NO813153L - Nye karboksyalkylpeptider og tioetere og etere av peptider med antihypertensiv aktivitet - Google Patents
Nye karboksyalkylpeptider og tioetere og etere av peptider med antihypertensiv aktivitetInfo
- Publication number
- NO813153L NO813153L NO813153A NO813153A NO813153L NO 813153 L NO813153 L NO 813153L NO 813153 A NO813153 A NO 813153A NO 813153 A NO813153 A NO 813153A NO 813153 L NO813153 L NO 813153L
- Authority
- NO
- Norway
- Prior art keywords
- carbon atoms
- acid
- groups
- group
- methyl
- Prior art date
Links
- 108090000765 processed proteins & peptides Proteins 0.000 title description 9
- 102000004196 processed proteins & peptides Human genes 0.000 title description 7
- 150000002170 ethers Chemical class 0.000 title description 4
- 230000003276 anti-hypertensive effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 166
- -1 -SH Chemical group 0.000 claims description 153
- 125000004432 carbon atom Chemical group C* 0.000 claims description 92
- 238000000034 method Methods 0.000 claims description 46
- 125000000217 alkyl group Chemical group 0.000 claims description 38
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 25
- 125000002947 alkylene group Chemical group 0.000 claims description 24
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 22
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 20
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 16
- 229910052799 carbon Inorganic materials 0.000 claims description 15
- 229910052757 nitrogen Inorganic materials 0.000 claims description 14
- 125000004185 ester group Chemical group 0.000 claims description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 10
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 10
- 125000000623 heterocyclic group Chemical group 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 8
- 150000003568 thioethers Chemical class 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 150000001721 carbon Chemical group 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical group 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 6
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 6
- 125000005130 alkyl carbonyl thio group Chemical group 0.000 claims description 6
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 5
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 231100000252 nontoxic Toxicity 0.000 claims description 5
- 230000003000 nontoxic effect Effects 0.000 claims description 5
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 4
- 241000124008 Mammalia Species 0.000 claims description 4
- 125000006294 amino alkylene group Chemical group 0.000 claims description 4
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 125000004982 dihaloalkyl group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 4
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 claims description 4
- 125000002883 imidazolyl group Chemical group 0.000 claims description 4
- 125000005358 mercaptoalkyl group Chemical group 0.000 claims description 4
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- 150000003973 alkyl amines Chemical class 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000004970 halomethyl group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 3
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 125000006307 alkoxy benzyl group Chemical group 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000005334 azaindolyl group Chemical group N1N=C(C2=CC=CC=C12)* 0.000 claims description 2
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims description 2
- 238000005100 correlation spectroscopy Methods 0.000 claims description 2
- 125000004802 cyanophenyl group Chemical group 0.000 claims description 2
- 125000004981 cycloalkylmethyl group Chemical group 0.000 claims description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000001041 indolyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 claims description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 2
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims description 2
- 125000002757 morpholinyl group Chemical group 0.000 claims description 2
- 125000004998 naphthylethyl group Chemical group C1(=CC=CC2=CC=CC=C12)CC* 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000004193 piperazinyl group Chemical group 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 229960005235 piperonyl butoxide Drugs 0.000 claims description 2
- 125000004591 piperonyl group Chemical group C(C1=CC=2OCOC2C=C1)* 0.000 claims description 2
- 125000001500 prolyl group Chemical group [H]N1C([H])(C(=O)[*])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 claims description 2
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 2
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 2
- 125000001984 thiazolidinyl group Chemical group 0.000 claims description 2
- 125000000335 thiazolyl group Chemical group 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- 125000000686 lactone group Chemical group 0.000 claims 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims 1
- 125000006371 dihalo methyl group Chemical group 0.000 claims 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims 1
- 239000000047 product Substances 0.000 description 169
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 127
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 117
- 238000003786 synthesis reaction Methods 0.000 description 107
- 230000015572 biosynthetic process Effects 0.000 description 106
- 239000000243 solution Substances 0.000 description 92
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 75
- 239000000203 mixture Substances 0.000 description 67
- 239000002904 solvent Substances 0.000 description 61
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 51
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 50
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 50
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 46
- 239000002253 acid Substances 0.000 description 45
- 235000019439 ethyl acetate Nutrition 0.000 description 40
- 235000019441 ethanol Nutrition 0.000 description 39
- 229960003767 alanine Drugs 0.000 description 37
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- 230000002829 reductive effect Effects 0.000 description 32
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 31
- 229960002429 proline Drugs 0.000 description 31
- 239000011541 reaction mixture Substances 0.000 description 29
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 25
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 25
- 238000006243 chemical reaction Methods 0.000 description 25
- 239000002808 molecular sieve Substances 0.000 description 24
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 24
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 23
- 125000004494 ethyl ester group Chemical group 0.000 description 22
- 239000012074 organic phase Substances 0.000 description 22
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 21
- 239000003112 inhibitor Substances 0.000 description 21
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 description 20
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 description 20
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 17
- 238000003756 stirring Methods 0.000 description 17
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 17
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 15
- 150000002148 esters Chemical class 0.000 description 15
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 14
- 235000004279 alanine Nutrition 0.000 description 14
- 102000004190 Enzymes Human genes 0.000 description 13
- 108090000790 Enzymes Proteins 0.000 description 13
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 13
- 238000004587 chromatography analysis Methods 0.000 description 13
- 230000000694 effects Effects 0.000 description 13
- 239000000758 substrate Substances 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- 102400000344 Angiotensin-1 Human genes 0.000 description 12
- 101800000734 Angiotensin-1 Proteins 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 12
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 12
- 229960000830 captopril Drugs 0.000 description 12
- 239000000543 intermediate Substances 0.000 description 12
- 125000006239 protecting group Chemical group 0.000 description 12
- 238000007127 saponification reaction Methods 0.000 description 11
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 10
- 102400000345 Angiotensin-2 Human genes 0.000 description 10
- 101800000733 Angiotensin-2 Proteins 0.000 description 10
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 10
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 10
- 229940024606 amino acid Drugs 0.000 description 10
- 235000001014 amino acid Nutrition 0.000 description 10
- 229950006323 angiotensin ii Drugs 0.000 description 10
- 206010020772 Hypertension Diseases 0.000 description 9
- CZGUSIXMZVURDU-JZXHSEFVSA-N Ile(5)-angiotensin II Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C([O-])=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=[NH2+])NC(=O)[C@@H]([NH3+])CC([O-])=O)C(C)C)C1=CC=C(O)C=C1 CZGUSIXMZVURDU-JZXHSEFVSA-N 0.000 description 9
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 9
- 150000001413 amino acids Chemical class 0.000 description 9
