NO175633B - - Google Patents
Download PDFInfo
- Publication number
- NO175633B NO175633B NO913769A NO913769A NO175633B NO 175633 B NO175633 B NO 175633B NO 913769 A NO913769 A NO 913769A NO 913769 A NO913769 A NO 913769A NO 175633 B NO175633 B NO 175633B
- Authority
- NO
- Norway
- Prior art keywords
- disulfide
- bis
- compounds
- general formula
- preparation
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 46
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 13
- 239000001257 hydrogen Substances 0.000 claims abstract description 13
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- -1 polymethylene chain Polymers 0.000 claims abstract description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 10
- 238000002360 preparation method Methods 0.000 claims description 43
- 244000005700 microbiome Species 0.000 claims description 7
- CMBROIKDCIGYJC-UHFFFAOYSA-N 2-[(2-carbamoylcyclopenten-1-yl)disulfanyl]cyclopentene-1-carboxamide Chemical compound C1CCC(C(=O)N)=C1SSC1=C(C(N)=O)CCC1 CMBROIKDCIGYJC-UHFFFAOYSA-N 0.000 claims description 4
- 230000000813 microbial effect Effects 0.000 claims description 4
- SEHXHQIYIKYSBZ-UHFFFAOYSA-N n-hexyl-2-[[2-(hexylcarbamoyl)cyclopenten-1-yl]disulfanyl]cyclopentene-1-carboxamide Chemical compound C1CCC(C(=O)NCCCCCC)=C1SSC1=C(C(=O)NCCCCCC)CCC1 SEHXHQIYIKYSBZ-UHFFFAOYSA-N 0.000 claims description 3
- IHGPDCYERQRBSS-UHFFFAOYSA-N n-methyl-2-[[2-(methylcarbamoyl)cyclopenten-1-yl]disulfanyl]cyclopentene-1-carboxamide Chemical compound C1CCC(C(=O)NC)=C1SSC1=C(C(=O)NC)CCC1 IHGPDCYERQRBSS-UHFFFAOYSA-N 0.000 claims description 3
- VEDMJZVCUFTECL-UHFFFAOYSA-N n-butyl-2-[[2-(butylcarbamoyl)cyclopenten-1-yl]disulfanyl]cyclopentene-1-carboxamide Chemical compound C1CCC(C(=O)NCCCC)=C1SSC1=C(C(=O)NCCCC)CCC1 VEDMJZVCUFTECL-UHFFFAOYSA-N 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract description 5
- 150000002431 hydrogen Chemical class 0.000 abstract description 3
- 230000002906 microbiologic effect Effects 0.000 abstract description 2
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 32
- 238000006243 chemical reaction Methods 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- 150000001412 amines Chemical class 0.000 description 23
- 239000007800 oxidant agent Substances 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- DENPQNAWGQXKCU-UHFFFAOYSA-N thiophene-2-carboxamide Chemical compound NC(=O)C1=CC=CS1 DENPQNAWGQXKCU-UHFFFAOYSA-N 0.000 description 18
- 239000002904 solvent Substances 0.000 description 16
- 230000000845 anti-microbial effect Effects 0.000 description 15
- 229910052717 sulfur Inorganic materials 0.000 description 12
- 239000003139 biocide Substances 0.000 description 11
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- 239000002609 medium Substances 0.000 description 10
- UEFCKYIRXORTFI-UHFFFAOYSA-N 1,2-thiazolidin-3-one Chemical compound O=C1CCSN1 UEFCKYIRXORTFI-UHFFFAOYSA-N 0.000 description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 9
- 239000007788 liquid Substances 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 230000003115 biocidal effect Effects 0.000 description 8
