NO116983B - - Google Patents
Download PDFInfo
- Publication number
- NO116983B NO116983B NO164776A NO16477666A NO116983B NO 116983 B NO116983 B NO 116983B NO 164776 A NO164776 A NO 164776A NO 16477666 A NO16477666 A NO 16477666A NO 116983 B NO116983 B NO 116983B
- Authority
- NO
- Norway
- Prior art keywords
- compound
- uracilyl
- disulphide
- mercaptouracil
- diazouracil
- Prior art date
Links
- MIHCRNZMESVPJI-UHFFFAOYSA-N 5-sulfanyl-1h-pyrimidine-2,4-dione Chemical compound SC1=CNC(=O)NC1=O MIHCRNZMESVPJI-UHFFFAOYSA-N 0.000 claims description 28
- QJVBBTQJGKITKK-UHFFFAOYSA-N 5-[(2,4-dioxo-1h-pyrimidin-5-yl)disulfanyl]-1h-pyrimidine-2,4-dione Chemical compound O=C1NC(=O)NC=C1SSC1=CNC(=O)NC1=O QJVBBTQJGKITKK-UHFFFAOYSA-N 0.000 claims description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 24
- 150000001875 compounds Chemical class 0.000 claims description 21
- -1 5-diazouracil compound Chemical class 0.000 claims description 20
- 229910052717 sulfur Inorganic materials 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 17
- 239000000126 substance Substances 0.000 claims description 16
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 14
- 125000004434 sulfur atom Chemical group 0.000 claims description 13
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical group O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 239000000047 product Substances 0.000 claims description 12
- BISHACNKZIBDFM-UHFFFAOYSA-N 5-amino-1h-pyrimidine-2,4-dione Chemical compound NC1=CNC(=O)NC1=O BISHACNKZIBDFM-UHFFFAOYSA-N 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 8
- 239000000706 filtrate Substances 0.000 claims description 8
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 7
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 claims description 7
- 239000003513 alkali Substances 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 239000012954 diazonium Substances 0.000 claims description 6
- 150000001989 diazonium salts Chemical class 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 238000001816 cooling Methods 0.000 claims description 4
- 238000006193 diazotization reaction Methods 0.000 claims description 4
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical compound CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- 239000005864 Sulphur Substances 0.000 claims description 2
- 239000003929 acidic solution Substances 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- SKOLWUPSYHWYAM-UHFFFAOYSA-N carbonodithioic O,S-acid Chemical compound SC(S)=O SKOLWUPSYHWYAM-UHFFFAOYSA-N 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 150000002894 organic compounds Chemical class 0.000 claims 1
- 238000010992 reflux Methods 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 43
- 239000000243 solution Substances 0.000 description 42
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- 239000000203 mixture Substances 0.000 description 27
- 239000002244 precipitate Substances 0.000 description 23
- 238000001914 filtration Methods 0.000 description 13
- 239000007788 liquid Substances 0.000 description 13
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- VEOLNAAQJHGJPM-UHFFFAOYSA-N 5-diazouracil Chemical compound [N-]=[N+]=C1C=NC(=O)NC1=O VEOLNAAQJHGJPM-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- 235000010288 sodium nitrite Nutrition 0.000 description 6
