NO120231B - - Google Patents
Download PDFInfo
- Publication number
- NO120231B NO120231B NO16600066A NO16600066A NO120231B NO 120231 B NO120231 B NO 120231B NO 16600066 A NO16600066 A NO 16600066A NO 16600066 A NO16600066 A NO 16600066A NO 120231 B NO120231 B NO 120231B
- Authority
- NO
- Norway
- Prior art keywords
- benzofuran
- bromo
- ethyl
- ethanol
- methyl
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 12
- 239000007858 starting material Substances 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 150000001412 amines Chemical class 0.000 claims description 11
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 claims description 11
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 150000003944 halohydrins Chemical class 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 150000001907 coumarones Chemical class 0.000 claims description 5
- 150000002118 epoxides Chemical class 0.000 claims description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 108
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 44
- 239000000203 mixture Substances 0.000 description 29
- 239000000243 solution Substances 0.000 description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- -1 potassium hydroxide Chemical class 0.000 description 25
- 230000008018 melting Effects 0.000 description 21
- 238000002844 melting Methods 0.000 description 21
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 18
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- 239000000284 extract Substances 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 11
- 238000001704 evaporation Methods 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 11
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000005660 chlorination reaction Methods 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 8
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical class OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 8
- 239000000155 melt Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 230000031709 bromination Effects 0.000 description 6
- 238000005893 bromination reaction Methods 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000012279 sodium borohydride Substances 0.000 description 5
- 229910000033 sodium borohydride Inorganic materials 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- BBVPFZQONOONGZ-UHFFFAOYSA-N 1-(5-bromo-6,7-dimethyl-1-benzofuran-2-yl)-2-chloroethanol Chemical compound BrC=1C(=C(C2=C(C=C(O2)C(CCl)O)C1)C)C BBVPFZQONOONGZ-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 4
- GNPKVYPZSGCARR-UHFFFAOYSA-N 1-(5-bromo-6,7-dimethyl-1-benzofuran-2-yl)ethanone Chemical compound BrC1=C(C)C(C)=C2OC(C(=O)C)=CC2=C1 GNPKVYPZSGCARR-UHFFFAOYSA-N 0.000 description 3
- VJNALHQRNMZYBD-UHFFFAOYSA-N 1-(5-bromo-7-methyl-1-benzofuran-2-yl)-2-chloroethanol Chemical compound BrC=1C=C(C2=C(C=C(O2)C(CCl)O)C1)C VJNALHQRNMZYBD-UHFFFAOYSA-N 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000005283 haloketone group Chemical group 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 3
- OYKIBHHCEGIIMB-UHFFFAOYSA-N 1-(5-bromo-6,7-dimethyl-1-benzofuran-2-yl)-2-(propan-2-ylamino)ethanol Chemical compound BrC=1C(=C(C2=C(C=C(O2)C(CNC(C)C)O)C1)C)C OYKIBHHCEGIIMB-UHFFFAOYSA-N 0.000 description 2
- XGJLQDGUVDNLPL-UHFFFAOYSA-N 1-(5-bromo-6,7-dimethyl-1-benzofuran-2-yl)-2-chloroethanone Chemical compound ClCC(=O)C=1OC2=C(C1)C=C(C(=C2C)C)Br XGJLQDGUVDNLPL-UHFFFAOYSA-N 0.000 description 2
- GPOBDLAUCDZDIJ-UHFFFAOYSA-N 1-(5-bromo-7-ethyl-1-benzofuran-2-yl)-2-chloroethanol Chemical compound CCC1=CC(Br)=CC2=C1OC(C(O)CCl)=C2 GPOBDLAUCDZDIJ-UHFFFAOYSA-N 0.000 description 2
- KQDCMQDWSNQPOI-UHFFFAOYSA-N 1-(5-bromo-7-methyl-1-benzofuran-2-yl)-2-chloroethanone Chemical compound ClCC(=O)C=1OC2=C(C1)C=C(C=C2C)Br KQDCMQDWSNQPOI-UHFFFAOYSA-N 0.000 description 2