- 230000036772 blood pressure Effects 0.000 description 9
- 238000010168 coupling process Methods 0.000 description 9
- 238000001704 evaporation Methods 0.000 description 9
- 230000008020 evaporation Effects 0.000 description 9
- 229940107700 pyruvic acid Drugs 0.000 description 9
- 239000000376 reactant Substances 0.000 description 9
- 229930182821 L-proline Natural products 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 150000004702 methyl esters Chemical class 0.000 description 8
- 235000017557 sodium bicarbonate Nutrition 0.000 description 8
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 8
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 7
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 7
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 7
- 239000004472 Lysine Substances 0.000 description 7
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 7
- 230000009471 action Effects 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 229960005190 phenylalanine Drugs 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 238000004809 thin layer chromatography Methods 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 210000004369 blood Anatomy 0.000 description 6
- 239000008280 blood Substances 0.000 description 6
- 239000000872 buffer Substances 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 150000002596 lactones Chemical group 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 5
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 229960002989 glutamic acid Drugs 0.000 description 5
- 238000000338 in vitro Methods 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- XJJBXZIKXFOMLP-ZETCQYMHSA-N tert-butyl (2s)-pyrrolidine-2-carboxylate Chemical compound CC(C)(C)OC(=O)[C@@H]1CCCN1 XJJBXZIKXFOMLP-ZETCQYMHSA-N 0.000 description 5
- OMGHIGVFLOPEHJ-UHFFFAOYSA-N 2,5-dihydro-1h-pyrrol-1-ium-2-carboxylate Chemical compound OC(=O)C1NCC=C1 OMGHIGVFLOPEHJ-UHFFFAOYSA-N 0.000 description 4
- PMNLUUOXGOOLSP-UHFFFAOYSA-N 2-mercaptopropanoic acid Chemical compound CC(S)C(O)=O PMNLUUOXGOOLSP-UHFFFAOYSA-N 0.000 description 4
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 4
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical compound OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 description 4
- 239000005541 ACE inhibitor Substances 0.000 description 4
- 102000015427 Angiotensins Human genes 0.000 description 4
- 108010064733 Angiotensins Proteins 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 238000004108 freeze drying Methods 0.000 description 4
- 235000013922 glutamic acid Nutrition 0.000 description 4
- 239000004220 glutamic acid Substances 0.000 description 4
- BTNMPGBKDVTSJY-UHFFFAOYSA-N keto-phenylpyruvic acid Chemical compound OC(=O)C(=O)CC1=CC=CC=C1 BTNMPGBKDVTSJY-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 4
- 235000008729 phenylalanine Nutrition 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 125000001308 pyruvoyl group Chemical group O=C([*])C(=O)C([H])([H])[H] 0.000 description 4
- 229960001153 serine Drugs 0.000 description 4
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 3
- IADUEWIQBXOCDZ-UHFFFAOYSA-N (2S)-azetidine-2-carboxylic acid Natural products OC(=O)C1CCN1 IADUEWIQBXOCDZ-UHFFFAOYSA-N 0.000 description 3
- PPKAIMDMNWBOKN-UHFFFAOYSA-N 2-Oxo-4-phenylbutyric acid Chemical compound OC(=O)C(=O)CCC1=CC=CC=C1 PPKAIMDMNWBOKN-UHFFFAOYSA-N 0.000 description 3
- 239000001903 2-oxo-3-phenylpropanoic acid Substances 0.000 description 3
- KPGXRSRHYNQIFN-UHFFFAOYSA-N 2-oxoglutaric acid Chemical compound OC(=O)CCC(=O)C(O)=O KPGXRSRHYNQIFN-UHFFFAOYSA-N 0.000 description 3
- HGIOOMCLOWLFTJ-UHFFFAOYSA-N 3-phenyl-2-sulfanylpropanoic acid Chemical compound OC(=O)C(S)CC1=CC=CC=C1 HGIOOMCLOWLFTJ-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WPWUFUBLGADILS-WDSKDSINSA-N Ala-Pro Chemical compound C[C@H](N)C(=O)N1CCC[C@H]1C(O)=O WPWUFUBLGADILS-WDSKDSINSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 239000004475 Arginine Substances 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 101800004538 Bradykinin Proteins 0.000 description 3
- 239000004471 Glycine Substances 0.000 description 3
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 108090000783 Renin Proteins 0.000 description 3
- 229920005654 Sephadex Polymers 0.000 description 3
- 239000012507 Sephadex™ Substances 0.000 description 3
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 3
- 235000008206 alpha-amino acids Nutrition 0.000 description 3
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 3
- 230000004872 arterial blood pressure Effects 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000006698 hydrazinolysis reaction Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- XELZGAJCZANUQH-UHFFFAOYSA-N methyl 1-acetylthieno[3,2-c]pyrazole-5-carboxylate Chemical compound CC(=O)N1N=CC2=C1C=C(C(=O)OC)S2 XELZGAJCZANUQH-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 238000004810 partition chromatography Methods 0.000 description 3
- 210000002381 plasma Anatomy 0.000 description 3
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 3
- DZLNHFMRPBPULJ-UHFFFAOYSA-N thioproline Chemical compound OC(=O)C1CSCN1 DZLNHFMRPBPULJ-UHFFFAOYSA-N 0.000 description 3
- UXWOYJLLMYKTQJ-VIFPVBQESA-N (2s)-2-amino-4-(cyclopentylmethylsulfanyl)butanoic acid Chemical compound OC(=O)[C@@H](N)CCSCC1CCCC1 UXWOYJLLMYKTQJ-VIFPVBQESA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- WFIYPADYPQQLNN-UHFFFAOYSA-N 2-[2-(4-bromopyrazol-1-yl)ethyl]isoindole-1,3-dione Chemical compound C1=C(Br)C=NN1CCN1C(=O)C2=CC=CC=C2C1=O WFIYPADYPQQLNN-UHFFFAOYSA-N 0.000 description 2
- LTLQSMNFQOAELQ-UHFFFAOYSA-N 2-amino-1,3-dihydroindene-2,5-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=C2CC(N)(C(O)=O)CC2=C1 LTLQSMNFQOAELQ-UHFFFAOYSA-N 0.000 description 2
- OQFSQFPPLPISGP-UHFFFAOYSA-N 2-aminoethane-1,1,2-tricarboxylic acid Chemical compound OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 2
- YAQLSKVCTLCIIE-UHFFFAOYSA-N 2-bromobutyric acid Chemical compound CCC(Br)C(O)=O YAQLSKVCTLCIIE-UHFFFAOYSA-N 0.000 description 2
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 description 2
- RSUOYCBRWUTZAO-UHFFFAOYSA-N 2-oxo-3-phenoxypropanoic acid Chemical compound OC(=O)C(=O)COC1=CC=CC=C1 RSUOYCBRWUTZAO-UHFFFAOYSA-N 0.000 description 2
- MLHLDFLQSMZQNK-UHFFFAOYSA-N 2-oxo-3-phenylpropanethioic s-acid Chemical compound SC(=O)C(=O)CC1=CC=CC=C1 MLHLDFLQSMZQNK-UHFFFAOYSA-N 0.000 description 2
- QDJVGSZTQJRNKQ-UHFFFAOYSA-N 2-oxo-4-(4-phenoxyphenyl)butanoic acid Chemical compound C1=CC(CCC(=O)C(=O)O)=CC=C1OC1=CC=CC=C1 QDJVGSZTQJRNKQ-UHFFFAOYSA-N 0.000 description 2
- TYEYBOSBBBHJIV-UHFFFAOYSA-N 2-oxobutanoic acid Chemical compound CCC(=O)C(O)=O TYEYBOSBBBHJIV-UHFFFAOYSA-N 0.000 description 2
- JTNCEQNHURODLX-UHFFFAOYSA-N 2-phenylethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1 JTNCEQNHURODLX-UHFFFAOYSA-N 0.000 description 2
- YMOQJIWHKXKWDN-UHFFFAOYSA-N 3-(4-cyanophenyl)-2-oxopropanoic acid Chemical compound OC(=O)C(=O)CC1=CC=C(C#N)C=C1 YMOQJIWHKXKWDN-UHFFFAOYSA-N 0.000 description 2
- RSTKLPZEZYGQPY-UHFFFAOYSA-N 3-(indol-3-yl)pyruvic acid Chemical compound C1=CC=C2C(CC(=O)C(=O)O)=CNC2=C1 RSTKLPZEZYGQPY-UHFFFAOYSA-N 0.000 description 2
- BAQRRRYYSFQKIF-UHFFFAOYSA-N 3-methyl-2-oxobutanoyl chloride Chemical compound CC(C)C(=O)C(Cl)=O BAQRRRYYSFQKIF-UHFFFAOYSA-N 0.000 description 2
- ZKRDTNHGGOKJNM-UHFFFAOYSA-N 4-(3,4-dichlorophenyl)-2-oxobutanoic acid Chemical compound OC(=O)C(=O)CCC1=CC=C(Cl)C(Cl)=C1 ZKRDTNHGGOKJNM-UHFFFAOYSA-N 0.000 description 2
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 2
- BKAJNAXTPSGJCU-UHFFFAOYSA-N 4-methyl-2-oxopentanoic acid Chemical compound CC(C)CC(=O)C(O)=O BKAJNAXTPSGJCU-UHFFFAOYSA-N 0.000 description 2
- HFXAFXVXPMUQCQ-BYPYZUCNSA-N 4-oxo-L-proline Chemical compound OC(=O)[C@@H]1CC(=O)CN1 HFXAFXVXPMUQCQ-BYPYZUCNSA-N 0.000 description 2
- CIBNXHHWVVKRDY-UHFFFAOYSA-N 5-methyl-2-oxohexanoic acid Chemical compound CC(C)CCC(=O)C(O)=O CIBNXHHWVVKRDY-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- 241000167854 Bourreria succulenta Species 0.000 description 2
- 102400000967 Bradykinin Human genes 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 229910014033 C-OH Inorganic materials 0.000 description 2
- 101100129088 Caenorhabditis elegans lys-2 gene Proteins 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- 108010071840 Cytosol nonspecific dipeptidase Proteins 0.000 description 2
- 229910014570 C—OH Inorganic materials 0.000 description 2
- UQBOJOOOTLPNST-UHFFFAOYSA-N Dehydroalanine Chemical compound NC(=C)C(O)=O UQBOJOOOTLPNST-UHFFFAOYSA-N 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 108010016626 Dipeptides Proteins 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- FFFHZYDWPBMWHY-VKHMYHEASA-N L-homocysteine Chemical compound OC(=O)[C@@H](N)CCS FFFHZYDWPBMWHY-VKHMYHEASA-N 0.000 description 2
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 2
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 2
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 2
- IDGQXGPQOGUGIX-VIFPVBQESA-N O-BENZYL-l-SERINE Chemical compound OC(=O)[C@@H](N)COCC1=CC=CC=C1 IDGQXGPQOGUGIX-VIFPVBQESA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 2
