MXPA04011471A - Arilalquilaminas moduladoras de receptor de calcio. - Google Patents
Arilalquilaminas moduladoras de receptor de calcio.Info
- Publication number
- MXPA04011471A MXPA04011471A MXPA04011471A MXPA04011471A MXPA04011471A MX PA04011471 A MXPA04011471 A MX PA04011471A MX PA04011471 A MXPA04011471 A MX PA04011471A MX PA04011471 A MXPA04011471 A MX PA04011471A MX PA04011471 A MXPA04011471 A MX PA04011471A
- Authority
- MX
- Mexico
- Prior art keywords
- methyl
- methyloxy
- phenyl
- ethanamine
- biphenyl
- Prior art date
Links
- 102000013830 Calcium-Sensing Receptors Human genes 0.000 title description 4
- 108010050543 Calcium-Sensing Receptors Proteins 0.000 title description 4
- 150000003975 aryl alkyl amines Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 260
- 238000000034 method Methods 0.000 claims abstract description 122
- 239000000203 mixture Substances 0.000 claims abstract description 97
- 150000003839 salts Chemical class 0.000 claims abstract description 55
- 238000011282 treatment Methods 0.000 claims abstract description 22
- 230000028327 secretion Effects 0.000 claims abstract description 20
- 108090000445 Parathyroid hormone Proteins 0.000 claims abstract description 14
- 201000010099 disease Diseases 0.000 claims abstract description 11
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 11
- 230000008569 process Effects 0.000 claims abstract description 10
- 201000002980 Hyperparathyroidism Diseases 0.000 claims abstract description 9
- 208000001132 Osteoporosis Diseases 0.000 claims abstract description 9
- 208000020084 Bone disease Diseases 0.000 claims abstract description 8
- 239000000543 intermediate Substances 0.000 claims abstract description 4
- 238000011321 prophylaxis Methods 0.000 claims abstract description 3
- -1 -C (= 0) 0H Chemical group 0.000 claims description 363
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 236
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims description 137
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 131
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 97
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 96
- 150000001412 amines Chemical class 0.000 claims description 87
- 229910052736 halogen Inorganic materials 0.000 claims description 70
- 150000002367 halogens Chemical class 0.000 claims description 67
- 125000000623 heterocyclic group Chemical group 0.000 claims description 67
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 63
- 125000001424 substituent group Chemical group 0.000 claims description 63
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 60
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 54
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims description 52
- 125000000217 alkyl group Chemical group 0.000 claims description 47
- 125000004429 atom Chemical group 0.000 claims description 44
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 44
- 229920006395 saturated elastomer Polymers 0.000 claims description 41
- 125000003118 aryl group Chemical group 0.000 claims description 34
- 125000001624 naphthyl group Chemical group 0.000 claims description 34
- 229910052757 nitrogen Inorganic materials 0.000 claims description 30
- 125000001188 haloalkyl group Chemical group 0.000 claims description 28
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 20
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims description 17
- 239000003814 drug Substances 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 125000003545 alkoxy group Chemical group 0.000 claims description 14
- 229910052760 oxygen Inorganic materials 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 13
- 125000001072 heteroaryl group Chemical group 0.000 claims description 9
- 125000004415 heterocyclylalkyl group Chemical group 0.000 claims description 9
- 229910052717 sulfur Inorganic materials 0.000 claims description 9
- RTCUCQWIICFPOD-UHFFFAOYSA-N 1-naphthalen-1-ylethanamine Chemical compound C1=CC=C2C(C(N)C)=CC=CC2=C1 RTCUCQWIICFPOD-UHFFFAOYSA-N 0.000 claims description 8
- 125000002618 bicyclic heterocycle group Chemical group 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- 239000008194 pharmaceutical composition Substances 0.000 claims description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 7
- 125000003107 substituted aryl group Chemical group 0.000 claims description 7
- 229910003827 NRaRb Inorganic materials 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 5
- 125000004434 sulfur atom Chemical group 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- RQADPXJMIZWVPT-GOSISDBHSA-N (1r)-1-(3-methoxyphenyl)-n-[(4-methoxy-3-quinolin-6-ylphenyl)methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C3C=CC=NC3=CC=2)=C1 RQADPXJMIZWVPT-GOSISDBHSA-N 0.000 claims description 4
- BSFGFDBHPRSHLE-OAHLLOKOSA-N (1r)-1-(3-methoxyphenyl)-n-[(4-methoxy-3-thiophen-2-ylphenyl)methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2SC=CC=2)=C1 BSFGFDBHPRSHLE-OAHLLOKOSA-N 0.000 claims description 4
- XSZFLTHQEHLQFO-OAHLLOKOSA-N (1r)-1-(3-methoxyphenyl)-n-[[4-(trifluoromethyl)-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(=CC=2)C(F)(F)F)C=2C=CC(=CC=2)C(F)(F)F)=C1 XSZFLTHQEHLQFO-OAHLLOKOSA-N 0.000 claims description 4
- LCFIMLWBRYBGEW-OAHLLOKOSA-N (1r)-1-(3-methoxyphenyl)-n-[[4-methoxy-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=NC(=CC=2)C(F)(F)F)=C1 LCFIMLWBRYBGEW-OAHLLOKOSA-N 0.000 claims description 4
- RTAQFBDJXHNNOO-QGZVFWFLSA-N (1r)-1-naphthalen-1-yl-n-[[3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]methyl]ethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=CC=1C1=CC=C(C(F)(F)F)N=C1 RTAQFBDJXHNNOO-QGZVFWFLSA-N 0.000 claims description 4
- VUOVDNBYCMNUQV-LJQANCHMSA-N (1r)-n-[(4-methoxy-3-naphthalen-2-ylphenyl)methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C3C=CC=CC3=CC=2)=C1 VUOVDNBYCMNUQV-LJQANCHMSA-N 0.000 claims description 4
- XTJHZNKRDGKTAT-OAQYLSRUSA-N (1r)-n-[(4-methoxy-3-naphthalen-2-ylphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=CC=CC2=CC(C3=CC(CN[C@H](C)C=4C5=CC=CC=C5C=CC=4)=CC=C3OC)=CC=C21 XTJHZNKRDGKTAT-OAQYLSRUSA-N 0.000 claims description 4
- BAVLQVRFDZOBIH-GOSISDBHSA-N (1r)-n-[(4-methoxy-3-pyridin-3-ylphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=CN=C1 BAVLQVRFDZOBIH-GOSISDBHSA-N 0.000 claims description 4
- FOYXABQEUUUOCT-MRXNPFEDSA-N (1r)-n-[(4-methoxy-3-pyrrol-1-ylphenyl)methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)N2C=CC=C2)OC)=CC=CC=C1 FOYXABQEUUUOCT-MRXNPFEDSA-N 0.000 claims description 4
- CYMWPTPYYAVYRB-MRXNPFEDSA-N (1r)-n-[(4-methoxy-3-pyrrolidin-1-ylphenyl)methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)N2CCCC2)OC)=CC=CC=C1 CYMWPTPYYAVYRB-MRXNPFEDSA-N 0.000 claims description 4
- OVVWUZGGYFWTPZ-HXUWFJFHSA-N (1r)-n-[(4-methoxy-3-quinolin-6-ylphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound N1=CC=CC2=CC(C3=CC(CN[C@H](C)C=4C5=CC=CC=C5C=CC=4)=CC=C3OC)=CC=C21 OVVWUZGGYFWTPZ-HXUWFJFHSA-N 0.000 claims description 4
- CNHQLJUQQJEHLV-QGZVFWFLSA-N (1r)-n-[(4-methoxy-3-thiophen-2-ylphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=CS1 CNHQLJUQQJEHLV-QGZVFWFLSA-N 0.000 claims description 4
- ZWSUNHQVYZFJSB-OAHLLOKOSA-N (1r)-n-[(4-methoxy-3-thiophen-2-ylphenyl)methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2SC=CC=2)OC)=CC=CC=C1 ZWSUNHQVYZFJSB-OAHLLOKOSA-N 0.000 claims description 4
- ITCGXXYGFCHYIR-QGZVFWFLSA-N (1r)-n-[[3-(2,3-dihydro-1-benzofuran-5-yl)-4-methoxyphenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C3CCOC3=CC=2)=C1 ITCGXXYGFCHYIR-QGZVFWFLSA-N 0.000 claims description 4
- ZLEILCZRYNIVKH-QGZVFWFLSA-N (1r)-n-[[3-(2-fluorophenyl)phenyl]methyl]-1-(4-methylphenyl)ethanamine Chemical compound N([C@H](C)C=1C=CC(C)=CC=1)CC(C=1)=CC=CC=1C1=CC=CC=C1F ZLEILCZRYNIVKH-QGZVFWFLSA-N 0.000 claims description 4
- KBLCBTOCUIGXOK-MRXNPFEDSA-N (1r)-n-[[3-(4-chlorophenyl)-4-methoxyphenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=CC(Cl)=CC=2)=C1 KBLCBTOCUIGXOK-MRXNPFEDSA-N 0.000 claims description 4
- UCJPUTDOFVLQAH-QGZVFWFLSA-N (1r)-n-[[3-(6-ethoxypyridin-3-yl)-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1=NC(OCC)=CC=C1C1=CC(CN[C@H](C)C=2C=CC=CC=2)=CC=C1OC UCJPUTDOFVLQAH-QGZVFWFLSA-N 0.000 claims description 4
- PDRJCVDFFAYVIL-QGZVFWFLSA-N (1r)-n-[[3-(furan-3-yl)-4-methoxyphenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C=1C=COC=1 PDRJCVDFFAYVIL-QGZVFWFLSA-N 0.000 claims description 4
- XLJOOGVBDDJLRN-OAHLLOKOSA-N (1r)-n-[[3-(furan-3-yl)-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C2=COC=C2)OC)=CC=CC=C1 XLJOOGVBDDJLRN-OAHLLOKOSA-N 0.000 claims description 4
- IIXTWFHYVMVOGH-HXUWFJFHSA-N (1r)-n-[[3-[1-(cyclopropylmethyl)indol-5-yl]-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3C=CN(CC4CC4)C3=CC=2)OC)=CC=CC=C1 IIXTWFHYVMVOGH-HXUWFJFHSA-N 0.000 claims description 4
- PHONWDQUIDBSKW-OAHLLOKOSA-N (1r)-n-[[4-chloro-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-phenylethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=C(Cl)C=1C1=CC=C(C(F)(F)F)C=C1 PHONWDQUIDBSKW-OAHLLOKOSA-N 0.000 claims description 4
- OWONWIQJYVNGBG-GOSISDBHSA-N (1r)-n-[[4-ethoxy-3-(4-methoxyphenyl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC(OC)=CC=2)OCC)=CC=CC=C1 OWONWIQJYVNGBG-GOSISDBHSA-N 0.000 claims description 4
- TVGGUHMOMNMTDH-OAHLLOKOSA-N (1r)-n-[[4-iodo-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(I)=CC=2)C=2C=CC(=CC=2)C(F)(F)F)=C1 TVGGUHMOMNMTDH-OAHLLOKOSA-N 0.000 claims description 4
- AVJSABFPVHXYJC-QGZVFWFLSA-N (1r)-n-[[4-iodo-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=C(I)C=1C1=CC=C(C(F)(F)F)C=C1 AVJSABFPVHXYJC-QGZVFWFLSA-N 0.000 claims description 4
- RVRGOEJXGVUUCR-CQSZACIVSA-N (1r)-n-[[4-methoxy-3-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2N=C(C)SC=2)=C1 RVRGOEJXGVUUCR-CQSZACIVSA-N 0.000 claims description 4
- JDTMQICOXDQEEW-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(3-methoxyphenyl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C(OC)C=CC=2)=C1 JDTMQICOXDQEEW-QGZVFWFLSA-N 0.000 claims description 4
- KJENJFHPRSVOMN-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-(4-methoxypyridin-2-yl)phenyl]methyl]-1-phenylethanamine Chemical compound COC1=CC=NC(C=2C(=CC=C(CN[C@H](C)C=3C=CC=CC=3)C=2)OC)=C1 KJENJFHPRSVOMN-MRXNPFEDSA-N 0.000 claims description 4
- GWGCPIVXAMYMFL-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-[1-methyl-2-(trifluoromethyl)benzimidazol-5-yl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=C2N(C)C(C(F)(F)F)=NC2=CC(C2=CC(CN[C@H](C)C=3C4=CC=CC=C4C=CC=3)=CC=C2OC)=C1 GWGCPIVXAMYMFL-GOSISDBHSA-N 0.000 claims description 4
- LZPAEGVXISFGFD-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-[3-(trifluoromethyl)phenyl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=CC(C(F)(F)F)=C1 LZPAEGVXISFGFD-GOSISDBHSA-N 0.000 claims description 4
- XZOGOAODTAIQCG-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-[4-(trifluoromethoxy)phenyl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=C(OC(F)(F)F)C=C1 XZOGOAODTAIQCG-GOSISDBHSA-N 0.000 claims description 4
- JRFWKLXVTAAZAB-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC(=CC=2)C(F)(F)F)OC)=CC=CC=C1 JRFWKLXVTAAZAB-MRXNPFEDSA-N 0.000 claims description 4
- QJXDHSSSGPGEQC-UHFFFAOYSA-N 1-(3-bromophenyl)-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound C1=C(C=2C=CC(=CC=2)C(F)(F)F)C(OC)=CC=C1CNC(C)C1=CC=CC(Br)=C1 QJXDHSSSGPGEQC-UHFFFAOYSA-N 0.000 claims description 4
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims description 4
- 239000003085 diluting agent Substances 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- DPVDYMFQKDPRNX-UHFFFAOYSA-N n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-(3-methylphenyl)ethanamine Chemical compound C1=C(C=2C=CC(=CC=2)C(F)(F)F)C(OC)=CC=C1CNC(C)C1=CC=CC(C)=C1 DPVDYMFQKDPRNX-UHFFFAOYSA-N 0.000 claims description 4
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 4
- VWINXACDKLTYJX-OAHLLOKOSA-N (1r)-1-(3-fluorophenyl)-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC(=CC=2)C(F)(F)F)OC)=CC=CC(F)=C1 VWINXACDKLTYJX-OAHLLOKOSA-N 0.000 claims description 3
- CEPPLCAAVYJNIS-MRXNPFEDSA-N (1r)-1-(3-methoxyphenyl)-n-[(4-methoxy-3-pyridin-3-ylphenyl)methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=NC=CC=2)=C1 CEPPLCAAVYJNIS-MRXNPFEDSA-N 0.000 claims description 3
- QIJDSWCRIIVSBQ-MRXNPFEDSA-N (1r)-1-(3-methoxyphenyl)-n-[[4-methoxy-3-[3-(trifluoromethoxy)phenyl]phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C(OC(F)(F)F)C=CC=2)=C1 QIJDSWCRIIVSBQ-MRXNPFEDSA-N 0.000 claims description 3
- MLOYLNMJZHVRSN-OAHLLOKOSA-N (1r)-n-[(4-chloro-3-pyridin-3-ylphenyl)methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(Cl)=CC=2)C=2C=NC=CC=2)=C1 MLOYLNMJZHVRSN-OAHLLOKOSA-N 0.000 claims description 3
- LEQFNLGTEITPTE-LJQANCHMSA-N (1r)-n-[(4-methoxy-3-naphthalen-2-ylphenyl)methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3C=CC=CC3=CC=2)OC)=CC=CC=C1 LEQFNLGTEITPTE-LJQANCHMSA-N 0.000 claims description 3
- ALFLSQSRGRWMMK-GOSISDBHSA-N (1r)-n-[(4-methoxy-3-pyridin-2-ylphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=CC=N1 ALFLSQSRGRWMMK-GOSISDBHSA-N 0.000 claims description 3
- XEWKUHVPJNSANG-GOSISDBHSA-N (1r)-n-[(4-methoxy-3-pyrrol-1-ylphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1N1C=CC=C1 XEWKUHVPJNSANG-GOSISDBHSA-N 0.000 claims description 3
- KDIVLDLVXSFWGT-MRXNPFEDSA-N (1r)-n-[[3-(1,3-benzothiazol-2-yl)-4-methoxyphenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2SC3=CC=CC=C3N=2)=C1 KDIVLDLVXSFWGT-MRXNPFEDSA-N 0.000 claims description 3
- MLJLWOLFBPENHB-MRXNPFEDSA-N (1r)-n-[[3-(1,3-benzothiazol-2-yl)-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2SC3=CC=CC=C3N=2)OC)=CC=CC=C1 MLJLWOLFBPENHB-MRXNPFEDSA-N 0.000 claims description 3
- UAHSVSJVRITSCG-GOSISDBHSA-N (1r)-n-[[3-(1,3-benzoxazol-5-yl)-4-methoxyphenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=C2OC=NC2=CC(C2=CC(CN[C@H](C)C=3C4=CC=CC=C4C=CC=3)=CC=C2OC)=C1 UAHSVSJVRITSCG-GOSISDBHSA-N 0.000 claims description 3
- OQOVGTNMORGUEU-QGZVFWFLSA-N (1r)-n-[[3-(1-benzothiophen-3-yl)-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C3=CC=CC=C3SC=2)OC)=CC=CC=C1 OQOVGTNMORGUEU-QGZVFWFLSA-N 0.000 claims description 3
- APXNHCQYZZUWBZ-OAHLLOKOSA-N (1r)-n-[[3-(2,1,3-benzoxadiazol-5-yl)-4-methoxyphenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C2=CC3=NON=C3C=C2)=C1 APXNHCQYZZUWBZ-OAHLLOKOSA-N 0.000 claims description 3
- AOQMKDMVAHVRMW-QGZVFWFLSA-N (1r)-n-[[3-(2,1,3-benzoxadiazol-5-yl)-4-methoxyphenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=CC2=NON=C2C=C1C1=CC(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)=CC=C1OC AOQMKDMVAHVRMW-QGZVFWFLSA-N 0.000 claims description 3
- RXIHFECCUGCJJK-OAHLLOKOSA-N (1r)-n-[[3-(2,1,3-benzoxadiazol-5-yl)-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C2=CC3=NON=C3C=C2)OC)=CC=CC=C1 RXIHFECCUGCJJK-OAHLLOKOSA-N 0.000 claims description 3
- NIJPOMBROVGNOL-LJQANCHMSA-N (1r)-n-[[3-(2,3-dihydro-1-benzofuran-5-yl)-4-methoxyphenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=C2OCCC2=CC(C2=CC(CN[C@H](C)C=3C4=CC=CC=C4C=CC=3)=CC=C2OC)=C1 NIJPOMBROVGNOL-LJQANCHMSA-N 0.000 claims description 3
- MEHPPZLMBARNEC-QGZVFWFLSA-N (1r)-n-[[3-(2,3-dihydro-1-benzofuran-5-yl)-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3CCOC3=CC=2)OC)=CC=CC=C1 MEHPPZLMBARNEC-QGZVFWFLSA-N 0.000 claims description 3
- RXXMPHSVIZFZFZ-MRXNPFEDSA-N (1r)-n-[[3-(4-chlorophenyl)-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC(Cl)=CC=2)OC)=CC=CC=C1 RXXMPHSVIZFZFZ-MRXNPFEDSA-N 0.000 claims description 3
- FLWFHIBQVQVDFE-JOCHJYFZSA-N (1r)-n-[[3-[1-(cyclopropylmethyl)indol-5-yl]-4-methoxyphenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C(C=C1C=C2)=CC=C1N2CC1CC1 FLWFHIBQVQVDFE-JOCHJYFZSA-N 0.000 claims description 3
- LYZLJYRTGRFMDO-QGZVFWFLSA-N (1r)-n-[[4-(difluoromethoxy)-3-pyridin-3-ylphenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=C(OC(F)F)C=1C1=CC=CN=C1 LYZLJYRTGRFMDO-QGZVFWFLSA-N 0.000 claims description 3
- CFKONZIMXTYJHT-QGZVFWFLSA-N (1r)-n-[[4-chloro-3-[4-(trifluoromethoxy)phenyl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=C(Cl)C=1C1=CC=C(OC(F)(F)F)C=C1 CFKONZIMXTYJHT-QGZVFWFLSA-N 0.000 claims description 3
- CETUQNBULBNBNJ-MRXNPFEDSA-N (1r)-n-[[4-fluoro-3-(4-methoxyphenyl)phenyl]methyl]-1-(4-methoxyphenyl)ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=C(F)C(C=2C=CC(OC)=CC=2)=C1 CETUQNBULBNBNJ-MRXNPFEDSA-N 0.000 claims description 3
- YGDOCAVOSNUNFN-OAHLLOKOSA-N (1r)-n-[[4-fluoro-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-phenylethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=C(F)C=1C1=CC=C(C(F)(F)F)C=C1 YGDOCAVOSNUNFN-OAHLLOKOSA-N 0.000 claims description 3