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- RWQNBRDOKXIBIV-UHFFFAOYSA-N thymine Chemical compound CC1=CNC(=O)NC1=O RWQNBRDOKXIBIV-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 238000010521 absorption reaction Methods 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- XEYBHCRIKKKOSS-UHFFFAOYSA-N disodium;azanylidyneoxidanium;iron(2+);pentacyanide Chemical compound [Na+].[Na+].[Fe+2].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].[O+]#N XEYBHCRIKKKOSS-UHFFFAOYSA-N 0.000 description 5
- 229940083618 sodium nitroprusside Drugs 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- 102000053602 DNA Human genes 0.000 description 4
- 108020004414 DNA Proteins 0.000 description 4
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000012670 alkaline solution Substances 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000008103 glucose Substances 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- 230000002906 microbiologic effect Effects 0.000 description 4
- JCBJVAJGLKENNC-UHFFFAOYSA-M potassium ethyl xanthate Chemical compound [K+].CCOC([S-])=S JCBJVAJGLKENNC-UHFFFAOYSA-M 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229910052979 sodium sulfide Inorganic materials 0.000 description 3
- 239000011550 stock solution Substances 0.000 description 3
- 229940113082 thymine Drugs 0.000 description 3
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- NPSNBDHMMLFJNG-UHFFFAOYSA-N [N+](=[N-])=C1C(C(=O)O)=NC(NC1=O)=O Chemical compound [N+](=[N-])=C1C(C(=O)O)=NC(NC1=O)=O NPSNBDHMMLFJNG-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 150000002019 disulfides Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- SRRKNRDXURUMPP-UHFFFAOYSA-N sodium disulfide Chemical compound [Na+].[Na+].[S-][S-] SRRKNRDXURUMPP-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- 229940035893 uracil Drugs 0.000 description 2
- 239000012991 xanthate Substances 0.000 description 2
- HWCXJKLFOSBVLH-UHFFFAOYSA-N 5-amino-2,4-dioxo-1h-pyrimidine-6-carboxylic acid Chemical compound NC1=C(C(O)=O)NC(=O)NC1=O HWCXJKLFOSBVLH-UHFFFAOYSA-N 0.000 description 1
- FNSSATCDUXTALE-UHFFFAOYSA-N 5-amino-6-methyl-1h-pyrimidine-2,4-dione Chemical compound CC=1NC(=O)NC(=O)C=1N FNSSATCDUXTALE-UHFFFAOYSA-N 0.000 description 1
- YZEPYLCKFQBKHM-UHFFFAOYSA-N 6-methyl-5-sulfanyl-1h-pyrimidine-2,4-dione Chemical compound CC=1NC(=O)NC(=O)C=1S YZEPYLCKFQBKHM-UHFFFAOYSA-N 0.000 description 1
- VVIAGPKUTFNRDU-UHFFFAOYSA-N 6S-folinic acid Natural products C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- BOJKULTULYSRAS-OTESTREVSA-N Andrographolide Chemical compound C([C@H]1[C@]2(C)CC[C@@H](O)[C@]([C@H]2CCC1=C)(CO)C)\C=C1/[C@H](O)COC1=O BOJKULTULYSRAS-OTESTREVSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 230000006820 DNA synthesis Effects 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- MPJKWIXIYCLVCU-UHFFFAOYSA-N Folinic acid Natural products NC1=NC2=C(N(C=O)C(CNc3ccc(cc3)C(=O)NC(CCC(=O)O)CC(=O)O)CN2)C(=O)N1 MPJKWIXIYCLVCU-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001134654 Lactobacillus leichmannii Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 150000008064 anhydrides Chemical group 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 239000012496 blank sample Substances 0.000 description 1
