NO800463L - Fremgangsmaate for fremstilling av histamin-antagonister - Google Patents
Fremgangsmaate for fremstilling av histamin-antagonisterInfo
- Publication number
- NO800463L NO800463L NO800463A NO800463A NO800463L NO 800463 L NO800463 L NO 800463L NO 800463 A NO800463 A NO 800463A NO 800463 A NO800463 A NO 800463A NO 800463 L NO800463 L NO 800463L
- Authority
- NO
- Norway
- Prior art keywords
- pyridyl
- hydrogen
- pyrimidone
- methyl
- hydroxy
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 16
- 239000000739 antihistaminic agent Substances 0.000 title description 5
- 238000004519 manufacturing process Methods 0.000 title description 2
- -1 C_■ i -C b Chemical group 0.000 claims description 43
- 150000001875 compounds Chemical class 0.000 claims description 39
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 239000001257 hydrogen Substances 0.000 claims description 24
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 150000002431 hydrogen Chemical group 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 8
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 239000000047 product Substances 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 239000011593 sulfur Substances 0.000 claims description 7
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 125000003435 aroyl group Chemical group 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 125000001589 carboacyl group Chemical group 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- RVVLSMNRYMNQBO-UHFFFAOYSA-N 2-[4-[2-[[5-[(6-methylpyridin-3-yl)methyl]-6-oxo-1h-pyrimidin-2-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine Chemical compound C1=NC(C)=CC=C1CC(C(N1)=O)=CN=C1NCCSCC1=CSC(NC(N)=N)=N1 RVVLSMNRYMNQBO-UHFFFAOYSA-N 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000001072 heteroaryl group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000006239 protecting group Chemical group 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 239000000460 chlorine Chemical group 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 3
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 claims description 3
- 150000003573 thiols Chemical class 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 3
- 239000007858 starting material Substances 0.000 claims 3
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 1
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 56
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 49
- 229960001340 histamine Drugs 0.000 description 28
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- 239000000203 mixture Substances 0.000 description 24
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 238000010992 reflux Methods 0.000 description 14
- 239000007787 solid Substances 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 102000005962 receptors Human genes 0.000 description 8
- 108020003175 receptors Proteins 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 239000005557 antagonist Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- JFINSZHXZPNADJ-UHFFFAOYSA-N 2-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine Chemical compound NCCSCC1=CSC(NC(N)=N)=N1 JFINSZHXZPNADJ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 230000004071 biological effect Effects 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 230000001404 mediated effect Effects 0.000 description 5