- MEVNMNPWFFCYAR-LJQANCHMSA-N (1r)-n-[[4-methoxy-3-(1-methylbenzimidazol-2-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=CC=C2N(C)C(C3=CC(CN[C@H](C)C=4C5=CC=CC=C5C=CC=4)=CC=C3OC)=NC2=C1 MEVNMNPWFFCYAR-LJQANCHMSA-N 0.000 claims description 3
- ZBRFTRYQMDAJBZ-LJQANCHMSA-N (1r)-n-[[4-methoxy-3-(1-methylindazol-5-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=C2N(C)N=CC2=CC(C2=CC(CN[C@H](C)C=3C4=CC=CC=C4C=CC=3)=CC=C2OC)=C1 ZBRFTRYQMDAJBZ-LJQANCHMSA-N 0.000 claims description 3
- NEBIMYHJRKARGF-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(1-methylindazol-5-yl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3C=NN(C)C3=CC=2)OC)=CC=CC=C1 NEBIMYHJRKARGF-QGZVFWFLSA-N 0.000 claims description 3
- XECXXTPSLPEQBL-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-(1-methylindol-6-yl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3N(C)C=CC3=CC=2)OC)=CC=CC=C1 XECXXTPSLPEQBL-GOSISDBHSA-N 0.000 claims description 3
- JMKYAESRILIBMO-LJQANCHMSA-N (1r)-n-[[4-methoxy-3-(2-methylindazol-5-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=CC2=NN(C)C=C2C=C1C1=CC(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)=CC=C1OC JMKYAESRILIBMO-LJQANCHMSA-N 0.000 claims description 3
- SABLPKRMOXVTPM-OAHLLOKOSA-N (1r)-n-[[4-methoxy-3-(6-methoxypyridazin-3-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2N=NC(OC)=CC=2)=C1 SABLPKRMOXVTPM-OAHLLOKOSA-N 0.000 claims description 3
- PAWCOVGAOZKDTG-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-(6-methoxypyridin-3-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=NC(OC)=CC=C1C1=CC(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)=CC=C1OC PAWCOVGAOZKDTG-GOSISDBHSA-N 0.000 claims description 3
- ONLHPHMMWZYITL-LJQANCHMSA-N (1r)-n-[[4-methoxy-3-(6-methylpyridin-3-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=C(C)N=C1 ONLHPHMMWZYITL-LJQANCHMSA-N 0.000 claims description 3
- BKIKBPDETUMXMG-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-[1-(2,2,2-trifluoroethyl)indol-5-yl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3C=CN(CC(F)(F)F)C3=CC=2)OC)=CC=CC=C1 BKIKBPDETUMXMG-GOSISDBHSA-N 0.000 claims description 3
- ZYUNULTUMNOMFM-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-[1-methyl-2-(trifluoromethyl)benzimidazol-5-yl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3N=C(N(C)C3=CC=2)C(F)(F)F)OC)=CC=CC=C1 ZYUNULTUMNOMFM-MRXNPFEDSA-N 0.000 claims description 3
- NBQMHGXTIGBGOP-LCQOSCCDSA-N (1r)-n-[[4-methoxy-3-[2-(oxolan-2-ylmethoxy)pyridin-3-yl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C(=NC=CC=2)OCC2OCCC2)OC)=CC=CC=C1 NBQMHGXTIGBGOP-LCQOSCCDSA-N 0.000 claims description 3
- CSXSIPJJJXOZCQ-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-[3-(trifluoromethoxy)phenyl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C(OC(F)(F)F)C=CC=2)OC)=CC=CC=C1 CSXSIPJJJXOZCQ-MRXNPFEDSA-N 0.000 claims description 3
- FRFFBCZZGHKBPB-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-[6-(2,2,2-trifluoroethoxy)pyridin-3-yl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=C(OCC(F)(F)F)N=C1 FRFFBCZZGHKBPB-GOSISDBHSA-N 0.000 claims description 3
- BZOQKLSBVWHNBN-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-[6-(2,2,2-trifluoroethoxy)pyridin-3-yl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=NC(OCC(F)(F)F)=CC=2)OC)=CC=CC=C1 BZOQKLSBVWHNBN-MRXNPFEDSA-N 0.000 claims description 3
- VFDDJTFSAVAPRP-HWYAHNCWSA-N (1r)-n-[[4-methoxy-3-[6-(oxolan-2-ylmethoxy)pyridin-3-yl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=NC(OCC3OCCC3)=CC=2)OC)=CC=CC=C1 VFDDJTFSAVAPRP-HWYAHNCWSA-N 0.000 claims description 3
- OGZXKUTZRHBILZ-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=C(C(F)(F)F)N=C1 OGZXKUTZRHBILZ-QGZVFWFLSA-N 0.000 claims description 3
- UGWMKLSZBLVUJS-OAHLLOKOSA-N (1r)-n-[[4-methoxy-3-[6-(trifluoromethyl)pyridin-3-yl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=NC(=CC=2)C(F)(F)F)OC)=CC=CC=C1 UGWMKLSZBLVUJS-OAHLLOKOSA-N 0.000 claims description 3
- SNTFBFJNEYIDNA-UHFFFAOYSA-N 1-(3,5-difluorophenyl)-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound C1=C(C=2C=CC(=CC=2)C(F)(F)F)C(OC)=CC=C1CNC(C)C1=CC(F)=CC(F)=C1 SNTFBFJNEYIDNA-UHFFFAOYSA-N 0.000 claims description 3
- ZWTAIWLCPPSPMZ-LJQANCHMSA-N 3-[2-methoxy-5-[[[(1r)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]benzonitrile Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=CC(C#N)=C1 ZWTAIWLCPPSPMZ-LJQANCHMSA-N 0.000 claims description 3
- YRPYIMZSUOZJTN-GOSISDBHSA-N 4-[2-methoxy-5-[[[(1r)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]-n,n-dimethylbenzamide Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=CC(=CC=2)C(=O)N(C)C)=C1 YRPYIMZSUOZJTN-GOSISDBHSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- HAEVCNGPGUSHFN-UHFFFAOYSA-N ethyl 1,2-dihydropyridine-2-carboxylate Chemical compound CCOC(=O)C1NC=CC=C1 HAEVCNGPGUSHFN-UHFFFAOYSA-N 0.000 claims description 3
- 125000005415 substituted alkoxy group Chemical group 0.000 claims description 3
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 3
- 239000003981 vehicle Substances 0.000 claims description 3
- OTEFLXQBXZRJIK-GOSISDBHSA-N (1r)-n-[(4-methoxy-3-phenylphenyl)methyl]-1-(4-methylphenyl)ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC=CC=2)OC)=CC=C(C)C=C1 OTEFLXQBXZRJIK-GOSISDBHSA-N 0.000 claims description 2
- MJIOXYXMGSOJKY-GOSISDBHSA-N (1r)-n-[(4-methoxy-3-quinolin-6-ylphenyl)methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3C=CC=NC3=CC=2)OC)=CC=CC=C1 MJIOXYXMGSOJKY-GOSISDBHSA-N 0.000 claims description 2
- DIZNYPAVOLTXLB-LJQANCHMSA-N (1r)-n-[(4-methoxy-3-quinoxalin-6-ylphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound N1=CC=NC2=CC(C3=CC(CN[C@H](C)C=4C5=CC=CC=C5C=CC=4)=CC=C3OC)=CC=C21 DIZNYPAVOLTXLB-LJQANCHMSA-N 0.000 claims description 2
- XAJBBIXNWPPZIL-QGZVFWFLSA-N (1r)-n-[(4-methoxy-3-quinoxalin-6-ylphenyl)methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3N=CC=NC3=CC=2)OC)=CC=CC=C1 XAJBBIXNWPPZIL-QGZVFWFLSA-N 0.000 claims description 2
- LKTFBEPQGHDSFD-OAHLLOKOSA-N (1r)-n-[[3-(2,1,3-benzothiadiazol-5-yl)-4-methoxyphenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C2=CC3=NSN=C3C=C2)=C1 LKTFBEPQGHDSFD-OAHLLOKOSA-N 0.000 claims description 2
- ZHBHMTSYFTZGJU-QGZVFWFLSA-N (1r)-n-[[3-(2-ethylbenzotriazol-5-yl)-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC=2C=C(C(=CC=2)OC)C=2C=CC3=NN(N=C3C=2)CC)=CC=CC=C1 ZHBHMTSYFTZGJU-QGZVFWFLSA-N 0.000 claims description 2
- DNJNIVCXNVKPGI-GOSISDBHSA-N (1r)-n-[[4-(2-methoxyethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC(=CC=2)C(F)(F)F)OCCOC)=CC=CC=C1 DNJNIVCXNVKPGI-GOSISDBHSA-N 0.000 claims description 2
- WHUSJDSEPIRUPK-QGZVFWFLSA-N (1r)-n-[[4-chloro-3-[6-(2,2,2-trifluoroethoxy)pyridin-3-yl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=C(Cl)C=1C1=CC=C(OCC(F)(F)F)N=C1 WHUSJDSEPIRUPK-QGZVFWFLSA-N 0.000 claims description 2
- AGAPDKOIMFPVBX-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(1-methylimidazol-4-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CN(C)C=N1 AGAPDKOIMFPVBX-QGZVFWFLSA-N 0.000 claims description 2
- GEAMDHSIVJJYKE-HXUWFJFHSA-N (1r)-n-[[4-methoxy-3-(1-methylindol-6-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=C2C=CN(C)C2=CC(C2=CC(CN[C@H](C)C=3C4=CC=CC=C4C=CC=3)=CC=C2OC)=C1 GEAMDHSIVJJYKE-HXUWFJFHSA-N 0.000 claims description 2
- DDXWORALLBSNKE-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(1-methylpyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C3C=CN(C)C3=NC=2)=C1 DDXWORALLBSNKE-QGZVFWFLSA-N 0.000 claims description 2
- OMHFNNNWXOMKQX-LJQANCHMSA-N (1r)-n-[[4-methoxy-3-(2-morpholin-4-ylpyridin-3-yl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C(=NC=CC=2)N2CCOCC2)OC)=CC=CC=C1 OMHFNNNWXOMKQX-LJQANCHMSA-N 0.000 claims description 2
- MHCPDJPPPAXLJD-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-[3-(trifluoromethoxy)phenyl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=CC(OC(F)(F)F)=C1 MHCPDJPPPAXLJD-GOSISDBHSA-N 0.000 claims description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 2
- 150000004678 hydrides Chemical class 0.000 claims description 2
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims 2
- AXGRUOYVIIUWLD-QGZVFWFLSA-N (1r)-n-[[3-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-methoxyphenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=C2OC(F)(F)OC2=CC(C2=CC(CN[C@H](C)C=3C4=CC=CC=C4C=CC=3)=CC=C2OC)=C1 AXGRUOYVIIUWLD-QGZVFWFLSA-N 0.000 claims 1
- HVLRTSLDGIJEKQ-OAHLLOKOSA-N (1r)-n-[[3-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3OC(F)(F)OC3=CC=2)OC)=CC=CC=C1 HVLRTSLDGIJEKQ-OAHLLOKOSA-N 0.000 claims 1
- FKULHUOKXHXXBE-OAHLLOKOSA-N (1r)-n-[[4-fluoro-3-(4-fluorophenyl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(F)=CC=2)C=2C=CC(F)=CC=2)=C1 FKULHUOKXHXXBE-OAHLLOKOSA-N 0.000 claims 1
- JCADJSHNTMOCCR-CQSZACIVSA-N (1r)-n-[[4-methoxy-3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=NN=C(C(F)(F)F)O1 JCADJSHNTMOCCR-CQSZACIVSA-N 0.000 claims 1
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- HZRWSWYFIZIQOC-UHFFFAOYSA-N 1-methoxy-2-[3-(trifluoromethyl)phenyl]benzene Chemical group COC1=CC=CC=C1C1=CC=CC(C(F)(F)F)=C1 HZRWSWYFIZIQOC-UHFFFAOYSA-N 0.000 claims 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims 1
- AIKXYHWIVVEIQJ-QGZVFWFLSA-N 5-[2-methoxy-5-[[[(1r)-1-phenylethyl]amino]methyl]phenyl]-n,n-dimethylpyridin-2-amine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=NC(=CC=2)N(C)C)OC)=CC=CC=C1 AIKXYHWIVVEIQJ-QGZVFWFLSA-N 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims 1
- 230000002401 inhibitory effect Effects 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 227
- 239000000243 solution Substances 0.000 description 100
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 84
- 238000005481 NMR spectroscopy Methods 0.000 description 79
- 150000002500 ions Chemical class 0.000 description 79
- 235000019439 ethyl acetate Nutrition 0.000 description 78
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 67
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 66
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 53
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 51
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 46
- 239000007787 solid Substances 0.000 description 44
- 239000002904 solvent Substances 0.000 description 44
- 101150041968 CDC13 gene Proteins 0.000 description 42
- 238000004440 column chromatography Methods 0.000 description 42
- 230000002829 reductive effect Effects 0.000 description 41
- 238000006243 chemical reaction Methods 0.000 description 38
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 38
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 34
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 33
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 31
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 31
- 229910052938 sodium sulfate Inorganic materials 0.000 description 31
- 235000011152 sodium sulphate Nutrition 0.000 description 31
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 28
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 25
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 24
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- 239000012044 organic layer Substances 0.000 description 24
- 239000000741 silica gel Substances 0.000 description 24
- 229910002027 silica gel Inorganic materials 0.000 description 24
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 24
- 239000003921 oil Substances 0.000 description 22
- 235000019198 oils Nutrition 0.000 description 22
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 21
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 21
- 235000019441 ethanol Nutrition 0.000 description 21
- 239000012267 brine Substances 0.000 description 20
- 239000012074 organic phase Substances 0.000 description 19
- 229910000027 potassium carbonate Inorganic materials 0.000 description 19
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000000651 prodrug Substances 0.000 description 16
- 229940002612 prodrug Drugs 0.000 description 16
- RTCUCQWIICFPOD-SECBINFHSA-N (1r)-1-naphthalen-1-ylethanamine Chemical compound C1=CC=C2C([C@H](N)C)=CC=CC2=C1 RTCUCQWIICFPOD-SECBINFHSA-N 0.000 description 15
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 15
- 210000004027 cell Anatomy 0.000 description 15
- 235000011181 potassium carbonates Nutrition 0.000 description 15
- 150000002148 esters Chemical class 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- RQEUFEKYXDPUSK-SSDOTTSWSA-N (1R)-1-phenylethanamine Chemical compound C[C@@H](N)C1=CC=CC=C1 RQEUFEKYXDPUSK-SSDOTTSWSA-N 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 12
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 11
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 11
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 10
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- VOAAEKKFGLPLLU-UHFFFAOYSA-N (4-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1 VOAAEKKFGLPLLU-UHFFFAOYSA-N 0.000 description 9
- NKKNXLPHCRLBDY-UHFFFAOYSA-N (5-formyl-2-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(C=O)C=C1B(O)O NKKNXLPHCRLBDY-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- 239000000377 silicon dioxide Substances 0.000 description 9
- PTSAGTYANNZUKP-UHFFFAOYSA-N 4-methoxy-3-(4-methoxyphenyl)benzaldehyde Chemical compound C1=CC(OC)=CC=C1C1=CC(C=O)=CC=C1OC PTSAGTYANNZUKP-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 229910001424 calcium ion Inorganic materials 0.000 description 8
- 239000012043 crude product Substances 0.000 description 8
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 8
- 125000006239 protecting group Chemical group 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 7
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 7
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 7
- 239000008346 aqueous phase Substances 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 229940079593 drug Drugs 0.000 description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 6
- 239000005909 Kieselgur Substances 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- 150000001299 aldehydes Chemical class 0.000 description 6
- 229940024606 amino acid Drugs 0.000 description 6
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 6
- 239000004202 carbamide Substances 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- 235000017550 sodium carbonate Nutrition 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- JQVUPBOPWSLZJF-UJONTBEJSA-N C[C@H](C1=CC=CC=C1)NCC2=CC=CC=C2C3=CNC(C=C3)(N)OC Chemical compound C[C@H](C1=CC=CC=C1)NCC2=CC=CC=C2C3=CNC(C=C3)(N)OC JQVUPBOPWSLZJF-UJONTBEJSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000007832 Na2SO4 Substances 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 239000002671 adjuvant Substances 0.000 description 5
- 235000011114 ammonium hydroxide Nutrition 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000011575 calcium Substances 0.000 description 5
- 229910052791 calcium Inorganic materials 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 125000004122 cyclic group Chemical group 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000011570 nicotinamide Substances 0.000 description 5
- 229960003966 nicotinamide Drugs 0.000 description 5
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 5
- 230000000849 parathyroid Effects 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical compound C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 description 4
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 4
- OCGLWYIQCTYEEP-UHFFFAOYSA-N 3-(1,3-benzoxazol-5-yl)-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=CC=C(OC=N2)C2=C1 OCGLWYIQCTYEEP-UHFFFAOYSA-N 0.000 description 4
- DYHPWYGMFSOXQW-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=NC2=CC=CC=C2N1 DYHPWYGMFSOXQW-UHFFFAOYSA-N 0.000 description 4
- GXZKWQZYPXGICN-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-4-methoxybenzaldehyde Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(C=O)=CC=C1OC GXZKWQZYPXGICN-UHFFFAOYSA-N 0.000 description 4
- UOTMHAOCAJROQF-UHFFFAOYSA-N 3-bromo-4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1Br UOTMHAOCAJROQF-UHFFFAOYSA-N 0.000 description 4
- YXAXVEYGWWNYHE-UHFFFAOYSA-N 3-pyridin-3-yl-4-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=C(C=O)C=C1C1=CC=CN=C1 YXAXVEYGWWNYHE-UHFFFAOYSA-N 0.000 description 4
- RUQVQHUMYBUHFH-UHFFFAOYSA-N 4-methoxy-3-(3-methoxyphenyl)benzaldehyde Chemical compound COC1=CC=CC(C=2C(=CC=C(C=O)C=2)OC)=C1 RUQVQHUMYBUHFH-UHFFFAOYSA-N 0.000 description 4
- SEEQSCRDPUVJEQ-UHFFFAOYSA-N 4-methoxy-3-pyridin-4-ylbenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=CC=NC=C1 SEEQSCRDPUVJEQ-UHFFFAOYSA-N 0.000 description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 4
