NO810064L - Fremgangsmaate for fremstilling av fysiologisk aktive pyrimidin-2-sulfider og s-oksyder derav - Google Patents
Fremgangsmaate for fremstilling av fysiologisk aktive pyrimidin-2-sulfider og s-oksyder deravInfo
- Publication number
- NO810064L NO810064L NO810064A NO810064A NO810064L NO 810064 L NO810064 L NO 810064L NO 810064 A NO810064 A NO 810064A NO 810064 A NO810064 A NO 810064A NO 810064 L NO810064 L NO 810064L
- Authority
- NO
- Norway
- Prior art keywords
- group
- formula
- chloropyrimidine
- mmol
- solution
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 25
- 238000002360 preparation method Methods 0.000 title claims description 15
- 150000001875 compounds Chemical class 0.000 claims abstract description 99
- -1 nitro, hydroxy Chemical group 0.000 claims abstract description 47
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 26
- 125000003118 aryl group Chemical group 0.000 claims abstract description 24
- 150000003839 salts Chemical class 0.000 claims abstract description 21
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 18
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 17
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 12
- 125000001424 substituent group Chemical group 0.000 claims abstract description 12
- 125000005843 halogen group Chemical group 0.000 claims abstract description 11
- 230000002378 acidificating effect Effects 0.000 claims abstract description 8
- ABLZXFCXXLZCGV-UHFFFAOYSA-N phosphonic acid group Chemical group P(O)(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000004122 cyclic group Chemical group 0.000 claims abstract description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 5
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims abstract description 5
- 125000001302 tertiary amino group Chemical group 0.000 claims abstract description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract description 4
- 125000004442 acylamino group Chemical group 0.000 claims abstract description 4
- 125000002015 acyclic group Chemical group 0.000 claims abstract description 3
- 125000003368 amide group Chemical group 0.000 claims abstract description 3
- 125000004429 atom Chemical group 0.000 claims abstract description 3
- 239000000460 chlorine Substances 0.000 claims description 23
- 229910052801 chlorine Inorganic materials 0.000 claims description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 13
- 238000004519 manufacturing process Methods 0.000 claims description 11
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 10
- 239000000463 material Substances 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 239000007858 starting material Substances 0.000 claims description 7
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 5
- 150000001768 cations Chemical class 0.000 claims description 4
- 239000003153 chemical reaction reagent Substances 0.000 claims description 4
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 150000003573 thiols Chemical class 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- CFMHODUFAULRDE-UHFFFAOYSA-N 2-benzylsulfinyl-5-chloropyrimidine Chemical compound N1=CC(Cl)=CN=C1S(=O)CC1=CC=CC=C1 CFMHODUFAULRDE-UHFFFAOYSA-N 0.000 claims description 3
- WBFKVUDHNWXMGZ-UHFFFAOYSA-N 2-benzylsulfonyl-5-bromopyrimidine Chemical compound N1=CC(Br)=CN=C1S(=O)(=O)CC1=CC=CC=C1 WBFKVUDHNWXMGZ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000005343 heterocyclic alkyl group Chemical group 0.000 claims description 2
- 230000000087 stabilizing effect Effects 0.000 claims description 2
- 125000005504 styryl group Chemical group 0.000 claims description 2
- 150000007944 thiolates Chemical class 0.000 claims description 2
- UTRLCQDZBAISRZ-UHFFFAOYSA-N 4-(5-chloropyrimidin-2-yl)sulfonylbut-3-en-2-one Chemical compound CC(=O)C=CS(=O)(=O)C1=NC=C(Cl)C=N1 UTRLCQDZBAISRZ-UHFFFAOYSA-N 0.000 claims 1
- MTQAMKPQZOODHH-UHFFFAOYSA-N 5-chloro-2-(2-phenylethenylsulfonyl)pyrimidine Chemical compound N1=CC(Cl)=CN=C1S(=O)(=O)C=CC1=CC=CC=C1 MTQAMKPQZOODHH-UHFFFAOYSA-N 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 abstract description 23
- 230000003647 oxidation Effects 0.000 abstract description 22
- 238000006243 chemical reaction Methods 0.000 abstract description 21
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract description 13
- 230000002159 abnormal effect Effects 0.000 abstract description 12
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 abstract description 11
- 125000004043 oxo group Chemical group O=* 0.000 abstract description 5
- 125000000714 pyrimidinyl group Chemical group 0.000 abstract description 3