- IDCPFAYURAQKDZ-UHFFFAOYSA-N 1-nitroguanidine Chemical compound NC(=N)N[N+]([O-])=O IDCPFAYURAQKDZ-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- CEUDOBSKJUUQRV-UHFFFAOYSA-N 2-[4-[2-[[6-oxo-5-[(3,4,5-trimethoxyphenyl)methyl]-1h-pyrimidin-2-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine Chemical compound COC1=C(OC)C(OC)=CC(CC=2C(NC(NCCSCC=3N=C(N=C(N)N)SC=3)=NC=2)=O)=C1 CEUDOBSKJUUQRV-UHFFFAOYSA-N 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 229940125715 antihistaminic agent Drugs 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229960001380 cimetidine Drugs 0.000 description 3
- CCGSUNCLSOWKJO-UHFFFAOYSA-N cimetidine Chemical compound N#CNC(=N/C)\NCCSCC1=NC=N[C]1C CCGSUNCLSOWKJO-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- ZABMIGDVOIATQB-UHFFFAOYSA-N ethyl 3-(6-methylpyridin-3-yl)propanoate Chemical compound CCOC(=O)CCC1=CC=C(C)N=C1 ZABMIGDVOIATQB-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000027119 gastric acid secretion Effects 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 229960000582 mepyramine Drugs 0.000 description 3
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- JXNJORJFKUCUSM-UHFFFAOYSA-N 2-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride Chemical compound Cl.Cl.NCCSCC1=CSC(NC(N)=N)=N1 JXNJORJFKUCUSM-UHFFFAOYSA-N 0.000 description 2
- UOBDHDXXAUUGJH-UHFFFAOYSA-N 2-[4-[2-[[6-oxo-5-(pyridin-3-ylmethyl)-1h-pyrimidin-2-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine Chemical compound S1C(NC(=N)N)=NC(CSCCNC=2NC(=O)C(CC=3C=NC=CC=3)=CN=2)=C1 UOBDHDXXAUUGJH-UHFFFAOYSA-N 0.000 description 2
- OAZIAOCXVZMCCR-UHFFFAOYSA-N 3-(6-methylpyridin-3-yl)prop-2-enoic acid Chemical compound CC1=CC=C(C=CC(O)=O)C=N1 OAZIAOCXVZMCCR-UHFFFAOYSA-N 0.000 description 2
- FEQKZDDVINUMPR-UHFFFAOYSA-N 5-[(6-methylpyridin-3-yl)methyl]-2-methylsulfanyl-1h-pyrimidin-6-one Chemical compound N1C(SC)=NC(=O)C(CC=2C=NC(C)=CC=2)=C1 FEQKZDDVINUMPR-UHFFFAOYSA-N 0.000 description 2
- IBRVMLVSNYQCGL-UHFFFAOYSA-N 5-[(6-methylpyridin-3-yl)methyl]-2-sulfanylidene-1h-pyrimidin-4-one Chemical compound C1=NC(C)=CC=C1CC1=CNC(=S)NC1=O IBRVMLVSNYQCGL-UHFFFAOYSA-N 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- 102000003710 Histamine H2 Receptors Human genes 0.000 description 2
- 108090000050 Histamine H2 Receptors Proteins 0.000 description 2
- 102000000543 Histamine Receptors Human genes 0.000 description 2
- 108010002059 Histamine Receptors Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 206010020751 Hypersensitivity Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- CDXSJGDDABYYJV-UHFFFAOYSA-N acetic acid;ethanol Chemical compound CCO.CC(O)=O CDXSJGDDABYYJV-UHFFFAOYSA-N 0.000 description 2
- 230000009858 acid secretion Effects 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- RIMGDBZXWSGBQN-UHFFFAOYSA-N burimamide Chemical compound CNC(=S)NCCCCC1=CN=C[N]1 RIMGDBZXWSGBQN-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000020335 dealkylation Effects 0.000 description 2
- 238000006900 dealkylation reaction Methods 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- IIOWETJNAPDAGC-UHFFFAOYSA-N ethyl 2-formyl-3-(6-methylpyridin-3-yl)propanoate Chemical compound CCOC(=O)C(C=O)CC1=CC=C(C)N=C1 IIOWETJNAPDAGC-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 210000004211 gastric acid Anatomy 0.000 description 2
