NO128372B - - Google Patents
Download PDFInfo
- Publication number
- NO128372B NO128372B NO01766/70A NO176670A NO128372B NO 128372 B NO128372 B NO 128372B NO 01766/70 A NO01766/70 A NO 01766/70A NO 176670 A NO176670 A NO 176670A NO 128372 B NO128372 B NO 128372B
- Authority
- NO
- Norway
- Prior art keywords
- treatment
- oxygen
- mass
- alkali
- cellulose
- Prior art date
Links
- 239000007788 liquid Substances 0.000 claims description 39
- 239000000463 material Substances 0.000 claims description 39
- 238000000034 method Methods 0.000 claims description 33
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 30
- 239000001301 oxygen Substances 0.000 claims description 30
- 229910052760 oxygen Inorganic materials 0.000 claims description 30
- 229920002678 cellulose Polymers 0.000 claims description 27
- 239000001913 cellulose Substances 0.000 claims description 27
- 239000003513 alkali Substances 0.000 claims description 26
- 239000007789 gas Substances 0.000 claims description 16
- 150000002681 magnesium compounds Chemical class 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 9
- 230000002378 acidificating effect Effects 0.000 claims description 9
- 229920002488 Hemicellulose Polymers 0.000 claims description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 6
- 150000002736 metal compounds Chemical class 0.000 claims description 6
- 230000003197 catalytic effect Effects 0.000 claims description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 4
- 239000011707 mineral Substances 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 229910052742 iron Inorganic materials 0.000 claims description 3
- 229920005610 lignin Polymers 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 229910052910 alkali metal silicate Inorganic materials 0.000 claims description 2
- 238000007348 radical reaction Methods 0.000 claims description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims 1
- 239000003112 inhibitor Substances 0.000 claims 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 23
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 19
- 229910001882 dioxygen Inorganic materials 0.000 description 19
- 238000004061 bleaching Methods 0.000 description 16
- 230000008569 process Effects 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 description 10
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 9
- 238000007792 addition Methods 0.000 description 9
- 239000011777 magnesium Substances 0.000 description 9
- 230000035484 reaction time Effects 0.000 description 9
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 8
- 230000015556 catabolic process Effects 0.000 description 8
- 229910052749 magnesium Inorganic materials 0.000 description 8
- 229920001131 Pulp (paper) Polymers 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 230000008901 benefit Effects 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000004155 Chlorine dioxide Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 235000019398 chlorine dioxide Nutrition 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 239000000395 magnesium oxide Substances 0.000 description 5
- 229910021653 sulphate ion Inorganic materials 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229960001484 edetic acid Drugs 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 229910001385 heavy metal Inorganic materials 0.000 description 4
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 4
- 238000002203 pretreatment Methods 0.000 description 4
- 230000001681 protective effect Effects 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- -1 saccharic acids Chemical compound 0.000 description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 4
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 3
- 239000008139 complexing agent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 159000000003 magnesium salts Chemical class 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000002023 wood Substances 0.000 description 3
- URDCARMUOSMFFI-UHFFFAOYSA-N 2-[2-[bis(carboxymethyl)amino]ethyl-(2-hydroxyethyl)amino]acetic acid Chemical compound OCCN(CC(O)=O)CCN(CC(O)=O)CC(O)=O URDCARMUOSMFFI-UHFFFAOYSA-N 0.000 description 2
- 239000005749 Copper compound Substances 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 2
- 229920000297 Rayon Polymers 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229910001902 chlorine oxide Inorganic materials 0.000 description 2
