NO820726L - Fremgangsmaate for fremstilling av terapeutisk aktive guanidin-derivater. - Google Patents
Fremgangsmaate for fremstilling av terapeutisk aktive guanidin-derivater.Info
- Publication number
- NO820726L NO820726L NO820726A NO820726A NO820726L NO 820726 L NO820726 L NO 820726L NO 820726 A NO820726 A NO 820726A NO 820726 A NO820726 A NO 820726A NO 820726 L NO820726 L NO 820726L
- Authority
- NO
- Norway
- Prior art keywords
- alkyl
- ring
- trifluoroethyl
- mixture
- radical
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 50
- 238000002360 preparation method Methods 0.000 title claims description 19
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical class NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 title claims description 11
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 title claims description 9
- 230000001225 therapeutic effect Effects 0.000 title 1
- -1 hydroxy- Chemical class 0.000 claims description 93
- 150000001875 compounds Chemical class 0.000 claims description 81
- 229910052757 nitrogen Inorganic materials 0.000 claims description 30
- 239000002253 acid Substances 0.000 claims description 28
- 125000000217 alkyl group Chemical group 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 23
- 229910052760 oxygen Inorganic materials 0.000 claims description 23
- 239000001301 oxygen Substances 0.000 claims description 22
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 20
- 125000004434 sulfur atom Chemical group 0.000 claims description 20
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 19
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 18
- 239000000460 chlorine Substances 0.000 claims description 17
- 150000002357 guanidines Chemical class 0.000 claims description 17
- 229910052801 chlorine Inorganic materials 0.000 claims description 14
- 150000001412 amines Chemical class 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 125000001424 substituent group Chemical group 0.000 claims description 12
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 229910052717 sulfur Inorganic materials 0.000 claims description 11
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 10
- 229910052731 fluorine Inorganic materials 0.000 claims description 10
- 229920006395 saturated elastomer Polymers 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 9
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 239000011737 fluorine Substances 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 8
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 8
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 8
- 125000002947 alkylene group Chemical group 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 125000001246 bromo group Chemical group Br* 0.000 claims description 7
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims description 7
- 125000001072 heteroaryl group Chemical group 0.000 claims description 7
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 230000027119 gastric acid secretion Effects 0.000 claims description 6
- 239000003485 histamine H2 receptor antagonist Substances 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 5
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 5
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical group CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 claims description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 4
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 239000012458 free base Substances 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 230000008569 process Effects 0.000 claims description 3
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 3
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 125000005242 carbamoyl alkyl group Chemical group 0.000 claims description 2
- 125000001589 carboacyl group Chemical group 0.000 claims description 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 claims description 2
- 239000012634 fragment Substances 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 125000004992 haloalkylamino group Chemical group 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 238000009830 intercalation Methods 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000002993 cycloalkylene group Chemical group 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 175
- 239000000203 mixture Substances 0.000 description 163
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 126
- 239000000243 solution Substances 0.000 description 122
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 105
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 87
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 87
- 235000019439 ethyl acetate Nutrition 0.000 description 87
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 75
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 62
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 60
- 239000007858 starting material Substances 0.000 description 53
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 42
- 239000007787 solid Substances 0.000 description 39
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 36
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 34
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 33
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 32
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 32
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 31
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 28
- 239000000284 extract Substances 0.000 description 27
- 239000003921 oil Substances 0.000 description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 22
- 238000010992 reflux Methods 0.000 description 22
- 238000012360 testing method Methods 0.000 description 21
- GOXVPASJCHROBY-UHFFFAOYSA-N 1,1,1-trifluoro-2-isothiocyanatoethane Chemical compound FC(F)(F)CN=C=S GOXVPASJCHROBY-UHFFFAOYSA-N 0.000 description 20
- 229910021529 ammonia Inorganic materials 0.000 description 18
- 239000000706 filtrate Substances 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- 239000002244 precipitate Substances 0.000 description 17
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 16
- 229960001340 histamine Drugs 0.000 description 16
- 239000011976 maleic acid Substances 0.000 description 16
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- 210000001519 tissue Anatomy 0.000 description 14
- 239000003208 petroleum Substances 0.000 description 13
- 238000000746 purification Methods 0.000 description 13
- 239000011541 reaction mixture Substances 0.000 description 13
- 239000000725 suspension Substances 0.000 description 13
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 12
- 150000003254 radicals Chemical group 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 11
- 239000003480 eluent Substances 0.000 description 11
- 230000028327 secretion Effects 0.000 description 11
- 238000001914 filtration Methods 0.000 description 10
- 238000001953 recrystallisation Methods 0.000 description 10
- RMMXTBMQSGEXHJ-UHFFFAOYSA-N Aminophenazone Chemical compound O=C1C(N(C)C)=C(C)N(C)N1C1=CC=CC=C1 RMMXTBMQSGEXHJ-UHFFFAOYSA-N 0.000 description 9
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 9
- 241000282472 Canis lupus familiaris Species 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 9
- 229960000212 aminophenazone Drugs 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 229950001902 dimevamide Drugs 0.000 description 9
- 238000002474 experimental method Methods 0.000 description 9