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 abstract description 3
- 230000004663 cell proliferation Effects 0.000 abstract 1
- 238000006073 displacement reaction Methods 0.000 abstract 1
- 238000006798 ring closing metathesis reaction Methods 0.000 abstract 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 abstract 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 202
- 239000000243 solution Substances 0.000 description 180
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 111
- 239000000203 mixture Substances 0.000 description 94
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 84
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 78
- 238000005481 NMR spectroscopy Methods 0.000 description 77
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 58
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 45
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 39
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 36
- 239000002904 solvent Substances 0.000 description 32
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 30
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 27
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- 238000010992 reflux Methods 0.000 description 23
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 20
- YQPFSEFXQRQMHG-UHFFFAOYSA-N 5-chloro-1h-pyrimidine-2-thione Chemical compound SC1=NC=C(Cl)C=N1 YQPFSEFXQRQMHG-UHFFFAOYSA-N 0.000 description 17
- 150000003457 sulfones Chemical class 0.000 description 16
- 210000004027 cell Anatomy 0.000 description 15
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- 235000019439 ethyl acetate Nutrition 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 239000011734 sodium Substances 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- 239000003208 petroleum Substances 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 9
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 8
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 150000003462 sulfoxides Chemical class 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 238000005160 1H NMR spectroscopy Methods 0.000 description 7
- HUCDDPXTOUAWRA-UHFFFAOYSA-N 5-chloro-2-(iodomethylsulfanyl)pyrimidine Chemical compound ClC1=CN=C(SCI)N=C1 HUCDDPXTOUAWRA-UHFFFAOYSA-N 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 230000010261 cell growth Effects 0.000 description 7
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 7
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 7
- 125000003396 thiol group Chemical group [H]S* 0.000 description 7
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- 239000002198 insoluble material Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000007800 oxidant agent Substances 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- PGBONSLCITYXTJ-UHFFFAOYSA-N 5-chloro-2-(chloromethylsulfanyl)pyrimidine Chemical compound ClCSC1=NC=C(Cl)C=N1 PGBONSLCITYXTJ-UHFFFAOYSA-N 0.000 description 5
- KCFLVIFHMXKXSG-UHFFFAOYSA-N 5-chloro-2-prop-2-ynylsulfanylpyrimidine Chemical compound ClC1=CN=C(SCC#C)N=C1 KCFLVIFHMXKXSG-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 230000022131 cell cycle Effects 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 5
- 229930192474 thiophene Natural products 0.000 description 5
- ZNMVGPFFXNRTKV-UHFFFAOYSA-N 2-benzylsulfanyl-5-chloropyrimidine Chemical compound N1=CC(Cl)=CN=C1SCC1=CC=CC=C1 ZNMVGPFFXNRTKV-UHFFFAOYSA-N 0.000 description 4
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 4
- XPGIBDJXEVAVTO-UHFFFAOYSA-N 5-bromo-2-chloropyrimidine Chemical compound ClC1=NC=C(Br)C=N1 XPGIBDJXEVAVTO-UHFFFAOYSA-N 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 230000001766 physiological effect Effects 0.000 description 4
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- LXOANVAJTYXINB-UHFFFAOYSA-N 2-benzylsulfanyl-5-bromopyrimidine Chemical compound N1=CC(Br)=CN=C1SCC1=CC=CC=C1 LXOANVAJTYXINB-UHFFFAOYSA-N 0.000 description 3
- MDZCNJHECVPINP-UHFFFAOYSA-N 5-bromo-2-chloro-4,6-dimethylpyrimidine Chemical compound CC1=NC(Cl)=NC(C)=C1Br MDZCNJHECVPINP-UHFFFAOYSA-N 0.000 description 3
- GIUNKHSQPXBIFE-UHFFFAOYSA-N 5-chloro-2-(iodomethylsulfinyl)pyrimidine Chemical compound ClC1=CN=C(S(=O)CI)N=C1 GIUNKHSQPXBIFE-UHFFFAOYSA-N 0.000 description 3
- SOUFZTWGFMIRQK-UHFFFAOYSA-N 5-chloro-2-[(4-chlorophenoxy)methylsulfanyl]pyrimidine Chemical compound C1=CC(Cl)=CC=C1OCSC1=NC=C(Cl)C=N1 SOUFZTWGFMIRQK-UHFFFAOYSA-N 0.000 description 3
- PVQBPCUDJZNALN-UHFFFAOYSA-N 5-chloro-2-[(5-chloropyrimidin-2-yl)oxymethylsulfanyl]pyrimidine Chemical compound N1=CC(Cl)=CN=C1OCSC1=NC=C(Cl)C=N1 PVQBPCUDJZNALN-UHFFFAOYSA-N 0.000 description 3
