NO125530B - - Google Patents
Download PDFInfo
- Publication number
- NO125530B NO125530B NO164934A NO16493466A NO125530B NO 125530 B NO125530 B NO 125530B NO 164934 A NO164934 A NO 164934A NO 16493466 A NO16493466 A NO 16493466A NO 125530 B NO125530 B NO 125530B
- Authority
- NO
- Norway
- Prior art keywords
- dichloro
- nitro
- phenoxy
- acetic acid
- mixture
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 29
- 150000002148 esters Chemical class 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 150000001408 amides Chemical class 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 7
- 125000004971 nitroalkyl group Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 87
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 75
- 239000000203 mixture Substances 0.000 description 55
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 50
- -1 hydroxy-substituted benzaldehyde Chemical class 0.000 description 44
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 36
- 239000002253 acid Substances 0.000 description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- 229960000583 acetic acid Drugs 0.000 description 29
- 238000002844 melting Methods 0.000 description 29
- 230000008018 melting Effects 0.000 description 29
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- 239000007787 solid Substances 0.000 description 24
- 239000000047 product Substances 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 16
- 239000000243 solution Substances 0.000 description 16
- 238000009835 boiling Methods 0.000 description 13
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 description 8
- 239000000376 reactant Substances 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- JSZOAYXJRCEYSX-UHFFFAOYSA-N 1-nitropropane Chemical compound CCC[N+]([O-])=O JSZOAYXJRCEYSX-UHFFFAOYSA-N 0.000 description 7
- GEORDJYJYUGGSO-UHFFFAOYSA-N 2,3-dichloro-4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C(Cl)=C1Cl GEORDJYJYUGGSO-UHFFFAOYSA-N 0.000 description 7
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 239000002934 diuretic Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- IWZPFUFJILGFLC-UHFFFAOYSA-N ethyl 2-(2,3-dichloro-4-formylphenoxy)acetate Chemical compound CCOC(=O)COC1=CC=C(C=O)C(Cl)=C1Cl IWZPFUFJILGFLC-UHFFFAOYSA-N 0.000 description 5
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 5
- UHPBFMVUGRPHHK-UHFFFAOYSA-N 2-(2,3-dichloro-4-formylphenoxy)acetic acid Chemical compound OC(=O)COC1=CC=C(C=O)C(Cl)=C1Cl UHPBFMVUGRPHHK-UHFFFAOYSA-N 0.000 description 4
- OVOCPGBXSHLKPA-UHFFFAOYSA-N 2-(2,4-dichloro-6-formylphenoxy)acetic acid Chemical compound OC(=O)COC1=C(Cl)C=C(Cl)C=C1C=O OVOCPGBXSHLKPA-UHFFFAOYSA-N 0.000 description 4
