NL7906196A - Werkwijze voor het bereiden van opslagstabiele en gede- sensitiveerde percanbonzuren. - Google Patents
Werkwijze voor het bereiden van opslagstabiele en gede- sensitiveerde percanbonzuren. Download PDFInfo
- Publication number
- NL7906196A NL7906196A NL7906196A NL7906196A NL7906196A NL 7906196 A NL7906196 A NL 7906196A NL 7906196 A NL7906196 A NL 7906196A NL 7906196 A NL7906196 A NL 7906196A NL 7906196 A NL7906196 A NL 7906196A
- Authority
- NL
- Netherlands
- Prior art keywords
- acid
- added
- process according
- sodium
- diperoxyazelaic
- Prior art date
Links
- 239000002253 acid Substances 0.000 title claims description 42
- 238000000034 method Methods 0.000 title claims description 32
- 238000003860 storage Methods 0.000 title claims description 6
- 150000007513 acids Chemical class 0.000 title description 13
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 47
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 18
- 239000000463 material Substances 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 14
- SXLLDUPXUVRMEE-UHFFFAOYSA-N nonanediperoxoic acid Chemical compound OOC(=O)CCCCCCCC(=O)OO SXLLDUPXUVRMEE-UHFFFAOYSA-N 0.000 claims description 14
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 claims description 12
- 239000003975 dentin desensitizing agent Substances 0.000 claims description 10
- 150000004965 peroxy acids Chemical class 0.000 claims description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 claims description 8
- 238000001035 drying Methods 0.000 claims description 8
- 239000007864 aqueous solution Substances 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 claims description 6
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- 150000003467 sulfuric acid derivatives Chemical class 0.000 claims description 6
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 claims description 5
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 229910001388 sodium aluminate Inorganic materials 0.000 claims description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims description 4
- 239000007900 aqueous suspension Substances 0.000 claims description 4
- 239000011248 coating agent Substances 0.000 claims description 4
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 claims description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 claims description 4
- 235000019341 magnesium sulphate Nutrition 0.000 claims description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 4
- 235000011152 sodium sulphate Nutrition 0.000 claims description 4
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 claims description 4
- 239000001361 adipic acid Substances 0.000 claims description 3
- 235000011037 adipic acid Nutrition 0.000 claims description 3
- 239000000347 magnesium hydroxide Substances 0.000 claims description 3
- 229910001862 magnesium hydroxide Inorganic materials 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910021653 sulphate ion Inorganic materials 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- -1 alkaline earth metal sulphate Chemical class 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- GJPYYNMJTJNYTO-UHFFFAOYSA-J sodium aluminium sulfate Chemical compound [Na+].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GJPYYNMJTJNYTO-UHFFFAOYSA-J 0.000 claims description 2
- WTKWFNIIIXNTDO-UHFFFAOYSA-N 3-isocyanato-5-methyl-2-(trifluoromethyl)furan Chemical compound CC1=CC(N=C=O)=C(C(F)(F)F)O1 WTKWFNIIIXNTDO-UHFFFAOYSA-N 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N acetoacetic acid Chemical compound CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 claims 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- TVIDDXQYHWJXFK-UHFFFAOYSA-N n-Dodecanedioic acid Natural products OC(=O)CCCCCCCCCCC(O)=O TVIDDXQYHWJXFK-UHFFFAOYSA-N 0.000 claims 1
- HQHCYKULIHKCEB-UHFFFAOYSA-N tetradecanedioic acid Natural products OC(=O)CCCCCCCCCCCCC(O)=O HQHCYKULIHKCEB-UHFFFAOYSA-N 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 238000001914 filtration Methods 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 5
- FBWADIKARMIWNM-UHFFFAOYSA-N N-3,5-dichloro-4-hydroxyphenyl-1,4-benzoquinone imine Chemical compound C1=C(Cl)C(O)=C(Cl)C=C1N=C1C=CC(=O)C=C1 FBWADIKARMIWNM-UHFFFAOYSA-N 0.000 description 5
