NO800536L - Ikke-vandig elektrokjemisk celle. - Google Patents
Ikke-vandig elektrokjemisk celle.Info
- Publication number
- NO800536L NO800536L NO800536A NO800536A NO800536L NO 800536 L NO800536 L NO 800536L NO 800536 A NO800536 A NO 800536A NO 800536 A NO800536 A NO 800536A NO 800536 L NO800536 L NO 800536L
- Authority
- NO
- Norway
- Prior art keywords
- sulfur
- cathode
- cathode electrolyte
- electrolyte
- anode
- Prior art date
Links
- 239000003792 electrolyte Substances 0.000 claims description 66
- 239000007788 liquid Substances 0.000 claims description 52
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 23
- GLNWILHOFOBOFD-UHFFFAOYSA-N lithium sulfide Chemical compound [Li+].[Li+].[S-2] GLNWILHOFOBOFD-UHFFFAOYSA-N 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 19
- 150000003464 sulfur compounds Chemical class 0.000 claims description 19
- 229910052751 metal Inorganic materials 0.000 claims description 17
- 239000002184 metal Substances 0.000 claims description 17
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 15
- 229910052744 lithium Inorganic materials 0.000 claims description 15
- 229910052717 sulfur Inorganic materials 0.000 claims description 15
- 239000011593 sulfur Substances 0.000 claims description 15
- 239000000126 substance Substances 0.000 claims description 9
- 230000000737 periodic effect Effects 0.000 claims description 7
- 239000002841 Lewis acid Substances 0.000 claims description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 6
- 150000007517 lewis acids Chemical class 0.000 claims description 6
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 5
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 claims description 5
- 229920002554 vinyl polymer Polymers 0.000 claims description 5
- 239000008151 electrolyte solution Substances 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Chemical group 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 210000004027 cell Anatomy 0.000 description 73
- 239000002904 solvent Substances 0.000 description 27
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- 238000009835 boiling Methods 0.000 description 14
- -1 sulfur halides Chemical class 0.000 description 14
- 239000000463 material Substances 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000003795 chemical substances by application Substances 0.000 description 10
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 10
- 238000002161 passivation Methods 0.000 description 9
- 239000000654 additive Substances 0.000 description 8
- 230000000996 additive effect Effects 0.000 description 8
- 239000010406 cathode material Substances 0.000 description 7
- 230000002999 depolarising effect Effects 0.000 description 7
- 239000006182 cathode active material Substances 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 5
- 239000010405 anode material Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 238000003860 storage Methods 0.000 description 5
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 230000009977 dual effect Effects 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- FZKPQHFEMFIDNR-UHFFFAOYSA-N 2-hydroxyethyl hydrogen sulfite Chemical compound OCCOS(O)=O FZKPQHFEMFIDNR-UHFFFAOYSA-N 0.000 description 3
- VWIIJDNADIEEDB-UHFFFAOYSA-N 3-methyl-1,3-oxazolidin-2-one Chemical compound CN1CCOC1=O VWIIJDNADIEEDB-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000004809 Teflon Substances 0.000 description 3
