NL8420138A - Bloempot. - Google Patents
Bloempot. Download PDFInfo
- Publication number
- NL8420138A NL8420138A NL8420138A NL8420138A NL8420138A NL 8420138 A NL8420138 A NL 8420138A NL 8420138 A NL8420138 A NL 8420138A NL 8420138 A NL8420138 A NL 8420138A NL 8420138 A NL8420138 A NL 8420138A
- Authority
- NL
- Netherlands
- Prior art keywords
- pot
- channel
- channels
- flower
- access
- Prior art date
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 239000002689 soil Substances 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 5
- 238000009434 installation Methods 0.000 claims 2
- 238000000034 method Methods 0.000 description 11
- 238000009423 ventilation Methods 0.000 description 11
- 241000196324 Embryophyta Species 0.000 description 6
- 125000006850 spacer group Chemical group 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 2
- HIZCTWCPHWUPFU-UHFFFAOYSA-N Glycerol tribenzoate Chemical compound C=1C=CC=CC=1C(=O)OCC(OC(=O)C=1C=CC=CC=1)COC(=O)C1=CC=CC=C1 HIZCTWCPHWUPFU-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01G—HORTICULTURE; CULTIVATION OF VEGETABLES, FLOWERS, RICE, FRUIT, VINES, HOPS OR SEAWEED; FORESTRY; WATERING
- A01G27/00—Self-acting watering devices, e.g. for flower-pots
Landscapes
- Engineering & Computer Science (AREA)
- Water Supply & Treatment (AREA)
- Life Sciences & Earth Sciences (AREA)
- Environmental Sciences (AREA)
- Cultivation Receptacles Or Flower-Pots, Or Pots For Seedlings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK8400043 | 1984-05-23 | ||
| PCT/DK1984/000043 WO1985005247A1 (en) | 1984-05-23 | 1984-05-23 | Flowerpot |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL8420138A true NL8420138A (nl) | 1986-04-01 |
Family
ID=8153214
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8420138A NL8420138A (nl) | 1984-05-23 | 1984-05-23 | Bloempot. |
Country Status (10)
| Country | Link |
|---|---|
| EP (1) | EP0181328B1 (enFirst) |
| CH (1) | CH665748A5 (enFirst) |
| DE (3) | DE3448290C2 (enFirst) |
| ES (1) | ES295680Y (enFirst) |
| FI (1) | FI81481C (enFirst) |
| GB (1) | GB2161358B (enFirst) |
| NL (1) | NL8420138A (enFirst) |
| NO (1) | NO161592C (enFirst) |
| SE (1) | SE500240C2 (enFirst) |
| WO (1) | WO1985005247A1 (enFirst) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3490714C3 (de) * | 1984-05-23 | 1995-01-26 | Os Plastic As | Blumentopf |
| DE4000950A1 (de) * | 1989-01-16 | 1990-07-19 | Heinrich Ostkotte Gmbh | Blumentopf aus kunststoff |
| US5419080A (en) * | 1991-02-01 | 1995-05-30 | Gardener's Supply | Multi-celled tray for growing plants |
| DE9105154U1 (de) * | 1991-04-26 | 1991-08-01 | Hartmann Verpackung GmbH, 6236 Eschborn | Pflanztopf |
| ES2042406B1 (es) * | 1992-03-26 | 1994-08-01 | Poliexmur S A | Contenedor hidroponico perfeccionado. |
| DE19801141A1 (de) | 1998-01-14 | 1999-07-15 | Erich Lehmann | Vorrichtung, insbesondere zum Anzüchten von Pflanzen |
| EP3047723A1 (en) * | 2015-01-26 | 2016-07-27 | Plantlogic LLC | Stackable pots for plants |
| US10076085B2 (en) | 2015-01-26 | 2018-09-18 | Plantlogic LLC | Stackable pots for plants |
| US10687479B2 (en) * | 2016-01-27 | 2020-06-23 | Plantlogic, LLC | Drainage collection pots for plants |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7220959U (de) * | 1972-09-14 | Gebr Poeppelmann Korkenfabrik | Pflanztopf aus Kunststoff | |
| GB191200300A (en) * | 1912-01-04 | 1913-01-06 | William Oram Trivett | Improvements in or relating to Flower Pots and the like. |
| GB101027A (enFirst) * | 1915-07-24 | Societe Anonyme Des Automobiles & Cycles Peugeot | ||
| US1775731A (en) * | 1922-11-20 | 1930-09-16 | Fairchild Aerial Camera Corp | Warning signal |
| NL69576C (enFirst) * | 1946-10-31 | 1949-07-15 | ||
| CH277547A (de) * | 1949-11-23 | 1951-09-15 | Mohler Heinrich | Pflanzengefäss. |
| DE1712687U (de) * | 1955-08-04 | 1955-12-08 | Plachy & Materne O H G | Blumentopf, pflanzentopf, od. dgl. mit passendem untersatz. |
| DE1836786U (de) * | 1959-12-17 | 1961-08-31 | Herbert Ender | Zuchtgefaess fuer den gartenbaubetrieb. |
| US3271900A (en) * | 1963-03-12 | 1966-09-13 | Mori Sakae | Automatic pure cultivator |
| FR1423596A (fr) * | 1965-01-15 | 1966-01-03 | Pot de culture | |
