NO118699B - - Google Patents
Download PDFInfo
- Publication number
- NO118699B NO118699B NO166498A NO16649867A NO118699B NO 118699 B NO118699 B NO 118699B NO 166498 A NO166498 A NO 166498A NO 16649867 A NO16649867 A NO 16649867A NO 118699 B NO118699 B NO 118699B
- Authority
- NO
- Norway
- Prior art keywords
- cross
- polymer
- fiber
- acrylonitrile
- linked
- Prior art date
Links
- 239000000835 fiber Substances 0.000 claims description 70
- 229920000642 polymer Polymers 0.000 claims description 40
- 238000005345 coagulation Methods 0.000 claims description 36
- 230000015271 coagulation Effects 0.000 claims description 36
- 239000002904 solvent Substances 0.000 claims description 28
- 238000004132 cross linking Methods 0.000 claims description 25
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 19
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 16
- 229920001577 copolymer Polymers 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 16
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 13
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 9
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 3
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims 1
- BUACSMWVFUNQET-UHFFFAOYSA-H dialuminum;trisulfate;hydrate Chemical compound O.[Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O BUACSMWVFUNQET-UHFFFAOYSA-H 0.000 claims 1
- 238000003825 pressing Methods 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 57
- 239000003350 kerosene Substances 0.000 description 39
- 238000009987 spinning Methods 0.000 description 37
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- 239000000243 solution Substances 0.000 description 19
- 239000003245 coal Substances 0.000 description 14
- 239000000126 substance Substances 0.000 description 14
- 239000000701 coagulant Substances 0.000 description 13
- 238000009835 boiling Methods 0.000 description 11
- 125000003118 aryl group Chemical group 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 229920006037 cross link polymer Polymers 0.000 description 8
- 238000001035 drying Methods 0.000 description 7
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 6
- 125000001931 aliphatic group Chemical group 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000000178 monomer Substances 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- 239000003431 cross linking reagent Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000002166 wet spinning Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000000981 basic dye Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000001112 coagulating effect Effects 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- 238000000578 dry spinning Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- MHOFGBJTSNWTDT-UHFFFAOYSA-M 2-[n-ethyl-4-[(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]anilino]ethanol;methyl sulfate Chemical compound COS([O-])(=O)=O.C1=CC(N(CCO)CC)=CC=C1N=NC1=[N+](C)C2=CC=C(OC)C=C2S1 MHOFGBJTSNWTDT-UHFFFAOYSA-M 0.000 description 1
- DZLUPKIRNOCKJB-UHFFFAOYSA-N 2-methoxy-n,n-dimethylacetamide Chemical compound COCC(=O)N(C)C DZLUPKIRNOCKJB-UHFFFAOYSA-N 0.000 description 1
- 229920002972 Acrylic fiber Polymers 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- ZPOLOEWJWXZUSP-WAYWQWQTSA-N bis(prop-2-enyl) (z)-but-2-enedioate Chemical compound C=CCOC(=O)\C=C/C(=O)OCC=C ZPOLOEWJWXZUSP-WAYWQWQTSA-N 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- 229930188620 butyrolactone Natural products 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 229920000891 common polymer Polymers 0.000 description 1
- 238000002788 crimping Methods 0.000 description 1