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 4
- 235000019445 benzyl alcohol Nutrition 0.000 description 4
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 238000013461 design Methods 0.000 description 4
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000012458 free base Substances 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 235000015320 potassium carbonate Nutrition 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 102000005962 receptors Human genes 0.000 description 4
- 108020003175 receptors Proteins 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- UOCLRXFKRLRMKV-UHFFFAOYSA-N trolnitrate phosphate Chemical compound OP(O)(O)=O.OP(O)(O)=O.[O-][N+](=O)OCCN(CCO[N+]([O-])=O)CCO[N+]([O-])=O UOCLRXFKRLRMKV-UHFFFAOYSA-N 0.000 description 4
- GYAHRDZHVYLQCN-MRXNPFEDSA-N (1r)-n-[[3-(1,3-benzodioxol-5-yl)phenyl]methyl]-1-(4-methoxyphenyl)ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2C=C3OCOC3=CC=2)=C1 GYAHRDZHVYLQCN-MRXNPFEDSA-N 0.000 description 3
- ASOUJWKMTRGINA-OAHLLOKOSA-N (1r)-n-[[3-(2,1,3-benzothiadiazol-5-yl)-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C2=CC3=NSN=C3C=C2)OC)=CC=CC=C1 ASOUJWKMTRGINA-OAHLLOKOSA-N 0.000 description 3
- GIWRDDJDHCHBFX-OAHLLOKOSA-N (1r)-n-[[3-(2-fluoropyridin-3-yl)-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C(=NC=CC=2)F)OC)=CC=CC=C1 GIWRDDJDHCHBFX-OAHLLOKOSA-N 0.000 description 3
- HMOMPRSQCCUZIA-OAHLLOKOSA-N (1r)-n-[[3-(furan-3-yl)-4-methoxyphenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C2=COC=C2)=C1 HMOMPRSQCCUZIA-OAHLLOKOSA-N 0.000 description 3
- WZUVUBRFWAMIQJ-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-[3-(trifluoromethyl)phenyl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C(C=CC=2)C(F)(F)F)OC)=CC=CC=C1 WZUVUBRFWAMIQJ-MRXNPFEDSA-N 0.000 description 3
- LEZHSANVDVJVLE-UHFFFAOYSA-N 1-(1-methylindol-4-yl)ethanamine Chemical compound CC(N)C1=CC=CC2=C1C=CN2C LEZHSANVDVJVLE-UHFFFAOYSA-N 0.000 description 3
- VWINXACDKLTYJX-UHFFFAOYSA-N 1-(3-fluorophenyl)-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound C1=C(C=2C=CC(=CC=2)C(F)(F)F)C(OC)=CC=C1CNC(C)C1=CC=CC(F)=C1 VWINXACDKLTYJX-UHFFFAOYSA-N 0.000 description 3
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 3
- UGHSPHXGXFPVMB-UHFFFAOYSA-N 3-(2,3-dihydro-1,4-benzodioxin-5-yl)-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=CC=CC2=C1OCCO2 UGHSPHXGXFPVMB-UHFFFAOYSA-N 0.000 description 3
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 3
- QYJOCYHGBONCIE-UHFFFAOYSA-N 4-(cyclopropylmethoxy)-3-(4-methoxyphenyl)benzaldehyde Chemical compound C1=CC(OC)=CC=C1C1=CC(C=O)=CC=C1OCC1CC1 QYJOCYHGBONCIE-UHFFFAOYSA-N 0.000 description 3
- BQDIZAINPORDHO-UHFFFAOYSA-N 4-ethyl-3-(4-methoxyphenyl)benzaldehyde Chemical compound CCC1=CC=C(C=O)C=C1C1=CC=C(OC)C=C1 BQDIZAINPORDHO-UHFFFAOYSA-N 0.000 description 3
- GBMDJZWSAXHBGU-UHFFFAOYSA-N 4-ethyl-3-pyridin-3-ylbenzaldehyde Chemical compound CCC1=CC=C(C=O)C=C1C1=CC=CN=C1 GBMDJZWSAXHBGU-UHFFFAOYSA-N 0.000 description 3
- VPWWVIKQHVDXQG-UHFFFAOYSA-N 4-hydroxy-3-(4-methoxyphenyl)benzaldehyde Chemical compound C1=CC(OC)=CC=C1C1=CC(C=O)=CC=C1O VPWWVIKQHVDXQG-UHFFFAOYSA-N 0.000 description 3
- YXQZTYAMWGGXEK-UHFFFAOYSA-N 4-methoxy-3-(1-methylbenzimidazol-5-yl)benzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=CC=C(N(C)C=N2)C2=C1 YXQZTYAMWGGXEK-UHFFFAOYSA-N 0.000 description 3
- KPVCUFOIIPCCCM-UHFFFAOYSA-N 4-methoxy-3-(1-methylindol-5-yl)benzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=CC=C(N(C)C=C2)C2=C1 KPVCUFOIIPCCCM-UHFFFAOYSA-N 0.000 description 3
- MBVAPSOJVKVKSM-UHFFFAOYSA-N 4-methoxy-3-(2-methyl-1,3-benzoxazol-5-yl)benzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=CC=C(OC(C)=N2)C2=C1 MBVAPSOJVKVKSM-UHFFFAOYSA-N 0.000 description 3
- OQMYZDMSLIKZRO-UHFFFAOYSA-N 4-methoxy-3-pyridin-2-ylbenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=CC=CC=N1 OQMYZDMSLIKZRO-UHFFFAOYSA-N 0.000 description 3
- ZBCCSPFGJDVVJB-UHFFFAOYSA-N 5-bromo-2-methyl-1,3-benzoxazole Chemical compound BrC1=CC=C2OC(C)=NC2=C1 ZBCCSPFGJDVVJB-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 3
- 101100167062 Caenorhabditis elegans chch-3 gene Proteins 0.000 description 3
- YQYJSBFKSSDGFO-UHFFFAOYSA-N Epihygromycin Natural products OC1C(O)C(C(=O)C)OC1OC(C(=C1)O)=CC=C1C=C(C)C(=O)NC1C(O)C(O)C2OCOC2C1O YQYJSBFKSSDGFO-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- 102100036893 Parathyroid hormone Human genes 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 210000000988 bone and bone Anatomy 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 239000000872 buffer Substances 0.000 description 3
- 230000002092 calcimimetic effect Effects 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- FFQZMOHAQYZTNR-UHFFFAOYSA-N ethyl 4-phenylbenzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1C1=CC=CC=C1 FFQZMOHAQYZTNR-UHFFFAOYSA-N 0.000 description 3
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 3
- 238000007327 hydrogenolysis reaction Methods 0.000 description 3
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 3
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 3
- 239000003701 inert diluent Substances 0.000 description 3
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 3
- QHEMUGWQWBLMIE-UHFFFAOYSA-N n-[4-formyl-2-(4-methoxyphenyl)phenyl]acetamide Chemical compound C1=CC(OC)=CC=C1C1=CC(C=O)=CC=C1NC(C)=O QHEMUGWQWBLMIE-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 238000006884 silylation reaction Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- GSOMMFLMCBOYKC-OAHLLOKOSA-N (1r)-1-(3-chlorophenyl)-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC(=CC=2)C(F)(F)F)OC)=CC=CC(Cl)=C1 GSOMMFLMCBOYKC-OAHLLOKOSA-N 0.000 description 2
- AIDIKGMOBWYTQU-MRXNPFEDSA-N (1r)-1-(3-fluorophenyl)-n-[(4-methoxy-3-phenylphenyl)methyl]ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC=CC=2)OC)=CC=CC(F)=C1 AIDIKGMOBWYTQU-MRXNPFEDSA-N 0.000 description 2
- XLHSNWIFKVHFLT-OAHLLOKOSA-N (1r)-1-(3-fluorophenyl)-n-[[3-(4-fluorophenyl)-4-methoxyphenyl]methyl]ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC(F)=CC=2)OC)=CC=CC(F)=C1 XLHSNWIFKVHFLT-OAHLLOKOSA-N 0.000 description 2
- HYQVMDKDKKRAIU-MRXNPFEDSA-N (1r)-1-(3-methoxyphenyl)-n-[(3-pyridin-2-ylphenyl)methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2N=CC=CC=2)=C1 HYQVMDKDKKRAIU-MRXNPFEDSA-N 0.000 description 2
- GFWMXUCWRKTZAW-OAHLLOKOSA-N (1r)-1-(3-methoxyphenyl)-n-[(3-pyrimidin-5-ylphenyl)methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2C=NC=NC=2)=C1 GFWMXUCWRKTZAW-OAHLLOKOSA-N 0.000 description 2
- CWZJROZXIGELRN-QGZVFWFLSA-N (1r)-1-(3-methoxyphenyl)-n-[(4-methoxy-3-phenylphenyl)methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=CC=CC=2)=C1 CWZJROZXIGELRN-QGZVFWFLSA-N 0.000 description 2
- NZGVDXKZLRKFFO-OAHLLOKOSA-N (1r)-1-(3-methoxyphenyl)-n-[(4-methoxy-3-pyrazin-2-ylphenyl)methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2N=CC=NC=2)=C1 NZGVDXKZLRKFFO-OAHLLOKOSA-N 0.000 description 2
- KMMMRABXCZAPRZ-QGZVFWFLSA-N (1r)-1-(3-methoxyphenyl)-n-[(4-methoxy-3-quinoxalin-6-ylphenyl)methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C3N=CC=NC3=CC=2)=C1 KMMMRABXCZAPRZ-QGZVFWFLSA-N 0.000 description 2
- BYVSVHDVZYMXDM-QGZVFWFLSA-N (1r)-1-(3-methoxyphenyl)-n-[[3-(3-methoxyphenyl)phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2C=C(OC)C=CC=2)=C1 BYVSVHDVZYMXDM-QGZVFWFLSA-N 0.000 description 2
- XPARHUIUNGQWQW-CYBMUJFWSA-N (1r)-1-(3-methoxyphenyl)-n-[[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2ON=C(C)N=2)=C1 XPARHUIUNGQWQW-CYBMUJFWSA-N 0.000 description 2
- AHRINSLALPTLTE-QGZVFWFLSA-N (1r)-1-(3-methoxyphenyl)-n-[[3-(4-methoxyphenyl)phenyl]methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1C1=CC=CC(CN[C@H](C)C=2C=C(OC)C=CC=2)=C1 AHRINSLALPTLTE-QGZVFWFLSA-N 0.000 description 2
- IYCZAMQNEJCYGZ-OAHLLOKOSA-N (1r)-1-(3-methoxyphenyl)-n-[[3-(6-methoxypyridazin-3-yl)phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2N=NC(OC)=CC=2)=C1 IYCZAMQNEJCYGZ-OAHLLOKOSA-N 0.000 description 2
- GBPZMFAJMUZJCQ-CQSZACIVSA-N (1r)-1-(3-methoxyphenyl)-n-[[4-methoxy-3-(1,3-thiazol-2-yl)phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2SC=CN=2)=C1 GBPZMFAJMUZJCQ-CQSZACIVSA-N 0.000 description 2
- SZNVUZRECWCTEQ-GOSISDBHSA-N (1r)-1-(3-methoxyphenyl)-n-[[4-methoxy-3-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2N=C(SC=2)N2CCCCC2)=C1 SZNVUZRECWCTEQ-GOSISDBHSA-N 0.000 description 2
- YCNDLQRBCKYYFD-MRXNPFEDSA-N (1r)-1-(3-methoxyphenyl)-n-[[4-methoxy-3-[3-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C(C=CC=2)C(F)(F)F)=C1 YCNDLQRBCKYYFD-MRXNPFEDSA-N 0.000 description 2
- WAHHHNYICCZJFL-MRXNPFEDSA-N (1r)-1-(3-methoxyphenyl)-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=CC(=CC=2)C(F)(F)F)=C1 WAHHHNYICCZJFL-MRXNPFEDSA-N 0.000 description 2
- RPPKIUJMGAGOFW-GFCCVEGCSA-N (1r)-1-(3-methoxyphenyl)-n-[[4-methoxy-3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2OC(=NN=2)C(F)(F)F)=C1 RPPKIUJMGAGOFW-GFCCVEGCSA-N 0.000 description 2
- UQCATOZUJVKOAZ-OAHLLOKOSA-N (1r)-1-(4-methoxyphenyl)-n-[(3-pyrazin-2-ylphenyl)methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2N=CC=NC=2)=C1 UQCATOZUJVKOAZ-OAHLLOKOSA-N 0.000 description 2
- WECMDNFXRXSCIR-MRXNPFEDSA-N (1r)-1-(4-methoxyphenyl)-n-[(3-pyridin-2-ylphenyl)methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2N=CC=CC=2)=C1 WECMDNFXRXSCIR-MRXNPFEDSA-N 0.000 description 2
- GVNAIPQQFIMMHP-OAHLLOKOSA-N (1r)-1-(4-methoxyphenyl)-n-[(4-methoxy-3-pyrazin-2-ylphenyl)methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=C(OC)C(C=2N=CC=NC=2)=C1 GVNAIPQQFIMMHP-OAHLLOKOSA-N 0.000 description 2
- ICFCCGMBIBRSIK-OAHLLOKOSA-N (1r)-1-(4-methoxyphenyl)-n-[(4-methoxy-3-pyrimidin-5-ylphenyl)methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=C(OC)C(C=2C=NC=NC=2)=C1 ICFCCGMBIBRSIK-OAHLLOKOSA-N 0.000 description 2
- IAPCPKAERZNEOO-GOSISDBHSA-N (1r)-1-(4-methoxyphenyl)-n-[[3-(2-methylphenyl)phenyl]methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2C(=CC=CC=2)C)=C1 IAPCPKAERZNEOO-GOSISDBHSA-N 0.000 description 2
- GVMQTNQKLFLFSG-QGZVFWFLSA-N (1r)-1-(4-methoxyphenyl)-n-[[3-(3-methoxyphenyl)phenyl]methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2C=C(OC)C=CC=2)=C1 GVMQTNQKLFLFSG-QGZVFWFLSA-N 0.000 description 2
- LVVLAAHILJAAGN-QGZVFWFLSA-N (1r)-1-(4-methoxyphenyl)-n-[[3-(4-methoxyphenyl)phenyl]methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2C=CC(OC)=CC=2)=C1 LVVLAAHILJAAGN-QGZVFWFLSA-N 0.000 description 2
- SDPNEGQEXZIAKB-OAHLLOKOSA-N (1r)-1-(4-methoxyphenyl)-n-[[3-(6-methoxypyridazin-3-yl)phenyl]methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2N=NC(OC)=CC=2)=C1 SDPNEGQEXZIAKB-OAHLLOKOSA-N 0.000 description 2
- CXAXBNAMZDFYDQ-LJQANCHMSA-N (1r)-1-(4-methylphenyl)-n-[[3-(2-methylphenyl)phenyl]methyl]ethanamine Chemical compound N([C@H](C)C=1C=CC(C)=CC=1)CC(C=1)=CC=CC=1C1=CC=CC=C1C CXAXBNAMZDFYDQ-LJQANCHMSA-N 0.000 description 2
- GPZUFQGYZNGKSN-GOSISDBHSA-N (1r)-1-(4-methylphenyl)-n-[[3-(6-methylpyridin-3-yl)phenyl]methyl]ethanamine Chemical compound N([C@H](C)C=1C=CC(C)=CC=1)CC(C=1)=CC=CC=1C1=CC=C(C)N=C1 GPZUFQGYZNGKSN-GOSISDBHSA-N 0.000 description 2
- ZPRVWMUFNRFPQT-MRXNPFEDSA-N (1r)-1-(4-methylphenyl)-n-[[3-(9-methylpurin-6-yl)phenyl]methyl]ethanamine Chemical compound C1([C@H](NCC=2C=C(C=CC=2)C=2C=3N=CN(C)C=3N=CN=2)C)=CC=C(C)C=C1 ZPRVWMUFNRFPQT-MRXNPFEDSA-N 0.000 description 2
- YHQSTRPTPSSTEH-MRXNPFEDSA-N (1r)-1-naphthalen-1-yl-n-[[3-(1,3-thiazol-2-yl)phenyl]methyl]ethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=CC=1C1=NC=CS1 YHQSTRPTPSSTEH-MRXNPFEDSA-N 0.000 description 2
- BRTPCLVXWDYVKZ-QGZVFWFLSA-N (1r)-1-naphthalen-1-yl-n-[[4-(trifluoromethyl)-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=C(C(F)(F)F)C=1C1=CC=C(C(F)(F)F)C=C1 BRTPCLVXWDYVKZ-QGZVFWFLSA-N 0.000 description 2
- CXMUSHANLDMQBE-GOSISDBHSA-N (1r)-1-naphthalen-2-yl-n-[(3-pyridin-2-ylphenyl)methyl]ethanamine Chemical compound N([C@H](C)C=1C=C2C=CC=CC2=CC=1)CC(C=1)=CC=CC=1C1=CC=CC=N1 CXMUSHANLDMQBE-GOSISDBHSA-N 0.000 description 2
- VHLZLJZRCZWWMP-OAHLLOKOSA-N (1r)-1-phenyl-n-[(3-pyrazin-2-ylphenyl)methyl]ethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=CC=1C1=CN=CC=N1 VHLZLJZRCZWWMP-OAHLLOKOSA-N 0.000 description 2
- LMHPWECKJBTYAP-MRXNPFEDSA-N (1r)-1-phenyl-n-[(3-pyridin-2-ylphenyl)methyl]ethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=CC=1C1=CC=CC=N1 LMHPWECKJBTYAP-MRXNPFEDSA-N 0.000 description 2
- ZJZBCXYUXBLDGF-MRXNPFEDSA-N (1r)-1-phenyl-n-[(4-pyrrolidin-1-ylphenyl)methyl]ethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=C1)=CC=C1N1CCCC1 ZJZBCXYUXBLDGF-MRXNPFEDSA-N 0.000 description 2
- ZEASBLRIUFWEOQ-CQSZACIVSA-N (1r)-1-phenyl-n-[[3-(1,3-thiazol-2-yl)phenyl]methyl]ethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=CC=1C1=NC=CS1 ZEASBLRIUFWEOQ-CQSZACIVSA-N 0.000 description 2
- WLGXKIYCDJUICT-QGZVFWFLSA-N (1r)-n-[(3-imidazo[1,2-a]pyridin-6-yl-4-methoxyphenyl)methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C2=CN3C=CN=C3C=C2)OC)=CC=CC=C1 WLGXKIYCDJUICT-QGZVFWFLSA-N 0.000 description 2
- RFBNCTSGKPFPMO-GOSISDBHSA-N (1r)-n-[(4-methoxy-3-piperidin-4-ylphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1CCNCC1 RFBNCTSGKPFPMO-GOSISDBHSA-N 0.000 description 2
- DSCAEVVCTKZVDK-QGZVFWFLSA-N (1r)-n-[(4-methoxy-3-pyrazin-2-ylphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CN=CC=N1 DSCAEVVCTKZVDK-QGZVFWFLSA-N 0.000 description 2
- PYVVRAHSEYJUOM-QGZVFWFLSA-N (1r)-n-[(4-methoxy-3-pyrazin-2-ylphenyl)methyl]-1-naphthalen-2-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C=C3C=CC=CC3=CC=2)C=C1C1=CN=CC=N1 PYVVRAHSEYJUOM-QGZVFWFLSA-N 0.000 description 2
- HDJHFQJMDKSIBW-OAHLLOKOSA-N (1r)-n-[(4-methoxy-3-pyrazin-2-ylphenyl)methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2N=CC=NC=2)OC)=CC=CC=C1 HDJHFQJMDKSIBW-OAHLLOKOSA-N 0.000 description 2
- YFPGSRMOTWNGCQ-QGZVFWFLSA-N (1r)-n-[(4-methoxy-3-pyridin-3-ylphenyl)methyl]-1-(4-methylphenyl)ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=NC=CC=2)OC)=CC=C(C)C=C1 YFPGSRMOTWNGCQ-QGZVFWFLSA-N 0.000 description 2
- SQURZJBUTGYIHS-QGZVFWFLSA-N (1r)-n-[(4-methoxy-3-pyrimidin-2-ylphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=NC=CC=N1 SQURZJBUTGYIHS-QGZVFWFLSA-N 0.000 description 2
- VEBILXUMINWJRT-OAHLLOKOSA-N (1r)-n-[(4-methoxy-3-pyrimidin-2-ylphenyl)methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2N=CC=CN=2)OC)=CC=CC=C1 VEBILXUMINWJRT-OAHLLOKOSA-N 0.000 description 2
- WNBREFQPKCSVIJ-MRXNPFEDSA-N (1r)-n-[(4-methoxy-3-pyrimidin-5-ylphenyl)methyl]-1-(4-methylphenyl)ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=NC=NC=2)OC)=CC=C(C)C=C1 WNBREFQPKCSVIJ-MRXNPFEDSA-N 0.000 description 2
- OUJIBYJMLUAHAF-GOSISDBHSA-N (1r)-n-[(4-methoxy-3-pyrrolidin-1-ylphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1N1CCCC1 OUJIBYJMLUAHAF-GOSISDBHSA-N 0.000 description 2
- WEDPGZRYMOETQE-MRXNPFEDSA-N (1r)-n-[(4-methoxy-3-thiophen-3-ylphenyl)methyl]-1-(4-methylphenyl)ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C2=CSC=C2)OC)=CC=C(C)C=C1 WEDPGZRYMOETQE-MRXNPFEDSA-N 0.000 description 2
- WPSBDCBUZDZJEW-QGZVFWFLSA-N (1r)-n-[(4-methoxy-3-thiophen-3-ylphenyl)methyl]-1-naphthalen-2-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C=C3C=CC=CC3=CC=2)C=C1C=1C=CSC=1 WPSBDCBUZDZJEW-QGZVFWFLSA-N 0.000 description 2
- ZMCLTTYDTMNJHX-QGZVFWFLSA-N (1r)-n-[(4-methyl-3-pyridin-3-ylphenyl)methyl]-1-phenylethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=C(C)C=1C1=CC=CN=C1 ZMCLTTYDTMNJHX-QGZVFWFLSA-N 0.000 description 2
- NAQBYCTUIFKWMX-MRXNPFEDSA-N (1r)-n-[[3-(1,3-benzodioxol-5-yl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@H](NCC=2C=C(C=CC=2)C=2C=C3OCOC3=CC=2)C)=CC=CC=C1 NAQBYCTUIFKWMX-MRXNPFEDSA-N 0.000 description 2
- CPDJXEQPRWAZAN-GOSISDBHSA-N (1r)-n-[[3-(1,3-benzothiazol-2-yl)-4-methoxyphenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=CC=C2SC(C3=CC(CN[C@H](C)C=4C5=CC=CC=C5C=CC=4)=CC=C3OC)=NC2=C1 CPDJXEQPRWAZAN-GOSISDBHSA-N 0.000 description 2
- GXEPQKJMRFVFHM-MRXNPFEDSA-N (1r)-n-[[3-(1,3-benzoxazol-5-yl)-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3N=COC3=CC=2)OC)=CC=CC=C1 GXEPQKJMRFVFHM-MRXNPFEDSA-N 0.000 description 2
- OZYMAYQSPANJAG-LJQANCHMSA-N (1r)-n-[[3-(1-benzothiophen-3-yl)-4-methoxyphenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=CC=C2C(C3=CC(CN[C@H](C)C=4C5=CC=CC=C5C=CC=4)=CC=C3OC)=CSC2=C1 OZYMAYQSPANJAG-LJQANCHMSA-N 0.000 description 2
- DWVHZLHNIRUWBP-QGZVFWFLSA-N (1r)-n-[[3-(1h-indol-5-yl)-4-methoxyphenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C3C=CNC3=CC=2)=C1 DWVHZLHNIRUWBP-QGZVFWFLSA-N 0.000 description 2
- OGKRMTUEEWYXAG-LJQANCHMSA-N (1r)-n-[[3-(1h-indol-5-yl)-4-methoxyphenyl]methyl]-1-naphthalen-2-ylethanamine Chemical compound C1=C2NC=CC2=CC(C2=CC(CN[C@H](C)C=3C=C4C=CC=CC4=CC=3)=CC=C2OC)=C1 OGKRMTUEEWYXAG-LJQANCHMSA-N 0.000 description 2