- RXJVUAUDFUNCSU-UHFFFAOYSA-N 2-[2,3-dichloro-4-(2-nitroprop-1-enyl)phenoxy]acetic acid Chemical compound [O-][N+](=O)C(C)=CC1=CC=C(OCC(O)=O)C(Cl)=C1Cl RXJVUAUDFUNCSU-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- LOIDHXHRLGQKMG-UHFFFAOYSA-N [N+](=O)([O-])C(=CC1=CC=C(C2=CC=CC=C12)OCC(=O)O)CC Chemical compound [N+](=O)([O-])C(=CC1=CC=C(C2=CC=CC=C12)OCC(=O)O)CC LOIDHXHRLGQKMG-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- QPUVQSXODORTAY-UHFFFAOYSA-N ethyl 2-(2,4-dichloro-6-formylphenoxy)acetate Chemical compound CCOC(=O)COC1=C(Cl)C=C(Cl)C=C1C=O QPUVQSXODORTAY-UHFFFAOYSA-N 0.000 description 4
- CWVFRPWXXQBYBV-UHFFFAOYSA-N ethyl 2-(4-formylnaphthalen-1-yl)oxyacetate Chemical compound C(=O)C1=CC=C(C2=CC=CC=C12)OCC(=O)OCC CWVFRPWXXQBYBV-UHFFFAOYSA-N 0.000 description 4
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 150000003141 primary amines Chemical class 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- FFKQXPWQNXPZHK-UHFFFAOYSA-N 2-[2,3-dichloro-4-(2-nitrohept-1-enyl)phenoxy]acetic acid Chemical compound ClC1=C(OCC(=O)O)C=CC(=C1Cl)C=C(CCCCC)[N+](=O)[O-] FFKQXPWQNXPZHK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- VEZXCJBBBCKRPI-UHFFFAOYSA-N beta-propiolactone Chemical compound O=C1CCO1 VEZXCJBBBCKRPI-UHFFFAOYSA-N 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000001882 diuretic effect Effects 0.000 description 3
- ZECSUZBYOAVAIH-UHFFFAOYSA-N ethyl 2-(2,3-dimethylphenoxy)acetate Chemical compound CCOC(=O)COC1=CC=CC(C)=C1C ZECSUZBYOAVAIH-UHFFFAOYSA-N 0.000 description 3
- QCWITBLXLXGWBQ-UHFFFAOYSA-N ethyl 2-[4-(2-nitroprop-1-enyl)naphthalen-1-yl]oxyacetate Chemical compound C1=CC=C2C(OCC(=O)OCC)=CC=C(C=C(C)[N+]([O-])=O)C2=C1 QCWITBLXLXGWBQ-UHFFFAOYSA-N 0.000 description 3
- WAWVPKKLNWOVMH-UHFFFAOYSA-N ethyl 2-[4-(chloromethyl)-2,3-dimethylphenoxy]acetate Chemical compound C(C)OC(COC1=C(C(=C(C=C1)CCl)C)C)=O WAWVPKKLNWOVMH-UHFFFAOYSA-N 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 230000020477 pH reduction Effects 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 2
- QWBBPBRQALCEIZ-UHFFFAOYSA-N 2,3-dimethylphenol Chemical compound CC1=CC=CC(O)=C1C QWBBPBRQALCEIZ-UHFFFAOYSA-N 0.000 description 2
- RNYYKOWWMVGPHR-UHFFFAOYSA-N 2-[2,3-dichloro-4-(2-nitrobut-1-enyl)phenoxy]propanoic acid Chemical compound ClC1=C(OC(C(=O)O)C)C=CC(=C1Cl)C=C(CC)[N+](=O)[O-] RNYYKOWWMVGPHR-UHFFFAOYSA-N 0.000 description 2
- FKRJGKUGVNZNLI-UHFFFAOYSA-N 2-[2,3-dichloro-4-(2-nitroprop-1-enyl)phenoxy]propanoic acid Chemical compound ClC1=C(OC(C(=O)O)C)C=CC(=C1Cl)C=C(C)[N+](=O)[O-] FKRJGKUGVNZNLI-UHFFFAOYSA-N 0.000 description 2
- KJCKIDCFGOHRMN-UHFFFAOYSA-N 4-(2,3-dichloro-4-formylphenoxy)butanoic acid Chemical compound OC(=O)CCCOC1=CC=C(C=O)C(Cl)=C1Cl KJCKIDCFGOHRMN-UHFFFAOYSA-N 0.000 description 2
- SSRMBZBMXIUTRI-UHFFFAOYSA-N CC1=C(OCC(=O)O)C=CC(=C1C)C=C(CC)[N+](=O)[O-] Chemical compound CC1=C(OCC(=O)O)C=CC(=C1C)C=C(CC)[N+](=O)[O-] SSRMBZBMXIUTRI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- SRKLYOLWLMCNKM-UHFFFAOYSA-N ClC1=C(OCC(=O)O)C=CC(=C1Cl)C=C(CCCC)[N+](=O)[O-] Chemical compound ClC1=C(OCC(=O)O)C=CC(=C1Cl)C=C(CCCC)[N+](=O)[O-] SRKLYOLWLMCNKM-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012050 conventional carrier Substances 0.000 description 2