- 230000005764 inhibitory process Effects 0.000 description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- RFFFKMOABOFIDF-UHFFFAOYSA-N Pentanenitrile Chemical compound CCCCC#N RFFFKMOABOFIDF-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000000872 buffer Substances 0.000 description 8
- 239000003085 diluting agent Substances 0.000 description 8
- 239000002609 medium Substances 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 8
- ALCSGJCIESECFD-UHFFFAOYSA-N 5-[3-[[amino(2,2,2-trifluoroethylimino)methyl]amino]-1-pyrazolyl]pentanamide Chemical compound NC(=O)CCCCN1C=CC(NC(N)=NCC(F)(F)F)=N1 ALCSGJCIESECFD-UHFFFAOYSA-N 0.000 description 7
- NWWWGAKVHCSAEU-UHFFFAOYSA-N 5-bromopentanenitrile Chemical compound BrCCCCC#N NWWWGAKVHCSAEU-UHFFFAOYSA-N 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 235000011114 ammonium hydroxide Nutrition 0.000 description 7
- 239000008346 aqueous phase Substances 0.000 description 7
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 7
- 238000004587 chromatography analysis Methods 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 229940101209 mercuric oxide Drugs 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- 210000002784 stomach Anatomy 0.000 description 7
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 6
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 6
- 229910004373 HOAc Inorganic materials 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- IPWFJLQDVFKJDU-UHFFFAOYSA-N pentanamide Chemical compound CCCCC(N)=O IPWFJLQDVFKJDU-UHFFFAOYSA-N 0.000 description 6
- 239000000825 pharmaceutical preparation Substances 0.000 description 6
- 102000005962 receptors Human genes 0.000 description 6
- 108020003175 receptors Proteins 0.000 description 6
- OYUNTGBISCIYPW-UHFFFAOYSA-N 2-chloroprop-2-enenitrile Chemical compound ClC(=C)C#N OYUNTGBISCIYPW-UHFFFAOYSA-N 0.000 description 5
- FWWOWPGPERBCNJ-UHFFFAOYSA-N 2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid Chemical compound OCCOC(=O)CC(O)C(O)=O FWWOWPGPERBCNJ-UHFFFAOYSA-N 0.000 description 5
- 241000700199 Cavia porcellus Species 0.000 description 5
- 206010016717 Fistula Diseases 0.000 description 5
- 239000005909 Kieselgur Substances 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 5
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- 210000004027 cell Anatomy 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 230000003890 fistula Effects 0.000 description 5
- 210000004211 gastric acid Anatomy 0.000 description 5
- 210000004907 gland Anatomy 0.000 description 5
- 238000001802 infusion Methods 0.000 description 5
- 238000001990 intravenous administration Methods 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 5
- 239000000523 sample Substances 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- LLJKEQMAYLRVBR-UHFFFAOYSA-N 1,1,2,2-tetrafluoro-3-isothiocyanatopropane Chemical compound FC(F)C(F)(F)CN=C=S LLJKEQMAYLRVBR-UHFFFAOYSA-N 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical group C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 4
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 4
- YUCPFMOAOKYIGN-UHFFFAOYSA-N 4-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanamide Chemical compound NC(=O)CCCSC1=NC=CC(NC(N)=NCC(F)(F)F)=N1 YUCPFMOAOKYIGN-UHFFFAOYSA-N 0.000 description 4
- DTRIDVOOPAQEEL-UHFFFAOYSA-N 4-sulfanylbutanoic acid Chemical compound OC(=O)CCCS DTRIDVOOPAQEEL-UHFFFAOYSA-N 0.000 description 4
- ZUXOHKDGFDBNNW-UHFFFAOYSA-N 5-(3-nitropyrazol-1-yl)pentanenitrile Chemical compound [O-][N+](=O)C=1C=CN(CCCCC#N)N=1 ZUXOHKDGFDBNNW-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 230000009858 acid secretion Effects 0.000 description 4
- CCGSUNCLSOWKJO-UHFFFAOYSA-N cimetidine Chemical compound N#CNC(=N/C)\NCCSCC1=NC=N[C]1C CCGSUNCLSOWKJO-UHFFFAOYSA-N 0.000 description 4
- 229960001380 cimetidine Drugs 0.000 description 4
- UNAQSRLBVVDYGP-UHFFFAOYSA-N hex-5-enenitrile Chemical compound C=CCCCC#N UNAQSRLBVVDYGP-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 3
- MOEIRUOTENBARR-UHFFFAOYSA-N 1-[1-(4-cyanobutyl)pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound FC(F)(F)CN=C(N)NC=1C=CN(CCCCC#N)N=1 MOEIRUOTENBARR-UHFFFAOYSA-N 0.000 description 3
- FQIHSTUKNKJFJP-UHFFFAOYSA-N 2,2,2-trifluoroethylcyanamide Chemical compound FC(F)(F)CNC#N FQIHSTUKNKJFJP-UHFFFAOYSA-N 0.000 description 3
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 3
- XXFQIFGVKYHYAI-UHFFFAOYSA-N 4-[6-[[n'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]pyridin-2-yl]sulfanylbutanamide Chemical compound NC(=O)CCCSC1=CC=CC(NC(N)=NCC(F)(F)C(F)F)=N1 XXFQIFGVKYHYAI-UHFFFAOYSA-N 0.000 description 3
- KBWHMHDRPUAGLB-UHFFFAOYSA-N 5-(3-aminopyrazol-1-yl)pentanamide Chemical compound NC(=O)CCCCN1C=CC(N)=N1 KBWHMHDRPUAGLB-UHFFFAOYSA-N 0.000 description 3
- HCVDXBYWVYEVNY-UHFFFAOYSA-N 5-[3-[[n'-(2-chloro-2,2-difluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanamide Chemical compound NC(=O)CCCCN1C=CC(NC(N)=NCC(F)(F)Cl)=N1 HCVDXBYWVYEVNY-UHFFFAOYSA-N 0.000 description 3
- CGYUBCDWVYXKFR-UHFFFAOYSA-N 5-[4-[[n'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]triazol-2-yl]pentanamide Chemical compound NC(=O)CCCCN1N=CC(NC(N)=NCC(F)(F)C(F)F)=N1 CGYUBCDWVYXKFR-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 3
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 3
- 229940122957 Histamine H2 receptor antagonist Drugs 0.000 description 3
- 208000008469 Peptic Ulcer Diseases 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- QGVJGVSOYVPOGX-UHFFFAOYSA-N [n'-(2,2,2-trifluoroethyl)carbamimidoyl]thiourea Chemical compound NC(=S)NC(=N)NCC(F)(F)F QGVJGVSOYVPOGX-UHFFFAOYSA-N 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000002269 analeptic agent Substances 0.000 description 3
- 239000005557 antagonist Substances 0.000 description 3
- 239000000739 antihistaminic agent Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 230000004071 biological effect Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- KORBASYRJWTUKT-UHFFFAOYSA-N ethyl 4-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanoate Chemical compound CCOC(=O)CCCSC1=NC=CC(NC(N)=NCC(F)(F)F)=N1 KORBASYRJWTUKT-UHFFFAOYSA-N 0.000 description 3
- 239000002024 ethyl acetate extract Substances 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 150000002540 isothiocyanates Chemical class 0.000 description 3
- 150000002689 maleic acids Chemical class 0.000 description 3
- 229960000582 mepyramine Drugs 0.000 description 3
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 3
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 3
- 125000003226 pyrazolyl group Chemical group 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 2
- QZULBUIYVBOYON-UHFFFAOYSA-N 1-(2-methylsulfinylpyrimidin-4-yl)-2-(2,2,2-trifluoroethyl)guanidine Chemical compound CS(=O)C1=NC=CC(NC(N)=NCC(F)(F)F)=N1 QZULBUIYVBOYON-UHFFFAOYSA-N 0.000 description 2
- KIRKIQMOQXADDF-UHFFFAOYSA-N 1-(6-chloropyrazin-2-yl)-2-(2,2,2-trifluoroethyl)guanidine Chemical compound FC(F)(F)CN=C(N)NC1=CN=CC(Cl)=N1 KIRKIQMOQXADDF-UHFFFAOYSA-N 0.000 description 2
- XQPUJIYHDOSRDE-UHFFFAOYSA-N 1-(6-chloropyrazin-2-yl)-3-(2,2,2-trifluoroethyl)thiourea Chemical compound FC(F)(F)CNC(=S)NC1=CN=CC(Cl)=N1 XQPUJIYHDOSRDE-UHFFFAOYSA-N 0.000 description 2
- MROPEBIAYIMMMH-UHFFFAOYSA-N 1-[2-(3-cyanopropylsulfanyl)pyrimidin-4-yl]-2-(2-methoxyethyl)guanidine Chemical compound COCCN=C(N)NC1=CC=NC(SCCCC#N)=N1 MROPEBIAYIMMMH-UHFFFAOYSA-N 0.000 description 2
- MHAKCHRESXGCOM-UHFFFAOYSA-N 1-[2-(3-cyanopropylsulfanyl)pyrimidin-4-yl]-3-(2,2,2-trifluoroethyl)thiourea Chemical compound FC(F)(F)CNC(=S)NC1=CC=NC(SCCCC#N)=N1 MHAKCHRESXGCOM-UHFFFAOYSA-N 0.000 description 2