- 239000004473 Threonine Substances 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Chemical compound CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 description 2
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 238000010306 acid treatment Methods 0.000 description 2
- ODHCTXKNWHHXJC-UHFFFAOYSA-N acide pyroglutamique Natural products OC(=O)C1CCC(=O)N1 ODHCTXKNWHHXJC-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001371 alpha-amino acids Chemical class 0.000 description 2
- DEDGUGJNLNLJSR-UHFFFAOYSA-N alpha-hydroxycinnamic acid Natural products OC(=O)C(O)=CC1=CC=CC=C1 DEDGUGJNLNLJSR-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000000539 amino acid group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 229940030600 antihypertensive agent Drugs 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000001574 biopsy Methods 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 235000019693 cherries Nutrition 0.000 description 2
- 230000002860 competitive effect Effects 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- PFLHGSJLYNJIOF-UHFFFAOYSA-N diethyl 2-formamidopropanedioate Chemical compound CCOC(=O)C(NC=O)C(=O)OCC PFLHGSJLYNJIOF-UHFFFAOYSA-N 0.000 description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 150000002019 disulfides Chemical class 0.000 description 2
- PMMYEEVYMWASQN-UHFFFAOYSA-N dl-hydroxyproline Natural products OC1C[NH2+]C(C([O-])=O)C1 PMMYEEVYMWASQN-UHFFFAOYSA-N 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- VZMQTNWZEYXCEH-KRWDZBQOSA-N ethyl (2S)-2-amino-3-(2-benzylphenyl)propanoate Chemical compound CCOC(=O)[C@@H](N)Cc1ccccc1Cc1ccccc1 VZMQTNWZEYXCEH-KRWDZBQOSA-N 0.000 description 2
- STPXIOGYOLJXMZ-UHFFFAOYSA-N ethyl 2-oxo-4-phenylbutanoate Chemical compound CCOC(=O)C(=O)CCC1=CC=CC=C1 STPXIOGYOLJXMZ-UHFFFAOYSA-N 0.000 description 2
- IIFWIQQBZUIBLR-UHFFFAOYSA-N ethyl 4-methyl-2-sulfanylhexanoate Chemical compound CCOC(=O)C(S)CC(C)CC IIFWIQQBZUIBLR-UHFFFAOYSA-N 0.000 description 2
- 210000003191 femoral vein Anatomy 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 125000000291 glutamic acid group Chemical group N[C@@H](CCC(O)=O)C(=O)* 0.000 description 2
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 108010016268 hippuryl-histidyl-leucine Proteins 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 230000001631 hypertensive effect Effects 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 210000000936 intestine Anatomy 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 229960000310 isoleucine Drugs 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- GCHPUFAZSONQIV-UHFFFAOYSA-N isovaline Chemical compound CCC(C)(N)C(O)=O GCHPUFAZSONQIV-UHFFFAOYSA-N 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000001360 methionine group Chemical group N[C@@H](CCSC)C(=O)* 0.000 description 2
- IUXVIPGPIFGSEU-INIZCTEOSA-N methyl (2s)-2-amino-3-(4-phenylmethoxyphenyl)propanoate Chemical compound C1=CC(C[C@H](N)C(=O)OC)=CC=C1OCC1=CC=CC=C1 IUXVIPGPIFGSEU-INIZCTEOSA-N 0.000 description 2
- NKZNPRQIONEKPT-UHFFFAOYSA-N n,n-dimethyl-1-quinolin-2-ylmethanamine Chemical compound C1=CC=CC2=NC(CN(C)C)=CC=C21 NKZNPRQIONEKPT-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229960003104 ornithine Drugs 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 238000005192 partition Methods 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- 125000001151 peptidyl group Chemical group 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 150000003140 primary amides Chemical class 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000013557 residual solvent Substances 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 229910001923 silver oxide Inorganic materials 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 238000001308 synthesis method Methods 0.000 description 2
- CANQRTXTMVVNCH-LBPRGKRZSA-N tert-butyl (2s)-2-amino-4-phenylbutanoate Chemical compound CC(C)(C)OC(=O)[C@@H](N)CCC1=CC=CC=C1 CANQRTXTMVVNCH-LBPRGKRZSA-N 0.000 description 2
- 150000007970 thio esters Chemical class 0.000 description 2
- 229960004441 tyrosine Drugs 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- 229960004295 valine Drugs 0.000 description 2
- 239000004474 valine Substances 0.000 description 2
- QSLPNSWXUQHVLP-UHFFFAOYSA-N $l^{1}-sulfanylmethane Chemical compound [S]C QSLPNSWXUQHVLP-UHFFFAOYSA-N 0.000 description 1
- YSIRGMXKALGADV-LLVKDONJSA-N (2R)-4-hydroxy-2-methoxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid Chemical compound C(=O)(OC(C)(C)C)N([C@@](CCO)(C(=O)O)OC)C YSIRGMXKALGADV-LLVKDONJSA-N 0.000 description 1
- BJBUEDPLEOHJGE-UHFFFAOYSA-N (2R,3S)-3-Hydroxy-2-pyrolidinecarboxylic acid Natural products OC1CCNC1C(O)=O BJBUEDPLEOHJGE-UHFFFAOYSA-N 0.000 description 1
- LTRAANAHCCCXHC-NTFOPCPOSA-N (2S)-2-amino-3-(2-hydroxy-5-methyl-6-oxo-1,2-dihydropyrimidin-3-yl)propanoic acid Chemical compound CC1=CN(C[C@H](N)C(O)=O)C(O)N=C1O LTRAANAHCCCXHC-NTFOPCPOSA-N 0.000 description 1
- SROIPITXZMZRRB-HNNXBMFYSA-N (2S)-3-[4-(4-hydroxyphenoxy)phenyl]-2-(methylamino)propanoic acid Chemical compound C1=CC(C[C@H](NC)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 SROIPITXZMZRRB-HNNXBMFYSA-N 0.000 description 1
- MTQVURJWWKQMRZ-MQWKRIRWSA-N (2S)-5-(diaminomethylideneamino)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl-nitroamino]pentanoic acid Chemical compound C(=O)(OC(C)(C)C)N([C@@H](CC(CNC(N)=N)C)C(=O)O)[N+](=O)[O-] MTQVURJWWKQMRZ-MQWKRIRWSA-N 0.000 description 1
- MXPBQQXWXZWBMK-LLVKDONJSA-N (2r)-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)[C@](C)(C(O)=O)NC(=O)OC(C)(C)C MXPBQQXWXZWBMK-LLVKDONJSA-N 0.000 description 1
- JAPMNWXYNYHZGZ-QMMMGPOBSA-N (2r)-2-amino-2-methyl-3-(2-methylpropylsulfanyl)propanoic acid Chemical compound CC(C)CSC[C@](C)(N)C(O)=O JAPMNWXYNYHZGZ-QMMMGPOBSA-N 0.000 description 1
- JQZCNHYREAEVKK-VIFPVBQESA-N (2r)-2-amino-2-methyl-3-(3-methylbutylsulfanyl)propanoic acid Chemical compound CC(C)CCSC[C@](C)(N)C(O)=O JQZCNHYREAEVKK-VIFPVBQESA-N 0.000 description 1
- LWKUSWORIVQIAU-YFKPBYRVSA-N (2r)-2-amino-2-methyl-3-methylsulfanylpropanoic acid Chemical compound CSC[C@](C)(N)C(O)=O LWKUSWORIVQIAU-YFKPBYRVSA-N 0.000 description 1
- DKKTXYCCRGEHPC-VIFPVBQESA-N (2r)-2-amino-2-methyl-3-pentylsulfanylpropanoic acid Chemical compound CCCCCSC[C@](C)(N)C(O)=O DKKTXYCCRGEHPC-VIFPVBQESA-N 0.000 description 1
- ZRBBFADVPJQXFF-ZETCQYMHSA-N (2r)-2-amino-2-methyl-3-propan-2-ylsulfanylpropanoic acid Chemical compound CC(C)SC[C@](C)(N)C(O)=O ZRBBFADVPJQXFF-ZETCQYMHSA-N 0.000 description 1
- LFLCENOSUFBYGP-ZETCQYMHSA-N (2r)-2-amino-2-methyl-3-propylsulfanylpropanoic acid Chemical compound CCCSC[C@](C)(N)C(O)=O LFLCENOSUFBYGP-ZETCQYMHSA-N 0.000 description 1
- PPNFGVZDIOCWDK-QMMMGPOBSA-N (2r)-2-amino-3-butylsulfanyl-2-methylpropanoic acid Chemical compound CCCCSC[C@](C)(N)C(O)=O PPNFGVZDIOCWDK-QMMMGPOBSA-N 0.000 description 1
- LZDAORHYUMEQGT-LURJTMIESA-N (2r)-2-amino-3-ethylsulfanyl-2-methylpropanoic acid Chemical compound CCSC[C@](C)(N)C(O)=O LZDAORHYUMEQGT-LURJTMIESA-N 0.000 description 1
- NMJNPLIFGMSGNZ-QMMMGPOBSA-N (2r)-2-amino-3-tert-butylsulfanyl-2-methylpropanoic acid Chemical compound CC(C)(C)SC[C@](C)(N)C(O)=O NMJNPLIFGMSGNZ-QMMMGPOBSA-N 0.000 description 1
- KIPDMPPOTUGMPW-SNVBAGLBSA-N (2r)-2-amino-4-benzylsulfanylbutanoic acid Chemical compound OC(=O)[C@H](N)CCSCC1=CC=CC=C1 KIPDMPPOTUGMPW-SNVBAGLBSA-N 0.000 description 1
- YOFPFYYTUIARDI-ZCFIWIBFSA-N (2r)-2-aminooctanedioic acid Chemical compound OC(=O)[C@H](N)CCCCCC(O)=O YOFPFYYTUIARDI-ZCFIWIBFSA-N 0.000 description 1
- UXODLFPSCPTZAE-JTQLQIEISA-N (2r)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanoic acid Chemical compound CSC[C@@](C)(C(O)=O)NC(=O)OC(C)(C)C UXODLFPSCPTZAE-JTQLQIEISA-N 0.000 description 1
- HRTQWVNNCOTUNZ-ZDUSSCGKSA-N (2r)-3-tert-butylsulfanyl-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@](C)(C(O)=O)CSC(C)(C)C HRTQWVNNCOTUNZ-ZDUSSCGKSA-N 0.000 description 1
- GKCBQPXKGNTQKX-VDGAXYAQSA-N (2s)-1-[(2s)-2-[[(2s)-2-benzamido-3-phenylpropanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid Chemical compound C([C@@H](C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)NC(=O)C=1C=CC=CC=1)C1=CC=CC=C1 GKCBQPXKGNTQKX-VDGAXYAQSA-N 0.000 description 1
- DAOGFHQPAHSMQS-LURJTMIESA-N (2s)-1-propanoylpyrrolidine-2-carboxylic acid Chemical compound CCC(=O)N1CCC[C@H]1C(O)=O DAOGFHQPAHSMQS-LURJTMIESA-N 0.000 description 1
- OMGHIGVFLOPEHJ-BYPYZUCNSA-N (2s)-2,5-dihydro-1h-pyrrole-2-carboxylic acid Chemical compound OC(=O)[C@H]1NCC=C1 OMGHIGVFLOPEHJ-BYPYZUCNSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- QTOUZGRCRVLFHQ-BYPYZUCNSA-N (2s)-2-(2,4,5-trihydroxyanilino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1=CC(O)=C(O)C=C1O QTOUZGRCRVLFHQ-BYPYZUCNSA-N 0.000 description 1
- FOYXZVHDLXZETB-LBPRGKRZSA-N (2s)-2-(benzylazaniumyl)-3-(1h-imidazol-5-yl)propanoate Chemical compound C([C@@H](C(=O)O)NCC=1C=CC=CC=1)C1=CNC=N1 FOYXZVHDLXZETB-LBPRGKRZSA-N 0.000 description 1
- UBZLAKLDZOATNF-YFKPBYRVSA-N (2s)-2-(dihydroxyamino)-4-methylpentanoic acid Chemical compound CC(C)C[C@H](N(O)O)C(O)=O UBZLAKLDZOATNF-YFKPBYRVSA-N 0.000 description 1
- HSPALBCOMMFFNI-YFKXAPIDSA-N (2s)-2-(dimethylamino)-3-[4-(4-hydroxyphenoxy)phenyl]-2-methylbutanoic acid Chemical compound C1=CC(C(C)[C@](C)(N(C)C)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 HSPALBCOMMFFNI-YFKXAPIDSA-N 0.000 description 1