- 229930007927 cymene Natural products 0.000 description 1
- OJLOUXPPKZRTHK-UHFFFAOYSA-N dodecan-1-ol;sodium Chemical compound [Na].CCCCCCCCCCCCO OJLOUXPPKZRTHK-UHFFFAOYSA-N 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 238000007380 fibre production Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- ZBJVLWIYKOAYQH-UHFFFAOYSA-N naphthalen-2-yl 2-hydroxybenzoate Chemical compound OC1=CC=CC=C1C(=O)OC1=CC=C(C=CC=C2)C2=C1 ZBJVLWIYKOAYQH-UHFFFAOYSA-N 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F41—WEAPONS
- F41A—FUNCTIONAL FEATURES OR DETAILS COMMON TO BOTH SMALLARMS AND ORDNANCE, e.g. CANNONS; MOUNTINGS FOR SMALLARMS OR ORDNANCE
- F41A9/00—Feeding or loading of ammunition; Magazines; Guiding means for the extracting of cartridges
- F41A9/01—Feeding of unbelted ammunition
- F41A9/06—Feeding of unbelted ammunition using cyclically moving conveyors, i.e. conveyors having ammunition pusher or carrier elements which are emptied or disengaged from the ammunition during the return stroke
- F41A9/09—Movable ammunition carriers or loading trays, e.g. for feeding from magazines
- F41A9/10—Movable ammunition carriers or loading trays, e.g. for feeding from magazines pivoting or swinging
- F41A9/13—Movable ammunition carriers or loading trays, e.g. for feeding from magazines pivoting or swinging in a vertical plane
- F41A9/16—Movable ammunition carriers or loading trays, e.g. for feeding from magazines pivoting or swinging in a vertical plane which is parallel to the barrel axis
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F41—WEAPONS
- F41A—FUNCTIONAL FEATURES OR DETAILS COMMON TO BOTH SMALLARMS AND ORDNANCE, e.g. CANNONS; MOUNTINGS FOR SMALLARMS OR ORDNANCE
- F41A9/00—Feeding or loading of ammunition; Magazines; Guiding means for the extracting of cartridges
- F41A9/61—Magazines
- F41A9/64—Magazines for unbelted ammunition
- F41A9/76—Magazines having an endless-chain conveyor
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Closing Of Containers (AREA)
- Chain Conveyers (AREA)
- Artificial Filaments (AREA)
- Portable Nailing Machines And Staplers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DER42487A DE1301742B (de) | 1966-01-26 | 1966-01-26 | Magazin fuer in Panzerkuppeln eingebaute Geschuetze |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO118699B true NO118699B (el) | 1970-01-26 |
Family
ID=7406675
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO166498A NO118699B (el) | 1966-01-26 | 1967-01-20 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3501996A (el) |
| BE (1) | BE693050A (el) |
| CH (1) | CH471363A (el) |
| DE (1) | DE1301742B (el) |
| FR (1) | FR1508694A (el) |
| GB (1) | GB1140483A (el) |
| NL (1) | NL6700882A (el) |
| NO (1) | NO118699B (el) |
| SE (1) | SE314927B (el) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH508192A (de) * | 1969-05-08 | 1971-05-31 | Oerlikon Buehrle Ag | Panzerturm mit mindestens einer ausserhalb des Panzerturmes gelagerten, selbsttätigen Feuerwaffe |
| DE1938681C3 (de) * | 1969-07-30 | 1973-09-27 | Rheinmetall Gmbh, 4000 Duesseldorf | Magazin für in Panzertürme, insbesondere von Panzerfahrzeugen eingebaute Geschütze |
| US3683743A (en) * | 1969-08-01 | 1972-08-15 | Stoner Eugen Morrison | Linkless cartridge feed system |
| FR2133034A5 (el) * | 1971-04-06 | 1972-11-24 | Thomson Csf | |
| SE430820B (sv) * | 1979-12-18 | 1983-12-12 | Bofors Ab | Laddbord |
| DE3137850A1 (de) * | 1981-09-23 | 1983-04-07 | Rheinmetall GmbH, 4000 Düsseldorf | Notansetzvorrichtung |
| DE3208169A1 (de) * | 1982-03-06 | 1983-09-22 | Krauss-Maffei AG, 8000 München | Munitionsfoerdervorrichtung |