- TZYMAFPSBMGLEX-UHFFFAOYSA-N 1-[2-(4-cyanobutyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound FC(F)(F)CN=C(N)NC1=CC=NC(CCCCC#N)=N1 TZYMAFPSBMGLEX-UHFFFAOYSA-N 0.000 description 2
- BWVBYHYZGSVBNH-UHFFFAOYSA-N 1-[2-(4-cyanobutyl)triazol-4-yl]-3-(2,2,2-trifluoroethyl)thiourea Chemical compound FC(F)(F)CNC(=S)NC=1C=NN(CCCCC#N)N=1 BWVBYHYZGSVBNH-UHFFFAOYSA-N 0.000 description 2
- NHUQNVQAHMBVKC-UHFFFAOYSA-N 1-chloro-1,1-difluoro-2-isothiocyanatoethane Chemical compound FC(F)(Cl)CN=C=S NHUQNVQAHMBVKC-UHFFFAOYSA-N 0.000 description 2
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 description 2
- KIPSRYDSZQRPEA-UHFFFAOYSA-N 2,2,2-trifluoroethanamine Chemical compound NCC(F)(F)F KIPSRYDSZQRPEA-UHFFFAOYSA-N 0.000 description 2
- QGJIESRUALRBPX-UHFFFAOYSA-N 2-(3-aminopyrazol-1-yl)ethanol Chemical compound NC=1C=CN(CCO)N=1 QGJIESRUALRBPX-UHFFFAOYSA-N 0.000 description 2
- JHMDYNKFZWMIBN-UHFFFAOYSA-N 2-(phenylsulfanylmethyl)pyrimidin-4-amine Chemical compound NC1=CC=NC(CSC=2C=CC=CC=2)=N1 JHMDYNKFZWMIBN-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- 125000004780 2-chloro-2,2-difluoroethyl group Chemical group [H]C([H])(*)C(F)(F)Cl 0.000 description 2
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- QVKGCOTZLQMKDK-UHFFFAOYSA-N 3-(4-aminotriazol-2-yl)cyclopentane-1-carboxamide Chemical compound C1C(C(=O)N)CCC1N1N=C(N)C=N1 QVKGCOTZLQMKDK-UHFFFAOYSA-N 0.000 description 2
- ALHNOANYMBHSSR-UHFFFAOYSA-N 3-(4-nitrotriazol-2-yl)cyclopentane-1-carboxamide Chemical compound C1C(C(=O)N)CCC1N1N=C([N+]([O-])=O)C=N1 ALHNOANYMBHSSR-UHFFFAOYSA-N 0.000 description 2
- VAYKHUVUFVZUFA-UHFFFAOYSA-N 3-(4-nitrotriazol-2-yl)cyclopentane-1-carboxylic acid Chemical compound C1C(C(=O)O)CCC1N1N=C([N+]([O-])=O)C=N1 VAYKHUVUFVZUFA-UHFFFAOYSA-N 0.000 description 2
- DFYBLNUMPOAYLE-UHFFFAOYSA-N 3-(triazol-2-yl)cyclopentan-1-ol Chemical compound C1C(O)CCC1N1N=CC=N1 DFYBLNUMPOAYLE-UHFFFAOYSA-N 0.000 description 2
- SEUIBNDHWJSYHC-UHFFFAOYSA-N 3-(triazol-2-yl)cyclopentane-1-carbonitrile Chemical compound C1C(C#N)CCC1N1N=CC=N1 SEUIBNDHWJSYHC-UHFFFAOYSA-N 0.000 description 2
- VWVQQYDXIGGJMJ-UHFFFAOYSA-N 3-carboxybenzenediazonium;chloride Chemical compound [Cl-].OC(=O)C1=CC=CC([N+]#N)=C1 VWVQQYDXIGGJMJ-UHFFFAOYSA-N 0.000 description 2
- KLUCIFZDMPPWOB-UHFFFAOYSA-N 4-(4-aminopyrimidin-2-yl)sulfanylbutanenitrile Chemical compound NC1=CC=NC(SCCCC#N)=N1 KLUCIFZDMPPWOB-UHFFFAOYSA-N 0.000 description 2
- UIQPVJOTFZGILT-UHFFFAOYSA-N 4-(6-aminopyridin-2-yl)sulfanylbutanoic acid Chemical compound NC1=CC=CC(SCCCC(O)=O)=N1 UIQPVJOTFZGILT-UHFFFAOYSA-N 0.000 description 2
- NMTPRIYWACWVNV-UHFFFAOYSA-N 4-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanoic acid Chemical compound FC(F)(F)CN=C(N)NC1=CC=NC(SCCCC(O)=O)=N1 NMTPRIYWACWVNV-UHFFFAOYSA-N 0.000 description 2
- PWEFPAVXAWLQAG-UHFFFAOYSA-N 4-[4-[[n'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]pyrimidin-2-yl]oxybutanamide Chemical compound NC(=O)CCCOC1=NC=CC(NC(N)=NCC(F)(F)C(F)F)=N1 PWEFPAVXAWLQAG-UHFFFAOYSA-N 0.000 description 2
- VAABLVJAXOXFLH-UHFFFAOYSA-N 4-[6-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazin-2-yl]sulfanylbutanoic acid Chemical compound FC(F)(F)CN=C(N)NC1=CN=CC(SCCCC(O)=O)=N1 VAABLVJAXOXFLH-UHFFFAOYSA-N 0.000 description 2
- ZFCFBWSVQWGOJJ-UHFFFAOYSA-N 4-chlorobutanenitrile Chemical compound ClCCCC#N ZFCFBWSVQWGOJJ-UHFFFAOYSA-N 0.000 description 2
- BAQQRABCRRQRSR-UHFFFAOYSA-N 4-hydroxybutylnitrile Chemical compound OCCCC#N BAQQRABCRRQRSR-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- IIZHXMZRHOYRGH-UHFFFAOYSA-N 5-(3-aminopyrazol-1-yl)pentanenitrile Chemical compound NC=1C=CN(CCCCC#N)N=1 IIZHXMZRHOYRGH-UHFFFAOYSA-N 0.000 description 2
- QAGUAPQYSNJNFZ-UHFFFAOYSA-N 5-(3-nitropyrazol-1-yl)pentanamide Chemical compound NC(=O)CCCCN1C=CC([N+]([O-])=O)=N1 QAGUAPQYSNJNFZ-UHFFFAOYSA-N 0.000 description 2
- YMZPJSOZMNVTRV-UHFFFAOYSA-N 5-(4-aminopyrimidin-2-yl)pentanenitrile Chemical compound NC1=CC=NC(CCCCC#N)=N1 YMZPJSOZMNVTRV-UHFFFAOYSA-N 0.000 description 2
- ISCJLIJIOFOWTR-UHFFFAOYSA-N 5-hydroxypentanenitrile Chemical compound OCCCCC#N ISCJLIJIOFOWTR-UHFFFAOYSA-N 0.000 description 2
- DCPSTSVLRXOYGS-UHFFFAOYSA-N 6-amino-1h-pyrimidine-2-thione Chemical compound NC1=CC=NC(S)=N1 DCPSTSVLRXOYGS-UHFFFAOYSA-N 0.000 description 2
- BKLJUYPLUWUEOQ-UHFFFAOYSA-N 6-bromopyridin-2-amine Chemical compound NC1=CC=CC(Br)=N1 BKLJUYPLUWUEOQ-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- BZKFMUIJRXWWQK-UHFFFAOYSA-N Cyclopentenone Chemical compound O=C1CCC=C1 BZKFMUIJRXWWQK-UHFFFAOYSA-N 0.000 description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 2
- 206010065713 Gastric Fistula Diseases 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 2
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical group C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 2
- 108010079943 Pentagastrin Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 229940125715 antihistaminic agent Drugs 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229940098773 bovine serum albumin Drugs 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 2
- OJEYDZBIAYMFFD-UHFFFAOYSA-N cyclopentanecarboxamide Chemical compound NC(=O)C1C[CH]CC1 OJEYDZBIAYMFFD-UHFFFAOYSA-N 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical compound C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 2
- 229960000520 diphenhydramine Drugs 0.000 description 2
- 239000002612 dispersion medium Substances 0.000 description 2
- 210000003238 esophagus Anatomy 0.000 description 2
- QFTABHSVLGVCPR-UHFFFAOYSA-N ethyl 5-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylpentanoate Chemical compound CCOC(=O)CCCCSC1=NC=CC(NC(N)=NCC(F)(F)F)=N1 QFTABHSVLGVCPR-UHFFFAOYSA-N 0.000 description 2
- PRLTYCBRKTUEJZ-UHFFFAOYSA-N ethyl 5-cyanopentanimidate Chemical compound CCOC(=N)CCCCC#N PRLTYCBRKTUEJZ-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 210000002837 heart atrium Anatomy 0.000 description 2
- 239000000938 histamine H1 antagonist Substances 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- ZTUJDPKOHPKRMO-UHFFFAOYSA-N hydron;2,2,2-trifluoroethanamine;chloride Chemical compound Cl.NCC(F)(F)F ZTUJDPKOHPKRMO-UHFFFAOYSA-N 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- BQPIGGFYSBELGY-UHFFFAOYSA-N mercury(2+) Chemical compound [Hg+2] BQPIGGFYSBELGY-UHFFFAOYSA-N 0.000 description 2
- MTAWUKWVQQZZSY-UHFFFAOYSA-N methyl 3-(4-aminotriazol-2-yl)benzoate Chemical compound COC(=O)C1=CC=CC(N2N=C(N)C=N2)=C1 MTAWUKWVQQZZSY-UHFFFAOYSA-N 0.000 description 2
- UIRVFIRFYRFBDI-UHFFFAOYSA-N methyl 3-(4-nitrotriazol-2-yl)benzoate Chemical compound COC(=O)C1=CC=CC(N2N=C(C=N2)[N+]([O-])=O)=C1 UIRVFIRFYRFBDI-UHFFFAOYSA-N 0.000 description 2
- UTWBBVDVDINNKS-UHFFFAOYSA-N methyl 3-[2-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]cyclopentane-1-carboxylate Chemical compound C1C(C(=O)OC)CCC1C1=CSC(NC(N)=NCC(F)(F)F)=N1 UTWBBVDVDINNKS-UHFFFAOYSA-N 0.000 description 2
- KVAFNEXCJDVTEM-UHFFFAOYSA-N methyl 3-[4-(2,2,2-trifluoroethylcarbamothioylamino)triazol-2-yl]benzoate Chemical compound COC(=O)C1=CC=CC(N2N=C(NC(=S)NCC(F)(F)F)C=N2)=C1 KVAFNEXCJDVTEM-UHFFFAOYSA-N 0.000 description 2
- SULZWNFGEUTVGK-UHFFFAOYSA-N methyl 3-[[2-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]propanoate Chemical compound COC(=O)CCSCC1=CSC(NC(N)=NCC(F)(F)F)=N1 SULZWNFGEUTVGK-UHFFFAOYSA-N 0.000 description 2
- QKHNSKAMPMHMJS-UHFFFAOYSA-N methyl 5-[2-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]pentanoate Chemical compound COC(=O)CCCCC1=CSC(NC(N)=NCC(F)(F)F)=N1 QKHNSKAMPMHMJS-UHFFFAOYSA-N 0.000 description 2