- 210000002837 heart atrium Anatomy 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- KWBSLRQDOHBJPQ-UHFFFAOYSA-N n-[5-[(6-methylpyridin-3-yl)methyl]-6-oxo-1h-pyrimidin-2-yl]nitramide Chemical compound C1=NC(C)=CC=C1CC1=CN=C(N[N+]([O-])=O)NC1=O KWBSLRQDOHBJPQ-UHFFFAOYSA-N 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- OMIVCRYZSXDGAB-UHFFFAOYSA-N 1,4-butanediyl Chemical group [CH2]CC[CH2] OMIVCRYZSXDGAB-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 150000008081 1H-pyrimidin-4-ones Chemical class 0.000 description 1
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- FDXBEVYBBQBOIC-UHFFFAOYSA-N 2-[4-[2-[[5-(furan-2-ylmethyl)-6-oxo-1h-pyrimidin-2-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine Chemical compound S1C(N=C(N)N)=NC(CSCCNC=2NC(=O)C(CC=3OC=CC=3)=CN=2)=C1 FDXBEVYBBQBOIC-UHFFFAOYSA-N 0.000 description 1
- SMRMQWSWFIRHJN-UHFFFAOYSA-N 2-[4-[2-[[5-(naphthalen-1-ylmethyl)-6-oxo-1h-pyrimidin-2-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine Chemical compound S1C(NC(=N)N)=NC(CSCCNC=2NC(=O)C(CC=3C4=CC=CC=C4C=CC=3)=CN=2)=C1 SMRMQWSWFIRHJN-UHFFFAOYSA-N 0.000 description 1
- NRSZMZGQKZTYDX-UHFFFAOYSA-N 2-[4-[2-[[5-[(2-methoxypyridin-4-yl)methyl]-6-oxo-1h-pyrimidin-2-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine Chemical compound C1=NC(OC)=CC(CC=2C(NC(NCCSCC=3N=C(NC(N)=N)SC=3)=NC=2)=O)=C1 NRSZMZGQKZTYDX-UHFFFAOYSA-N 0.000 description 1
- ZWTIEUGGVTXYRI-UHFFFAOYSA-N 2-[4-[2-[[5-[(4-methoxypyridin-2-yl)methyl]-6-oxo-1h-pyrimidin-2-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine Chemical compound COC1=CC=NC(CC=2C(NC(NCCSCC=3N=C(NC(N)=N)SC=3)=NC=2)=O)=C1 ZWTIEUGGVTXYRI-UHFFFAOYSA-N 0.000 description 1
- WARMELYBYGLLAJ-UHFFFAOYSA-N 2-[4-[2-[[5-[(5,6-dimethylpyridin-3-yl)methyl]-6-oxo-1h-pyrimidin-2-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine Chemical compound N1=C(C)C(C)=CC(CC=2C(NC(NCCSCC=3N=C(N=C(N)N)SC=3)=NC=2)=O)=C1 WARMELYBYGLLAJ-UHFFFAOYSA-N 0.000 description 1
- UFPOJDZXRJQXLG-UHFFFAOYSA-N 2-[4-[2-[[5-[(6-methoxypyridin-3-yl)methyl]-6-oxo-1h-pyrimidin-2-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine Chemical compound C1=NC(OC)=CC=C1CC(C(N1)=O)=CN=C1NCCSCC1=CSC(NC(N)=N)=N1 UFPOJDZXRJQXLG-UHFFFAOYSA-N 0.000 description 1
- LGGMUBRVLWFWHR-UHFFFAOYSA-N 2-[4-[2-[[6-oxo-5-[(2-oxo-1h-pyridin-4-yl)methyl]-1h-pyrimidin-2-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine Chemical compound S1C(NC(=N)N)=NC(CSCCNC=2NC(=O)C(CC=3C=C(O)N=CC=3)=CN=2)=C1 LGGMUBRVLWFWHR-UHFFFAOYSA-N 0.000 description 1
- USBMCWKUXOWUIS-UHFFFAOYSA-N 2-[4-[2-[[6-oxo-5-[(6-oxo-1h-pyridin-3-yl)methyl]-1h-pyrimidin-2-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine Chemical compound S1C(NC(=N)N)=NC(CSCCNC=2NC(=O)C(CC=3C=NC(O)=CC=3)=CN=2)=C1 USBMCWKUXOWUIS-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- OAMKHQBKAMPNAB-UHFFFAOYSA-N 5-[(6-methylpyridin-3-yl)methyl]-2-(2-sulfanylethylamino)-1h-pyrimidin-6-one Chemical compound C1=NC(C)=CC=C1CC1=CN=C(NCCS)NC1=O OAMKHQBKAMPNAB-UHFFFAOYSA-N 0.000 description 1