- YYQOYLZOMFNKKG-UHFFFAOYSA-N 5-chloro-2-methylsulfanylpyrimidine Chemical compound CSC1=NC=C(Cl)C=N1 YYQOYLZOMFNKKG-UHFFFAOYSA-N 0.000 description 3
- YNTUFGHUELCCQR-UHFFFAOYSA-N 5-chloro-2-phenylsulfanylpyrimidine Chemical compound N1=CC(Cl)=CN=C1SC1=CC=CC=C1 YNTUFGHUELCCQR-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 230000002152 alkylating effect Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 150000002924 oxiranes Chemical class 0.000 description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 239000012286 potassium permanganate Substances 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 3
- PSRGBWDWQPDGPM-UHFFFAOYSA-N 1-chloro-3-(5-chloropyrimidin-2-yl)sulfanylpropan-2-ol Chemical compound ClCC(O)CSC1=NC=C(Cl)C=N1 PSRGBWDWQPDGPM-UHFFFAOYSA-N 0.000 description 2
- CEJAHXLRNZJPQH-UHFFFAOYSA-N 2,5-dichloropyrimidine Chemical compound ClC1=CN=C(Cl)N=C1 CEJAHXLRNZJPQH-UHFFFAOYSA-N 0.000 description 2
- IEQKGDZZLKQDPY-UHFFFAOYSA-N 2-benzylsulfanyl-5-bromo-4,6-dimethylpyrimidine Chemical compound CC1=C(Br)C(C)=NC(SCC=2C=CC=CC=2)=N1 IEQKGDZZLKQDPY-UHFFFAOYSA-N 0.000 description 2
- DONRDSVBRXKNPO-UHFFFAOYSA-N 2-benzylsulfonyl-5-chloropyrimidine Chemical compound N1=CC(Cl)=CN=C1S(=O)(=O)CC1=CC=CC=C1 DONRDSVBRXKNPO-UHFFFAOYSA-N 0.000 description 2
- DILXLMRYFWFBGR-UHFFFAOYSA-N 2-formylbenzene-1,4-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(S(O)(=O)=O)C(C=O)=C1 DILXLMRYFWFBGR-UHFFFAOYSA-N 0.000 description 2
- PELYSUXCWVOHPG-UHFFFAOYSA-N 2-iodo-n-(2-methylphenyl)acetamide Chemical compound CC1=CC=CC=C1NC(=O)CI PELYSUXCWVOHPG-UHFFFAOYSA-N 0.000 description 2
- RJWGGLVUYJLKRT-UHFFFAOYSA-N 3-(5-chloropyrimidin-2-yl)sulfonylpentan-3-ylphosphonic acid Chemical compound CCC(CC)(P(O)(O)=O)S(=O)(=O)C1=NC=C(Cl)C=N1 RJWGGLVUYJLKRT-UHFFFAOYSA-N 0.000 description 2
- GJMCPBUCFOSOKN-UHFFFAOYSA-N 5-bromo-2-(thiophen-2-ylmethylsulfanyl)pyrimidine Chemical compound N1=CC(Br)=CN=C1SCC1=CC=CS1 GJMCPBUCFOSOKN-UHFFFAOYSA-N 0.000 description 2
- CPLBOQSYONKFSP-UHFFFAOYSA-N 5-bromo-2-phenylsulfanylpyrimidine Chemical compound N1=CC(Br)=CN=C1SC1=CC=CC=C1 CPLBOQSYONKFSP-UHFFFAOYSA-N 0.000 description 2
- KONYTYMKVGOEBN-UHFFFAOYSA-N 5-bromo-4,6-dimethyl-1h-pyrimidine-2-thione Chemical compound CC1=NC(=S)NC(C)=C1Br KONYTYMKVGOEBN-UHFFFAOYSA-N 0.000 description 2
- JJXPKWJTZKBJQS-UHFFFAOYSA-N 5-chloro-1-[(5-chloropyrimidin-2-yl)sulfanylmethyl]pyrimidin-2-one Chemical compound N1=CC(Cl)=CN=C1SCN1C(=O)N=CC(Cl)=C1 JJXPKWJTZKBJQS-UHFFFAOYSA-N 0.000 description 2
- ASYNSKXFOWAKQM-UHFFFAOYSA-N 5-chloro-2-(5-nitrothiophen-2-yl)sulfanylpyrimidine Chemical compound S1C([N+](=O)[O-])=CC=C1SC1=NC=C(Cl)C=N1 ASYNSKXFOWAKQM-UHFFFAOYSA-N 0.000 description 2
- AXQBWFJQDBCVAU-UHFFFAOYSA-N 5-chloro-2-(chloromethylsulfonyl)pyrimidine Chemical compound ClCS(=O)(=O)C1=NC=C(Cl)C=N1 AXQBWFJQDBCVAU-UHFFFAOYSA-N 0.000 description 2
- JSUSHJNGUSLNBK-UHFFFAOYSA-N 5-chloro-2-(oxiran-2-ylmethylsulfanyl)pyrimidine Chemical compound N1=CC(Cl)=CN=C1SCC1OC1 JSUSHJNGUSLNBK-UHFFFAOYSA-N 0.000 description 2
- YKJDZLMYVKOOKD-UHFFFAOYSA-N 5-chloro-2-[(5-chloropyrimidin-2-yl)sulfonylmethylsulfinyl]pyrimidine Chemical compound N1=CC(Cl)=CN=C1S(=O)CS(=O)(=O)C1=NC=C(Cl)C=N1 YKJDZLMYVKOOKD-UHFFFAOYSA-N 0.000 description 2
- FEXFFZBLHZLWDA-UHFFFAOYSA-N 5-chloro-2-propa-1,2-dienylsulfonylpyrimidine Chemical compound ClC1=CN=C(S(=O)(=O)C=C=C)N=C1 FEXFFZBLHZLWDA-UHFFFAOYSA-N 0.000 description 2
- GCEZBTQPTWHODP-UHFFFAOYSA-N 5-chloro-2-thiophen-2-ylsulfanylpyrimidine Chemical compound N1=CC(Cl)=CN=C1SC1=CC=CS1 GCEZBTQPTWHODP-UHFFFAOYSA-N 0.000 description 2
- ZAOPTPRRZLCPDW-UHFFFAOYSA-N 5-fluoro-2-phenylsulfanylpyrimidine Chemical compound N1=CC(F)=CN=C1SC1=CC=CC=C1 ZAOPTPRRZLCPDW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 230000006820 DNA synthesis Effects 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 150000001361 allenes Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 150000001720 carbohydrates Chemical group 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 2
- NZZFYRREKKOMAT-UHFFFAOYSA-N diiodomethane Chemical compound ICI NZZFYRREKKOMAT-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 150000002081 enamines Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- JKQOBWVOAYFWKG-UHFFFAOYSA-N molybdenum trioxide Chemical compound O=[Mo](=O)=O JKQOBWVOAYFWKG-UHFFFAOYSA-N 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012038 nucleophile Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- VOHJWGCPAXJFFX-UHFFFAOYSA-N prop-2-ynyl carbamimidothioate;hydrobromide Chemical compound [Br-].NC(=[NH2+])SCC#C VOHJWGCPAXJFFX-UHFFFAOYSA-N 0.000 description 2
