NO831727L - Nye aziridin- og fenetanolaminderivater. - Google Patents
Nye aziridin- og fenetanolaminderivater.Info
- Publication number
- NO831727L NO831727L NO831727A NO831727A NO831727L NO 831727 L NO831727 L NO 831727L NO 831727 A NO831727 A NO 831727A NO 831727 A NO831727 A NO 831727A NO 831727 L NO831727 L NO 831727L
- Authority
- NO
- Norway
- Prior art keywords
- hydrogen
- formula
- compounds
- hydroxy
- lower alkyl
- Prior art date
Links
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 49
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 44
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 44
- -1 hydroxy, benzyloxy Chemical group 0.000 claims description 35
- 229910052739 hydrogen Inorganic materials 0.000 claims description 28
- 239000001257 hydrogen Substances 0.000 claims description 28
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 22
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 150000002431 hydrogen Chemical class 0.000 claims description 12
- 238000004519 manufacturing process Methods 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 12
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 239000007858 starting material Substances 0.000 claims description 10
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 125000004442 acylamino group Chemical group 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 125000001589 carboacyl group Chemical group 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 125000001033 ether group Chemical group 0.000 claims description 2
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 89
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 44
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 32
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 22
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000002253 acid Substances 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 14
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- CCRCUPLGCSFEDV-UHFFFAOYSA-N cinnamic acid methyl ester Natural products COC(=O)C=CC1=CC=CC=C1 CCRCUPLGCSFEDV-UHFFFAOYSA-N 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 150000001408 amides Chemical class 0.000 description 7
- 125000004494 ethyl ester group Chemical group 0.000 description 7
- CCRCUPLGCSFEDV-BQYQJAHWSA-N methyl trans-cinnamate Chemical compound COC(=O)\C=C\C1=CC=CC=C1 CCRCUPLGCSFEDV-BQYQJAHWSA-N 0.000 description 7
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 7
- 230000009467 reduction Effects 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 229920000084 Gum arabic Polymers 0.000 description 6
- 241000978776 Senegalia senegal Species 0.000 description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 6
- 239000000205 acacia gum Substances 0.000 description 6
- 235000010489 acacia gum Nutrition 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 235000011121 sodium hydroxide Nutrition 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- AWMVMTVKBNGEAK-QMMMGPOBSA-N (R)-styrene oxide Chemical compound C1O[C@@H]1C1=CC=CC=C1 AWMVMTVKBNGEAK-QMMMGPOBSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 239000012230 colorless oil Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 239000000825 pharmaceutical preparation Substances 0.000 description 5
