NO126027B - - Google Patents
Download PDFInfo
- Publication number
- NO126027B NO126027B NO2298/70A NO229870A NO126027B NO 126027 B NO126027 B NO 126027B NO 2298/70 A NO2298/70 A NO 2298/70A NO 229870 A NO229870 A NO 229870A NO 126027 B NO126027 B NO 126027B
- Authority
- NO
- Norway
- Prior art keywords
- polycarbonate
- weight
- parts
- flame
- polycarbonates
- Prior art date
Links
- 239000004417 polycarbonate Substances 0.000 claims description 63
- 229920000515 polycarbonate Polymers 0.000 claims description 63
- 229920001169 thermoplastic Polymers 0.000 claims description 7
- 239000004416 thermosoftening plastic Substances 0.000 claims description 7
- 150000002989 phenols Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- -1 alkali metal sulfonates Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000000203 mixture Substances 0.000 description 25
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229910052708 sodium Inorganic materials 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 7
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 7
- 229910052736 halogen Inorganic materials 0.000 description 7
- 150000002367 halogens Chemical class 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- 239000011591 potassium Substances 0.000 description 7
- WFRUBUQWJYMMRQ-UHFFFAOYSA-M potassium;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate Chemical compound [K+].[O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F WFRUBUQWJYMMRQ-UHFFFAOYSA-M 0.000 description 7
- 238000007792 addition Methods 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- JGTNAGYHADQMCM-UHFFFAOYSA-M 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate Chemical compound [O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F JGTNAGYHADQMCM-UHFFFAOYSA-M 0.000 description 3
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000003365 glass fiber Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- LVTHXRLARFLXNR-UHFFFAOYSA-M potassium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate Chemical compound [K+].[O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F LVTHXRLARFLXNR-UHFFFAOYSA-M 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 3
- JDWGPDRDUUNFIB-UHFFFAOYSA-N 1,1,1,2,3,3,4,4,5,5,5-undecafluoropentane-2-sulfonic acid Chemical compound OS(=O)(=O)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F JDWGPDRDUUNFIB-UHFFFAOYSA-N 0.000 description 2
- GKNWQHIXXANPTN-UHFFFAOYSA-N 1,1,2,2,2-pentafluoroethanesulfonic acid Chemical compound OS(=O)(=O)C(F)(F)C(F)(F)F GKNWQHIXXANPTN-UHFFFAOYSA-N 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- XBWQFDNGNOOMDZ-UHFFFAOYSA-M 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate Chemical compound [O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F XBWQFDNGNOOMDZ-UHFFFAOYSA-M 0.000 description 1
- MAQOZOILPAMFSW-UHFFFAOYSA-N 2,6-bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=C(CC=3C(=CC=C(C)C=3)O)C=C(C)C=2)O)=C1 MAQOZOILPAMFSW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- PQUCIEFHOVEZAU-UHFFFAOYSA-N Diammonium sulfite Chemical compound [NH4+].[NH4+].[O-]S([O-])=O PQUCIEFHOVEZAU-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 235000021438 curry Nutrition 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000006259 organic additive Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- BITYAPCSNKJESK-UHFFFAOYSA-N potassiosodium Chemical compound [Na].[K] BITYAPCSNKJESK-UHFFFAOYSA-N 0.000 description 1