| DE1582683B1 (de) * | 1966-12-02 | 1970-09-03 | Erich Blattert | Pflanzbehaelter,wie Blumentopf,Anzuchttopf od.dgl. |
| DE1932110A1 (de) * | 1969-06-25 | 1971-01-07 | Herbert Ullrich | Blumentoepfe u.dgl. mit Feuchtigkeitsregulierung und Luftzufuhr |
| US3800469A (en) * | 1972-07-17 | 1974-04-02 | Plastics T Inc | Flower pot |
| DE2441372C3 (de) * | 1974-08-29 | 1978-03-30 | Bayer Ag, 5090 Leverkusen | Vorrichtung zum Einstecken von Düngemittelbehältern in Hydrokultur-Behälter |
| US4173097A (en) * | 1977-09-14 | 1979-11-06 | Staby George L | Container with raised indentations for aeration and drainage |
| GB1586781A (en) * | 1977-12-22 | 1981-03-25 | Howe G | Containers for plants or bulbs |
| US4171593A (en) * | 1978-02-10 | 1979-10-23 | Canaird Sales Ltd. | Pot including water level indicator |
| GB2018115B (en) * | 1978-04-05 | 1982-02-24 | Corrie Frank | Plant holder |
| DE3119778A1 (de) * | 1981-05-19 | 1982-12-09 | Bellaplast Gmbh, 6200 Wiesbaden | Duennwandiges pflanzgefaess |
-
1984
- 1984-05-23 DE DE3448290A patent/DE3448290C2/de not_active Expired - Fee Related
- 1984-05-23 DE DE19843490714 patent/DE3490714T/de active Pending
- 1984-05-23 EP EP84901985A patent/EP0181328B1/en not_active Expired - Lifetime
- 1984-05-23 WO PCT/DK1984/000043 patent/WO1985005247A1/en not_active Ceased
- 1984-05-23 NL NL8420138A patent/NL8420138A/nl active Search and Examination
- 1984-05-23 CH CH344/86A patent/CH665748A5/de not_active IP Right Cessation
-
1985
- 1985-03-22 DE DE8508654U patent/DE8508654U1/de not_active Expired
- 1985-05-10 GB GB08511937A patent/GB2161358B/en not_active Expired
- 1985-05-23 ES ES1985295680U patent/ES295680Y/es not_active Expired
- 1985-12-27 NO NO85855325A patent/NO161592C/no not_active IP Right Cessation
-
1986
- 1986-01-21 FI FI860286A patent/FI81481C/fi not_active IP Right Cessation
- 1986-01-23 SE SE8600294A patent/SE500240C2/sv unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE8600294D0 (sv) | 1986-01-23 |
| FI860286A0 (fi) | 1986-01-21 |
| NO161592C (no) | 1989-09-06 |
| FI81481B (fi) | 1990-07-31 |
| CH665748A5 (de) | 1988-06-15 |
| DE3490714T (de) | 1986-07-17 |
| ES295680Y (es) | 1989-02-01 |
| EP0181328A1 (en) | 1986-05-21 |
| ES295680U (es) | 1988-06-16 |
| DE8508654U1 (de) | 1985-07-18 |
| DE3448290C2 (enFirst) | 1992-11-19 |
| FI860286L (fi) | 1986-01-21 |
| GB2161358A (en) | 1986-01-15 |
| EP0181328B1 (en) | 1993-03-17 |
| GB8511937D0 (en) | 1985-06-19 |
| GB2161358B (en) | 1987-11-25 |
| NO161592B (no) | 1989-05-29 |
| SE8600294L (sv) | 1986-01-23 |
| SE500240C2 (sv) | 1994-05-24 |
| FI81481C (fi) | 1990-11-12 |
| NO855325L (no) | 1985-12-27 |
| WO1985005247A1 (en) | 1985-12-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US8191310B2 (en) | Stackable plant pot | |
| US6955008B2 (en) | Aerating base plate for a flowerpot | |
| NL8420138A (nl) | Bloempot. | |
| EP0693869B1 (en) | Flowerpot, especially for forcing plants while using automatic watering | |
| US7730667B2 (en) | Stackable plant pot | |
| US10292339B2 (en) | Terrarium | |
| US5010687A (en) | Flowerpot | |
| US2055844A (en) | Self watering flower vessel | |
| AU2017292897B2 (en) | An improved plant pot | |
| GB2313283A (en) | Plant cultivation device | |
| DK2818038T3 (en) | PLANT POT | |
| JPH0920366A (ja) | 植物輸送用コンテナ | |
| GB2133264A (en) | Self-watering plant pots | |
| KR200368043Y1 (ko) | 하부 급수식 화분받침용 연결상자 | |
| KR20110005110U (ko) | 화분용 수조 | |
| KR20120008782U (ko) | 소형 분화 유통트레이 | |
| US10667476B2 (en) | Sustained release irrigation apparatus with pivoting cap | |
| AU701706B2 (en) | Upside down hanging plant pot | |
| CA1264553A (en) | Flower pot | |
| DK159947B3 (da) | Urtepotte, isaer til drivning af planter under anvendelse af automatisk vanding | |
| KR200496880Y1 (ko) | 내부가 분할되는 화분 | |
| KR200440736Y1 (ko) | 분리형 화분 | |
| KR20140084386A (ko) | 통기성이 향상된 화분 | |
| NL1024651C2 (nl) | Werkwijze en pot voor het kweken van een epifyt. | |
| NL1027797C2 (nl) | Plantpot. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BA | A request for search or an international-type search has been filed | ||
| BB | A search report has been drawn up | ||
| BC | A request for examination has been filed | ||
| BN | A decision not to publish the application has become irrevocable |