- 229920006362 Teflon® Polymers 0.000 description 3
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 3
- 239000006184 cosolvent Substances 0.000 description 3
- 230000001934 delay Effects 0.000 description 3
- BDUPRNVPXOHWIL-UHFFFAOYSA-N dimethyl sulfite Chemical compound COS(=O)OC BDUPRNVPXOHWIL-UHFFFAOYSA-N 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 2
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000005864 Sulphur Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 210000003850 cellular structure Anatomy 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 239000011532 electronic conductor Substances 0.000 description 2
- 239000003365 glass fiber Substances 0.000 description 2
- 229910021478 group 5 element Inorganic materials 0.000 description 2
- 229910021476 group 6 element Inorganic materials 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- PQXKHYXIUOZZFA-UHFFFAOYSA-M lithium fluoride Chemical compound [Li+].[F-] PQXKHYXIUOZZFA-UHFFFAOYSA-M 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000011255 nonaqueous electrolyte Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 230000010287 polarization Effects 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- 150000003568 thioethers Chemical class 0.000 description 2
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- YHRUOJUYPBUZOS-UHFFFAOYSA-N 1,3-dichloropropane Chemical compound ClCCCCl YHRUOJUYPBUZOS-UHFFFAOYSA-N 0.000 description 1
- IRPGOXJVTQTAAN-UHFFFAOYSA-N 2,2,3,3,3-pentafluoropropanal Chemical compound FC(F)(F)C(F)(F)C=O IRPGOXJVTQTAAN-UHFFFAOYSA-N 0.000 description 1
- OBSLLHNATPQFMJ-UHFFFAOYSA-N 2,4-Dimethylthiazole Chemical compound CC1=CSC(C)=N1 OBSLLHNATPQFMJ-UHFFFAOYSA-N 0.000 description 1
- MCFSNYMQISXQTF-UHFFFAOYSA-N 2-chlorosulfonylacetyl chloride Chemical compound ClC(=O)CS(Cl)(=O)=O MCFSNYMQISXQTF-UHFFFAOYSA-N 0.000 description 1
- OFTKFKYVSBNYEC-UHFFFAOYSA-N 2-furoyl chloride Chemical compound ClC(=O)C1=CC=CO1 OFTKFKYVSBNYEC-UHFFFAOYSA-N 0.000 description 1
- GUGQQGROXHPINL-UHFFFAOYSA-N 2-oxobutanoyl chloride Chemical compound CCC(=O)C(Cl)=O GUGQQGROXHPINL-UHFFFAOYSA-N 0.000 description 1
- FICAQKBMCKEFDI-UHFFFAOYSA-N 3,5-dimethyl-1,2-oxazole Chemical compound CC=1C=C(C)ON=1 FICAQKBMCKEFDI-UHFFFAOYSA-N 0.000 description 1
- CMJLMPKFQPJDKP-UHFFFAOYSA-N 3-methylthiolane 1,1-dioxide Chemical compound CC1CCS(=O)(=O)C1 CMJLMPKFQPJDKP-UHFFFAOYSA-N 0.000 description 1
- SGDKTJPVCKQTHK-UHFFFAOYSA-N 5-bromo-2-fluoro-3-nitropyridine Chemical compound [O-][N+](=O)C1=CC(Br)=CN=C1F SGDKTJPVCKQTHK-UHFFFAOYSA-N 0.000 description 1
- KLZUFWVZNOTSEM-UHFFFAOYSA-K Aluminum fluoride Inorganic materials F[Al](F)F KLZUFWVZNOTSEM-UHFFFAOYSA-K 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 229920002433 Vinyl chloride-vinyl acetate copolymer Polymers 0.000 description 1
- KYOIPUDHYRWSFO-UHFFFAOYSA-N [Br].[Li] Chemical compound [Br].[Li] KYOIPUDHYRWSFO-UHFFFAOYSA-N 0.000 description 1
- NJVHJTQSGGRHGP-UHFFFAOYSA-K [Li].[Al+3].[Cl-].[Cl-].[Cl-] Chemical compound [Li].[Al+3].[Cl-].[Cl-].[Cl-] NJVHJTQSGGRHGP-UHFFFAOYSA-K 0.000 description 1
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910000573 alkali metal alloy Inorganic materials 0.000 description 1