- RSCGQEBKFSGWJT-UHFFFAOYSA-M potassium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate Chemical compound [K+].[O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F RSCGQEBKFSGWJT-UHFFFAOYSA-M 0.000 description 1
- LBAKROCDOXEWPV-UHFFFAOYSA-M potassium;1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonate Chemical compound [K+].[O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F LBAKROCDOXEWPV-UHFFFAOYSA-M 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/41—Compounds containing sulfur bound to oxygen
- C08K5/42—Sulfonic acids; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691930257 DE1930257C3 (de) | 1969-06-13 | Flammwidrige Polycarbonatmassen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO126027B true NO126027B (enPDFPhase) | 1972-12-11 |
Family
ID=5737002
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO2298/70A NO126027B (enPDFPhase) | 1969-06-13 | 1970-06-12 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3775367A (enPDFPhase) |
| AT (1) | AT297333B (enPDFPhase) |
| BE (1) | BE751924A (enPDFPhase) |
| CH (1) | CH531548A (enPDFPhase) |
| DK (1) | DK128686B (enPDFPhase) |
| FR (1) | FR2046762B1 (enPDFPhase) |
| GB (1) | GB1299618A (enPDFPhase) |
| NL (1) | NL154541B (enPDFPhase) |
| NO (1) | NO126027B (enPDFPhase) |
| SE (1) | SE365230B (enPDFPhase) |
Families Citing this family (111)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3852238A (en) * | 1972-01-03 | 1974-12-03 | Gen Electric | Flame retardant polycarbonate composition |
| US3933734A (en) * | 1973-12-28 | 1976-01-20 | General Electric Company | Flame retardant polycarbonate composition |
| US4039509A (en) * | 1973-12-28 | 1977-08-02 | General Electric Company | Non-opaque flame retardant polycarbonate composition |
| US4032506A (en) * | 1973-12-28 | 1977-06-28 | General Electric Company | Flame retardant polycarbonate composition |
| CA1062837A (en) * | 1973-12-28 | 1979-09-18 | Victor Mark | Flame retardant polycarbonate composition |
| US3953396A (en) * | 1973-12-28 | 1976-04-27 | General Electric Company | Flame retardant polycarbonate composition |
| US3953399A (en) * | 1973-12-28 | 1976-04-27 | General Electric Company | Flame retardant polycarbonate composition |
| US3919167A (en) * | 1973-12-28 | 1975-11-11 | Gen Electric | Flame retardant polycarbonate composition |
| US3926908A (en) * | 1973-12-28 | 1975-12-16 | Gen Electric | Flame retardant polycarbonate composition |
| US4033930A (en) * | 1973-12-28 | 1977-07-05 | General Electric Company | Flame retardant polycarbonate composition |
| US3940366A (en) * | 1973-12-28 | 1976-02-24 | General Electric Company | Flame retardant polycarbonate composition |
| US3931100A (en) * | 1973-12-28 | 1976-01-06 | General Electric Company | Flame retardant polycarbonate composition |
| US3917559A (en) * | 1973-12-28 | 1975-11-04 | Gen Electric | Flame retardant polycarbonate composition |
| CA1050685A (en) * | 1973-12-28 | 1979-03-13 | Victor Mark | Flame retardant polycarbonate composition |
| US3978024A (en) * | 1973-12-28 | 1976-08-31 | General Electric Company | Flame retardant polycarbonate composition |
| US3948851A (en) * | 1973-12-28 | 1976-04-06 | General Electric Company | Flame retardant polycarbonate composition |