- UMYUUBDMQLDDTH-OAHLLOKOSA-N (1r)-n-[[3-(2,2-difluoro-1,3-benzodioxol-5-yl)-4-methoxyphenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C3OC(F)(F)OC3=CC=2)=C1 UMYUUBDMQLDDTH-OAHLLOKOSA-N 0.000 description 2
- AKNXCVXQUJVRHZ-MRXNPFEDSA-N (1r)-n-[[3-(2-fluorophenyl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2C(=CC=CC=2)F)=C1 AKNXCVXQUJVRHZ-MRXNPFEDSA-N 0.000 description 2
- PFWIAKXASQPRJO-MRXNPFEDSA-N (1r)-n-[[3-(2-fluorophenyl)phenyl]methyl]-1-(4-methoxyphenyl)ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2C(=CC=CC=2)F)=C1 PFWIAKXASQPRJO-MRXNPFEDSA-N 0.000 description 2
- FZQVWQPFHJDYJG-GOSISDBHSA-N (1r)-n-[[3-(3-methoxyphenyl)phenyl]methyl]-1-(4-methylphenyl)ethanamine Chemical compound COC1=CC=CC(C=2C=C(CN[C@H](C)C=3C=CC(C)=CC=3)C=CC=2)=C1 FZQVWQPFHJDYJG-GOSISDBHSA-N 0.000 description 2
- KHKXTCWIMZVUOD-MRXNPFEDSA-N (1r)-n-[[3-(4-fluorophenyl)-4-methoxyphenyl]methyl]-1-(4-methoxyphenyl)ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=C(OC)C(C=2C=CC(F)=CC=2)=C1 KHKXTCWIMZVUOD-MRXNPFEDSA-N 0.000 description 2
- VQRMCNDVMDWNDX-MRXNPFEDSA-N (1r)-n-[[3-(4-fluorophenyl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2C=CC(F)=CC=2)=C1 VQRMCNDVMDWNDX-MRXNPFEDSA-N 0.000 description 2
- CNGOIVVDHDKWQQ-QGZVFWFLSA-N (1r)-n-[[3-(4-fluorophenyl)phenyl]methyl]-1-(4-methylphenyl)ethanamine Chemical compound N([C@H](C)C=1C=CC(C)=CC=1)CC(C=1)=CC=CC=1C1=CC=C(F)C=C1 CNGOIVVDHDKWQQ-QGZVFWFLSA-N 0.000 description 2
- STKKUKRVTOGJBD-LJQANCHMSA-N (1r)-n-[[3-(4-methoxyphenyl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=CC(OC)=CC=C1C1=CC=CC(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)=C1 STKKUKRVTOGJBD-LJQANCHMSA-N 0.000 description 2
- NUDXJPUGOWIQKL-LJQANCHMSA-N (1r)-n-[[3-(4-methoxyphenyl)phenyl]methyl]-1-naphthalen-2-ylethanamine Chemical compound C1=CC(OC)=CC=C1C1=CC=CC(CN[C@H](C)C=2C=C3C=CC=CC3=CC=2)=C1 NUDXJPUGOWIQKL-LJQANCHMSA-N 0.000 description 2
- DFGAEBNHLJWZGK-OAHLLOKOSA-N (1r)-n-[[3-(6-methoxypyridazin-3-yl)phenyl]methyl]-1-phenylethanamine Chemical compound N1=NC(OC)=CC=C1C1=CC=CC(CN[C@H](C)C=2C=CC=CC=2)=C1 DFGAEBNHLJWZGK-OAHLLOKOSA-N 0.000 description 2
- GICGPRPCEOYFMF-QGZVFWFLSA-N (1r)-n-[[3-(6-methylpyridin-3-yl)phenyl]methyl]-1-phenylethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=CC=1C1=CC=C(C)N=C1 GICGPRPCEOYFMF-QGZVFWFLSA-N 0.000 description 2
- QXFORAKUHYDLDH-OAHLLOKOSA-N (1r)-n-[[3-(furan-3-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C2=COC=C2)=C1 QXFORAKUHYDLDH-OAHLLOKOSA-N 0.000 description 2
- AJGWKESKJNXBPR-MRXNPFEDSA-N (1r)-n-[[3-(furan-3-yl)phenyl]methyl]-1-(4-methylphenyl)ethanamine Chemical compound N([C@H](C)C=1C=CC(C)=CC=1)CC(C=1)=CC=CC=1C=1C=COC=1 AJGWKESKJNXBPR-MRXNPFEDSA-N 0.000 description 2
- QNROCVUTRIGUTD-QGZVFWFLSA-N (1r)-n-[[3-(furan-3-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=CC=1C=1C=COC=1 QNROCVUTRIGUTD-QGZVFWFLSA-N 0.000 description 2
- RSFVCVDYNPSWTI-OAHLLOKOSA-N (1r)-n-[[3-(furan-3-yl)phenyl]methyl]-1-phenylethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=CC=1C=1C=COC=1 RSFVCVDYNPSWTI-OAHLLOKOSA-N 0.000 description 2
- UWYCKYFTRXRMLG-GOSISDBHSA-N (1r)-n-[[4-(2-methoxyethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC(=CC=2)C(F)(F)F)OCCOC)=CC=CC(OC)=C1 UWYCKYFTRXRMLG-GOSISDBHSA-N 0.000 description 2
- WVTVXRJGMXERAK-HXUWFJFHSA-N (1r)-n-[[4-(2-methoxyethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COCCOC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=C(C(F)(F)F)C=C1 WVTVXRJGMXERAK-HXUWFJFHSA-N 0.000 description 2
- XNMHVEPDAYQBJJ-MRXNPFEDSA-N (1r)-n-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=C1)=CC=C1C=1C(C)=NOC=1C XNMHVEPDAYQBJJ-MRXNPFEDSA-N 0.000 description 2
- SYRKUKPRPDNPGF-OAHLLOKOSA-N (1r)-n-[[4-(difluoromethoxy)-3-pyridin-3-ylphenyl]methyl]-1-phenylethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=C(OC(F)F)C=1C1=CC=CN=C1 SYRKUKPRPDNPGF-OAHLLOKOSA-N 0.000 description 2
- FPTSTHKGNCSJHO-OAHLLOKOSA-N (1r)-n-[[4-chloro-3-[4-(trifluoromethoxy)phenyl]phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(Cl)=CC=2)C=2C=CC(OC(F)(F)F)=CC=2)=C1 FPTSTHKGNCSJHO-OAHLLOKOSA-N 0.000 description 2
- PPAWGCMBGMKIQA-OAHLLOKOSA-N (1r)-n-[[4-chloro-3-[4-(trifluoromethoxy)phenyl]phenyl]methyl]-1-phenylethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=C(Cl)C=1C1=CC=C(OC(F)(F)F)C=C1 PPAWGCMBGMKIQA-OAHLLOKOSA-N 0.000 description 2
- RWFZEVYKGDVASF-QGZVFWFLSA-N (1r)-n-[[4-chloro-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=C(Cl)C=1C1=CC=C(C(F)(F)F)C=C1 RWFZEVYKGDVASF-QGZVFWFLSA-N 0.000 description 2
- YMPQHTRRGXWGEU-MRXNPFEDSA-N (1r)-n-[[4-fluoro-3-(4-methoxyphenyl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound C1=CC(OC)=CC=C1C1=CC(CN[C@H](C)C=2C=C(OC)C=CC=2)=CC=C1F YMPQHTRRGXWGEU-MRXNPFEDSA-N 0.000 description 2
- OXUYWNSGYNMODS-OAHLLOKOSA-N (1r)-n-[[4-iodo-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-phenylethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=C(I)C=1C1=CC=C(C(F)(F)F)C=C1 OXUYWNSGYNMODS-OAHLLOKOSA-N 0.000 description 2
- HUJQWHMOSVOASA-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(1-methylbenzimidazol-5-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C3N=CN(C)C3=CC=2)=C1 HUJQWHMOSVOASA-QGZVFWFLSA-N 0.000 description 2
- CZQYQBBNIBRRPJ-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(1-methylbenzimidazol-5-yl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3N=CN(C)C3=CC=2)OC)=CC=CC=C1 CZQYQBBNIBRRPJ-QGZVFWFLSA-N 0.000 description 2
- OMTNZALECVFTSZ-OAHLLOKOSA-N (1r)-n-[[4-methoxy-3-(1-methylimidazol-4-yl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2N=CN(C)C=2)OC)=CC=CC=C1 OMTNZALECVFTSZ-OAHLLOKOSA-N 0.000 description 2
- IPRYNHOAPVETKX-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-(1-methylindol-6-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C3N(C)C=CC3=CC=2)=C1 IPRYNHOAPVETKX-GOSISDBHSA-N 0.000 description 2
- WAEHHRNEGVITMF-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(1-methylpiperidin-4-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C2CCN(C)CC2)=C1 WAEHHRNEGVITMF-QGZVFWFLSA-N 0.000 description 2
- UHJUNHOJAOBLAX-LJQANCHMSA-N (1r)-n-[[4-methoxy-3-(1-methylpyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound N1=C2N(C)C=CC2=CC(C2=CC(CN[C@H](C)C=3C4=CC=CC=C4C=CC=3)=CC=C2OC)=C1 UHJUNHOJAOBLAX-LJQANCHMSA-N 0.000 description 2
- MAGSXLMLPDAIME-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(1-methylpyrrolo[2,3-b]pyridin-5-yl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C3C=CN(C)C3=NC=2)OC)=CC=CC=C1 MAGSXLMLPDAIME-QGZVFWFLSA-N 0.000 description 2
- PZDROYSLDAHFNF-CQSZACIVSA-N (1r)-n-[[4-methoxy-3-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2N=C(C)SC=2)OC)=CC=CC=C1 PZDROYSLDAHFNF-CQSZACIVSA-N 0.000 description 2
- BXTCWUYTMFGPHN-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(2-methylindazol-5-yl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C2=CC3=CN(C)N=C3C=C2)OC)=CC=CC=C1 BXTCWUYTMFGPHN-QGZVFWFLSA-N 0.000 description 2
- RKYUTYLMIIXGKY-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2N=C(SC=2)N2CCCCC2)OC)=CC=CC=C1 RKYUTYLMIIXGKY-GOSISDBHSA-N 0.000 description 2
- HPBSCHVBVALILK-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(3-methoxyphenyl)phenyl]methyl]-1-phenylethanamine Chemical compound COC1=CC=CC(C=2C(=CC=C(CN[C@H](C)C=3C=CC=CC=3)C=2)OC)=C1 HPBSCHVBVALILK-QGZVFWFLSA-N 0.000 description 2
- BYKSGYZVONQAGM-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-(4-methoxypyridin-2-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2N=CC=C(OC)C=2)=C1 BYKSGYZVONQAGM-MRXNPFEDSA-N 0.000 description 2
- HRVFABQRESTMOP-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(4-methylsulfonylphenyl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=CC(=CC=2)S(C)(=O)=O)=C1 HRVFABQRESTMOP-QGZVFWFLSA-N 0.000 description 2
- KKINPXHCDRNLSJ-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-(5-methoxypyridin-2-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound N1=CC(OC)=CC=C1C1=CC(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)=CC=C1OC KKINPXHCDRNLSJ-GOSISDBHSA-N 0.000 description 2
- ZYLQOMQYBCTBNR-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-(5-methoxypyridin-2-yl)phenyl]methyl]-1-phenylethanamine Chemical compound N1=CC(OC)=CC=C1C1=CC(CN[C@H](C)C=2C=CC=CC=2)=CC=C1OC ZYLQOMQYBCTBNR-MRXNPFEDSA-N 0.000 description 2
- HYAUNHQDIZJPGJ-OAHLLOKOSA-N (1r)-n-[[4-methoxy-3-(6-methoxypyridazin-3-yl)phenyl]methyl]-1-(4-methoxyphenyl)ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=C(OC)C(C=2N=NC(OC)=CC=2)=C1 HYAUNHQDIZJPGJ-OAHLLOKOSA-N 0.000 description 2
- RAFGQJONJZLPFI-OAHLLOKOSA-N (1r)-n-[[4-methoxy-3-(6-methoxypyridazin-3-yl)phenyl]methyl]-1-phenylethanamine Chemical compound N1=NC(OC)=CC=C1C1=CC(CN[C@H](C)C=2C=CC=CC=2)=CC=C1OC RAFGQJONJZLPFI-OAHLLOKOSA-N 0.000 description 2
- FFOWWTNVPQCHFE-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-(6-methoxypyridin-3-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=NC(OC)=CC=2)=C1 FFOWWTNVPQCHFE-MRXNPFEDSA-N 0.000 description 2
- SGNXNSIBNJJANB-HXUWFJFHSA-N (1r)-n-[[4-methoxy-3-[1-(2,2,2-trifluoroethyl)indol-5-yl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=C2N(CC(F)(F)F)C=CC2=CC(C2=CC(CN[C@H](C)C=3C4=CC=CC=C4C=CC=3)=CC=C2OC)=C1 SGNXNSIBNJJANB-HXUWFJFHSA-N 0.000 description 2
- TVASUYFKSVJBTJ-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-[2-(2,2,2-trifluoroethoxy)pyridin-3-yl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C(=NC=CC=2)OCC(F)(F)F)OC)=CC=CC=C1 TVASUYFKSVJBTJ-MRXNPFEDSA-N 0.000 description 2
- LPBUYKORSBGTLI-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=C(C(F)(F)F)C=C1 LPBUYKORSBGTLI-GOSISDBHSA-N 0.000 description 2
- VVGNQFMJPISBJT-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-[6-(2-methoxyethoxy)pyridin-3-yl]phenyl]methyl]-1-phenylethanamine Chemical compound C1=NC(OCCOC)=CC=C1C1=CC(CN[C@H](C)C=2C=CC=CC=2)=CC=C1OC VVGNQFMJPISBJT-GOSISDBHSA-N 0.000 description 2
- FTKZYQAPFYXTBT-OAQYLSRUSA-N (1r)-n-[[4-methoxy-3-[6-(2-pyrrolidin-1-ylethoxy)pyridin-3-yl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=NC(OCCN3CCCC3)=CC=2)OC)=CC=CC=C1 FTKZYQAPFYXTBT-OAQYLSRUSA-N 0.000 description 2
- JRFWKLXVTAAZAB-INIZCTEOSA-N (1s)-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@H](C)NCC2=CC=C(C(=C2)C=2C=CC(=CC=2)C(F)(F)F)OC)=CC=CC=C1 JRFWKLXVTAAZAB-INIZCTEOSA-N 0.000 description 2
- ZUXLQZNUPRSYEX-UHFFFAOYSA-N (3-bromo-4-chlorophenyl)methanol Chemical compound OCC1=CC=C(Cl)C(Br)=C1 ZUXLQZNUPRSYEX-UHFFFAOYSA-N 0.000 description 2
- ZYUUROXGZLAEQH-UHFFFAOYSA-N (4-amino-3-bromophenyl)methanol Chemical compound NC1=CC=C(CO)C=C1Br ZYUUROXGZLAEQH-UHFFFAOYSA-N 0.000 description 2
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-bis(diphenylphosphino)propane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 2
- BMBXRSOMVWQNTK-UHFFFAOYSA-N 1-(1-methylindol-4-yl)ethanol Chemical compound CC(O)C1=CC=CC2=C1C=CN2C BMBXRSOMVWQNTK-UHFFFAOYSA-N 0.000 description 2
- PQFNLPYIXYDSGS-UHFFFAOYSA-N 1-(2,3-dichlorophenyl)-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound C1=C(C=2C=CC(=CC=2)C(F)(F)F)C(OC)=CC=C1CNC(C)C1=CC=CC(Cl)=C1Cl PQFNLPYIXYDSGS-UHFFFAOYSA-N 0.000 description 2
- JXJNOLWWZPDAKP-UHFFFAOYSA-N 1-(4-fluorophenyl)-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound C1=C(C=2C=CC(=CC=2)C(F)(F)F)C(OC)=CC=C1CNC(C)C1=CC=C(F)C=C1 JXJNOLWWZPDAKP-UHFFFAOYSA-N 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- IQVQNBXPYJGNEA-UHFFFAOYSA-N 1-pyridin-3-ylethanamine Chemical compound CC(N)C1=CC=CN=C1 IQVQNBXPYJGNEA-UHFFFAOYSA-N 0.000 description 2
- YSGOYTDRBSUDIA-UHFFFAOYSA-N 1-quinolin-5-ylethanone Chemical compound C1=CC=C2C(C(=O)C)=CC=CC2=N1 YSGOYTDRBSUDIA-UHFFFAOYSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- YZEMLDSDPMTXNH-UHFFFAOYSA-N 2-(4-methoxyphenyl)-4-[tri(propan-2-yloxy)methyl]aniline Chemical compound C1=CC(OC)=CC=C1C1=CC(C(OC(C)C)(OC(C)C)OC(C)C)=CC=C1N YZEMLDSDPMTXNH-UHFFFAOYSA-N 0.000 description 2
- MCCJUBZKMOGFGG-UHFFFAOYSA-N 2-[4-methoxy-4-[tri(propan-2-yloxy)methyl]cyclohexa-1,5-dien-1-yl]-n-phenylacetamide Chemical compound C1=CC(OC)(C(OC(C)C)(OC(C)C)OC(C)C)CC=C1CC(=O)NC1=CC=CC=C1 MCCJUBZKMOGFGG-UHFFFAOYSA-N 0.000 description 2
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- YRNMXIXKOWPVPY-UHFFFAOYSA-N 3-(1h-indol-5-yl)-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=CC=C(NC=C2)C2=C1 YRNMXIXKOWPVPY-UHFFFAOYSA-N 0.000 description 2
- FRCGSQXLKBTGDW-UHFFFAOYSA-N 3-(4-methoxyphenyl)-2-propoxybenzaldehyde Chemical compound C(CC)OC1=C(C=O)C=CC=C1C1=CC=C(C=C1)OC FRCGSQXLKBTGDW-UHFFFAOYSA-N 0.000 description 2
- UMJCWKDDKLTMIM-QGZVFWFLSA-N 3-(4-methoxyphenyl)-4-methyl-n-[(1r)-1-phenylethyl]benzamide Chemical compound C1=CC(OC)=CC=C1C1=CC(C(=O)N[C@H](C)C=2C=CC=CC=2)=CC=C1C UMJCWKDDKLTMIM-QGZVFWFLSA-N 0.000 description 2
- IOJFGJXEEWJADF-UHFFFAOYSA-N 3-(4-methoxyphenyl)-4-prop-2-ynoxybenzaldehyde Chemical compound C1=CC(OC)=CC=C1C1=CC(C=O)=CC=C1OCC#C IOJFGJXEEWJADF-UHFFFAOYSA-N 0.000 description 2
- WEGYGNROSJDEIW-UHFFFAOYSA-N 3-Acetylpyridine Chemical compound CC(=O)C1=CC=CN=C1 WEGYGNROSJDEIW-UHFFFAOYSA-N 0.000 description 2
- XBHDLTKMYDHGNX-UHFFFAOYSA-N 3-[1-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methylamino]ethyl]benzonitrile Chemical compound C1=C(C=2C=CC(=CC=2)C(F)(F)F)C(OC)=CC=C1CNC(C)C1=CC=CC(C#N)=C1 XBHDLTKMYDHGNX-UHFFFAOYSA-N 0.000 description 2
- LLFDODCZVIRMQP-GOSISDBHSA-N 3-[2-methoxy-5-[[[(1r)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]benzamide Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=CC(C(N)=O)=C1 LLFDODCZVIRMQP-GOSISDBHSA-N 0.000 description 2
- UXWHXQJLDWKIGT-UHFFFAOYSA-N 3-bromo-4-(3-chloropropoxy)benzaldehyde Chemical compound ClCCCOC1=CC=C(C=O)C=C1Br UXWHXQJLDWKIGT-UHFFFAOYSA-N 0.000 description 2
- AKDABJGHOOCVKX-UHFFFAOYSA-N 3-bromo-4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1Br AKDABJGHOOCVKX-UHFFFAOYSA-N 0.000 description 2
- RQHCEGIMPJEZGS-UHFFFAOYSA-N 3-bromo-4-ethylbenzaldehyde Chemical compound CCC1=CC=C(C=O)C=C1Br RQHCEGIMPJEZGS-UHFFFAOYSA-N 0.000 description 2
- XMEQDAIDOBVHEK-UHFFFAOYSA-N 3-bromo-4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C(Br)=C1 XMEQDAIDOBVHEK-UHFFFAOYSA-N 0.000 description 2
- OPVAAJSUIURGPJ-GFCCVEGCSA-N 3-bromo-4-methyl-n-[(1r)-1-phenylethyl]benzamide Chemical compound N([C@H](C)C=1C=CC=CC=1)C(=O)C1=CC=C(C)C(Br)=C1 OPVAAJSUIURGPJ-GFCCVEGCSA-N 0.000 description 2
- SYHJILPZUNKNHQ-UHFFFAOYSA-N 3-phenylbenzonitrile Chemical compound N#CC1=CC=CC(C=2C=CC=CC=2)=C1 SYHJILPZUNKNHQ-UHFFFAOYSA-N 0.000 description 2
- MDMAEOADUAUBPX-UHFFFAOYSA-N 4-(azidomethyl)-1-methoxy-2-(4-methoxyphenyl)benzene Chemical compound C1=CC(OC)=CC=C1C1=CC(CN=[N+]=[N-])=CC=C1OC MDMAEOADUAUBPX-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- NFZSYRISTIKLKE-UHFFFAOYSA-N 4-chloro-3-(4-methoxyphenyl)benzaldehyde Chemical compound C1=CC(OC)=CC=C1C1=CC(C=O)=CC=C1Cl NFZSYRISTIKLKE-UHFFFAOYSA-N 0.000 description 2
- JYOCALMCMKKFTN-UHFFFAOYSA-N 4-methoxy-3-(1-methyl-2h-pyridin-5-yl)benzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=CN(C)CC=C1 JYOCALMCMKKFTN-UHFFFAOYSA-N 0.000 description 2
- QBPGPLILJUJCOI-UHFFFAOYSA-N 4-methoxy-3-(5-methoxypyridin-3-yl)benzaldehyde Chemical compound COC1=CN=CC(C=2C(=CC=C(C=O)C=2)OC)=C1 QBPGPLILJUJCOI-UHFFFAOYSA-N 0.000 description 2
- LUQVCHRDAGWYMG-UHFFFAOYSA-N 4-phenylbenzamide Chemical compound C1=CC(C(=O)N)=CC=C1C1=CC=CC=C1 LUQVCHRDAGWYMG-UHFFFAOYSA-N 0.000 description 2
- ZVTWZSXLLMNMQC-UHFFFAOYSA-N 4-phenylmethoxybenzaldehyde Chemical compound C1=CC(C=O)=CC=C1OCC1=CC=CC=C1 ZVTWZSXLLMNMQC-UHFFFAOYSA-N 0.000 description 2
- FGXZWMCBNMMYPL-UHFFFAOYSA-N 4-propoxybenzaldehyde Chemical compound CCCOC1=CC=C(C=O)C=C1 FGXZWMCBNMMYPL-UHFFFAOYSA-N 0.000 description 2
- CELSXKJNHXMDLT-QGZVFWFLSA-N 5-[3-[[[(1r)-1-naphthalen-2-ylethyl]amino]methyl]phenyl]pyridine-3-carboxamide Chemical compound N([C@H](C)C=1C=C2C=CC=CC2=CC=1)CC(C=1)=CC=CC=1C1=CN=CC(C(N)=O)=C1 CELSXKJNHXMDLT-QGZVFWFLSA-N 0.000 description 2
- KMJMDIYGNFGEEO-UHFFFAOYSA-N 5-bromo-1-methylbenzimidazole Chemical compound BrC1=CC=C2N(C)C=NC2=C1 KMJMDIYGNFGEEO-UHFFFAOYSA-N 0.000 description 2
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- 108090000371 Esterases Proteins 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- 102000003982 Parathyroid hormone Human genes 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 2
- UPPIQDMTUVQILX-UHFFFAOYSA-N [4-methoxy-3-(4-methoxyphenyl)phenyl]methanamine Chemical compound C1=CC(OC)=CC=C1C1=CC(CN)=CC=C1OC UPPIQDMTUVQILX-UHFFFAOYSA-N 0.000 description 2
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 2
- 229940072056 alginate Drugs 0.000 description 2