- 239000000902 placebo Substances 0.000 description 5
- 229940068196 placebo Drugs 0.000 description 5
- 229940086542 triethylamine Drugs 0.000 description 5
- RYKMBRQIAMJWEU-UHFFFAOYSA-N 5-(3-aminopropyl)thiophene-2-carboxamide Chemical compound NCCCC1=CC=C(C(N)=O)S1 RYKMBRQIAMJWEU-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 210000003486 adipose tissue brown Anatomy 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 229910052987 metal hydride Inorganic materials 0.000 description 4
- 150000004681 metal hydrides Chemical class 0.000 description 4
- 230000036284 oxygen consumption Effects 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000004069 aziridinyl group Chemical group 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 3
- 239000008103 glucose Substances 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 229930192474 thiophene Natural products 0.000 description 3
- 210000002700 urine Anatomy 0.000 description 3
- WKUCZAMEOKOYJI-DFLTZVLMSA-N 4-[(3s)-3-(2-phenylaziridin-1-yl)butyl]benzamide Chemical compound C([C@H](C)N1C(C1)C=1C=CC=CC=1)CC1=CC=C(C(N)=O)C=C1 WKUCZAMEOKOYJI-DFLTZVLMSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 208000008589 Obesity Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000001541 aziridines Chemical class 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 206010012601 diabetes mellitus Diseases 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 230000003345 hyperglycaemic effect Effects 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 235000020824 obesity Nutrition 0.000 description 2
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- CRWJEUDFKNYSBX-UHFFFAOYSA-N sodium;hypobromite Chemical compound [Na+].Br[O-] CRWJEUDFKNYSBX-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- UXTDUVSLJXVJSO-UHFFFAOYSA-N 1,3-bis[5-(2-azidoethyl)thiophen-2-yl]propan-2-one Chemical compound N(=[N+]=[N-])CCC1=CC=C(S1)CC(=O)CC=1SC(=CC1)CCN=[N+]=[N-] UXTDUVSLJXVJSO-UHFFFAOYSA-N 0.000 description 1
- KVHASPNUPMVSQK-UHFFFAOYSA-N 1,3-bis[5-(2-hydroxypropyl)thiophen-2-yl]propan-2-one Chemical compound OC(CC1=CC=C(S1)CC(=O)CC=1SC(=CC=1)CC(C)O)C KVHASPNUPMVSQK-UHFFFAOYSA-N 0.000 description 1
- DKLBGSKRPVSQQV-UHFFFAOYSA-N 1,3-bis[5-(3-hydroxybutyl)thiophen-2-yl]propan-2-one Chemical compound OC(CCC1=CC=C(S1)CC(=O)CC=1SC(=CC=1)CCC(C)O)C DKLBGSKRPVSQQV-UHFFFAOYSA-N 0.000 description 1
- QXJKEFPXGNCWCH-UHFFFAOYSA-N 1-[5-(2-azidopropyl)thiophen-2-yl]ethanone Chemical compound [N-]=[N+]=NC(C)CC1=CC=C(C(C)=O)S1 QXJKEFPXGNCWCH-UHFFFAOYSA-N 0.000 description 1
- MOMFXATYAINJML-UHFFFAOYSA-N 2-Acetylthiazole Chemical group CC(=O)C1=NC=CS1 MOMFXATYAINJML-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- KWMBADTWRIGGGG-UHFFFAOYSA-N 2-diethoxyphosphorylacetonitrile Chemical compound CCOP(=O)(CC#N)OCC KWMBADTWRIGGGG-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- CROOTHFHCNJSLF-UHFFFAOYSA-N 3-[2-(5-acetylthiophen-2-yl)ethyl]-4-methylbenzenesulfonic acid Chemical compound S1C(C(=O)C)=CC=C1CCC1=CC(S(O)(=O)=O)=CC=C1C CROOTHFHCNJSLF-UHFFFAOYSA-N 0.000 description 1