- DDRJAANPRJIHGJ-UHFFFAOYSA-N creatinine Chemical compound CN1CC(=O)NC1=N DDRJAANPRJIHGJ-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 238000006266 etherification reaction Methods 0.000 description 2
- 230000029142 excretion Effects 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 230000022244 formylation Effects 0.000 description 2
- 238000006170 formylation reaction Methods 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000004312 hexamethylene tetramine Substances 0.000 description 2
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229960000380 propiolactone Drugs 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 230000000894 saliuretic effect Effects 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 238000011287 therapeutic dose Methods 0.000 description 2
- 210000002700 urine Anatomy 0.000 description 2
- RPAJSBKBKSSMLJ-DFWYDOINSA-N (2s)-2-aminopentanedioic acid;hydrochloride Chemical class Cl.OC(=O)[C@@H](N)CCC(O)=O RPAJSBKBKSSMLJ-DFWYDOINSA-N 0.000 description 1
- NALZTFARIYUCBY-UHFFFAOYSA-N 1-nitrobutane Chemical compound CCCC[N+]([O-])=O NALZTFARIYUCBY-UHFFFAOYSA-N 0.000 description 1
- FEYJIFXFOHFGCC-UHFFFAOYSA-N 1-nitrohexane Chemical compound CCCCCC[N+]([O-])=O FEYJIFXFOHFGCC-UHFFFAOYSA-N 0.000 description 1
- BVALZCVRLDMXOQ-UHFFFAOYSA-N 1-nitropentane Chemical compound CCCCC[N+]([O-])=O BVALZCVRLDMXOQ-UHFFFAOYSA-N 0.000 description 1
- UMPSXRYVXUPCOS-UHFFFAOYSA-N 2,3-dichlorophenol Chemical compound OC1=CC=CC(Cl)=C1Cl UMPSXRYVXUPCOS-UHFFFAOYSA-N 0.000 description 1
- HMRFGYPCXHBBGO-UHFFFAOYSA-N 2-[4-(2-nitroprop-1-enyl)naphthalen-1-yl]oxyacetic acid Chemical compound C1=CC=C2C(C=C(C)[N+]([O-])=O)=CC=C(OCC(O)=O)C2=C1 HMRFGYPCXHBBGO-UHFFFAOYSA-N 0.000 description 1
- FABVMBDCVAJXMB-UHFFFAOYSA-N 3,5-dichloro-2-hydroxybenzaldehyde Chemical compound OC1=C(Cl)C=C(Cl)C=C1C=O FABVMBDCVAJXMB-UHFFFAOYSA-N 0.000 description 1
- VPNIQOAWYIPOOJ-UHFFFAOYSA-N 3-(2,3-dichloro-4-formylphenoxy)propanoic acid Chemical compound OC(=O)CCOC1=CC=C(C=O)C(Cl)=C1Cl VPNIQOAWYIPOOJ-UHFFFAOYSA-N 0.000 description 1
- UVGYHIYZGDLXQU-UHFFFAOYSA-N 4-[2,3-dichloro-4-(2-nitrobut-1-enyl)phenoxy]butanoic acid Chemical compound CCC([N+]([O-])=O)=CC1=CC=C(OCCCC(O)=O)C(Cl)=C1Cl UVGYHIYZGDLXQU-UHFFFAOYSA-N 0.000 description 1
- GEVILTWPAPSGDK-UHFFFAOYSA-N 4-hydroxy-2,3-dimethylbenzaldehyde Chemical compound CC1=C(C)C(C=O)=CC=C1O GEVILTWPAPSGDK-UHFFFAOYSA-N 0.000 description 1
- LORPDGZOLAPNHP-UHFFFAOYSA-N 4-hydroxynaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(O)=CC=C(C=O)C2=C1 LORPDGZOLAPNHP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- YZONDHMTNGFURK-UHFFFAOYSA-N ClC1=C(OCC(=O)O)C=CC(=C1Cl)C=C(CC)[N+](=O)[O-] Chemical compound ClC1=C(OCC(=O)O)C=CC(=C1Cl)C=C(CC)[N+](=O)[O-] YZONDHMTNGFURK-UHFFFAOYSA-N 0.000 description 1