- 125000000837 carbohydrate group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000012738 dissolution medium Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000011672 folinic acid Substances 0.000 description 1
- VVIAGPKUTFNRDU-ABLWVSNPSA-N folinic acid Chemical compound C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-ABLWVSNPSA-N 0.000 description 1
- 235000008191 folinic acid Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229960001691 leucovorin Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- YQCIWBXEVYWRCW-UHFFFAOYSA-N methane;sulfane Chemical compound C.S YQCIWBXEVYWRCW-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 230000019086 sulfide ion homeostasis Effects 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- JTNXQVCPQMQLHK-UHFFFAOYSA-N thioacetone Chemical compound CC(C)=S JTNXQVCPQMQLHK-UHFFFAOYSA-N 0.000 description 1
- 125000005323 thioketone group Chemical group 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F24—HEATING; RANGES; VENTILATING
- F24C—DOMESTIC STOVES OR RANGES ; DETAILS OF DOMESTIC STOVES OR RANGES, OF GENERAL APPLICATION
- F24C7/00—Stoves or ranges heated by electric energy
- F24C7/002—Stoves
- F24C7/004—Stoves simulating flames
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F21—LIGHTING
- F21S—NON-PORTABLE LIGHTING DEVICES; SYSTEMS THEREOF; VEHICLE LIGHTING DEVICES SPECIALLY ADAPTED FOR VEHICLE EXTERIORS
- F21S10/00—Lighting devices or systems producing a varying lighting effect
- F21S10/04—Lighting devices or systems producing a varying lighting effect simulating flames
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F21—LIGHTING
- F21W—INDEXING SCHEME ASSOCIATED WITH SUBCLASSES F21K, F21L, F21S and F21V, RELATING TO USES OR APPLICATIONS OF LIGHTING DEVICES OR SYSTEMS
- F21W2131/00—Use or application of lighting devices or systems not provided for in codes F21W2102/00-F21W2121/00
- F21W2131/40—Lighting for industrial, commercial, recreational or military use
- F21W2131/406—Lighting for industrial, commercial, recreational or military use for theatres, stages or film studios
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- Non-Portable Lighting Devices Or Systems Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Illuminated Signs And Luminous Advertising (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB40198/65A GB1113209A (en) | 1965-09-21 | 1965-09-21 | Improvements in or relating to simulated fires |
| GB413666 | 1966-01-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO116983B true NO116983B (xx) | 1969-06-16 |
Family
ID=26238905
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO164776A NO116983B (xx) | 1965-09-21 | 1966-09-19 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3699697A (xx) |
| BE (1) | BE687129A (xx) |
| CH (1) | CH455683A (xx) |
| DD (1) | DD57334A5 (xx) |
| DK (1) | DK114012B (xx) |
| ES (1) | ES331410A1 (xx) |
| GB (1) | GB1113209A (xx) |
| NL (1) | NL147529B (xx) |
| NO (1) | NO116983B (xx) |
| SE (1) | SE334337B (xx) |
Families Citing this family (57)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2234928A1 (de) * | 1971-07-29 | 1973-02-08 | Augusto Gentilini | Vorrichtung zur beleuchtung mit glitzereffekten fuer reklame- und/oder dekorationszwecke |
| US4026544A (en) * | 1976-05-05 | 1977-05-31 | Plambeck H Robert | Burning logs simulator |