- 150000002019 disulfides Chemical class 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 241000894006 Bacteria Species 0.000 description 7
- 150000007942 carboxylates Chemical class 0.000 description 7
- 238000004128 high performance liquid chromatography Methods 0.000 description 7
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 6
- 238000011156 evaluation Methods 0.000 description 6
- 229930195733 hydrocarbon Natural products 0.000 description 6
- 150000002430 hydrocarbons Chemical class 0.000 description 6
- 230000003158 microbiostatic effect Effects 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 239000004215 Carbon black (E152) Substances 0.000 description 5
- 241000233866 Fungi Species 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 239000012530 fluid Substances 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 230000000844 anti-bacterial effect Effects 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 238000000921 elemental analysis Methods 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 239000003973 paint Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- VUWCWMOCWKCZTA-UHFFFAOYSA-N 1,2-thiazol-4-one Chemical group O=C1CSN=C1 VUWCWMOCWKCZTA-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000003973 alkyl amines Chemical class 0.000 description 3
- 150000001408 amides Chemical group 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000498 cooling water Substances 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 239000002054 inoculum Substances 0.000 description 3
- 239000010985 leather Substances 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 238000004321 preservation Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- 239000002023 wood Substances 0.000 description 3
- PZOGAKOZVSTZSO-UHFFFAOYSA-N 2-methyl-5,6-dihydro-4h-cyclopenta[d][1,2]thiazol-3-one Chemical compound C1CCC2=C1SN(C)C2=O PZOGAKOZVSTZSO-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RUPBZQFQVRMKDG-UHFFFAOYSA-M Didecyldimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCC[N+](C)(C)CCCCCCCCCC RUPBZQFQVRMKDG-UHFFFAOYSA-M 0.000 description 2
- GUUVPOWQJOLRAS-UHFFFAOYSA-N Diphenyl disulfide Chemical compound C=1C=CC=CC=1SSC1=CC=CC=C1 GUUVPOWQJOLRAS-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical class OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 229960000587 glutaral Drugs 0.000 description 2
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000005555 metalworking Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- NKECSSFFRPNHRR-UHFFFAOYSA-N n-octyl-2-[[2-(octylcarbamoyl)cyclopenten-1-yl]disulfanyl]cyclopentene-1-carboxamide Chemical compound C1CCC(C(=O)NCCCCCCCC)=C1SSC1=C(C(=O)NCCCCCCCC)CCC1 NKECSSFFRPNHRR-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000006916 nutrient agar Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000003495 polar organic solvent Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 230000007306 turnover Effects 0.000 description 2