- IMWMEIWYPWVABQ-UHFFFAOYSA-N 6-methylpyridine-3-carbaldehyde Chemical compound CC1=CC=C(C=O)C=N1 IMWMEIWYPWVABQ-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 235000006491 Acacia senegal Nutrition 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 206010065713 Gastric Fistula Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 208000032843 Hemorrhage Diseases 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 108010079943 Pentagastrin Proteins 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 208000001871 Tachycardia Diseases 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- HPXWWLGOFMSKHV-UHFFFAOYSA-N [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium;chloride Chemical compound Cl.NC(N)=NC1=NC(CCl)=CS1 HPXWWLGOFMSKHV-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- ZCHPKWUIAASXPV-UHFFFAOYSA-N acetic acid;methanol Chemical compound OC.CC(O)=O ZCHPKWUIAASXPV-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 238000006480 benzoylation reaction Methods 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- IIQFIDKGTDXLBU-UHFFFAOYSA-N benzyl thiohypochlorite Chemical compound ClSCC1=CC=CC=C1 IIQFIDKGTDXLBU-UHFFFAOYSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 239000002876 beta blocker Substances 0.000 description 1
- 208000034158 bleeding Diseases 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- SOYKEARSMXGVTM-UHFFFAOYSA-N chlorphenamine Chemical compound C=1C=CC=NC=1C(CCN(C)C)C1=CC=C(Cl)C=C1 SOYKEARSMXGVTM-UHFFFAOYSA-N 0.000 description 1
- 229960003291 chlorphenamine Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical compound C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 229960000520 diphenhydramine Drugs 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 230000002183 duodenal effect Effects 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- SFPIPAREYAMJEW-UHFFFAOYSA-N ethyl 2-formyl-3-pyridin-3-ylpropanoate Chemical compound CCOC(=O)C(C=O)CC1=CC=CN=C1 SFPIPAREYAMJEW-UHFFFAOYSA-N 0.000 description 1
- UPQKGGCHMZDTBL-UHFFFAOYSA-N ethyl 3-(6-methylpyridin-3-yl)prop-2-enoate Chemical compound CCOC(=O)C=CC1=CC=C(C)N=C1 UPQKGGCHMZDTBL-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000000763 evoking effect Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 208000021302 gastroesophageal reflux disease Diseases 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000003485 histamine H2 receptor antagonist Substances 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- DYSDJZQYNYDJBU-UHFFFAOYSA-N n-[5-[(2-methoxypyridin-4-yl)methyl]-6-oxo-1h-pyrimidin-2-yl]nitramide Chemical compound C1=NC(OC)=CC(CC=2C(NC(N[N+]([O-])=O)=NC=2)=O)=C1 DYSDJZQYNYDJBU-UHFFFAOYSA-N 0.000 description 1
- PKQFGDMUBKODDI-UHFFFAOYSA-N n-[5-[(3-methoxyphenyl)methyl]-6-oxo-1h-pyrimidin-2-yl]nitramide Chemical compound COC1=CC=CC(CC=2C(NC(N[N+]([O-])=O)=NC=2)=O)=C1 PKQFGDMUBKODDI-UHFFFAOYSA-N 0.000 description 1
- CCOVEZVZSDAGQQ-UHFFFAOYSA-N n-[5-[(4-methoxypyridin-2-yl)methyl]-6-oxo-1h-pyrimidin-2-yl]nitramide Chemical compound COC1=CC=NC(CC=2C(NC(N[N+]([O-])=O)=NC=2)=O)=C1 CCOVEZVZSDAGQQ-UHFFFAOYSA-N 0.000 description 1
- WCCXSTMOFAXKAF-UHFFFAOYSA-N n-[5-[(5,6-dimethylpyridin-3-yl)methyl]-6-oxo-1h-pyrimidin-2-yl]nitramide Chemical compound N1=C(C)C(C)=CC(CC=2C(NC(N[N+]([O-])=O)=NC=2)=O)=C1 WCCXSTMOFAXKAF-UHFFFAOYSA-N 0.000 description 1
- RHOIVJHCCZBVSO-UHFFFAOYSA-N n-[5-[(6-methoxypyridin-3-yl)methyl]-6-oxo-1h-pyrimidin-2-yl]nitramide Chemical compound C1=NC(OC)=CC=C1CC1=CN=C(N[N+]([O-])=O)NC1=O RHOIVJHCCZBVSO-UHFFFAOYSA-N 0.000 description 1
