NO773840L - Fremgangsmaate for emulsjonspolymerisering av vinylklorid - Google Patents
Fremgangsmaate for emulsjonspolymerisering av vinylkloridInfo
- Publication number
- NO773840L NO773840L NO773840A NO773840A NO773840L NO 773840 L NO773840 L NO 773840L NO 773840 A NO773840 A NO 773840A NO 773840 A NO773840 A NO 773840A NO 773840 L NO773840 L NO 773840L
- Authority
- NO
- Norway
- Prior art keywords
- approx
- alcohol
- surfactant
- linear
- vinyl chloride
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 28
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 title claims description 20
- 238000006116 polymerization reaction Methods 0.000 title description 18
- 239000000178 monomer Substances 0.000 claims description 26
- 239000003995 emulsifying agent Substances 0.000 claims description 24
- 239000004094 surface-active agent Substances 0.000 claims description 23
- -1 alkali metal cation Chemical class 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 16
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 claims description 16
- 239000003999 initiator Substances 0.000 claims description 14
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 claims description 12
- 235000019333 sodium laurylsulphate Nutrition 0.000 claims description 12
- 229920000642 polymer Polymers 0.000 claims description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 9
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 238000007720 emulsion polymerization reaction Methods 0.000 claims description 5
- 229930195734 saturated hydrocarbon Natural products 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 239000013543 active substance Substances 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 239000002245 particle Substances 0.000 description 21
- 238000002474 experimental method Methods 0.000 description 9
- 229920005989 resin Polymers 0.000 description 7
- 239000011347 resin Substances 0.000 description 7
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 6
- 239000004816 latex Substances 0.000 description 6
- 229920000126 latex Polymers 0.000 description 6
- 239000012429 reaction media Substances 0.000 description 6
- 238000009826 distribution Methods 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 230000015271 coagulation Effects 0.000 description 4
- 238000005345 coagulation Methods 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 229920000915 polyvinyl chloride Polymers 0.000 description 4
- 239000004800 polyvinyl chloride Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 235000010323 ascorbic acid Nutrition 0.000 description 3
- 229960005070 ascorbic acid Drugs 0.000 description 3
- 239000011668 ascorbic acid Substances 0.000 description 3
- 229960000541 cetyl alcohol Drugs 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 229920001944 Plastisol Polymers 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- BTFJIXJJCSYFAL-UHFFFAOYSA-N arachidyl alcohol Natural products CCCCCCCCCCCCCCCCCCCCO BTFJIXJJCSYFAL-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000009533 lab test Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229940055577 oleyl alcohol Drugs 0.000 description 2
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 239000004999 plastisol Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000035040 seed growth Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229940012831 stearyl alcohol Drugs 0.000 description 2
- 229920001567 vinyl ester resin Polymers 0.000 description 2
- LCPVQAHEFVXVKT-UHFFFAOYSA-N 2-(2,4-difluorophenoxy)pyridin-3-amine Chemical compound NC1=CC=CN=C1OC1=CC=C(F)C=C1F LCPVQAHEFVXVKT-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- MHGOKSLTIUHUBF-UHFFFAOYSA-N 2-ethylhexyl sulfate Chemical compound CCCCC(CC)COS(O)(=O)=O MHGOKSLTIUHUBF-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium peroxydisulfate Substances [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- BHDAXLOEFWJKTL-UHFFFAOYSA-L dipotassium;carboxylatooxy carbonate Chemical compound [K+].[K+].[O-]C(=O)OOC([O-])=O BHDAXLOEFWJKTL-UHFFFAOYSA-L 0.000 description 1
- 238000010556 emulsion polymerization method Methods 0.000 description 1
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 description 1
- BNKAXGCRDYRABM-UHFFFAOYSA-N ethenyl dihydrogen phosphate Chemical compound OP(O)(=O)OC=C BNKAXGCRDYRABM-UHFFFAOYSA-N 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-L ethenyl-dioxido-oxo-$l^{5}-phosphane Chemical compound [O-]P([O-])(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-L 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 150000002238 fumaric acids Chemical class 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- 239000000693 micelle Substances 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000010944 pre-mature reactiony Methods 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229940080236 sodium cetyl sulfate Drugs 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 229950005425 sodium myristyl sulfate Drugs 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Substances [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- GGHPAKFFUZUEKL-UHFFFAOYSA-M sodium;hexadecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCCCOS([O-])(=O)=O GGHPAKFFUZUEKL-UHFFFAOYSA-M 0.000 description 1