- YGKOYVNJPRSSRX-UHFFFAOYSA-M (4-dodecylphenyl)methyl-trimethylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCC1=CC=C(C[N+](C)(C)C)C=C1 YGKOYVNJPRSSRX-UHFFFAOYSA-M 0.000 description 1
- QAGFPFWZCJWYRP-UHFFFAOYSA-N 1,1-bis(hydroxymethyl)urea Chemical compound NC(=O)N(CO)CO QAGFPFWZCJWYRP-UHFFFAOYSA-N 0.000 description 1
- OYWRDHBGMCXGFY-UHFFFAOYSA-N 1,2,3-triazinane Chemical compound C1CNNNC1 OYWRDHBGMCXGFY-UHFFFAOYSA-N 0.000 description 1
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 1
- DTOUUUZOYKYHEP-UHFFFAOYSA-N 1,3-bis(2-ethylhexyl)-5-methyl-1,3-diazinan-5-amine Chemical compound CCCCC(CC)CN1CN(CC(CC)CCCC)CC(C)(N)C1 DTOUUUZOYKYHEP-UHFFFAOYSA-N 0.000 description 1
- VAZJLPXFVQHDFB-UHFFFAOYSA-N 1-(diaminomethylidene)-2-hexylguanidine Polymers CCCCCCN=C(N)N=C(N)N VAZJLPXFVQHDFB-UHFFFAOYSA-N 0.000 description 1
- XOILGBPDXMVFIP-UHFFFAOYSA-N 1-(diiodomethylsulfonyl)-4-methylbenzene Chemical compound CC1=CC=C(S(=O)(=O)C(I)I)C=C1 XOILGBPDXMVFIP-UHFFFAOYSA-N 0.000 description 1
- SIQZJFKTROUNPI-UHFFFAOYSA-N 1-(hydroxymethyl)-5,5-dimethylhydantoin Chemical compound CC1(C)N(CO)C(=O)NC1=O SIQZJFKTROUNPI-UHFFFAOYSA-N 0.000 description 1
- PZBPKYOVPCNPJY-UHFFFAOYSA-N 1-[2-(allyloxy)-2-(2,4-dichlorophenyl)ethyl]imidazole Chemical compound ClC1=CC(Cl)=CC=C1C(OCC=C)CN1C=NC=C1 PZBPKYOVPCNPJY-UHFFFAOYSA-N 0.000 description 1
- GKQHIYSTBXDYNQ-UHFFFAOYSA-M 1-dodecylpyridin-1-ium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+]1=CC=CC=C1 GKQHIYSTBXDYNQ-UHFFFAOYSA-M 0.000 description 1
- IQDVXXOBJULTFE-UHFFFAOYSA-M 1-dodecylpyridin-1-ium;hydron;sulfate Chemical compound OS([O-])(=O)=O.CCCCCCCCCCCC[N+]1=CC=CC=C1 IQDVXXOBJULTFE-UHFFFAOYSA-M 0.000 description 1
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 1
- LAFVACJBZDPFMO-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)phenol Chemical compound OC1=CC=CC=C1OC1=CC=C(Cl)C=C1Cl LAFVACJBZDPFMO-UHFFFAOYSA-N 0.000 description 1
- OLQJQHSAWMFDJE-UHFFFAOYSA-N 2-(hydroxymethyl)-2-nitropropane-1,3-diol Chemical compound OCC(CO)(CO)[N+]([O-])=O OLQJQHSAWMFDJE-UHFFFAOYSA-N 0.000 description 1
- NWPCFCBFUXXJIE-UHFFFAOYSA-N 2-(hydroxymethylamino)ethanol Chemical compound OCCNCO NWPCFCBFUXXJIE-UHFFFAOYSA-N 0.000 description 1
- DHVLDKHFGIVEIP-UHFFFAOYSA-N 2-bromo-2-(bromomethyl)pentanedinitrile Chemical compound BrCC(Br)(C#N)CCC#N DHVLDKHFGIVEIP-UHFFFAOYSA-N 0.000 description 1
- KBQVEKJYNIMIAT-UHFFFAOYSA-N 2-butyl-1,2-thiazolidin-3-one Chemical compound CCCCN1SCCC1=O KBQVEKJYNIMIAT-UHFFFAOYSA-N 0.000 description 1
- OIMQLXQDHOFORS-UHFFFAOYSA-N 2-chloro-2-(chloromethyl)pentanedinitrile Chemical compound ClCC(Cl)(C#N)CCC#N OIMQLXQDHOFORS-UHFFFAOYSA-N 0.000 description 1
- SXVFGEJOKLTATI-UHFFFAOYSA-N 2-chloro-n,n-bis(hydroxymethyl)acetamide Chemical compound OCN(CO)C(=O)CCl SXVFGEJOKLTATI-UHFFFAOYSA-N 0.000 description 1
- TXNSZCSYBXHETP-UHFFFAOYSA-N 2-chloro-n-(hydroxymethyl)acetamide Chemical compound OCNC(=O)CCl TXNSZCSYBXHETP-UHFFFAOYSA-N 0.000 description 1
- RDWXSJCICPOOKO-UHFFFAOYSA-N 2-methyl-1,2-benzothiazol-3-one Chemical compound C1=CC=C2C(=O)N(C)SC2=C1 RDWXSJCICPOOKO-UHFFFAOYSA-N 0.000 description 1
- PUSPAPGHKSLKKH-UHFFFAOYSA-N 2-methyl-1,2-thiazolidin-3-one Chemical compound CN1SCCC1=O PUSPAPGHKSLKKH-UHFFFAOYSA-N 0.000 description 1