- 229910000941 alkaline earth metal alloy Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- VMPVEPPRYRXYNP-UHFFFAOYSA-I antimony(5+);pentachloride Chemical compound Cl[Sb](Cl)(Cl)(Cl)Cl VMPVEPPRYRXYNP-UHFFFAOYSA-I 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- AQIHMSVIAGNIDM-UHFFFAOYSA-N benzoyl bromide Chemical compound BrC(=O)C1=CC=CC=C1 AQIHMSVIAGNIDM-UHFFFAOYSA-N 0.000 description 1
- GSCLMSFRWBPUSK-UHFFFAOYSA-N beta-Butyrolactone Chemical compound CC1CC(=O)O1 GSCLMSFRWBPUSK-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- YXWZBDDFTDHQGT-UHFFFAOYSA-J bromo(trichloro)stannane Chemical compound [Cl-].[Cl-].[Cl-].[Br-].[Sn+4] YXWZBDDFTDHQGT-UHFFFAOYSA-J 0.000 description 1
- XXFBOXZYQLMDQA-UHFFFAOYSA-N bromoselanyl selenohypobromite Chemical compound Br[Se][Se]Br XXFBOXZYQLMDQA-UHFFFAOYSA-N 0.000 description 1
- 229930188620 butyrolactone Natural products 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- ASKHTHDBINVNFJ-UHFFFAOYSA-N chlorosulfonyloxyethane Chemical compound CCOS(Cl)(=O)=O ASKHTHDBINVNFJ-UHFFFAOYSA-N 0.000 description 1
- AHXGRMIPHCAXFP-UHFFFAOYSA-L chromyl dichloride Chemical compound Cl[Cr](Cl)(=O)=O AHXGRMIPHCAXFP-UHFFFAOYSA-L 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- HOBKJDRIWYGNQZ-UHFFFAOYSA-J dibromo(dichloro)stannane Chemical compound Cl[Sn](Cl)(Br)Br HOBKJDRIWYGNQZ-UHFFFAOYSA-J 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- BPFZRKQDXVZTFD-UHFFFAOYSA-N disulfur decafluoride Chemical compound FS(F)(F)(F)(F)S(F)(F)(F)(F)F BPFZRKQDXVZTFD-UHFFFAOYSA-N 0.000 description 1
- JIRDGEGGAWJQHQ-UHFFFAOYSA-N disulfur dibromide Chemical compound BrSSBr JIRDGEGGAWJQHQ-UHFFFAOYSA-N 0.000 description 1
- TXKMVPPZCYKFAC-UHFFFAOYSA-N disulfur monoxide Inorganic materials O=S=S TXKMVPPZCYKFAC-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000003487 electrochemical reaction Methods 0.000 description 1
- 239000007772 electrode material Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910001502 inorganic halide Inorganic materials 0.000 description 1
- 229910000765 intermetallic Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- GCICAPWZNUIIDV-UHFFFAOYSA-N lithium magnesium Chemical compound [Li].[Mg] GCICAPWZNUIIDV-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- NFVUDQKTAWONMJ-UHFFFAOYSA-I pentafluorovanadium Chemical compound [F-].[F-].[F-].[F-].[F-].[V+5] NFVUDQKTAWONMJ-UHFFFAOYSA-I 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 239000002897 polymer film coating Substances 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000010979 ruby Substances 0.000 description 1
- 229910001750 ruby Inorganic materials 0.000 description 1
- PMOBWAXBGUSOPS-UHFFFAOYSA-N selenium tetrafluoride Chemical compound F[Se](F)(F)F PMOBWAXBGUSOPS-UHFFFAOYSA-N 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000006104 solid solution Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Chemical compound S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- PUGUQINMNYINPK-UHFFFAOYSA-N tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(=O)CCl)CC1 PUGUQINMNYINPK-UHFFFAOYSA-N 0.000 description 1
- PJYXVICYYHGLSW-UHFFFAOYSA-J tetrachloroplumbane Chemical compound Cl[Pb](Cl)(Cl)Cl PJYXVICYYHGLSW-UHFFFAOYSA-J 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- LFQCEHFDDXELDD-UHFFFAOYSA-N tetramethyl orthosilicate Chemical compound CO[Si](OC)(OC)OC LFQCEHFDDXELDD-UHFFFAOYSA-N 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- WQYSXVGEZYESBR-UHFFFAOYSA-N thiophosphoryl chloride Chemical compound ClP(Cl)(Cl)=S WQYSXVGEZYESBR-UHFFFAOYSA-N 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- AHCHEGZCJVSHOL-UHFFFAOYSA-J tribromo(chloro)stannane Chemical compound Cl[Sn](Br)(Br)Br AHCHEGZCJVSHOL-UHFFFAOYSA-J 0.000 description 1