| US3951910A (en) * | 1973-12-28 | 1976-04-20 | General Electric Company | Flame retardant polycarbonate composition |
| US3909490A (en) * | 1973-12-28 | 1975-09-30 | Gen Electric | Flame retardant polycarbonate composition |
| US4107230A (en) * | 1974-05-08 | 1978-08-15 | Tenneco Chemicals, Inc. | Flame-retardant thermosetting resinous compositions |
| DE2460052A1 (de) * | 1974-12-19 | 1976-07-01 | Bayer Ag | Verfahren zur herstellung schwerbrennbarer hochmolekularer thermoplastischer polycarbonate |
| US4185009A (en) * | 1975-01-03 | 1980-01-22 | Bayer Aktiengesellschaft | Branched, high-molecular weight thermoplastic polycarbonates |
| DE2506726C2 (de) * | 1975-02-18 | 1982-06-16 | Bayer Ag, 5090 Leverkusen | Verwendung von Perfluoralkansulfonamiden und/oder Ammoniumsalzen von Perfluoralkansulfonsäuren und/oder Cyclimmoniumsalzen von Perfluoralkansulfonsäuren als Entformungsmittel |
| US4001175A (en) * | 1975-10-29 | 1977-01-04 | General Electric Company | Flame retardant polycarbonate composition |
| US4110299A (en) * | 1976-10-15 | 1978-08-29 | General Electric Company | Flame-retardant polycarbonate composition |
| US4104253A (en) * | 1976-10-15 | 1978-08-01 | General Electric Company | Flame retardant polycarbonate composition |
| US4208489A (en) * | 1977-01-29 | 1980-06-17 | Bayer Aktiengesellschaft | Polycarbonate molding compositions with improved flame-repellency |
| US4093589A (en) * | 1977-02-03 | 1978-06-06 | General Electric Company | Non-opaque flame retardant polycarbonate composition |
| DE2706126C2 (de) * | 1977-02-14 | 1984-03-29 | Bayer Ag, 5090 Leverkusen | Schwerentflammbare Polycarbonat-Folien |
| DE2706125A1 (de) * | 1977-02-14 | 1978-08-17 | Bayer Ag | Flammfeste polyhydantoinfolien |
| US4174359A (en) * | 1977-09-06 | 1979-11-13 | Mobay Chemical Corporation | Flame retardant polycarbonate polyblends |
| CA1103840A (en) * | 1977-10-13 | 1981-06-23 | Siegfried Adelmann | Polycarbonates with end groups containing double bonds which can be crosslinked by uv light |
| US4199540A (en) * | 1977-10-13 | 1980-04-22 | Bayer Aktiengesellschaft | Modified polycarbonates and a process for their preparation |
| GB2019422B (en) * | 1978-04-20 | 1982-07-14 | Gen Electric | Flame retardant crystalline polycarbonate compositions |
| DE2829256A1 (de) * | 1978-07-04 | 1980-01-17 | Bayer Ag | Polycarbonate mit uv-licht-vernetzbaren doppelbindungen enthaltenden endgruppen |
| US4223100A (en) * | 1979-04-18 | 1980-09-16 | Mobay Chemical Corporation | Flame retardant aromatic polycarbonate with good mechanical properties and melt stability |
| DE2931172A1 (de) * | 1979-08-01 | 1981-02-19 | Bayer Ag | Verwendung von alkali- und erdalkalisalzen alkylsubstituierter aromatischer sulfonsaeuren, phosphonsaeuren und sauerer phosphonsaeureester als interne antistatika fuer polycarbonat, insbesondere fuer polycarbonatfolien |
| DE2933344A1 (de) * | 1979-08-17 | 1981-03-26 | Bayer Ag, 51373 Leverkusen | Verfahren zur herstellung von flammwidrigen polycarbonaten |
| US4366283A (en) * | 1979-11-13 | 1982-12-28 | The Dow Chemical Company | Polycarbonate containing a metal salt of a perhalometalate as an ignition depressant |
| US4303575A (en) * | 1980-02-07 | 1981-12-01 | Mobay Chemical Corporation | Flame retardant polycarbonate compositions |