- QJFUYJHXJQEQCM-UHFFFAOYSA-N 4-(3-aminopropyl)benzenesulfonamide Chemical compound NCCCC1=CC=C(S(N)(=O)=O)C=C1 QJFUYJHXJQEQCM-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- GUQRWFJKWHWUFF-UHFFFAOYSA-N 4-(5-acetylthiophen-2-yl)butan-2-one Chemical compound CC(=O)CCC1=CC=C(C(C)=O)S1 GUQRWFJKWHWUFF-UHFFFAOYSA-N 0.000 description 1
- WKUCZAMEOKOYJI-ZPTDFLPOSA-N 4-[(3R)-3-(2-phenylaziridin-1-yl)butyl]benzamide Chemical compound C([C@@H](C)N1C(C1)C=1C=CC=CC=1)CC1=CC=C(C(N)=O)C=C1 WKUCZAMEOKOYJI-ZPTDFLPOSA-N 0.000 description 1
- MICITYZABAFVCF-YCMKEVRSSA-N 4-[(3S)-3-(2-phenylaziridin-1-yl)butyl]phenol Chemical compound C([C@H](C)N1C(C1)C=1C=CC=CC=1)CC1=CC=C(O)C=C1 MICITYZABAFVCF-YCMKEVRSSA-N 0.000 description 1
- YOEQANQKAJKLEO-JQOGRIKYSA-N 4-[(3s)-3-(2-phenylaziridin-1-yl)butyl]benzamide;dihydrochloride Chemical compound Cl.Cl.C([C@H](C)N1C(C1)C=1C=CC=CC=1)CC1=CC=C(C(N)=O)C=C1 YOEQANQKAJKLEO-JQOGRIKYSA-N 0.000 description 1
- CZIVGZSHNQOSLJ-UHFFFAOYSA-N 4-[3-(1-phenylethylamino)butyl]benzenesulfonamide Chemical class C=1C=CC=CC=1C(C)NC(C)CCC1=CC=C(S(N)(=O)=O)C=C1 CZIVGZSHNQOSLJ-UHFFFAOYSA-N 0.000 description 1
- CVIWDRLFWMZSRR-UHFFFAOYSA-N 4-[3-(2-phenylaziridin-1-yl)propyl]benzamide Chemical compound C1=CC(C(=O)N)=CC=C1CCCN1C(C=2C=CC=CC=2)C1 CVIWDRLFWMZSRR-UHFFFAOYSA-N 0.000 description 1
- XAYGSYMEHLKFBN-UHFFFAOYSA-N 4-[3-(2-phenylaziridin-1-yl)propyl]benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)N)=CC=C1CCCN1C(C=2C=CC=CC=2)C1 XAYGSYMEHLKFBN-UHFFFAOYSA-N 0.000 description 1
- IJWMVEYGGKPTMG-UHFFFAOYSA-N 4-[3-(2-phenylaziridin-1-yl)propyl]benzonitrile Chemical compound C1=CC(C#N)=CC=C1CCCN1C(C=2C=CC=CC=2)C1 IJWMVEYGGKPTMG-UHFFFAOYSA-N 0.000 description 1
- UUPASTGTIQCCCM-UHFFFAOYSA-N 4-[3-[2-(3-chlorophenyl)aziridin-1-yl]propyl]benzamide Chemical compound C1=CC(C(=O)N)=CC=C1CCCN1C(C=2C=C(Cl)C=CC=2)C1 UUPASTGTIQCCCM-UHFFFAOYSA-N 0.000 description 1
- SMOHAYNPDJXPGI-UHFFFAOYSA-N 4-[3-[2-(3-methoxyphenyl)aziridin-1-yl]propyl]benzamide Chemical compound COC1=CC=CC(C2N(C2)CCCC=2C=CC(=CC=2)C(N)=O)=C1 SMOHAYNPDJXPGI-UHFFFAOYSA-N 0.000 description 1
- APDCQCKLJUVOGQ-UHFFFAOYSA-N 4-[3-[2-[3-(trifluoromethyl)phenyl]aziridin-1-yl]propyl]benzamide Chemical compound C1=CC(C(=O)N)=CC=C1CCCN1C(C=2C=C(C=CC=2)C(F)(F)F)C1 APDCQCKLJUVOGQ-UHFFFAOYSA-N 0.000 description 1
- WKGMOSXLGSNFQN-UHFFFAOYSA-N 4-[4-(5-acetylthiophen-2-yl)-2-methylbutyl]benzenesulfonic acid Chemical compound C=1C=C(S(O)(=O)=O)C=CC=1CC(C)CCC1=CC=C(C(C)=O)S1 WKGMOSXLGSNFQN-UHFFFAOYSA-N 0.000 description 1
- PCPUKVSTMLHXQF-UHFFFAOYSA-N 4-formylbenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=C(C=O)C=C1 PCPUKVSTMLHXQF-UHFFFAOYSA-N 0.000 description 1
- AALHGKIMYLYESB-UHFFFAOYSA-N 5-(2-aminoethyl)thiophene-2-carboxamide Chemical compound NCCC1=CC=C(C(N)=O)S1 AALHGKIMYLYESB-UHFFFAOYSA-N 0.000 description 1
- DDPSFUGBOSXSKW-UHFFFAOYSA-N 5-(2-azidoethyl)thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=C(CCN=[N+]=[N-])S1 DDPSFUGBOSXSKW-UHFFFAOYSA-N 0.000 description 1
- LLIXWOGVCHHOTC-UHFFFAOYSA-N 5-(3-hydroxybutyl)thiophene-2-carboxylic acid Chemical compound CC(O)CCC1=CC=C(C(O)=O)S1 LLIXWOGVCHHOTC-UHFFFAOYSA-N 0.000 description 1