- OWNZHTHZRZVKSQ-UHFFFAOYSA-N tribromo(sulfanylidene)-$l^{5}-phosphane Chemical compound BrP(Br)(Br)=S OWNZHTHZRZVKSQ-UHFFFAOYSA-N 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- DUNKXUFBGCUVQW-UHFFFAOYSA-J zirconium tetrachloride Chemical compound Cl[Zr](Cl)(Cl)Cl DUNKXUFBGCUVQW-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M6/00—Primary cells; Manufacture thereof
- H01M6/14—Cells with non-aqueous electrolyte
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/015,938 US4218523A (en) | 1979-02-28 | 1979-02-28 | Nonaqueous electrochemical cell |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO800536L true NO800536L (no) | 1980-08-29 |
Family
ID=21774442
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO800536A NO800536L (no) | 1979-02-28 | 1980-02-26 | Ikke-vandig elektrokjemisk celle. |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4218523A (fr) |
| JP (1) | JPS55119364A (fr) |
| AR (1) | AR227764A1 (fr) |
| AU (1) | AU535064B2 (fr) |
| BE (1) | BE881932A (fr) |
| BR (1) | BR8001106A (fr) |
| CA (1) | CA1134906A (fr) |
| CH (1) | CH638931A5 (fr) |
| DE (1) | DE3005869C2 (fr) |
| DK (1) | DK84480A (fr) |
| ES (1) | ES8101331A1 (fr) |
| FR (1) | FR2450506A1 (fr) |
| GB (1) | GB2043988B (fr) |
| HK (1) | HK30685A (fr) |
| IE (1) | IE49643B1 (fr) |
| IL (1) | IL59437A (fr) |
| IN (1) | IN153627B (fr) |
| IT (1) | IT1141399B (fr) |
| MX (1) | MX153060A (fr) |
| NL (1) | NL8001183A (fr) |
| NO (1) | NO800536L (fr) |
| SE (1) | SE8001508L (fr) |
| SG (1) | SG7285G (fr) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK156152C (da) * | 1979-06-27 | 1989-11-20 | Eveready Battery Inc | Ikke-vandigt elektrokemisk element |
| DK155559C (da) * | 1979-06-27 | 1989-10-16 | Eveready Battery Inc | Ikke-vandigt elektrokemisk element |
| FR2497407A2 (fr) * | 1980-12-30 | 1982-07-02 | Gipelec | Pile de grande energie specifique dans laquelle la matiere active anodique est un metal alcalin |
| US4296187A (en) * | 1980-06-13 | 1981-10-20 | Gte Products Corporation | Integrated carbon/insulator structure and method for fabricating same |
| IL61085A (en) * | 1980-09-19 | 1983-07-31 | Univ Ramot | Nonaqueous sulfur cell |
| US4327159A (en) * | 1980-12-29 | 1982-04-27 | Union Carbide Corporation | Non-aqueous electrochemical cell |
| US4360572A (en) * | 1981-02-18 | 1982-11-23 | Honeywell, Inc. | Electrochemical cell |
| US4405693A (en) * | 1981-10-05 | 1983-09-20 | Honeywell Inc. | High rate metal-sulfuryl chloride batteries |
| US4489144A (en) * | 1983-03-28 | 1984-12-18 | Union Carbide Corporation | Isoxazole derivative additive in organic electrolytes of nonaqueous cells employing solid cathodes |
| JPS59209273A (ja) * | 1983-05-13 | 1984-11-27 | Toshiba Corp | 非水溶媒電池用電解液の製造方法 |
| US4981672A (en) * | 1983-06-27 | 1991-01-01 | Voltaix, Inc. | Composite coating for electrochemical electrode and method |
| US4784925A (en) * | 1983-10-03 | 1988-11-15 | Whittaker Corporation | Primary electrochemical cell containing molecular iodine |
| US4784927A (en) * | 1983-10-03 | 1988-11-15 | Whittaker Corporation | Electrochemical cell using iodine monochloride |
| US4654280A (en) * | 1984-12-27 | 1987-03-31 | Eveready Battery Company | Nonaqueous cell employing a cathode-electrolyte solution containing a boron-containing additive |