- 150000001880 copper compounds Chemical class 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 238000005470 impregnation Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 2
- 239000001095 magnesium carbonate Substances 0.000 description 2
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 2
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 2
- 239000000347 magnesium hydroxide Substances 0.000 description 2
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 2
- 235000012254 magnesium hydroxide Nutrition 0.000 description 2
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 2
- 229960003330 pentetic acid Drugs 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000003760 tallow Substances 0.000 description 2
- DLVZBSZXZDGKQY-UHFFFAOYSA-N 2,2-dihydroxybutanoic acid Chemical compound CCC(O)(O)C(O)=O DLVZBSZXZDGKQY-UHFFFAOYSA-N 0.000 description 1
- 235000017166 Bambusa arundinacea Nutrition 0.000 description 1
- 235000017491 Bambusa tulda Nutrition 0.000 description 1
- 235000018185 Betula X alpestris Nutrition 0.000 description 1
- 235000018212 Betula X uliginosa Nutrition 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 244000273256 Phragmites communis Species 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- 244000082204 Phyllostachys viridis Species 0.000 description 1
- 235000015334 Phyllostachys viridis Nutrition 0.000 description 1
- 241000218657 Picea Species 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 229930182558 Sterol Natural products 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000011425 bamboo Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- MAYPHUUCLRDEAZ-UHFFFAOYSA-N chlorine peroxide Inorganic materials ClOOCl MAYPHUUCLRDEAZ-UHFFFAOYSA-N 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000002506 iron compounds Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 239000012978 lignocellulosic material Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 150000002680 magnesium Chemical class 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011122 softwood Substances 0.000 description 1
- 150000003432 sterols Chemical class 0.000 description 1
- 235000003702 sterols Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005031 sulfite paper Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21C—PRODUCTION OF CELLULOSE BY REMOVING NON-CELLULOSE SUBSTANCES FROM CELLULOSE-CONTAINING MATERIALS; REGENERATION OF PULPING LIQUORS; APPARATUS THEREFOR
- D21C9/00—After-treatment of cellulose pulp, e.g. of wood pulp, or cotton linters ; Treatment of dilute or dewatered pulp or process improvement taking place after obtaining the raw cellulosic material and not provided for elsewhere
- D21C9/10—Bleaching ; Apparatus therefor
- D21C9/1026—Other features in bleaching processes
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21C—PRODUCTION OF CELLULOSE BY REMOVING NON-CELLULOSE SUBSTANCES FROM CELLULOSE-CONTAINING MATERIALS; REGENERATION OF PULPING LIQUORS; APPARATUS THEREFOR
- D21C9/00—After-treatment of cellulose pulp, e.g. of wood pulp, or cotton linters ; Treatment of dilute or dewatered pulp or process improvement taking place after obtaining the raw cellulosic material and not provided for elsewhere
- D21C9/10—Bleaching ; Apparatus therefor
- D21C9/1005—Pretreatment of the pulp, e.g. degassing the pulp
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Wood Science & Technology (AREA)
- Paper (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE06780/69A SE335053B (cg-RX-API-DMAC10.html) | 1969-05-13 | 1969-05-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO128372B true NO128372B (cg-RX-API-DMAC10.html) | 1973-11-05 |
Family
ID=20269591
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO01766/70A NO128372B (cg-RX-API-DMAC10.html) | 1969-05-13 | 1970-05-09 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3652385A (cg-RX-API-DMAC10.html) |
| AT (1) | AT295997B (cg-RX-API-DMAC10.html) |
| DE (1) | DE2022866C3 (cg-RX-API-DMAC10.html) |
| FI (1) | FI45575C (cg-RX-API-DMAC10.html) |
| FR (1) | FR2047420A5 (cg-RX-API-DMAC10.html) |
| NO (1) | NO128372B (cg-RX-API-DMAC10.html) |
| SE (1) | SE335053B (cg-RX-API-DMAC10.html) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE355614B (cg-RX-API-DMAC10.html) * | 1970-05-13 | 1973-04-30 | Mo Och Domsjoe Ab | |
| US4182648A (en) * | 1972-02-07 | 1980-01-08 | Sterling Drug Inc. | Oxygen pulping process |
| JPS502641B2 (cg-RX-API-DMAC10.html) * | 1972-03-23 | 1975-01-28 | ||