- UEPCFCWEIKTKOZ-UHFFFAOYSA-N 2-oxocyclopentane-1-carboxamide Chemical compound NC(=O)C1CCCC1=O UEPCFCWEIKTKOZ-UHFFFAOYSA-N 0.000 description 1
- 229940061334 2-phenylphenol Drugs 0.000 description 1
- 229940099451 3-iodo-2-propynylbutylcarbamate Drugs 0.000 description 1
- WYVVKGNFXHOCQV-UHFFFAOYSA-N 3-iodoprop-2-yn-1-yl butylcarbamate Chemical compound CCCCNC(=O)OCC#CI WYVVKGNFXHOCQV-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- KWFFEQXPFFDJER-UHFFFAOYSA-N 4-[3-(4-aminophenoxy)propoxy]aniline Chemical compound C1=CC(N)=CC=C1OCCCOC1=CC=C(N)C=C1 KWFFEQXPFFDJER-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- 229940046305 5-bromo-5-nitro-1,3-dioxane Drugs 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- 241000223678 Aureobasidium pullulans Species 0.000 description 1
- 244000063299 Bacillus subtilis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- LVDKZNITIUWNER-UHFFFAOYSA-N Bronopol Chemical compound OCC(Br)(CO)[N+]([O-])=O LVDKZNITIUWNER-UHFFFAOYSA-N 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241001149472 Clonostachys rosea Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920002413 Polyhexanide Polymers 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000606507 Talaromyces pinophilus Species 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- APQHKWPGGHMYKJ-UHFFFAOYSA-N Tributyltin oxide Chemical compound CCCC[Sn](CCCC)(CCCC)O[Sn](CCCC)(CCCC)CCCC APQHKWPGGHMYKJ-UHFFFAOYSA-N 0.000 description 1
- WXIUBYCJAAEOFL-UHFFFAOYSA-N [S].ClOCl Chemical class [S].ClOCl WXIUBYCJAAEOFL-UHFFFAOYSA-N 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229940053991 aldehydes and derivative Drugs 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004973 alkali metal peroxides Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 230000001098 anti-algal effect Effects 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- DMSMPAJRVJJAGA-UHFFFAOYSA-N benzo[d]isothiazol-3-one Chemical compound C1=CC=C2C(=O)NSC2=C1 DMSMPAJRVJJAGA-UHFFFAOYSA-N 0.000 description 1
- JBIROUFYLSSYDX-UHFFFAOYSA-M benzododecinium chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 JBIROUFYLSSYDX-UHFFFAOYSA-M 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- PEJWCDZMACRFHF-UHFFFAOYSA-M benzyl-(1,1-dichlorododecyl)-dimethylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC(Cl)(Cl)[N+](C)(C)CC1=CC=CC=C1 PEJWCDZMACRFHF-UHFFFAOYSA-M 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- KNLINLAXQBLGJI-UHFFFAOYSA-N bis(2-hydroxyethyl)-(13-phenyltridecyl)azanium;chloride Chemical compound [Cl-].OCC[NH+](CCO)CCCCCCCCCCCCCC1=CC=CC=C1 KNLINLAXQBLGJI-UHFFFAOYSA-N 0.000 description 1
- XVBRCOKDZVQYAY-UHFFFAOYSA-N bronidox Chemical compound [O-][N+](=O)C1(Br)COCOC1 XVBRCOKDZVQYAY-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 229940041514 candida albicans extract Drugs 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- SXPWTBGAZSPLHA-UHFFFAOYSA-M cetalkonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SXPWTBGAZSPLHA-UHFFFAOYSA-M 0.000 description 1