| DE3019527A1 (de) * | 1980-05-22 | 1982-01-14 | Bayer Ag, 5090 Leverkusen | Flammwidrige, transparente polycarbonate |
| US4366276A (en) * | 1980-06-25 | 1982-12-28 | Bayer Aktiengesellschaft | Flame-resistant moulding materials based on thermoplastic aromatic polyesters and polyesters carbonates, a process for their production and their use in the production of moulded bodies |
| US4320049A (en) * | 1980-07-14 | 1982-03-16 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| US4515937A (en) * | 1980-09-09 | 1985-05-07 | Mobay Chemical Corporation | Flame resistant sulfur-bearing copolycarbonate |
| US4358569A (en) * | 1980-12-31 | 1982-11-09 | General Electric Company | Blends of copolyester-carbonate with polysulfone |
| US4380598A (en) * | 1981-02-12 | 1983-04-19 | Union Carbide Corporation | Flame retardant polyarylate compositions |
| US4425456A (en) | 1981-09-28 | 1984-01-10 | Mobay Chemical Corporation | Copolycarbonates based on bis(4-hydroxyphenyl)biphenyl disulfone |
| DE3203905A1 (de) * | 1982-02-05 | 1983-08-11 | Bayer Ag, 5090 Leverkusen | Polycarbonat-formmassen mit verbesserter flammwidrigkeit |
| DE3225884A1 (de) * | 1982-07-10 | 1984-01-12 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polycarbonaten mit n-alkylperfluoralkylsulfonamid-endgruppen |
| DE3334822A1 (de) * | 1983-09-26 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Neue flammschutzmittel, ihre herstellung und ihre verwendung zur flammfestausruestung von polycarbonaten |
| DE3425122A1 (de) * | 1984-07-07 | 1986-01-16 | Bayer Ag, 5090 Leverkusen | Perfluoralkansulfonsaeurearylester als antitropfmittel in flammwidrigen formmassen auf basis thermoplastischer, aromatischer polycarbonate |
| US4673699A (en) * | 1984-11-19 | 1987-06-16 | Mobay Corporation | Flame retardant molding compositions |
| US4632949A (en) * | 1984-12-31 | 1986-12-30 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| US4578409A (en) * | 1985-01-14 | 1986-03-25 | Mobay Chemical Corporation | Flame retarding silanes |
| US4735978A (en) * | 1986-12-24 | 1988-04-05 | General Electric Company | Flame retardant polycarbonate composition |
| JPH0784558B2 (ja) | 1987-01-13 | 1995-09-13 | 大日本インキ化学工業株式会社 | ポリアリ−レンスルフイド樹脂組成物及びそれを用いた電子部品 |
| US4880864A (en) * | 1987-12-29 | 1989-11-14 | Mobay Corporation | Thermoplastic polycarbonates and blends with enhanced flame retardant properties |
| US4918125A (en) * | 1988-12-27 | 1990-04-17 | General Electric Company | Flame retardant carbonate polymer blends |
| US5109045A (en) * | 1990-11-19 | 1992-04-28 | Miles Inc. | Flame retardant polycarbonate compositions |
| US5250635A (en) * | 1991-02-28 | 1993-10-05 | Miles Inc. | Polycarbonate composition with reduced drip rate on burning |
| JP3260496B2 (ja) * | 1993-07-27 | 2002-02-25 | 帝人化成株式会社 | 難燃性芳香族ポリカーボネート樹脂組成物 |
| DE4440684A1 (de) * | 1994-11-15 | 1996-05-23 | Bayer Ag | Flammwidrige Polycarbonatformmassen |
| US6342550B1 (en) * | 1999-02-03 | 2002-01-29 | Mitsubishi Engineering Plastics Corporation | Flame-retardent polycarbonate resin composition and a molded product using the same |
| DE19907831A1 (de) † | 1999-02-24 | 2000-08-31 | Bayer Ag | Flammwidrige thermoplastische Formmasse |
| US6353046B1 (en) | 2000-04-28 | 2002-03-05 | General Electric Company | Fire-retarded polycarbonate resin composition |
