NL8103169A - Enzymen-bevattend vloeibaar wasmiddel. - Google Patents
Enzymen-bevattend vloeibaar wasmiddel. Download PDFInfo
- Publication number
- NL8103169A NL8103169A NL8103169A NL8103169A NL8103169A NL 8103169 A NL8103169 A NL 8103169A NL 8103169 A NL8103169 A NL 8103169A NL 8103169 A NL8103169 A NL 8103169A NL 8103169 A NL8103169 A NL 8103169A
- Authority
- NL
- Netherlands
- Prior art keywords
- enzyme
- detergent
- cross
- polymer
- polyol
- Prior art date
Links
- 239000003599 detergent Substances 0.000 title claims description 57
- 239000007788 liquid Substances 0.000 title claims description 29
- 102000004190 Enzymes Human genes 0.000 claims description 38
- 108090000790 Enzymes Proteins 0.000 claims description 38
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 24
- 229920005862 polyol Polymers 0.000 claims description 16
- 150000003077 polyols Chemical group 0.000 claims description 16
- 229920000642 polymer Polymers 0.000 claims description 12
- 229910021538 borax Inorganic materials 0.000 claims description 9
- 239000004328 sodium tetraborate Substances 0.000 claims description 9
- 235000010339 sodium tetraborate Nutrition 0.000 claims description 9
- 229920006037 cross link polymer Polymers 0.000 claims description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 7
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 7
- 239000004327 boric acid Substances 0.000 claims description 7
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 4
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 claims description 4
- 229930006000 Sucrose Natural products 0.000 claims description 4
- 229910052796 boron Inorganic materials 0.000 claims description 4
- 239000005720 sucrose Substances 0.000 claims description 4
- 239000012736 aqueous medium Substances 0.000 claims description 3
- 238000011065 in-situ storage Methods 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 229920000058 polyacrylate Polymers 0.000 claims 2
- 229940088598 enzyme Drugs 0.000 description 36
- 150000001875 compounds Chemical class 0.000 description 18
- 239000000203 mixture Substances 0.000 description 17
- -1 alkali metal borates Chemical class 0.000 description 13
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- 230000000694 effects Effects 0.000 description 7
- JVTIXNMXDLQEJE-UHFFFAOYSA-N 2-decanoyloxypropyl decanoate 2-octanoyloxypropyl octanoate Chemical compound C(CCCCCCC)(=O)OCC(C)OC(CCCCCCC)=O.C(=O)(CCCCCCCCC)OCC(C)OC(=O)CCCCCCCCC JVTIXNMXDLQEJE-UHFFFAOYSA-N 0.000 description 6
- 108010056079 Subtilisins Proteins 0.000 description 6
- 102000005158 Subtilisins Human genes 0.000 description 6
- 125000000129 anionic group Chemical group 0.000 description 6
- 239000012467 final product Substances 0.000 description 6
- 238000003860 storage Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 239000007844 bleaching agent Substances 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 150000004665 fatty acids Chemical class 0.000 description 5
- 235000019832 sodium triphosphate Nutrition 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 108091005804 Peptidases Proteins 0.000 description 4
- 239000004365 Protease Substances 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 241000894006 Bacteria Species 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 102000035195 Peptidases Human genes 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 239000000344 soap Substances 0.000 description 3
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000271 synthetic detergent Substances 0.000 description 3
- 239000010457 zeolite Substances 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 108010065511 Amylases Proteins 0.000 description 2
- 102000013142 Amylases Human genes 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 235000019418 amylase Nutrition 0.000 description 2
- 229940025131 amylases Drugs 0.000 description 2
- 150000001639 boron compounds Chemical class 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 150000008040 ionic compounds Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 108010003855 mesentericopeptidase Proteins 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 230000002797 proteolythic effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- SSYDTHANSGMJTP-ZXZARUISSA-N (3s,4r)-oxolane-3,4-diol Chemical compound O[C@H]1COC[C@H]1O SSYDTHANSGMJTP-ZXZARUISSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-UHFFFAOYSA-N 2-methylbutyric acid Chemical compound CCC(C)C(O)=O WLAMNBDJUVNPJU-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- 241000194108 Bacillus licheniformis Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 108010059892 Cellulase Proteins 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- BCKXLBQYZLBQEK-KVVVOXFISA-M Sodium oleate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC([O-])=O BCKXLBQYZLBQEK-KVVVOXFISA-M 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 102000004139 alpha-Amylases Human genes 0.000 description 1