- 229960000228 cetalkonium chloride Drugs 0.000 description 1
- DVBJBNKEBPCGSY-UHFFFAOYSA-M cetylpyridinium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 DVBJBNKEBPCGSY-UHFFFAOYSA-M 0.000 description 1
- YMKDRGPMQRFJGP-UHFFFAOYSA-M cetylpyridinium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 YMKDRGPMQRFJGP-UHFFFAOYSA-M 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- DHNRXBZYEKSXIM-UHFFFAOYSA-N chloromethylisothiazolinone Chemical compound CN1SC(Cl)=CC1=O DHNRXBZYEKSXIM-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004581 coalescence Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 238000012258 culturing Methods 0.000 description 1
- 239000002173 cutting fluid Substances 0.000 description 1
- NMCCNOZOBBWFMN-UHFFFAOYSA-N davicil Chemical compound CS(=O)(=O)C1=C(Cl)C(Cl)=NC(Cl)=C1Cl NMCCNOZOBBWFMN-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- VZVNXHMIKPHKHV-UHFFFAOYSA-M dimethyl-octadecyl-(2-phenylpropan-2-yl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)C(C)(C)C1=CC=CC=C1 VZVNXHMIKPHKHV-UHFFFAOYSA-M 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-N dithionous acid Chemical compound OS(=O)S(O)=O GRWZHXKQBITJKP-UHFFFAOYSA-N 0.000 description 1
- WSDISUOETYTPRL-UHFFFAOYSA-N dmdm hydantoin Chemical compound CC1(C)N(CO)C(=O)N(CO)C1=O WSDISUOETYTPRL-UHFFFAOYSA-N 0.000 description 1
- UTKUXSTWKJCLJX-UHFFFAOYSA-M dodecyl-dimethyl-(naphthalen-1-ylmethyl)azanium;chloride Chemical compound [Cl-].C1=CC=C2C(C[N+](C)(C)CCCCCCCCCCCC)=CC=CC2=C1 UTKUXSTWKJCLJX-UHFFFAOYSA-M 0.000 description 1
- VBKJGFUJNURQMO-UHFFFAOYSA-M dodecyl-ethyl-dimethylazanium methyl sulfate Chemical compound COS([O-])(=O)=O.CCCCCCCCCCCC[N+](C)(C)CC VBKJGFUJNURQMO-UHFFFAOYSA-M 0.000 description 1
- 238000005553 drilling Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- PASCYLAFGHJSHW-UHFFFAOYSA-N ethyl 2-[(4-methoxyphenyl)methyl]-3-(methylamino)propanoate Chemical compound CCOC(=O)C(CNC)CC1=CC=C(OC)C=C1 PASCYLAFGHJSHW-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- VPVSTMAPERLKKM-UHFFFAOYSA-N glycoluril Chemical compound N1C(=O)NC2NC(=O)NC21 VPVSTMAPERLKKM-UHFFFAOYSA-N 0.000 description 1
- 229940015043 glyoxal Drugs 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- ZCTXEAQXZGPWFG-UHFFFAOYSA-N imidurea Chemical compound O=C1NC(=O)N(CO)C1NC(=O)NCNC(=O)NC1C(=O)NC(=O)N1CO ZCTXEAQXZGPWFG-UHFFFAOYSA-N 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- JWZXKXIUSSIAMR-UHFFFAOYSA-N methylene bis(thiocyanate) Chemical compound N#CSCSC#N JWZXKXIUSSIAMR-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 235000010292 orthophenyl phenol Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Chemical group 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000011176 pooling Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 150000007979 thiazole derivatives Chemical class 0.000 description 1
- 150000003567 thiocyanates Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 150000003606 tin compounds Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- YBNLWIZAWPBUKQ-UHFFFAOYSA-N trichloro(trichloromethylsulfonyl)methane Chemical compound ClC(Cl)(Cl)S(=O)(=O)C(Cl)(Cl)Cl YBNLWIZAWPBUKQ-UHFFFAOYSA-N 0.000 description 1