| US4890600A (en) * | 1988-10-26 | 1990-01-02 | Genesis Technology | Fireplace burning simulator unit |
| GB9211611D0 (en) * | 1992-06-02 | 1992-07-15 | Electricity Ass Tech | Flame effect simulator |
| US5642580A (en) * | 1996-05-17 | 1997-07-01 | Dimplex North America Limited | Flame simulating assembley |
| US6393207B1 (en) | 1999-01-14 | 2002-05-21 | Cfm Majestic Inc. | Electric fireplace with light randomizer, filter and diffuser screen |
| GB2357829B (en) * | 1999-11-24 | 2004-06-02 | Geoffrey Alan Ward | A lighting device |
| US20060116674A1 (en) * | 2000-02-22 | 2006-06-01 | Rhytec Limited | Method of regenerating the recticular architecture of the dermis |
| US7194830B2 (en) * | 2000-08-29 | 2007-03-27 | Dimplex North America Limited | Flame simulating assembly |
| US6564485B1 (en) | 2000-08-29 | 2003-05-20 | Dimplex North America Limited | Fire simulating assembly |
| US6615519B2 (en) | 2000-08-29 | 2003-09-09 | Dimplex North America Limited | Flame simulating assembly |
| NL1016991C2 (nl) * | 2000-12-27 | 2002-06-28 | Kal Fire B V | Vlam- en vuursimulatie-inrichting. |
| GB2372806B (en) * | 2001-01-03 | 2005-07-20 | Robert John Stockwell | Electric fire flame effect |
| US6880275B2 (en) * | 2001-05-16 | 2005-04-19 | Hon Technology Inc. | Lenticular fireplace |
| CA2357182C (en) | 2001-09-12 | 2009-01-06 | Dimplex North America Limited | Flame simulating assembly |
| GB0123906D0 (en) | 2001-10-05 | 2001-11-28 | Cfm Kinder Ltd | Fire assembly |
| US6944982B2 (en) * | 2002-09-27 | 2005-09-20 | Napoloen Systems And Developments Inc. | Flame simulating apparatus |
| US20050066960A1 (en) * | 2003-09-30 | 2005-03-31 | Harp Debra L. | Firelight reflective system and method |
| US7673408B2 (en) * | 2004-01-20 | 2010-03-09 | Dimplex North America Limited | Flame simulating assembly |
| US7770312B2 (en) * | 2004-01-20 | 2010-08-10 | Dimplex North America Limited | Flame stimulating assembly |
| GB0422168D0 (en) * | 2004-10-06 | 2004-11-03 | Flamerite Fires Ltd | Simulated flame effect |
| US20060099565A1 (en) * | 2004-11-05 | 2006-05-11 | Elite Group, Inc. | Artificial fireplace |
| US7210256B2 (en) * | 2004-11-05 | 2007-05-01 | Elite Group, Inc. | Artificial fireplace |
| US20060101681A1 (en) | 2004-11-17 | 2006-05-18 | Dimplex North America Limited | Flame simulating assembly |
| US20060242870A1 (en) * | 2005-02-08 | 2006-11-02 | Travis Industries, Inc. | Flame assembly for fireplace |
| US20060185664A1 (en) * | 2005-02-22 | 2006-08-24 | Butler Gary L | Burner system incorporating flame and light |
| US7236693B2 (en) | 2005-03-22 | 2007-06-26 | Globaltec Fireplaces, Inc. | Flame simulator for use in an electric heater |
| NL2000180C2 (nl) * | 2005-08-13 | 2009-09-02 | Vicaroth N V | Gesimuleerd gloeibed met gesimuleerd vuur. |
| US7219456B1 (en) * | 2005-11-17 | 2007-05-22 | Winners Products Engineering, Ltd. | Fireplace simulator |
| CN2888579Y (zh) * | 2006-02-09 | 2007-04-11 | 周军 | 电壁炉仿真模拟火焰装置 |
| US20070224561A1 (en) * | 2006-03-08 | 2007-09-27 | Dimplex North America Limited | Flame simulating assembly |
| US7826727B2 (en) * | 2006-05-05 | 2010-11-02 | Twin-Star International, Inc. | Electric fireplace |
| US20080138050A1 (en) * | 2006-12-11 | 2008-06-12 | Hni Technologies Inc. | Topdown simulated flame |