| FR2553875B1 (fr) * | 1983-10-21 | 1988-04-15 | Creusot Loire | Dispositif d'alimentation et de chargement tout azimut et tout site d'une arme en munitions |
| DE3409018A1 (de) * | 1984-03-13 | 1985-09-26 | Rheinmetall GmbH, 4000 Düsseldorf | Munitionsbehaelter einer automatischen ladeeinrichtung |
| DE3517056A1 (de) * | 1985-05-11 | 1986-11-13 | Rheinmetall GmbH, 4000 Düsseldorf | Vorrichtung zum ummunitionieren von patronierter munition aus einem wannen- in ein turmmagazin |
| AT385594B (de) * | 1985-10-03 | 1988-04-25 | Steyr Daimler Puch Ag | Einrichtung zum versorgen der kanone eines panzerfahrzeuges mit munition |
| US4700609A (en) * | 1985-10-04 | 1987-10-20 | Fmc Corporation | Autoloader for military vehicle |
| US4860633A (en) * | 1985-10-04 | 1989-08-29 | Fmc Corporation | Autoloader for military vehicle |
| US4823676A (en) * | 1985-10-04 | 1989-04-25 | Fmc Corporation | Autoloader for military vehicle |
| CH667718A5 (de) * | 1985-11-26 | 1988-10-31 | Oerlikon Buehrle Ag | Patronenzufuehrvorrichtung an einer automatischen feuerwaffe. |
| CH670698A5 (en) * | 1986-07-16 | 1989-06-30 | Oerlikon Buehrle Ag | Chain type cartridge belt for automatic firearm - has cartridges supported by pairs of rods connected to chain links between hinge pins |
| DE3627042A1 (de) * | 1986-08-09 | 1988-02-11 | Kuka Wehrtechnik Gmbh | Vorrichtung zum laden von geschuetzen, insbesondere panzerhaubitzen |
| DE3701713A1 (de) * | 1987-01-22 | 1988-08-04 | Rheinmetall Gmbh | Magazinanordnung fuer einen panzer |
| DE3719020C1 (en) * | 1987-06-06 | 1988-11-24 | Krupp Mak Maschb Gmbh | Ammunition magazine |
| DE3725666C2 (de) * | 1987-08-03 | 1995-11-16 | Rheinmetall Ind Gmbh | Magazinkette für die Aufnahme von Munition |
| SE467174B (sv) * | 1988-10-12 | 1992-06-01 | Bofors Ab | I stridsvagn ingaaende matningsanordning |
| US4873911A (en) * | 1988-11-21 | 1989-10-17 | General Dynamics Land Systems, Inc. | Double loop ammunition magazine of compact construction |
| DE3921767A1 (de) * | 1989-07-01 | 1991-01-10 | Rheinmetall Gmbh | Treibladungsanzuendermagazin mit schrittweisem antrieb |
| US5151556A (en) * | 1990-12-24 | 1992-09-29 | General Electric Company | Propellant magazine for field artillery piece |
| US5131315A (en) * | 1990-12-24 | 1992-07-21 | General Electric Company | Magazine conveyor for large caliber ammunition |
| US5212338A (en) * | 1991-07-05 | 1993-05-18 | General Electric Co. | Ammunition transfer apparatus for uploading and downloading a magazine |
| CA2070510A1 (en) * | 1991-07-12 | 1993-01-13 | Keith Edward Lawrence | Apparatus for autoloading tank cannons |
| DE4126199C2 (de) * | 1991-08-08 | 1994-06-23 | Rheinmetall Gmbh | Munitionsbehälter |
| DE19644524C2 (de) | 1996-10-26 | 2002-06-13 | Rheinmetall Landsysteme Gmbh | Geschützturm für Panzerfahrzeuge |
| DE19738418C2 (de) * | 1997-09-03 | 2000-11-09 | Rheinmetall Ind Ag | Munitionsmagazin für großkalibrige Munition |
| US6073534A (en) * | 1998-01-14 | 2000-06-13 | General Dynamics Armament Systems, Inc. | Transfer mechanism and method for uploading and downloading propellant charges and projectiles |
| US6065385A (en) * | 1998-01-14 | 2000-05-23 | General Dynamics Armament Systems, Inc. | Bucket carrier for molded solid propellant storage magazine |
| GB0703931D0 (en) * | 2007-03-01 | 2007-04-11 | Parsons Bryan N V | Chain system |
| JP6418862B2 (ja) * | 2014-07-23 | 2018-11-07 | 有限会社マルゼン | エアガン用カートリッジ |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE251176C (el) * | ||||
| FR361753A (fr) * | 1905-09-06 | 1906-10-30 | Etienne Charles Louis Marzari | Perfectionnements apportés aux norias servant au hissage des munitions des canons et autres objets quelconques |