- 235000010443 alginic acid Nutrition 0.000 description 2
- 229920000615 alginic acid Polymers 0.000 description 2
- 125000005197 alkyl carbonyloxy alkyl group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- BCQSFGOHLMCNRQ-UHFFFAOYSA-N benzyl 3-bromo-4-phenylmethoxybenzoate Chemical compound BrC1=CC(C(=O)OCC=2C=CC=CC=2)=CC=C1OCC1=CC=CC=C1 BCQSFGOHLMCNRQ-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 229910000085 borane Inorganic materials 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- KQIADDMXRMTWHZ-UHFFFAOYSA-N chloro-tri(propan-2-yl)silane Chemical compound CC(C)[Si](Cl)(C(C)C)C(C)C KQIADDMXRMTWHZ-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 230000036267 drug metabolism Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- GJLUMNPPVMAXLN-UHFFFAOYSA-N ethyl 4-hydroxy-3-(4-methoxyphenyl)benzoate Chemical compound CCOC(=O)C1=CC=C(O)C(C=2C=CC(OC)=CC=2)=C1 GJLUMNPPVMAXLN-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- AMWRITDGCCNYAT-UHFFFAOYSA-L hydroxy(oxo)manganese;manganese Chemical compound [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 210000003292 kidney cell Anatomy 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 230000000670 limiting effect Effects 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- DSVWNGDXVXSYDV-LJQANCHMSA-N n-[2-(4-methoxyphenyl)-4-[[[(1r)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]methanesulfonamide Chemical compound C1=CC(OC)=CC=C1C1=CC(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)=CC=C1NS(C)(=O)=O DSVWNGDXVXSYDV-LJQANCHMSA-N 0.000 description 2
- CVPIZWYXHSNOAB-GOSISDBHSA-N n-[5-[3-[[[(1r)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]pyridin-2-yl]acetamide Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=CC=1C1=CC=C(NC(C)=O)N=C1 CVPIZWYXHSNOAB-GOSISDBHSA-N 0.000 description 2
- QTLINIBRKADFPA-MRXNPFEDSA-N n-[5-[3-[[[(1r)-1-phenylethyl]amino]methyl]phenyl]pyridin-2-yl]acetamide Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=CC=1C1=CC=C(NC(C)=O)N=C1 QTLINIBRKADFPA-MRXNPFEDSA-N 0.000 description 2
- AHIFMUIPRCKANV-UHFFFAOYSA-N n-[[4-methoxy-3-(4-methoxyphenyl)phenyl]methyl]-1-(1-methyl-2,3-dihydroindol-4-yl)ethanamine Chemical compound C1=CC(OC)=CC=C1C1=CC(CNC(C)C=2C=3CCN(C)C=3C=CC=2)=CC=C1OC AHIFMUIPRCKANV-UHFFFAOYSA-N 0.000 description 2
- GVBAYEZDQMQHJN-UHFFFAOYSA-N n-[[4-methoxy-3-(4-methoxyphenyl)phenyl]methyl]-1-(1-methylindol-4-yl)ethanamine Chemical compound C1=CC(OC)=CC=C1C1=CC(CNC(C)C=2C=3C=CN(C)C=3C=CC=2)=CC=C1OC GVBAYEZDQMQHJN-UHFFFAOYSA-N 0.000 description 2
- DJUKUTNJXTZIBW-UHFFFAOYSA-N n-[[4-methoxy-3-(4-methoxyphenyl)phenyl]methyl]-1-pyridin-3-ylethanamine Chemical compound C1=CC(OC)=CC=C1C1=CC(CNC(C)C=2C=NC=CC=2)=CC=C1OC DJUKUTNJXTZIBW-UHFFFAOYSA-N 0.000 description 2
- ZRVABODAMIWCIW-UHFFFAOYSA-N n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-[3-(trifluoromethoxy)phenyl]ethanamine Chemical compound C1=C(C=2C=CC(=CC=2)C(F)(F)F)C(OC)=CC=C1CNC(C)C1=CC=CC(OC(F)(F)F)=C1 ZRVABODAMIWCIW-UHFFFAOYSA-N 0.000 description 2
- RCHKEJKUUXXBSM-UHFFFAOYSA-N n-benzyl-2-(3-formylindol-1-yl)acetamide Chemical compound C12=CC=CC=C2C(C=O)=CN1CC(=O)NCC1=CC=CC=C1 RCHKEJKUUXXBSM-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 239000000199 parathyroid hormone Substances 0.000 description 2
- 229960001319 parathyroid hormone Drugs 0.000 description 2
- 125000001792 phenanthrenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C=CC12)* 0.000 description 2
- 229960003424 phenylacetic acid Drugs 0.000 description 2
- 239000003279 phenylacetic acid Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 2
- ABMYEXAYWZJVOV-UHFFFAOYSA-N pyridin-3-ylboronic acid Chemical compound OB(O)C1=CC=CN=C1 ABMYEXAYWZJVOV-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- RUCKYCSNVTXGHW-UHFFFAOYSA-N quinolin-5-yl trifluoromethanesulfonate Chemical compound C1=CC=C2C(OS(=O)(=O)C(F)(F)F)=CC=CC2=N1 RUCKYCSNVTXGHW-UHFFFAOYSA-N 0.000 description 2
- 238000012552 review Methods 0.000 description 2
- 239000007909 solid dosage form Substances 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 2
- 238000011200 topical administration Methods 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- CENXHPMLCKYKNS-MRXNPFEDSA-N (1r)-1-(3-chlorophenyl)-n-[(4-methoxy-3-phenylphenyl)methyl]ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC=CC=2)OC)=CC=CC(Cl)=C1 CENXHPMLCKYKNS-MRXNPFEDSA-N 0.000 description 1
- NWXCOUAVLLJQEL-OAHLLOKOSA-N (1r)-1-(3-methoxyphenyl)-n-[(3-pyrazin-2-ylphenyl)methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2N=CC=NC=2)=C1 NWXCOUAVLLJQEL-OAHLLOKOSA-N 0.000 description 1
- GZPJGMFDATWJLC-OAHLLOKOSA-N (1r)-1-(3-methoxyphenyl)-n-[(4-methoxy-3-pyrimidin-2-ylphenyl)methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2N=CC=CN=2)=C1 GZPJGMFDATWJLC-OAHLLOKOSA-N 0.000 description 1
- QQELEPUXWIXVJW-OAHLLOKOSA-N (1r)-1-(3-methoxyphenyl)-n-[(4-methoxy-3-pyrimidin-5-ylphenyl)methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=NC=NC=2)=C1 QQELEPUXWIXVJW-OAHLLOKOSA-N 0.000 description 1
- DQYURPIGRJUKAY-OAHLLOKOSA-N (1r)-1-(3-methoxyphenyl)-n-[(4-methoxy-3-thiophen-3-ylphenyl)methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C2=CSC=C2)=C1 DQYURPIGRJUKAY-OAHLLOKOSA-N 0.000 description 1
- MFIOWAWKNRIBPG-CQSZACIVSA-N (1r)-1-(3-methoxyphenyl)-n-[[3-(1,3-thiazol-2-yl)phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2SC=CN=2)=C1 MFIOWAWKNRIBPG-CQSZACIVSA-N 0.000 description 1
- YXFPASVLGKUOBI-GOSISDBHSA-N (1r)-1-(3-methoxyphenyl)-n-[[3-(2-methylphenyl)phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2C(=CC=CC=2)C)=C1 YXFPASVLGKUOBI-GOSISDBHSA-N 0.000 description 1
- YAOTUHPBMUVMDI-OAHLLOKOSA-N (1r)-1-(3-methoxyphenyl)-n-[[4-methoxy-3-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=NC(OCC(F)(F)F)=NC=2)=C1 YAOTUHPBMUVMDI-OAHLLOKOSA-N 0.000 description 1
- LLXSNCFTBASYEL-MRXNPFEDSA-N (1r)-1-(3-methoxyphenyl)-n-[[4-methoxy-3-[6-(2,2,2-trifluoroethoxy)pyridin-3-yl]phenyl]methyl]ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=NC(OCC(F)(F)F)=CC=2)=C1 LLXSNCFTBASYEL-MRXNPFEDSA-N 0.000 description 1
- UDEPPSFJGSNBRB-OAHLLOKOSA-N (1r)-1-(4-methoxyphenyl)-n-[(3-pyrimidin-5-ylphenyl)methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2C=NC=NC=2)=C1 UDEPPSFJGSNBRB-OAHLLOKOSA-N 0.000 description 1
- YKRZLGBSMOIFOO-QGZVFWFLSA-N (1r)-1-(4-methoxyphenyl)-n-[(4-methoxy-3-phenylphenyl)methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=C(OC)C(C=2C=CC=CC=2)=C1 YKRZLGBSMOIFOO-QGZVFWFLSA-N 0.000 description 1
- GQLDOAQGUHPHDX-MRXNPFEDSA-N (1r)-1-(4-methoxyphenyl)-n-[(4-methoxy-3-pyridin-3-ylphenyl)methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=C(OC)C(C=2C=NC=CC=2)=C1 GQLDOAQGUHPHDX-MRXNPFEDSA-N 0.000 description 1
- ISLWACXLOOFFSS-OAHLLOKOSA-N (1r)-1-(4-methoxyphenyl)-n-[(4-methoxy-3-pyrimidin-2-ylphenyl)methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=C(OC)C(C=2N=CC=CN=2)=C1 ISLWACXLOOFFSS-OAHLLOKOSA-N 0.000 description 1
- SFJCFZJGOBUGPF-OAHLLOKOSA-N (1r)-1-(4-methoxyphenyl)-n-[(4-methoxy-3-thiophen-3-ylphenyl)methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=C(OC)C(C2=CSC=C2)=C1 SFJCFZJGOBUGPF-OAHLLOKOSA-N 0.000 description 1
- AHXGHORROBMHLB-CQSZACIVSA-N (1r)-1-(4-methoxyphenyl)-n-[[3-(1,3-thiazol-2-yl)phenyl]methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2SC=CN=2)=C1 AHXGHORROBMHLB-CQSZACIVSA-N 0.000 description 1
- MDEVREFIPFPTFZ-CQSZACIVSA-N (1r)-1-(4-methoxyphenyl)-n-[[4-methoxy-3-(1,3-thiazol-2-yl)phenyl]methyl]ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=C(OC)C(C=2SC=CN=2)=C1 MDEVREFIPFPTFZ-CQSZACIVSA-N 0.000 description 1
- YWBTUZOFINXFCK-QGZVFWFLSA-N (1r)-1-(4-methylphenyl)-n-[(3-pyridin-2-ylphenyl)methyl]ethanamine Chemical compound N([C@H](C)C=1C=CC(C)=CC=1)CC(C=1)=CC=CC=1C1=CC=CC=N1 YWBTUZOFINXFCK-QGZVFWFLSA-N 0.000 description 1
- VRPAMMSRFWARMW-MRXNPFEDSA-N (1r)-1-(4-methylphenyl)-n-[(3-pyrimidin-5-ylphenyl)methyl]ethanamine Chemical compound N([C@H](C)C=1C=CC(C)=CC=1)CC(C=1)=CC=CC=1C1=CN=CN=C1 VRPAMMSRFWARMW-MRXNPFEDSA-N 0.000 description 1
- UZDDXUMOXKDXNE-MRVPVSSYSA-N (1r)-1-(4-methylphenyl)ethanamine Chemical compound C[C@@H](N)C1=CC=C(C)C=C1 UZDDXUMOXKDXNE-MRVPVSSYSA-N 0.000 description 1
- FISAQMZKSQESPQ-GOSISDBHSA-N (1r)-1-[3-(2-methoxyethoxy)phenyl]-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound COCCOC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=CC(=CC=2)C(F)(F)F)=C1 FISAQMZKSQESPQ-GOSISDBHSA-N 0.000 description 1
- LGAUOUIZCQFUHE-GOSISDBHSA-N (1r)-1-naphthalen-1-yl-n-[(3-pyridin-2-ylphenyl)methyl]ethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=CC=1C1=CC=CC=N1 LGAUOUIZCQFUHE-GOSISDBHSA-N 0.000 description 1
- OMFGURUUFPXTOC-GOSISDBHSA-N (1r)-1-naphthalen-1-yl-n-[[4-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=C(OCC(F)(F)F)C=1C1=CC=C(C(F)(F)F)C=C1 OMFGURUUFPXTOC-GOSISDBHSA-N 0.000 description 1
- UQTSIKLADBNSBC-OAHLLOKOSA-N (1r)-1-phenyl-n-[(3-pyrimidin-5-ylphenyl)methyl]ethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=CC=1C1=CN=CN=C1 UQTSIKLADBNSBC-OAHLLOKOSA-N 0.000 description 1
- UHHZTWLSQNZZII-MRXNPFEDSA-N (1r)-1-phenyl-n-[[4-(2,2,2-trifluoroethoxy)-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=C(OCC(F)(F)F)C=1C1=CC=C(C(F)(F)F)C=C1 UHHZTWLSQNZZII-MRXNPFEDSA-N 0.000 description 1
- AQFLVLHRZFLDDV-SECBINFHSA-N (1r)-1-phenylpropan-1-amine Chemical compound CC[C@@H](N)C1=CC=CC=C1 AQFLVLHRZFLDDV-SECBINFHSA-N 0.000 description 1
- XWPKEZIIMVKERI-LJQANCHMSA-N (1r)-n-[(3-imidazo[1,2-a]pyridin-6-yl-4-methoxyphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=CC2=NC=CN2C=C1C1=CC(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)=CC=C1OC XWPKEZIIMVKERI-LJQANCHMSA-N 0.000 description 1
- FNSGOKYUEILUDV-MRXNPFEDSA-N (1r)-n-[(3-morpholin-4-ylsulfonylphenyl)methyl]-1-phenylethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=CC=1S(=O)(=O)N1CCOCC1 FNSGOKYUEILUDV-MRXNPFEDSA-N 0.000 description 1
- KUKYRAUPUYFOON-SNVBAGLBSA-N (1r)-n-[(4-chloro-3-iodophenyl)methyl]-1-(3-fluorophenyl)ethanamine Chemical compound N([C@H](C)C=1C=C(F)C=CC=1)CC1=CC=C(Cl)C(I)=C1 KUKYRAUPUYFOON-SNVBAGLBSA-N 0.000 description 1
- VMCPXHQJRCZIDX-QGZVFWFLSA-N (1r)-n-[(4-chloro-3-pyridin-3-ylphenyl)methyl]-1-naphthalen-1-ylethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=C(Cl)C=1C1=CC=CN=C1 VMCPXHQJRCZIDX-QGZVFWFLSA-N 0.000 description 1
- AAFPMYPRQVVASA-MRXNPFEDSA-N (1r)-n-[(4-methoxy-3-pyrazin-2-ylphenyl)methyl]-1-(4-methylphenyl)ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2N=CC=NC=2)OC)=CC=C(C)C=C1 AAFPMYPRQVVASA-MRXNPFEDSA-N 0.000 description 1
- KJGOMOIHQVBXMP-OAHLLOKOSA-N (1r)-n-[(4-methoxy-3-pyrimidin-5-ylphenyl)methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=NC=NC=2)OC)=CC=CC=C1 KJGOMOIHQVBXMP-OAHLLOKOSA-N 0.000 description 1
- WHKASSQWFWSTIK-OAHLLOKOSA-N (1r)-n-[(4-methoxy-3-thiophen-3-ylphenyl)methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C2=CSC=C2)OC)=CC=CC=C1 WHKASSQWFWSTIK-OAHLLOKOSA-N 0.000 description 1
- WSDVIJDHNSAPQB-QGZVFWFLSA-N (1r)-n-[[3-(1,3-benzodioxol-5-yl)phenyl]methyl]-1-(4-methylphenyl)ethanamine Chemical compound C1([C@H](NCC=2C=C(C=CC=2)C=2C=C3OCOC3=CC=2)C)=CC=C(C)C=C1 WSDVIJDHNSAPQB-QGZVFWFLSA-N 0.000 description 1
- FJYSQTWDYZACAV-MRXNPFEDSA-N (1r)-n-[[3-(1,3-benzoxazol-5-yl)-4-methoxyphenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C3N=COC3=CC=2)=C1 FJYSQTWDYZACAV-MRXNPFEDSA-N 0.000 description 1
- AZUHDGIJNKMQQS-QGZVFWFLSA-N (1r)-n-[[3-(1h-indol-5-yl)-4-methoxyphenyl]methyl]-1-(4-methoxyphenyl)ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=C(OC)C(C=2C=C3C=CNC3=CC=2)=C1 AZUHDGIJNKMQQS-QGZVFWFLSA-N 0.000 description 1
- WAEFWRVHKCJUDP-HXUWFJFHSA-N (1r)-n-[[3-(3,4-dimethylphenyl)phenyl]methyl]-1-(4-methylphenyl)ethanamine Chemical compound N([C@H](C)C=1C=CC(C)=CC=1)CC(C=1)=CC=CC=1C1=CC=C(C)C(C)=C1 WAEFWRVHKCJUDP-HXUWFJFHSA-N 0.000 description 1
- FXWKCFKUHZTYJT-QGZVFWFLSA-N (1r)-n-[[3-(3-methoxyphenyl)phenyl]methyl]-1-phenylethanamine Chemical compound COC1=CC=CC(C=2C=C(CN[C@H](C)C=3C=CC=CC=3)C=CC=2)=C1 FXWKCFKUHZTYJT-QGZVFWFLSA-N 0.000 description 1
- CNWAQPPKLMRSLN-CYBMUJFWSA-N (1r)-n-[[3-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]-1-phenylethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=CC=1C1=NC(C)=NO1 CNWAQPPKLMRSLN-CYBMUJFWSA-N 0.000 description 1
- IIBDGGYPQWHSBE-GOSISDBHSA-N (1r)-n-[[3-(4-chlorophenyl)-4-methoxyphenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=C(Cl)C=C1 IIBDGGYPQWHSBE-GOSISDBHSA-N 0.000 description 1
- GUORSWHNSVGKKX-QGZVFWFLSA-N (1r)-n-[[3-(4-fluorophenyl)-4-methoxyphenyl]methyl]-1-(4-methylphenyl)ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC(F)=CC=2)OC)=CC=C(C)C=C1 GUORSWHNSVGKKX-QGZVFWFLSA-N 0.000 description 1
- MMLDGCXJAYTHIV-MRXNPFEDSA-N (1r)-n-[[3-(4-fluorophenyl)phenyl]methyl]-1-phenylethanamine Chemical compound N([C@H](C)C=1C=CC=CC=1)CC(C=1)=CC=CC=1C1=CC=C(F)C=C1 MMLDGCXJAYTHIV-MRXNPFEDSA-N 0.000 description 1
- BXYCGRUPUIPEGJ-QGZVFWFLSA-N (1r)-n-[[3-(6-methoxypyridazin-3-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound N1=NC(OC)=CC=C1C1=CC=CC(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)=C1 BXYCGRUPUIPEGJ-QGZVFWFLSA-N 0.000 description 1
- CYUKHDOCAJDOBY-LJQANCHMSA-N (1r)-n-[[3-(6-methylpyridin-3-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=CC=1C1=CC=C(C)N=C1 CYUKHDOCAJDOBY-LJQANCHMSA-N 0.000 description 1
- WPRPTCJCRFKEAL-LJQANCHMSA-N (1r)-n-[[3-(6-methylpyridin-3-yl)phenyl]methyl]-1-naphthalen-2-ylethanamine Chemical compound N([C@H](C)C=1C=C2C=CC=CC2=CC=1)CC(C=1)=CC=CC=1C1=CC=C(C)N=C1 WPRPTCJCRFKEAL-LJQANCHMSA-N 0.000 description 1
- XKJKNEAJVCFCFT-OAHLLOKOSA-N (1r)-n-[[3-(furan-3-yl)phenyl]methyl]-1-(4-methoxyphenyl)ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C2=COC=C2)=C1 XKJKNEAJVCFCFT-OAHLLOKOSA-N 0.000 description 1
- JKRGCDUZYXCLMV-HXUWFJFHSA-N (1r)-n-[[3-[1-(cyclopropylmethyl)indol-5-yl]-4-methoxyphenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C3C=CN(CC4CC4)C3=CC=2)=C1 JKRGCDUZYXCLMV-HXUWFJFHSA-N 0.000 description 1
- NTWOICPVPBTDAC-QGZVFWFLSA-N (1r)-n-[[3-[6-(2-aminoethoxy)pyridin-3-yl]-4-methoxyphenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=NC(OCCN)=CC=2)OC)=CC=CC=C1 NTWOICPVPBTDAC-QGZVFWFLSA-N 0.000 description 1
- SJDRCMZXABNNQD-OAHLLOKOSA-N (1r)-n-[[4-(difluoromethoxy)-3-pyridin-3-ylphenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC(F)F)=CC=2)C=2C=NC=CC=2)=C1 SJDRCMZXABNNQD-OAHLLOKOSA-N 0.000 description 1
- VEVVGCJSNNJLMF-OAHLLOKOSA-N (1r)-n-[[4-fluoro-3-(4-fluorophenyl)phenyl]methyl]-1-(4-methoxyphenyl)ethanamine Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=C(F)C(C=2C=CC(F)=CC=2)=C1 VEVVGCJSNNJLMF-OAHLLOKOSA-N 0.000 description 1
- YFFZAKRELYJIDL-QGZVFWFLSA-N (1r)-n-[[4-fluoro-3-(4-methoxyphenyl)phenyl]methyl]-1-(4-methylphenyl)ethanamine Chemical compound C1=CC(OC)=CC=C1C1=CC(CN[C@H](C)C=2C=CC(C)=CC=2)=CC=C1F YFFZAKRELYJIDL-QGZVFWFLSA-N 0.000 description 1
- QTIDRHPCSUWDGX-MRXNPFEDSA-N (1r)-n-[[4-fluoro-3-(4-methoxyphenyl)phenyl]methyl]-1-phenylethanamine Chemical compound C1=CC(OC)=CC=C1C1=CC(CN[C@H](C)C=2C=CC=CC=2)=CC=C1F QTIDRHPCSUWDGX-MRXNPFEDSA-N 0.000 description 1
- OAPOKFGMIBCCMA-OAHLLOKOSA-N (1r)-n-[[4-methoxy-3-(1,3-thiazol-2-yl)phenyl]methyl]-1-(4-methylphenyl)ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2SC=CN=2)OC)=CC=C(C)C=C1 OAPOKFGMIBCCMA-OAHLLOKOSA-N 0.000 description 1
- XPBDKKDINIWPIO-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-(1,3-thiazol-2-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=NC=CS1 XPBDKKDINIWPIO-MRXNPFEDSA-N 0.000 description 1
- PNAZGXMRBLPJBS-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-(1,3-thiazol-2-yl)phenyl]methyl]-1-naphthalen-2-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C=C3C=CC=CC3=CC=2)C=C1C1=NC=CS1 PNAZGXMRBLPJBS-MRXNPFEDSA-N 0.000 description 1
- TXNOQQKQTJODOS-CQSZACIVSA-N (1r)-n-[[4-methoxy-3-(1,3-thiazol-2-yl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2SC=CN=2)OC)=CC=CC=C1 TXNOQQKQTJODOS-CQSZACIVSA-N 0.000 description 1
- XQKCCHOFCBXYPS-LJQANCHMSA-N (1r)-n-[[4-methoxy-3-(1-methylbenzimidazol-5-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound C1=C2N(C)C=NC2=CC(C2=CC(CN[C@H](C)C=3C4=CC=CC=C4C=CC=3)=CC=C2OC)=C1 XQKCCHOFCBXYPS-LJQANCHMSA-N 0.000 description 1
- IIDQXRCODYLEGP-LJQANCHMSA-N (1r)-n-[[4-methoxy-3-(1-methylpiperidin-4-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1CCN(C)CC1 IIDQXRCODYLEGP-LJQANCHMSA-N 0.000 description 1
- BJBKUUDZLHWGQQ-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(2-methoxyphenyl)phenyl]methyl]-1-phenylethanamine Chemical compound COC1=CC=CC=C1C1=CC(CN[C@H](C)C=2C=CC=CC=2)=CC=C1OC BJBKUUDZLHWGQQ-QGZVFWFLSA-N 0.000 description 1