- CEYYIKYYFSTQRU-UHFFFAOYSA-M trimethyl(tetradecyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCCC[N+](C)(C)C CEYYIKYYFSTQRU-UHFFFAOYSA-M 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000003442 weekly effect Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000012138 yeast extract Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/30—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a ring other than a six-membered aromatic ring of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/61—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a ring other than a six-membered aromatic ring of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/10—Systems containing only non-condensed rings with a five-membered ring the ring being unsaturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Diaphragms For Electromechanical Transducers (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Adhesive Tapes (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB909020933A GB9020933D0 (en) | 1990-09-26 | 1990-09-26 | Compound,preparation and use |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| NO913769D0 NO913769D0 (no) | 1991-09-25 |
| NO913769L NO913769L (no) | 1992-03-27 |
| NO175633B true NO175633B (fi) | 1994-08-01 |
| NO175633C NO175633C (no) | 1994-11-09 |
Family
ID=10682773
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO913769A NO175633C (no) | 1990-09-26 | 1991-09-25 | Forbindelse, preparat og anvendelse |
| NO940265A NO940265D0 (no) | 1990-09-26 | 1994-01-25 | Fremgangsmaate ved fremstilling av svovelholdige karboksylsyreamider |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO940265A NO940265D0 (no) | 1990-09-26 | 1994-01-25 | Fremgangsmaate ved fremstilling av svovelholdige karboksylsyreamider |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US5224980A (fi) |
| EP (1) | EP0478194B1 (fi) |
| JP (1) | JPH05117229A (fi) |
| KR (1) | KR920006307A (fi) |
| AT (1) | ATE120455T1 (fi) |
| AU (1) | AU634662B2 (fi) |
| CA (1) | CA2052075A1 (fi) |
| DE (1) | DE69108499T2 (fi) |
| DK (1) | DK0478194T3 (fi) |
| FI (1) | FI914526A (fi) |
| GB (2) | GB9020933D0 (fi) |
| IE (1) | IE66124B1 (fi) |
| MX (1) | MX9101270A (fi) |
| NO (2) | NO175633C (fi) |
| PT (1) | PT99044B (fi) |
| ZA (1) | ZA917492B (fi) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5302592A (en) * | 1990-08-17 | 1994-04-12 | Rohm And Haas Company | Use of substituted 3-thioacryloyl compounds as antimicrobial agents |
| GB9020924D0 (en) * | 1990-09-26 | 1990-11-07 | Ici Plc | Compound,use and preparation |
| GB9505377D0 (en) * | 1995-03-17 | 1995-05-03 | Zeneca Ltd | Process |
| BR0110852A (pt) | 2000-05-19 | 2003-02-11 | Alcon Inc | Composições que contêm um derivado dissulfeto de benzamida para tratamento de doenças alérgicas |
| EP1289945B1 (en) | 2000-05-19 | 2004-08-04 | Alcon Inc. | Aniline disulfide derivatives for treating allergic diseases |
| CN1241912C (zh) | 2000-05-19 | 2006-02-15 | 爱尔康公司 | 用于治疗过敏性疾病的二硫化物衍生物 |