| US2437425A (en) * | 1945-12-19 | 1948-03-09 | United Shoe Machinery Corp | Ammunition container |
| US2464920A (en) * | 1947-01-27 | 1949-03-22 | United Shoe Machinery Corp | Rocket launcher |
| US3101647A (en) * | 1952-04-04 | 1963-08-27 | United Shoe Machinery Corp | Ammunition handling apparatus |
| US3075434A (en) * | 1952-08-27 | 1963-01-29 | Jean W Hickman | Ammunition transfer mechanism |
| BE553455A (el) * | 1956-01-01 | |||
| US3169445A (en) * | 1957-06-03 | 1965-02-16 | Arthur J Stanton | Magazine mechanism |
| US3170372A (en) * | 1957-06-03 | 1965-02-23 | Arthur J Stauton | Loader and magazine mechanism |
-
1966
- 1966-01-26 DE DER42487A patent/DE1301742B/de active Pending
-
1967
- 1967-01-18 GB GB2742/67A patent/GB1140483A/en not_active Expired
- 1967-01-19 NL NL6700882A patent/NL6700882A/xx unknown
- 1967-01-19 SE SE825/67A patent/SE314927B/xx unknown
- 1967-01-19 US US610429A patent/US3501996A/en not_active Expired - Lifetime
- 1967-01-20 CH CH79867A patent/CH471363A/de not_active IP Right Cessation
- 1967-01-20 FR FR91891A patent/FR1508694A/fr not_active Expired
- 1967-01-20 NO NO166498A patent/NO118699B/no unknown
- 1967-01-23 BE BE693050D patent/BE693050A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6700882A (el) | 1967-07-27 |
| DE1301742B (de) | 1969-08-21 |
| CH471363A (de) | 1969-04-15 |
| US3501996A (en) | 1970-03-24 |
| BE693050A (el) | 1967-07-03 |
| FR1508694A (fr) | 1968-01-05 |
| GB1140483A (en) | 1969-01-22 |
| SE314927B (el) | 1969-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO118699B (el) | ||
| US3983095A (en) | Absorbent fibers and process for their preparation | |
| IE42531B1 (en) | Bifilar acrylic fibres | |
| CN105002592B (zh) | 一种醋腈纤维及其制备方法 | |
| CN100393935C (zh) | 高吸水纤维及其制造方法 | |
| US4536363A (en) | Process for production of set polyacrylonitrile filaments and fibers | |
| CN101070634A (zh) | 亲水性共聚丙烯腈纤维的制备方法 | |
| US2692875A (en) | Methacrylonitrile-acrylonitrile copolymers and fibers thereof | |
| US4913870A (en) | Process for preparing polyacrylonitrile filaments having high tensile strength and modulus | |
| CN103614800B (zh) | 一种二元聚丙烯腈基碳纤维原丝的制备方法 | |
| CN105525388B (zh) | 采用硫氰酸钠干湿法纺丝工艺制备碳纤维原丝的方法 | |
| US4100143A (en) | Filaments which may be cross-linked comprising at least 65% acrylonitrile and 0.5-10% N-methylol derivative of a urethane | |
| US4124673A (en) | Process for the production of bifilar acrylic fibres | |
| US3936513A (en) | Gloss-stabilised fibres and films of acrylonitrile copolymers | |
| US2970977A (en) | Method of preparing an acrylonitrile polymer inter-linked by a metal alcoholate, composition thereof, and filament therefrom | |
| NO147675B (no) | Fremgangsmaate for fremstilling av formede cellulosegjenstander som fibre, filamenter, membraner, filmer og folier | |
| US4226824A (en) | Process for spinning modacrylic fiber having high retraction and reduced inflammability | |
| US2571777A (en) | Acrylonitrile polymer mixed with copolymer of vinyl acetate and isopropenyl acetate | |
| US3287304A (en) | Acrylonitrile copolymers and compositions | |
| US3505445A (en) | Solvent removal process for wet spun fibers | |
| US4017561A (en) | Wet spun modacrylic filaments with improved coloristic properties | |
| CA1053835A (en) | Modacrylic filaments with improved coloristic properties | |
| US3984495A (en) | Shaped products such as fibers and films composed mainly of polyvinyl chloride and polyvinyl alcohol, and further containing an amido-containing polymer, and methods for production thereof | |
| US2726220A (en) | Shaped articles of acrylonitrile polymers | |
| US2776945A (en) | Spinning solvent for acrylic fibers |