- 230000035945 sensitivity Effects 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 150000004677 hydrates Chemical class 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- GBXAHFXTHNBQRX-UHFFFAOYSA-N hexanediperoxoic acid Chemical compound OOC(=O)CCCCC(=O)OO GBXAHFXTHNBQRX-UHFFFAOYSA-N 0.000 description 2
- 239000008240 homogeneous mixture Substances 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- INHCSSUBVCNVSK-UHFFFAOYSA-L lithium sulfate Chemical compound [Li+].[Li+].[O-]S([O-])(=O)=O INHCSSUBVCNVSK-UHFFFAOYSA-L 0.000 description 2
- 235000012254 magnesium hydroxide Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 235000011116 calcium hydroxide Nutrition 0.000 description 1
- 239000001175 calcium sulphate Substances 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- JEGUKCSWCFPDGT-UHFFFAOYSA-N h2o hydrate Chemical compound O.O JEGUKCSWCFPDGT-UHFFFAOYSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910000372 mercury(II) sulfate Inorganic materials 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- BPLYVSYSBPLDOA-GYOJGHLZSA-N n-[(2r,3r)-1,3-dihydroxyoctadecan-2-yl]tetracosanamide Chemical compound CCCCCCCCCCCCCCCCCCCCCCCC(=O)N[C@H](CO)[C@H](O)CCCCCCCCCCCCCCC BPLYVSYSBPLDOA-GYOJGHLZSA-N 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 239000001120 potassium sulphate Substances 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
- C07C407/003—Separation; Purification; Stabilisation; Use of additives
- C07C407/006—Stabilisation; Use of additives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Detergent Compositions (AREA)
- Color Printing (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US95459078A | 1978-10-25 | 1978-10-25 | |
| US95459078 | 1978-10-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL7906196A true NL7906196A (nl) | 1980-04-29 |
Family
ID=25495659
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL7906196A NL7906196A (nl) | 1978-10-25 | 1979-08-14 | Werkwijze voor het bereiden van opslagstabiele en gede- sensitiveerde percanbonzuren. |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS5589263A (enrdf_load_stackoverflow) |
| AT (1) | AT370411B (enrdf_load_stackoverflow) |
| BE (1) | BE878199A (enrdf_load_stackoverflow) |
| DE (1) | DE2930546A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2446816A1 (enrdf_load_stackoverflow) |
| GB (1) | GB2032421B (enrdf_load_stackoverflow) |
| NL (1) | NL7906196A (enrdf_load_stackoverflow) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4370251A (en) * | 1980-07-25 | 1983-01-25 | Fmc Corporation | Continuous process for the production of peroxycarboxylic acid compositions |
| DE3320497A1 (de) * | 1983-06-07 | 1984-12-13 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung von wasserunloeslichen peroxycarbonsaeuren |
| DE3320496A1 (de) * | 1983-06-07 | 1984-12-13 | Degussa Ag, 6000 Frankfurt | Verfahren zum phlegmatisieren von wasserunloeslichen peroxycarbonsaeuren |
| DE3418450A1 (de) * | 1984-05-18 | 1985-11-28 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung wasserunloeslicher peroxycarbonsaeuren |
| DE3438529A1 (de) * | 1984-10-20 | 1986-04-24 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung substituierter diperoxybernsteinsaeuren |
| DE3628263A1 (de) * | 1986-08-25 | 1988-03-03 | Degussa | Verfahren zur phlegmatisierung von wasserunloeslichen peroxycarbonsaeuren |
| DE3822798A1 (de) * | 1988-07-06 | 1990-01-11 | Huels Chemische Werke Ag | Verfahren zur herstellung von phlegmatisierten aliphatischen diperoxidicarbonsaeuren |
| WO1994024260A1 (en) * | 1993-04-19 | 1994-10-27 | Akzo Nobel N.V. | Fluidized bed coated amidoperoxyacid bleach composition |
| FI111459B (fi) * | 2001-04-04 | 2003-07-31 | Kemira Chemicals Oy | Menetelmä stabiilin peretikkahappotuotteen valmistamiseksi |
| DE10361084A1 (de) | 2003-06-13 | 2005-01-05 | Henkel Kgaa | Lagerstabile Bleichmittelzusammensetzungen auf Basis von Peroxycarbonsäuren |
| DE10361100A1 (de) * | 2003-06-13 | 2005-01-05 | Henkel Kgaa | Lagerstabile Kapseln auf Basis von Peroxycarbonsäuren |
| DE102004030900A1 (de) * | 2004-06-25 | 2006-01-26 | Henkel Kgaa | Herstellung teilchenförmiger Peroxycarbonsäurezusammensetzungen |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2813896A (en) * | 1952-12-12 | 1957-11-19 | Bayer Ag | Process for preparing organic peracids |