| US6730720B2 (en) * | 2000-12-27 | 2004-05-04 | General Electric Company | Method for reducing haze in a fire resistant polycarbonate composition |
| US6518347B1 (en) | 2000-12-27 | 2003-02-11 | 3M Innovative Properties Company | Flame retardant carbonate polymers and use thereof |
| ES2246677B1 (es) * | 2001-06-22 | 2006-12-01 | Asahi Kasei Kabushiki Kaisha | Retardante de la llama en forma de particulas dotadas de recubrimient o para un polimero. |
| US6613824B2 (en) | 2001-11-12 | 2003-09-02 | General Electric Company | Flame retardant resinous compositions and method |
| US7799855B2 (en) * | 2001-11-12 | 2010-09-21 | Sabic Innovative Plastics Ip B.V. | Flame retardant thermoplastic polycarbonate compositions, use and method thereof |
| US6462111B1 (en) | 2001-12-10 | 2002-10-08 | General Electric Company | Translucent flame retardant polycarbonate compositions |
| US7390450B2 (en) * | 2002-06-07 | 2008-06-24 | General Electric Company | Process for preparing a fire resistant polycarbonate composition |
| US6790899B2 (en) * | 2002-10-29 | 2004-09-14 | General Electric Company | Method for making fire-retarded polycarbonate and related compositions |
| US7019059B2 (en) * | 2002-12-16 | 2006-03-28 | General Electric Company | Method for making fire-retarded glass-filled polycarbonate and related compositions |
| US20050009968A1 (en) * | 2003-06-28 | 2005-01-13 | General Electric Company | Transparent Flame Retardant Polycarbonate Compositions |
| SG144157A1 (en) * | 2003-07-10 | 2008-07-29 | Gen Electric | Fire-retarded polycarbonate resin composition |
| US6995212B2 (en) * | 2003-08-08 | 2006-02-07 | Bayer Materialscience Llc | Flame retardant, thermoplastic polycarbonate molding compositions |
| US20050085580A1 (en) * | 2003-10-16 | 2005-04-21 | General Electric Company | Light-Colored Polycarbonate Compositions and Methods |
| US7223804B2 (en) * | 2003-12-30 | 2007-05-29 | General Electric Company | Polycarbonate composition |
| US20060030647A1 (en) * | 2004-08-05 | 2006-02-09 | Thomas Ebeling | Flame retardant thermoplastic polycarbonate compositions, use, and method of manufacture thereof |
| US20080014446A1 (en) * | 2004-10-07 | 2008-01-17 | General Electric Company | Window shade and a multi-layered article, and methods of making the same |
| US20060116467A1 (en) * | 2004-11-30 | 2006-06-01 | Bayer Materialscience Llc | Flame retardant polycarbonate composition |
| US20060135737A1 (en) * | 2004-12-22 | 2006-06-22 | Davis Gary C | Polycarbonates with fluoroalkylene carbonate end groups |
| US20060135662A1 (en) * | 2004-12-22 | 2006-06-22 | General Electric Company | Polycarbonates with fluoroalkylene carbonate end groups |
| NL1029640C2 (nl) * | 2005-03-04 | 2006-09-06 | Stork Food & Dairy Systems Bv | Vulklep met een kleplichaam met een in hoofdzaak cilindrisch verdringingsdeel. |
| US7531615B2 (en) * | 2006-01-04 | 2009-05-12 | Sabic Innovative Platics Ip B.V. | Thermally stable polycarbonates, thermoplastic compositions thereof, and articles formed therefrom |
| US7514523B2 (en) * | 2006-01-05 | 2009-04-07 | Sabic Innovative Plastics Ip B.V. | Polycarbonate compositions and articles formed therefrom, with matte surfaces and high light transmissions |
| US7728059B2 (en) * | 2006-02-14 | 2010-06-01 | Sabic Innovative Plastics Ip B.V. | Polycarbonate compositions and articles formed therefrom |