| US7373743B1 (en) | 2007-03-14 | 2008-05-20 | Dimplex North America Limited | Flame simulating assembly |
| CN100561053C (zh) * | 2007-05-31 | 2009-11-18 | 朱宏锋 | 一种立体火焰仿真电壁炉 |
| US20090074390A1 (en) * | 2007-09-14 | 2009-03-19 | Patrick Virgilius Power | Flame effect apparatus |
| GB0718854D0 (en) * | 2007-09-27 | 2007-11-07 | Be Modern Ltd | Apparatus and method for generating a flame effect |
| US20090126241A1 (en) * | 2007-11-20 | 2009-05-21 | Twin-Star International, Inc. | Electric fireplace insert and methods of use |
| US20090205633A1 (en) * | 2008-02-19 | 2009-08-20 | Hussong Manufacturing Company, Inc. | Simulated fire glow lights for fireplace |
| US20090250050A1 (en) * | 2008-04-02 | 2009-10-08 | Mark Siren | Firelog tray |
| GB2462628A (en) * | 2008-08-13 | 2010-02-17 | Paul C Baird | Flame simulating assembly giving increased depth to the flames |
| USD616977S1 (en) | 2008-12-03 | 2010-06-01 | Twin-Star International Inc. | Fireplace insert |
| CN201363666Y (zh) * | 2009-01-23 | 2009-12-16 | 福建亚伦电子电器科技有限公司 | 一种仿真壁炉的反光组件 |
| US20100209860A1 (en) * | 2009-02-18 | 2010-08-19 | Hongfeng Zhu | 3D Flexible Simulated Carbon Bed and Electric Fireplace with 3D Flexible Simulated Carbon Bed |
| USD668748S1 (en) | 2009-07-07 | 2012-10-09 | Twin-Star International, Inc. | Electric fireplace |
| US8234803B2 (en) | 2010-06-08 | 2012-08-07 | Heat Surge, Llc | Reflective device for an electric fireplace and an electric fireplace incorporating the same |
| US8739439B2 (en) | 2010-12-20 | 2014-06-03 | Twin-Star International, Inc. | Multi-color simulated flame system for electric fireplaces |
| USRE49852E1 (en) | 2015-03-06 | 2024-02-27 | Glen Dimplex Americas Limited | Flame simulating assembly with flicker element including paddle elements |
| CA2903514C (en) | 2015-03-06 | 2023-02-14 | Dimplex North America Limited | Flame simulating assembly with flicker element including paddle elements |
| PL3220057T3 (pl) | 2016-03-16 | 2019-12-31 | Glen Dimplex Americas Limited | Zespół symulujący płomienie |
| US10495275B2 (en) | 2017-04-18 | 2019-12-03 | Glen Dimplex Americas Limited | Flame simulating assembly |
| USD837362S1 (en) | 2017-04-19 | 2019-01-01 | Glen Dimplex Americas Limited | Forked paddle element for an electric fireplace |
| US11067238B2 (en) | 2017-06-20 | 2021-07-20 | Living Style (B.V.I.) Limited | Flame simulating assembly for simulated fireplaces including a reflecting light system |
| CN109340869A (zh) * | 2018-11-23 | 2019-02-15 | 东莞崧崴电子科技有限公司 | 一种具有仿真砖块的电壁炉 |
| GB2602618B (en) * | 2020-11-09 | 2023-02-01 | C K Fires Ltd | Apparatus for simulating combustion |
| GB2619530A (en) * | 2022-06-08 | 2023-12-13 | Christopher Baird Paul | A flame effect device |
| CN217785004U (zh) * | 2022-07-25 | 2022-11-11 | 宁波丽辰电器有限公司 | 一种火焰仿真投影装置 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB314649A (en) * | 1928-05-26 | 1929-07-04 | Frank John Wineberg | Improvements in electric or imitation fires or radiators |
| GB392694A (en) * | 1932-03-01 | 1933-05-25 | Frederick Alexander Ross | Devices for producing imitation flame effects |
| GB405528A (en) * | 1932-10-06 | 1934-02-08 | Premier Electric Heaters Ltd | Improvements in imitation solid fuel fires |
| GB450941A (en) * | 1935-01-24 | 1936-07-24 | Gen Electric Co Ltd | Improvements in imitation fires |
| US2684244A (en) * | 1952-06-14 | 1954-07-20 | Lorimer P Brooks | Fireplace flame simulating device |