| NL132620C (enrdf_load_stackoverflow) * | 1964-12-15 | 1971-10-15 | ||
| NL137346C (enrdf_load_stackoverflow) * | 1966-12-19 | |||
| US3770816A (en) * | 1969-07-23 | 1973-11-06 | Ppg Industries Inc | Diperisophthalic acid compositions |
| US3655738A (en) * | 1969-10-31 | 1972-04-11 | Ppg Industries Inc | Preparation of diperphthalic acids |
| US3880914A (en) * | 1969-10-31 | 1975-04-29 | Ppg Industries Inc | Diperisophthalic acids |
| US4119660A (en) * | 1976-08-27 | 1978-10-10 | The Procter & Gamble Company | Method for making diperoxyacids |
| US4172086A (en) * | 1977-03-28 | 1979-10-23 | Fmc Corporation | Process for the manufacture of peroxycarboxylic acids |
| US4147720A (en) * | 1977-12-30 | 1979-04-03 | Fmc Corporation | Process for preparing aliphatic diperoxydicarboxylic acids |
-
1979
- 1979-07-27 DE DE19792930546 patent/DE2930546A1/de active Granted
- 1979-07-31 AT AT526279A patent/AT370411B/de not_active IP Right Cessation
- 1979-08-10 BE BE0/196696A patent/BE878199A/fr not_active IP Right Cessation
- 1979-08-14 NL NL7906196A patent/NL7906196A/nl not_active Application Discontinuation
- 1979-08-21 GB GB7928997A patent/GB2032421B/en not_active Expired
- 1979-08-23 FR FR7921295A patent/FR2446816A1/fr active Granted
- 1979-10-25 JP JP13708779A patent/JPS5589263A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5589263A (en) | 1980-07-05 |
| BE878199A (fr) | 1980-02-11 |
| AT370411B (de) | 1983-03-25 |
| DE2930546C2 (enrdf_load_stackoverflow) | 1988-04-14 |
| FR2446816B1 (enrdf_load_stackoverflow) | 1985-02-08 |
| FR2446816A1 (fr) | 1980-08-14 |
| GB2032421A (en) | 1980-05-08 |
| JPS6243990B2 (enrdf_load_stackoverflow) | 1987-09-17 |
| GB2032421B (en) | 1983-02-02 |
| ATA526279A (de) | 1982-08-15 |
| DE2930546A1 (de) | 1980-05-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL7906196A (nl) | Werkwijze voor het bereiden van opslagstabiele en gede- sensitiveerde percanbonzuren. | |
| EP0349220B1 (en) | Phosphate buffer wash for improved amidoperoxyacid storage stability | |
| US4287135A (en) | Stabilized diperoxyalkanedioic acids and aromatic peroxycarboxylic acids | |
| US5117049A (en) | Nitrogen-containing peroxycarboxylic monopersulfates | |
| EP2627645B1 (fr) | Procede de preparation de la 2-hydroxybutyrolactone | |
| CA2432321A1 (en) | High yield s-nitrosylation process | |
| Camps et al. | m-Chloroperoxybenzoic acid-potassium fluoride system: Study of its stability and reaction with. alpha.-methylstyrene | |
| EP0147207B2 (en) | Disinfectants | |
| JP2006504781A (ja) | カルボン酸の製造方法 | |
| FR2593808A1 (fr) | Procede de preparation d'acides perhalogenomethanesulfiniques et sulfoniques et de leurs sels | |
| EP0105689B1 (en) | Magnesium salts of peroxycarboxylic acids | |
| US4795594A (en) | Process for the production of water insoluble peroxycarboxylic acids | |
| EP0212913B1 (en) | Peroxyacid compositions | |
| JP2002543049A (ja) | 一重項酸素を用いた有機基質の酸化方法 | |
| JP4934025B2 (ja) | 不飽和ラクトンの調製方法 | |
| ITTO980249A1 (it) | Procedimento per la preparazione di sali di acidi carbossilici | |
| US20020022743A1 (en) | Method for the purification of aryl sulfonic acids and salts | |
| US3247244A (en) | Method for producing organic peroxyacids | |
| US3079411A (en) | Preparation of long-chain aliphatic peroxy acids | |
| JPS61100560A (ja) | 置換ジペルオキシコハク酸の製造方法 | |
| US3235584A (en) | Process for producing organic peroxyacids | |
| CA1261875A (en) | Substituted glutaric and adipic diperoxyacids | |
| US3492339A (en) | Preparation of acyloxy-alkane carboxylic acids | |
| US3860642A (en) | Metal-chelate catalyzed oxidation of monosaccharides and derivatives thereof | |
| US6034280A (en) | Process for the production of 2,5-dimethyl-2,5-di-t-butylperoxy-hexane |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| DNT | Communications of changes of names of applicants whose applications have been laid open to public inspection |
Free format text: DEGUSSA AKTIENGESELLSCHAT |
|
| A85 | Still pending on 85-01-01 | ||
| BA | A request for search or an international-type search has been filed | ||
| BB | A search report has been drawn up | ||
| BC | A request for examination has been filed | ||
| BV | The patent application has lapsed |