- HISQZAFLADECBN-UHFFFAOYSA-N methyl 7-chloro-6-oxoheptanoate Chemical compound COC(=O)CCCCC(=O)CCl HISQZAFLADECBN-UHFFFAOYSA-N 0.000 description 2
- SRNORCARENZRSA-UHFFFAOYSA-N methyl n'-(2,2,2-trifluoroethyl)carbamimidothioate;hydroiodide Chemical compound I.CSC(=N)NCC(F)(F)F SRNORCARENZRSA-UHFFFAOYSA-N 0.000 description 2
- 210000005036 nerve Anatomy 0.000 description 2
- ANRIQLNBZQLTFV-DZUOILHNSA-N pentagastrin Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1[C]2C=CC=CC2=NC=1)NC(=O)CCNC(=O)OC(C)(C)C)CCSC)C(N)=O)C1=CC=CC=C1 ANRIQLNBZQLTFV-DZUOILHNSA-N 0.000 description 2
- 229960000444 pentagastrin Drugs 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920000136 polysorbate Polymers 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 238000012746 preparative thin layer chromatography Methods 0.000 description 2
- SUVIGLJNEAMWEG-UHFFFAOYSA-N propane-1-thiol Chemical compound CCCS SUVIGLJNEAMWEG-UHFFFAOYSA-N 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- 229940080818 propionamide Drugs 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 210000005245 right atrium Anatomy 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- 210000004706 scrotum Anatomy 0.000 description 2
- 230000003248 secreting effect Effects 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- PUXXCOICMSYKNK-BTJKTKAUSA-N (z)-but-2-enedioic acid;1-[2-(3-sulfanylpropylsulfanyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound OC(=O)\C=C/C(O)=O.FC(F)(F)CN=C(N)NC1=CC=NC(SCCCS)=N1 PUXXCOICMSYKNK-BTJKTKAUSA-N 0.000 description 1
- HSWOPEUAUAECKB-BTJKTKAUSA-N (z)-but-2-enedioic acid;3-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]triazol-2-yl]cyclopentane-1-carboxamide Chemical compound OC(=O)\C=C/C(O)=O.C1C(C(=O)N)CCC1N1N=C(NC(N)=NCC(F)(F)F)C=N1 HSWOPEUAUAECKB-BTJKTKAUSA-N 0.000 description 1
- KYQYZENQHYTYFY-BTJKTKAUSA-N (z)-but-2-enedioic acid;4-[4-[[n'-(2-methoxyethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanamide Chemical compound OC(=O)\C=C/C(O)=O.COCCN=C(N)NC1=CC=NC(SCCCC(N)=O)=N1 KYQYZENQHYTYFY-BTJKTKAUSA-N 0.000 description 1
- NQMIXEZSDUDMNA-BTJKTKAUSA-N (z)-but-2-enedioic acid;4-[6-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazin-2-yl]sulfanylbutanamide Chemical compound OC(=O)\C=C/C(O)=O.NC(=O)CCCSC1=CN=CC(NC(N)=NCC(F)(F)F)=N1 NQMIXEZSDUDMNA-BTJKTKAUSA-N 0.000 description 1
- MKKCSRUQVWSKAW-BTJKTKAUSA-N (z)-but-2-enedioic acid;4-[6-[[n'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]pyridin-2-yl]sulfanylbutanamide Chemical compound OC(=O)\C=C/C(O)=O.NC(=O)CCCSC1=CC=CC(NC(N)=NCC(F)(F)C(F)F)=N1 MKKCSRUQVWSKAW-BTJKTKAUSA-N 0.000 description 1
- UELLSTWVHWRWMK-BTJKTKAUSA-N (z)-but-2-enedioic acid;5-[3-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]pentanamide Chemical compound OC(=O)\C=C/C(O)=O.NC(=O)CCCCN1C=CC(NC(N)=NCC(F)(F)F)=N1 UELLSTWVHWRWMK-BTJKTKAUSA-N 0.000 description 1
- SHAGQCPNDWUGKK-BTJKTKAUSA-N (z)-but-2-enedioic acid;5-[6-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyridin-2-yl]sulfanylpentanamide Chemical compound OC(=O)\C=C/C(O)=O.NC(=O)CCCCSC1=CC=CC(NC(N)=NCC(F)(F)F)=N1 SHAGQCPNDWUGKK-BTJKTKAUSA-N 0.000 description 1
- KCZYJQOMQXLVRI-BTJKTKAUSA-N (z)-but-2-enedioic acid;5-[[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3,5-triazin-2-yl]sulfanyl]pentanamide Chemical compound OC(=O)\C=C/C(O)=O.NC(=O)CCCCSC1=NC=NC(NC(N)=NCC(F)(F)F)=N1 KCZYJQOMQXLVRI-BTJKTKAUSA-N 0.000 description 1
- QWKNHQJTEJKXHS-BTJKTKAUSA-N (z)-but-2-enedioic acid;6-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylhexanamide Chemical compound OC(=O)\C=C/C(O)=O.NC(=O)CCCCCSC1=NC=CC(NC(N)=NCC(F)(F)F)=N1 QWKNHQJTEJKXHS-BTJKTKAUSA-N 0.000 description 1
- ZMNYFNKTNAQWPW-BTJKTKAUSA-N (z)-but-2-enedioic acid;cyclopentanecarboxamide Chemical compound NC(=O)C1CCCC1.OC(=O)\C=C/C(O)=O ZMNYFNKTNAQWPW-BTJKTKAUSA-N 0.000 description 1
- DUOOJYPDYWTDSH-BTJKTKAUSA-N (z)-but-2-enedioic acid;n-pyridazin-3-yl-5-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]pentanamide Chemical compound OC(=O)\C=C/C(O)=O.FC(F)(F)CN=C(N)NC1=CC=NC(CCCCC(=O)NC=2N=NC=CC=2)=N1 DUOOJYPDYWTDSH-BTJKTKAUSA-N 0.000 description 1
- YGTAZGSLCXNBQL-UHFFFAOYSA-N 1,2,4-thiadiazole Chemical group C=1N=CSN=1 YGTAZGSLCXNBQL-UHFFFAOYSA-N 0.000 description 1
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- COXVMEZXNQICDA-UHFFFAOYSA-N 1-(1h-pyrazol-5-yl)-2-(2,2,2-trifluoroethyl)guanidine Chemical compound FC(F)(F)CN=C(N)NC=1C=CNN=1 COXVMEZXNQICDA-UHFFFAOYSA-N 0.000 description 1
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 1
- LWEALJANYJSLPB-UHFFFAOYSA-N 1-[1-(2-hydroxyethyl)pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound FC(F)(F)CN=C(N)NC=1C=CN(CCO)N=1 LWEALJANYJSLPB-UHFFFAOYSA-N 0.000 description 1
- UVEJDIDFYXOABQ-UHFFFAOYSA-N 1-[1-(2-hydroxyethyl)pyrazol-3-yl]-3-(2,2,2-trifluoroethyl)thiourea Chemical compound OCCN1C=CC(NC(=S)NCC(F)(F)F)=N1 UVEJDIDFYXOABQ-UHFFFAOYSA-N 0.000 description 1
- PWHXBUCIDNPOPB-UHFFFAOYSA-N 1-[1-(4-cyanobutyl)-1,2,4-triazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound FC(F)(F)CN=C(N)NC=1N=CN(CCCCC#N)N=1 PWHXBUCIDNPOPB-UHFFFAOYSA-N 0.000 description 1
- QCJWLNRCSYEKAQ-UHFFFAOYSA-N 1-[1-(4-cyanobutyl)-1,2,4-triazol-3-yl]-3-(2,2,2-trifluoroethyl)thiourea Chemical compound FC(F)(F)CNC(=S)NC=1N=CN(CCCCC#N)N=1 QCJWLNRCSYEKAQ-UHFFFAOYSA-N 0.000 description 1
- JNCQYBKBRHUWBJ-UHFFFAOYSA-N 1-[1-[2-[(4-cyanophenyl)methoxy]ethyl]pyrazol-3-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound N1=C(NC(N)=NCC(F)(F)F)C=CN1CCOCC1=CC=C(C#N)C=C1 JNCQYBKBRHUWBJ-UHFFFAOYSA-N 0.000 description 1
- UZYUNRMPVHWCGR-UHFFFAOYSA-N 1-[2-(3-cyanopropylsulfanylmethyl)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound FC(F)(F)CN=C(N)NC1=CC=NC(CSCCCC#N)=N1 UZYUNRMPVHWCGR-UHFFFAOYSA-N 0.000 description 1
- AHYXUTWTRVWFQW-UHFFFAOYSA-N 1-[2-(4-cyanobutoxy)pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound FC(F)(F)CN=C(N)NC1=CC=NC(OCCCCC#N)=N1 AHYXUTWTRVWFQW-UHFFFAOYSA-N 0.000 description 1
- URAWXUGGZTVTPZ-UHFFFAOYSA-N 1-[2-(4-cyanobutyl)triazol-4-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound FC(F)(F)CN=C(N)NC=1C=NN(CCCCC#N)N=1 URAWXUGGZTVTPZ-UHFFFAOYSA-N 0.000 description 1
- GNBZDYNHTBDDQY-UHFFFAOYSA-N 1-[2-(4-hydrazinyl-4-oxobutyl)sulfanylpyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound NNC(=O)CCCSC1=NC=CC(NC(N)=NCC(F)(F)F)=N1 GNBZDYNHTBDDQY-UHFFFAOYSA-N 0.000 description 1
- PTYUMGDMZNGXTD-HWKANZROSA-N 1-[2-[(e)-5-cyanopent-1-enyl]pyrimidin-4-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound FC(F)(F)CN=C(N)NC1=CC=NC(\C=C\CCCC#N)=N1 PTYUMGDMZNGXTD-HWKANZROSA-N 0.000 description 1
- MDOXEHHHJZXYSX-UHFFFAOYSA-N 1-[4-(3-hydrazinyl-3-oxopropyl)-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound NNC(=O)CCC1=CSC(NC(N)=NCC(F)(F)F)=N1 MDOXEHHHJZXYSX-UHFFFAOYSA-N 0.000 description 1
- YHCYQYWNJKVFFH-UHFFFAOYSA-N 1-[4-(4-cyanobutylsulfanyl)-1,3,5-triazin-2-yl]-2-(2,2,2-trifluoroethyl)guanidine Chemical compound FC(F)(F)CN=C(N)NC1=NC=NC(SCCCCC#N)=N1 YHCYQYWNJKVFFH-UHFFFAOYSA-N 0.000 description 1
- BZHOZGYXJLTYQG-UHFFFAOYSA-N 1-[4-(4-cyanobutylsulfanyl)-1,3,5-triazin-2-yl]-3-(2,2,2-trifluoroethyl)thiourea Chemical compound FC(F)(F)CNC(=S)NC1=NC=NC(SCCCCC#N)=N1 BZHOZGYXJLTYQG-UHFFFAOYSA-N 0.000 description 1
- XYDGIJOFGLNMSB-UHFFFAOYSA-N 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine;hydrochloride Chemical compound Cl.FC(F)(F)CN=C(N)NC1=NC(CCl)=CS1 XYDGIJOFGLNMSB-UHFFFAOYSA-N 0.000 description 1
- NIIPOMKMZZUVKA-UHFFFAOYSA-N 1-cyano-1-methylguanidine Chemical group N#CN(C)C(N)=N NIIPOMKMZZUVKA-UHFFFAOYSA-N 0.000 description 1