| US6921739B2 (en) * | 2000-12-18 | 2005-07-26 | Aquatic Treatment Systems, Inc. | Anti-microbial and oxidative co-polymer |
| US6576792B2 (en) | 2001-05-04 | 2003-06-10 | Eastman Kodak Company | 2-halo-1-cycloalkenecarboxamides and their preparation |
| US6849664B2 (en) | 2001-10-18 | 2005-02-01 | Chevron U.S.A. Inc. | Process for disposing biocide-containing cooling water |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE295486C (fi) * | ||||
| US2470945A (en) * | 1945-01-26 | 1949-05-24 | Us Rubber Co | Di (orthoacylaminoaryl) disulfide softeners for rubbers |
| US3012039A (en) * | 1958-03-14 | 1961-12-05 | Ici Ltd | 2-p-chlorobenzyl-1, 2-benzisothiazolone |
| CH395094A (de) * | 1960-03-24 | 1965-07-15 | Wander Ag Dr A | Verfahren zur Herstellung von 6-Chlor-benzisothiazolon |
| US3452034A (en) * | 1967-03-09 | 1969-06-24 | American Cyanamid Co | Substituted 2-(1,3,4-thiadiazol-2-yl)-4(5)-nitroimidazoles |
| DE1768784A1 (de) * | 1968-06-29 | 1972-02-10 | Merck Anlagen Gmbh | Verfahren zur Herstellung von AEthenderivaten |
| US3914301A (en) * | 1971-05-06 | 1975-10-21 | Rohm & Haas | Acrylamide derivatives of 3-isothiazolones |
| GB1532984A (en) * | 1975-04-10 | 1978-11-22 | Ici Ltd | Method for the control of micro-organisms |
| US4190663A (en) * | 1976-01-24 | 1980-02-26 | Bayer Aktiengesellschaft | Anti-thrombotic 1,2-benzisothiazolin-3-ones |
| US4315031A (en) * | 1977-09-01 | 1982-02-09 | Science Union Et Cie | Thiosubstituted amino acids |
| US4165318A (en) * | 1977-09-06 | 1979-08-21 | Rohm And Haas Company | Formaldehyde stabilized coating compositions |
| DE2821639A1 (de) * | 1978-05-18 | 1979-11-22 | Hoechst Ag | Neue thioenolaether, verfahren zu ihrer herstellung sowie ihre verwendung |
| EP0006227B1 (en) * | 1978-06-16 | 1984-12-27 | Kyowa Hakko Kogyo Co., Ltd | Antithrombotic pharmaceutical preparation containing 2,2'-dithiobis benzamide derivatives and new 2,2'-dithiobis benzamide derivatives |
| FR2492376A1 (fr) * | 1980-10-17 | 1982-04-23 | Cird | Polymethylene-4,5 isothiazoline-4 ones-3, leur procede de preparation et leurs utilisation comme agents bactericides et fongicides |
| JPS58198418A (ja) * | 1982-05-14 | 1983-11-18 | Kyowa Hakko Kogyo Co Ltd | 抗菌剤 |
| DE3411385A1 (de) * | 1984-03-28 | 1985-10-10 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von o,o'-dithiobenzamiden |
| DE3500577A1 (de) * | 1985-01-10 | 1986-07-10 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von 1,2-benzisothiazolonen |
| FR2583046B1 (fr) * | 1985-06-05 | 1987-07-17 | Cird | Alkyl ou aralkyl thio-2 cycloalkene-1 carboxamides-1 et leurs sulfoxydes, leurs procedes de preparation et leur application a la synthese de tri et tetramethylene-4,5 isothiazoline-4, ones-3 |
| GB8517478D0 (en) * | 1985-07-10 | 1985-08-14 | Ici Plc | Isothiazolone solutions |
| FR2631028B1 (fr) * | 1988-05-09 | 1990-07-13 | Cird | Adamantyl-2 isothiazoline-4 ones-3, leur procede de preparation et leur utilisation comme agents bactericides et fongicides |
| IL95157A (en) * | 1989-07-28 | 1996-05-14 | Rohm & Haas | S-Melted Beta-Thioacrylamides, their preparation and use as bactericides |