- KHNMVIBFFDHICX-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-(2-methyl-1,3-benzoxazol-5-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C3N=C(C)OC3=CC=2)=C1 KHNMVIBFFDHICX-MRXNPFEDSA-N 0.000 description 1
- XYHAIUUASPEVQZ-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-(2-methyl-1,3-thiazol-4-yl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CSC(C)=N1 XYHAIUUASPEVQZ-MRXNPFEDSA-N 0.000 description 1
- YPDYFVKJXXHFPI-LJQANCHMSA-N (1r)-n-[[4-methoxy-3-(3-methoxyphenyl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=CC(C=2C(=CC=C(CN[C@H](C)C=3C4=CC=CC=C4C=CC=3)C=2)OC)=C1 YPDYFVKJXXHFPI-LJQANCHMSA-N 0.000 description 1
- JBHLFDCLQXMHRH-HSZRJFAPSA-N (1r)-n-[[4-methoxy-3-(4-methoxyphenyl)phenyl]methyl]-1-phenylpropan-1-amine Chemical compound N([C@H](CC)C=1C=CC=CC=1)CC(C=1)=CC=C(OC)C=1C1=CC=C(OC)C=C1 JBHLFDCLQXMHRH-HSZRJFAPSA-N 0.000 description 1
- IRCREHFABZFJOK-LJQANCHMSA-N (1r)-n-[[4-methoxy-3-(4-methylsulfonylphenyl)phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=C(S(C)(=O)=O)C=C1 IRCREHFABZFJOK-LJQANCHMSA-N 0.000 description 1
- JCAFYUIQCYIVBH-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(4-methylsulfonylphenyl)phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC(=CC=2)S(C)(=O)=O)OC)=CC=CC=C1 JCAFYUIQCYIVBH-QGZVFWFLSA-N 0.000 description 1
- AYIDNHXRDSHJNR-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-(5-methoxypyridin-2-yl)phenyl]methyl]-1-(3-methoxyphenyl)ethanamine Chemical compound N1=CC(OC)=CC=C1C1=CC(CN[C@H](C)C=2C=C(OC)C=CC=2)=CC=C1OC AYIDNHXRDSHJNR-MRXNPFEDSA-N 0.000 description 1
- MEOUFMKWTNUCNL-QGZVFWFLSA-N (1r)-n-[[4-methoxy-3-(6-methoxypyridazin-3-yl)phenyl]methyl]-1-naphthalen-2-ylethanamine Chemical compound N1=NC(OC)=CC=C1C1=CC(CN[C@H](C)C=2C=C3C=CC=CC3=CC=2)=CC=C1OC MEOUFMKWTNUCNL-QGZVFWFLSA-N 0.000 description 1
- BNKNTUQDEOUALS-GOSISDBHSA-N (1r)-n-[[4-methoxy-3-(6-methylpyridin-3-yl)phenyl]methyl]-1-(4-methylphenyl)ethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=NC(C)=CC=2)OC)=CC=C(C)C=C1 BNKNTUQDEOUALS-GOSISDBHSA-N 0.000 description 1
- GGCMGVRNCAZBRK-MRXNPFEDSA-N (1r)-n-[[4-methoxy-3-[4-(trifluoromethoxy)phenyl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC(OC(F)(F)F)=CC=2)OC)=CC=CC=C1 GGCMGVRNCAZBRK-MRXNPFEDSA-N 0.000 description 1
- GCBQZTUDIRQZEM-GFCCVEGCSA-N (1r)-n-[[4-methoxy-3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-1-phenylethanamine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2OC(=NN=2)C(F)(F)F)OC)=CC=CC=C1 GCBQZTUDIRQZEM-GFCCVEGCSA-N 0.000 description 1
- MWLZEZUZQHUBRJ-HSZRJFAPSA-N (1r)-n-[[4-methoxy-3-[6-(2-pyrrolidin-1-ylethoxy)pyridin-3-yl]phenyl]methyl]-1-naphthalen-1-ylethanamine Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C(C=N1)=CC=C1OCCN1CCCC1 MWLZEZUZQHUBRJ-HSZRJFAPSA-N 0.000 description 1
- SOCAXRLFGRNEPK-IFZYUDKTSA-N (1r,3s,5r)-2-n-[1-carbamoyl-5-(cyanomethoxy)indol-3-yl]-3-n-[(3-chloro-2-fluorophenyl)methyl]-2-azabicyclo[3.1.0]hexane-2,3-dicarboxamide Chemical compound O=C([C@@H]1C[C@H]2C[C@H]2N1C(=O)NC1=CN(C2=CC=C(OCC#N)C=C21)C(=O)N)NCC1=CC=CC(Cl)=C1F SOCAXRLFGRNEPK-IFZYUDKTSA-N 0.000 description 1
- DGFCTCGCMKEILT-UHFFFAOYSA-N (2-ethoxyphenyl)boronic acid Chemical compound CCOC1=CC=CC=C1B(O)O DGFCTCGCMKEILT-UHFFFAOYSA-N 0.000 description 1
- XMLWFNOAIKVBHS-UHFFFAOYSA-N (2-methoxy-5-phenylphenyl)boronic acid Chemical compound COC1=C(C=C(C=C1)C1=CC=CC=C1)B(O)O XMLWFNOAIKVBHS-UHFFFAOYSA-N 0.000 description 1
- DOMQFIFVDIAOOT-ROUUACIJSA-N (2S,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylpyridin-3-yl)-1,2,4-triazol-3-yl]-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide Chemical compound COC1=C(C(=CC=C1)OC)N1C(=NN=C1C=1C=NC=C(C=1)C)NS(=O)(=O)[C@@H](C)[C@H](C)C1=NC=C(C=N1)C DOMQFIFVDIAOOT-ROUUACIJSA-N 0.000 description 1
- DNISEZBAYYIQFB-PHDIDXHHSA-N (2r,3r)-2,3-diacetyloxybutanedioic acid Chemical compound CC(=O)O[C@@H](C(O)=O)[C@H](C(O)=O)OC(C)=O DNISEZBAYYIQFB-PHDIDXHHSA-N 0.000 description 1
- RCVDPBFUMYUKPB-UHFFFAOYSA-N (3,4-dimethoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1OC RCVDPBFUMYUKPB-UHFFFAOYSA-N 0.000 description 1
- HTNVFUBCWIYPJN-HSZRJFAPSA-N (3r)-3,5-dimethyl-3-(4-methylpent-3-enyl)-11h-pyrano[3,2-a]carbazole Chemical compound C1=CC=C2C3=CC(C)=C4O[C@@](CCC=C(C)C)(C)C=CC4=C3NC2=C1 HTNVFUBCWIYPJN-HSZRJFAPSA-N 0.000 description 1
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 1
- HGRWHBQLRXWSLV-DEOSSOPVSA-N (4s)-3'-(3,6-dihydro-2h-pyran-5-yl)-1'-fluoro-7'-(3-fluoropyridin-2-yl)spiro[5h-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine Chemical compound C1OC(N)=N[C@]21C1=CC(C=3COCCC=3)=NC(F)=C1OC1=CC=C(C=3C(=CC=CN=3)F)C=C12 HGRWHBQLRXWSLV-DEOSSOPVSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- UKGJZDSUJSPAJL-YPUOHESYSA-N (e)-n-[(1r)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)pyridin-3-yl]prop-2-enamide Chemical compound CCCC1=NC(C(F)(F)F)=CC=C1\C=C\C(=O)N[C@H](C)C1=CC(F)=C(NS(C)(=O)=O)C(F)=C1 UKGJZDSUJSPAJL-YPUOHESYSA-N 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- HDPNBNXLBDFELL-UHFFFAOYSA-N 1,1,1-trimethoxyethane Chemical compound COC(C)(OC)OC HDPNBNXLBDFELL-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- SWJPEBQEEAHIGZ-UHFFFAOYSA-N 1,4-dibromobenzene Chemical compound BrC1=CC=C(Br)C=C1 SWJPEBQEEAHIGZ-UHFFFAOYSA-N 0.000 description 1
- XUYQRHWGVJCEEC-UHFFFAOYSA-N 1-(1-methyl-2,3-dihydroindol-4-yl)ethanamine Chemical compound CC(N)C1=CC=CC2=C1CCN2C XUYQRHWGVJCEEC-UHFFFAOYSA-N 0.000 description 1
- SVUKISNBRDNDMF-UHFFFAOYSA-N 1-(1-methylindol-2-yl)ethanone Chemical compound C1=CC=C2N(C)C(C(=O)C)=CC2=C1 SVUKISNBRDNDMF-UHFFFAOYSA-N 0.000 description 1
- ASUMTUNMRMQBAM-UHFFFAOYSA-N 1-(1-methylindol-4-yl)ethanone Chemical compound CC(=O)C1=CC=CC2=C1C=CN2C ASUMTUNMRMQBAM-UHFFFAOYSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- VCMZJDCTOSLTLN-UHFFFAOYSA-N 1-(2,2,2-trifluoroethyl)pyridin-2-one Chemical compound FC(F)(F)CN1C=CC=CC1=O VCMZJDCTOSLTLN-UHFFFAOYSA-N 0.000 description 1
- MJUVRTYWUMPBTR-MRXNPFEDSA-N 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-n-[1-[(2r)-2,3-dihydroxypropyl]-6-fluoro-2-(1-hydroxy-2-methylpropan-2-yl)indol-5-yl]cyclopropane-1-carboxamide Chemical compound FC=1C=C2N(C[C@@H](O)CO)C(C(C)(CO)C)=CC2=CC=1NC(=O)C1(C=2C=C3OC(F)(F)OC3=CC=2)CC1 MJUVRTYWUMPBTR-MRXNPFEDSA-N 0.000 description 1
- HVPQBOKQESIJLN-GOSISDBHSA-N 1-(2-methoxyethyl)-5-[2-methoxy-5-[[[(1r)-1-phenylethyl]amino]methyl]phenyl]pyridin-2-one Chemical compound C1=CC(=O)N(CCOC)C=C1C1=CC(CN[C@H](C)C=2C=CC=CC=2)=CC=C1OC HVPQBOKQESIJLN-GOSISDBHSA-N 0.000 description 1
- JTDGKQNNPKXKII-UHFFFAOYSA-N 1-(4-methoxyphenyl)ethanamine Chemical compound COC1=CC=C(C(C)N)C=C1 JTDGKQNNPKXKII-UHFFFAOYSA-N 0.000 description 1
- UZDDXUMOXKDXNE-UHFFFAOYSA-N 1-(4-methylphenyl)ethanamine Chemical compound CC(N)C1=CC=C(C)C=C1 UZDDXUMOXKDXNE-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical group C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- OWNZUYNYCDIKHA-LJQANCHMSA-N 1-[4-[2-methoxy-5-[[[(1r)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]piperidin-1-yl]ethanone Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1CCN(C(C)=O)CC1 OWNZUYNYCDIKHA-LJQANCHMSA-N 0.000 description 1
- PLDWAJLZAAHOGG-UHFFFAOYSA-N 1-bromo-3-methoxybenzene Chemical compound COC1=CC=CC(Br)=C1 PLDWAJLZAAHOGG-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- VUQPJRPDRDVQMN-UHFFFAOYSA-N 1-chlorooctadecane Chemical class CCCCCCCCCCCCCCCCCCCl VUQPJRPDRDVQMN-UHFFFAOYSA-N 0.000 description 1
- GBCCSSNDQZEQMJ-UHFFFAOYSA-N 1-methoxy-2-(4-methoxyphenyl)benzene Chemical group C1=CC(OC)=CC=C1C1=CC=CC=C1OC GBCCSSNDQZEQMJ-UHFFFAOYSA-N 0.000 description 1
- GFTNSZIYQMJJMD-UHFFFAOYSA-N 1-methylindole-4-carbaldehyde Chemical compound C1=CC=C2N(C)C=CC2=C1C=O GFTNSZIYQMJJMD-UHFFFAOYSA-N 0.000 description 1
- KYWCUACNBIYDNL-UHFFFAOYSA-N 1-oxo-2h-isoquinoline-3-carboxylic acid Chemical compound C1=CC=C2C(=O)NC(C(=O)O)=CC2=C1 KYWCUACNBIYDNL-UHFFFAOYSA-N 0.000 description 1
- OMNCAMLXMUWIRR-UHFFFAOYSA-N 1-phenylpentane-2,3-diamine Chemical class CCC(N)C(N)CC1=CC=CC=C1 OMNCAMLXMUWIRR-UHFFFAOYSA-N 0.000 description 1
- WMQUKDQWMMOHSA-UHFFFAOYSA-N 1-pyridin-4-ylethanone Chemical compound CC(=O)C1=CC=NC=C1 WMQUKDQWMMOHSA-UHFFFAOYSA-N 0.000 description 1
- DSIDLSUPGTYHPZ-UHFFFAOYSA-N 1-quinolin-4-ylethanol Chemical compound C1=CC=C2C(C(O)C)=CC=NC2=C1 DSIDLSUPGTYHPZ-UHFFFAOYSA-N 0.000 description 1
- SHVCKCOMBWIPBE-UHFFFAOYSA-N 1-quinolin-8-ylethanone Chemical compound C1=CN=C2C(C(=O)C)=CC=CC2=C1 SHVCKCOMBWIPBE-UHFFFAOYSA-N 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical group C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- CEUFGDDOMXCXFW-UHFFFAOYSA-N 1h-indole-4-carbonitrile Chemical compound N#CC1=CC=CC2=C1C=CN2 CEUFGDDOMXCXFW-UHFFFAOYSA-N 0.000 description 1
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 1
- ZWAANBFAJSCNEF-UHFFFAOYSA-N 2,2,2-trifluoro-n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-phenylethanamine Chemical compound C1=C(C=2C=CC(=CC=2)C(F)(F)F)C(OC)=CC=C1CNC(C(F)(F)F)C1=CC=CC=C1 ZWAANBFAJSCNEF-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- ZNJRONVKWRHYBF-UHFFFAOYSA-N 2-[2-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-6-methylpyran-4-ylidene]propanedinitrile Chemical compound O1C(C)=CC(=C(C#N)C#N)C=C1C=CC1=CC(CCCN2CCC3)=C2C3=C1 ZNJRONVKWRHYBF-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- NILGQLAVUYVEAW-UHFFFAOYSA-N 2-[4-(hydroxymethyl)-4-methoxycyclohexa-1,5-dien-1-yl]-n-phenylacetamide Chemical compound C1=CC(OC)(CO)CC=C1CC(=O)NC1=CC=CC=C1 NILGQLAVUYVEAW-UHFFFAOYSA-N 0.000 description 1
- JHRIPENGTGSNPJ-UHFFFAOYSA-N 2-amino-4-bromophenol Chemical compound NC1=CC(Br)=CC=C1O JHRIPENGTGSNPJ-UHFFFAOYSA-N 0.000 description 1
- KMGUEILFFWDGFV-UHFFFAOYSA-N 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid Chemical compound C=1C=CC=CC=1C(=O)C(C(C(O)=O)O)(C(O)=O)OC(=O)C1=CC=CC=C1 KMGUEILFFWDGFV-UHFFFAOYSA-N 0.000 description 1
- PHPYXVIHDRDPDI-UHFFFAOYSA-N 2-bromo-1h-benzimidazole Chemical compound C1=CC=C2NC(Br)=NC2=C1 PHPYXVIHDRDPDI-UHFFFAOYSA-N 0.000 description 1
- IMRWILPUOVGIMU-UHFFFAOYSA-N 2-bromopyridine Chemical compound BrC1=CC=CC=N1 IMRWILPUOVGIMU-UHFFFAOYSA-N 0.000 description 1
- AYPSHJCKSDNETA-UHFFFAOYSA-N 2-chloro-1h-benzimidazole Chemical compound C1=CC=C2NC(Cl)=NC2=C1 AYPSHJCKSDNETA-UHFFFAOYSA-N 0.000 description 1
- MYNNBHRMYMRFCM-HXUWFJFHSA-N 2-methoxy-1-[4-[2-methoxy-5-[[[(1r)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)COC)CCC1C1=CC(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)=CC=C1OC MYNNBHRMYMRFCM-HXUWFJFHSA-N 0.000 description 1
- RUJHATQMIMUYKD-UHFFFAOYSA-N 2-naphthalen-1-ylethanamine Chemical compound C1=CC=C2C(CCN)=CC=CC2=C1 RUJHATQMIMUYKD-UHFFFAOYSA-N 0.000 description 1
- 229940080296 2-naphthalenesulfonate Drugs 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical class BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- SOSPMXMEOFGPIM-UHFFFAOYSA-N 3,5-dibromopyridine Chemical compound BrC1=CN=CC(Br)=C1 SOSPMXMEOFGPIM-UHFFFAOYSA-N 0.000 description 1
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- RIVTYXDIBVNZND-OAHLLOKOSA-N 3-(2-chloropyridin-4-yl)-4-methoxy-N-methyl-N-[(1R)-1-phenylethyl]aniline Chemical compound ClC1=NC=CC(=C1)C=1C=C(C=CC1OC)N([C@H](C)C1=CC=CC=C1)C RIVTYXDIBVNZND-OAHLLOKOSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- WHSKVOQOPDRJEW-UHFFFAOYSA-N 3-(4-fluorophenyl)-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=CC=C(F)C=C1 WHSKVOQOPDRJEW-UHFFFAOYSA-N 0.000 description 1
- YGYGASJNJTYNOL-CQSZACIVSA-N 3-[(4r)-2,2-dimethyl-1,1-dioxothian-4-yl]-5-(4-fluorophenyl)-1h-indole-7-carboxamide Chemical compound C1CS(=O)(=O)C(C)(C)C[C@@H]1C1=CNC2=C(C(N)=O)C=C(C=3C=CC(F)=CC=3)C=C12 YGYGASJNJTYNOL-CQSZACIVSA-N 0.000 description 1
- PXGJAFVMTAUEFF-MRXNPFEDSA-N 3-[2-methoxy-5-[[[(1r)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]benzoic acid Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C(C=CC=2)C(O)=O)=C1 PXGJAFVMTAUEFF-MRXNPFEDSA-N 0.000 description 1
- SHHXNYWUMGQDCB-QGZVFWFLSA-N 3-[2-methoxy-5-[[[(1r)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]benzonitrile Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2C=C(C=CC=2)C#N)=C1 SHHXNYWUMGQDCB-QGZVFWFLSA-N 0.000 description 1
- RMBKYBFGIFKVMD-GOSISDBHSA-N 3-[2-methoxy-5-[[[(1r)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]benzoic acid Chemical compound COC1=CC=C(CN[C@H](C)C=2C3=CC=CC=C3C=CC=2)C=C1C1=CC=CC(C(O)=O)=C1 RMBKYBFGIFKVMD-GOSISDBHSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- ICVODPFGWCUVJC-UHFFFAOYSA-N 3-bromo-4,5-dimethoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC(Br)=C1OC ICVODPFGWCUVJC-UHFFFAOYSA-N 0.000 description 1
- XMPVMXZVOFUFNH-UHFFFAOYSA-N 3-bromo-4-(cyclopropylmethoxy)benzaldehyde Chemical compound BrC1=CC(C=O)=CC=C1OCC1CC1 XMPVMXZVOFUFNH-UHFFFAOYSA-N 0.000 description 1
- NLEPZGNUPNMRGF-UHFFFAOYSA-N 3-bromo-4-chlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C(Br)=C1 NLEPZGNUPNMRGF-UHFFFAOYSA-N 0.000 description 1
- QMPNFQLVIGPNEI-UHFFFAOYSA-N 3-bromo-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1Br QMPNFQLVIGPNEI-UHFFFAOYSA-N 0.000 description 1
- ZFJOMUKPDWNRFI-UHFFFAOYSA-N 3-bromo-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C=C1Br ZFJOMUKPDWNRFI-UHFFFAOYSA-N 0.000 description 1
- LQBIFQKBCLOXHC-UHFFFAOYSA-N 3-bromo-4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1Br LQBIFQKBCLOXHC-UHFFFAOYSA-N 0.000 description 1
- SDBUQQVMQXOGBO-UHFFFAOYSA-N 3-chloro-4-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=C(C=O)C=C1Cl SDBUQQVMQXOGBO-UHFFFAOYSA-N 0.000 description 1
- ZRPLANDPDWYOMZ-UHFFFAOYSA-N 3-cyclopentylpropionic acid Chemical compound OC(=O)CCC1CCCC1 ZRPLANDPDWYOMZ-UHFFFAOYSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- IYZIARNSXPGYSC-UHFFFAOYSA-N 3-phenylbenzamide Chemical compound NC(=O)C1=CC=CC(C=2C=CC=CC=2)=C1 IYZIARNSXPGYSC-UHFFFAOYSA-N 0.000 description 1
- XNLWJFYYOIRPIO-UHFFFAOYSA-N 3-phenylbenzoic acid Chemical compound OC(=O)C1=CC=CC(C=2C=CC=CC=2)=C1 XNLWJFYYOIRPIO-UHFFFAOYSA-N 0.000 description 1
- VJPPLCNBDLZIFG-ZDUSSCGKSA-N 4-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide Chemical compound C(C#CC)(=O)N[C@@H]1CN(CCC1)C1=C2C(=C(NC2=C(C=C1F)C(=O)N)C)C VJPPLCNBDLZIFG-ZDUSSCGKSA-N 0.000 description 1
- PPXQVKBDPQGWHY-GOSISDBHSA-N 4-[2-methoxy-5-[[[(1r)-1-phenylethyl]amino]methyl]phenyl]-n,n-dimethylbenzamide Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=CC(=CC=2)C(=O)N(C)C)OC)=CC=CC=C1 PPXQVKBDPQGWHY-GOSISDBHSA-N 0.000 description 1
- YFCIFWOJYYFDQP-PTWZRHHISA-N 4-[3-amino-6-[(1S,3S,4S)-3-fluoro-4-hydroxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-(methylamino)ethyl]-2-fluorobenzamide Chemical compound CNC[C@@H](NC(=O)c1ccc(cc1F)-c1nc(cnc1N)[C@H]1CC[C@H](O)[C@@H](F)C1)c1cc(F)cc(Br)c1 YFCIFWOJYYFDQP-PTWZRHHISA-N 0.000 description 1
- XYWIPYBIIRTJMM-IBGZPJMESA-N 4-[[(2S)-2-[4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-5-methoxy-2-oxopyridin-1-yl]butanoyl]amino]-2-fluorobenzamide Chemical compound CC[C@H](N1C=C(OC)C(=CC1=O)C1=C(C=CC(Cl)=C1)N1C=C(N=N1)C(F)(F)F)C(=O)NC1=CC(F)=C(C=C1)C(N)=O XYWIPYBIIRTJMM-IBGZPJMESA-N 0.000 description 1
- REKZEWWZQIMCSU-QGZVFWFLSA-N 4-[[5-[3-[[[(1r)-1-(4-methoxyphenyl)ethyl]amino]methyl]phenyl]pyridin-2-yl]amino]-4-oxobutanoic acid Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2C=NC(NC(=O)CCC(O)=O)=CC=2)=C1 REKZEWWZQIMCSU-QGZVFWFLSA-N 0.000 description 1
- SHBYVHVNHYBESU-UHFFFAOYSA-N 4-amino-3-bromobenzaldehyde Chemical compound NC1=CC=C(C=O)C=C1Br SHBYVHVNHYBESU-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- JGXCXQPNYWBAGW-UHFFFAOYSA-N 4-bromo-1-n-methylbenzene-1,2-diamine Chemical compound CNC1=CC=C(Br)C=C1N JGXCXQPNYWBAGW-UHFFFAOYSA-N 0.000 description 1
- CUTFAPGINUFNQM-UHFFFAOYSA-N 4-bromo-2-nitrophenol Chemical compound OC1=CC=C(Br)C=C1[N+]([O-])=O CUTFAPGINUFNQM-UHFFFAOYSA-N 0.000 description 1
- MPZMVUQGXAOJIK-UHFFFAOYSA-N 4-bromopyridine;hydron;chloride Chemical compound Cl.BrC1=CC=NC=C1 MPZMVUQGXAOJIK-UHFFFAOYSA-N 0.000 description 1
- BSWJNOUAEYBJSK-UHFFFAOYSA-N 4-chloro-3-(2-methoxyphenyl)benzaldehyde Chemical compound COC1=CC=CC=C1C1=CC(C=O)=CC=C1Cl BSWJNOUAEYBJSK-UHFFFAOYSA-N 0.000 description 1
- SFKRATXYENHKEM-UHFFFAOYSA-N 4-methoxy-3-(6-methoxypyridazin-3-yl)benzaldehyde Chemical compound N1=NC(OC)=CC=C1C1=CC(C=O)=CC=C1OC SFKRATXYENHKEM-UHFFFAOYSA-N 0.000 description 1
- XBYUHRVKKZSBGH-UHFFFAOYSA-N 4-methoxy-3-(6-methoxypyridin-3-yl)benzaldehyde Chemical compound C1=NC(OC)=CC=C1C1=CC(C=O)=CC=C1OC XBYUHRVKKZSBGH-UHFFFAOYSA-N 0.000 description 1
- YOWUDRKGDPIMEW-UHFFFAOYSA-N 4-methoxy-3-phenylbenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=CC=CC=C1 YOWUDRKGDPIMEW-UHFFFAOYSA-N 0.000 description 1
- AONOJCRUKPDQEX-UHFFFAOYSA-N 4-methoxy-3-pyridin-3-ylbenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1C1=CC=CN=C1 AONOJCRUKPDQEX-UHFFFAOYSA-N 0.000 description 1