- RHHFNUQDIRYPSI-UHFFFAOYSA-N n-[6-oxo-5-(pyridin-3-ylmethyl)-1h-pyrimidin-2-yl]nitramide Chemical compound N1C(N[N+](=O)[O-])=NC(=O)C(CC=2C=NC=CC=2)=C1 RHHFNUQDIRYPSI-UHFFFAOYSA-N 0.000 description 1
- JBBMUXNATHOAFT-UHFFFAOYSA-N n-[6-oxo-5-[(3,4,5-trimethoxyphenyl)methyl]-1h-pyrimidin-2-yl]nitramide Chemical compound COC1=C(OC)C(OC)=CC(CC=2C(NC(N[N+]([O-])=O)=NC=2)=O)=C1 JBBMUXNATHOAFT-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 230000001151 other effect Effects 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- ANRIQLNBZQLTFV-DZUOILHNSA-N pentagastrin Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1[C]2C=CC=CC2=NC=1)NC(=O)CCNC(=O)OC(C)(C)C)CCSC)C(N)=O)C1=CC=CC=C1 ANRIQLNBZQLTFV-DZUOILHNSA-N 0.000 description 1
- 229960000444 pentagastrin Drugs 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000005495 pyridazyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000000306 recurrent effect Effects 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000006794 tachycardia Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- RIOQSEWOXXDEQQ-UHFFFAOYSA-O triphenylphosphanium Chemical compound C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-O 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000036269 ulceration Effects 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/55—Acids; Esters
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7906070 | 1979-02-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO800463L true NO800463L (no) | 1980-08-22 |
Family
ID=10503327
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO800463A NO800463L (no) | 1979-02-21 | 1980-02-20 | Fremgangsmaate for fremstilling av histamin-antagonister |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4521418A (de) |
| EP (1) | EP0015138B1 (de) |
| JP (1) | JPS55115883A (de) |
| AR (1) | AR224392A1 (de) |
| AT (1) | AT377260B (de) |
| AU (1) | AU536194B2 (de) |
| DD (1) | DD149217A5 (de) |
| DE (1) | DE3062310D1 (de) |
| DK (1) | DK74680A (de) |
| ES (1) | ES8103078A1 (de) |
| FI (1) | FI800515A (de) |
| GR (1) | GR74009B (de) |
| IE (1) | IE49270B1 (de) |
| NO (1) | NO800463L (de) |
| PL (1) | PL222115A1 (de) |
| PT (1) | PT70850A (de) |
| RO (1) | RO79711A (de) |
| ZA (1) | ZA801002B (de) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4227271A (en) * | 1979-08-09 | 1980-10-14 | Kulka Thomas S | Foot supporting strap for hospital bed |
| US4383343A (en) * | 1979-08-09 | 1983-05-17 | Kulka Thomas S | Foot supporting strap for hospital bed |
| CA1206151A (en) * | 1981-12-28 | 1986-06-17 | Richard P. Pioch | Pyrimidone anti-ulcer agents |
| CA1211111A (en) * | 1982-02-15 | 1986-09-09 | Isao Yanagisawa | Process for preparing novel pyrimidone compounds |
| US4808589A (en) * | 1982-02-20 | 1989-02-28 | Smith Kline & French Laboratories Limited | Pyrimidone derivatives |
| US4444381A (en) * | 1982-05-11 | 1984-04-24 | Wayne Sherwyn J | Operating table accessory, particularly for lumbar laminectomies |
| DE3220118A1 (de) * | 1982-05-28 | 1983-12-01 | Bayer Ag, 5090 Leverkusen | Alkylenverbrueckte guanidinothiazolderivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE3306102C1 (de) * | 1983-02-22 | 1984-08-02 | Ludwig Heumann & Co GmbH, 8500 Nürnberg | Pyridin-Pyrimidinon-Derivate,Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| GB8320505D0 (en) * | 1983-07-29 | 1983-09-01 | Smith Kline French Lab | Chemical compounds |
