NO761431L - - Google Patents
Info
- Publication number
- NO761431L NO761431L NO761431A NO761431A NO761431L NO 761431 L NO761431 L NO 761431L NO 761431 A NO761431 A NO 761431A NO 761431 A NO761431 A NO 761431A NO 761431 L NO761431 L NO 761431L
- Authority
- NO
- Norway
- Prior art keywords
- denotes
- formula
- general formula
- methyl
- compound
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 46
- -1 alkali metal salt Chemical class 0.000 claims description 39
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 claims description 39
- 238000000034 method Methods 0.000 claims description 39
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 15
- 150000002148 esters Chemical class 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 11
- 239000007858 starting material Substances 0.000 claims description 11
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 9
- 229910052794 bromium Inorganic materials 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 8
- 239000008194 pharmaceutical composition Substances 0.000 claims description 8
- 230000007062 hydrolysis Effects 0.000 claims description 7
- 238000006460 hydrolysis reaction Methods 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical class CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 claims description 5
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 5
- 230000020176 deacylation Effects 0.000 claims description 5
- 238000005947 deacylation reaction Methods 0.000 claims description 5
- 125000004185 ester group Chemical group 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 125000004036 acetal group Chemical group 0.000 claims description 3
- 238000003776 cleavage reaction Methods 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 230000007017 scission Effects 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 2
- 238000006396 nitration reaction Methods 0.000 claims description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims 2
- 239000002552 dosage form Substances 0.000 claims 1
- 230000026030 halogenation Effects 0.000 claims 1
- 238000005658 halogenation reaction Methods 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- 230000001225 therapeutic effect Effects 0.000 claims 1
- 230000007306 turnover Effects 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical class [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000000243 solution Substances 0.000 description 17
- 239000000047 product Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 9
- 238000003756 stirring Methods 0.000 description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 7
- 235000008504 concentrate Nutrition 0.000 description 7
- 239000012141 concentrate Substances 0.000 description 7
- 229910052802 copper Inorganic materials 0.000 description 7
- 239000010949 copper Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 235000011121 sodium hydroxide Nutrition 0.000 description 6
- 206010012735 Diarrhoea Diseases 0.000 description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 5
- 150000001241 acetals Chemical class 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000000284 extract Substances 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 238000005809 transesterification reaction Methods 0.000 description 4
- TWFOGIKUCAISET-UHFFFAOYSA-N 5-bromo-2-[2-methyl-3-(trifluoromethyl)anilino]benzoic acid Chemical compound C1=CC=C(C(F)(F)F)C(C)=C1NC1=CC=C(Br)C=C1C(O)=O TWFOGIKUCAISET-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 230000001142 anti-diarrhea Effects 0.000 description 3
- 150000001718 carbodiimides Chemical class 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 238000007429 general method Methods 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 125000005908 glyceryl ester group Chemical group 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011118 potassium hydroxide Nutrition 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- QZZKAWCQQHRERK-UHFFFAOYSA-N 2-[3-(difluoromethyl)-2-methylanilino]benzoic acid Chemical compound C1=CC=C(C(F)F)C(C)=C1NC1=CC=CC=C1C(O)=O QZZKAWCQQHRERK-UHFFFAOYSA-N 0.000 description 2
- TWLDBACVSHADLI-UHFFFAOYSA-N 2-methyl-3-(trifluoromethyl)aniline Chemical compound CC1=C(N)C=CC=C1C(F)(F)F TWLDBACVSHADLI-UHFFFAOYSA-N 0.000 description 2