| US6017651A (en) * | 1994-11-23 | 2000-01-25 | Polyplus Battery Company, Inc. | Methods and reagents for enhancing the cycling efficiency of lithium polymer batteries |
| US5712057A (en) * | 1995-12-08 | 1998-01-27 | Mitsubishi Chemical Corporation | Poly-sulfide and carbon electrode material and associated process |
| US6165641A (en) * | 1997-05-09 | 2000-12-26 | The United States Of America As Represented By The United States Department Of Energy | Nanodisperse transition metal electrodes (NTME) for electrochemical cells |
| US6083475A (en) * | 1999-04-02 | 2000-07-04 | Rentech, Inc. | Method for making lithiated metal oxide |
| RU2402842C2 (ru) * | 2005-03-22 | 2010-10-27 | Оксис Энерджи Лимитед | Химический источник электроэнергии и способ его изготовления |
| GB2424511B (en) * | 2005-03-22 | 2007-01-24 | Intellikraft Ltd | Lithium sulphide battery and method of producing the same |
| GB2430542B (en) * | 2005-09-26 | 2008-03-26 | Oxis Energy Ltd | Lithium-sulphur battery with high specific energy |
| EP1941568A1 (fr) * | 2005-09-26 | 2008-07-09 | Oxis Energy Limited | Pile lithium-soufre a energie specifique elevee |
| EP2629352A1 (fr) | 2012-02-17 | 2013-08-21 | Oxis Energy Limited | Électrode de feuille métallique renforcée |
| EP2784850A1 (fr) | 2013-03-25 | 2014-10-01 | Oxis Energy Limited | Procédé de cycle d'une cellule au lithium-soufre |
| EP2784852B1 (fr) | 2013-03-25 | 2018-05-16 | Oxis Energy Limited | Procédé de chargement pour batterie lithium-soufre |
| ES2546609T3 (es) | 2013-03-25 | 2015-09-25 | Oxis Energy Limited | Un método para cargar una celda de litio-azufre |
| GB2517228B (en) | 2013-08-15 | 2016-03-02 | Oxis Energy Ltd | Laminate cell |
| WO2015092380A1 (fr) | 2013-12-17 | 2015-06-25 | Oxis Energy Limited | Électrolyte pour pile au soufre-lithium |
| CN106537660B (zh) | 2014-05-30 | 2020-08-14 | 奥克斯能源有限公司 | 锂硫电池 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE793372A (fr) * | 1971-12-27 | 1973-06-27 | Union Carbide Corp | Pile electro-chimique non aqueuse |
| US4444855A (en) * | 1974-05-29 | 1984-04-24 | Union Carbide Corporation | Non-aqueous electrochemical cell |
| US3993501A (en) * | 1975-03-24 | 1976-11-23 | Union Carbide Corporation | Nonaqueous electrochemical cell |
| US3998657A (en) * | 1975-07-25 | 1976-12-21 | Gte Laboratories Incorporated | Electrochemical cells |
| US4020240A (en) * | 1975-09-03 | 1977-04-26 | P. R. Mallory & Co., Inc. | Electrochemical cell with clovoborate salt in electrolyte and method of operation and composition of matter |
| US4071664A (en) * | 1977-04-01 | 1978-01-31 | P. R. Mallory & Co. Inc. | Electrolyte salt additive |
| US4093784A (en) * | 1977-08-26 | 1978-06-06 | The United States Of America As Represented By The Secretary Of The Army | Lithium primary cell |
| FR2416559A1 (fr) * | 1978-01-31 | 1979-08-31 | Accumulateurs Fixes | Generateur electrochimique au lithium contenant du chlorure de thionyle |
| CH625914A5 (fr) * | 1978-01-31 | 1981-10-15 | Accumulateurs Fixes |
-
1979
- 1979-02-28 US US06/015,938 patent/US4218523A/en not_active Expired - Lifetime
-
1980
- 1980-01-30 IN IN67/DEL/80A patent/IN153627B/en unknown
- 1980-02-04 CA CA000345043A patent/CA1134906A/fr not_active Expired
- 1980-02-16 DE DE3005869A patent/DE3005869C2/de not_active Expired
- 1980-02-20 IL IL59437A patent/IL59437A/xx unknown
- 1980-02-20 AR AR280017A patent/AR227764A1/es active
- 1980-02-26 NO NO800536A patent/NO800536L/no unknown