- QVHJQCGUWFKTSE-YFKPBYRVSA-N (2s)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound OC(=O)[C@H](C)NC(=O)OC(C)(C)C QVHJQCGUWFKTSE-YFKPBYRVSA-N 0.000 description 1
- HBFHGJUIEHIHFT-MACXSXHHSA-N (2s)-2-[[(2r,3s,4r,5r)-5-(2-amino-6-oxo-3h-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-sulfanylbutanoic acid Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](CN[C@@H](CCS)C(O)=O)[C@@H](O)[C@H]1O HBFHGJUIEHIHFT-MACXSXHHSA-N 0.000 description 1
- FICCYWIDRZLXIS-ZETCQYMHSA-N (2s)-2-amino-3-(1h-pyrrolo[3,2-b]pyridin-3-yl)propanoic acid Chemical compound C1=CN=C2C(C[C@H](N)C(O)=O)=CNC2=C1 FICCYWIDRZLXIS-ZETCQYMHSA-N 0.000 description 1
- YYTDJPUFAVPHQA-VKHMYHEASA-N (2s)-2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=C(F)C(F)=C(F)C(F)=C1F YYTDJPUFAVPHQA-VKHMYHEASA-N 0.000 description 1
- JFDDIQNKNLUINS-LURJTMIESA-N (2s)-2-amino-3-(2,3,5,6-tetrafluorophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=C(F)C(F)=CC(F)=C1F JFDDIQNKNLUINS-LURJTMIESA-N 0.000 description 1
- YHYQITHAFYELNW-QMMMGPOBSA-N (2s)-2-amino-3-(2,5-difluorophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC(F)=CC=C1F YHYQITHAFYELNW-QMMMGPOBSA-N 0.000 description 1
- MWCDQZBPLTYYSP-VIFPVBQESA-N (2s)-2-amino-3-(2,5-dimethoxy-4-methylphenyl)propanoic acid Chemical compound COC1=CC(C[C@H](N)C(O)=O)=C(OC)C=C1C MWCDQZBPLTYYSP-VIFPVBQESA-N 0.000 description 1
- WVXAXDTZEMZHQB-BYPYZUCNSA-N (2s)-2-amino-3-(2-aminoethylamino)propanoic acid Chemical compound NCCNC[C@H](N)C(O)=O WVXAXDTZEMZHQB-BYPYZUCNSA-N 0.000 description 1
- BRONSICUNQRLFP-QMMMGPOBSA-N (2s)-2-amino-3-(2-ethyl-4,5-dihydroxyphenyl)propanoic acid Chemical compound CCC1=CC(O)=C(O)C=C1C[C@H](N)C(O)=O BRONSICUNQRLFP-QMMMGPOBSA-N 0.000 description 1
- XAFNUWVLFYOQSL-ZETCQYMHSA-N (2s)-2-amino-3-(2-hydroxy-5-nitrophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC([N+]([O-])=O)=CC=C1O XAFNUWVLFYOQSL-ZETCQYMHSA-N 0.000 description 1
- IOYWTNNHQPFPDP-VIFPVBQESA-N (2s)-2-amino-3-(2-tert-butyl-4,5-dihydroxyphenyl)propanoic acid Chemical compound CC(C)(C)C1=CC(O)=C(O)C=C1C[C@H](N)C(O)=O IOYWTNNHQPFPDP-VIFPVBQESA-N 0.000 description 1
- MXXMBZQIPZDATA-ZETCQYMHSA-N (2s)-2-amino-3-(3,4,5-triiodophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC(I)=C(I)C(I)=C1 MXXMBZQIPZDATA-ZETCQYMHSA-N 0.000 description 1
- QFGMPXZFCIHYIR-QMMMGPOBSA-N (2s)-2-amino-3-(3,5-difluorophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC(F)=CC(F)=C1 QFGMPXZFCIHYIR-QMMMGPOBSA-N 0.000 description 1
- NSCSKUVWGVFCLY-JTQLQIEISA-N (2s)-2-amino-3-(3-bromophenyl)-2-methylpropanoic acid Chemical compound OC(=O)[C@](N)(C)CC1=CC=CC(Br)=C1 NSCSKUVWGVFCLY-JTQLQIEISA-N 0.000 description 1
- GLWVGMMAPQLEKR-LBPRGKRZSA-N (2s)-2-amino-3-(3-ethyl-4-hydroxyphenyl)-2-methylpropanoic acid Chemical compound CCC1=CC(C[C@](C)(N)C(O)=O)=CC=C1O GLWVGMMAPQLEKR-LBPRGKRZSA-N 0.000 description 1
- FQZGACCJFXQSCQ-JTQLQIEISA-N (2s)-2-amino-3-(3-fluorophenyl)-2-methylpropanoic acid Chemical compound OC(=O)[C@](N)(C)CC1=CC=CC(F)=C1 FQZGACCJFXQSCQ-JTQLQIEISA-N 0.000 description 1
- JFAXKBVMETZAFM-AWEZNQCLSA-N (2s)-2-amino-3-(3-tert-butyl-4-hydroxyphenyl)-2-methylpropanoic acid Chemical compound CC(C)(C)C1=CC(C[C@](C)(N)C(O)=O)=CC=C1O JFAXKBVMETZAFM-AWEZNQCLSA-N 0.000 description 1
- ZQCYJCMADFAKAA-ZETCQYMHSA-N (2s)-2-amino-3-(4,5-dihydroxy-2-methylphenyl)propanoic acid Chemical compound CC1=CC(O)=C(O)C=C1C[C@H](N)C(O)=O ZQCYJCMADFAKAA-ZETCQYMHSA-N 0.000 description 1
- JDWSIKUNMDDGCF-VIFPVBQESA-N (2s)-2-amino-3-(4,5-dihydroxy-2-propan-2-ylphenyl)propanoic acid Chemical compound CC(C)C1=CC(O)=C(O)C=C1C[C@H](N)C(O)=O JDWSIKUNMDDGCF-VIFPVBQESA-N 0.000 description 1
- XPRCPVGCTGELMN-QMMMGPOBSA-N (2s)-2-amino-3-(4-carbamimidoylphenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(C(N)=N)C=C1 XPRCPVGCTGELMN-QMMMGPOBSA-N 0.000 description 1
- VYGOZODJYPOFTR-ZDUSSCGKSA-N (2s)-2-amino-3-(4-hydroxy-3-propan-2-ylphenyl)-2-methylpropanoic acid Chemical compound CC(C)C1=CC(C[C@](C)(N)C(O)=O)=CC=C1O VYGOZODJYPOFTR-ZDUSSCGKSA-N 0.000 description 1
- DQLHSFUMICQIMB-VIFPVBQESA-N (2s)-2-amino-3-(4-methylphenyl)propanoic acid Chemical compound CC1=CC=C(C[C@H](N)C(O)=O)C=C1 DQLHSFUMICQIMB-VIFPVBQESA-N 0.000 description 1
- YTWNUUSHKAQWDZ-VKZKZBKNSA-N (2s)-2-amino-3-(4-nitroimidazol-4-yl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1([N+]([O-])=O)C=NC=N1 YTWNUUSHKAQWDZ-VKZKZBKNSA-N 0.000 description 1
- DKZIJCYVZNQMAU-QMMMGPOBSA-N (2s)-2-amino-3-(4-sulfanylphenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(S)C=C1 DKZIJCYVZNQMAU-QMMMGPOBSA-N 0.000 description 1
- PPHXPZMIUIDJKV-ZETCQYMHSA-N (2s)-2-amino-3-(6-chloro-4-methyl-1h-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid Chemical compound CC1=CC(Cl)=NC2=C1C(C[C@H](N)C(O)=O)=CN2 PPHXPZMIUIDJKV-ZETCQYMHSA-N 0.000 description 1
- BZTOZLYJRLNNAY-BYPYZUCNSA-N (2s)-2-amino-3-(6-oxo-3h-purin-9-yl)propanoic acid Chemical compound N1=CN=C2N(C[C@H](N)C(O)=O)C=NC2=C1O BZTOZLYJRLNNAY-BYPYZUCNSA-N 0.000 description 1
- ZQTURUOHWQFTNS-DHRDCHLVSA-N (2s)-2-amino-3-[3,5-di(butan-2-yl)-4-(4-hydroxy-3-iodophenoxy)phenyl]propanoic acid Chemical compound CCC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)CC)=C1OC1=CC=C(O)C(I)=C1 ZQTURUOHWQFTNS-DHRDCHLVSA-N 0.000 description 1
- XLZGQPNBZQUBNI-QMMMGPOBSA-N (2s)-2-amino-3-[3-[(2-chloroacetyl)amino]-4-fluorophenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(F)C(NC(=O)CCl)=C1 XLZGQPNBZQUBNI-QMMMGPOBSA-N 0.000 description 1
- LYNSNQULPIJXAO-DHRDCHLVSA-N (2s)-2-amino-3-[4-(3-bromo-4-hydroxyphenoxy)-3,5-di(butan-2-yl)phenyl]propanoic acid Chemical compound CCC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)CC)=C1OC1=CC=C(O)C(Br)=C1 LYNSNQULPIJXAO-DHRDCHLVSA-N 0.000 description 1
- YZTKBJWKYGBVPL-SFHVURJKSA-N (2s)-2-amino-3-[4-(3-bromo-4-hydroxyphenoxy)-3,5-di(propan-2-yl)phenyl]propanoic acid Chemical compound CC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)C)=C1OC1=CC=C(O)C(Br)=C1 YZTKBJWKYGBVPL-SFHVURJKSA-N 0.000 description 1
- QHHWMOKQVCJRPS-KRWDZBQOSA-N (2s)-2-amino-3-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]propanoic acid Chemical compound C1=C(O)C(C(C)C)=CC(OC=2C(=CC(C[C@H](N)C(O)=O)=CC=2C)C)=C1 QHHWMOKQVCJRPS-KRWDZBQOSA-N 0.000 description 1
- FLSWNGNXLWAVMK-IBGZPJMESA-N (2s)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-di(propan-2-yl)phenyl]propanoic acid Chemical compound CC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)C)=C1OC1=CC=C(O)C=C1 FLSWNGNXLWAVMK-IBGZPJMESA-N 0.000 description 1
- FYMNTAQFDTZISY-QMMMGPOBSA-N (2s)-2-amino-3-[4-(diaminomethylideneamino)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N=C(N)N)C=C1 FYMNTAQFDTZISY-QMMMGPOBSA-N 0.000 description 1
- OXNUZCWFCJRJSU-VIFPVBQESA-N (2s)-2-amino-3-[4-(hydroxymethyl)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(CO)C=C1 OXNUZCWFCJRJSU-VIFPVBQESA-N 0.000 description 1
- YNLOZYCMUQNFNZ-VIFPVBQESA-N (2s)-2-amino-3-[4-[(2-bromoacetyl)amino]phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(NC(=O)CBr)C=C1 YNLOZYCMUQNFNZ-VIFPVBQESA-N 0.000 description 1
- GHBAYRBVXCRIHT-SECBINFHSA-N (2s)-2-amino-3-benzylsulfanylpropanoic acid Chemical compound OC(=O)[C@H](N)CSCC1=CC=CC=C1 GHBAYRBVXCRIHT-SECBINFHSA-N 0.000 description 1
- LXRUAYBIUSUULX-NFJMKROFSA-N (2s)-2-amino-3-methylbutanedioic acid Chemical compound OC(=O)C(C)[C@H](N)C(O)=O LXRUAYBIUSUULX-NFJMKROFSA-N 0.000 description 1
- CXIYBDIJKQJUMN-QMMMGPOBSA-N (2s)-2-anilino-3-hydroxypropanoic acid Chemical compound OC[C@@H](C(O)=O)NC1=CC=CC=C1 CXIYBDIJKQJUMN-QMMMGPOBSA-N 0.000 description 1
- UEFLPVKMPDEMFW-QMMMGPOBSA-N (2s)-2-azaniumyl-3-(2,4-difluorophenyl)propanoate Chemical compound [O-]C(=O)[C@@H]([NH3+])CC1=CC=C(F)C=C1F UEFLPVKMPDEMFW-QMMMGPOBSA-N 0.000 description 1
- RCYLCZQGMUWCBV-JTQLQIEISA-N (2s)-2-azaniumyl-3-(3-iodophenyl)-2-methylpropanoate Chemical compound OC(=O)[C@](N)(C)CC1=CC=CC(I)=C1 RCYLCZQGMUWCBV-JTQLQIEISA-N 0.000 description 1
- VSWSDTLXDWESGZ-AWEZNQCLSA-N (2s)-3-[4-(4-hydroxyphenoxy)phenyl]-2-(iodoamino)propanoic acid Chemical compound C1=CC(C[C@@H](C(=O)O)NI)=CC=C1OC1=CC=C(O)C=C1 VSWSDTLXDWESGZ-AWEZNQCLSA-N 0.000 description 1
- RUQLVQSODALTBB-KRWDZBQOSA-N (2s)-3-[4-(4-hydroxyphenoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OC(C)(C)C)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 RUQLVQSODALTBB-KRWDZBQOSA-N 0.000 description 1
- IAYDKLHSZNCWJF-SECBINFHSA-N (2s)-3-fluoro-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@](C)(CF)C(O)=O IAYDKLHSZNCWJF-SECBINFHSA-N 0.000 description 1
- HEGVMKCCKXABPX-ZDUSSCGKSA-N (2s)-4-(3-acetamido-2,4,6-triiodophenyl)-2-amino-2-methylbutanoic acid Chemical compound CC(=O)NC1=C(I)C=C(I)C(CC[C@](C)(N)C(O)=O)=C1I HEGVMKCCKXABPX-ZDUSSCGKSA-N 0.000 description 1
- HSQIYOPBCOPMSS-ZETCQYMHSA-N (2s)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCCN=C(N)N HSQIYOPBCOPMSS-ZETCQYMHSA-N 0.000 description 1
- DCUQRNAKJBVFDN-ZETCQYMHSA-N (2s)-5-(diaminomethylideneazaniumyl)-2-[(2-methylpropan-2-yl)oxycarbonyl-nitroamino]pentanoate Chemical compound CC(C)(C)OC(=O)N([N+]([O-])=O)[C@H](C(O)=O)CCCNC(N)=N DCUQRNAKJBVFDN-ZETCQYMHSA-N 0.000 description 1
- VVNYDCGZZSTUBC-LURJTMIESA-N (2s)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCC(N)=O VVNYDCGZZSTUBC-LURJTMIESA-N 0.000 description 1
- QJCNLJWUIOIMMF-YUMQZZPRSA-N (2s,3s)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CC[C@H](C)[C@@H](C(O)=O)NC(=O)OC(C)(C)C QJCNLJWUIOIMMF-YUMQZZPRSA-N 0.000 description 1