- AGUVLVQZVUITQN-UHFFFAOYSA-N ClC1=C(OCC(=O)O)C=CC(=C1Cl)C=C[N+](=O)[O-] Chemical compound ClC1=C(OCC(=O)O)C=CC(=C1Cl)C=C[N+](=O)[O-] AGUVLVQZVUITQN-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- PPWHTZKZQNXVAE-UHFFFAOYSA-N Tetracaine hydrochloride Chemical compound Cl.CCCCNC1=CC=C(C(=O)OCCN(C)C)C=C1 PPWHTZKZQNXVAE-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000004705 aldimines Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001656 butanoic acid esters Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 229940109239 creatinine Drugs 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- XBPOBCXHALHJFP-UHFFFAOYSA-N ethyl 4-bromobutanoate Chemical compound CCOC(=O)CCCBr XBPOBCXHALHJFP-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/12—Preparation of nitro compounds by reactions not involving the formation of nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/32—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups bound to acyclic carbon atoms and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/008—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with tri- or tetrahalomethyl compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/09—Preparation of carboxylic acids or their salts, halides or anhydrides from carboxylic acid esters or lactones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/74—Unsaturated compounds containing —CHO groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US491818A US3409661A (en) | 1965-09-30 | 1965-09-30 | Nuclear polysubstituted[(2-nitro-1-alkenyl)-aryloxy]alkanoic acids |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO125530B true NO125530B (oth) | 1972-09-25 |
Family
ID=23953804
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO164934A NO125530B (oth) | 1965-09-30 | 1966-09-29 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3409661A (oth) |
| BE (1) | BE687556A (oth) |
| BR (1) | BR6683207D0 (oth) |
| CH (1) | CH484043A (oth) |
| DE (1) | DE1593091B2 (oth) |
| DK (1) | DK117220B (oth) |
| ES (1) | ES332083A1 (oth) |
| FR (2) | FR1513316A (oth) |
| GB (1) | GB1115135A (oth) |
| IL (1) | IL26553A (oth) |
| NL (1) | NL6613774A (oth) |
| NO (1) | NO125530B (oth) |
| SE (1) | SE337815B (oth) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3507910A (en) * | 1967-03-23 | 1970-04-21 | Merck & Co Inc | ((1-organothio-2-nitroalkyl)phenoxy)alkanoic acids |
| US4342782A (en) * | 1978-11-16 | 1982-08-03 | Merck & Co., Inc. | 1-(Substituted-aminoalkoxyphenyl)-2-methylene-1-alkanones, compositions and use thereof |
| US4751244A (en) * | 1986-04-04 | 1988-06-14 | Merck & Co., Inc. | Compounds useful in treating sickle cell anemia |
| DE3778576D1 (de) * | 1986-04-04 | 1992-06-04 | Merck & Co Inc | Verbindungen von nutzen bei der behandlung vom herrickschen syndrom. |
-
1965
- 1965-09-30 US US491818A patent/US3409661A/en not_active Expired - Lifetime
-
1966
- 1966-09-20 FR FR77046A patent/FR1513316A/fr not_active Expired
- 1966-09-21 IL IL26553A patent/IL26553A/xx unknown
- 1966-09-22 CH CH1367466A patent/CH484043A/de not_active IP Right Cessation