| US7632881B2 (en) | 2006-06-22 | 2009-12-15 | Sabic Innovative Plastics Ip B.V. | Polycarbonate compositions and articles formed therefrom |
| US20080015292A1 (en) * | 2006-07-12 | 2008-01-17 | General Electric Company | Flame retardant and scratch resistant thermoplastic polycarbonate compositions |
| US20080081892A1 (en) * | 2006-09-29 | 2008-04-03 | General Electric Company | Thermoplastic compositions, methods of making, and articles formed therefrom |
| US7622504B2 (en) * | 2006-12-20 | 2009-11-24 | MCS Laboratories, Inc. | Esters of 2-phenylalkanenitriles and antifungal compositions containing them |
| US7947770B2 (en) * | 2007-03-07 | 2011-05-24 | E. I. Du Pont De Nemours And Company | Flame retardant polycarbonate compositions |
| ES2366747T3 (es) * | 2007-06-12 | 2011-10-25 | Styron Europe Gmbh | Película de resina de policarbonato clara y retardadora de la llama. |
| US20090062438A1 (en) * | 2007-08-30 | 2009-03-05 | Van De Grampel Robert Dirk | Copolyestercarbonate compositions |
| DE102007040925A1 (de) | 2007-08-30 | 2009-03-05 | Bayer Materialscience Ag | Thermoplastische Zusammensetzungen mit geringer Trübung |
| KR100914666B1 (ko) * | 2007-12-28 | 2009-08-28 | 주식회사 엘지화학 | 난연성 내스크래치 폴리카보네이트 수지 조성물 |
| KR100962389B1 (ko) * | 2008-05-14 | 2010-06-10 | 제일모직주식회사 | 난연성이 우수한 폴리카보네이트 수지 조성물 |
| US8623948B2 (en) * | 2008-06-26 | 2014-01-07 | Sabic Innovative Plastics Ip B.V. | Polycarbonate compositions having antistatic enhancers, method of preparing, and articles comprising the same |
| US8691895B2 (en) * | 2008-06-30 | 2014-04-08 | Bayer Materialscience Llc | Flame retardant, optically clear thermoplastic molding composition |
| US8445568B2 (en) * | 2008-09-25 | 2013-05-21 | Sabic Innovative Plastics Ip B.V. | Flame retardant thermoplastic composition and articles formed therefrom |
| US8771829B2 (en) * | 2008-09-25 | 2014-07-08 | Sabic Innovative Plastics Ip B.V. | Flame retardant thermoplastic polymer composition, method of manufacture, and articles formed therefrom |
| US8552096B2 (en) * | 2009-07-31 | 2013-10-08 | Sabic Innovative Plastics Ip B.V. | Flame-retardant reinforced polycarbonate compositions |
| US8343706B2 (en) | 2010-01-25 | 2013-01-01 | International Business Machines Corporation | Fluorine-free fused ring heteroaromatic photoacid generators and resist compositions containing the same |
| US9056445B2 (en) | 2010-05-26 | 2015-06-16 | Sabic Global Technologies B.V. | Multilayer sheet and methods of making and articles comprising the multilayer sheet |
| EP2640782B1 (en) | 2010-11-15 | 2021-04-07 | SHPP Global Technologies B.V. | Compositions and articles of manufacture containing siloxane |
| US9115269B2 (en) | 2010-12-16 | 2015-08-25 | Mitsubishi Engineering-Plastics Corporation | Flame retardant polycarbonate resin composition, flame retardant for polycarbonate resin, and method for producing same |
| US9145490B2 (en) * | 2013-02-28 | 2015-09-29 | Bayer Materialscience Llc | Flame-retardant polycarbonate compositions |
| US11352478B2 (en) * | 2017-03-01 | 2022-06-07 | Idemitsu Kosan Co., Ltd. | Flame-retardant polycarbonate-based resin composition and molded product thereof |
| KR102245725B1 (ko) | 2018-11-06 | 2021-04-28 | 주식회사 엘지화학 | 폴리카보네이트 수지 조성물 및 이를 포함하는 물품 |
| EP3805315B1 (en) | 2018-11-06 | 2022-04-27 | Lg Chem, Ltd. | Polycarbonate resin composition and article comprising same |