- 1980-02-26 IT IT20192/80A patent/IT1141399B/it active
- 1980-02-26 BR BR8001106A patent/BR8001106A/pt unknown
- 1980-02-26 ES ES488936A patent/ES8101331A1/es not_active Expired
- 1980-02-26 BE BE0/199557A patent/BE881932A/fr not_active IP Right Cessation
- 1980-02-27 CH CH157380A patent/CH638931A5/fr not_active IP Right Cessation
- 1980-02-27 SE SE8001508A patent/SE8001508L/xx not_active Application Discontinuation
- 1980-02-27 AU AU55954/80A patent/AU535064B2/en not_active Ceased
- 1980-02-27 GB GB8006565A patent/GB2043988B/en not_active Expired
- 1980-02-27 MX MX181350A patent/MX153060A/es unknown
- 1980-02-27 IE IE395/80A patent/IE49643B1/en unknown
- 1980-02-27 NL NL8001183A patent/NL8001183A/nl not_active Application Discontinuation
- 1980-02-27 FR FR8004291A patent/FR2450506A1/fr active Granted
- 1980-02-27 DK DK84480A patent/DK84480A/da not_active Application Discontinuation
- 1980-02-27 JP JP2289680A patent/JPS55119364A/ja active Pending
-
1985
- 1985-01-26 SG SG72/85A patent/SG7285G/en unknown
- 1985-04-18 HK HK306/85A patent/HK30685A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE3005869A1 (de) | 1980-09-04 |
| HK30685A (en) | 1985-04-26 |
| BR8001106A (pt) | 1980-10-29 |
| FR2450506A1 (fr) | 1980-09-26 |
| AU5595480A (en) | 1980-09-04 |
| SE8001508L (sv) | 1980-08-29 |
| IL59437A (en) | 1983-05-15 |
| IT1141399B (it) | 1986-10-01 |
| JPS55119364A (en) | 1980-09-13 |
| FR2450506B1 (fr) | 1984-10-26 |
| US4218523A (en) | 1980-08-19 |
| DE3005869C2 (de) | 1984-09-27 |
| ES488936A0 (es) | 1980-12-01 |
| MX153060A (es) | 1986-07-24 |
| SG7285G (en) | 1985-11-15 |
| AR227764A1 (es) | 1982-12-15 |
| ES8101331A1 (es) | 1980-12-01 |
| IN153627B (fr) | 1984-07-28 |
| IE49643B1 (en) | 1985-11-13 |
| IE800395L (en) | 1980-08-28 |
| CA1134906A (fr) | 1982-11-02 |
| GB2043988A (en) | 1980-10-08 |
| IT8020192A0 (it) | 1980-02-26 |
| IL59437A0 (en) | 1980-05-30 |
| DK84480A (da) | 1980-08-29 |
| AU535064B2 (en) | 1984-03-01 |
| CH638931A5 (fr) | 1983-10-14 |
| BE881932A (fr) | 1980-08-26 |
| GB2043988B (en) | 1983-08-03 |
| NL8001183A (nl) | 1980-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO800536L (no) | Ikke-vandig elektrokjemisk celle. | |
| CA1079800A (fr) | Additif salin pour electrolyte | |
| US5691083A (en) | Potassium ion additives for voltage control and performance improvement in nonaqueous cells | |
| JPS6158946B2 (fr) | ||
| JPS59117070A (ja) | ホウ素含有表面膜を有する負極を使用する非水性電池 | |
| JPH0415988B2 (fr) | ||
| NO151562B (no) | Ikke-vandig celle | |
| JPS6093757A (ja) | 二酸化マンガン含有非水性電池用の炭酸マンガン添加剤 | |
| US8067108B1 (en) | Hybrid battery for use over extended temperature range | |
| US4444855A (en) | Non-aqueous electrochemical cell | |
| GB2034512A (en) | Electrolyte salts for non-aqueous electrochemical cells | |
| US4277545A (en) | Nonaqueous cell | |
| US4367266A (en) | Cathode collectors for nonaqueous cell having a metal oxide catalyst | |
| US4362794A (en) | Electrolyte | |
| JPS5840777A (ja) | 非水性電池用の錯体金属硫化物正極 | |
| US4327159A (en) | Non-aqueous electrochemical cell | |
| NO148125B (no) | Ikke-vandig primaerbatteri. | |
| US4327160A (en) | Non-aqueous cell | |
| US4510220A (en) | Cell with PbCl2 cathode | |
| JPH087923A (ja) | リチウム２次電池用電解液 | |
| KR800000157B1 (ko) | 비수성 전지 | |
| US3998657A (en) | Electrochemical cells | |
| JPH0424826B2 (fr) | ||
| JPS6318838B2 (fr) | ||
| US5024906A (en) | Rechargeable electrochemical cell |