- LXXWXYXPWXFTHQ-UHFFFAOYSA-N 3-(difluoromethyl)-2-methylaniline Chemical compound CC1=C(N)C=CC=C1C(F)F LXXWXYXPWXFTHQ-UHFFFAOYSA-N 0.000 description 2
- BURCQHIJBLTPGK-UHFFFAOYSA-N 5-chloro-2-[3-(difluoromethyl)-2-methylanilino]benzoic acid Chemical compound C1=CC=C(C(F)F)C(C)=C1NC1=CC=C(Cl)C=C1C(O)=O BURCQHIJBLTPGK-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000006286 aqueous extract Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- IAHMNSCQDXESII-UHFFFAOYSA-N benzenecarboximidoyl chloride Chemical compound ClC(=N)C1=CC=CC=C1 IAHMNSCQDXESII-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- ODWXUNBKCRECNW-UHFFFAOYSA-M bromocopper(1+) Chemical compound Br[Cu+] ODWXUNBKCRECNW-UHFFFAOYSA-M 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 206010009887 colitis Diseases 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 2
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 2
- 230000002496 gastric effect Effects 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 2
- 150000002463 imidates Chemical class 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- KOMCGNXBTANHSJ-UHFFFAOYSA-N 2,3-dihydroxypropyl 5-bromo-2-[2-methyl-3-(trifluoromethyl)anilino]benzoate Chemical compound C1=CC=C(C(F)(F)F)C(C)=C1NC1=CC=C(Br)C=C1C(=O)OCC(O)CO KOMCGNXBTANHSJ-UHFFFAOYSA-N 0.000 description 1
- QVTQYSFCFOGITD-UHFFFAOYSA-N 2,5-dichlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1Cl QVTQYSFCFOGITD-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- SOWDTHRIACEPGB-UHFFFAOYSA-N 2-[2-methyl-3-(trifluoromethyl)anilino]-5-nitrobenzoic acid Chemical compound C1=CC=C(C(F)(F)F)C(C)=C1NC1=CC=C([N+]([O-])=O)C=C1C(O)=O SOWDTHRIACEPGB-UHFFFAOYSA-N 0.000 description 1
- YRBRYHACQBMPLO-UHFFFAOYSA-N 2-[2-methyl-3-(trifluoromethyl)anilino]benzoic acid Chemical compound C1=CC=C(C(F)(F)F)C(C)=C1NC1=CC=CC=C1C(O)=O YRBRYHACQBMPLO-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- QUEKGYQTRJVEQC-UHFFFAOYSA-N 2516-96-3 Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1Cl QUEKGYQTRJVEQC-UHFFFAOYSA-N 0.000 description 1
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 1
- KRJUUOZTFJXTBZ-UHFFFAOYSA-N 5-bromo-2-[3-(difluoromethyl)-2-methylanilino]benzoic acid Chemical compound C1=CC=C(C(F)F)C(C)=C1NC1=CC=C(Br)C=C1C(O)=O KRJUUOZTFJXTBZ-UHFFFAOYSA-N 0.000 description 1
- DDAZMILBHCLMQJ-UHFFFAOYSA-N 5-chloro-2-[2-methyl-3-(trifluoromethyl)anilino]benzoic acid Chemical compound C1=CC=C(C(F)(F)F)C(C)=C1NC1=CC=C(Cl)C=C1C(O)=O DDAZMILBHCLMQJ-UHFFFAOYSA-N 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 206010008631 Cholera Diseases 0.000 description 1
- 102000009016 Cholera Toxin Human genes 0.000 description 1
- 108010049048 Cholera Toxin Proteins 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 239000005751 Copper oxide Substances 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical class C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229920000148 Polycarbophil calcium Polymers 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005079 alkoxycarbonylmethyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000012735 amaranth Nutrition 0.000 description 1
- 239000004178 amaranth Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 229940125714 antidiarrheal agent Drugs 0.000 description 1
- 239000003793 antidiarrheal agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-M benzenecarboximidate Chemical compound [NH-]C(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-M 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 210000000941 bile Anatomy 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000007963 capsule composition Substances 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 229940116318 copper carbonate Drugs 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- QUQFTIVBFKLPCL-UHFFFAOYSA-L copper;2-amino-3-[(2-amino-2-carboxylatoethyl)disulfanyl]propanoate Chemical compound [Cu+2].[O-]C(=O)C(N)CSSCC(N)C([O-])=O QUQFTIVBFKLPCL-UHFFFAOYSA-L 0.000 description 1
- GEZOTWYUIKXWOA-UHFFFAOYSA-L copper;carbonate Chemical compound [Cu+2].[O-]C([O-])=O GEZOTWYUIKXWOA-UHFFFAOYSA-L 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- KJWHRMZKJXOWFC-UHFFFAOYSA-N methyl 5-chloro-2-hydroxybenzoate Chemical compound COC(=O)C1=CC(Cl)=CC=C1O KJWHRMZKJXOWFC-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 238000009481 moist granulation Methods 0.000 description 1
