NL8004811A - Polycarbonaatmaterialen. - Google Patents
Polycarbonaatmaterialen. Download PDFInfo
- Publication number
- NL8004811A NL8004811A NL8004811A NL8004811A NL8004811A NL 8004811 A NL8004811 A NL 8004811A NL 8004811 A NL8004811 A NL 8004811A NL 8004811 A NL8004811 A NL 8004811A NL 8004811 A NL8004811 A NL 8004811A
- Authority
- NL
- Netherlands
- Prior art keywords
- acrylate
- parts
- methacrylate
- material according
- copolymer
- Prior art date
Links
- 239000004417 polycarbonate Substances 0.000 title claims description 31
- 229920000515 polycarbonate Polymers 0.000 title claims description 30
- 239000000463 material Substances 0.000 title claims description 25
- 229920001577 copolymer Polymers 0.000 claims description 31
- 125000003118 aryl group Chemical group 0.000 claims description 18
- 150000003377 silicon compounds Chemical class 0.000 claims description 14
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 claims description 10
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical group COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 7
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 6
- 230000009969 flowable effect Effects 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 6
- -1 1,3-butylene acrylate Chemical compound 0.000 claims description 5
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 claims description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 4
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 claims description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 claims description 3
- VDYWHVQKENANGY-UHFFFAOYSA-N 1,3-Butyleneglycol dimethacrylate Chemical compound CC(=C)C(=O)OC(C)CCOC(=O)C(C)=C VDYWHVQKENANGY-UHFFFAOYSA-N 0.000 claims description 2
- CFVWNXQPGQOHRJ-UHFFFAOYSA-N 2-methylpropyl prop-2-enoate Chemical compound CC(C)COC(=O)C=C CFVWNXQPGQOHRJ-UHFFFAOYSA-N 0.000 claims description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 claims description 2
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 claims description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 claims 2
- RUMACXVDVNRZJZ-UHFFFAOYSA-N 2-methylpropyl 2-methylprop-2-enoate Chemical compound CC(C)COC(=O)C(C)=C RUMACXVDVNRZJZ-UHFFFAOYSA-N 0.000 claims 1
- IQSHMXAZFHORGY-UHFFFAOYSA-N methyl prop-2-enoate;2-methylprop-2-enoic acid Chemical compound COC(=O)C=C.CC(=C)C(O)=O IQSHMXAZFHORGY-UHFFFAOYSA-N 0.000 claims 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims 1
- KFBCZUGNWHSCSW-UHFFFAOYSA-N prop-2-enoic acid 4-prop-2-enoyloxybutyl prop-2-enoate Chemical compound C(C=C)(=O)OCCCCOC(C=C)=O.C(C=C)(=O)O KFBCZUGNWHSCSW-UHFFFAOYSA-N 0.000 claims 1
- 238000000034 method Methods 0.000 description 8
- 229920005668 polycarbonate resin Polymers 0.000 description 7
- 239000004431 polycarbonate resin Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 238000009863 impact test Methods 0.000 description 6
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 230000032683 aging Effects 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Chemical group 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- FQMIAEWUVYWVNB-UHFFFAOYSA-N 3-prop-2-enoyloxybutyl prop-2-enoate Chemical compound C=CC(=O)OC(C)CCOC(=O)C=C FQMIAEWUVYWVNB-UHFFFAOYSA-N 0.000 description 1
- MLDIQALUMKMHCC-UHFFFAOYSA-N 4,4-Bis(4-hydroxyphenyl)heptane Chemical compound C=1C=C(O)C=CC=1C(CCC)(CCC)C1=CC=C(O)C=C1 MLDIQALUMKMHCC-UHFFFAOYSA-N 0.000 description 1
- JHWGFJBTMHEZME-UHFFFAOYSA-N 4-prop-2-enoyloxybutyl prop-2-enoate Chemical compound C=CC(=O)OCCCCOC(=O)C=C JHWGFJBTMHEZME-UHFFFAOYSA-N 0.000 description 1
- JETIJTIWAZHGHS-UHFFFAOYSA-N 6,6-dichloro-4-methylcyclohexa-2,4-diene-1,1-diol Chemical compound CC1=CC(Cl)(Cl)C(O)(O)C=C1 JETIJTIWAZHGHS-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000006087 Silane Coupling Agent Substances 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 229920006243 acrylic copolymer Polymers 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- OLLFKUHHDPMQFR-UHFFFAOYSA-N dihydroxy(diphenyl)silane Chemical compound C=1C=CC=CC=1[Si](O)(O)C1=CC=CC=C1 OLLFKUHHDPMQFR-UHFFFAOYSA-N 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- VQJVNZWNXWAWJA-UHFFFAOYSA-N methyl 2-methylprop-2-enoate;2-methylpropyl 2-methylprop-2-enoate Chemical compound COC(=O)C(C)=C.CC(C)COC(=O)C(C)=C VQJVNZWNXWAWJA-UHFFFAOYSA-N 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000004460 silage Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/069,824 US4263416A (en) | 1979-08-27 | 1979-08-27 | Polycarbonate compositions |