- HGRWHBQLRXWSLV-DEOSSOPVSA-N (4s)-3'-(3,6-dihydro-2h-pyran-5-yl)-1'-fluoro-7'-(3-fluoropyridin-2-yl)spiro[5h-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine Chemical compound C1OC(N)=N[C@]21C1=CC(C=3COCCC=3)=NC(F)=C1OC1=CC=C(C=3C(=CC=CN=3)F)C=C12 HGRWHBQLRXWSLV-DEOSSOPVSA-N 0.000 description 1
- FJQZXCPWAGYPSD-UHFFFAOYSA-N 1,3,4,6-tetrachloro-3a,6a-diphenylimidazo[4,5-d]imidazole-2,5-dione Chemical compound ClN1C(=O)N(Cl)C2(C=3C=CC=CC=3)N(Cl)C(=O)N(Cl)C12C1=CC=CC=C1 FJQZXCPWAGYPSD-UHFFFAOYSA-N 0.000 description 1
- CWZUTHDJLNZLCM-DFBGVHRSSA-N 1-[2-[(1r,3s,5r)-3-[(6-bromopyridin-2-yl)carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]indazole-3-carboxamide Chemical compound O=C([C@@H]1C[C@H]2C[C@H]2N1C(=O)CN1N=C(C2=CC=CC=C21)C(=O)N)NC1=CC=CC(Br)=N1 CWZUTHDJLNZLCM-DFBGVHRSSA-N 0.000 description 1
- APAZZDBYJISGLX-UHFFFAOYSA-N 1-bromo-4-phenylbutan-2-one Chemical compound BrCC(=O)CCC1=CC=CC=C1 APAZZDBYJISGLX-UHFFFAOYSA-N 0.000 description 1
- RZYHXKLKJRGJGP-UHFFFAOYSA-N 2,2,2-trifluoro-n,n-bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)N([Si](C)(C)C)C(=O)C(F)(F)F RZYHXKLKJRGJGP-UHFFFAOYSA-N 0.000 description 1
- VXFFUPQANCMCHK-UHFFFAOYSA-N 2-(2-amino-4-oxocyclohexa-1,5-dien-1-yl)hexanoic acid Chemical compound CCCCC(C(O)=O)C1=C(N)CC(=O)C=C1 VXFFUPQANCMCHK-UHFFFAOYSA-N 0.000 description 1
- AUYIERBBYROJDD-UHFFFAOYSA-N 2-(2-aminoindol-2-yl)acetic acid Chemical compound C1=CC=CC2=NC(N)(CC(O)=O)C=C21 AUYIERBBYROJDD-UHFFFAOYSA-N 0.000 description 1
- APAUAYLVDHNFBF-UHFFFAOYSA-N 2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid Chemical compound N1C(C(=O)O)CSC1C1=CC=CC=C1O APAUAYLVDHNFBF-UHFFFAOYSA-N 0.000 description 1
- LYBUHXDWRMVACI-UHFFFAOYSA-N 2-(3-amino-3-carboxypropyl)-1,3-thiazole-4-carboxylic acid Chemical compound OC(=O)C(N)CCC1=NC(C(O)=O)=CS1 LYBUHXDWRMVACI-UHFFFAOYSA-N 0.000 description 1
- PRNFQNXJCUGXNZ-UHFFFAOYSA-N 2-(6-oxocyclohexa-2,4-dien-1-yl)butanoic acid Chemical compound CCC(C(O)=O)C1C=CC=CC1=O PRNFQNXJCUGXNZ-UHFFFAOYSA-N 0.000 description 1
- UZAGRLZNUCTZIT-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-oxo-4-phenylbutanoate Chemical compound CN(C)CCOC(=O)C(=O)CCC1=CC=CC=C1 UZAGRLZNUCTZIT-UHFFFAOYSA-N 0.000 description 1
- LUQBDMIQOXUAEQ-UHFFFAOYSA-N 2-[2-bromo-4-[(2-methylpropan-2-yl)oxy]phenyl]acetic acid Chemical compound CC(C)(C)OC1=CC=C(CC(O)=O)C(Br)=C1 LUQBDMIQOXUAEQ-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- LLBKEUTWJFQRJU-UHFFFAOYSA-N 2-[4-(4-aminophenyl)sulfonylanilino]ethanol Chemical group C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(NCCO)C=C1 LLBKEUTWJFQRJU-UHFFFAOYSA-N 0.000 description 1
- LQIVQJXEBHFIRB-UHFFFAOYSA-N 2-[carbamimidoyl(nitro)amino]pentanoic acid Chemical compound CCCC(C(O)=O)N(C(N)=N)[N+]([O-])=O LQIVQJXEBHFIRB-UHFFFAOYSA-N 0.000 description 1
- VWZZNLSWJZJYCQ-UHFFFAOYSA-N 2-acetamidoethyl 2-oxo-4-phenylbutanoate Chemical compound CC(=O)NCCOC(=O)C(=O)CCC1=CC=CC=C1 VWZZNLSWJZJYCQ-UHFFFAOYSA-N 0.000 description 1
- YZLMTHNLBVMABH-UHFFFAOYSA-N 2-amino-2-bromo-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid Chemical compound CC(C)(C)OC(=O)CCCC(N)(Br)C(O)=O YZLMTHNLBVMABH-UHFFFAOYSA-N 0.000 description 1
- LTDTUZSHTIJYIF-UHFFFAOYSA-N 2-amino-2-methyl-4-oxo-6-phenylhexanoic acid Chemical compound OC(=O)C(N)(C)CC(=O)CCC1=CC=CC=C1 LTDTUZSHTIJYIF-UHFFFAOYSA-N 0.000 description 1
- QHSCIWIRXWFIGH-UHFFFAOYSA-N 2-amino-2-methylpentanedioic acid Chemical compound OC(=O)C(N)(C)CCC(O)=O QHSCIWIRXWFIGH-UHFFFAOYSA-N 0.000 description 1
- ATGSPCNBGHEKRW-UHFFFAOYSA-N 2-amino-3,3-dimethylhex-5-enoic acid Chemical compound C=CCC(C)(C)C(N)C(O)=O ATGSPCNBGHEKRW-UHFFFAOYSA-N 0.000 description 1
- BEFUFPUMGNJZEV-UHFFFAOYSA-N 2-amino-3,3-dimethylhexa-4,5-dienoic acid Chemical compound C=C=CC(C)(C)C(N)C(O)=O BEFUFPUMGNJZEV-UHFFFAOYSA-N 0.000 description 1
- FNEBZSUXWSCLSN-UHFFFAOYSA-N 2-amino-3,3-dimethylnona-4,5-dienoic acid Chemical compound CCCC=C=CC(C)(C)C(N)C(O)=O FNEBZSUXWSCLSN-UHFFFAOYSA-N 0.000 description 1
- XNLKIKNNGCSKQU-UHFFFAOYSA-N 2-amino-3-(4-fluoroimidazol-4-yl)propanoic acid Chemical compound OC(=O)C(N)CC1(F)C=NC=N1 XNLKIKNNGCSKQU-UHFFFAOYSA-N 0.000 description 1
- VBCSMZMAPIIUJQ-UHFFFAOYSA-N 2-amino-3-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-di(propan-2-yl)phenyl]propanoic acid Chemical compound C1=C(O)C(C(C)C)=CC(OC=2C(=CC(CC(N)C(O)=O)=CC=2C(C)C)C(C)C)=C1 VBCSMZMAPIIUJQ-UHFFFAOYSA-N 0.000 description 1
- QAAAJCNONHZRTG-UHFFFAOYSA-N 2-amino-3-chloropentanedioic acid Chemical compound OC(=O)C(N)C(Cl)CC(O)=O QAAAJCNONHZRTG-UHFFFAOYSA-N 0.000 description 1
- LIAMCTICNTVEHD-UHFFFAOYSA-N 2-amino-3-hydroxy-6-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid Chemical compound CC(C)(C)OC(=O)CCC(O)C(N)(C(O)=O)NC(=O)OC(C)(C)C LIAMCTICNTVEHD-UHFFFAOYSA-N 0.000 description 1
- DJJDVURDQUREHS-UHFFFAOYSA-N 2-amino-3-methoxy-3-oxopropanoic acid Chemical compound COC(=O)C(N)C(O)=O DJJDVURDQUREHS-UHFFFAOYSA-N 0.000 description 1
- RAQYONYLNDYWKY-UHFFFAOYSA-N 2-amino-3-methylhepta-5,6-dienoic acid Chemical compound OC(=O)C(N)C(C)CC=C=C RAQYONYLNDYWKY-UHFFFAOYSA-N 0.000 description 1
- AKOINERHKFEQLT-UHFFFAOYSA-N 2-amino-4-(1h-pyrrol-2-yl)butanoic acid Chemical compound OC(=O)C(N)CCC1=CC=CN1 AKOINERHKFEQLT-UHFFFAOYSA-N 0.000 description 1
- IFPQOXNWLSRZKX-UHFFFAOYSA-N 2-amino-4-(diaminomethylideneamino)butanoic acid Chemical compound OC(=O)C(N)CCN=C(N)N IFPQOXNWLSRZKX-UHFFFAOYSA-N 0.000 description 1
- OZIXMSIQZYAGGK-UHFFFAOYSA-N 2-amino-4-(methylamino)butanoic acid Chemical compound CNCCC(N)C(O)=O OZIXMSIQZYAGGK-UHFFFAOYSA-N 0.000 description 1
- KUPUYBKLZDKJSY-UHFFFAOYSA-N 2-amino-4-oxo-6-phenylhexanoic acid Chemical compound OC(=O)C(N)CC(=O)CCC1=CC=CC=C1 KUPUYBKLZDKJSY-UHFFFAOYSA-N 0.000 description 1
- GTUZDCUWVAGCRP-UHFFFAOYSA-N 2-amino-5,6-dihydroxy-1,3-dihydroindene-2-carboxylic acid Chemical compound OC1=C(O)C=C2CC(N)(C(O)=O)CC2=C1 GTUZDCUWVAGCRP-UHFFFAOYSA-N 0.000 description 1
- ZSXABAHJUIZMEM-UHFFFAOYSA-N 2-amino-5-(1h-pyrrol-2-yl)pentanoic acid Chemical compound OC(=O)C(N)CCCC1=CC=CN1 ZSXABAHJUIZMEM-UHFFFAOYSA-N 0.000 description 1
- WMXIVLBPMFZRLM-UHFFFAOYSA-N 2-amino-5-bromo-1,3-dihydroindene-2-carboxylic acid Chemical compound C1=C(Br)C=C2CC(N)(C(O)=O)CC2=C1 WMXIVLBPMFZRLM-UHFFFAOYSA-N 0.000 description 1
- HBEFHUVCZDCVQM-UHFFFAOYSA-N 2-amino-5-chloro-1,3-dihydroindene-2-carboxylic acid Chemical compound C1=C(Cl)C=C2CC(N)(C(O)=O)CC2=C1 HBEFHUVCZDCVQM-UHFFFAOYSA-N 0.000 description 1
- XJTXTAXBACZMBN-UHFFFAOYSA-N 2-amino-5-hydroxy-1,3-dihydroindene-2-carboxylic acid Chemical compound C1=C(O)C=C2CC(N)(C(O)=O)CC2=C1 XJTXTAXBACZMBN-UHFFFAOYSA-N 0.000 description 1
- DZDAHNSLONRHLW-UHFFFAOYSA-N 2-amino-5-iodo-1,3-dihydroindene-2-carboxylic acid Chemical compound C1=C(I)C=C2CC(N)(C(O)=O)CC2=C1 DZDAHNSLONRHLW-UHFFFAOYSA-N 0.000 description 1
- XITCRIZJHHQTCH-UHFFFAOYSA-N 2-amino-5-methoxy-1,3-dihydroindene-2-carboxylic acid Chemical compound COC1=CC=C2CC(N)(C(O)=O)CC2=C1 XITCRIZJHHQTCH-UHFFFAOYSA-N 0.000 description 1
- DYCMDRVZQOLIMD-UHFFFAOYSA-N 2-amino-5-methylhepta-3,4-dienoic acid Chemical compound CCC(C)=C=CC(N)C(O)=O DYCMDRVZQOLIMD-UHFFFAOYSA-N 0.000 description 1
- OZELAETXNOXZOK-UHFFFAOYSA-N 2-aminodecanedioic acid Chemical compound OC(=O)C(N)CCCCCCCC(O)=O OZELAETXNOXZOK-UHFFFAOYSA-N 0.000 description 1
- CHXSDCXDWAXIBR-UHFFFAOYSA-N 2-aminohept-4-en-6-ynoic acid Chemical compound OC(=O)C(N)CC=CC#C CHXSDCXDWAXIBR-UHFFFAOYSA-N 0.000 description 1
- PHWDBZCRUNKABS-UHFFFAOYSA-N 2-aminohepta-4,5-dienoic acid Chemical compound CC=C=CCC(N)C(O)=O PHWDBZCRUNKABS-UHFFFAOYSA-N 0.000 description 1
- NMNDMLQYTWPKSA-UHFFFAOYSA-N 2-aminohepta-5,6-dienoic acid Chemical compound OC(=O)C(N)CCC=C=C NMNDMLQYTWPKSA-UHFFFAOYSA-N 0.000 description 1
- VDWGCMRALYSYJV-UHFFFAOYSA-N 2-aminohex-4-ynoic acid Chemical compound CC#CCC(N)C(O)=O VDWGCMRALYSYJV-UHFFFAOYSA-N 0.000 description 1
- LUYLVPILJAHRJD-UHFFFAOYSA-N 2-aminohexa-4,5-dienoic acid Chemical compound OC(=O)C(N)CC=C=C LUYLVPILJAHRJD-UHFFFAOYSA-N 0.000 description 1
- PEATYEGLPLYRIN-UHFFFAOYSA-N 2-aminononanedioic acid Chemical compound OC(=O)C(N)CCCCCCC(O)=O PEATYEGLPLYRIN-UHFFFAOYSA-N 0.000 description 1
- BKMMTJMQCTUHRP-UHFFFAOYSA-N 2-aminopropan-1-ol Chemical compound CC(N)CO BKMMTJMQCTUHRP-UHFFFAOYSA-N 0.000 description 1
- DQLYTFPAEVJTFM-UHFFFAOYSA-N 2-azaniumyl-2-(3-hydroxyphenyl)acetate Chemical compound OC(=O)C(N)C1=CC=CC(O)=C1 DQLYTFPAEVJTFM-UHFFFAOYSA-N 0.000 description 1
- DEBQMEYEKKWIKC-UHFFFAOYSA-N 2-azaniumyl-3-(4-fluoro-1h-indol-3-yl)propanoate Chemical compound C1=CC(F)=C2C(CC(N)C(O)=O)=CNC2=C1 DEBQMEYEKKWIKC-UHFFFAOYSA-N 0.000 description 1
- XRARHOAIGIRUNR-UHFFFAOYSA-N 2-azaniumyl-5-methylhex-4-enoate Chemical compound CC(C)=CCC(N)C(O)=O XRARHOAIGIRUNR-UHFFFAOYSA-N 0.000 description 1
- GXQWQJTWVARFQS-UHFFFAOYSA-N 2-benzamidoacetic acid Chemical compound OC(=O)CNC(=O)C1=CC=CC=C1.OC(=O)CNC(=O)C1=CC=CC=C1 GXQWQJTWVARFQS-UHFFFAOYSA-N 0.000 description 1
- XXSPGBOGLXKMDU-UHFFFAOYSA-N 2-bromo-2-methylpropanoic acid Chemical compound CC(C)(Br)C(O)=O XXSPGBOGLXKMDU-UHFFFAOYSA-N 0.000 description 1
- UEBARDWJXBGYEJ-UHFFFAOYSA-N 2-bromo-3-methylbutanoic acid Chemical compound CC(C)C(Br)C(O)=O UEBARDWJXBGYEJ-UHFFFAOYSA-N 0.000 description 1
- VKJQJNVYWGDEQN-UHFFFAOYSA-N 2-bromo-3-phenylmethoxypropanoic acid Chemical compound OC(=O)C(Br)COCC1=CC=CC=C1 VKJQJNVYWGDEQN-UHFFFAOYSA-N 0.000 description 1