- VULOTKHHGNMHDA-IKJXHCRLSA-N 5-[3-[(2S)-2-phenylaziridin-1-yl]propyl]thiophene-2-carboxamide Chemical compound S1C(C(=O)N)=CC=C1CCCN1[C@@H](C=2C=CC=CC=2)C1 VULOTKHHGNMHDA-IKJXHCRLSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- FJNCXZZQNBKEJT-UHFFFAOYSA-N 8beta-hydroxymarrubiin Natural products O1C(=O)C2(C)CCCC3(C)C2C1CC(C)(O)C3(O)CCC=1C=COC=1 FJNCXZZQNBKEJT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical class CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-IGMARMGPSA-N Carbon-12 Chemical compound [12C] OKTJSMMVPCPJKN-IGMARMGPSA-N 0.000 description 1
- 206010018473 Glycosuria Diseases 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- BEBAUJPHVHSNMY-KATGSKEPSA-N N-methyl-4-[(3S)-3-(2-phenylaziridin-1-yl)butyl]benzamide Chemical compound C1=CC(C(=O)NC)=CC=C1CC[C@H](C)N1C(C=2C=CC=CC=2)C1 BEBAUJPHVHSNMY-KATGSKEPSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 229910004283 SiO 4 Inorganic materials 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 230000003178 anti-diabetic effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000009937 brining Methods 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 230000001925 catabolic effect Effects 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- TUHMQDODLHWPCC-UHFFFAOYSA-N formyl cyanide Chemical compound O=CC#N TUHMQDODLHWPCC-UHFFFAOYSA-N 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 230000035780 glucosuria Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- WNPZREZPHDCWRC-UHFFFAOYSA-N methyl 3-(3-methylphenyl)prop-2-enoate Chemical compound COC(=O)C=CC1=CC=CC(C)=C1 WNPZREZPHDCWRC-UHFFFAOYSA-N 0.000 description 1
- FIOXZOBOYLMPBC-UHFFFAOYSA-N methyl 5-(3-azidopropyl)thiophene-2-carboxylate Chemical compound COC(=O)C1=CC=C(CCCN=[N+]=[N-])S1 FIOXZOBOYLMPBC-UHFFFAOYSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- NCCHARWOCKOHIH-UHFFFAOYSA-N n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1 NCCHARWOCKOHIH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- XUYJLQHKOGNDPB-UHFFFAOYSA-N phosphonoacetic acid Chemical compound OC(=O)CP(O)(O)=O XUYJLQHKOGNDPB-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000010773 plant oil Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
- C07D295/26—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/08—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/135—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/22—Radicals substituted by doubly bound hetero atoms, or by two hetero atoms other than halogen singly bound to the same carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CH301382 | 1982-05-14 | ||
CH143483 | 1983-03-16 |
Publications (1)
Publication Number | Publication Date |
---|---|
NO831727L true NO831727L (no) | 1983-11-15 |
Family
ID=25687635
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO831727A NO831727L (no) | 1982-05-14 | 1983-05-13 | Nye aziridin- og fenetanolaminderivater. |
Country Status (14)
Country | Link |
---|---|
US (1) | US4652679A (xx) |
EP (1) | EP0094595B1 (xx) |
AU (1) | AU1442483A (xx) |
CA (1) | CA1219865A (xx) |
DE (1) | DE3369130D1 (xx) |
DK (1) | DK209383A (xx) |
ES (1) | ES522403A0 (xx) |
FI (1) | FI831617L (xx) |
HU (1) | HU191523B (xx) |
IL (1) | IL68635A (xx) |
MC (1) | MC1516A1 (xx) |
NO (1) | NO831727L (xx) |
NZ (1) | NZ204177A (xx) |
PT (1) | PT76688B (xx) |
Families Citing this family (14)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CA1258454A (en) * | 1982-08-10 | 1989-08-15 | Leo Alig | Phenethanolamines |