- DTZZRBJJPFQYAO-UHFFFAOYSA-N n-[3-(difluoromethyl)-2-methylphenyl]benzenecarboximidoyl chloride Chemical compound C1=CC=C(C(F)F)C(C)=C1N=C(Cl)C1=CC=CC=C1 DTZZRBJJPFQYAO-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100001160 nonlethal Toxicity 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical group 0.000 description 1
- 229950005134 polycarbophil Drugs 0.000 description 1
- 229940093430 polyethylene glycol 1500 Drugs 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- WBHHMMIMDMUBKC-XLNAKTSKSA-N ricinelaidic acid Chemical compound CCCCCC[C@@H](O)C\C=C\CCCCCCCC(O)=O WBHHMMIMDMUBKC-XLNAKTSKSA-N 0.000 description 1
- 229960003656 ricinoleic acid Drugs 0.000 description 1
- FEUQNCSVHBHROZ-UHFFFAOYSA-N ricinoleic acid Natural products CCCCCCC(O[Si](C)(C)C)CC=CCCCCCCCC(=O)OC FEUQNCSVHBHROZ-UHFFFAOYSA-N 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- RNVYQYLELCKWAN-UHFFFAOYSA-N solketal Chemical compound CC1(C)OCC(CO)O1 RNVYQYLELCKWAN-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
- C07C243/24—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids
- C07C243/38—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids with acylating carboxyl groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/24—Radicals substituted by singly bound oxygen or sulfur atoms esterified
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/572,981 US4029815A (en) | 1975-04-30 | 1975-04-30 | Anti-diarrheal anthranilic acids |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO761431L true NO761431L (fa) | 1976-11-02 |
Family
ID=24290152
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO761431A NO761431L (fa) | 1975-04-30 | 1976-04-26 |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4029815A (fa) |
| JP (1) | JPS51133245A (fa) |
| AU (1) | AU1337676A (fa) |
| BE (1) | BE841121A (fa) |
| DE (1) | DE2618215A1 (fa) |
| DK (1) | DK186776A (fa) |
| FI (1) | FI761150A7 (fa) |
| FR (1) | FR2354761A1 (fa) |
| GR (1) | GR59917B (fa) |
| IL (1) | IL49474A0 (fa) |
| LU (1) | LU74841A1 (fa) |
| NL (1) | NL7604422A (fa) |
| NO (1) | NO761431L (fa) |
| PT (1) | PT65036B (fa) |
| SE (1) | SE7604789L (fa) |
| ZA (1) | ZA762472B (fa) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53105445A (en) * | 1977-02-26 | 1978-09-13 | Hokuriku Pharmaceutical | Nn*33trifluoromethylphenyl* anthranylate alklyester derivative and process for preparing same |
| IT1113331B (it) * | 1979-03-27 | 1986-01-20 | Neopharmed Spa | Esteri della salicilammide con attivita' terapeutica,procedimento per la loro preparazione e relative composizioni farmaceutiche |
| DE3608726A1 (de) * | 1986-03-15 | 1987-09-17 | Hoechst Ag | Verwendung aminosubstituierter benzoesaeuren als heilmittel gegen diarrhoe und arzneimittel auf basis dieser verbindungen |
| US4906667A (en) * | 1986-07-30 | 1990-03-06 | E. R. Squibb & Sons, Inc. | Phenyl hydroxamic acids including a hetero-containing substituent |
| ES2039226T3 (es) * | 1986-12-30 | 1993-09-16 | American Cyanamid Company | Procedimiento para preparar composiciones que contienen policarbofil. |
| DE3706224A1 (de) * | 1987-02-26 | 1988-09-08 | Henkel Kgaa | Haarfaerbemittel mit direktziehenden nitrodiphenylamin-derivaten |
| US5155110A (en) * | 1987-10-27 | 1992-10-13 | Warner-Lambert Company | Fenamic acid hydroxamate derivatives having cyclooxygenase and 5-lipoxygenase inhibition |
| US5112868A (en) * | 1988-05-19 | 1992-05-12 | Warner-Lambert Company | Hydroxamate derivatives of selected nonsteroidal antiinflammatory acyl residues having cyclooxygenase and 5-lipoxygenase inhibition |
| US4943587A (en) * | 1988-05-19 | 1990-07-24 | Warner-Lambert Company | Hydroxamate derivatives of selected nonsteroidal antiinflammatory acyl residues and their use for cyclooxygenase and 5-lipoxygenase inhibition |
| US4938963A (en) * | 1988-11-22 | 1990-07-03 | Parnell Pharmaceuticals, Inc. | Method and composition for treating xerostomia |
| US5015474A (en) * | 1988-11-22 | 1991-05-14 | Parnell Pharmaceuticals, Inc. | Composition for imparting moisture to a substrate |
| US4983378A (en) * | 1988-11-22 | 1991-01-08 | Parnell Pharmaceuticals, Inc. | Method and composition for treating xerostomia |
