NO125927B - - Google Patents
Download PDFInfo
- Publication number
- NO125927B NO125927B NO0699/68A NO69968A NO125927B NO 125927 B NO125927 B NO 125927B NO 0699/68 A NO0699/68 A NO 0699/68A NO 69968 A NO69968 A NO 69968A NO 125927 B NO125927 B NO 125927B
- Authority
- NO
- Norway
- Prior art keywords
- lower alkyl
- compound
- tautomer
- amino
- pyrroline
- Prior art date
Links
- -1 alkyl mustard oil Chemical compound 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 19
- 239000008164 mustard oil Substances 0.000 claims description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 239000008280 blood Substances 0.000 claims description 5
- 210000004369 blood Anatomy 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 230000000694 effects Effects 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 239000000047 product Substances 0.000 claims description 2
- 150000003580 thiophosphoric acid esters Chemical class 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims 3
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 150000002367 halogens Chemical class 0.000 claims 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- 230000001476 alcoholic effect Effects 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- NAGJZTKCGNOGPW-UHFFFAOYSA-N dithiophosphoric acid Chemical compound OP(O)(S)=S NAGJZTKCGNOGPW-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229940123208 Biguanide Drugs 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 150000004283 biguanides Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 210000000577 adipose tissue Anatomy 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- ZOJBYZNEUISWFT-UHFFFAOYSA-N allyl isothiocyanate Chemical compound C=CCN=C=S ZOJBYZNEUISWFT-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000003178 anti-diabetic effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- XSEUMFJMFFMCIU-UHFFFAOYSA-N buformin Chemical compound CCCC\N=C(/N)N=C(N)N XSEUMFJMFFMCIU-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 230000010030 glucose lowering effect Effects 0.000 description 1
- 230000006377 glucose transport Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 1
- 150000003236 pyrrolines Chemical class 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/38—2-Pyrrolones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH290567A CH501615A (de) | 1967-02-27 | 1967-02-27 | Verfahren zur Herstellung von Pyrrolidinverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO125927B true NO125927B (enExample) | 1972-11-27 |
Family
ID=4244242
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO0699/68A NO125927B (enExample) | 1967-02-27 | 1968-02-26 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3564010A (enExample) |
| AT (2) | AT277222B (enExample) |
| BE (1) | BE711260A (enExample) |
| CH (7) | CH514584A (enExample) |
| DE (1) | DE1695220C3 (enExample) |
| ES (1) | ES350956A1 (enExample) |
| FR (2) | FR8382M (enExample) |
| GB (2) | GB1204804A (enExample) |
| IE (1) | IE31968B1 (enExample) |
| IL (2) | IL37775A (enExample) |
| NL (1) | NL6802460A (enExample) |
| NO (1) | NO125927B (enExample) |
| SE (2) | SE331996B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4005100A (en) * | 1972-02-28 | 1977-01-25 | Hoffmann-La Roche Inc. | Pyrazole-5-carboxamides |
| CA1201119A (en) * | 1978-09-18 | 1986-02-25 | Mcneilab, Inc. | Diaza-cyclic derivatives of guanidine |
| JPS55160764A (en) * | 1979-05-29 | 1980-12-13 | Ciba Geigy Ag | Guanidine* its manufacture and pharmaceutic medicine containing same |
| EP0020304A1 (de) * | 1979-05-29 | 1980-12-10 | Ciba-Geigy Ag | Guanidine, Verfahren zur Herstellung, pharmazeutische Präparate enthaltend solche Verbindungen und ihre Verwendung |
-
1967
- 1967-02-27 CH CH1791169A patent/CH514584A/de not_active IP Right Cessation
- 1967-02-27 CH CH1791369A patent/CH513849A/de not_active IP Right Cessation
- 1967-02-27 CH CH1791069A patent/CH513158A/de not_active IP Right Cessation
- 1967-02-27 CH CH1791269A patent/CH513848A/de not_active IP Right Cessation
- 1967-02-27 CH CH1790869A patent/CH513156A/de not_active IP Right Cessation
- 1967-02-27 CH CH290567A patent/CH501615A/de not_active IP Right Cessation