| US6982479 | 1979-08-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL8004811A true NL8004811A (nl) | 1981-03-03 |
Family
ID=22091439
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8004811A NL8004811A (nl) | 1979-08-27 | 1980-08-26 | Polycarbonaatmaterialen. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4263416A (OSRAM) |
| JP (1) | JPS5645947A (OSRAM) |
| AU (1) | AU539169B2 (OSRAM) |
| BR (1) | BR8005457A (OSRAM) |
| DE (1) | DE3031539A1 (OSRAM) |
| FR (1) | FR2464284B1 (OSRAM) |
| GB (1) | GB2057464B (OSRAM) |
| MX (1) | MX155420A (OSRAM) |
| NL (1) | NL8004811A (OSRAM) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4299928A (en) * | 1980-03-14 | 1981-11-10 | Mobay Chemical Corporation | Impact modified polycarbonates |
| US4378449A (en) * | 1980-03-14 | 1983-03-29 | Mobay Chemical Corporation | Impact modified polycarbonates |
| US4539358A (en) * | 1980-03-20 | 1985-09-03 | General Electric Company | Polycarbonate compositions |
| US4320212A (en) * | 1980-03-20 | 1982-03-16 | General Electric Co. | Ternary polycarbonate compositions containing polyacrylate and thermoplastic polyester |
| US4390657A (en) * | 1981-10-19 | 1983-06-28 | General Electric Company | Composition of polycarbonate, an ABS resin and an acrylate-methacrylate interpolymer |
| US4430475A (en) | 1981-12-31 | 1984-02-07 | Mobay Chemical Corporation | Alkylated aromatic polycarbonate compositions of improved impact strength |
| US4515921A (en) * | 1982-07-21 | 1985-05-07 | Mobay Chemical Corporation | Polycarbonate compositions having a high impact strength and melt flow rate |
| US4456725A (en) * | 1982-12-20 | 1984-06-26 | General Electric Company | Compositions comprising polycarbonates, acrylate resins, and aliphatic hydrocarbons |
| US4677162A (en) * | 1983-04-15 | 1987-06-30 | Mobay Corporation | Polycarbonate blends having low gloss |
| US4847153A (en) * | 1983-07-13 | 1989-07-11 | Mobay Corporation | Metal plated molded compositions containing polycarbonate and a certain ABS resin |
| US4446090A (en) * | 1983-10-03 | 1984-05-01 | General Electric Company | High viscosity silicone blending process |
| AU3570484A (en) * | 1983-12-20 | 1985-06-27 | General Electric Company | Copolyestercarbonate polysiloxane compositions |
| DE3518538A1 (de) * | 1985-05-23 | 1986-11-27 | Röhm GmbH, 6100 Darmstadt | Vertraegliche polymermischungen |
| US4749738A (en) * | 1986-12-19 | 1988-06-07 | General Electric Company | Polycarbonate compositions exhibiting improved wear resistance |
| DE3743199A1 (de) * | 1987-12-19 | 1989-06-29 | Roehm Gmbh | Schlagzaeh-modifizierungsmittel fuer kunststoffe |
| US5219935A (en) * | 1987-12-19 | 1993-06-15 | Rohm Gmbh | Impact modified synthetic resins |
| DE4118705A1 (de) * | 1991-03-26 | 1993-01-14 | Bayer Ag | Stabilisierung von hochwaermeformbestaendigem polycarbonat |
| DE4432379A1 (de) * | 1994-09-12 | 1996-03-14 | Bayer Ag | Blends aus Polycarbonaten, Dimerfettsäurepolyestern und PIB-Kautschuken, Siliconen oder Mineralölen |
| KR101297160B1 (ko) | 2010-05-17 | 2013-08-21 | 제일모직주식회사 | 폴리카보네이트 수지 조성물 및 이를 이용한 성형품 |
| KR101309808B1 (ko) | 2010-07-30 | 2013-09-23 | 제일모직주식회사 | 내스크래치성과 내충격성이 우수한 난연 폴리카보네이트 수지 조성물 및 이를 이용한 성형품 |
| KR101340539B1 (ko) * | 2010-11-23 | 2014-01-02 | 제일모직주식회사 | 표면 특성이 우수한 고광택 고충격 폴리카보네이트계 수지 조성물 및 이를 이용한 성형품 |
| KR101335290B1 (ko) | 2010-12-30 | 2013-12-02 | 제일모직주식회사 | 내화학성이 우수한 폴리카보네이트 수지 조성물 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1182807A (en) * | 1967-08-03 | 1970-03-04 | Ici Ltd | Thermoplastic Polymeric Compositions |
| BE782372R (en) * | 1968-04-15 | 1972-10-20 | Monsanto Co | Thermoplastic resin compsn - contg liquid acrylic ester (co) polymer as lubricant |