- NWZBFJYXRGSRGD-UHFFFAOYSA-M sodium;octadecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCCCCCOS([O-])(=O)=O NWZBFJYXRGSRGD-UHFFFAOYSA-M 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- UPUIQOIQVMNQAP-UHFFFAOYSA-M sodium;tetradecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCOS([O-])(=O)=O UPUIQOIQVMNQAP-UHFFFAOYSA-M 0.000 description 1
- HQCFDOOSGDZRII-UHFFFAOYSA-M sodium;tridecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCOS([O-])(=O)=O HQCFDOOSGDZRII-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- KOZCZZVUFDCZGG-UHFFFAOYSA-N vinyl benzoate Chemical compound C=COC(=O)C1=CC=CC=C1 KOZCZZVUFDCZGG-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical class OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 1
- 238000011179 visual inspection Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F14/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen
- C08F14/02—Monomers containing chlorine
- C08F14/04—Monomers containing two carbon atoms
- C08F14/06—Vinyl chloride
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymerisation Methods In General (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/740,989 US4093581A (en) | 1976-11-11 | 1976-11-11 | Emulsion polymerization of vinyl chloride using prehomogenized mixed emulsifier system |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO773840L true NO773840L (no) | 1978-05-12 |
Family
ID=24978902
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO773840A NO773840L (no) | 1976-11-11 | 1977-11-10 | Fremgangsmaate for emulsjonspolymerisering av vinylklorid |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4093581A (de) |
| JP (1) | JPS5360980A (de) |
| BE (1) | BE860575A (de) |
| CA (1) | CA1137248A (de) |
| CH (1) | CH631464A5 (de) |
| DE (1) | DE2742178A1 (de) |
| DK (1) | DK497577A (de) |
| FR (1) | FR2370760A1 (de) |
| GB (1) | GB1575080A (de) |
| IL (1) | IL52910A (de) |
| NL (1) | NL7710979A (de) |
| NO (1) | NO773840L (de) |
| SE (1) | SE7712609L (de) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4150210A (en) * | 1978-06-19 | 1979-04-17 | Stauffer Chemical Company | Emulsion polymerization of vinyl chloride polymers using mixed emulsifier system |
| US4204023A (en) * | 1978-07-07 | 1980-05-20 | The Kendall Company | Mixed sulfonated emulsifying agents used to produce adhesive compositions from acrylic monomers and adhesive tape using the compositions |
| SE430896B (sv) * | 1979-12-06 | 1983-12-19 | Kema Nord Ab | Forfarande for polymerisation av vinylklorid i nervaro av en stabiliserande polymerlatex |
| DE3120708A1 (de) * | 1981-05-25 | 1982-12-09 | Basf Ag, 6700 Ludwigshafen | Verfahren zur diskontinuierlichen polymerisation von vinylchlorid |
| DE3210891A1 (de) * | 1982-03-25 | 1983-09-29 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur herstellung von verpastbaren polymeren des vinylchlorids |
| DE3242088A1 (de) * | 1982-11-13 | 1984-05-17 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur herstellung von verpastbaren polymeren des vinylchlorids |
| DE3343766A1 (de) * | 1983-12-03 | 1985-06-13 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur herstellung von verpastbaren vinylchloridpolymerisaten |
| EP0144614B1 (de) * | 1983-12-03 | 1989-05-31 | Hüls Aktiengesellschaft | Verfahren zur Herstellung von verpastbaren Vinylchloridpolymerisaten |
| DE3421354A1 (de) * | 1984-06-08 | 1985-12-12 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung hochmolekularer thermoplastharze |
| DE3526251A1 (de) * | 1985-07-23 | 1987-01-29 | Huels Chemische Werke Ag | Verfahren zur herstellung von verpastbaren vinylchlorid-polymerisaten |
| EP0435444A1 (de) * | 1989-11-27 | 1991-07-03 | Mobil Oil Corporation | Verzweigte oberflächenaktive Substanzen und Schneidölzusammensetzungen, welche diese gegen mikrobiologische Zersetzung resistenten oberflächenaktiven Substanzen enthalten |
| JP3398171B2 (ja) * | 1993-03-15 | 2003-04-21 | 株式会社資生堂 | 水中油型乳化組成物 |
| EP3369787B1 (de) | 2017-03-03 | 2019-05-08 | Evonik Röhm GmbH | Härtbare (meth)acrylharzzusammensetzungen mit erhöhter viskosität |
| EP3369788B1 (de) | 2017-03-03 | 2019-05-08 | Evonik Röhm GmbH | Härtbare thermoplastische harzzusammensetzungen mit verbesserten mechanischen eigenschaften |