| US4004967A (en) * | 1972-06-22 | 1977-01-25 | Billeruds Aktiebolag | Bleaching cellulose pulp with oxygen in the presence of formaldehyde |
| SE373896B (cg-RX-API-DMAC10.html) * | 1972-07-05 | 1975-02-17 | Mo Och Domsjoe Ab | |
| GB1505529A (en) * | 1974-06-14 | 1978-03-30 | Mo Och Domsjoe Ab | Method for the oxygen-gas delignification of lignocellulosic material and apparatus for carrying out the method |
| US4187141A (en) * | 1975-02-24 | 1980-02-05 | Alf Societe Anonyme | Method of producing bleached mechanical pulp |
| US4172006A (en) * | 1976-08-26 | 1979-10-23 | Weyerhaeuser Company | Method of delignifying wood chips with oxygen by adding cooking liquor under pressure |
| SE417114B (sv) * | 1977-07-25 | 1981-02-23 | Mo Och Domsjoe Ab | Forfarande for forebyggande av inkrustbildning i cellulosafabriker |
| US4181516A (en) * | 1977-08-22 | 1980-01-01 | Gray Kenneth R | Products for correcting iron chlorosis in plants |
| SE420430B (sv) * | 1978-02-17 | 1981-10-05 | Mo Och Domsjoe Ab | Forfarande for blekning och extraktion av lignocellulosahaltig material med peroxidhaltiga blekmedel |
| DE2841013C2 (de) * | 1978-09-21 | 1984-06-07 | Degussa Ag, 6000 Frankfurt | Verfahren zur Vollbleiche von Zellstoff |
| US4594130A (en) * | 1978-11-27 | 1986-06-10 | Chang Pei Ching | Pulping of lignocellulose with aqueous alcohol and alkaline earth metal salt catalyst |
| US4238282A (en) * | 1979-07-23 | 1980-12-09 | Nalco Chemical Company | Chemical treatments in bleaching stages which increase pulp brightness |
| US6398908B1 (en) | 1991-04-30 | 2002-06-04 | Eka Nobel Ab | Process for acid bleaching of lignocellulose-containing pulp with a magnesium compound |
| SE470065C (sv) * | 1991-04-30 | 1996-01-15 | Eka Nobel Ab | Behandling av kemisk massa med en syra och därefter en magnesium- och kalciumförening vid klorfri blekning |
| CA2082557C (en) * | 1992-02-24 | 1997-03-11 | Charles W. Hankins | Integrated pulping process of waste paper yielding tissue-grade paper fibers |
| SE502667C2 (sv) * | 1993-07-12 | 1995-12-04 | Kvaerner Pulping Tech | Behandling av fibermaterial med komplexbildare före kokning |
| SE9401628L (sv) * | 1994-05-10 | 1995-11-11 | Stora Kopparbergs Bergslags Ab | Förfarande vid syrgasdelignifiering |
| US6306334B1 (en) | 1996-08-23 | 2001-10-23 | The Weyerhaeuser Company | Process for melt blowing continuous lyocell fibers |
| US6210801B1 (en) * | 1996-08-23 | 2001-04-03 | Weyerhaeuser Company | Lyocell fibers, and compositions for making same |
| US6605350B1 (en) * | 1996-08-23 | 2003-08-12 | Weyerhaeuser Company | Sawdust alkaline pulp having low average degree of polymerization values and method of producing the same |
| US6331354B1 (en) | 1996-08-23 | 2001-12-18 | Weyerhaeuser Company | Alkaline pulp having low average degree of polymerization values and method of producing the same |
| US6471727B2 (en) | 1996-08-23 | 2002-10-29 | Weyerhaeuser Company | Lyocell fibers, and compositions for making the same |
| US6770168B1 (en) | 1999-02-15 | 2004-08-03 | Kiram Ab | Process for oxygen pulping of lignocellulosic material and recorvery of pulping chemicals |
| US6686040B2 (en) | 1999-02-24 | 2004-02-03 | Weyerhaeuser Company | Use of thinnings and other low specific gravity wood for lyocell products |
| US6797113B2 (en) * | 1999-02-24 | 2004-09-28 | Weyerhaeuser Company | Use of thinnings and other low specific gravity wood for lyocell pulps method |
| US6686039B2 (en) | 1999-02-24 | 2004-02-03 | Weyerhaeuser Company | Use of thinnings and other low specific gravity wood for lyocell pulps |
| US6685856B2 (en) | 1999-02-24 | 2004-02-03 | Weyerhaeuser Company | Use of thinnings and other low specific gravity wood for lyocell products method |
| CA2376528A1 (en) * | 1999-06-08 | 2000-12-14 | Nana Barde | Bleaching pulp with high-pressure o2 |
| AU6604100A (en) * | 2000-02-14 | 2001-08-20 | Kiram Ab | Process for oxygen pulping of lignocellulosic material and recovery of pulping chemicals |
| WO2010139589A1 (en) * | 2009-06-02 | 2010-12-09 | Akzo Nobel Chemicals International B.V. | Process for producing mechanical pulp |
| CN106968127B (zh) | 2012-04-18 | 2019-03-01 | Gp纤维素股份有限公司 | 用于粘胶溶液的针叶木牛皮纸浆 |
| WO2015155788A2 (en) * | 2014-04-07 | 2015-10-15 | Praj Industries Limited | Method for efficient enzymatic hydrolysis of lignocellulosic materials |
| JP7013246B2 (ja) * | 2015-09-30 | 2022-02-15 | イメリーズ ミネラルズ リミテッド | 水性パルプを漂白するための方法及びこれらの方法において使用するための組成物 |