CA1292747C (en) * | 1983-11-21 | 1991-12-03 | John Robert Carson | Aralykyl (arylethynyl) aralkyl amines and their use as vasodilators and antihypertensives |
AU610871B2 (en) * | 1987-03-12 | 1991-05-30 | Nippon Shokubai Kagaku Kogyo Co. Ltd. | Process for producing aziridines |
SI9111433B (sl) * | 1991-08-22 | 1999-02-28 | Pliva | Novi N-sulfonil-tetrahidro-/1,3/-dioksepino/5,6-b/azirini, postopek priprave, intermediati za njihovo pripravo in uporaba |
US5321036A (en) * | 1993-02-10 | 1994-06-14 | Bristol-Myers Squibb Company | Thiazole and oxazole-based β3 adrenergic receptor agonists |
DE4335718A1 (de) * | 1993-10-20 | 1995-04-27 | Merck Patent Gmbh | Cyclische Aminderivate |
US5563171A (en) * | 1993-11-05 | 1996-10-08 | American Cyanamid Company | Treatment of glaucoma and ocular hypertension with β3-adrenergic agonists |
US5578638A (en) * | 1993-11-05 | 1996-11-26 | American Cyanamid Company | Treatment of glaucoma and ocular hypertension with β3 -adrenergic agonists |
EP0669335A1 (en) * | 1994-02-21 | 1995-08-30 | PLIVA, farmaceutska, kemijska, prehrambena i kozmeticka industrija, dionicko drustvo | N-sulfonyl-tetrahydro-[1,3]-dioxepino [5,6] azirines with hypoglycemic activity |
ZA967892B (en) * | 1995-09-21 | 1998-03-18 | Lilly Co Eli | Selective β3 adrenergic agonists. |
US6075040A (en) * | 1996-09-05 | 2000-06-13 | Eli Lilly And Company | Selective β3 adrenergic agonists |
ATE215369T1 (de) * | 1996-09-05 | 2002-04-15 | Lilly Co Eli | Carbazolanaloge als selektive beta3-adrenergische agonisten |
CO5011072A1 (es) * | 1997-12-05 | 2001-02-28 | Lilly Co Eli | Etanolaminas pirazinil substituidas como agfonistas de los receptores |
US7812035B2 (en) | 2001-12-11 | 2010-10-12 | Sepracor Inc. | 4-substituted piperidines, and methods of use thereof |
Family Cites Families (36)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE108532C (xx) * | ||||
DD45721A (xx) * | ||||
US3092636A (en) * | 1959-10-21 | 1963-06-04 | Upjohn Co | Alpha-[2-(1-alkyleneimino) ethylamino]-alkanophenones and the corresponding alcohols |
GB1200886A (en) * | 1966-09-23 | 1970-08-05 | Allen & Hanburys Ltd | Phenylaminoethanol derivatives |
US3732300A (en) * | 1966-09-23 | 1973-05-08 | Allen & Hanburys Ltd | Phenylaminoethanol derivatives |
US3514465A (en) * | 1966-12-30 | 1970-05-26 | Degussa | Certain thiazolyl- and pyridinylaminoketones |
DE1593837A1 (de) * | 1967-06-29 | 1970-10-29 | Degussa | Verfahren zur Herstellung von neuen Aminoketonen |
DE1593836A1 (de) * | 1967-06-29 | 1971-08-19 | Degussa | Verfahren zur Herstellung von neuen Aminoketonen |
US3867455A (en) * | 1970-06-02 | 1975-02-18 | Allen & Hanburys Ltd | Preparation of phenylaminoethanols |
US3709913A (en) * | 1970-09-14 | 1973-01-09 | Smith Kline French Lab | N-thienylalkyl-beta-alkoxy-trifluoro-methylphenalkylamines |
US3803173A (en) * | 1971-04-26 | 1974-04-09 | Degussa | 3-(3-(1-(4-hydroxyphenyl)-1-hydroxypropyl-(2)-amino)-propionyl)-thiophene |
DD108532A1 (xx) * | 1973-02-15 | 1974-09-20 | ||
CA1030146A (en) * | 1974-04-18 | 1978-04-25 | American Home Products Corporation | Thiophene ethanolamines |
GB1540463A (en) * | 1976-10-07 | 1979-02-14 | Ici Ltd | Alkanolamine derivatives |