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- IQQAWKBHFPJYDR-UHFFFAOYSA-N thiophen-2-ylmethyl 2-(5-bromo-4,6-dimethylpyrimidin-2-yl)sulfanylacetate Chemical compound CC1=C(Br)C(C)=NC(SCC(=O)OCC=2SC=CC=2)=N1 IQQAWKBHFPJYDR-UHFFFAOYSA-N 0.000 description 2
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 238000006886 vinylation reaction Methods 0.000 description 2
- OEYMQQDJCUHKQS-UHFFFAOYSA-N (4-oxoazetidin-2-yl) acetate Chemical compound CC(=O)OC1CC(=O)N1 OEYMQQDJCUHKQS-UHFFFAOYSA-N 0.000 description 1
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 1
- BEALZAGHRIUTGV-UHFFFAOYSA-N 1-(3-chloropropyl)azocane Chemical compound ClCCCN1CCCCCCC1 BEALZAGHRIUTGV-UHFFFAOYSA-N 0.000 description 1
- LLEGBFUQORMBQY-UHFFFAOYSA-N 1-[3-(5-chloropyrimidin-2-yl)sulfanylpropyl]azocane Chemical compound N1=CC(Cl)=CN=C1SCCCN1CCCCCCC1 LLEGBFUQORMBQY-UHFFFAOYSA-N 0.000 description 1
- RFOWOPIZQXIPRQ-UHFFFAOYSA-N 1-chloro-3-(5-chloropyrimidin-2-yl)sulfinylpropan-2-ol Chemical compound ClCC(O)CS(=O)C1=NC=C(Cl)C=N1 RFOWOPIZQXIPRQ-UHFFFAOYSA-N 0.000 description 1
- PJLGIZXAYTZSIZ-UHFFFAOYSA-N 1-chloro-4-(chloromethoxy)benzene Chemical compound ClCOC1=CC=C(Cl)C=C1 PJLGIZXAYTZSIZ-UHFFFAOYSA-N 0.000 description 1
- CSCPPACGZOOCGX-MICDWDOJSA-N 1-deuteriopropan-2-one Chemical compound [2H]CC(C)=O CSCPPACGZOOCGX-MICDWDOJSA-N 0.000 description 1
- FLIUGEDRGZESKZ-UHFFFAOYSA-N 2-(5-bromo-4,6-dimethylpyrimidin-2-yl)sulfanylacetamide Chemical compound CC1=NC(SCC(N)=O)=NC(C)=C1Br FLIUGEDRGZESKZ-UHFFFAOYSA-N 0.000 description 1
- HHBPTWQIPUFCHI-UHFFFAOYSA-N 2-(5-bromo-4,6-dimethylpyrimidin-2-yl)sulfonylacetamide Chemical compound CC1=NC(S(=O)(=O)CC(N)=O)=NC(C)=C1Br HHBPTWQIPUFCHI-UHFFFAOYSA-N 0.000 description 1
- STSBQFLHMPMMPC-UHFFFAOYSA-N 2-(5-bromopyrimidin-2-yl)sulfanyl-1-phenylethanone Chemical compound N1=CC(Br)=CN=C1SCC(=O)C1=CC=CC=C1 STSBQFLHMPMMPC-UHFFFAOYSA-N 0.000 description 1
- GHZPIUUUDFKIAP-UHFFFAOYSA-N 2-(benzenesulfinyl)-5-chloropyrimidine Chemical compound N1=CC(Cl)=CN=C1S(=O)C1=CC=CC=C1 GHZPIUUUDFKIAP-UHFFFAOYSA-N 0.000 description 1
- OCWUTUPHPYTRFC-UHFFFAOYSA-N 2-(benzenesulfonyl)-5-bromopyrimidine Chemical compound N1=CC(Br)=CN=C1S(=O)(=O)C1=CC=CC=C1 OCWUTUPHPYTRFC-UHFFFAOYSA-N 0.000 description 1
- FBZVMUWMUYAHMG-UHFFFAOYSA-N 2-(benzenesulfonyl)-5-chloropyrimidine Chemical compound N1=CC(Cl)=CN=C1S(=O)(=O)C1=CC=CC=C1 FBZVMUWMUYAHMG-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- AGIBHMPYXXPGAX-UHFFFAOYSA-N 2-(iodomethyl)oxirane Chemical compound ICC1CO1 AGIBHMPYXXPGAX-UHFFFAOYSA-N 0.000 description 1
- IHCCLXNEEPMSIO-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 IHCCLXNEEPMSIO-UHFFFAOYSA-N 0.000 description 1
- APLNAFMUEHKRLM-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)N=CN2 APLNAFMUEHKRLM-UHFFFAOYSA-N 0.000 description 1
- YZMORZUVZMOFQG-UHFFFAOYSA-N 2-benzylsulfinyl-5-bromopyrimidine Chemical compound N1=CC(Br)=CN=C1S(=O)CC1=CC=CC=C1 YZMORZUVZMOFQG-UHFFFAOYSA-N 0.000 description 1
- CQGWJGWODWJJRO-UHFFFAOYSA-N 2-benzylsulfonyl-5-bromo-4,6-dimethylpyrimidine Chemical compound CC1=C(Br)C(C)=NC(S(=O)(=O)CC=2C=CC=CC=2)=N1 CQGWJGWODWJJRO-UHFFFAOYSA-N 0.000 description 1
- ZPNFMDYBAQDFDY-UHFFFAOYSA-N 2-bromo-5-nitrothiophene Chemical compound [O-][N+](=O)C1=CC=C(Br)S1 ZPNFMDYBAQDFDY-UHFFFAOYSA-N 0.000 description 1
- AYLPWFVMBCQRGR-UHFFFAOYSA-N 2-bromo-n-(2-methylphenyl)acetamide Chemical compound CC1=CC=CC=C1NC(=O)CBr AYLPWFVMBCQRGR-UHFFFAOYSA-N 0.000 description 1
- SYZRZLUNWVNNNV-UHFFFAOYSA-N 2-bromoacetyl chloride Chemical compound ClC(=O)CBr SYZRZLUNWVNNNV-UHFFFAOYSA-N 0.000 description 1
- AGYUQBNABXVWMS-UHFFFAOYSA-N 2-chloro-5-fluoropyrimidine Chemical compound FC1=CN=C(Cl)N=C1 AGYUQBNABXVWMS-UHFFFAOYSA-N 0.000 description 1
- WSZRCNZXKKTLQE-UHFFFAOYSA-N 2-chloro-5-iodopyrimidine Chemical compound ClC1=NC=C(I)C=N1 WSZRCNZXKKTLQE-UHFFFAOYSA-N 0.000 description 1
- QLVKECUOHNDWOI-UHFFFAOYSA-N 2-oxo-1,3,2$l^{5}-diazaphosphonan-2-amine Chemical compound NP1(=O)NCCCCCCN1 QLVKECUOHNDWOI-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 description 1
- XPTMJJIPRSWBDK-UHFFFAOYSA-N 3-prop-2-ynylsulfanylprop-1-yne Chemical compound C#CCSCC#C XPTMJJIPRSWBDK-UHFFFAOYSA-N 0.000 description 1
- VEOQUVQXCVRRBY-UHFFFAOYSA-N 4-(5-chloropyrimidin-2-yl)sulfanylbut-3-en-2-one Chemical compound CC(=O)C=CSC1=NC=C(Cl)C=N1 VEOQUVQXCVRRBY-UHFFFAOYSA-N 0.000 description 1
- QWFFZZPFRPINKJ-UHFFFAOYSA-N 4-[(5-chloro-2h-pyrimidin-1-yl)sulfonyl]but-3-en-2-one Chemical compound CC(=O)C=CS(=O)(=O)N1CN=CC(Cl)=C1 QWFFZZPFRPINKJ-UHFFFAOYSA-N 0.000 description 1
- STABAPSYCQFWOK-UHFFFAOYSA-N 4-chlorobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(Cl)C=C1 STABAPSYCQFWOK-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- MWKMQPSNTJCASD-UHFFFAOYSA-N 4-phenylazetidin-2-one Chemical compound N1C(=O)CC1C1=CC=CC=C1 MWKMQPSNTJCASD-UHFFFAOYSA-N 0.000 description 1