| US5017604A (en) * | 1990-04-11 | 1991-05-21 | Warner-Lambert Company | Novel fenamic acid methyl hydroxamate derivatives having cyclooxygenase and 5-lipoxygenase inhibition |
| US5110605A (en) * | 1990-08-21 | 1992-05-05 | Oramed, Inc. | Calcium polycarbophil-alginate controlled release composition and method |
| US5102666A (en) * | 1990-09-11 | 1992-04-07 | Oramed, Inc. | Calcium polycarbophil controlled release composition and method |
| US5686094A (en) * | 1991-04-01 | 1997-11-11 | Theratech, Inc. | Controlled release formulations for the treatment of xerostomia |
| FI953968A7 (fi) * | 1993-12-27 | 1995-10-19 | Eisai Co Ltd | Antraniiliset happojohdannaiset |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH479599A (de) * | 1965-04-12 | 1969-10-15 | Bristol Myers Co | Verfahren zur Herstellung von Verbindungen von Nitrilen mit Stickstoffwasserstoffsäure oder Aziden |
-
1975
- 1975-04-30 US US05/572,981 patent/US4029815A/en not_active Expired - Lifetime
-
1976
- 1976-04-26 BE BE166457A patent/BE841121A/xx unknown
- 1976-04-26 IL IL49474A patent/IL49474A0/xx unknown
- 1976-04-26 ZA ZA762472A patent/ZA762472B/xx unknown
- 1976-04-26 SE SE7604789A patent/SE7604789L/xx unknown
- 1976-04-26 DK DK186776A patent/DK186776A/da unknown
- 1976-04-26 FR FR7612298A patent/FR2354761A1/fr active Granted
- 1976-04-26 NO NO761431A patent/NO761431L/no unknown
- 1976-04-26 JP JP51047573A patent/JPS51133245A/ja active Pending
- 1976-04-26 DE DE19762618215 patent/DE2618215A1/de active Pending
- 1976-04-26 PT PT65036A patent/PT65036B/pt unknown
- 1976-04-26 NL NL7604422A patent/NL7604422A/xx unknown
- 1976-04-26 FI FI761150A patent/FI761150A7/fi not_active Application Discontinuation
- 1976-04-27 GR GR50604A patent/GR59917B/el unknown
- 1976-04-27 LU LU74841A patent/LU74841A1/xx unknown
- 1976-04-27 AU AU13376/76A patent/AU1337676A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL49474A0 (en) | 1976-06-30 |
| DE2618215A1 (de) | 1976-11-18 |
| PT65036B (en) | 1977-09-12 |
| FR2354761A1 (fr) | 1978-01-13 |
| GR59917B (en) | 1978-03-20 |
| BE841121A (fr) | 1976-10-26 |
| US4029815A (en) | 1977-06-14 |
| SE7604789L (sv) | 1976-10-31 |
| AU1337676A (en) | 1977-11-03 |
| ZA762472B (en) | 1977-04-27 |
| FI761150A7 (fa) | 1976-10-31 |
| PT65036A (en) | 1976-05-01 |
| DK186776A (da) | 1976-10-31 |
| LU74841A1 (fa) | 1977-02-08 |
| FR2354761B1 (fa) | 1978-10-20 |
| JPS51133245A (en) | 1976-11-18 |
| NL7604422A (nl) | 1976-11-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO761431L (fa) | ||
| US2910488A (en) | Aniline derivatives | |
| EP1073656B1 (en) | Imidazo pyridine derivatives which inhibit gastric acid secretion | |
| KR860001876B1 (ko) | 헤테로고리 카르복사미드의 제조방법 | |
| US3917625A (en) | Salicylamides and compositions thereof | |
| US4234736A (en) | Antiandrogenic and schistosomicidal imidazolidine derivatives | |
| UA60354C2 (uk) | Похідні хіноліну, спосіб їх одержання (варіанти) та спосіб лікування ссавців | |
| AU2006301708B2 (en) | Glycyrrhetinic acid-30-amide derivatives and the uses thereof | |
| US4528393A (en) | Derivatives having expectorant activity, the procedure for their preparation and the pharmaceutical compositions which contain them | |
| CA2456350A1 (en) | Novel imidazopyridine compounds with therapeutic effect | |
| JPH059424B2 (fa) | ||
| US4390541A (en) | Quinolone derivatives and their use in a method of controlling an immediate hypersensitivity disease | |
| DK175838B1 (da) | Fremgangsmåde til fremstilling af 2,6-dichlordiphenylamineddikesyrederivater | |
| JPS5829782A (ja) | 新規複素環化合物、その製法及び該化合物を含有する医薬組成物 | |
| US4176194A (en) | Oxyalkanoic acid derivatives | |
| NO832810L (no) | 1,3-dioksolo(4,5-g)-kinoliner og fremgangsmaate for deres fremstilling. | |
| JPS58162591A (ja) | 新規ピリジン化合物 | |
| JPS61100565A (ja) | インド−ル酢酸誘導体 | |
| CN109988075A (zh) | 一种溴芬酸钠的制备方法 | |
| US3465002A (en) | (succinimidoaryloxy)alkanoic acids,esters and amides thereof | |
| US4046896A (en) | 1-Methyl-2-(pyridyl-oxymethyl)-5-nitro-imidazoles | |
| PL182361B1 (pl) | Pochodne 6-metoksy-1H-benzotriazolo-5-karboksyamidu, sposoby ich wytwarzaniai kompozycje farmaceutyczne zawierajace te pochodne PL PL PL PL PL PL PL PL | |
| NO132930B (fa) | ||
| US3324003A (en) | Method of controlling growth of bacteria using 4-methyl-1-benzo[f]quinolone-2-carboxylic acid | |
| JPS5951542B2 (ja) | 5−フエニル−チアゾリジン−4−オン誘導体の製造方法 |