| US4772704A (en) * | 1983-09-21 | 1988-09-20 | Bristol-Myers Company | 2,5-disubstituted-4(3H)-pyrimidones having histamine H2 -receptor antagonist activity |
| GB8421427D0 (en) * | 1984-08-23 | 1984-09-26 | Smith Kline French Lab | Chemical compounds |
| IT1178026B (it) * | 1984-10-05 | 1987-09-03 | Medosan Ind Biochimi | Derivati del 2-amino-tiazolo |
| JO1410B1 (en) * | 1984-11-03 | 1986-11-30 | سميث كلاين اند فرينش لابوراتوريز ليمتد | Vehicles |
| JP2807577B2 (ja) * | 1990-06-15 | 1998-10-08 | エーザイ株式会社 | 環状アミド誘導体 |
| US5611097A (en) * | 1995-08-17 | 1997-03-18 | Dumke; Dan | Foot stop for beds |
| WO2022034121A1 (en) | 2020-08-11 | 2022-02-17 | Université De Strasbourg | H2 blockers targeting liver macrophages for the prevention and treatment of liver disease and cancer |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1223686A (en) * | 1967-02-24 | 1971-03-03 | Ici Ltd | Salts of pyrimidine derivatives and the use thereof as fungicides |
| US3980781A (en) * | 1966-03-31 | 1976-09-14 | Imperial Chemical Industries Limited | Fungicidal composition and method containing 2-amino-pyrimidines |
| GB1419994A (en) * | 1973-05-03 | 1976-01-07 | Smith Kline French Lab | Heterocyclicalkylaminotheterocyclic compounds methods for their preparation and compositions comprising them |
| IN146736B (de) * | 1975-10-02 | 1979-08-25 | Smith Kline French Lab | |
| US4145546A (en) * | 1975-10-02 | 1979-03-20 | Smith Kline & French Laboratories Limited | 4-Pyrimidone compounds |
| US4154834A (en) * | 1975-12-29 | 1979-05-15 | Smith Kline & French Laboratories Limited | Substituted isocytosines having histamine H2 -antagonist activity |
| MW5076A1 (en) * | 1975-12-29 | 1978-02-08 | Smith Kline French Lab | Pharmacologicalle active compounds |
| US4216318A (en) * | 1975-12-29 | 1980-08-05 | Smith Kline & French Laboratories Limited | Heterocyclic alkyl 4-pyrimidones |
| DE2817078C2 (de) * | 1977-04-20 | 1995-06-14 | Zeneca Ltd | Guanidinderivate |
| US4165378A (en) * | 1977-04-20 | 1979-08-21 | Ici Americas Inc. | Guanidine derivatives of imidazoles and thiazoles |
| NZ186965A (en) * | 1977-04-20 | 1980-02-21 | Ici Ltd | Guanidino derivatives and pharmaceutical compositions |
| JPS54132566A (en) * | 1978-01-18 | 1979-10-15 | Ici Ltd | Guanidine derivative*its manufacture and secretion controlling pharmaceutical composition containing it |
| US4374836A (en) * | 1978-10-16 | 1983-02-22 | Imperial Chemical Industries Ltd. | Antisecretory heterocyclic derivatives, process for their manufacture and pharmaceutical compositions containing them |
-
1980
- 1980-02-12 US US06/120,807 patent/US4521418A/en not_active Expired - Lifetime
- 1980-02-19 GR GR61235A patent/GR74009B/el unknown
- 1980-02-20 PT PT70850A patent/PT70850A/pt unknown
- 1980-02-20 JP JP2106580A patent/JPS55115883A/ja active Pending
- 1980-02-20 NO NO800463A patent/NO800463L/no unknown
- 1980-02-20 ES ES488772A patent/ES8103078A1/es not_active Expired
- 1980-02-20 EP EP80300478A patent/EP0015138B1/de not_active Expired
- 1980-02-20 PL PL22211580A patent/PL222115A1/xx unknown
- 1980-02-20 IE IE337/80A patent/IE49270B1/en unknown
- 1980-02-20 DE DE8080300478T patent/DE3062310D1/de not_active Expired
- 1980-02-21 AT AT0098280A patent/AT377260B/de not_active IP Right Cessation