- HTSAVXAFEVUJQE-UHFFFAOYSA-N 1-isothiocyanato-2-methoxyethane Chemical compound COCCN=C=S HTSAVXAFEVUJQE-UHFFFAOYSA-N 0.000 description 1
- QAOBBBBDJSWHMU-WMBBNPMCSA-N 16,16-dimethylprostaglandin E2 Chemical compound CCCCC(C)(C)[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O QAOBBBBDJSWHMU-WMBBNPMCSA-N 0.000 description 1
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical compound NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- OMUMOOLRHXALLM-UHFFFAOYSA-N 2,2,2-trifluoroethylthiourea Chemical compound NC(=S)NCC(F)(F)F OMUMOOLRHXALLM-UHFFFAOYSA-N 0.000 description 1
- ZHVINKLXOAUNEU-UHFFFAOYSA-N 2,2,2-trifluoroethylthiourea;hydrate Chemical compound O.NC(=S)NCC(F)(F)F ZHVINKLXOAUNEU-UHFFFAOYSA-N 0.000 description 1
- 125000004781 2,2-dichloro-2-fluoroethyl group Chemical group [H]C([H])(*)C(F)(Cl)Cl 0.000 description 1
- 125000004778 2,2-difluoroethyl group Chemical group [H]C([H])(*)C([H])(F)F 0.000 description 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 1
- SWSAHTPTRVJWIM-UHFFFAOYSA-N 2-(2-chloro-2,2-difluoroethyl)-1-(2-methylsulfinylpyrimidin-4-yl)guanidine Chemical compound CS(=O)C1=NC=CC(NC(N)=NCC(F)(F)Cl)=N1 SWSAHTPTRVJWIM-UHFFFAOYSA-N 0.000 description 1
- OQOLYTBWYAUNJX-UHFFFAOYSA-O 2-(2-nitroanilino)ethylazanium Chemical compound [NH3+]CCNC1=CC=CC=C1[N+]([O-])=O OQOLYTBWYAUNJX-UHFFFAOYSA-O 0.000 description 1
- BISUJYGMIKVWSF-UHFFFAOYSA-N 2-(benzenesulfinylmethyl)pyrimidin-4-amine Chemical compound NC1=CC=NC(CS(=O)C=2C=CC=CC=2)=N1 BISUJYGMIKVWSF-UHFFFAOYSA-N 0.000 description 1
- JWAQENUKTAOJST-UHFFFAOYSA-N 2-(chloromethyl)pyrimidin-4-amine Chemical compound NC1=CC=NC(CCl)=N1 JWAQENUKTAOJST-UHFFFAOYSA-N 0.000 description 1
- KDDPNNXAZURUGP-UHFFFAOYSA-N 2-[2-(3,4-dichlorophenyl)-3-[2-(piperidin-3-ylamino)pyrimidin-4-yl]imidazol-4-yl]acetonitrile Chemical compound ClC=1C=C(C=CC=1Cl)C=1N(C(=CN=1)CC#N)C1=NC(=NC=C1)NC1CNCCC1 KDDPNNXAZURUGP-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- JTPXVCKCLBROOJ-UHFFFAOYSA-N 2-amino-6-chloropyrazine Chemical compound NC1=CN=CC(Cl)=N1 JTPXVCKCLBROOJ-UHFFFAOYSA-N 0.000 description 1
- UQDVRVNMIJAGRK-UHFFFAOYSA-N 2-amino-6-methyl-4-propyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-one Chemical compound C1=C(C)C(=O)N(CCC)C2=NC(N)=NN21 UQDVRVNMIJAGRK-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- 125000004779 2-chloro-2-fluoroethyl group Chemical group [H]C([H])(*)C([H])(F)Cl 0.000 description 1
- DYAQXLDQUHCRBU-UHFFFAOYSA-N 2-chloroacetamide;hydrochloride Chemical compound Cl.NC(=O)CCl DYAQXLDQUHCRBU-UHFFFAOYSA-N 0.000 description 1
- GUPOZVHRTJYZCX-UHFFFAOYSA-N 2-chloroethanimidamide;hydron;chloride Chemical compound [Cl-].NC(=[NH2+])CCl GUPOZVHRTJYZCX-UHFFFAOYSA-N 0.000 description 1
- JVOVWCQCFMWAAC-UHFFFAOYSA-N 2-cyano-1-methyl-1-nitrosoguanidine Chemical group O=NN(C)C(N)=NC#N JVOVWCQCFMWAAC-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 150000008327 2-guanidinothiazoles Chemical class 0.000 description 1
- GBHCABUWWQUMAJ-UHFFFAOYSA-N 2-hydrazinoethanol Chemical compound NNCCO GBHCABUWWQUMAJ-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- QTFCJAKFFGFURL-UHFFFAOYSA-N 2-phenylsulfanylethanimidamide Chemical compound NC(=N)CSC1=CC=CC=C1 QTFCJAKFFGFURL-UHFFFAOYSA-N 0.000 description 1
- CWDWDWQVZOWQLY-UHFFFAOYSA-N 2-phenylsulfanylethanimidamide;hydrochloride Chemical compound Cl.NC(=N)CSC1=CC=CC=C1 CWDWDWQVZOWQLY-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- KWPQTFXULUUCGD-UHFFFAOYSA-N 3,4,5,7,8,9,10,10a-octahydropyrido[1,2-a][1,4]diazepine Chemical compound C1CCN=CC2CCCCN21 KWPQTFXULUUCGD-UHFFFAOYSA-N 0.000 description 1
- UUKWKUSGGZNXGA-UHFFFAOYSA-N 3,5-dinitrobenzamide Chemical compound NC(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 UUKWKUSGGZNXGA-UHFFFAOYSA-N 0.000 description 1
- SIJGQCMRBQTUBC-UHFFFAOYSA-N 3-(2-chloroacetyl)benzonitrile Chemical compound ClCC(=O)C1=CC=CC(C#N)=C1 SIJGQCMRBQTUBC-UHFFFAOYSA-N 0.000 description 1
- AJHPGXZOIAYYDW-UHFFFAOYSA-N 3-(2-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=CC=C1C#N AJHPGXZOIAYYDW-UHFFFAOYSA-N 0.000 description 1
- WYMAQYLSRGWXFC-UHFFFAOYSA-N 3-(triazol-2-yl)cyclopentan-1-one Chemical compound C1C(=O)CCC1N1N=CC=N1 WYMAQYLSRGWXFC-UHFFFAOYSA-N 0.000 description 1
- UYACGRRBMAJKDA-UHFFFAOYSA-N 3-[(4-aminopyrimidin-2-yl)methylsulfanyl]propanenitrile Chemical compound NC1=CC=NC(CSCCC#N)=N1 UYACGRRBMAJKDA-UHFFFAOYSA-N 0.000 description 1
- YDSNARQYJYUGPL-UHFFFAOYSA-N 3-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]triazol-2-yl]benzamide Chemical compound N1=C(NC(N)=NCC(F)(F)F)C=NN1C1=CC=CC(C(N)=O)=C1 YDSNARQYJYUGPL-UHFFFAOYSA-N 0.000 description 1
- LJKOASXSBJOIKZ-UHFFFAOYSA-N 3-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]triazol-2-yl]benzoic acid Chemical compound N1=C(NC(N)=NCC(F)(F)F)C=NN1C1=CC=CC(C(O)=O)=C1 LJKOASXSBJOIKZ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- UMLFTCYAQPPZER-UHFFFAOYSA-N 4-(bromomethyl)benzonitrile Chemical compound BrCC1=CC=C(C#N)C=C1 UMLFTCYAQPPZER-UHFFFAOYSA-N 0.000 description 1
- OVILZFVTUVWJTO-UHFFFAOYSA-N 4-(chloromethyl)benzamide Chemical compound NC(=O)C1=CC=C(CCl)C=C1 OVILZFVTUVWJTO-UHFFFAOYSA-N 0.000 description 1
- FNNDBWFHEAPUTK-UHFFFAOYSA-N 4-[(3-aminopyrazol-1-yl)methyl]benzamide Chemical compound C1=CC(C(=O)N)=CC=C1CN1N=C(N)C=C1 FNNDBWFHEAPUTK-UHFFFAOYSA-N 0.000 description 1
- JCXLVBRKAIWUGF-UHFFFAOYSA-N 4-[(3-nitropyrazol-1-yl)methyl]benzamide Chemical compound C1=CC(C(=O)N)=CC=C1CN1N=C([N+]([O-])=O)C=C1 JCXLVBRKAIWUGF-UHFFFAOYSA-N 0.000 description 1
- OXIBCAZBZUGHFB-UHFFFAOYSA-N 4-[2-[3-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]ethoxymethyl]benzamide Chemical compound N1=C(NC(N)=NCC(F)(F)F)C=CN1CCOCC1=CC=C(C(N)=O)C=C1 OXIBCAZBZUGHFB-UHFFFAOYSA-N 0.000 description 1
- GWRGQOSDSAQBPT-UHFFFAOYSA-N 4-[6-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyridin-2-yl]sulfanylbutanoic acid Chemical compound FC(F)(F)CN=C(N)NC1=CC=CC(SCCCC(O)=O)=N1 GWRGQOSDSAQBPT-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- SEDUJCLGGDJTOS-UHFFFAOYSA-N 4-[[3-(2,2,2-trifluoroethylcarbamothioylamino)pyrazol-1-yl]methyl]benzamide Chemical compound C1=CC(C(=O)N)=CC=C1CN1N=C(NC(=S)NCC(F)(F)F)C=C1 SEDUJCLGGDJTOS-UHFFFAOYSA-N 0.000 description 1
- UQFFZCWSIXCJOM-UHFFFAOYSA-N 4-[[3-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrazol-1-yl]methyl]benzamide Chemical compound N1=C(NC(N)=NCC(F)(F)F)C=CN1CC1=CC=C(C(N)=O)C=C1 UQFFZCWSIXCJOM-UHFFFAOYSA-N 0.000 description 1
- KNAUNARBJNOXHV-UHFFFAOYSA-N 4-[[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]methylsulfanyl]butanamide Chemical compound NC(=O)CCCSCC1=NC=CC(NC(N)=NCC(F)(F)F)=N1 KNAUNARBJNOXHV-UHFFFAOYSA-N 0.000 description 1
- CQPGDDAKTTWVDD-UHFFFAOYSA-N 4-bromobutanenitrile Chemical compound BrCCCC#N CQPGDDAKTTWVDD-UHFFFAOYSA-N 0.000 description 1
- YXFWFUSVDJIVIV-UHFFFAOYSA-N 4-nitro-2h-triazole Chemical compound [O-][N+](=O)C=1C=NNN=1 YXFWFUSVDJIVIV-UHFFFAOYSA-N 0.000 description 1
- KEDMCNJBFNYBLK-UHFFFAOYSA-N 4-sulfanylbutanenitrile Chemical compound SCCCC#N KEDMCNJBFNYBLK-UHFFFAOYSA-N 0.000 description 1
- BAZFSIVELWHYKT-UHFFFAOYSA-N 5-(3-amino-1,2,4-triazol-1-yl)pentanenitrile Chemical compound NC=1N=CN(CCCCC#N)N=1 BAZFSIVELWHYKT-UHFFFAOYSA-N 0.000 description 1
- BOWSCRHVIBNYPZ-UHFFFAOYSA-N 5-(4-nitrotriazol-2-yl)pentanenitrile Chemical compound [O-][N+](=O)C=1C=NN(CCCCC#N)N=1 BOWSCRHVIBNYPZ-UHFFFAOYSA-N 0.000 description 1
- MWJPQYYTSHICRI-UHFFFAOYSA-N 5-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]pentanenitrile Chemical compound NC1=NC=NC(SCCCCC#N)=N1 MWJPQYYTSHICRI-UHFFFAOYSA-N 0.000 description 1