GB1593651A (en) * | 1977-02-03 | 1981-07-22 | Allen & Hanburys Ltd | Amides |
US4374149A (en) * | 1977-06-03 | 1983-02-15 | Sterling Drug Inc. | α-{[(Arylalkyl)amino]alkyl}-4-hydroxy-3-(lower-alkylsulfinyl)benzenemethanols |
CA1147342A (en) * | 1977-10-12 | 1983-05-31 | Kazuo Imai | Process of producing novel phenylethanolamine derivatives |
DE2965655D1 (en) * | 1978-06-28 | 1983-07-21 | Beecham Group Plc | Secondary amines, their preparation, pharmaceutical compositions containing them and their use |
IL57672A (en) * | 1978-07-03 | 1983-03-31 | Lilly Co Eli | Phenethanolamines,their preparation and pharmaceutical compositions containing the same |
IL57670A (en) * | 1978-07-03 | 1982-11-30 | Lilly Co Eli | Phenethanolamines,their preparation and pharmaceutical formulations comprising them |
DK269079A (da) * | 1978-07-03 | 1980-02-01 | Lilly Co Eli | Fremgangsmaade til fremstilling af phenethanolaminer |
EP0023385B1 (en) * | 1979-06-16 | 1982-12-15 | Beecham Group Plc | Ethanamine derivatives, their preparation and use in pharmaceutical compositions |
ATE1899T1 (de) * | 1979-06-16 | 1982-12-15 | Beecham Group Plc | Sekundaere amine, ihre herstellung und verwendung in pharmazeutischen zusammensetzungen. |
DE3062216D1 (en) * | 1979-09-06 | 1983-04-07 | Beecham Group Plc | Cinnamic acid derivatives, their preparation, and pharmaceutical compositions containing them |
DE3061693D1 (en) * | 1979-10-25 | 1983-02-24 | Beecham Group Plc | Secondary amines, their preparation and use in pharmaceutical compositions |
DE3070865D1 (en) * | 1979-11-15 | 1985-08-14 | Beecham Group Plc | Secondary ethanol amines, their preparation and their use in pharmaceutical compositions |
DE3161165D1 (en) * | 1980-05-08 | 1983-11-17 | Beecham Group Plc | Arylethanolamine derivatives, their preparation and use in pharmaceutical compositions |
DE3162756D1 (en) * | 1980-05-22 | 1984-04-26 | Beecham Group Plc | Arylethanolamine derivatives, their preparation and use in pharmaceutical compositions |
GB2084577B (en) * | 1980-09-26 | 1984-05-02 | Beecham Group Ltd | Secondary amines |
IT1149846B (it) * | 1980-10-16 | 1986-12-10 | Blasinachim Spa | Processo per la sintesi di 1-ammino-3-p(b-metossi-etil)-fenosi-2-propanolo |
GB2096988B (en) * | 1980-11-20 | 1984-08-01 | Beecham Group Ltd | Aromatic hydroxyamines |
EP0068699A1 (en) * | 1981-06-22 | 1983-01-05 | Beecham Group Plc | Decahydroquinolyl benzamides, process for their preparation and pharmaceutical compositions containing them |
US4379166A (en) * | 1981-08-03 | 1983-04-05 | Schering Corporation | Arylmethoxy-, arylmethylthio-, heteroarylmethoxy-, and heteroarylmethylthio-alkylaminoalcohols |
EP0091749A3 (en) * | 1982-04-08 | 1984-12-05 | Beecham Group Plc | Ethanolamine derivatives, process for their preparation and pharmaceutical compositions containing them |
DE3360426D1 (en) * | 1982-04-08 | 1985-08-29 | Beecham Group Plc | N-substituted derivatives of ethanol amine |
CA1258454A (en) * | 1982-08-10 | 1989-08-15 | Leo Alig | Phenethanolamines |
-
1983
- 1983-05-04 CA CA000427392A patent/CA1219865A/en not_active Expired
- 1983-05-09 US US06/492,981 patent/US4652679A/en not_active Expired - Fee Related
- 1983-05-09 NZ NZ204177A patent/NZ204177A/en unknown