- VTUDATOSQGYWML-UHFFFAOYSA-N 5-bromo-1h-pyrimidin-2-one Chemical compound OC1=NC=C(Br)C=N1 VTUDATOSQGYWML-UHFFFAOYSA-N 0.000 description 1
- YFCSMQKDQMKSCX-UHFFFAOYSA-N 5-bromo-2-(thiophen-2-ylmethylsulfinyl)pyrimidine Chemical compound N1=CC(Br)=CN=C1S(=O)CC1=CC=CS1 YFCSMQKDQMKSCX-UHFFFAOYSA-N 0.000 description 1
- DDFKYMKZRGHLAK-UHFFFAOYSA-N 5-bromo-2-(thiophen-2-ylmethylsulfonyl)pyrimidine Chemical compound N1=CC(Br)=CN=C1S(=O)(=O)CC1=CC=CS1 DDFKYMKZRGHLAK-UHFFFAOYSA-N 0.000 description 1
- WFLSPLBDSJLPFW-UHFFFAOYSA-N 5-bromo-2-methylsulfanylpyrimidine Chemical compound CSC1=NC=C(Br)C=N1 WFLSPLBDSJLPFW-UHFFFAOYSA-N 0.000 description 1
- YJEWVVYJOJJLBP-UHFFFAOYSA-N 5-bromo-2-methylsulfanylpyrimidine-4-carboxylic acid Chemical compound CSC1=NC=C(Br)C(C(O)=O)=N1 YJEWVVYJOJJLBP-UHFFFAOYSA-N 0.000 description 1
- WYOCZUNSYMRRKF-UHFFFAOYSA-N 5-bromo-2-methylsulfinylpyrimidine Chemical compound CS(=O)C1=NC=C(Br)C=N1 WYOCZUNSYMRRKF-UHFFFAOYSA-N 0.000 description 1
- MVIRMXABVKJKAR-UHFFFAOYSA-N 5-bromo-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC=C(Br)C=N1 MVIRMXABVKJKAR-UHFFFAOYSA-N 0.000 description 1
- ITOMZKFANJAYJE-UHFFFAOYSA-N 5-bromo-4,6-dimethyl-2-(4-methylphenyl)sulfonylpyrimidine Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C1=NC(C)=C(Br)C(C)=N1 ITOMZKFANJAYJE-UHFFFAOYSA-N 0.000 description 1
- OCSYCDVQABSEPJ-UHFFFAOYSA-N 5-chloro-1h-pyrimidin-2-one Chemical compound OC1=NC=C(Cl)C=N1 OCSYCDVQABSEPJ-UHFFFAOYSA-N 0.000 description 1
- RJPSBYOHYVFGIQ-UHFFFAOYSA-N 5-chloro-2-(5-chloropyrimidin-2-yl)sulfonylpyrimidine Chemical group N1=CC(Cl)=CN=C1S(=O)(=O)C1=NC=C(Cl)C=N1 RJPSBYOHYVFGIQ-UHFFFAOYSA-N 0.000 description 1
- XAOXCILWZGSXFR-UHFFFAOYSA-N 5-chloro-2-(5-nitrothiophen-2-yl)sulfonylpyrimidine Chemical compound S1C([N+](=O)[O-])=CC=C1S(=O)(=O)C1=NC=C(Cl)C=N1 XAOXCILWZGSXFR-UHFFFAOYSA-N 0.000 description 1
- AMXLAPRVHQVTDU-UHFFFAOYSA-N 5-chloro-2-(chloromethylsulfinyl)pyrimidine Chemical compound ClCS(=O)C1=NC=C(Cl)C=N1 AMXLAPRVHQVTDU-UHFFFAOYSA-N 0.000 description 1
- LXIJKYKAXZFMMO-UHFFFAOYSA-N 5-chloro-2-(diethoxyphosphorylmethylsulfonyl)pyrimidine Chemical compound CCOP(=O)(OCC)CS(=O)(=O)C1=NC=C(Cl)C=N1 LXIJKYKAXZFMMO-UHFFFAOYSA-N 0.000 description 1
- SMCBWPSPCSKMAZ-UHFFFAOYSA-N 5-chloro-2-(iodomethylsulfonyl)pyrimidine Chemical compound ClC1=CN=C(S(=O)(=O)CI)N=C1 SMCBWPSPCSKMAZ-UHFFFAOYSA-N 0.000 description 1
- ZDFGXGVKVDZLBI-UHFFFAOYSA-N 5-chloro-2-(oxiran-2-ylmethylsulfinyl)pyrimidine Chemical compound N1=CC(Cl)=CN=C1S(=O)CC1OC1 ZDFGXGVKVDZLBI-UHFFFAOYSA-N 0.000 description 1
- DWMIEQSIQYKUQD-UHFFFAOYSA-N 5-chloro-2-[(5-chloropyrimidin-2-yl)sulfonylmethoxy]pyrimidine Chemical compound N1=CC(Cl)=CN=C1OCS(=O)(=O)C1=NC=C(Cl)C=N1 DWMIEQSIQYKUQD-UHFFFAOYSA-N 0.000 description 1
- MTQAMKPQZOODHH-VOTSOKGWSA-N 5-chloro-2-[(e)-2-phenylethenyl]sulfonylpyrimidine Chemical compound N1=CC(Cl)=CN=C1S(=O)(=O)\C=C\C1=CC=CC=C1 MTQAMKPQZOODHH-VOTSOKGWSA-N 0.000 description 1
- SEPCYCDQJZTPHO-UHFFFAOYSA-N 5-chloro-2-methylsulfanylpyrimidine-4-carboxylic acid Chemical compound CSC1=NC=C(Cl)C(C(O)=O)=N1 SEPCYCDQJZTPHO-UHFFFAOYSA-N 0.000 description 1
- CKHNPGGEXNTNPC-UHFFFAOYSA-N 5-chloro-2-methylsulfinylpyrimidine Chemical compound CS(=O)C1=NC=C(Cl)C=N1 CKHNPGGEXNTNPC-UHFFFAOYSA-N 0.000 description 1
- UEWMTFZGDJZUPJ-UHFFFAOYSA-N 5-chloro-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC=C(Cl)C=N1 UEWMTFZGDJZUPJ-UHFFFAOYSA-N 0.000 description 1
- CGZXTNCFCUZUBZ-UHFFFAOYSA-N 5-fluoro-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC=C(F)C=N1 CGZXTNCFCUZUBZ-UHFFFAOYSA-N 0.000 description 1
- RXGDYFOXUUWUHO-UHFFFAOYSA-N 5-iodo-2-(4-methylphenyl)sulfonylpyrimidine Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C1=NC=C(I)C=N1 RXGDYFOXUUWUHO-UHFFFAOYSA-N 0.000 description 1
- DEXFNLNNUZKHNO-UHFFFAOYSA-N 6-[3-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-3-oxopropyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)C(CCC1=CC2=C(NC(O2)=O)C=C1)=O DEXFNLNNUZKHNO-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 206010012442 Dermatitis contact Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 238000006546 Horner-Wadsworth-Emmons reaction Methods 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- NEAPKZHDYMQZCB-UHFFFAOYSA-N N-[2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]ethyl]-2-oxo-3H-1,3-benzoxazole-6-carboxamide Chemical compound C1CN(CCN1CCNC(=O)C2=CC3=C(C=C2)NC(=O)O3)C4=CN=C(N=C4)NC5CC6=CC=CC=C6C5 NEAPKZHDYMQZCB-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 230000018199 S phase Effects 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- SWEDAZLCYJDAGW-UHFFFAOYSA-N Thiophene-2-thiol Chemical compound SC1=CC=CS1 SWEDAZLCYJDAGW-UHFFFAOYSA-N 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- FHKPLLOSJHHKNU-INIZCTEOSA-N [(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]-(oxan-4-yl)methanone Chemical compound C(C)N1N=CC(=C1C)C=1N(C2=NC=NC(=C2N=1)O[C@@H]1CN(CC1)C(=O)C1CCOCC1)C FHKPLLOSJHHKNU-INIZCTEOSA-N 0.000 description 1