| US2984032A (en) * | 1958-09-15 | 1961-05-16 | Cornell Frederick Stuart | Artificial fireplace apparatus |
| US3526984A (en) * | 1968-03-22 | 1970-09-08 | Drum Fire Inc | Lighted fireplace and fire noise simulator |
-
1965
- 1965-09-21 GB GB40198/65A patent/GB1113209A/en not_active Expired
-
1966
- 1966-09-19 DK DK484766AA patent/DK114012B/da not_active Application Discontinuation
- 1966-09-19 NO NO164776A patent/NO116983B/no unknown
- 1966-09-19 CH CH1345466A patent/CH455683A/de unknown
- 1966-09-20 BE BE687129D patent/BE687129A/xx unknown
- 1966-09-20 ES ES0331410A patent/ES331410A1/es not_active Expired
- 1966-09-21 DD DD12001366A patent/DD57334A5/xx unknown
- 1966-09-21 SE SE12684/66A patent/SE334337B/xx unknown
- 1966-09-21 NL NL666613301A patent/NL147529B/xx unknown
-
1970
- 1970-01-19 US US3819A patent/US3699697A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1497278A1 (de) | 1969-05-08 |
| ES331410A1 (es) | 1967-07-01 |
| BE687129A (xx) | 1967-03-01 |
| DK114012B (da) | 1969-05-19 |
| DE1497278B2 (de) | 1972-08-24 |
| DD57334A5 (xx) | 1967-08-20 |
| GB1113209A (en) | 1968-05-08 |
| NL6613301A (xx) | 1967-03-22 |
| NL147529B (nl) | 1975-10-15 |
| CH455683A (de) | 1968-07-15 |
| SE334337B (xx) | 1971-04-26 |
| US3699697A (en) | 1972-10-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO116983B (xx) | ||
| Bogert et al. | 4-AMINO-0-PHTHALIC ACID AND SOME OF ITS DERIVATIVES. | |
| Challenger et al. | 84. Studies on biological methylation. Part X. The fission of the mono-and di-sulphide links by moulds | |
| NO136947B (no) | Bredb}ndsrundstr}leantenne. | |
| Sykes et al. | 113. Aneurin. Part X. The mechanism of thiochrome formation from aneurin and aneurin disulphide | |
| CA2014068A1 (en) | Process for the preparation of cefodizime sodium | |
| Evans et al. | 74. A rearrangement of carbamyl-sulphones and-sulphides | |
| EP0272365B1 (en) | Method of producing l-cystine | |
| Field et al. | Biologically oriented organic sulfur chemistry. VI. Uses of o-carboxyphenyl o-carboxybenzenethiosulfonate with thiols | |
| Crowther et al. | 274. Synthetic antimalarials. Part XXXIX. Dialkylaminoalkylaminoquinoxalines | |
| JPS61260071A (ja) | ベンゾチアゾ−ルスルフエンアミド類の製造法 | |
| US2766255A (en) | alpha-methyltryptophane and salts thereof | |
| Perkin | XXI.—Myricetin. Part II | |
| LaForge et al. | ROTENONE. III. DEHYDROROTENONE1 | |
| NO130727B (xx) | ||
| US3132144A (en) | Z-amevo-g-iodopurine | |
| NO133892B (xx) | ||
| Baker et al. | Synthesis of derivatives of thiazolo [4, 5-d] pyrimidine. Part I | |
| Hale et al. | THE FORMATION OF METATHIAZINES FROM THIOUREA. 2 | |
| Carrington | 132. Thiohydantoins. Part II. Conversion of 5: 5-disubstituted 2: 4-dithiohydantoins into the corresponding monothiohydantoins | |
| Smiles et al. | XV.—The interaction of aromatic disulphides and sulphuric acid | |
| Bergmann et al. | 695. 2-Phenylpurines, their chemical and enzymological reactivity | |
| CA1259320A (en) | Process for preparing 5-mercapto-1,2,3-thiadiazole salts | |
| Elvidge et al. | S 30. Gliotoxin. Part I. Synthesis of 2-thio-3-methylindolo-1′: 2′–1: 5-hydantoin and its identification as a degradation product of gliotoxin | |
| Scott et al. | CCXLV.—The condensation of aromatic o-aminosulphonic acids with iso cyanic acid |