| US3742085A (en) * | 1970-04-15 | 1973-06-26 | Gen Electric | Thermally stable polycarbonate composition |
| US3751519A (en) * | 1971-07-29 | 1973-08-07 | Gen Electric | Compatible polycarbonate-siloxane composition |
| AU462964B2 (en) * | 1972-01-03 | 1975-06-25 | General Electric Company | An improved polycarbonate molding composition |
| CA1019876A (en) * | 1972-01-24 | 1977-10-25 | Robert L. Lauchlan | Modified polycarbonate compositions |
| JPS5039160B2 (OSRAM) * | 1972-06-09 | 1975-12-15 | ||
| JPS4918777A (OSRAM) * | 1972-06-14 | 1974-02-19 | ||
| DE2320786A1 (de) * | 1973-04-25 | 1974-11-14 | Texaco Development Corp | Polycarbonatharz - zusammensetzung erhoehter schlagzaehigkeit |
| US3971756A (en) * | 1974-08-09 | 1976-07-27 | General Electric Company | Flame retardant polycarbonate composition |
| US4130530A (en) * | 1977-04-08 | 1978-12-19 | General Electric Company | Cyclic siloxane plasticized polycarbonate composition |
| US4148773A (en) * | 1977-12-28 | 1979-04-10 | General Electric Company | Polycarbonate composition containing siloxane plasticizer |
| US4148842A (en) * | 1978-06-15 | 1979-04-10 | Stauffer Chemical Company | Blends of a polycarbonate resin and interpolymer modifier |
-
1979
- 1979-08-27 US US06/069,824 patent/US4263416A/en not_active Expired - Lifetime
-
1980
- 1980-08-15 GB GB8026652A patent/GB2057464B/en not_active Expired
- 1980-08-21 DE DE19803031539 patent/DE3031539A1/de not_active Ceased
- 1980-08-26 NL NL8004811A patent/NL8004811A/nl not_active Application Discontinuation
- 1980-08-26 JP JP11654380A patent/JPS5645947A/ja active Granted
- 1980-08-26 AU AU61744/80A patent/AU539169B2/en not_active Ceased
- 1980-08-26 FR FR8018515A patent/FR2464284B1/fr not_active Expired
- 1980-08-27 MX MX183703A patent/MX155420A/es unknown
- 1980-08-27 BR BR8005457A patent/BR8005457A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR8005457A (pt) | 1981-03-10 |
| GB2057464A (en) | 1981-04-01 |
| JPH0150258B2 (OSRAM) | 1989-10-27 |
| GB2057464B (en) | 1983-05-18 |
| JPS5645947A (en) | 1981-04-25 |
| FR2464284A1 (fr) | 1981-03-06 |
| DE3031539A1 (de) | 1981-03-19 |
| AU539169B2 (en) | 1984-09-13 |
| AU6174480A (en) | 1981-03-05 |
| US4263416A (en) | 1981-04-21 |
| MX155420A (es) | 1988-03-01 |
| FR2464284B1 (fr) | 1986-06-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL8004811A (nl) | Polycarbonaatmaterialen. | |
| NL8004813A (nl) | Polycarbonaatmaterialen. | |
| EP0023291B1 (de) | Stabilisierte thermoplastische Formmassen auf Basis von Polycarbonaten, ABS-Polymeren und Phosphiten | |
| NL8004812A (nl) | Polycarbonaatmateriaal. | |
| NL8004810A (nl) | Polycarbonaatmaterialen. | |
| US4320212A (en) | Ternary polycarbonate compositions containing polyacrylate and thermoplastic polyester | |
| KR102018714B1 (ko) | 열가소성 수지 조성물 및 이를 이용한 성형품 | |
| NL8101397A (nl) | Ternaire, polycarbonaat bevattende samenstellingen. | |
| KR100770131B1 (ko) | 폴리에스테르계 열가소성 수지 조성물 | |
| NL8303769A (nl) | Polycarbonaat bevattende samenstelling. | |
| CA1182236A (en) | Thermoplastic moulding compositions of aromatic polycarbonate and graft polymer of o,o,o',o' tetra- methyl bisphenol polycarbonate and a graft polymer with an acrylate rubber base | |
| NL8101396A (nl) | Binaire, polycarbonaat bevattende materialen. | |
| KR100581437B1 (ko) | 폴리에스테르계 열가소성 수지 조성물 | |
| US4415692A (en) | Stabilized thermoplastic moulding compositions | |
| CA1213387A (en) | Thermoplastic resinous blend having an improved impact performance | |
| EP0085046B1 (en) | Polycarbonate compositions | |
| EP0677555A1 (de) | Kompatibilisierte Mischungen aus ABS-Kunststoffen, Polyolefinen und gegebenenfalls aromatischen Polycarbonaten | |
| US4539358A (en) | Polycarbonate compositions | |
| EP0059375A2 (en) | Composition | |
| KR0182359B1 (ko) | 내악품성이 우수한 폴리카보네이트계 수지조성물 | |
| AU543449B2 (en) | Polycarbonate compositions | |
| CA1145093A (en) | Polycarbonate compositions | |
| JPS6234074B2 (OSRAM) | ||
| KR20050049177A (ko) | 폴리에스테르계 열가소성 수지 조성물 | |
| KR20200137836A (ko) | 열가소성 수지 조성물 및 이를 이용한 성형품 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A85 | Still pending on 85-01-01 | ||
| BV | The patent application has lapsed |