown
- 1983-06-06 IL IL68891A patent/IL68891A0/xx unknown
- 1983-06-06 DK DK257383A patent/DK257383A/da not_active Application Discontinuation
- 1983-06-06 ZA ZA834074A patent/ZA834074B/xx unknown
- 1983-06-07 AU AU15445/83A patent/AU556373B2/en not_active Ceased
-
1987
- 1987-03-31 US US07/032,766 patent/US4786507A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| FI831952L (fi) | 1983-12-08 |
| IL68891A0 (en) | 1983-10-31 |
| JPS591413A (ja) | 1984-01-06 |
| DE3221425A1 (de) | 1983-12-08 |
| FI831952A0 (fi) | 1983-06-01 |
| US4786507A (en) | 1988-11-22 |
| NZ204478A (en) | 1985-07-12 |
| DK257383D0 (da) | 1983-06-06 |
| EP0096286A2 (de) | 1983-12-21 |
| AU1544583A (en) | 1983-12-15 |
| IE55140B1 (en) | 1990-06-06 |
| GB2123289A (en) | 1984-02-01 |
| GR78281B (xx) | 1984-09-26 |
| AU556373B2 (en) | 1986-10-30 |
| GB2123289B (en) | 1986-08-28 |
| ZA834074B (en) | 1985-02-27 |
| DK257383A (da) | 1983-12-08 |
| GB8315489D0 (en) | 1983-07-13 |
| IE831313L (en) | 1983-12-07 |
| EP0096286A3 (de) | 1984-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO832039L (no) | Fremgangsmaate for fremstilling av lagringsstabile tabletter inneholdende hydrolysefoelsomme virkestoffer | |
| DE60222803T2 (de) | Orale kapselformulierung mit verbesserter physikalischer stabilität | |
| US5635209A (en) | Stabilized composition of levothyroxine sodium medication and method for its production | |
| US3256153A (en) | Method of stabilizing wax-fat coating materials and product thereof | |
| FI84781C (fi) | Foerfarande foer produktion av en stabil nikorandilprodukt. | |
| MXPA05003039A (es) | Formulaciones farmaceuticas solidas que comparten telmisartan. | |
| NO155476B (no) | Fremgangsmaate til fremstilling av en kapsel inneholdende acetylsalicylsyre. | |
| HU230033B1 (hu) | N-acetil-p-aminofenol tartalmú készítmény | |
| NO173590B (no) | Fremgangsmaate for fremstilling av et stabilt nikorandilholdig farmasoeytisk preparat | |
| EA021317B1 (ru) | Монослойные таблетки, содержащие ирбесартан и амлодипин, их получение и их терапевтическое применение | |
| DE202009019152U1 (de) | Stabile verpackte Dosierungsform eines Kombinationspräparats umfassend eine pharmazeutische Zusammensetzung enthaltend Amlodipin-Besylat und Bisoprolol- Fumarat | |
| CN100551444C (zh) | 稳定固体药物制剂 | |
| US4601895A (en) | Delayed-action acetylsalicylic acid formulations for oral administration | |
| AU2013365715A1 (en) | A pharmaceutical composition containing candesartan cilexetil and amlodipine | |
| KR20030024849A (ko) | 소수성 약물의 개선된 고형 약제학적 투여 제제 | |
| US4716042A (en) | Stabilized coated aspirin tablets | |
| CN1321642C (zh) | 泮托拉唑钠肠溶微丸 | |
| US20070036732A1 (en) | Stable topiramate formulations | |
| CA2641575C (en) | Stabilization of solid thyroid drug formulations | |
| CA2259727A1 (en) | A two-layer pharmaceutical tablet comprising an nsaid and misoprostol | |
| AU2001291244A1 (en) | Stabilization of solid thyroid drug formulations | |
| CN102210693A (zh) | 一种阿司匹林和双嘧达莫多层片的制备方法 | |
| CN211461322U (zh) | 一种阿托伐他汀钙和苯磺酸氨氯地平的复方三层片 | |
| SK53798A3 (en) | Captopril tablets | |
| EP0770386B1 (en) | Lanperisone formulation |