- KVPCRWUOWXALRM-UHFFFAOYSA-N 1-(5-bromo-7-methyl-1-benzofuran-2-yl)ethanone Chemical compound BrC1=CC(C)=C2OC(C(=O)C)=CC2=C1 KVPCRWUOWXALRM-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- SFHHSTAPEXMOJY-UHFFFAOYSA-N BrC=1C=C(C2=C(C=C(O2)C(CNC(C)C)O)C1)C Chemical compound BrC=1C=C(C2=C(C=C(O2)C(CNC(C)C)O)C1)C SFHHSTAPEXMOJY-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- QTMDXZNDVAMKGV-UHFFFAOYSA-L copper(ii) bromide Chemical compound [Cu+2].[Br-].[Br-] QTMDXZNDVAMKGV-UHFFFAOYSA-L 0.000 description 2
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000004312 hexamethylene tetramine Substances 0.000 description 2
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- PRXNKYBFWAWBNZ-UHFFFAOYSA-N trimethylphenylammonium tribromide Chemical compound Br[Br-]Br.C[N+](C)(C)C1=CC=CC=C1 PRXNKYBFWAWBNZ-UHFFFAOYSA-N 0.000 description 2
- YUTFQTAITWWGFH-UHFFFAOYSA-N 1-(1-benzofuran-2-yl)ethanone Chemical class C1=CC=C2OC(C(=O)C)=CC2=C1 YUTFQTAITWWGFH-UHFFFAOYSA-N 0.000 description 1
- MFYPMFVGBNFZBL-UHFFFAOYSA-N 1-(5-bromo-7-ethyl-1-benzofuran-2-yl)-2-(propan-2-ylamino)ethanol Chemical compound BrC=1C=C(C2=C(C=C(O2)C(CNC(C)C)O)C1)CC MFYPMFVGBNFZBL-UHFFFAOYSA-N 0.000 description 1
- SYSQCQYOHVPKJZ-UHFFFAOYSA-N 1-(5-bromo-7-ethyl-1-benzofuran-2-yl)-2-chloroethanone Chemical compound CCC1=CC(Br)=CC2=C1OC(C(=O)CCl)=C2 SYSQCQYOHVPKJZ-UHFFFAOYSA-N 0.000 description 1
- PPNZFWQOMJVVJT-UHFFFAOYSA-N 1-(5-bromo-7-ethyl-1-benzofuran-2-yl)ethanone Chemical compound CCC1=CC(Br)=CC2=C1OC(C(C)=O)=C2 PPNZFWQOMJVVJT-UHFFFAOYSA-N 0.000 description 1
- BOPAZEJKRKUDOB-UHFFFAOYSA-N 1-(7-bromo-5-methyl-1-benzofuran-2-yl)-2-chloroethanone Chemical compound ClCC(=O)C=1OC2=C(C1)C=C(C=C2Br)C BOPAZEJKRKUDOB-UHFFFAOYSA-N 0.000 description 1
- YXWHHNLPLIPDDQ-UHFFFAOYSA-N 1-(7-bromo-5-methyl-1-benzofuran-2-yl)ethanone Chemical compound CC1=CC(Br)=C2OC(C(=O)C)=CC2=C1 YXWHHNLPLIPDDQ-UHFFFAOYSA-N 0.000 description 1
- PZGFSVYPDAQKHJ-UHFFFAOYSA-N 5-bromo-2-hydroxy-3-methylbenzaldehyde Chemical compound CC1=CC(Br)=CC(C=O)=C1O PZGFSVYPDAQKHJ-UHFFFAOYSA-N 0.000 description 1
- NSKZAOKQZDLHGO-UHFFFAOYSA-N 5-chloro-2-hydroxy-3-methylbenzaldehyde Chemical compound CC1=CC(Cl)=CC(C=O)=C1O NSKZAOKQZDLHGO-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- RKAGPBANPHKVKS-UHFFFAOYSA-N BrC1=CC(=CC=2C=C(OC21)C(CNC(C)C)O)C Chemical compound BrC1=CC(=CC=2C=C(OC21)C(CNC(C)C)O)C RKAGPBANPHKVKS-UHFFFAOYSA-N 0.000 description 1
- 229910021590 Copper(II) bromide Inorganic materials 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 238000006364 Duff aldehyde synthesis reaction Methods 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000001871 Tachycardia Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- GRTGGSXWHGKRSB-UHFFFAOYSA-N dichloromethyl methyl ether Chemical compound COC(Cl)Cl GRTGGSXWHGKRSB-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 230000010247 heart contraction Effects 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000006794 tachycardia Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- GNMJFQWRASXXMS-UHFFFAOYSA-M trimethyl(phenyl)azanium;bromide Chemical compound [Br-].C[N+](C)(C)C1=CC=CC=C1 GNMJFQWRASXXMS-UHFFFAOYSA-M 0.000 description 1
- 229940099259 vaseline Drugs 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D307/80—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D307/81—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5321065A GB1106059A (en) | 1965-12-15 | 1965-12-15 | Novel benzofuran derivatives and a process for the manufacture thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO120231B true NO120231B (OSRAM) | 1970-09-21 |
Family
ID=10466999
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO16600066A NO120231B (OSRAM) | 1965-12-15 | 1966-12-14 |
Country Status (14)
| Country | Link |
|---|---|
| BE (1) | BE690934A (OSRAM) |
| BR (1) | BR6685348D0 (OSRAM) |
| CH (1) | CH477432A (OSRAM) |