- WDRSCFNERFONKU-UHFFFAOYSA-N 2-bromo-3-phenylpropanoic acid Chemical compound OC(=O)C(Br)CC1=CC=CC=C1 WDRSCFNERFONKU-UHFFFAOYSA-N 0.000 description 1
- MBEFIKGMUFCNOV-UHFFFAOYSA-N 2-bromo-4-oxopentanoic acid Chemical compound CC(=O)CC(Br)C(O)=O MBEFIKGMUFCNOV-UHFFFAOYSA-N 0.000 description 1
- OZGMODDEIHYPRY-UHFFFAOYSA-N 2-bromopropanoyl chloride Chemical compound CC(Br)C(Cl)=O OZGMODDEIHYPRY-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- SFWQHFXRVMKCLS-UHFFFAOYSA-N 2-imidazol-1-ylpropanoic acid Chemical compound OC(=O)C(C)N1C=CN=C1 SFWQHFXRVMKCLS-UHFFFAOYSA-N 0.000 description 1
- IASIQPSVWNZTGZ-UHFFFAOYSA-N 2-methyl-2-sulfanylpentanedioic acid Chemical compound OC(=O)C(S)(C)CCC(O)=O IASIQPSVWNZTGZ-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- WSLKBSIXZCTCJG-UHFFFAOYSA-N 2-oxo-3-phenylmethoxypropanoic acid Chemical compound OC(=O)C(=O)COCC1=CC=CC=C1 WSLKBSIXZCTCJG-UHFFFAOYSA-N 0.000 description 1
- HXVYSVJVIUDSBN-UHFFFAOYSA-N 2-oxo-4-phenylbutanethioic s-acid Chemical compound SC(=O)C(=O)CCC1=CC=CC=C1 HXVYSVJVIUDSBN-UHFFFAOYSA-N 0.000 description 1
- AUUTXOKCFQTKPL-UHFFFAOYSA-N 2-oxopropanoyl chloride Chemical compound CC(=O)C(Cl)=O AUUTXOKCFQTKPL-UHFFFAOYSA-N 0.000 description 1
- VOOLHWPXPFEYAH-UHFFFAOYSA-N 3,3-dimethyl-2-oxopentanoic acid Chemical compound CCC(C)(C)C(=O)C(O)=O VOOLHWPXPFEYAH-UHFFFAOYSA-N 0.000 description 1
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- MWOOKDULMBMMPN-UHFFFAOYSA-N 3-(2-ethyl-1,2-oxazol-2-ium-5-yl)benzenesulfonate Chemical compound O1[N+](CC)=CC=C1C1=CC=CC(S([O-])(=O)=O)=C1 MWOOKDULMBMMPN-UHFFFAOYSA-N 0.000 description 1
- KETLEKPFYHJPIN-UHFFFAOYSA-N 3-(4-nitrophenyl)-2-sulfanylpropanoic acid Chemical compound OC(=O)C(S)CC1=CC=C([N+]([O-])=O)C=C1 KETLEKPFYHJPIN-UHFFFAOYSA-N 0.000 description 1
- YASMWUYVDFUVPO-UHFFFAOYSA-N 3-amino-6-[(2-methylpropan-2-yl)oxy]-2,6-dioxohexanoic acid Chemical compound CC(C)(C)OC(=O)CCC(N)C(=O)C(O)=O YASMWUYVDFUVPO-UHFFFAOYSA-N 0.000 description 1
- NEGBRWMBIHKZDW-UHFFFAOYSA-N 3-benzylsulfanyl-3-methyl-2-oxobutanoic acid Chemical compound OC(=O)C(=O)C(C)(C)SCC1=CC=CC=C1 NEGBRWMBIHKZDW-UHFFFAOYSA-N 0.000 description 1
- FLOKBGAYTGLYGR-UHFFFAOYSA-N 3-bromo-5-methyloxolan-2-one Chemical compound CC1CC(Br)C(=O)O1 FLOKBGAYTGLYGR-UHFFFAOYSA-N 0.000 description 1
- 125000006305 3-iodophenyl group Chemical group [H]C1=C([H])C(I)=C([H])C(*)=C1[H] 0.000 description 1
- QHKABHOOEWYVLI-UHFFFAOYSA-N 3-methyl-2-oxobutanoic acid Chemical compound CC(C)C(=O)C(O)=O QHKABHOOEWYVLI-UHFFFAOYSA-N 0.000 description 1
- AYZZGFLBVPUZQH-UHFFFAOYSA-N 4-(1h-indol-3-yl)-2-oxobutanoic acid Chemical compound C1=CC=C2C(CCC(=O)C(=O)O)=CNC2=C1 AYZZGFLBVPUZQH-UHFFFAOYSA-N 0.000 description 1
- HNZMKKXVFZVKII-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-oxobutanoic acid Chemical compound OC(=O)C(=O)CCC1=CC=C(Cl)C=C1 HNZMKKXVFZVKII-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 description 1
- KKADPXVIOXHVKN-UHFFFAOYSA-N 4-hydroxyphenylpyruvic acid Chemical compound OC(=O)C(=O)CC1=CC=C(O)C=C1 KKADPXVIOXHVKN-UHFFFAOYSA-N 0.000 description 1
- 239000001142 4-methyl-2-oxopentanoic acid Substances 0.000 description 1
- SFJWLUAGMZINFE-UHFFFAOYSA-N 4-methyl-2-oxopentanoyl chloride Chemical compound CC(C)CC(=O)C(Cl)=O SFJWLUAGMZINFE-UHFFFAOYSA-N 0.000 description 1
- DKCOYWUJPJQANX-UHFFFAOYSA-N 4-phenyl-2-sulfanylbutanoic acid Chemical compound OC(=O)C(S)CCC1=CC=CC=C1 DKCOYWUJPJQANX-UHFFFAOYSA-N 0.000 description 1
- QNNOXNDUPDUGTC-UHFFFAOYSA-N 4-piperazin-1-ylbut-2-ynoic acid Chemical compound OC(=O)C#CCN1CCNCC1 QNNOXNDUPDUGTC-UHFFFAOYSA-N 0.000 description 1
- ITGDMPWPIYDICY-UHFFFAOYSA-N 4-piperidin-1-ylbut-2-ynoic acid Chemical compound OC(=O)C#CCN1CCCCC1 ITGDMPWPIYDICY-UHFFFAOYSA-N 0.000 description 1
- BJFBOTPLASYWPD-UHFFFAOYSA-N 4-pyrrolidin-1-ylbut-2-ynoic acid Chemical compound OC(=O)C#CCN1CCCC1 BJFBOTPLASYWPD-UHFFFAOYSA-N 0.000 description 1
- OYNANFOWNSGDJL-UHFFFAOYSA-N 4-sulfanylpyrrolidin-1-ium-2-carboxylate Chemical compound OC(=O)C1CC(S)CN1 OYNANFOWNSGDJL-UHFFFAOYSA-N 0.000 description 1
- INPQIVHQSQUEAJ-UHFFFAOYSA-N 5-fluorotryptophan Chemical compound C1=C(F)C=C2C(CC(N)C(O)=O)=CNC2=C1 INPQIVHQSQUEAJ-UHFFFAOYSA-N 0.000 description 1
- YMEXGEAJNZRQEH-UHFFFAOYSA-N 6-Fluoro-DL-tryptophan Chemical compound FC1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 YMEXGEAJNZRQEH-UHFFFAOYSA-N 0.000 description 1
- UZSNAHYKHTVGRZ-UHFFFAOYSA-N 6-ethoxy-4-hydroxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid Chemical compound CCOC(=O)CC(O)CC(C)(C(O)=O)NC(=O)OC(C)(C)C UZSNAHYKHTVGRZ-UHFFFAOYSA-N 0.000 description 1
- VIJOIFCZOYEASP-UHFFFAOYSA-N 6-methoxy-2,6-dioxohexanoic acid Chemical compound COC(=O)CCCC(=O)C(O)=O VIJOIFCZOYEASP-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- PQSUYGKTWSAVDQ-ZVIOFETBSA-N Aldosterone Chemical compound C([C@@]1([C@@H](C(=O)CO)CC[C@H]1[C@@H]1CC2)C=O)[C@H](O)[C@@H]1[C@]1(C)C2=CC(=O)CC1 PQSUYGKTWSAVDQ-ZVIOFETBSA-N 0.000 description 1
- PQSUYGKTWSAVDQ-UHFFFAOYSA-N Aldosterone Natural products C1CC2C3CCC(C(=O)CO)C3(C=O)CC(O)C2C2(C)C1=CC(=O)CC2 PQSUYGKTWSAVDQ-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 102000004881 Angiotensinogen Human genes 0.000 description 1
- 108090001067 Angiotensinogen Proteins 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- IADUEWIQBXOCDZ-VKHMYHEASA-N Azetidine-2-carboxylic acid Natural products OC(=O)[C@@H]1CCN1 IADUEWIQBXOCDZ-VKHMYHEASA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 125000001433 C-terminal amino-acid group Chemical group 0.000 description 1
- YOKDVWWESDBOGV-QMMMGPOBSA-N CC(C)CN[C@@H](CCC(=O)O)C(=O)OC Chemical compound CC(C)CN[C@@H](CCC(=O)O)C(=O)OC YOKDVWWESDBOGV-QMMMGPOBSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 102000000496 Carboxypeptidases A Human genes 0.000 description 1
- 108010080937 Carboxypeptidases A Proteins 0.000 description 1
- CKLJMWTZIZZHCS-UWTATZPHSA-N D-aspartic acid Chemical compound OC(=O)[C@H](N)CC(O)=O CKLJMWTZIZZHCS-UWTATZPHSA-N 0.000 description 1
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical compound CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 108010059378 Endopeptidases Proteins 0.000 description 1
- 102000005593 Endopeptidases Human genes 0.000 description 1
- 208000010201 Exanthema Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 102000006395 Globulins Human genes 0.000 description 1
- 108010044091 Globulins Proteins 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical group OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- MMFKFJORZBJVNF-UWVGGRQHSA-N His-Leu Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)[C@@H](N)CC1=CN=CN1 MMFKFJORZBJVNF-UWVGGRQHSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000909641 Homo sapiens Transcription factor COE2 Proteins 0.000 description 1
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 1
- JUQLUIFNNFIIKC-YFKPBYRVSA-N L-2-aminopimelic acid Chemical compound OC(=O)[C@@H](N)CCCCC(O)=O JUQLUIFNNFIIKC-YFKPBYRVSA-N 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- SEWIYICDCVPBEW-BYPYZUCNSA-N L-glutamate methyl ester Chemical compound COC(=O)[C@@H](N)CCC(O)=O SEWIYICDCVPBEW-BYPYZUCNSA-N 0.000 description 1
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 description 1
- FORGMRSGVSYZQR-YFKPBYRVSA-N L-leucinamide Chemical compound CC(C)C[C@H](N)C(N)=O FORGMRSGVSYZQR-YFKPBYRVSA-N 0.000 description 1
- HXEACLLIILLPRG-YFKPBYRVSA-N L-pipecolic acid Chemical compound [O-]C(=O)[C@@H]1CCCC[NH2+]1 HXEACLLIILLPRG-YFKPBYRVSA-N 0.000 description 1
- VLJNHYLEOZPXFW-BYPYZUCNSA-N L-prolinamide Chemical compound NC(=O)[C@@H]1CCCN1 VLJNHYLEOZPXFW-BYPYZUCNSA-N 0.000 description 1
- DZLNHFMRPBPULJ-VKHMYHEASA-N L-thioproline Chemical compound OC(=O)[C@@H]1CSCN1 DZLNHFMRPBPULJ-VKHMYHEASA-N 0.000 description 1
- KKCIOUWDFWQUBT-AWEZNQCLSA-N L-thyronine Chemical compound C1=CC(C[C@H](N)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 KKCIOUWDFWQUBT-AWEZNQCLSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- RQVLGLPAZTUBKX-VKHMYHEASA-N L-vinylglycine Chemical compound C=C[C@H](N)C(O)=O RQVLGLPAZTUBKX-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000272168 Laridae Species 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- MDXGYYOJGPFFJL-QMMMGPOBSA-N N(alpha)-t-butoxycarbonyl-L-leucine Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)OC(C)(C)C MDXGYYOJGPFFJL-QMMMGPOBSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- ODHCTXKNWHHXJC-GSVOUGTGSA-N Pyroglutamic acid Natural products OC(=O)[C@H]1CCC(=O)N1 ODHCTXKNWHHXJC-GSVOUGTGSA-N 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- 102100028255 Renin Human genes 0.000 description 1
- 102000005686 Serum Globulins Human genes 0.000 description 1
- 108010045362 Serum Globulins Proteins 0.000 description 1
- MSCCTZZBYHQMQJ-AZAGJHQNSA-N Tocopheryl nicotinate Chemical compound C([C@@](OC1=C(C)C=2C)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CC1=C(C)C=2OC(=O)C1=CC=CN=C1 MSCCTZZBYHQMQJ-AZAGJHQNSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 102100024204 Transcription factor COE2 Human genes 0.000 description 1
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical group [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 108010087924 alanylproline Proteins 0.000 description 1