- 1967-02-27 CH CH1791469A patent/CH513850A/de not_active IP Right Cessation
-
1968
- 1968-01-16 AT AT42968A patent/AT277222B/de not_active IP Right Cessation
- 1968-01-16 AT AT04284/69A patent/AT283341B/de active
- 1968-01-16 DE DE1695220A patent/DE1695220C3/de not_active Expired
- 1968-02-18 IL IL37775A patent/IL37775A/xx unknown
- 1968-02-18 IL IL29491A patent/IL29491A/en unknown
- 1968-02-20 FR FR140496A patent/FR8382M/fr not_active Expired
- 1968-02-21 NL NL6802460A patent/NL6802460A/xx unknown
- 1968-02-23 US US707484A patent/US3564010A/en not_active Expired - Lifetime
- 1968-02-26 SE SE02451/68A patent/SE331996B/xx unknown
- 1968-02-26 GB GB56314/69A patent/GB1204804A/en not_active Expired
- 1968-02-26 NO NO0699/68A patent/NO125927B/no unknown
- 1968-02-26 ES ES350956A patent/ES350956A1/es not_active Expired
- 1968-02-26 GB GB9202/68A patent/GB1204803A/en not_active Expired
- 1968-02-26 BE BE711260D patent/BE711260A/xx unknown
- 1968-02-27 IE IE230/68A patent/IE31968B1/xx unknown
- 1968-02-27 FR FR141415A patent/FR1573948A/fr not_active Expired
- 1968-08-27 SE SE11504/68A patent/SE340620B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE31968L (en) | 1968-08-27 |
| IE31968B1 (en) | 1973-03-07 |
| DE1695220B2 (de) | 1980-01-10 |
| CH513158A (de) | 1971-09-30 |
| DE1695220C3 (de) | 1980-09-11 |
| CH513848A (de) | 1971-10-15 |
| SE331996B (enExample) | 1971-01-25 |
| BE711260A (enExample) | 1968-08-26 |
| SE340620B (enExample) | 1971-11-29 |
| FR1573948A (enExample) | 1969-07-11 |
| GB1204803A (en) | 1970-09-09 |
| IL29491A (en) | 1972-01-27 |
| CH513849A (de) | 1971-10-15 |
| CH501615A (de) | 1971-01-15 |
| AT277222B (de) | 1969-12-10 |
| GB1204804A (en) | 1970-09-09 |
| CH514584A (de) | 1971-10-31 |
| CH513850A (de) | 1971-10-15 |
| CH513156A (de) | 1971-09-30 |
| AT283341B (de) | 1970-08-10 |
| FR8382M (enExample) | 1971-03-01 |
| DE1695220A1 (de) | 1971-03-18 |
| ES350956A1 (es) | 1969-05-16 |
| NL6802460A (enExample) | 1968-08-28 |
| US3564010A (en) | 1971-02-16 |
| IL37775A (en) | 1972-01-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO160781B (no) | 1,2,5-tiadiazolderivater. | |
| CA2669069A1 (en) | Process for the preparation of 2-imino-thiazolidin-4-one derivatives | |
| Ulrich et al. | The reaction of oxalyl chloride with substituted ureas and thioureas | |
| NO125927B (enExample) | ||
| NO178396B (no) | Forbedret fremgangsmåte for fremstilling av substituerte indolonderivater og mellomprodukter i fremstillingen derav | |
| NO764039L (enExample) | ||
| NO138530B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive 1-substituerte pyrazolon-(5)-derivater | |
| Lewis et al. | Alkyl phenyl-(2-pyridyl)-methyl sulfones. Sulfonium salts as alkylating agents | |
| US2621162A (en) | J-propargyl-x-quinazolones and acid | |
| NO158185B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 1,5-difenylpyrazolin-3-on-forbindelser. | |
| NO814468L (no) | Tiazolinderivater, fremgangsmaate til deres fremstilling, deres anvendelse samt farmasoeytiske preparater paa basis av disse forbindelser | |
| US3242189A (en) | Processes for preparing 3-amino-isoxazoles | |
| US4289765A (en) | 4-Aminopyridines and medicaments containing the same | |
| NO792275L (no) | Fremgangsmaate for fremstilling av farmakologisk aktive pyrazolo-pyridinderivater | |
| Simpson | Two Simple Amidinium Vinylogs | |
| KR860001568B1 (ko) | 선택적 설폰화 방법에 의한 페닐렌디아민 유도체의 제조 방법 | |
| NO136410B (enExample) | ||
| KR20170109709A (ko) | 신규한 피리도아이소인돌 유도체의 제조방법 | |
| NO862541L (no) | Nye tieno-1,2-tiazolderivater og fremgangsmaate til fremstilling derav. | |
| NO179004B (no) | Analogifremgangsmåte til fremstilling av terapeutisk aktive imidazolderivater | |
| US3210348A (en) | 6h-6-trichloromethylmercapto-dibenzo[c, e][1, 2]thiazine 5, 5-dioxide compounds | |
| NO154131B (no) | Analogifremgangsm¨te for fremstilling av terapeutisk aktiv e karbostyrilderivater. | |
| Cook et al. | 46. Sulphonamides derived from substituted anilines | |
| NO149209B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive 1-(3-(3,4,5-trimetoksyfenoksy)-2-hydroksypropyl))-4-aryl-piperazin-derivater | |
| US2030373A (en) | Derivatives of thiazole and process of preparing the same |