- XAKBSHICSHRJCL-UHFFFAOYSA-N [CH2]C(=O)C1=CC=CC=C1 Chemical group [CH2]C(=O)C1=CC=CC=C1 XAKBSHICSHRJCL-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- WJAASTDRAAMYNK-UHFFFAOYSA-N benzyl carbamimidothioate;hydron;chloride Chemical compound Cl.NC(=N)SCC1=CC=CC=C1 WJAASTDRAAMYNK-UHFFFAOYSA-N 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 210000001185 bone marrow Anatomy 0.000 description 1
- XRGPFNGLRSIPSA-UHFFFAOYSA-N butyn-2-one Chemical compound CC(=O)C#C XRGPFNGLRSIPSA-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 208000010247 contact dermatitis Diseases 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- ZJULYDCRWUEPTK-UHFFFAOYSA-N dichloromethyl Chemical compound Cl[CH]Cl ZJULYDCRWUEPTK-UHFFFAOYSA-N 0.000 description 1
- LXCYSACZTOKNNS-UHFFFAOYSA-N diethoxy(oxo)phosphanium Chemical group CCO[P+](=O)OCC LXCYSACZTOKNNS-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002084 enol ethers Chemical class 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- KVIPHDKUOLVVQN-UHFFFAOYSA-N ethene;hydrate Chemical compound O.C=C KVIPHDKUOLVVQN-UHFFFAOYSA-N 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 125000003843 furanosyl group Chemical group 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005640 glucopyranosyl group Chemical group 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000003147 glycosyl group Chemical group 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- YHPFSSDMRBEYRJ-UHFFFAOYSA-N hydron;thiourea;bromide Chemical class Br.NC(N)=S YHPFSSDMRBEYRJ-UHFFFAOYSA-N 0.000 description 1
- 150000001261 hydroxy acids Chemical class 0.000 description 1
- 125000000879 imine group Chemical group 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 230000008105 immune reaction Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- PGLTVOMIXTUURA-UHFFFAOYSA-N iodoacetamide Chemical compound NC(=O)CI PGLTVOMIXTUURA-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000031864 metaphase Effects 0.000 description 1
- PSBLUGJWGGDSKM-UHFFFAOYSA-N methyl 5-chloro-2-methylsulfanylpyrimidine-4-carboxylate Chemical compound COC(=O)C1=NC(SC)=NC=C1Cl PSBLUGJWGGDSKM-UHFFFAOYSA-N 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- JFIKHFNGAURIIB-UHFFFAOYSA-N n,n-dimethyl-1,1-bis(phenylmethoxy)methanamine Chemical compound C=1C=CC=CC=1COC(N(C)C)OCC1=CC=CC=C1 JFIKHFNGAURIIB-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical group 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 238000003408 phase transfer catalysis Methods 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000003132 pyranosyl group Chemical group 0.000 description 1
- HBCQSNAFLVXVAY-UHFFFAOYSA-N pyrimidine-2-thiol Chemical compound SC1=NC=CC=N1 HBCQSNAFLVXVAY-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- KAZGHCKETHQOPA-UHFFFAOYSA-N s-(5-chloropyrimidin-2-yl) n-methylcarbamothioate Chemical compound CNC(=O)SC1=NC=C(Cl)C=N1 KAZGHCKETHQOPA-UHFFFAOYSA-N 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003571 thiolactams Chemical class 0.000 description 1
- ZPHGMBGIFODUMF-UHFFFAOYSA-N thiophen-2-ylmethanol Chemical compound OCC1=CC=CS1 ZPHGMBGIFODUMF-UHFFFAOYSA-N 0.000 description 1
- DVKOYUPWZWIPGR-UHFFFAOYSA-N thiophen-2-ylmethyl 2-(5-bromo-4,6-dimethylpyrimidin-2-yl)sulfonylacetate Chemical compound CC1=C(Br)C(C)=NC(S(=O)(=O)CC(=O)OCC=2SC=CC=2)=N1 DVKOYUPWZWIPGR-UHFFFAOYSA-N 0.000 description 1
- LIGBFROSTNFYKH-UHFFFAOYSA-N thiophen-2-ylmethyl 2-bromoacetate Chemical compound BrCC(=O)OCC1=CC=CS1 LIGBFROSTNFYKH-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/38—One sulfur atom
- C07D239/40—One sulfur atom as doubly bound sulfur atom or as unsubstituted mercapto radical
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/02—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
- C07C233/04—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals with carbon atoms of carboxamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C233/07—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals with carbon atoms of carboxamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/38—One sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/645—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having two nitrogen atoms as the only ring hetero atoms