- 1966-09-27 BR BR183207/66A patent/BR6683207D0/pt unknown
- 1966-09-27 ES ES0332083A patent/ES332083A1/es not_active Expired
- 1966-09-28 GB GB43398/66A patent/GB1115135A/en not_active Expired
- 1966-09-29 NO NO164934A patent/NO125530B/no unknown
- 1966-09-29 DE DE19661593091 patent/DE1593091B2/de active Granted
- 1966-09-29 SE SE13117/66A patent/SE337815B/xx unknown
- 1966-09-29 NL NL6613774A patent/NL6613774A/xx unknown
- 1966-09-29 DK DK503366AA patent/DK117220B/da unknown
- 1966-09-29 BE BE687556D patent/BE687556A/xx unknown
- 1966-12-19 FR FR88015A patent/FR6024M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES332083A1 (es) | 1967-07-16 |
| NL6613774A (oth) | 1967-03-31 |
| SE337815B (oth) | 1971-08-23 |
| BE687556A (oth) | 1967-03-29 |
| BR6683207D0 (pt) | 1973-12-04 |
| DK117220B (da) | 1970-03-31 |
| IL26553A (en) | 1970-05-21 |
| DE1593091C3 (oth) | 1974-01-03 |
| CH484043A (de) | 1970-01-15 |
| GB1115135A (en) | 1968-05-29 |
| DE1593091B2 (de) | 1973-05-24 |
| FR1513316A (fr) | 1968-02-16 |
| FR6024M (oth) | 1968-05-13 |
| DE1593091A1 (de) | 1970-07-16 |
| US3409661A (en) | 1968-11-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO164357B (no) | Fluid polymer/polyol-dispersjon og anvendelse derav for fremstilling av polyuretanskum. | |
| US4110337A (en) | Triazolobenzodiazepines | |
| JP2556821B2 (ja) | 三環式芳香族化合物 | |
| JPH01313466A (ja) | α‐置換4‐(キノリン‐2‐イル‐メトキシ)フエニル酢酸及びエステル | |
| US3586694A (en) | 1-benzoylbenzimidazol-2-ylacetic acids | |
| JPS6037095B2 (ja) | ピペラジン置換体の製法 | |
| CA1275102A (en) | Intermediates for diphenyl and phenyl pyridyl anti- histamines | |
| US4602093A (en) | Novel substituted imidazoles, their preparation and use | |
| IE58207B1 (en) | Oxindole antiinflammatory agents | |
| US3579529A (en) | Heterocyclic compounds | |
| US4596816A (en) | 4-aryl oxazoles | |
| NO125530B (oth) | ||
| US3308121A (en) | 3-morpholinones, thiones and 5, 6 oxazines | |
| NO164934B (no) | Fremgangsmaate for maaling av trykk ved perforering av en foring i et borehull. | |
| US3751417A (en) | 1-acyl-3-(2-(4-phenyl-1-piperazinyl)ethyl)indolines | |
| NO145209B (no) | Apparat for magnetisk paavirkning av en stroemmende vaeske | |
| US3717659A (en) | Heterocyclic salicylic acid derivatives | |
| US4362891A (en) | Alkanoic acid derivatives | |
| Campbell et al. | 224. 5-Alkylacridines. Part I. Synthesis of 5-methylacridine and certain substituted analogues | |
| US3982001A (en) | 4-(3.4-Methylene dioxy phenyl)-piperidines | |
| NO830758L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 4-fenyl-4,5,6,7-tetrahydro tieno (2,3-c) pyridin-derivater | |
| EP0026505B1 (en) | 7,8-substituted-1-phenyl-2,3,4,5-tetrahydro-1-h-3-benzazepines | |
| US4822791A (en) | Pharmaceutical compositions of-2,2-1,1-[bis-2,2'-(3,1-benzoxazin-4-one)9 ethylenes | |
| JP3492433B2 (ja) | 3−(フェニルアルキルアミノアルキルオキシ)−5−フェニルピラゾール−化合物、その製造のための方法及び中間体、及びこれを含有する心臓循環作用薬剤 | |
| US3781295A (en) | Pyridyl ketipate lactones and derivatives |