- KICHMFNKOKTGCG-UHFFFAOYSA-N 5-[3-(2,2,2-trifluoroethylcarbamothioylamino)pyrazol-1-yl]pentanamide Chemical compound NC(=O)CCCCN1C=CC(NC(=S)NCC(F)(F)F)=N1 KICHMFNKOKTGCG-UHFFFAOYSA-N 0.000 description 1
- AULKKZPFSINMAT-UHFFFAOYSA-N 5-[3-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,2,4-triazol-1-yl]pentanamide Chemical compound NC(=O)CCCCN1C=NC(NC(N)=NCC(F)(F)F)=N1 AULKKZPFSINMAT-UHFFFAOYSA-N 0.000 description 1
- PNDIBVPZILQBTN-UHFFFAOYSA-N 5-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypentanamide Chemical compound NC(=O)CCCCOC1=NC=CC(NC(N)=NCC(F)(F)F)=N1 PNDIBVPZILQBTN-UHFFFAOYSA-N 0.000 description 1
- OCEWCPVXZWDSSX-UHFFFAOYSA-N 5-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]pentanoic acid Chemical compound FC(F)(F)CN=C(N)NC1=CC=NC(CCCCC(O)=O)=N1 OCEWCPVXZWDSSX-UHFFFAOYSA-N 0.000 description 1
- IYORMIDQABQCIM-UHFFFAOYSA-N 5-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]triazol-2-yl]pentanamide Chemical compound NC(=O)CCCCN1N=CC(NC(N)=NCC(F)(F)F)=N1 IYORMIDQABQCIM-UHFFFAOYSA-N 0.000 description 1
- RQGNONZDCHUIIQ-UHFFFAOYSA-N 5-[6-[[n'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]pyridin-2-yl]pentanamide Chemical compound NC(=O)CCCCC1=CC=CC(NC(N)=NCC(F)(F)C(F)F)=N1 RQGNONZDCHUIIQ-UHFFFAOYSA-N 0.000 description 1
- MZRUFMBFIKGOAL-UHFFFAOYSA-N 5-nitro-1h-pyrazole Chemical compound [O-][N+](=O)C1=CC=NN1 MZRUFMBFIKGOAL-UHFFFAOYSA-N 0.000 description 1
- GCIZMJUHGHGRNW-UHFFFAOYSA-N 5-sulfanylpentanoic acid Chemical compound OC(=O)CCCCS GCIZMJUHGHGRNW-UHFFFAOYSA-N 0.000 description 1
- WTFUTSCZYYCBAY-SXBRIOAWSA-N 6-[(E)-C-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-N-hydroxycarbonimidoyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C/C(=N/O)/C1=CC2=C(NC(O2)=O)C=C1 WTFUTSCZYYCBAY-SXBRIOAWSA-N 0.000 description 1
- JDTUOGQVZXLKJB-UHFFFAOYSA-N 6-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]hexanamide Chemical compound NC(=O)CCCCCC1=NC=CC(NC(N)=NCC(F)(F)F)=N1 JDTUOGQVZXLKJB-UHFFFAOYSA-N 0.000 description 1
- LLQHSBBZNDXTIV-UHFFFAOYSA-N 6-[5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-4,5-dihydro-1,2-oxazol-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC1CC(=NO1)C1=CC2=C(NC(O2)=O)C=C1 LLQHSBBZNDXTIV-UHFFFAOYSA-N 0.000 description 1
- VBWWCYYBZFKCEX-UHFFFAOYSA-N 6-amino-1h-1,3,5-triazine-2-thione Chemical compound NC1=NC=NC(=S)N1 VBWWCYYBZFKCEX-UHFFFAOYSA-N 0.000 description 1
- PHOSWLARCIBBJZ-UHFFFAOYSA-N 6-bromohexanenitrile Chemical compound BrCCCCCC#N PHOSWLARCIBBJZ-UHFFFAOYSA-N 0.000 description 1
- BUCORZSTKDOEKQ-UHFFFAOYSA-N 7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine Chemical compound C=12C=C(Cl)C=CC2=NC(=NC)CN(O)C=1C1=CC=CC=C1 BUCORZSTKDOEKQ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- 108010039627 Aprotinin Proteins 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 229930003347 Atropine Natural products 0.000 description 1
- JEQPFDCFMRGUNV-BTJKTKAUSA-N C(\C=C/C(=O)O)(=O)O.C(CCCC)#N Chemical compound C(\C=C/C(=O)O)(=O)O.C(CCCC)#N JEQPFDCFMRGUNV-BTJKTKAUSA-N 0.000 description 1
- RJNFJWCYGSIVDT-BTJKTKAUSA-N C(\C=C/C(=O)O)(=O)O.C(CCCC)(=O)N Chemical compound C(\C=C/C(=O)O)(=O)O.C(CCCC)(=O)N RJNFJWCYGSIVDT-BTJKTKAUSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BQENDLAVTKRQMS-SBBGFIFASA-L Carbenoxolone sodium Chemical compound [Na+].[Na+].C([C@H]1C2=CC(=O)[C@H]34)[C@@](C)(C([O-])=O)CC[C@]1(C)CC[C@@]2(C)[C@]4(C)CC[C@@H]1[C@]3(C)CC[C@H](OC(=O)CCC([O-])=O)C1(C)C BQENDLAVTKRQMS-SBBGFIFASA-L 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 102000029816 Collagenase Human genes 0.000 description 1
- 108060005980 Collagenase Proteins 0.000 description 1
- 241001480079 Corymbia calophylla Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 208000012671 Gastrointestinal haemorrhages Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 239000007995 HEPES buffer Substances 0.000 description 1
- 102000000543 Histamine Receptors Human genes 0.000 description 1
- 108010002059 Histamine Receptors Proteins 0.000 description 1
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- DHUZAAUGHUHIDS-ONEGZZNKSA-N Isomyristicin Chemical compound COC1=CC(\C=C\C)=CC2=C1OCO2 DHUZAAUGHUHIDS-ONEGZZNKSA-N 0.000 description 1
- 239000007836 KH2PO4 Substances 0.000 description 1
- 239000012839 Krebs-Henseleit buffer Substances 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000006552 Liquidambar styraciflua Nutrition 0.000 description 1
- 229920001410 Microfiber Polymers 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 229940121948 Muscarinic receptor antagonist Drugs 0.000 description 1
- NEAPKZHDYMQZCB-UHFFFAOYSA-N N-[2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]ethyl]-2-oxo-3H-1,3-benzoxazole-6-carboxamide Chemical compound C1CN(CCN1CCNC(=O)C2=CC3=C(C=C2)NC(=O)O3)C4=CN=C(N=C4)NC5CC6=CC=CC=C6C5 NEAPKZHDYMQZCB-UHFFFAOYSA-N 0.000 description 1
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- DNEQKULSQPHHNB-BTJKTKAUSA-N OC(=O)\C=C/C(O)=O.NCCNC(=O)CCCSC1=NC=CC(NC(N)=NCC(F)(F)F)=N1 Chemical compound OC(=O)\C=C/C(O)=O.NCCNC(=O)CCCSC1=NC=CC(NC(N)=NCC(F)(F)F)=N1 DNEQKULSQPHHNB-BTJKTKAUSA-N 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- 229940099471 Phosphodiesterase inhibitor Drugs 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 206010042220 Stress ulcer Diseases 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- FHKPLLOSJHHKNU-INIZCTEOSA-N [(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]-(oxan-4-yl)methanone Chemical compound C(C)N1N=CC(=C1C)C=1N(C2=NC=NC(=C2N=1)O[C@@H]1CN(CC1)C(=O)C1CCOCC1)C FHKPLLOSJHHKNU-INIZCTEOSA-N 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 229940069428 antacid Drugs 0.000 description 1
- 239000003159 antacid agent Substances 0.000 description 1
- 210000002159 anterior chamber Anatomy 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000002467 anti-pepsin effect Effects 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 230000000949 anxiolytic effect Effects 0.000 description 1
- 229940005530 anxiolytics Drugs 0.000 description 1
- 229960004405 aprotinin Drugs 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 230000001746 atrial effect Effects 0.000 description 1
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 1
- 229960000396 atropine Drugs 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 238000010009 beating Methods 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- NZUPCNDJBJXXRF-UHFFFAOYSA-O bethanechol Chemical compound C[N+](C)(C)CC(C)OC(N)=O NZUPCNDJBJXXRF-UHFFFAOYSA-O 0.000 description 1
- 229960000910 bethanechol Drugs 0.000 description 1
- 150000001621 bismuth Chemical class 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- JCKOIDCICQCFGH-BTJKTKAUSA-N butanamide;(z)-but-2-enedioic acid Chemical compound CCCC(N)=O.OC(=O)\C=C/C(O)=O JCKOIDCICQCFGH-BTJKTKAUSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- 229960000530 carbenoxolone Drugs 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 231100000315 carcinogenic Toxicity 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 229960004782 chlordiazepoxide Drugs 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- 229960002424 collagenase Drugs 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- ZWOQVPFVARFZSF-UHFFFAOYSA-N cyclopentyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC1CCCC1 ZWOQVPFVARFZSF-UHFFFAOYSA-N 0.000 description 1
- 125000004979 cyclopentylene group Chemical group 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 229960003529 diazepam Drugs 0.000 description 1