- C07F9/6509—Six-membered rings
- C07F9/6512—Six-membered rings having the nitrogen atoms in positions 1 and 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H17/00—Compounds containing heterocyclic radicals directly attached to hetero atoms of saccharide radicals
- C07H17/02—Heterocyclic radicals containing only nitrogen as ring hetero atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Biochemistry (AREA)
- Engineering & Computer Science (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biotechnology (AREA)
- Genetics & Genomics (AREA)
- Dermatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Glass Compositions (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
- Saccharide Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Treatment Of Liquids With Adsorbents In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8000802 | 1980-01-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO810064L true NO810064L (no) | 1981-07-13 |
Family
ID=10510550
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO810064A NO810064L (no) | 1980-01-10 | 1981-01-09 | Fremgangsmaate for fremstilling av fysiologisk aktive pyrimidin-2-sulfider og s-oksyder derav |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4423047A (es) |
| EP (1) | EP0033195B1 (es) |
| JP (1) | JPS56154467A (es) |
| AT (1) | ATE16799T1 (es) |
| AU (1) | AU549117B2 (es) |
| CA (1) | CA1168240A (es) |
| DE (1) | DE3173080D1 (es) |
| DK (1) | DK149885B (es) |
| ES (2) | ES8205782A1 (es) |
| NO (1) | NO810064L (es) |
| NZ (1) | NZ195992A (es) |
| ZA (1) | ZA81140B (es) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4596870A (en) * | 1981-01-09 | 1986-06-24 | Nyegaard & Co. A.S. | Substituted pyrimidin-2-ones and the salts thereof |
| JPS58159479A (ja) * | 1982-02-24 | 1983-09-21 | ニユエガ−ド・アンド・コンパニ−・アクシエ／セルカペト | 置換されたピリミジン−２−オン化合物 |
| JPH0739394B2 (ja) * | 1985-05-30 | 1995-05-01 | 住友化学工業株式会社 | 含窒素複素環化合物およびそれを有効成分として含有する有害生物防除剤 |
| JPS63179840A (ja) * | 1986-07-24 | 1988-07-23 | Yamanouchi Pharmaceut Co Ltd | 新規化学物質 |
| US4808591A (en) * | 1988-02-16 | 1989-02-28 | Pfizer Inc. | Antiulcer 8-(2-pyrimidylsulfinyl)quinolines |
| DE3912155A1 (de) * | 1988-09-24 | 1990-03-29 | Bayer Ag | Schaedlingsbekaempfungsmittel auf basis von 2-halogenalkylthio-substituierten pyrimidin-derivaten |
| AU7742491A (en) * | 1990-04-12 | 1991-11-11 | Stereo-Chemical Genetics, Inc. | Synthetic piperidinediones with cytostatic activity |
| GB9205487D0 (en) * | 1991-03-28 | 1992-04-29 | Ici Plc | Heterocyclic compounds |
| GB9106609D0 (en) * | 1991-03-28 | 1991-05-15 | Ici Plc | Heterocyclic compounds |
| GB9205484D0 (en) * | 1991-03-28 | 1992-04-29 | Ici Plc | Heterocyclic compounds |
| GB9219635D0 (en) * | 1992-09-16 | 1992-10-28 | Ici Plc | Heterocyclic compounds |
| DE19622270A1 (de) * | 1996-06-03 | 1997-12-04 | Basf Ag | Pyrimidin-4-carbonsäureamide |
| US6268310B1 (en) * | 1997-01-28 | 2001-07-31 | Nippon Soda Co., Ltd. | Oxazole derivative, process for producing the same, and herbicide |
| CA2343027A1 (en) | 1998-09-09 | 2000-03-16 | Metabasis Therapeutics, Inc. | Novel heteroaromatic inhibitors of fructose 1,6-bisphosphatase |
| CN1376145A (zh) * | 1998-11-30 | 2002-10-23 | 石原产业株式会社 | 间硝基苯酚衍生物及其制备方法 |
| US6313072B1 (en) * | 1999-02-18 | 2001-11-06 | American Cyanamid Company | Herbicidal 2-aryloxy-or 2-arylthio-6-arylpyrimidines |
| US7563774B2 (en) | 2000-06-29 | 2009-07-21 | Metabasis Therapeutics, Inc. | Combination of FBPase inhibitors and antidiabetic agents useful for the treatment of diabetes |
| US7138404B2 (en) * | 2001-05-23 | 2006-11-21 | Hoffmann-La Roche Inc. | 4-aminopyrimidine derivatives |
| DE10154075A1 (de) * | 2001-11-02 | 2003-05-15 | Bayer Cropscience Ag | Substituierte Pyrimidine |
| EP2081905B1 (en) * | 2006-07-28 | 2012-09-12 | Boehringer Ingelheim International GmbH | Sulfonyl compounds which modulate the cb2 receptor |
| US9364191B2 (en) | 2013-02-11 | 2016-06-14 | University Of Rochester | Method and apparatus of spectral differential phase-contrast cone-beam CT and hybrid cone-beam CT |
| KR102381584B1 (ko) | 2014-01-16 | 2022-04-04 | 에프엠씨 코포레이션 | 제초제로서의 피리미디닐옥시 벤젠 유도체 |
| TWI828952B (zh) | 2015-06-05 | 2024-01-11 | 美商艾佛艾姆希公司 | 作為除草劑之嘧啶氧基苯衍生物 |
| GB201514649D0 (en) * | 2015-08-18 | 2015-09-30 | Medical Res Council | 2-Sulfonylpyrimidines |
| US11427549B2 (en) | 2017-05-02 | 2022-08-30 | Fmc Corporation | Pyrimidinyloxy benzo-fused compounds as herbicides |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3112316A (en) * | 1963-11-26 | Z-o-chlohobenzylmercapto-x-dimethyl- | ||