| KR102367336B1 (ko) * | 2018-10-11 | 2022-02-25 | 주식회사 엘지화학 | 중합 개시제 조성물의 제조방법 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3219609A (en) * | 1961-02-22 | 1965-11-23 | Kuhlmann Ets | Aqueous dispersions of vinyl chloride-acrylic ester copolymers |
| GB978875A (de) * | 1963-03-29 | Ici Ltd | ||
| US3383346A (en) * | 1965-04-07 | 1968-05-14 | Goodyear Tire & Rubber | Particle size control in seed technique emulsion polymerization using hydroxyl group-containing modifier |
| GB1102980A (en) * | 1966-01-31 | 1968-02-14 | Kanegafuchi Chemical Ind | Improvements in and relating to the preparation of vinyl chloride polymers |
| US3755225A (en) * | 1971-08-17 | 1973-08-28 | Diamond Shamrock Corp | Process for preparing homo- and copolymers of vinyl chloride in aqueous emulsion with post addition of a water-soluble ethylene oxide-ethylene glycol adduct |
| GB1492028A (en) * | 1974-01-23 | 1977-11-16 | Ici Ltd | Vinyl chloride polymerisation process |
-
1976
- 1976-11-11 US US05/740,989 patent/US4093581A/en not_active Expired - Lifetime
-
1977
- 1977-09-08 IL IL52910A patent/IL52910A/xx unknown
- 1977-09-13 CA CA000286649A patent/CA1137248A/en not_active Expired
- 1977-09-20 DE DE19772742178 patent/DE2742178A1/de not_active Withdrawn
- 1977-10-06 NL NL7710979A patent/NL7710979A/xx not_active Application Discontinuation
- 1977-10-13 JP JP12295877A patent/JPS5360980A/ja active Pending
- 1977-10-17 GB GB43046/77A patent/GB1575080A/en not_active Expired
- 1977-10-18 FR FR7731336A patent/FR2370760A1/fr not_active Withdrawn
- 1977-11-08 BE BE2056409A patent/BE860575A/xx unknown
- 1977-11-08 SE SE7712609A patent/SE7712609L/xx not_active Application Discontinuation
- 1977-11-08 CH CH1360277A patent/CH631464A5/de not_active IP Right Cessation
- 1977-11-09 DK DK497577A patent/DK497577A/da not_active Application Discontinuation
- 1977-11-10 NO NO773840A patent/NO773840L/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL52910A (en) | 1980-07-31 |
| CH631464A5 (de) | 1982-08-13 |
| SE7712609L (sv) | 1978-05-12 |
| CA1137248A (en) | 1982-12-07 |
| US4093581A (en) | 1978-06-06 |
| BE860575A (nl) | 1978-05-08 |
| GB1575080A (en) | 1980-09-17 |
| IL52910A0 (en) | 1977-11-30 |
| FR2370760A1 (fr) | 1978-06-09 |
| JPS5360980A (en) | 1978-05-31 |
| DE2742178A1 (de) | 1978-05-18 |
| DK497577A (da) | 1978-05-12 |
| NL7710979A (nl) | 1978-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO773840L (no) | Fremgangsmaate for emulsjonspolymerisering av vinylklorid | |
| US4786696A (en) | Process for the preparation of tacky polymeric microspheres | |
| US2300920A (en) | Interpolymers of vinyl sulphonic acid with another vinyl compound and aqueous emulsions thereof | |
| CA1049175A (en) | Styrene-butadiene copolymer latices containing carboxyl groups | |
| US3980603A (en) | Microsuspension polymerization process to yield vinyl halide polymer latex involving delayed addition of bulk monomer mix | |
| US4071675A (en) | Emulsion polymerization of vinyl chloride using mixed emulsifier system in a single step in the absence of seed formation | |
| US4631324A (en) | Process for the production of paste-forming polymers of vinyl chloride | |
| US2662866A (en) | Emulsion polymerization of vinyl acetate | |
| NO163101B (no) | Fremgangsmaate til fremstilling av vinylkloridpolymerisater som kan omdannes til pastaform, samt anvendelse av polymerisatene til fremstilling av mykskumstoff. | |
| NO151010B (no) | Fremgangsmaate for fremstilling av vinylkloridhomo- eller -ko-polymerisater inneholdende minst 50 vekt% vinylklorid-enheter | |
| US3595848A (en) | Process for the stable aqueous monomer dispersion polymerization and mixed polymerization of vinyl chloride | |
| US3468833A (en) | Process for the preparation of large-particle-size latices | |
| KR100400526B1 (ko) | 발포특성이우수한염화비닐계수지의제조방법 | |
| US3097178A (en) | Vinylidene chloride copolymer latex containing oxyethylated castor oil | |
| US3632562A (en) | Process for polymerizing and copolymerizing vinyl chloride in aqueous emulsions | |
| CA1152695A (en) | Method of polymerizing vinyl chloride | |
| US2479241A (en) | Process for emulsifying polymerizable compounds and effecting polymerization with said emulsions | |
| US2616886A (en) | Shortstopping vinyl chloride polymerizations with polyunsaturated monocarboxylic acids | |
| KR810001468B1 (ko) | 혼합유화제를 사용하는 염화비닐의 유화중합법 | |
| Törnell | Recent developments in PVC polymerization | |
| CN105273119A (zh) | 一种高聚合度聚氯乙烯树脂的制备方法 | |
| US2395812A (en) | Polymers of 1-carbalkoxybutadienes-1,3 and process of making same | |
| CA1065540A (en) | Process for producing dispersion resins by homo or copolymerization of vinyl or vinylidene halides | |
| US3061562A (en) | Method of stabilizing vinylidene chloride copolymer latices and resulting latex | |
| CN108467450A (zh) | 一种基于皮克林乳液型交联剂的高聚合度消光聚氯乙烯的合成方法 |