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- OLHQOJYVQUNWPL-UHFFFAOYSA-N dimaprit Chemical compound CN(C)CCCSC(N)=N OLHQOJYVQUNWPL-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 208000000718 duodenal ulcer Diseases 0.000 description 1
- 210000001198 duodenum Anatomy 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- XBPOBCXHALHJFP-UHFFFAOYSA-N ethyl 4-bromobutanoate Chemical compound CCOC(=O)CCCBr XBPOBCXHALHJFP-UHFFFAOYSA-N 0.000 description 1
- OGEBBQYBNGKJIH-UHFFFAOYSA-N ethyl 6-cyanohexanimidate Chemical compound CCOC(=N)CCCCCC#N OGEBBQYBNGKJIH-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 229940043075 fluocinolone Drugs 0.000 description 1
- FEBLZLNTKCEFIT-VSXGLTOVSA-N fluocinolone acetonide Chemical compound C1([C@@H](F)C2)=CC(=O)C=C[C@]1(C)[C@]1(F)[C@@H]2[C@@H]2C[C@H]3OC(C)(C)O[C@@]3(C(=O)CO)[C@@]2(C)C[C@@H]1O FEBLZLNTKCEFIT-VSXGLTOVSA-N 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 208000030304 gastrointestinal bleeding Diseases 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical group 0.000 description 1
- RTKJOHNRJGFJQF-UHFFFAOYSA-N hex-5-enamide Chemical compound NC(=O)CCCC=C RTKJOHNRJGFJQF-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229960001680 ibuprofen Drugs 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- ZPNFWUPYTFPOJU-LPYSRVMUSA-N iniprol Chemical compound C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@H]2CSSC[C@H]3C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(N[C@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC=4C=CC=CC=4)C(=O)N[C@@H](CC=4C=CC(O)=CC=4)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC=4C=CC=CC=4)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC2=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](CC=2C=CC=CC=2)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]2N(CCC2)C(=O)[C@@H](N)CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N2[C@@H](CCC2)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N3)C(=O)NCC(=O)NCC(=O)N[C@@H](C)C(O)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@H](C(=O)N1)C(C)C)[C@@H](C)O)[C@@H](C)CC)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 ZPNFWUPYTFPOJU-LPYSRVMUSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- PGLTVOMIXTUURA-UHFFFAOYSA-N iodoacetamide Chemical compound NC(=O)CI PGLTVOMIXTUURA-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 210000004731 jugular vein Anatomy 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- ADKOXSOCTOWDOP-UHFFFAOYSA-L magnesium;aluminum;dihydroxide;trihydrate Chemical compound O.O.O.[OH-].[OH-].[Mg+2].[Al] ADKOXSOCTOWDOP-UHFFFAOYSA-L 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- FFQSAYKBXUMYIR-UHFFFAOYSA-N methyl 3-[2-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]benzoate;hydrochloride Chemical compound Cl.COC(=O)C1=CC=CC(C=2N=C(NC(N)=NCC(F)(F)F)SC=2)=C1 FFQSAYKBXUMYIR-UHFFFAOYSA-N 0.000 description 1
- WJISHIQGSRSDAW-UHFFFAOYSA-N methyl 3-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]triazol-2-yl]benzoate Chemical compound COC(=O)C1=CC=CC(N2N=C(NC(N)=NCC(F)(F)F)C=N2)=C1 WJISHIQGSRSDAW-UHFFFAOYSA-N 0.000 description 1
- LDTLDBDUBGAEDT-UHFFFAOYSA-N methyl 3-sulfanylpropanoate Chemical compound COC(=O)CCS LDTLDBDUBGAEDT-UHFFFAOYSA-N 0.000 description 1
- KCLLUAVKDGGAGV-UHFFFAOYSA-N methyl 6-chloro-5-oxohexanoate Chemical compound COC(=O)CCCC(=O)CCl KCLLUAVKDGGAGV-UHFFFAOYSA-N 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 239000003658 microfiber Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 210000004877 mucosa Anatomy 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- NUDAQTBOLBNYMM-UHFFFAOYSA-N n-(2-hydroxyethyl)-4-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylbutanamide Chemical compound FC(F)(F)CN=C(N)NC1=CC=NC(SCCCC(=O)NCCO)=N1 NUDAQTBOLBNYMM-UHFFFAOYSA-N 0.000 description 1
- YRWNBJPZFVDNNY-UHFFFAOYSA-N n-methyl-3-[2-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]benzamide Chemical compound CNC(=O)C1=CC=CC(C=2N=C(NC(N)=NCC(F)(F)F)SC=2)=C1 YRWNBJPZFVDNNY-UHFFFAOYSA-N 0.000 description 1
- QGNJGYJVWCAINQ-UHFFFAOYSA-N n-methyl-4-[2-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]butanamide Chemical compound CNC(=O)CCCC1=CSC(NC(N)=NCC(F)(F)F)=N1 QGNJGYJVWCAINQ-UHFFFAOYSA-N 0.000 description 1
- YSHZWAMGXKOALB-UHFFFAOYSA-N n-methyl-5-[2-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]pentanamide Chemical compound CNC(=O)CCCCC1=CSC(NC(N)=NCC(F)(F)F)=N1 YSHZWAMGXKOALB-UHFFFAOYSA-N 0.000 description 1
- DGPLPCOEPRHNDX-UHFFFAOYSA-N n-methyl-5-[4-[[n'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]sulfanylpentanamide Chemical compound CNC(=O)CCCCSC1=NC=CC(NC(N)=NCC(F)(F)F)=N1 DGPLPCOEPRHNDX-UHFFFAOYSA-N 0.000 description 1
- 229960002009 naproxen Drugs 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 238000011587 new zealand white rabbit Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000002829 nitrogen Chemical group 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical class O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 210000001711 oxyntic cell Anatomy 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 229950000964 pepstatin Drugs 0.000 description 1
- 108010091212 pepstatin Proteins 0.000 description 1
- FAXGPCHRFPCXOO-LXTPJMTPSA-N pepstatin A Chemical compound OC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)CC(C)C FAXGPCHRFPCXOO-LXTPJMTPSA-N 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- 229960002695 phenobarbital Drugs 0.000 description 1
- 239000002571 phosphodiesterase inhibitor Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- GNSKLFRGEWLPPA-UHFFFAOYSA-M potassium dihydrogen phosphate Chemical compound [K+].OP(O)([O-])=O GNSKLFRGEWLPPA-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- ZJLMKPKYJBQJNH-UHFFFAOYSA-N propane-1,3-dithiol Chemical compound SCCCS ZJLMKPKYJBQJNH-UHFFFAOYSA-N 0.000 description 1
- 229960005439 propantheline bromide Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 210000001187 pylorus Anatomy 0.000 description 1
- LETVJWLLIMJADE-UHFFFAOYSA-N pyridazin-3-amine Chemical compound NC1=CC=CN=N1 LETVJWLLIMJADE-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- VMXUWOKSQNHOCA-LCYFTJDESA-N ranitidine Chemical compound [O-][N+](=O)/C=C(/NC)NCCSCC1=CC=C(CN(C)C)O1 VMXUWOKSQNHOCA-LCYFTJDESA-N 0.000 description 1
- 229960000620 ranitidine Drugs 0.000 description 1
- 238000005057 refrigeration Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000002294 steroidal antiinflammatory agent Substances 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- GFNANZIMVAIWHM-OBYCQNJPSA-N triamcinolone Chemical compound O=C1C=C[C@]2(C)[C@@]3(F)[C@@H](O)C[C@](C)([C@@]([C@H](O)C4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 GFNANZIMVAIWHM-OBYCQNJPSA-N 0.000 description 1
- 229960005294 triamcinolone Drugs 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000003357 wound healing promoting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/76—Nitrogen atoms to which a second hetero atom is attached
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/38—Nitrogen atoms
- C07D231/40—Acylated on said nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/47—One nitrogen atom and one oxygen or sulfur atom, e.g. cytosine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/20—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
- C07D249/06—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles with aryl radicals directly attached to ring atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/14—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom
- C07D251/16—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to only one ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/48—Acylated amino or imino radicals by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof, e.g. carbonylguanidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB8107273 | 1981-03-09 | ||
GB8128179 | 1981-09-17 |
Publications (1)
Publication Number | Publication Date |
---|---|
NO820726L true NO820726L (no) | 1982-09-10 |
Family
ID=26278698
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO820726A NO820726L (no) | 1981-03-09 | 1982-03-08 | Fremgangsmaate for fremstilling av terapeutisk aktive guanidin-derivater. |
Country Status (19)
Country | Link |
---|---|
US (2) | US4447441A (de) |
EP (1) | EP0060094B1 (de) |
AU (3) | AU560043B2 (de) |
CA (1) | CA1233818A (de) |
DD (1) | DD202551A5 (de) |
DE (1) | DE3268615D1 (de) |
DK (1) | DK101882A (de) |
ES (5) | ES510258A0 (de) |
FI (1) | FI820795L (de) |
GR (1) | GR74750B (de) |
IE (1) | IE52719B1 (de) |
IL (1) | IL65216A (de) |
IN (1) | IN160139B (de) |
NO (1) | NO820726L (de) |
NZ (1) | NZ199941A (de) |
PL (1) | PL138527B1 (de) |
PT (1) | PT74548B (de) |
YU (1) | YU49482A (de) |
ZW (1) | ZW4182A1 (de) |
Families Citing this family (11)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CA1233818A (en) * | 1981-03-09 | 1988-03-08 | David J. Gilman | Guanidine derivatives as histamine h-2 receptor antagonists |
EP0103390A3 (de) * | 1982-08-13 | 1986-02-26 | Imperial Chemical Industries Plc | Guanidin enthaltende Ester mit Histamin-H-2-Empfänger blockierender Wirkung |
GB8320820D0 (en) * | 1982-09-03 | 1983-09-01 | Ici Plc | Polymorphs |
GB8316779D0 (en) * | 1982-09-07 | 1983-07-27 | Ici Plc | Process |
DE3334455A1 (de) * | 1983-03-04 | 1984-09-06 | Bayer Ag, 5090 Leverkusen | Guanidin - derivate |
GB8401751D0 (en) * | 1984-01-24 | 1984-02-29 | Ici Plc | Guanidine derivatives |
DE3532880A1 (de) * | 1985-09-14 | 1987-03-26 | Basf Ag | 1,4-disubstituierte pyrazolderivate |
GB2205210B (en) * | 1987-05-27 | 1991-04-24 | Mitsubishi Electric Corp | Amplifier circuit including single capacitor for dc differential-input balance |
GB9125970D0 (en) * | 1991-12-06 | 1992-02-05 | Fujisawa Pharmaceutical Co | New compounds |
AR091516A1 (es) | 2012-06-22 | 2015-02-11 | Actelion Pharmaceuticals Ltd | Derivados de 1-[m-carboxamido(hetero)aril-metil]-heterociclil-carboxamida |
WO2022034121A1 (en) | 2020-08-11 | 2022-02-17 | Université De Strasbourg | H2 blockers targeting liver macrophages for the prevention and treatment of liver disease and cancer |
Family Cites Families (14)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4117131A (en) * | 1976-12-07 | 1978-09-26 | Warner-Lambert Company | Method of inhibiting gastric acid secretions with 2-(4-pyrimidinyl)thioacetamides |
US4248784A (en) * | 1977-02-25 | 1981-02-03 | Sterling Drug Inc. | Pyrrole-3-acetamides |
NZ186965A (en) * | 1977-04-20 | 1980-02-21 | Ici Ltd | Guanidino derivatives and pharmaceutical compositions |
US4165378A (en) * | 1977-04-20 | 1979-08-21 | Ici Americas Inc. | Guanidine derivatives of imidazoles and thiazoles |
JPS5444660A (en) * | 1977-08-29 | 1979-04-09 | Yamanouchi Pharmaceut Co Ltd | Heterocyclic compound and its preparation |
JPS54132566A (en) * | 1978-01-18 | 1979-10-15 | Ici Ltd | Guanidine derivative*its manufacture and secretion controlling pharmaceutical composition containing it |
EP0006679B1 (de) * | 1978-05-24 | 1982-07-21 | Imperial Chemical Industries Plc | Anti-Sekretion Thiadiazol-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen |
US4309435A (en) * | 1978-10-16 | 1982-01-05 | Imperial Chemical Industries Ltd. | Antisecretory guanidine derivatives and pharmaceutical compositions containing them |
PH16099A (en) * | 1979-03-06 | 1983-06-24 | Yamanouchi Pharma Co Ltd | Guanidinothiazole compounds,process for preparing them and medical composition containing them |
US4242351A (en) * | 1979-05-07 | 1980-12-30 | Imperial Chemical Industries Limited | Antisecretory oxadiazoles and pharmaceutical compositions containing them |
GR71929B (de) * | 1979-11-13 | 1983-08-19 | Ici Ltd | |
CA1233818A (en) * | 1981-03-09 | 1988-03-08 | David J. Gilman | Guanidine derivatives as histamine h-2 receptor antagonists |
IN158869B (de) * | 1981-03-18 | 1987-02-07 | Ici Plc | |
US4451463A (en) * | 1981-03-24 | 1984-05-29 | Imperial Chemical Industries Plc | Alcohol derivatives |
-
1982
- 1982-02-23 CA CA000396836A patent/CA1233818A/en not_active Expired
- 1982-03-01 US US06/353,502 patent/US4447441A/en not_active Expired - Fee Related
- 1982-03-04 EP EP82301106A patent/EP0060094B1/de not_active Expired
- 1982-03-04 DE DE8282301106T patent/DE3268615D1/de not_active Expired
- 1982-03-05 AU AU81172/82A patent/AU560043B2/en not_active Ceased
- 1982-03-05 PL PL1982235333A patent/PL138527B1/pl unknown
- 1982-03-08 YU YU00494/82A patent/YU49482A/xx unknown
- 1982-03-08 NO NO820726A patent/NO820726L/no unknown
- 1982-03-08 FI FI820795A patent/FI820795L/fi not_active Application Discontinuation
- 1982-03-08 DD DD82238277A patent/DD202551A5/de unknown
- 1982-03-08 IN IN193/DEL/82A patent/IN160139B/en unknown
- 1982-03-08 NZ NZ199941A patent/NZ199941A/en unknown
- 1982-03-08 ZW ZW41/82A patent/ZW4182A1/xx unknown
- 1982-03-08 PT PT74548A patent/PT74548B/pt unknown
- 1982-03-08 GR GR67522A patent/GR74750B/el unknown
- 1982-03-08 IE IE518/82A patent/IE52719B1/en unknown
- 1982-03-09 ES ES510258A patent/ES510258A0/es active Granted
- 1982-03-09 DK DK101882A patent/DK101882A/da not_active Application Discontinuation
- 1982-03-10 IL IL65216A patent/IL65216A/xx unknown
- 1982-12-30 ES ES518706A patent/ES518706A0/es active Granted
- 1982-12-30 ES ES518704A patent/ES8402561A1/es not_active Expired
- 1982-12-30 ES ES518705A patent/ES518705A0/es active Granted
- 1982-12-30 ES ES518707A patent/ES8402580A1/es not_active Expired
-
1984
- 1984-03-14 US US06/589,345 patent/US4665073A/en not_active Expired - Fee Related
-
1987
- 1987-02-17 AU AU68893/87A patent/AU582492B2/en not_active Ceased
- 1987-02-17 AU AU68894/87A patent/AU582948B2/en not_active Ceased
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NO803414L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive guanidinderivater | |
EP0059597B1 (de) | Guanidin substituierte heterocyclische Derivate mit histamin-H-2-antagonistischer Wirkung | |
US4493840A (en) | Antisecretory guanidine derivatives, and pharmaceutical compositions containing them | |
NO791710L (no) | Analogifremgangsmaate for fremstilling av fysiologisk aktive tiadiazolderivater | |
NO820726L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive guanidin-derivater. | |
US4795755A (en) | Heterocyclic derivatives | |
US4748165A (en) | Amidine derivatives | |
EP0061318B1 (de) | Guanidinoheterocyclische Derivate als Histamin H-2 antagonisten | |
US4696933A (en) | Guanidine compounds useful as histamine H2-antagonists | |
NO820889L (no) | Fremgangsmaate for fremstilling av fysiologisk aktive bicykliske derivater. | |
CS241503B2 (en) | Method of guanidine derivatives production | |
US4683228A (en) | Guanidinopyrazolylamides, guanidimoimidazolylamides, compositions containing them, and method of using them to inhibit gastric acid secretion | |
JPH0219111B2 (de) | ||
CS241535B2 (cs) | Způsob výroby derivátů guanidinu | |
CA1249822A (en) | Guanidine derivatives as histamine h-2 receptor antagonists | |
CA1220477A (en) | Amide derivatives as histamine h-2 receptor antagonists | |
CS240952B2 (cs) | Způsob výroby heterooyklických derivátů guanidinu |