| US2876224A (en) * | 1957-08-07 | 1959-03-03 | American Home Prod | Basic esters of substituted pyrimidine-4-carboxylic acids and their preparation |
| DE2455582A1 (de) * | 1974-11-23 | 1976-05-26 | Hoechst Ag | Verfahren zur herstellung von (1-alkyl-5-nitro-imidazolyl-2-alkyl)heteroaryl-sulfiden |
| GB1561290A (en) | 1975-10-16 | 1980-02-20 | Nyegaard & Co As | Pyrimid - 2 - ones |
| US4248618A (en) * | 1977-05-06 | 1981-02-03 | Ici Australia Limited | Derivatives of (pyrimidyloxy)phenoxy-alkanecarboxylic acid and herbicidal compositions thereof |
| NZ188244A (en) * | 1977-09-13 | 1981-04-24 | Ici Australia Ltd | 2-substituted pyrimidines compositions growth regulating processes |
-
1981
- 1981-01-09 DK DK008081AA patent/DK149885B/da unknown
- 1981-01-09 DE DE8181300098T patent/DE3173080D1/de not_active Expired
- 1981-01-09 US US06/223,760 patent/US4423047A/en not_active Expired - Fee Related
- 1981-01-09 EP EP81300098A patent/EP0033195B1/en not_active Expired
- 1981-01-09 ZA ZA00810140A patent/ZA81140B/xx unknown
- 1981-01-09 NZ NZ195992A patent/NZ195992A/xx unknown
- 1981-01-09 AU AU66130/81A patent/AU549117B2/en not_active Expired - Fee Related
- 1981-01-09 JP JP200181A patent/JPS56154467A/ja active Pending
- 1981-01-09 AT AT81300098T patent/ATE16799T1/de not_active IP Right Cessation
- 1981-01-09 NO NO810064A patent/NO810064L/no unknown
- 1981-01-09 ES ES498406A patent/ES8205782A1/es not_active Expired
- 1981-01-12 CA CA000368409A patent/CA1168240A/en not_active Expired
-
1982
- 1982-01-02 ES ES508498A patent/ES508498A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE3173080D1 (en) | 1986-01-16 |
| ES498406A0 (es) | 1982-08-01 |
| ES8205782A1 (es) | 1982-08-01 |
| CA1168240A (en) | 1984-05-29 |
| EP0033195B1 (en) | 1985-12-04 |
| JPS56154467A (en) | 1981-11-30 |
| NZ195992A (en) | 1983-11-30 |
| DK149885B (da) | 1986-10-20 |
| ES8304947A1 (es) | 1983-03-16 |
| US4423047A (en) | 1983-12-27 |
| ATE16799T1 (de) | 1985-12-15 |
| EP0033195A1 (en) | 1981-08-05 |
| DK8081A (da) | 1981-07-11 |
| AU6613081A (en) | 1981-07-16 |
| ES508498A0 (es) | 1983-03-16 |
| AU549117B2 (en) | 1986-01-16 |
| ZA81140B (en) | 1982-02-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO810064L (no) | Fremgangsmaate for fremstilling av fysiologisk aktive pyrimidin-2-sulfider og s-oksyder derav | |
| SU1052161A3 (ru) | Способ получени производных тиоэтиановой кислоты | |
| US4812570A (en) | Method for producing thiazolidinedione derivatives | |
| NO160781B (no) | 1,2,5-tiadiazolderivater. | |
| NO150839B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktivt 5-(4-pyridyl-6-(4-fluorfenyl)-2,3-dihydroimidazo-(2,1-b)-tiazol | |
| AU9058798A (en) | 2,3,5-trisubstituted pyridines as inhibitors of cyclooxygenase-2 | |
| Lee et al. | Syntheses and reactions of 2‐halo‐5‐thiazolecarboxylates | |
| NO148926B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive, nye merkaptoimidazolderivater | |
| NO820881L (no) | Fremgangsmaate til fremstilling av nye tiazolderivater. | |
| US4874877A (en) | Process for optically active 3-(methane-sulfonyloxy)thiolane and analogs | |
| CN109678797A (zh) | 一种快速制备脱落酸受体激动剂的方法 | |
| KR910005850B1 (ko) | 이미다조[1,5-a]피리미딘 유도체의 제조방법 | |
| CA1091695A (en) | 4-alkylthio-2-trifluoromethylalkane-sulfonanilides and derivatives thereof | |
| NO160514B (no) | Analogifremgangsm te for fremstilling av farmasoeytisk aktive pyrimid-2-on-derivater. | |
| US4496568A (en) | Antiinflammatory thieno [2,3-c]pyridine derivatives | |
| CA1336516C (en) | Acyl derivatives of 2-amino-4-substituted-5-hydroxy pyrimidines | |
| RU2117007C1 (ru) | Способ получения 2-замещенных 4,6-диалкоксипиримидинов,2-n-бутиламино-4,6-диметоксипиримидин и способ получения галогенпроизводных пиримидина | |
| US6777575B2 (en) | Process for the preparation of 2-alkylthio benzoic acid derivatives | |
| NO823075L (no) | Fremgangsmaate for fremstilling av substituerte pyrimid-2-on-derivater | |
| Gronowitz et al. | On the syntheses and some reactions of bis‐and tris (methylthio) thiophenes | |
| NO161440B (no) | Analogifremgangsmaate for fremstilling av fysiologisk aktive pyrimidin-2-oner. | |
| NO783775L (no) | 2,4-diamino-5-benzylpyrimidiner og fremgangsmaate ved fremstilling av disse | |
| SE436571B (sv) | Imidazolylmetyltrifenylfosfoniumderivat anvendbar som mellanprodukt for framstellning av histamin h?712-antagonister | |
| CA1200495A (en) | Pyrimidine-2-sulphides and their s-oxides for use in medicine and methods of use therefor, pharmaceutical compositions containing them, processes for their preparation and suchcompounds when novel per se | |
| JPH08217779A (ja) | ヘキサヒドロチエノ〔３，４−ｄ〕イミダゾール−２，４−ジオン類の製造法 |