- 229960002478 aldosterone Drugs 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 125000003275 alpha amino acid group Chemical group 0.000 description 1
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 description 1
- HWXBTNAVRSUOJR-UHFFFAOYSA-N alpha-hydroxyglutaric acid Natural products OC(=O)C(O)CCC(O)=O HWXBTNAVRSUOJR-UHFFFAOYSA-N 0.000 description 1
- 229940009533 alpha-ketoglutaric acid Drugs 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000000890 antigenic effect Effects 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 108010001822 benzoylphenylalanyl-alanyl-proline Proteins 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000004899 c-terminal region Anatomy 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000007958 cherry flavor Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 235000018417 cysteine Nutrition 0.000 description 1
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 1
- 125000000847 cytosin-1-yl group Chemical group [*]N1C(=O)N=C(N([H])[H])C([H])=C1[H] 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- FBWIRBFZWNIGJC-UHFFFAOYSA-N dihomomethionine Chemical compound CSCCCCC([NH3+])C([O-])=O FBWIRBFZWNIGJC-UHFFFAOYSA-N 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000002532 enzyme inhibitor Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- HBOGUIFRIAXYNB-UHFFFAOYSA-N ethyl 2-hydroxy-3-phenylpropanoate Chemical compound CCOC(=O)C(O)CC1=CC=CC=C1 HBOGUIFRIAXYNB-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethyl mercaptane Natural products CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 210000000585 glomerular basement membrane Anatomy 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- 108010025306 histidylleucine Proteins 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-M hydrosulfide Chemical compound [SH-] RWSOTUBLDIXVET-UHFFFAOYSA-M 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 229960002591 hydroxyproline Drugs 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 description 1
- 125000000741 isoleucyl group Chemical group [H]N([H])C(C(C([H])([H])[H])C([H])([H])C([H])([H])[H])C(=O)O* 0.000 description 1
- 229950003188 isovaleryl diethylamide Drugs 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 238000011862 kidney biopsy Methods 0.000 description 1
- HXEACLLIILLPRG-RXMQYKEDSA-N l-pipecolic acid Natural products OC(=O)[C@H]1CCCCN1 HXEACLLIILLPRG-RXMQYKEDSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 125000001909 leucine group Chemical group [H]N(*)C(C(*)=O)C([H])([H])C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- XMGQYMWWDOXHJM-UHFFFAOYSA-N limonene Chemical compound CC(=C)C1CCC(C)=CC1 XMGQYMWWDOXHJM-UHFFFAOYSA-N 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000001525 mentha piperita l. herb oil Substances 0.000 description 1
- VHRYZQNGTZXDNX-UHFFFAOYSA-N methacryloyl chloride Chemical compound CC(=C)C(Cl)=O VHRYZQNGTZXDNX-UHFFFAOYSA-N 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- RMAHPRNLQIRHIJ-UHFFFAOYSA-N methyl carbamimidate Chemical compound COC(N)=N RMAHPRNLQIRHIJ-UHFFFAOYSA-N 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000007968 orange flavor Substances 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 229960001639 penicillamine Drugs 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 235000019477 peppermint oil Nutrition 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- WNHWUSVXJSPDTE-JTQLQIEISA-N phenylsulfanyl (2s)-pyrrolidine-2-carboxylate Chemical compound O=C([C@H]1NCCC1)OSC1=CC=CC=C1 WNHWUSVXJSPDTE-JTQLQIEISA-N 0.000 description 1
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 229920000172 poly(styrenesulfonic acid) Polymers 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229940005642 polystyrene sulfonic acid Drugs 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical class CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 206010038464 renal hypertension Diseases 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000002207 retinal effect Effects 0.000 description 1
- 102220067365 rs143592561 Human genes 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000003607 serino group Chemical group [H]N([H])[C@]([H])(C(=O)[*])C(O[H])([H])[H] 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000003998 snake venom Substances 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000012064 sodium phosphate buffer Substances 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000003375 sulfoxide group Chemical group 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- PGFHBPAUWNEKSM-MQWKRIRWSA-N tert-butyl (2s)-4-methoxypyrrolidine-2-carboxylate Chemical compound COC1CN[C@H](C(=O)OC(C)(C)C)C1 PGFHBPAUWNEKSM-MQWKRIRWSA-N 0.000 description 1
- FDIUCOJHQOLBPR-UHFFFAOYSA-N tert-butyl 3-phenylmethoxy-2-sulfanylpropanoate Chemical compound CC(C)(C)OC(=O)C(S)COCC1=CC=CC=C1 FDIUCOJHQOLBPR-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004014 thioethyl group Chemical group [H]SC([H])([H])C([H])([H])* 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- NJRXVEJTAYWCQJ-UHFFFAOYSA-N thiomalic acid Chemical compound OC(=O)CC(S)C(O)=O NJRXVEJTAYWCQJ-UHFFFAOYSA-N 0.000 description 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 1
- LLSXISZUAPHAJQ-ZETCQYMHSA-N thiophen-2-yl (2s)-pyrrolidine-2-carboxylate Chemical compound O=C([C@H]1NCCC1)OC1=CC=CS1 LLSXISZUAPHAJQ-ZETCQYMHSA-N 0.000 description 1
- 125000000341 threoninyl group Chemical group [H]OC([H])(C([H])([H])[H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 229950009883 tocopheryl nicotinate Drugs 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- BJBUEDPLEOHJGE-IMJSIDKUSA-N trans-3-hydroxy-L-proline Chemical compound O[C@H]1CC[NH2+][C@@H]1C([O-])=O BJBUEDPLEOHJGE-IMJSIDKUSA-N 0.000 description 1
- 125000000430 tryptophan group Chemical group [H]N([H])C(C(=O)O*)C([H])([H])C1=C([H])N([H])C2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 125000001493 tyrosinyl group Chemical group [H]OC1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000019155 vitamin A Nutrition 0.000 description 1
- 239000011719 vitamin A Substances 0.000 description 1
- 235000019154 vitamin C Nutrition 0.000 description 1
- 239000011718 vitamin C Substances 0.000 description 1
- 235000019165 vitamin E Nutrition 0.000 description 1
- 239000011709 vitamin E Substances 0.000 description 1
- 150000003712 vitamin E derivatives Chemical class 0.000 description 1
- 239000009637 wintergreen oil Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/02—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link
- C07K5/022—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2
- C07K5/0222—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2 with the first amino acid being heterocyclic, e.g. Pro, Trp
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Genetics & Genomics (AREA)
- Biochemistry (AREA)
- Biophysics (AREA)
- General Health & Medical Sciences (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Molecular Biology (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US18799280A | 1980-09-17 | 1980-09-17 | |
US29513581A | 1981-08-21 | 1981-08-21 |
Publications (1)
Publication Number | Publication Date |
---|---|
NO813153L true NO813153L (no) | 1982-03-18 |
Family
ID=26883623
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO813153A NO813153L (no) | 1980-09-17 | 1981-09-16 | Nye karboksyalkylpeptider og tioetere og etere av peptider med antihypertensiv aktivitet |
Country Status (8)
Country | Link |
---|---|
EP (1) | EP0048159A3 ( ) |
AU (1) | AU7529581A ( ) |
DD (1) | DD201777A5 ( ) |
ES (2) | ES514664A0 ( ) |
GR (1) | GR75019B ( ) |
NO (1) | NO813153L ( ) |
PL (4) | PL238471A1 ( ) |
PT (1) | PT73685B ( ) |
Families Citing this family (56)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
FR2480747A1 (fr) * | 1980-04-17 | 1981-10-23 | Roques Bernard | Derives d'acides amines et leur application therapeutique |
IE54551B1 (en) * | 1982-01-22 | 1989-11-22 | Ici Plc | Amide derivatives |
JPS6058233B2 (ja) * | 1982-05-24 | 1985-12-19 | 田辺製薬株式会社 | 2−オキソイミダゾリジン誘導体及びその製法 |
IL69136A0 (en) * | 1982-07-19 | 1983-10-31 | Squibb & Sons Inc | Substituted peptide compounds |
US4500713A (en) * | 1982-09-23 | 1985-02-19 | Usv Pharmaceutical Corporation | Therapeutic dipeptides |
DK156484A (da) * | 1983-03-16 | 1984-09-17 | Usv Pharma Corp | Aminosyrederivater |
EP0127124A3 (en) * | 1983-05-23 | 1987-04-08 | Usv Pharmaceutical Corporation | Compounds for treating hypertension |
US4574079A (en) * | 1983-05-27 | 1986-03-04 | Gavras Haralambos P | Radiolabeled angiotensin converting enzyme inhibitors for radiolabeling mammalian organ sites |
IT1165464B (it) * | 1983-07-29 | 1987-04-22 | Montedison Spa | Composti ad attivita' antidotica per la difesa di colture di interesse agrario dall'azione di erbicidi non selettivi |
US4665052A (en) * | 1984-03-27 | 1987-05-12 | Merck & Co., Inc. | Renin inhibitors containing homophe8 and a C-terminal amide cycle |
US4668663A (en) * | 1984-03-27 | 1987-05-26 | Merck & Co., Inc. | Renin inhibitors containing homophe8 |
US5684016A (en) * | 1984-04-12 | 1997-11-04 | Hoechst Aktiengesellschaft | Method of treating cardiac insufficiency |
DE3413710A1 (de) * | 1984-04-12 | 1985-10-24 | Hoechst Ag, 6230 Frankfurt | Verfahren zur behandlung der herzinsuffizienz |