- 108090000637 alpha-Amylases Proteins 0.000 description 1
- 230000003625 amylolytic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000002519 antifouling agent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 229940106157 cellulase Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 230000001461 cytolytic effect Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229960002163 hydrogen peroxide Drugs 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229920005646 polycarboxylate Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- HSJXWMZKBLUOLQ-UHFFFAOYSA-M potassium;2-dodecylbenzenesulfonate Chemical compound [K+].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O HSJXWMZKBLUOLQ-UHFFFAOYSA-M 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 238000009895 reductive bleaching Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38663—Stabilised liquid enzyme compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT68042/80A IT1129814B (it) | 1980-07-02 | 1980-07-02 | Composizione detergente enzimatica liquida |
| IT6804280 | 1980-07-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL8103169A true NL8103169A (nl) | 1982-02-01 |
Family
ID=11307403
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8103169A NL8103169A (nl) | 1980-07-02 | 1981-07-01 | Enzymen-bevattend vloeibaar wasmiddel. |
Country Status (14)
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3264685D1 (en) | 1981-11-13 | 1985-08-14 | Unilever Nv | Enzymatic liquid cleaning composition |
| US4462922A (en) * | 1981-11-19 | 1984-07-31 | Lever Brothers Company | Enzymatic liquid detergent composition |
| US4529525A (en) * | 1982-08-30 | 1985-07-16 | Colgate-Palmolive Co. | Stabilized enzyme-containing detergent compositions |
| GB8311314D0 (en) * | 1983-04-26 | 1983-06-02 | Unilever Plc | Aqueous enzyme-containing compositions |
| NZ208157A (en) * | 1983-05-31 | 1986-11-12 | Colgate Palmolive Co | Built single-phase liquid detergent compositions containing stabilised enzymes |
| NZ208156A (en) * | 1983-05-31 | 1986-11-12 | Colgate Palmolive Co | Built single-phase liquid detergent compositions containing stabilised enzymes |
| US4652394A (en) * | 1983-05-31 | 1987-03-24 | Colgate Palmolive Co. | Built single phase liquid anionic detergent compositions containing stabilized enzymes |
| US4537706A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid to stabilize enzymes |
| US4537707A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid and formate to stabilize enzymes |
| NZ216792A (en) * | 1985-07-26 | 1989-04-26 | Colgate Palmolive Co | Stabilised,fabric-softening built detergent compositions containing enzymes and swelling bentonite clay |
| US4842769A (en) * | 1985-07-26 | 1989-06-27 | Colgate-Palmolive Co. | Stabilized fabric softening built detergent composition containing enzymes |
| ZA865096B (en) * | 1985-07-26 | 1988-02-24 | Colgate Palmolive Co | Stabilized built liquid detergent composition containing enzymes |
| US4900475A (en) * | 1985-07-26 | 1990-02-13 | Colgate-Palmolive Co. | Stabilized built liquid detergent composition containing enzyme |
| US5004557A (en) * | 1985-08-16 | 1991-04-02 | The B. F. Goodrich Company | Aqueous laundry detergent compositions containing acrylic acid polymers |
| US4670179A (en) * | 1986-05-29 | 1987-06-02 | Colgate Palmolive Company | Stabilized built single phase liquid detergent composition containing enzymes |
| US4842767A (en) * | 1986-09-10 | 1989-06-27 | Colgate-Palmolive Company | Heavy duty built aqueous liquid detergent composition containing stabilized enzymes |
| US4842758A (en) * | 1986-10-31 | 1989-06-27 | Colgate-Palmolive Company | Stabilized enzyme system for use in aqueous liquid built detergent compositions |
| GB8728610D0 (en) * | 1987-12-08 | 1988-01-13 | Donnell A O | Cleaning liquids |
| US4959179A (en) * | 1989-01-30 | 1990-09-25 | Lever Brothers Company | Stabilized enzymes liquid detergent composition containing lipase and protease |
| US5089163A (en) * | 1989-01-30 | 1992-02-18 | Lever Brothers Company, Division Of Conopco, Inc. | Enzymatic liquid detergent composition |
| DE3942617A1 (de) * | 1989-12-22 | 1991-06-27 | Henkel Kgaa | Stabilisatoren fuer waessrige fluessigwaschmittel |
| DE4034840A1 (de) * | 1990-11-02 | 1992-05-07 | Henkel Kgaa | Enzymatisches fluessigwaschmittel |
| JPH0775620B2 (ja) * | 1991-04-08 | 1995-08-16 | トーメー産業株式会社 | 含水性コンタクトレンズ用液剤組成物及び含水性コンタクトレンズの洗浄方法 |
| DE69206795T2 (de) * | 1991-04-30 | 1996-09-05 | Procter & Gamble | ARYLBORONSäURE ENTHALTENDE FLüSSIGWASCHMITTEL |