- 1980-02-21 DK DK74680A patent/DK74680A/da not_active Application Discontinuation
- 1980-02-21 DD DD80219202A patent/DD149217A5/de unknown
- 1980-02-21 FI FI800515A patent/FI800515A/fi not_active Application Discontinuation
- 1980-02-21 AR AR280058A patent/AR224392A1/es active
- 1980-02-21 AU AU55791/80A patent/AU536194B2/en not_active Ceased
- 1980-02-21 RO RO80100261A patent/RO79711A/ro unknown
- 1980-02-21 ZA ZA00801002A patent/ZA801002B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE49270B1 (en) | 1985-09-04 |
| ATA98280A (de) | 1984-07-15 |
| ES488772A0 (es) | 1981-02-16 |
| EP0015138A1 (de) | 1980-09-03 |
| PL222115A1 (de) | 1980-12-01 |
| AU536194B2 (en) | 1984-04-19 |
| IE800337L (en) | 1980-08-21 |
| EP0015138B1 (de) | 1983-03-16 |
| DK74680A (da) | 1980-08-22 |
| DE3062310D1 (en) | 1983-04-21 |
| AU5579180A (en) | 1980-08-28 |
| DD149217A5 (de) | 1981-07-01 |
| FI800515A (fi) | 1980-08-22 |
| US4521418A (en) | 1985-06-04 |
| AR224392A1 (es) | 1981-11-30 |
| GR74009B (de) | 1984-06-06 |
| AT377260B (de) | 1985-02-25 |
| PT70850A (en) | 1980-03-01 |
| RO79711A (ro) | 1982-08-17 |
| ES8103078A1 (es) | 1981-02-16 |
| JPS55115883A (en) | 1980-09-06 |
| ZA801002B (en) | 1981-03-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66000B (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 2-amino-4-pyrimidonderivat | |
| NO800463L (no) | Fremgangsmaate for fremstilling av histamin-antagonister | |
| US3786061A (en) | Pyridyl-trifluoromethylimidazoles | |
| CA1190224A (en) | Derivatives of 1,2-diamino-cyclobutene-3,4-dione as potent histamine h.sub.2-antagonists | |
| US4159329A (en) | 4-Pyrimidones compositions, and methods of use | |
| CA1170261A (en) | Process for preparing pyrimidone derivatives | |
| NO170883B (no) | Fremgangsmaate for fremstilling av 2-amino-5-hydroksy-4-metylpyrimidin-derivater | |
| US4218452A (en) | Substituted 4-pyrimidone compounds, compositions and methods of use | |
| NO793642L (no) | Fremgangsmaate for fremstilling av farmasoeytisk aktive pyrimidinderivater. | |
| WO2010019924A1 (en) | Composition and methods for the design and development of metallo-enzyme inhibitors | |
| NO792337L (no) | Fremgangsmaate for fremstilling av pyrimidinforbindelser | |
| US4388317A (en) | Pyrimidones having histamine H2 -antagonist activity | |
| US4539207A (en) | Pyrimidine compounds | |
| NZ201642A (en) | 1-phenylindazol-3-one derivatives and pharmaceutical compositions | |
| DK165964B (da) | Forbedret indomethancin- eller oxicam-baseret anti-inflammatorisk praeparat | |
| KR830000313B1 (ko) | 피리미돈의 제조방법 | |
| HU193360B (en) | Process for producing /amino-pyridinyl/- and /nitro-pyridinyl/-amino-phenyl/-aryl-methanone derivatives | |
| US4439609A (en) | Pyridines | |
| US4359466A (en) | Guanidine compounds | |
| US4607107A (en) | (4-aminoalkyl-2-pyridyl alkyl)guanidines | |
| NO149846B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive nye 2-substituerte-4-(4-(2-metyl-3-hydroksy-4-hydroksymetyl-5-pyridylmetyl)-1-piperazinyl)-6-metylpyrimidiner | |
| PL124279B1 (en) | Process for preparing novel pyrimidones | |
| IE58204B1 (en) | 2-Guanidino-4-(2-methyl-4-imidazolyl) thiazoles in the treatment of rheumatoid arthritis | |
| JPS6345677B2 (de) | ||
| CS196353B2 (cs) | Způsob přípravy derivátů amidlnsulfinové kyseliny |