| DE (1) | DE1543673C3 (OSRAM) |
| DK (1) | DK123772B (OSRAM) |
| ES (1) | ES334476A1 (OSRAM) |
| FI (1) | FI47660C (OSRAM) |
| FR (2) | FR6045M (OSRAM) |
| GB (1) | GB1106059A (OSRAM) |
| IL (1) | IL26795A (OSRAM) |
| MY (1) | MY6900390A (OSRAM) |
| NL (1) | NL6616724A (OSRAM) |
| NO (1) | NO120231B (OSRAM) |
| SE (1) | SE346105B (OSRAM) |
-
1965
- 1965-12-15 GB GB5321065A patent/GB1106059A/en not_active Expired
-
1966
- 1966-11-02 IL IL2679566A patent/IL26795A/en unknown
- 1966-11-14 CH CH1639166A patent/CH477432A/de not_active IP Right Cessation
- 1966-11-16 DE DE19661543673 patent/DE1543673C3/de not_active Expired
- 1966-11-28 NL NL6616724A patent/NL6616724A/xx unknown
- 1966-11-30 FR FR85517A patent/FR6045M/fr not_active Expired
- 1966-12-07 FI FI324166A patent/FI47660C/fi active
- 1966-12-09 BE BE690934D patent/BE690934A/xx unknown
- 1966-12-11 SE SE1721366A patent/SE346105B/xx unknown
- 1966-12-12 FR FR86968A patent/FR1504310A/fr not_active Expired
- 1966-12-13 ES ES334476A patent/ES334476A1/es not_active Expired
- 1966-12-14 NO NO16600066A patent/NO120231B/no unknown
- 1966-12-14 BR BR18534866A patent/BR6685348D0/pt unknown
- 1966-12-15 DK DK651166A patent/DK123772B/da unknown
-
1969
- 1969-12-30 MY MY6900390A patent/MY6900390A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH477432A (de) | 1969-08-31 |
| BE690934A (OSRAM) | 1967-06-09 |
| NL6616724A (OSRAM) | 1967-06-16 |
| IL26795A (en) | 1970-06-17 |
| DE1543673A1 (de) | 1969-09-11 |
| BR6685348D0 (pt) | 1973-12-27 |
| DE1543673B2 (de) | 1974-10-03 |
| DE1543673C3 (de) | 1975-05-28 |
| SE346105B (OSRAM) | 1972-06-26 |
| FI47660B (OSRAM) | 1973-10-31 |
| MY6900390A (en) | 1969-12-31 |
| FI47660C (fi) | 1974-02-11 |
| DK123772B (da) | 1972-07-31 |
| GB1106059A (en) | 1968-03-13 |
| FR6045M (OSRAM) | 1968-05-20 |
| FR1504310A (fr) | 1967-12-01 |
| ES334476A1 (es) | 1968-02-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO167947B (no) | Lagringsanordning for baand- eller plate-registreringsmedier | |
| BR112014030091B1 (pt) | processos para produzir certos 2-(piridina-3-il)tiazóis | |
| CA2316944A1 (en) | Aminoguanidinehydrazone derivative, production and use thereof | |
| EP0054132A1 (de) | Neue Pyrimidinone, ihre Herstellung und Arzneimittel mit einem Gehalt an diesen Stoffen | |
| DK151260B (da) | Analogifremgangsmaade til fremstilling af spiro-thienohydantoinderivater. | |
| NO146540B (no) | Fremgangsmaate ved fremstilling av furocumariner | |
| NO762661L (OSRAM) | ||
| NO140069B (no) | Pulverformet, lagringsbestandig vaskemiddelblanding | |
| NO743534L (OSRAM) | ||
| DK168010B1 (da) | Tetrahydroisoquinolinforbindelser og farmaceutisk middel indeholdende en saadan forbindelse | |
| NO770161L (no) | Tiazolidinderivater og fremgangsm}te til deres fremstilling. | |
| NO120231B (OSRAM) | ||
| CZ281377B6 (cs) | Thiadiazinony, způsob jejich výroby a farmaceutické přípravky na jejich bázi | |
| NO120583B (OSRAM) | ||
| US4067873A (en) | Certain 1-amino-3-(1-isoquinolinyl)oxy-2-propanol derivatives | |
| DK141531B (da) | Analogifremgangsmåde til fremstilling af 1-metyl-9,10-dihydro-d-lysergsyreallylamid eller syreadditionssalte deraf. | |
| NO121896B (OSRAM) | ||
| NO149775B (no) | Analogifremgangsmaate for fremstilling av fenyl-pyridylamin-derivater med antidepressiv virkning | |
| NO880922L (no) | Fremgangsmaate for fremstilling av farmakologisk aktive benzodioksolderivater. | |
| NO164352B (no) | Analogifremgangsmaate for fremstilling av farmasoeytisk aktive, antivirale, substituerte isoksazolderivater. | |
| NO177962B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive 1-oxa-2-oxo-8-azaspiro[4,5Ådecan-derivater | |
| NO781712L (no) | Fremgangsmaate for fremstilling av nye derivater av 4-hydroksytiazolidin-2-tion | |
| US3268529A (en) | 3-cyanoalkyl substituted 4-(3h)-quinazolinones | |
| NO133892B (OSRAM) | ||
| NO134767B (OSRAM) |