| DE69204472T2 (de) * | 1991-12-04 | 1996-05-02 | Procter & Gamble | Fluessige waschmittel mit zitronensaeure, cellulase und bor-diol-komplex um proteolytisches enzym zu inhibieren. |
| JPH06122896A (ja) * | 1992-03-31 | 1994-05-06 | Shiseido Co Ltd | 洗浄剤組成物 |
| US5442100A (en) * | 1992-08-14 | 1995-08-15 | The Procter & Gamble Company | β-aminoalkyl and β-N-peptidylaminoalkyl boronic acids |
| WO1994024240A1 (en) * | 1993-04-08 | 1994-10-27 | The Procter & Gamble Company | Secondary (2,3) alkyl sulfate surfactants in stable enzyme-containing detergent compositions |
| ZA943640B (en) * | 1993-06-07 | 1995-01-26 | Buckman Labor Inc | Synergistically stabilized liquid enzymatic compositions |
| LT3962B (en) | 1993-12-21 | 1996-05-27 | Albright & Wilson | Funcional fluids |
| US5604190A (en) * | 1995-06-07 | 1997-02-18 | Alcon Laboratories, Inc. | Stable liquid enzyme compositions and methods of use in contact lens cleaning and disinfecting systems |
| US5723421A (en) * | 1995-06-07 | 1998-03-03 | Alcon Laboratories, Inc. | Stable liquid enzyme compositions and methods of use in contact lens cleaning and disinfecting systems |
| BR0015230A (pt) * | 1999-10-21 | 2002-07-23 | Daiso Co Ltd Daiso Kabushiki K | Agente de reticulação a base de compostos de poli (éter alìlico) |
| JP2017522413A (ja) * | 2014-06-24 | 2017-08-10 | スリーエム イノベイティブ プロパティズ カンパニー | 低起泡性多酵素洗浄剤 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3781212A (en) * | 1972-10-27 | 1973-12-25 | Townsend & Townsend | Aerosol enzyme detergents stabilized with carbon dioxide |
| GB1590445A (en) * | 1976-11-01 | 1981-06-03 | Unilever Ltd | Enzymatic liquid composition |
-
1980
- 1980-07-02 IT IT68042/80A patent/IT1129814B/it active
-
1981
- 1981-06-25 PH PH25817A patent/PH18505A/en unknown
- 1981-06-25 NZ NZ197531A patent/NZ197531A/xx unknown
- 1981-06-29 DE DE3125533A patent/DE3125533C2/de not_active Expired
- 1981-06-30 CA CA000380898A patent/CA1163218A/en not_active Expired
- 1981-06-30 AU AU72379/81A patent/AU537950B2/en not_active Expired
- 1981-06-30 BR BR8104171A patent/BR8104171A/pt not_active IP Right Cessation
- 1981-06-30 AR AR285926A patent/AR223618A1/es active
- 1981-06-30 GB GB8120184A patent/GB2079305B/en not_active Expired
- 1981-07-01 ZA ZA814462A patent/ZA814462B/xx unknown
- 1981-07-01 NL NL8103169A patent/NL8103169A/nl not_active Application Discontinuation
- 1981-07-01 FR FR8112984A patent/FR2486095A1/fr active Granted
- 1981-07-01 JP JP56103097A patent/JPS604874B2/ja not_active Expired
-
1986
- 1986-12-30 MY MY451/86A patent/MY8600451A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU7237981A (en) | 1982-01-07 |
| IT1129814B (it) | 1986-06-11 |
| GB2079305B (en) | 1984-02-08 |
| MY8600451A (en) | 1986-12-31 |
| NZ197531A (en) | 1983-12-16 |
| JPS5740599A (en) | 1982-03-06 |
| FR2486095B1 (enrdf_load_stackoverflow) | 1983-11-04 |
| BR8104171A (pt) | 1982-03-16 |
| FR2486095A1 (fr) | 1982-01-08 |
| PH18505A (en) | 1985-08-02 |
| CA1163218A (en) | 1984-03-06 |
| DE3125533C2 (de) | 1985-11-21 |
| AU537950B2 (en) | 1984-07-19 |
| AR223618A1 (es) | 1981-08-31 |
| GB2079305A (en) | 1982-01-20 |
| DE3125533A1 (de) | 1982-06-09 |
| IT8068042A0 (it) | 1980-07-02 |
| JPS604874B2 (ja) | 1985-02-07 |
| ZA814462B (en) | 1983-02-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL8103169A (nl) | Enzymen-bevattend vloeibaar wasmiddel. | |
| US4462922A (en) | Enzymatic liquid detergent composition | |
| FI61715C (fi) | Enzymer innehaollande stabiliserad flytande detergentkomposition | |
| EP0080748B1 (en) | Enzymatic liquid cleaning composition | |
| EP0126505B1 (en) | Aqueous enzyme-containing compositions with improved stability | |
| US4261868A (en) | Stabilized enzymatic liquid detergent composition containing a polyalkanolamine and a boron compound | |
| CA3022860C (en) | Cleaning compositions having an enzyme system | |
| US3985686A (en) | Detergent compositions containing enzymes | |
| US20140186868A1 (en) | Method for adapting a hydrolytic enzyme to a component that stabilizes the hydrolytic enzyme | |
| NZ208156A (en) | Built single-phase liquid detergent compositions containing stabilised enzymes | |
| US4652394A (en) | Built single phase liquid anionic detergent compositions containing stabilized enzymes | |
| FI61716C (fi) | Enzymer innehaollande vattenhaltig flytande detergentkomposition som uppvisar aennu baettre lagerhaollbarhet | |
| US5501820A (en) | Aqueous enzymatic detergent compositions | |
| CA2970850C (en) | Liquid surfactant composition having special surfactant combination and enzyme |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BA | A request for search or an international-type search has been filed | ||
| BB | A search report has been drawn up | ||
| BC | A request for examination has been filed | ||
| A85 | Still pending on 85-01-01 | ||
| BV | The patent application has lapsed |