| GB9020924D0 (en) * | 1990-09-26 | 1990-11-07 | Ici Plc | Compound,use and preparation |
-
1990
- 1990-09-26 GB GB909020933A patent/GB9020933D0/en active Pending
-
1991
- 1991-09-13 GB GB919119615A patent/GB9119615D0/en active Pending
- 1991-09-13 AT AT91308403T patent/ATE120455T1/de not_active IP Right Cessation
- 1991-09-13 EP EP91308403A patent/EP0478194B1/en not_active Expired - Lifetime
- 1991-09-13 DE DE69108499T patent/DE69108499T2/de not_active Expired - Fee Related
- 1991-09-13 DK DK91308403.4T patent/DK0478194T3/da active
- 1991-09-18 IE IE328891A patent/IE66124B1/en not_active IP Right Cessation
- 1991-09-19 AU AU84607/91A patent/AU634662B2/en not_active Ceased
- 1991-09-19 ZA ZA917492A patent/ZA917492B/xx unknown
- 1991-09-20 US US07/763,276 patent/US5224980A/en not_active Expired - Fee Related
- 1991-09-23 CA CA002052075A patent/CA2052075A1/en not_active Abandoned
- 1991-09-25 PT PT99044A patent/PT99044B/pt not_active IP Right Cessation
- 1991-09-25 NO NO913769A patent/NO175633C/no unknown
- 1991-09-25 MX MX9101270A patent/MX9101270A/es not_active IP Right Cessation
- 1991-09-26 JP JP3318749A patent/JPH05117229A/ja active Pending
- 1991-09-26 FI FI914526A patent/FI914526A/fi unknown
- 1991-09-26 KR KR1019910016745A patent/KR920006307A/ko not_active IP Right Cessation
-
1993
- 1993-03-15 US US08/031,712 patent/US5315009A/en not_active Expired - Fee Related
-
1994
- 1994-01-25 NO NO940265A patent/NO940265D0/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI914526A (fi) | 1992-03-27 |
| DK0478194T3 (da) | 1995-08-28 |
| DE69108499D1 (de) | 1995-05-04 |
| NO175633C (no) | 1994-11-09 |
| US5224980A (en) | 1993-07-06 |
| EP0478194A1 (en) | 1992-04-01 |
| ZA917492B (en) | 1992-08-26 |
| JPH05117229A (ja) | 1993-05-14 |
| ATE120455T1 (de) | 1995-04-15 |
| US5315009A (en) | 1994-05-24 |
| CA2052075A1 (en) | 1992-03-27 |
| IE66124B1 (en) | 1995-12-13 |
| GB9119615D0 (en) | 1991-10-23 |
| EP0478194B1 (en) | 1995-03-29 |
| NO940265L (no) | 1992-03-27 |
| PT99044A (pt) | 1992-08-31 |
| DE69108499T2 (de) | 1995-08-03 |
| NO913769L (no) | 1992-03-27 |
| NO940265D0 (no) | 1994-01-25 |
| FI914526A0 (fi) | 1991-09-26 |
| AU634662B2 (en) | 1993-02-25 |
| MX9101270A (es) | 1992-07-08 |
| AU8460791A (en) | 1992-05-14 |
| IE913288A1 (en) | 1992-04-08 |
| PT99044B (pt) | 1999-02-26 |
| KR920006307A (ko) | 1992-04-27 |
| GB9020933D0 (en) | 1990-11-07 |
| NO913769D0 (no) | 1991-09-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69518323T2 (de) | Oxaborole und deren salze, und deren verwendung als biozide | |
| NO175633B (fi) | ||
| US5594018A (en) | 2-(B-branched alkyl)-benziosothiazolin-3-ones | |
| AU617552B2 (en) | Compound, composition, process and use | |
| JPH01305064A (ja) | ２―フエニルスルフイニル―ニトロ―ピリジン類 | |
| AU592195B2 (en) | Hydroxypyrazole derivatives, their preparation and their use against microorganisms | |
| US5290810A (en) | Compound, use and preparation | |
| KR0157418B1 (ko) | 공업용 살균 조성물 | |
| CA2008503A1 (en) | Compound and use | |
| JPS60233050A (ja) | Ｎ‐ヨードプロパルギル‐クロロメタンスルホンアミド類 | |
| NO123004B (fi) | ||
| JPH1112213A (ja) | トリハロアリル誘導体、防腐防黴剤および農園芸用殺菌剤 |