| CA3075264A1 (en) | 2017-09-08 | 2019-03-14 | Dte Materials Incorporated | Selectively depolymerizing cellulosic materials for use as thermal and acoustic insulators |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1987195A (en) * | 1934-03-03 | 1935-01-08 | Herman B Kipper | Process for the digestion of vegetable growths to produce cellulose |
| GB576510A (en) * | 1944-03-16 | 1946-04-08 | Henry Dreyfus | Improvements in or relating to the production of cellulose |
| GB681994A (en) * | 1949-05-31 | 1952-11-05 | British Celanese | Improvements in or relating to the production of cellulose |
| US2862784A (en) * | 1955-03-04 | 1958-12-02 | Virginia Smelting Company | Oxidative-reductive multi-stage bleaching of ground wood pulp |
| US2811518A (en) * | 1955-06-07 | 1957-10-29 | Rayonier Inc | Alkaline refining of wood pulp |
| US3023140A (en) * | 1958-11-24 | 1962-02-27 | Bauer Bros Co | Pulp bleaching |
| US3088861A (en) * | 1960-08-03 | 1963-05-07 | Weyerhaeuser Co | Method of manufacturing chemical pulp from lignocellulose material |
| US3069309A (en) * | 1961-02-01 | 1962-12-18 | Du Pont | Pulp bleaching |
| US3251731A (en) * | 1963-02-11 | 1966-05-17 | Andrew J Gard | Bleaching of wood pulp with a sequestering agent and hydrogen peroxide |
| FR1387853A (fr) * | 1963-09-19 | 1965-02-05 | Air Liquide | Délignification et blanchiment des pâtes cellulosiques chimiques et mi-chimiques |
| US3382149A (en) * | 1964-10-29 | 1968-05-07 | Du Pont | Bleaching of hardwood sulfite pulp with hydrogen peroxide, including pretreatment with alkali |
-
1969
- 1969-05-13 SE SE06780/69A patent/SE335053B/xx unknown
-
1970
- 1970-04-08 FI FI700982A patent/FI45575C/fi active
- 1970-05-06 FR FR7016642A patent/FR2047420A5/fr not_active Expired
- 1970-05-09 NO NO01766/70A patent/NO128372B/no unknown
- 1970-05-11 DE DE2022866A patent/DE2022866C3/de not_active Expired
- 1970-05-12 US US36670A patent/US3652385A/en not_active Expired - Lifetime
- 1970-05-13 AT AT434170A patent/AT295997B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FI45575B (cg-RX-API-DMAC10.html) | 1972-04-04 |
| DE2022866B2 (de) | 1974-03-28 |
| US3652385A (en) | 1972-03-28 |
| DE2022866C3 (de) | 1974-11-14 |
| FR2047420A5 (cg-RX-API-DMAC10.html) | 1971-03-12 |
| DE2022866A1 (de) | 1970-12-23 |
| SE335053B (cg-RX-API-DMAC10.html) | 1971-05-10 |
| AT295997B (de) | 1972-01-25 |
| FI45575C (fi) | 1972-07-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO128372B (cg-RX-API-DMAC10.html) | ||
| US3759783A (en) | Process for bleaching cellulose pulp with alkali and oxygen gas utilizing waste bleaching liquor from an alka line oxygen gas bleaching stage | |
| US4187141A (en) | Method of producing bleached mechanical pulp | |
| JP5712754B2 (ja) | 溶解パルプの製造方法 | |
| US4244778A (en) | Process for the chemical refining of cellulose pulp | |
| US4050981A (en) | Process for the delignification of lignocellulosic material by maintaining a concentration of carbon monoxide in the presence of oxygen and alkali | |
| JPS6350465B2 (cg-RX-API-DMAC10.html) | ||
| NO130776B (cg-RX-API-DMAC10.html) | ||
| DE2109542B2 (de) | Verwendung von Aminopolycarbon saure oder eines Alkalisalzes derselben als Komplexbildner bei der Behandlung cellulosischer Materialien | |
| EP0823003A1 (en) | Ambient temperature pulp bleaching with peroxyacid salts | |
| NO124320B (cg-RX-API-DMAC10.html) | ||
| US4004967A (en) | Bleaching cellulose pulp with oxygen in the presence of formaldehyde | |
| NO140535B (no) | Fremgangsmaate for fremstilling av cellulosemasse ved oppslutning med oksygen | |
| JP2588495B2 (ja) | 製紙用高収率高漂白度パルプの製造方法 | |
| US3951732A (en) | Delignification and bleaching of wood pulp with oxygen in the presence of triethanolamine | |
| JP6197717B2 (ja) | 溶解パルプの製造方法 | |
| US4113553A (en) | Sodium sulfide pulping with hydrogen sulfide generation | |
| US5500084A (en) | Method and apparatus for pulping cellulosic material using a vessel with an impergnation zone and an attrition zone | |
| JP6187619B2 (ja) | 溶解パルプの製造方法 | |
| WO2016072885A2 (ru) | Способ получения целлюлозы | |
| US4750973A (en) | Process for reducing carbohydrate losses in the sulfate pulping of wood by pretreating the wood with oxygen and nitrogen oxides | |
| US1859845A (en) | Treatment of wood for the production of pulp | |
| US2061616A (en) | Production of cellulose | |
| NO140605B (no) | Fremgangsmaate ved fjernelse av lignin fra lignocelluloseholdige materialer | |
| US1557338A (en) | Method of producing half stuffs and cellulose |