- SMFCNLXOVHSDML-UHFFFAOYSA-N 5-(3,5-dimethyl-11h-pyrano[3,2-a]carbazol-3-yl)-2-methylpent-1-en-3-ol Chemical compound C1=CC=C2NC3=C(C=CC(CCC(O)C(=C)C)(C)O4)C4=C(C)C=C3C2=C1 SMFCNLXOVHSDML-UHFFFAOYSA-N 0.000 description 1
- DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- OEUPIMSFJPPPFZ-MRXNPFEDSA-N 5-[2-methoxy-5-[[[(1r)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]-1-(2,2,2-trifluoroethyl)pyridin-2-one Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C2=CN(CC(F)(F)F)C(=O)C=C2)=C1 OEUPIMSFJPPPFZ-MRXNPFEDSA-N 0.000 description 1
- WRWIYSLBQYJZHA-CQSZACIVSA-N 5-[2-methoxy-5-[[[(1r)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]furan-2-carboxylic acid Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C(OC)=CC=2)C=2OC(=CC=2)C(O)=O)=C1 WRWIYSLBQYJZHA-CQSZACIVSA-N 0.000 description 1
- NVXLHFPJJMJIGK-MRXNPFEDSA-N 5-[2-methoxy-5-[[[(1r)-1-(4-methylphenyl)ethyl]amino]methyl]phenyl]pyridine-3-carboxamide Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=C(C=NC=2)C(N)=O)OC)=CC=C(C)C=C1 NVXLHFPJJMJIGK-MRXNPFEDSA-N 0.000 description 1
- SIFLNQMENZZVCL-OAHLLOKOSA-N 5-[2-methoxy-5-[[[(1r)-1-(4-methylphenyl)ethyl]amino]methyl]phenyl]pyrimidin-2-amine Chemical compound C1([C@@H](C)NCC2=CC=C(C(=C2)C=2C=NC(N)=NC=2)OC)=CC=C(C)C=C1 SIFLNQMENZZVCL-OAHLLOKOSA-N 0.000 description 1
- NGVSFRFDMFIUCI-QGZVFWFLSA-N 5-[2-methoxy-5-[[[(1r)-1-naphthalen-2-ylethyl]amino]methyl]phenyl]pyridine-3-carboxamide Chemical compound COC1=CC=C(CN[C@H](C)C=2C=C3C=CC=CC3=CC=2)C=C1C1=CN=CC(C(N)=O)=C1 NGVSFRFDMFIUCI-QGZVFWFLSA-N 0.000 description 1
- VRMGVTXSERWYDP-MRXNPFEDSA-N 5-[2-methoxy-5-[[[(1r)-1-naphthalen-2-ylethyl]amino]methyl]phenyl]pyrimidin-2-amine Chemical compound COC1=CC=C(CN[C@H](C)C=2C=C3C=CC=CC3=CC=2)C=C1C1=CN=C(N)N=C1 VRMGVTXSERWYDP-MRXNPFEDSA-N 0.000 description 1
- WLJKXDBDWMSRQI-OAHLLOKOSA-N 5-[3-[[[(1r)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]pyridine-3-carboxamide Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2C=C(C=NC=2)C(N)=O)=C1 WLJKXDBDWMSRQI-OAHLLOKOSA-N 0.000 description 1
- PGOGTWDYLFKOHI-UHFFFAOYSA-N 5-bromo-1,3-benzoxazole Chemical compound BrC1=CC=C2OC=NC2=C1 PGOGTWDYLFKOHI-UHFFFAOYSA-N 0.000 description 1
- VXWVFZFZYXOBTA-UHFFFAOYSA-N 5-bromo-1h-indole Chemical compound BrC1=CC=C2NC=CC2=C1 VXWVFZFZYXOBTA-UHFFFAOYSA-N 0.000 description 1
- OFKWIQJLYCKDNY-UHFFFAOYSA-N 5-bromo-2-methylpyridine Chemical compound CC1=CC=C(Br)C=N1 OFKWIQJLYCKDNY-UHFFFAOYSA-N 0.000 description 1
- FQIUCPGDKPXSLL-UHFFFAOYSA-N 5-bromopyridine-3-carboxylic acid Chemical compound OC(=O)C1=CN=CC(Br)=C1 FQIUCPGDKPXSLL-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- UNQYAAAWKOOBFQ-UHFFFAOYSA-N 7-[(4-chlorophenyl)methyl]-8-[4-chloro-3-(trifluoromethoxy)phenoxy]-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione Chemical compound C=1C=C(Cl)C=CC=1CN1C=2C(=O)N(CCCO)C(=O)N(C)C=2N=C1OC1=CC=C(Cl)C(OC(F)(F)F)=C1 UNQYAAAWKOOBFQ-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- ZRPZPNYZFSJUPA-UHFFFAOYSA-N ARS-1620 Chemical compound Oc1cccc(F)c1-c1c(Cl)cc2c(ncnc2c1F)N1CCN(CC1)C(=O)C=C ZRPZPNYZFSJUPA-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 206010001497 Agitation Diseases 0.000 description 1
- 244000003377 Allium tuberosum Species 0.000 description 1
- 235000005338 Allium tuberosum Nutrition 0.000 description 1
- 208000006386 Bone Resorption Diseases 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- 210000003771 C cell Anatomy 0.000 description 1
- LJCNLHVOEZASDO-OAHLLOKOSA-N C[C@H](C1=CC=CC=C1)NCC2=CC(=C(C=C2)OC)C3=NC(=CC=C3)C(F)(F)F Chemical compound C[C@H](C1=CC=CC=C1)NCC2=CC(=C(C=C2)OC)C3=NC(=CC=C3)C(F)(F)F LJCNLHVOEZASDO-OAHLLOKOSA-N 0.000 description 1
- 102000055006 Calcitonin Human genes 0.000 description 1
- 108060001064 Calcitonin Proteins 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 102000005701 Calcium-Binding Proteins Human genes 0.000 description 1
- 108010045403 Calcium-Binding Proteins Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- GISRWBROCYNDME-PELMWDNLSA-N F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C Chemical compound F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C GISRWBROCYNDME-PELMWDNLSA-N 0.000 description 1
- OZLGRUXZXMRXGP-UHFFFAOYSA-N Fluo-3 Chemical compound CC1=CC=C(N(CC(O)=O)CC(O)=O)C(OCCOC=2C(=CC=C(C=2)C2=C3C=C(Cl)C(=O)C=C3OC3=CC(O)=C(Cl)C=C32)N(CC(O)=O)CC(O)=O)=C1 OZLGRUXZXMRXGP-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 239000007995 HEPES buffer Substances 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 239000007836 KH2PO4 Substances 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 229910010084 LiAlH4 Inorganic materials 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- IDSGFSCSMXRJON-UHFFFAOYSA-N N-Carbamyl-L-glutamicacid Chemical compound C1=CC([N+](=O)[O-])=CC=C1CC1=CC=CC=C1 IDSGFSCSMXRJON-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical group ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- FEYNFHSRETUBEM-UHFFFAOYSA-N N-[3-(1,1-difluoroethyl)phenyl]-1-(4-methoxyphenyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide Chemical compound COc1ccc(cc1)N1N=C(C)C(C(=O)Nc2cccc(c2)C(C)(F)F)C1=O FEYNFHSRETUBEM-UHFFFAOYSA-N 0.000 description 1
- 101150073096 NRAS gene Proteins 0.000 description 1
- 102000002002 Neurokinin-1 Receptors Human genes 0.000 description 1
- 108010040718 Neurokinin-1 Receptors Proteins 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 244000025272 Persea americana Species 0.000 description 1
- 235000008673 Persea americana Nutrition 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 108020004518 RNA Probes Proteins 0.000 description 1
- 239000003391 RNA probe Substances 0.000 description 1
- 101100072644 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) INO2 gene Proteins 0.000 description 1
- 244000000231 Sesamum indicum Species 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- MUUXBTFQEXVEEI-UHFFFAOYSA-N [2-(dimethyl-$l^{3}-silanyl)phenyl]-dimethylsilicon Chemical group C[Si](C)C1=CC=CC=C1[Si](C)C MUUXBTFQEXVEEI-UHFFFAOYSA-N 0.000 description 1
- YNUWUOLTZNGVKD-UHFFFAOYSA-N [4-amino-3-(4-methoxyphenyl)phenyl]methanol Chemical compound C1=CC(OC)=CC=C1C1=CC(CO)=CC=C1N YNUWUOLTZNGVKD-UHFFFAOYSA-N 0.000 description 1
- AMJRSUWJSRKGNO-UHFFFAOYSA-N acetyloxymethyl 2-[n-[2-(acetyloxymethoxy)-2-oxoethyl]-2-[2-[2-[bis[2-(acetyloxymethoxy)-2-oxoethyl]amino]-5-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)phenoxy]ethoxy]-4-methylanilino]acetate Chemical compound CC(=O)OCOC(=O)CN(CC(=O)OCOC(C)=O)C1=CC=C(C)C=C1OCCOC1=CC(C2=C3C=C(Cl)C(=O)C=C3OC3=CC(O)=C(Cl)C=C32)=CC=C1N(CC(=O)OCOC(C)=O)CC(=O)OCOC(C)=O AMJRSUWJSRKGNO-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000005042 acyloxymethyl group Chemical group 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- AWUCVROLDVIAJX-UHFFFAOYSA-N alpha-glycerophosphate Natural products OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 229940111131 antiinflammatory and antirheumatic product propionic acid derivative Drugs 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 125000005129 aryl carbonyl group Chemical group 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 239000000305 astragalus gummifer gum Substances 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- FHCIILYMWWRNIZ-UHFFFAOYSA-N benzhydryl(chloro)silane Chemical compound C=1C=CC=CC=1C([SiH2]Cl)C1=CC=CC=C1 FHCIILYMWWRNIZ-UHFFFAOYSA-N 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- BNBQRQQYDMDJAH-UHFFFAOYSA-N benzodioxan Chemical compound C1=CC=C2OCCOC2=C1 BNBQRQQYDMDJAH-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 230000036983 biotransformation Effects 0.000 description 1
- 239000004305 biphenyl Chemical group 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006269 biphenyl-2-yl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C1=C(*)C([H])=C([H])C([H])=C1[H] 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 230000023555 blood coagulation Effects 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- 210000002449 bone cell Anatomy 0.000 description 1
- 230000024279 bone resorption Effects 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BBBFJLBPOGFECG-VJVYQDLKSA-N calcitonin Chemical compound N([C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(N)=O)C(C)C)C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1 BBBFJLBPOGFECG-VJVYQDLKSA-N 0.000 description 1
- 229960004015 calcitonin Drugs 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- DGLFSNZWRYADFC-UHFFFAOYSA-N chembl2334586 Chemical compound C1CCC2=CN=C(N)N=C2C2=C1NC1=CC=C(C#CC(C)(O)C)C=C12 DGLFSNZWRYADFC-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- KWYZNESIGBQHJK-UHFFFAOYSA-N chloro-dimethyl-phenylsilane Chemical compound C[Si](C)(Cl)C1=CC=CC=C1 KWYZNESIGBQHJK-UHFFFAOYSA-N 0.000 description 1
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- LMEDOLJKVASKTP-UHFFFAOYSA-N dibutyl sulfate Chemical compound CCCCOS(=O)(=O)OCCCC LMEDOLJKVASKTP-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 235000019797 dipotassium phosphate Nutrition 0.000 description 1
- 229910000396 dipotassium phosphate Inorganic materials 0.000 description 1
- 208000037765 diseases and disorders Diseases 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical group [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000003821 enantio-separation Methods 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- PDSIQAILYQYARH-GOSISDBHSA-N ethyl 4-[2-methoxy-5-[[[(1r)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1C1=CC(CN[C@H](C)C=2C=C(OC)C=CC=2)=CC=C1OC PDSIQAILYQYARH-GOSISDBHSA-N 0.000 description 1
- FWBKPMQCXOSKNU-GOSISDBHSA-N ethyl 4-[2-methoxy-5-[[[(1r)-1-phenylethyl]amino]methyl]phenyl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1C1=CC(CN[C@H](C)C=2C=CC=CC=2)=CC=C1OC FWBKPMQCXOSKNU-GOSISDBHSA-N 0.000 description 1
- FQYYIPZPELSLDK-UHFFFAOYSA-N ethyl pyridine-2-carboxylate Chemical compound CCOC(=O)C1=CC=CC=N1 FQYYIPZPELSLDK-UHFFFAOYSA-N 0.000 description 1
- QGBMSFLTRRZTGI-UHFFFAOYSA-N ethyl(dimethyl)silane Chemical compound CC[SiH](C)C QGBMSFLTRRZTGI-UHFFFAOYSA-N 0.000 description 1
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 239000013604 expression vector Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000012091 fetal bovine serum Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical compound [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- ZRALSGWEFCBTJO-UHFFFAOYSA-N guanidine group Chemical group NC(=N)N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 1
- 239000000118 hair dye Substances 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000004692 haloalkylcarbonyl group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000006517 heterocyclyl carbonyl group Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 238000009396 hybridization Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- YPGCWEMNNLXISK-UHFFFAOYSA-N hydratropic acid Chemical compound OC(=O)C(C)C1=CC=CC=C1 YPGCWEMNNLXISK-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- USZLCYNVCCDPLQ-UHFFFAOYSA-N hydron;n-methoxymethanamine;chloride Chemical compound Cl.CNOC USZLCYNVCCDPLQ-UHFFFAOYSA-N 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Chemical group O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 229940102213 injectable suspension Drugs 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 125000006352 iso-propylthiomethyl group Chemical group [H]C([H])([H])C([H])(SC([H])([H])*)C([H])([H])[H] 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000006229 isopropoxyethyl group Chemical group [H]C([H])([H])C([H])(OC([H])([H])C([H])([H])*)C([H])([H])[H] 0.000 description 1
- 239000000865 liniment Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 125000005439 maleimidyl group Chemical group C1(C=CC(N1*)=O)=O 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 150000002696 manganese Chemical class 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- KRKPYFLIYNGWTE-UHFFFAOYSA-N n,o-dimethylhydroxylamine Chemical compound CNOC KRKPYFLIYNGWTE-UHFFFAOYSA-N 0.000 description 1
- FMASTMURQSHELY-UHFFFAOYSA-N n-(4-fluoro-2-methylphenyl)-3-methyl-n-[(2-methyl-1h-indol-4-yl)methyl]pyridine-4-carboxamide Chemical compound C1=CC=C2NC(C)=CC2=C1CN(C=1C(=CC(F)=CC=1)C)C(=O)C1=CC=NC=C1C FMASTMURQSHELY-UHFFFAOYSA-N 0.000 description 1
- KSVKECXWDNCRTM-UHFFFAOYSA-N n-[1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]benzamide Chemical compound C=1C=CC=CC=1CC(NC(=O)C=1C=CC=CC=1)C(=O)NC(CO)CC1=CC=CC=C1 KSVKECXWDNCRTM-UHFFFAOYSA-N 0.000 description 1
- IUBOQMNIFYRKPJ-QGZVFWFLSA-N n-[3-[3-[[[(1r)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]phenyl]acetamide Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2C=C(NC(C)=O)C=CC=2)=C1 IUBOQMNIFYRKPJ-QGZVFWFLSA-N 0.000 description 1
- IGUUFMWDCCNKLO-QGZVFWFLSA-N n-[3-[3-[[[(1r)-1-(4-methoxyphenyl)ethyl]amino]methyl]phenyl]phenyl]acetamide Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2C=C(NC(C)=O)C=CC=2)=C1 IGUUFMWDCCNKLO-QGZVFWFLSA-N 0.000 description 1
- RRVNYZUELSMXBH-GOSISDBHSA-N n-[3-[3-[[[(1r)-1-(4-methylphenyl)ethyl]amino]methyl]phenyl]phenyl]acetamide Chemical compound N([C@H](C)C=1C=CC(C)=CC=1)CC(C=1)=CC=CC=1C1=CC=CC(NC(C)=O)=C1 RRVNYZUELSMXBH-GOSISDBHSA-N 0.000 description 1
- BKPHWWRCBJRUBN-LJQANCHMSA-N n-[3-[3-[[[(1r)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]phenyl]acetamide Chemical compound N([C@H](C)C=1C2=CC=CC=C2C=CC=1)CC(C=1)=CC=CC=1C1=CC=CC(NC(C)=O)=C1 BKPHWWRCBJRUBN-LJQANCHMSA-N 0.000 description 1
- LCJFWTVQKVOAOI-LJQANCHMSA-N n-[3-[3-[[[(1r)-1-naphthalen-2-ylethyl]amino]methyl]phenyl]phenyl]acetamide Chemical compound N([C@H](C)C=1C=C2C=CC=CC2=CC=1)CC(C=1)=CC=CC=1C1=CC=CC(NC(C)=O)=C1 LCJFWTVQKVOAOI-LJQANCHMSA-N 0.000 description 1
- XHQNJKGCDFOCLR-MRXNPFEDSA-N n-[5-[3-[[[(1r)-1-(3-methoxyphenyl)ethyl]amino]methyl]phenyl]pyridin-2-yl]acetamide Chemical compound COC1=CC=CC([C@@H](C)NCC=2C=C(C=CC=2)C=2C=NC(NC(C)=O)=CC=2)=C1 XHQNJKGCDFOCLR-MRXNPFEDSA-N 0.000 description 1
- VFBVNFWREKFYMD-MRXNPFEDSA-N n-[5-[3-[[[(1r)-1-(4-methoxyphenyl)ethyl]amino]methyl]phenyl]pyridin-2-yl]acetamide Chemical compound C1=CC(OC)=CC=C1[C@@H](C)NCC1=CC=CC(C=2C=NC(NC(C)=O)=CC=2)=C1 VFBVNFWREKFYMD-MRXNPFEDSA-N 0.000 description 1
- VFBILHPIHUPBPZ-UHFFFAOYSA-N n-[[2-[4-(difluoromethoxy)-3-propan-2-yloxyphenyl]-1,3-oxazol-4-yl]methyl]-2-ethoxybenzamide Chemical compound CCOC1=CC=CC=C1C(=O)NCC1=COC(C=2C=C(OC(C)C)C(OC(F)F)=CC=2)=N1 VFBILHPIHUPBPZ-UHFFFAOYSA-N 0.000 description 1
- IPUPCTCERRIUTI-UHFFFAOYSA-N n-[[4-methoxy-3-(4-methoxyphenyl)phenyl]methyl]-1-quinolin-4-ylethanamine Chemical compound C1=CC(OC)=CC=C1C1=CC(CNC(C)C=2C3=CC=CC=C3N=CC=2)=CC=C1OC IPUPCTCERRIUTI-UHFFFAOYSA-N 0.000 description 1
- PSCZXHFELPPQBD-UHFFFAOYSA-N n-[[4-methoxy-3-(4-methoxyphenyl)phenyl]methyl]-1-quinolin-8-ylethanamine Chemical compound C1=CC(OC)=CC=C1C1=CC(CNC(C)C=2C3=NC=CC=C3C=CC=2)=CC=C1OC PSCZXHFELPPQBD-UHFFFAOYSA-N 0.000 description 1
- FPIQLHLRRUZFQQ-UHFFFAOYSA-N n-[[4-methoxy-3-[4-(trifluoromethyl)phenyl]phenyl]methyl]-1-[2-(trifluoromethyl)phenyl]ethanamine Chemical compound C1=C(C=2C=CC(=CC=2)C(F)(F)F)C(OC)=CC=C1CNC(C)C1=CC=CC=C1C(F)(F)F FPIQLHLRRUZFQQ-UHFFFAOYSA-N 0.000 description 1
- DOWVMJFBDGWVML-UHFFFAOYSA-N n-cyclohexyl-n-methyl-4-(1-oxidopyridin-1-ium-3-yl)imidazole-1-carboxamide Chemical compound C1=NC(C=2C=[N+]([O-])C=CC=2)=CN1C(=O)N(C)C1CCCCC1 DOWVMJFBDGWVML-UHFFFAOYSA-N 0.000 description 1
- NNKPHNTWNILINE-UHFFFAOYSA-N n-cyclopropyl-3-fluoro-4-methyl-5-[3-[[1-[2-[2-(methylamino)ethoxy]phenyl]cyclopropyl]amino]-2-oxopyrazin-1-yl]benzamide Chemical compound CNCCOC1=CC=CC=C1C1(NC=2C(N(C=3C(=C(F)C=C(C=3)C(=O)NC3CC3)C)C=CN=2)=O)CC1 NNKPHNTWNILINE-UHFFFAOYSA-N 0.000 description 1
- JMGIGVINAAPTAK-UHFFFAOYSA-N n-methoxy-n-methylquinoline-8-carboxamide Chemical compound C1=CN=C2C(C(=O)N(C)OC)=CC=CC2=C1 JMGIGVINAAPTAK-UHFFFAOYSA-N 0.000 description 1
- DNBWGFKLIBQQSL-UHFFFAOYSA-N n-methyl-1-pyridin-4-ylmethanamine Chemical compound CNCC1=CC=NC=C1 DNBWGFKLIBQQSL-UHFFFAOYSA-N 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-M naphthalene-2-sulfonate Chemical compound C1=CC=CC2=CC(S(=O)(=O)[O-])=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-M 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000000346 nonvolatile oil Substances 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- XURVRZSODRHRNK-UHFFFAOYSA-N o-quinodimethane Chemical group C=C1C=CC=CC1=C XURVRZSODRHRNK-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000011164 ossification Effects 0.000 description 1