- 1983-05-09 IL IL68635A patent/IL68635A/xx unknown
- 1983-05-10 DE DE8383104589T patent/DE3369130D1/de not_active Expired
- 1983-05-10 DK DK209383A patent/DK209383A/da not_active Application Discontinuation
- 1983-05-10 EP EP83104589A patent/EP0094595B1/de not_active Expired
- 1983-05-10 FI FI831617A patent/FI831617L/fi not_active Application Discontinuation
- 1983-05-10 AU AU14424/83A patent/AU1442483A/en not_active Abandoned
- 1983-05-10 MC MC821634A patent/MC1516A1/xx unknown
- 1983-05-11 HU HU831627A patent/HU191523B/hu unknown
- 1983-05-13 PT PT76688A patent/PT76688B/pt unknown
- 1983-05-13 ES ES522403A patent/ES522403A0/es active Granted
- 1983-05-13 NO NO831727A patent/NO831727L/no unknown
Also Published As
Publication number | Publication date |
---|---|
AU1442483A (en) | 1983-11-17 |
CA1219865A (en) | 1987-03-31 |
US4652679A (en) | 1987-03-24 |
PT76688B (en) | 1986-03-27 |
DK209383A (da) | 1983-11-15 |
EP0094595A1 (de) | 1983-11-23 |
DK209383D0 (da) | 1983-05-10 |
HU191523B (en) | 1987-03-30 |
FI831617A0 (fi) | 1983-05-10 |
PT76688A (en) | 1983-06-01 |
ES8407004A1 (es) | 1984-08-16 |
NZ204177A (en) | 1986-04-11 |
IL68635A0 (en) | 1983-09-30 |
IL68635A (en) | 1986-10-31 |
ES522403A0 (es) | 1984-08-16 |
DE3369130D1 (en) | 1987-02-19 |
MC1516A1 (fr) | 1984-02-10 |
FI831617L (fi) | 1983-11-15 |
EP0094595B1 (de) | 1987-01-14 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NO832867L (no) | Nye fenetanolaminer | |
NO831727L (no) | Nye aziridin- og fenetanolaminderivater. | |
US10662170B2 (en) | Substituted benzothiophenyl derivatives as GPR40 agonists for the treatment of type II diabetes | |
CA1262729A (en) | Phenoxypropanolamines | |
CA1124245A (en) | Interphenylene-9-thia-11-oxo-12-azaprostanoic acid compounds | |
US20070099991A1 (en) | Selective rxr ligands | |
JP2657324B2 (ja) | ヘテロ環を有するフェニルカルボン酸誘導体 | |
US20210139404A1 (en) | Compounds and synthetic methods for the preparation of retinoid x receptor-specific retinoids | |
NO159016B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive fenetanolaminderivater. | |
OA12303A (en) | Cyclopentyl-substituted glutaramide derivatives asinhibitors of neutral endopeptidase. | |
CA1249992A (en) | Oxazolidines | |
NO179834B (no) | Substituerte cykloheksanderivater og anvendelse av forbindelsene for fremstilling av legemidler | |
JPH04502334A (ja) | 3―アリールオキサゾリジノン誘導体、それらの製造方法及び治療での使用 | |
US20090005354A1 (en) | New Amino Derivatives and Their Use as Pharmaceuticals | |
EP2114913B1 (en) | Thiophene derivatives useful as ocular hypotensive agents | |
DK166584B1 (da) | Substituerede 4-benzyl-1h-imidazoler, fremgangsmaade til deres fremstilling samt farmaceutiske praeparater indeholdende dem | |
KR20020022102A (ko) | 1,4-치환 4,4-디아릴 시클로헥산 | |
US5166218A (en) | Phenoxypropanolamines and pharmaceutical compositions thereof | |
KR20070019678A (ko) | 아미노알콜 유도체 | |
EP0322164B1 (en) | Ethanolamine derivatives | |
US8546603B2 (en) | Substituted cyclopentanes having prostaglandin activity | |
US4996218A (en) | Chloroaniline derivatives | |
JPH0725851A (ja) | ピペリジン類およびピペラジン類 | |
HU196373B (en) | Process for production of of derivatives of heteroaromatic acetilene and medical preparatives containing them | |
US3095424A (en) | 3, 5-diaryl-3-pyrrolidinols |