NO121953B - - Google Patents
Download PDFInfo
- Publication number
- NO121953B NO121953B NO167160A NO16716067A NO121953B NO 121953 B NO121953 B NO 121953B NO 167160 A NO167160 A NO 167160A NO 16716067 A NO16716067 A NO 16716067A NO 121953 B NO121953 B NO 121953B
- Authority
- NO
- Norway
- Prior art keywords
- compound
- acid
- salicylate
- quaternary
- compounds
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 33
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 claims description 14
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 229960001138 acetylsalicylic acid Drugs 0.000 claims description 6
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 claims description 6
- 229960004889 salicylic acid Drugs 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 claims description 5
- 229960004909 aminosalicylic acid Drugs 0.000 claims description 5
- 229910002651 NO3 Inorganic materials 0.000 claims description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical group [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical group [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical group I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 3
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical group Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 2
- 150000001805 chlorine compounds Chemical group 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 235000019441 ethanol Nutrition 0.000 description 9
- 229960001860 salicylate Drugs 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 229940068372 acetyl salicylate Drugs 0.000 description 8
- QDYLMAYUEZBUFO-UHFFFAOYSA-N cetalkonium chloride Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 QDYLMAYUEZBUFO-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 210000001519 tissue Anatomy 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- -1 cyclic nitrogen compounds Chemical class 0.000 description 5
- 239000002674 ointment Substances 0.000 description 5
- NEUSVAOJNUQRTM-UHFFFAOYSA-N cetylpyridinium Chemical compound CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 NEUSVAOJNUQRTM-UHFFFAOYSA-N 0.000 description 4
- 229960004830 cetylpyridinium Drugs 0.000 description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical class [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 4
- 125000001453 quaternary ammonium group Chemical group 0.000 description 4
- 150000003873 salicylate salts Chemical class 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- WUBBRNOQWQTFEX-UHFFFAOYSA-M 4-aminosalicylate(1-) Chemical compound NC1=CC=C(C([O-])=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-M 0.000 description 3
- 241000283973 Oryctolagus cuniculus Species 0.000 description 3
- 206010040880 Skin irritation Diseases 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- SXPWTBGAZSPLHA-UHFFFAOYSA-M cetalkonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SXPWTBGAZSPLHA-UHFFFAOYSA-M 0.000 description 3
- 229960000228 cetalkonium chloride Drugs 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229910017464 nitrogen compound Inorganic materials 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 230000036556 skin irritation Effects 0.000 description 3
- 231100000475 skin irritation Toxicity 0.000 description 3
- UKAPYNPLXZAGQD-UHFFFAOYSA-M 2-carboxyphenolate;1-hexadecylpyridin-1-ium Chemical compound OC1=CC=CC=C1C([O-])=O.CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 UKAPYNPLXZAGQD-UHFFFAOYSA-M 0.000 description 2
- FVVDKUPCWXUVNP-UHFFFAOYSA-M Aminosalicylate sodium anhydrous Chemical compound [Na+].NC1=CC=C(C([O-])=O)C(O)=C1 FVVDKUPCWXUVNP-UHFFFAOYSA-M 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- YMKDRGPMQRFJGP-UHFFFAOYSA-M cetylpyridinium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 YMKDRGPMQRFJGP-UHFFFAOYSA-M 0.000 description 2
- 229960001927 cetylpyridinium chloride Drugs 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000002829 nitrogen Chemical group 0.000 description 2
- 150000002830 nitrogen compounds Chemical group 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- BGIBPLXEOUEABF-UHFFFAOYSA-N 2-carboxyphenolate;piperidin-1-ium Chemical group C1CCNCC1.OC(=O)C1=CC=CC=C1O BGIBPLXEOUEABF-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229920002230 Pectic acid Polymers 0.000 description 1
- NQRYJNQNLNOLGT-UHFFFAOYSA-O Piperidinium(1+) Chemical compound C1CC[NH2+]CC1 NQRYJNQNLNOLGT-UHFFFAOYSA-O 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- ABBQHOQBGMUPJH-UHFFFAOYSA-M Sodium salicylate Chemical compound [Na+].OC1=CC=CC=C1C([O-])=O ABBQHOQBGMUPJH-UHFFFAOYSA-M 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 229940125716 antipyretic agent Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- VEIWYFRREFUNRC-UHFFFAOYSA-N hydron;piperidine;chloride Chemical compound [Cl-].C1CC[NH2+]CC1 VEIWYFRREFUNRC-UHFFFAOYSA-N 0.000 description 1
- 239000008311 hydrophilic ointment Substances 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 239000003410 keratolytic agent Substances 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 229920003175 pectinic acid Polymers 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000010318 polygalacturonic acid Substances 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical group C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229960004025 sodium salicylate Drugs 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/10—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms
- C07D211/14—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/16—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing only one pyridine ring
- C07D213/20—Quaternary compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US53441266A | 1966-03-15 | 1966-03-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO121953B true NO121953B (de) | 1971-05-03 |
Family
ID=24129923
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO167160A NO121953B (de) | 1966-03-15 | 1967-03-07 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3498991A (de) |
| AT (2) | AT286297B (de) |
| BE (1) | BE695530A (de) |
| CH (1) | CH527159A (de) |
| DK (1) | DK135449B (de) |
| FI (1) | FI48456C (de) |
| FR (2) | FR6637M (de) |
| GB (1) | GB1178724A (de) |
| NL (2) | NL157889B (de) |
| NO (1) | NO121953B (de) |
| OA (1) | OA02346A (de) |
| SE (1) | SE355350B (de) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2851047C2 (de) * | 1977-12-01 | 1982-09-02 | Copal Co. Ltd., Tokyo | Verriegelungsmechanismus für elektromagnetisch gesteuerte Verschlüsse |
| DE3347378A1 (de) * | 1983-12-29 | 1985-07-11 | Hoechst Ag, 6230 Frankfurt | Fluorierte quaternaere ammonium-verbindungen, verfahren zu deren herstellung und deren verwendung als stroemungsbeschleuniger |
| JPH11349528A (ja) * | 1998-05-05 | 1999-12-21 | Witco Corp | 安息香酸塩およびサリチル酸塩ジアルキルクオットならびにトリアルキルクオット |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2692285A (en) * | 1951-05-07 | 1954-10-19 | Searle & Co | Di-sec-alkyl-dialkylammonium salts and processes for preparing the same |
| US3069321A (en) * | 1960-04-04 | 1962-12-18 | Lab For Pharmaceutical Dev Inc | Choline salicylate composition and methods of use |
-
1966
- 1966-03-15 US US534412A patent/US3498991A/en not_active Expired - Lifetime
-
1967
- 1967-01-27 GB GB4139/67A patent/GB1178724A/en not_active Expired
- 1967-03-07 NO NO167160A patent/NO121953B/no unknown
- 1967-03-07 OA OA52801A patent/OA02346A/xx unknown
- 1967-03-08 FR FR97944A patent/FR6637M/fr not_active Expired
- 1967-03-08 FR FR98000A patent/FR1513829A/fr not_active Expired
- 1967-03-13 CH CH362167A patent/CH527159A/de not_active IP Right Cessation
- 1967-03-14 AT AT12180/68A patent/AT286297B/de not_active IP Right Cessation
- 1967-03-14 FI FI670763A patent/FI48456C/fi active
- 1967-03-14 SE SE03534/67A patent/SE355350B/xx unknown
- 1967-03-14 AT AT244567A patent/AT276336B/de active
- 1967-03-14 DK DK132867AA patent/DK135449B/da unknown
- 1967-03-15 NL NL6703888.A patent/NL157889B/xx not_active IP Right Cessation
- 1967-03-15 BE BE695530D patent/BE695530A/xx not_active IP Right Cessation
-
1978
- 1978-04-26 NL NL7804470A patent/NL7804470A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH527159A (de) | 1972-08-31 |
| NL157889B (nl) | 1978-09-15 |
| DE1593933A1 (de) | 1970-12-03 |
| FR1513829A (fr) | 1968-02-16 |
| FI48456B (de) | 1974-07-01 |
| GB1178724A (en) | 1970-01-21 |
| US3498991A (en) | 1970-03-03 |
| AT286297B (de) | 1970-12-10 |
| NL7804470A (nl) | 1978-08-31 |
| OA02346A (fr) | 1970-05-05 |
| DK135449B (da) | 1977-05-02 |
| FR6637M (de) | 1969-01-20 |
| NL6703888A (de) | 1967-09-18 |
| FI48456C (fi) | 1974-10-10 |
| DK135449C (de) | 1977-10-17 |
| DE1593933B2 (de) | 1975-08-07 |
| AT276336B (de) | 1969-11-25 |
| SE355350B (de) | 1973-04-16 |
| BE695530A (de) | 1967-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR880000091B1 (ko) | 오메프라졸 중간체의 제조방법 | |
| Shaw | Analogs of aspergillic acid. I. The tautomerism of the hydroxypyridine-N-oxides | |
| US3957853A (en) | Metformine salt of acetylsalicylic acid | |
| JPS58164557A (ja) | 新規ピリジル化合物 | |
| JP2022518599A (ja) | 第四級アンモニウム塩系化合物およびその製造方法と使用 | |
| NO121953B (de) | ||
| CH542200A (de) | Verfahren zur Herstellung von Indolinderivaten | |
| JPS6051172A (ja) | ピロリジノン誘導体 | |
| CA1161044A (en) | 5-amino-tetrazole derivatives of retinoic acids, their preparation and pharmaceutical formulations containing these derivatives | |
| CH638510A5 (de) | Prostacyclinanaloga. | |
| US3002886A (en) | Betaine salicylates and the method for their preparation | |
| NO148947B (no) | Apparat for paafoering av et flytende bindemiddel. | |
| BR102014010331A2 (pt) | Process for the synthesis of aminaftone | |
| Folkers et al. | Erythrina Alkaloids. XVIII. Studies on the Structure of Erysopine, Erysodine, Erysovine and Erythraline | |
| US2182075A (en) | Water soluble derivatives of p-aminobenzenesulphonamide | |
| Dinculescu et al. | 2, 4, 6-TRIMETHYLPYRYLIUM SULFOACETATE | |
| US2984674A (en) | Amides of podophyllic acid and picropodophyllic acid | |
| JPS59104311A (ja) | 光遮蔽剤 | |
| US3394150A (en) | Polynitrates of steroidal alcohols | |
| US4028369A (en) | Preparation of glycol (2-(p-chlorophenoxy)-2-methylpropionate)-2-nicotinate | |
| US3888916A (en) | Amantadine salt of 16,16-dimethyl-pge' 2 | |
| US3519638A (en) | 4,5-diphenylimidazole derivative | |
| US5672613A (en) | 2-(4-methoxyphenoxy)-3-pyridineamine, its pharmaceutical compositions and therapeutic use | |
| JPS627900B2 (de) | ||
| JP2001081097A (ja) | ヒノキチオールアセトグルコシドおよびその製造方法 |