US4500518A (en) * | 1984-04-19 | 1985-02-19 | E. R. Squibb & Sons, Inc. | Amino thiol dipeptides |
US4560506A (en) * | 1984-05-25 | 1985-12-24 | E. R. Squibb & Sons, Inc. | Mercaptocycloalkylcarbonyl and mercaptoarylcarbonyl dipeptides |
GB8422165D0 (en) * | 1984-09-01 | 1984-10-03 | Wellcome Found | Compounds |
EP0175266B1 (en) * | 1984-09-12 | 1996-03-20 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Antihypertensive derivatives |
DE3436386A1 (de) * | 1984-10-04 | 1986-04-10 | Merck Patent Gmbh, 6100 Darmstadt | (thio)morpholine |
IT1176983B (it) * | 1984-10-16 | 1987-08-26 | Zambon Spa | Dipeptidi ad attivita' farmacologica |
CH672792A5 ( ) * | 1985-02-19 | 1989-12-29 | Sandoz Ag | |
ATE72431T1 (de) * | 1985-08-31 | 1992-02-15 | Fisons Plc | 5-gliedrige heterocyclische angiotensinumwandlungsenzym-inhibitoren. |
US5231080A (en) * | 1985-10-15 | 1993-07-27 | Hoechst Aktiengesellschaft | Method for the treatment of atherosclerosis, thrombosis, and peripheral vessel disease |
US5231084A (en) * | 1986-03-27 | 1993-07-27 | Hoechst Aktiengesellschaft | Compounds having a cognition adjuvant action, agents containing them, and the use thereof for the treatment and prophylaxis of cognitive dysfuncitons |
IT1206078B (it) * | 1987-06-03 | 1989-04-14 | Polifarma Spa | Procedimento per la produzione di acido 3-indolpiruvico e suoi derivati loro uso farmaceutico |
DE3803225A1 (de) * | 1988-02-04 | 1989-08-17 | Hoechst Ag | Aminosaeureamide mit psychotroper wirkung, verfahren zu ihrer herstellung, sie enthaltende mittel und deren verwendung |
US5563277A (en) * | 1994-12-21 | 1996-10-08 | Eli Lilly And Company | Process for preparing benzyl-substituted rhodanine derivatives |
US7056935B2 (en) | 1995-06-07 | 2006-06-06 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
GB2324527B (en) * | 1995-06-07 | 1999-12-22 | Guilford Pharm Inc | Small molecule inhibitors of rotamase enzyme activity |
US5859031A (en) * | 1995-06-07 | 1999-01-12 | Gpi Nil Holdings, Inc. | Small molecule inhibitors of rotamase enzyme activity |
US5801197A (en) * | 1995-10-31 | 1998-09-01 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
US6218424B1 (en) | 1996-09-25 | 2001-04-17 | Gpi Nil Holdings, Inc. | Heterocyclic ketone and thioester compounds and uses |
US5801187A (en) | 1996-09-25 | 1998-09-01 | Gpi-Nil Holdings, Inc. | Heterocyclic esters and amides |
US5786378A (en) * | 1996-09-25 | 1998-07-28 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters |
US6274602B1 (en) | 1998-06-03 | 2001-08-14 | Gpi Nil Holdings, Inc. | Heterocyclic thioester and ketone hair growth compositions and uses |
US6271244B1 (en) | 1998-06-03 | 2001-08-07 | Gpi Nil Holdings, Inc. | N-linked urea or carbamate of heterocyclic thioester hair growth compositions and uses |
US6187796B1 (en) | 1998-06-03 | 2001-02-13 | Gpi Nil Holdings, Inc. | Sulfone hair growth compositions and uses |
US5945441A (en) | 1997-06-04 | 1999-08-31 | Gpi Nil Holdings, Inc. | Pyrrolidine carboxylate hair revitalizing agents |
US6187784B1 (en) | 1998-06-03 | 2001-02-13 | Gpi Nil Holdings, Inc. | Pipecolic acid derivative hair growth compositions and uses |
US20010049381A1 (en) | 1997-06-04 | 2001-12-06 | Gpl Nil Holdings, Inc., | Pyrrolidine derivative hair growth compositions and uses |
CZ291417B6 (cs) * | 1997-08-06 | 2003-03-12 | Dsm Fine Chemicals Austria Nfg Gmbh & Co Kg | Způsob výroby 1-pyruvyl-L-prolinu |
US6331537B1 (en) | 1998-06-03 | 2001-12-18 | Gpi Nil Holdings, Inc. | Carboxylic acids and carboxylic acid isosteres of N-heterocyclic compounds |
US6172087B1 (en) | 1998-06-03 | 2001-01-09 | Gpi Nil Holding, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
US6429215B1 (en) | 1998-06-03 | 2002-08-06 | Gpi Nil Holdings, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
CA2334204A1 (en) | 1998-06-03 | 1999-12-09 | Gpi Nil Holdings, Inc. | Heterocyclic ester and amide hair growth compositions and uses |
US6218423B1 (en) | 1998-08-14 | 2001-04-17 | Gpi Nil Holdings, Inc. | Pyrrolidine derivatives for vision and memory disorders |
US6376517B1 (en) | 1998-08-14 | 2002-04-23 | Gpi Nil Holdings, Inc. | Pipecolic acid derivatives for vision and memory disorders |
US6339101B1 (en) | 1998-08-14 | 2002-01-15 | Gpi Nil Holdings, Inc. | N-linked sulfonamides of N-heterocyclic carboxylic acids or isosteres for vision and memory disorders |
US7338976B1 (en) | 1998-08-14 | 2008-03-04 | Gpi Nil Holdings, Inc. | Heterocyclic esters or amides for vision and memory disorders |
US6333340B1 (en) | 1998-08-14 | 2001-12-25 | Gpi Nil Holdings, Inc. | Small molecule sulfonamides for vision and memory disorders |
US6506788B1 (en) | 1998-08-14 | 2003-01-14 | Gpi Nil Holdings, Inc. | N-linked urea or carbamate of heterocyclic thioesters for vision and memory disorders |
US6399648B1 (en) | 1998-08-14 | 2002-06-04 | Gpi Nil Holdings, Inc. | N-oxides of heterocyclic ester, amide, thioester, or ketone for vision and memory disorders |
US6337340B1 (en) | 1998-08-14 | 2002-01-08 | Gpi Nil Holdings, Inc. | Carboxylic acids and isosteres of heterocyclic ring compounds having multiple heteroatoms for vision and memory disorders |
US6335348B1 (en) | 1998-08-14 | 2002-01-01 | Gpi Nil Holdings, Inc. | Nitrogen-containing linear and azepinyl/ compositions and uses for vision and memory disorders |
US6395758B1 (en) | 1998-08-14 | 2002-05-28 | Gpi Nil Holdings, Inc. | Small molecule carbamates or ureas for vision and memory disorders |
US6384056B1 (en) | 1998-08-14 | 2002-05-07 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters or ketones for vision and memory disorders |
US6462072B1 (en) | 1998-09-21 | 2002-10-08 | Gpi Nil Holdings, Inc. | Cyclic ester or amide derivatives |
Family Cites Families (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
IL58849A (en) * | 1978-12-11 | 1983-03-31 | Merck & Co Inc | Carboxyalkyl dipeptides and derivatives thereof,their preparation and pharmaceutical compositions containing them |
JPS5683483A (en) * | 1979-12-13 | 1981-07-08 | Santen Pharmaceut Co Ltd | Thiazolidine compound |
-
1981
- 1981-09-15 EP EP81304210A patent/EP0048159A3/en not_active Withdrawn
- 1981-09-15 GR GR66073A patent/GR75019B/el unknown
- 1981-09-16 AU AU75295/81A patent/AU7529581A/en not_active Abandoned
- 1981-09-16 PT PT73685A patent/PT73685B/pt not_active IP Right Cessation
- 1981-09-16 NO NO813153A patent/NO813153L/no unknown
- 1981-09-17 PL PL23847181A patent/PL238471A1/xx unknown
- 1981-09-17 DD DD81233368A patent/DD201777A5/de unknown
- 1981-09-17 PL PL23306081A patent/PL233060A1/xx unknown
- 1981-09-17 PL PL23847281A patent/PL238472A1/xx unknown
- 1981-09-17 PL PL23847081A patent/PL238470A1/xx unknown
-
1982
- 1982-08-02 ES ES514664A patent/ES514664A0/es active Granted
- 1982-08-02 ES ES514672A patent/ES8306098A1/es not_active Expired
Also Published As
Publication number | Publication date |
---|---|
AU7529581A (en) | 1982-03-25 |
PT73685B (pt) | 2003-12-31 |
EP0048159A2 (en) | 1982-03-24 |
ES8306097A1 (es) | 1983-05-01 |
ES514664A0 (es) | 1983-05-01 |
PL233060A1 (en) | 1983-01-31 |
ES514672A0 (es) | 1983-05-01 |
GR75019B ( ) | 1984-07-12 |
PL238470A1 (en) | 1983-08-29 |
ES8306098A1 (es) | 1983-05-01 |
PL238471A1 (en) | 1983-08-29 |
DD201777A5 (de) | 1983-08-10 |
EP0048159A3 (en) | 1982-05-12 |
PL238472A1 (en) | 1983-08-29 |
PT73685A (en) | 1981-10-01 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NO813153L (no) | Nye karboksyalkylpeptider og tioetere og etere av peptider med antihypertensiv aktivitet | |
US4692458A (en) | Anti-hypertensive agents | |
KR940001769B1 (ko) | 중성 메탈로엔도펩티다제 억제제 | |
EP0007477B1 (en) | 1-(3-mercapto-2-methylpropanoyl)prolyl amino acid derivatives and salts thereof, processes for their preparation, and pharmaceutical compositions containing such compounds | |
EP0073143A2 (en) | Novel complex amido and imido derivatives of carboxyalkyl peptides and thioethers and ethers of peptides | |
RU2298559C2 (ru) | Дипептиды, содержащие на n-концевом аминокислотном остатке 2-тиоацильную группу, в качестве ингибиторов вазопептидазы | |
US4745124A (en) | Orally effective anti-hypertensive agents | |
FI76558B (fi) | Foerfarande foer framstaellning av en vid blodtrycksjukdom anvaendbar inhibition foer angiotensinomvandlande enzym. | |
IE48922B1 (en) | Carboxyalkyl dipeptide derivatives,process for preparing them and pharmaceutical composition containing them | |
EP0048763A1 (en) | Sulfur-containing acylamino acids | |
JP3647914B2 (ja) | 環式アミノ酸誘導体 | |
KR100432618B1 (ko) | 시클릭아미노산유도체 | |
US4500467A (en) | Benzoylthio compounds, their preparation and their use as drugs | |
EP0036713B1 (en) | Angiotensin converting enzyme inhibitors | |
US4734420A (en) | Anti-hypertensive agents | |
US4833152A (en) | Anti-hypertensive agents | |
US4690936A (en) | Anti-hypertensive agents | |
US6426354B1 (en) | Certain heteroaryl substituted thiol inhibitors of endothelin-converting enzyme | |
KR850001629B1 (ko) | 아미노산-및 아실아미노산-치환 티올에스테르 프롤린류의 제조방법 | |
EP0181644B1 (en) | Amino thiol peptides | |
HU199786B (en) | Process for producing peptide derivatives suitable for treating high blood pressure | |
JPH0419228B2 ( ) | ||
NO168306B (no) | Analogifremgangsmaate til fremstilling av en inhibitor forangiotensin-omdannende enzym | |
GB2114561A (en) | Anti-hypertensive agents | |
IE51739B1 (en) | Anti-hypertensive agents |