| KR20220046344A (ko) | 2020-10-07 | 2022-04-14 | 주식회사 엘지화학 | 폴리카보네이트 조성물 및 이를 포함하는 성형품 |
-
1970
- 1970-06-03 AT AT498570A patent/AT297333B/de not_active IP Right Cessation
- 1970-06-04 GB GB27021/70A patent/GB1299618A/en not_active Expired
- 1970-06-11 DK DK303970AA patent/DK128686B/da unknown
- 1970-06-12 SE SE08211/70A patent/SE365230B/xx unknown
- 1970-06-12 CH CH889970A patent/CH531548A/de not_active IP Right Cessation
- 1970-06-12 NL NL707008632A patent/NL154541B/xx not_active IP Right Cessation
- 1970-06-12 BE BE751924D patent/BE751924A/xx not_active IP Right Cessation
- 1970-06-12 FR FR7021767A patent/FR2046762B1/fr not_active Expired
- 1970-06-12 NO NO2298/70A patent/NO126027B/no unknown
-
1971
- 1971-11-03 US US00195456A patent/US3775367A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE751924A (fr) | 1970-12-14 |
| DK128686B (da) | 1974-06-17 |
| NL7008632A (enPDFPhase) | 1970-12-15 |
| DE1930257B2 (de) | 1976-01-29 |
| SE365230B (enPDFPhase) | 1974-03-18 |
| US3775367A (en) | 1973-11-27 |
| FR2046762A1 (enPDFPhase) | 1971-03-12 |
| GB1299618A (en) | 1972-12-13 |
| CH531548A (de) | 1972-12-15 |
| NL154541B (nl) | 1977-09-15 |
| DE1930257A1 (de) | 1970-12-17 |
| AT297333B (de) | 1972-03-27 |
| FR2046762B1 (enPDFPhase) | 1974-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO126027B (enPDFPhase) | ||
| US3778407A (en) | Flame-proof glass-fiber-reinforced polyamide containing phosphorus | |
| DE69815708T2 (de) | Flammhemmende polycarbonatharzzusammensetzung | |
| WO2001083606A1 (en) | Fire-retarded polycarbonate resin composition | |
| US5663280A (en) | Carbonate polymer resins containing low volatility aromatic phosphate ester compounds | |
| US3836490A (en) | Flameproof polycarbonates containing an alkali metal salt soluble in the polycarbonate melt | |
| EP0042561A1 (de) | Flammwidrige Formmassen auf Basis thermoplastischer aromatischer Polyester, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Formkörpern | |
| US5013776A (en) | Flame-retardant polycarbonate resin composition | |
| NO790898L (no) | Flammemotstandsdyktig polystyrenskum og fremgangsmaate til dets fremstilling | |
| US3876580A (en) | Flame-resistant thermoplastic molding compositions and moldings made therefrom | |
| US4097547A (en) | Stabilized polycarbonates | |
| US4066618A (en) | Flame retardant polycarbonate composition | |
| CA2005962A1 (en) | Dispersing ignition resistant additives into carbonate polymers | |
| US3875107A (en) | Flame-resistant thermoplastic molding compositions and moldings made therefrom | |
| US4774273A (en) | Perfluoroalkanesulphonic acid aryl esters as anti-drip agents in flame-repellant molding compositions based on thermoplastic aromaticpolycarbonates | |
| JPS6134749B2 (enPDFPhase) | ||
| US3367958A (en) | Stabilized polycarbonates | |
| EP1558676A1 (en) | Method for making fire-retarded polycarbonate and related compositions | |
| DE2253072A1 (de) | Schwerbrennbare, perfluoralkansulfonatenthaltende polycarbonate | |
| US4014849A (en) | Self-extinguishing reinforced polycarbonate molding compositions | |
| JPS6031222B2 (ja) | 難燃性樹脂組成物 | |
| DE2755910A1 (de) | Schaeumbare thermoplastische polyester-zusammensetzungen | |
| NO154699B (no) | Selvslukkende styrenplast. | |
| JP2000239509A (ja) | 熱安定性に優れた難燃性ポリカーボネート樹脂組成物 | |
| JPS62116656A (ja) | ポリカ−ボネ−ト樹脂およびエチレンとアクリル酸またはメタクリル酸とのコポリマ−からなる熱可塑性組成物 |