- 210000002997 osteoclast Anatomy 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical class [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 125000005545 phthalimidyl group Chemical group 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-M pivalate Chemical compound CC(C)(C)C([O-])=O IUGYQRQAERSCNH-UHFFFAOYSA-M 0.000 description 1
- 229950010765 pivalate Drugs 0.000 description 1
- 239000013612 plasmid Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- LZMJNVRJMFMYQS-UHFFFAOYSA-N poseltinib Chemical compound C1CN(C)CCN1C(C=C1)=CC=C1NC1=NC(OC=2C=C(NC(=O)C=C)C=CC=2)=C(OC=C2)C2=N1 LZMJNVRJMFMYQS-UHFFFAOYSA-N 0.000 description 1
- GNSKLFRGEWLPPA-UHFFFAOYSA-M potassium dihydrogen phosphate Chemical compound [K+].OP(O)([O-])=O GNSKLFRGEWLPPA-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 150000005599 propionic acid derivatives Chemical class 0.000 description 1
- 125000006225 propoxyethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- GYESAYHWISMZOK-UHFFFAOYSA-N quinolin-5-ol Chemical compound C1=CC=C2C(O)=CC=CC2=N1 GYESAYHWISMZOK-UHFFFAOYSA-N 0.000 description 1
- QRDZFPUVLYEQTA-UHFFFAOYSA-N quinoline-8-carboxylic acid Chemical compound C1=CN=C2C(C(=O)O)=CC=CC2=C1 QRDZFPUVLYEQTA-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 238000006578 reductive coupling reaction Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- AWUCVROLDVIAJX-GSVOUGTGSA-N sn-glycerol 3-phosphate Chemical compound OC[C@@H](O)COP(O)(O)=O AWUCVROLDVIAJX-GSVOUGTGSA-N 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 150000008648 triflates Chemical group 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000004950 trifluoroalkyl group Chemical group 0.000 description 1
- UDOZVPVDQKQJAP-UHFFFAOYSA-N trifluoroamine oxide Chemical compound [O-][N+](F)(F)F UDOZVPVDQKQJAP-UHFFFAOYSA-N 0.000 description 1
- 125000000025 triisopropylsilyl group Chemical group C(C)(C)[Si](C(C)C)(C(C)C)* 0.000 description 1
- 239000013638 trimer Substances 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- ZDPHROOEEOARMN-UHFFFAOYSA-N undecanoic acid Chemical compound CCCCCCCCCCC(O)=O ZDPHROOEEOARMN-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/34—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups
- C07C233/35—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
- C07C233/36—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom having the carbon atom of the carboxamide group bound to a hydrogen atom or to a carbon atom of an acyclic saturated carbon skeleton
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/08—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/08—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease
- A61P19/10—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease for osteoporosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/12—Drugs for disorders of the metabolism for electrolyte homeostasis
- A61P3/14—Drugs for disorders of the metabolism for electrolyte homeostasis for calcium homeostasis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/18—Drugs for disorders of the endocrine system of the parathyroid hormones
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/18—Drugs for disorders of the endocrine system of the parathyroid hormones
- A61P5/20—Drugs for disorders of the endocrine system of the parathyroid hormones for decreasing, blocking or antagonising the activity of PTH
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/27—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring having amino groups linked to the six-membered aromatic ring by saturated carbon chains
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/29—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/30—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring the six-membered aromatic ring being part of a condensed ring system formed by two rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C211/54—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to two or three six-membered aromatic rings
- C07C211/55—Diphenylamines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/46—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C217/56—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms
- C07C217/58—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms with amino groups and the six-membered aromatic ring, or the condensed ring system containing that ring, bound to the same carbon atom of the carbon chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/38—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino groups bound to acyclic carbon atoms and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/34—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups
- C07C233/42—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
- C07C233/43—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring having the carbon atom of the carboxamide group bound to a hydrogen atom or to a carbon atom of a saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/45—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups
- C07C233/46—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C235/18—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated having at least one of the singly-bound oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. phenoxyacetamides
- C07C235/20—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated having at least one of the singly-bound oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. phenoxyacetamides having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/30—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having the nitrogen atom of the carboxamide group bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/58—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/58—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the carbon skeleton
- C07C255/59—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/40—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by nitrogen atoms not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/02—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C311/08—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/27—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/325—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/20—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms
- C07D211/22—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/26—Radicals substituted by halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/65—One oxygen atom attached in position 3 or 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/68—One oxygen atom attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D215/14—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/54—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings condensed with carbocyclic rings or ring systems
- C07D231/56—Benzopyrazoles; Hydrogenated benzopyrazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/20—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D233/22—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D235/10—Radicals substituted by halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D235/12—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/08—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/14—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/26—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/34—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/12—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/38—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with only hydrogen or carbon atoms directly attached to the ring nitrogen atoms
- C07D241/40—Benzopyrazines
- C07D241/42—Benzopyrazines with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/16—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms condensed with carbocyclic rings or ring systems
- C07D249/18—Benzotriazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/08—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/32—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/56—Benzoxazoles; Hydrogenated benzoxazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/08—1,2,5-Oxadiazoles; Hydrogenated 1,2,5-oxadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/10—1,3,4-Oxadiazoles; Hydrogenated 1,3,4-oxadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/12—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/24—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/28—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/40—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/42—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/64—Benzothiazoles with only hydrocarbon or substituted hydrocarbon radicals attached in position 2
- C07D277/66—Benzothiazoles with only hydrocarbon or substituted hydrocarbon radicals attached in position 2 with aromatic rings or ring systems directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/135—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
- C07D295/26—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/54—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/10—1,4-Dioxanes; Hydrogenated 1,4-dioxanes
- C07D319/14—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems
- C07D319/16—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D319/18—Ethylenedioxybenzenes, not substituted on the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D321/00—Heterocyclic compounds containing rings having two oxygen atoms as the only ring hetero atoms, not provided for by groups C07D317/00 - C07D319/00
- C07D321/02—Seven-membered rings
- C07D321/10—Seven-membered rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/56—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Public Health (AREA)
- General Chemical & Material Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Physical Education & Sports Medicine (AREA)
- Rheumatology (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Endocrinology (AREA)
- Diabetes (AREA)
- Obesity (AREA)
- Hematology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
- Quinoline Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Indole Compounds (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrrole Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US38305002P | 2002-05-23 | 2002-05-23 | |
| US44106503P | 2003-01-17 | 2003-01-17 | |
| US10/444,946 US6908935B2 (en) | 2002-05-23 | 2003-05-22 | Calcium receptor modulating agents |
| PCT/US2003/016401 WO2003099776A1 (en) | 2002-05-23 | 2003-05-23 | Calcium receptor modulating arylalkylamines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MXPA04011471A true MXPA04011471A (es) | 2005-02-14 |
Family
ID=29587692
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MXPA04011471A MXPA04011471A (es) | 2002-05-23 | 2003-05-23 | Arilalquilaminas moduladoras de receptor de calcio. |
Country Status (8)
| Country | Link |
|---|---|
| US (3) | US6908935B2 (enExample) |
| EP (1) | EP1509497A1 (enExample) |
| JP (2) | JP4486882B2 (enExample) |
| AU (1) | AU2003233671B2 (enExample) |
| CA (1) | CA2486399C (enExample) |
| MX (1) | MXPA04011471A (enExample) |
| PL (1) | PL376438A1 (enExample) |
| WO (1) | WO2003099776A1 (enExample) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6908935B2 (en) * | 2002-05-23 | 2005-06-21 | Amgen Inc. | Calcium receptor modulating agents |
| JP4787150B2 (ja) * | 2003-03-06 | 2011-10-05 | エーザイ・アール・アンド・ディー・マネジメント株式会社 | Jnk阻害剤 |
| KR101020350B1 (ko) * | 2003-03-13 | 2011-03-08 | 이데미쓰 고산 가부시키가이샤 | 신규한 질소 함유 헤테로환 유도체 및 이를 이용한 유기 전기발광 소자 |
| WO2005065050A2 (ja) * | 2003-12-25 | 2005-07-21 | Asahi Kasei Pharma Corporation | 2環化合物 |
| GB0400781D0 (en) | 2004-01-14 | 2004-02-18 | Novartis Ag | Organic compounds |
| KR101182690B1 (ko) * | 2004-03-02 | 2012-09-14 | 아벤티스 파마슈티칼스 인크. | 트립타제 억제제의 제조방법 |
| PT1757582E (pt) | 2004-05-28 | 2016-03-04 | Mitsubishi Tanabe Pharma Corp | Arilalquilaminas e processo para a sua produção |
| US7361789B1 (en) | 2004-07-28 | 2008-04-22 | Amgen Inc. | Dihydronaphthalene compounds, compositions, uses thereof, and methods for synthesis |
| US20060276534A1 (en) * | 2005-03-17 | 2006-12-07 | Amgen Inc. | Methods of decreasing calcification |
| EP1882684B1 (en) * | 2005-05-19 | 2014-12-10 | Astellas Pharma Inc. | Pyrrolidine derivative or salt thereof |
| EP1904491A2 (en) * | 2005-05-31 | 2008-04-02 | Vertex Pharmaceuticals Incorporated | Heterocycles useful as modulators of ion channels |
| WO2007037795A2 (en) * | 2005-08-05 | 2007-04-05 | Amgen Inc. | Stable aqueous protein or antibody pharmaceutical formulations and their preparation |
| ES2400693T3 (es) * | 2005-09-02 | 2013-04-11 | Amgen Inc. | Regulación del equilibrio de fluido intestinal usando calcimiméticos |
| JP2009512710A (ja) * | 2005-10-21 | 2009-03-26 | アムジエン・インコーポレーテツド | Il−1阻害剤を用いて血管石灰化を抑制する方法 |
| JP2009528273A (ja) * | 2006-01-25 | 2009-08-06 | シンタ ファーマシューティカルズ コーポレーション | 炎症および免疫関連使用用の置換ビアリール化合物 |
| EP2001832A1 (en) * | 2006-03-23 | 2008-12-17 | Amgen Inc. | Methods and compositions for making and using polymorphs of cinacalcet |
| CA2648939C (en) * | 2006-04-20 | 2014-07-08 | Amgen Inc. | Stable emulsion formulations |
| GB0614579D0 (en) * | 2006-07-21 | 2006-08-30 | Black James Foundation | Pyrimidine derivatives |
| US20100222345A1 (en) * | 2006-08-09 | 2010-09-02 | Caroline Jean Diaz | Novel compounds as antagonists or inverse agonists for opioid receptors |
| TW200821276A (en) * | 2006-08-18 | 2008-05-16 | Leo Pharma As | Substituted acetylenic compounds useful for the treatment of diseases |
| EP2079525A1 (en) * | 2006-10-26 | 2009-07-22 | Amgen Inc. | Calcium receptor modulating agents |
| KR20090064478A (ko) * | 2006-11-13 | 2009-06-18 | 화이자 프로덕츠 인크. | 디아릴, 디피리디닐 및 아릴-피리디닐 유도체, 및 이들의 용도 |
| TW200840566A (en) * | 2006-12-22 | 2008-10-16 | Esteve Labor Dr | Heterocyclyl-substituted-ethylamino-phenyl derivatives, their preparation and use as medicaments |
| US8093299B2 (en) | 2007-03-30 | 2012-01-10 | Amgen Inc. | Methods of treating bowel disorders |
| WO2009051718A2 (en) * | 2007-10-15 | 2009-04-23 | Amgen Inc. | Calcium receptor modulating agents |
| WO2009121015A2 (en) * | 2008-03-28 | 2009-10-01 | Amgen Inc. | Methods of treating epithelial injury |
| WO2010042642A1 (en) * | 2008-10-08 | 2010-04-15 | Amgen Inc. | Calcium receptor modulating agents |
| WO2010052448A2 (en) * | 2008-11-05 | 2010-05-14 | Ucb Pharma S.A. | Fused pyrazine derivatives as kinase inhibitors |
| WO2010104882A1 (en) | 2009-03-10 | 2010-09-16 | Amgen Inc. | Methods of modulating sperm motility |
| DE102009015697A1 (de) | 2009-03-31 | 2010-10-07 | Markus Dr. Heinrich | Verfahren zur Arylierung von ringsubstituierten Phenolen und Phenylethern |
| JP2012528086A (ja) | 2009-05-27 | 2012-11-12 | レオ ファーマ アクティーゼルスカブ | 新規のカルシウム感知受容体調節化合物およびその医薬用途 |
| WO2010136035A2 (en) | 2009-05-27 | 2010-12-02 | Leo Pharma A/S | Novel calcium sensing receptor modulating compounds and pharmaceutical use thereof |
| US9056814B2 (en) | 2010-06-30 | 2015-06-16 | Leo Pharma A/S | Polymorphic form of a calcimimetic compound |
| RU2599788C2 (ru) | 2010-06-30 | 2016-10-20 | Лео Фарма А/С | Новая полиморфная форма кальцимиметического соединения |
| EP2643292A1 (en) | 2010-11-26 | 2013-10-02 | Leo Pharma A/S | Calcium-sensing receptor-active compounds |
| EP2643291A2 (en) | 2010-11-26 | 2013-10-02 | Leo Pharma A/S | Calcium-sensing receptor-active compounds |
| JP2014500882A (ja) | 2010-11-26 | 2014-01-16 | レオ ファーマ アクティーゼルスカブ | カルシウム感知受容体活性化合物 |
| US20130261132A1 (en) | 2010-11-26 | 2013-10-03 | Leo Pharma A/S | Calcium-sensing receptor-active compounds |
| AP2013007153A0 (en) * | 2011-03-18 | 2013-09-30 | Lupin Ltd | Benzo [B] [1,4] oxazin derivatives as calcium sensing receptor modulators |
| EP2888225A1 (en) * | 2012-08-27 | 2015-07-01 | Lupin Limited | Arylalkylamine compounds as calcium sensing receptor modulators |
| GB201217330D0 (en) | 2012-09-28 | 2012-11-14 | Univ Cardiff | Therapeutic for treating inflammatory lung disorders |
| CN104292157A (zh) * | 2014-09-15 | 2015-01-21 | 湖南华腾制药有限公司 | 一种1-(喹啉-4-基)乙胺的制备方法 |
| WO2017037616A1 (en) * | 2015-08-31 | 2017-03-09 | Lupin Limited | Arylalkylamine compounds as calcium sensing receptor modulators |
| DE102015011861B4 (de) | 2015-09-10 | 2018-03-01 | Rudolf Schindler | Neue cyclische Carboxamide als NMDA NR2B Rezeptor Inhibitoren |
Family Cites Families (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PT72878B (en) | 1980-04-24 | 1983-03-29 | Merck & Co Inc | Process for preparing mannich-base hydroxamic acid pro-drugs for the improved delivery of non-steroidal anti-inflammatory agents |
| ES2218531T3 (es) | 1991-08-23 | 2004-11-16 | Nps Pharmaceuticals, Inc. | Arilalquilaminas activas sobre los receptores del calcio. |
| US6031003A (en) | 1991-08-23 | 2000-02-29 | Nps Pharmaceuticals, Inc. | Calcium receptor-active molecules |
| EP1296142B1 (en) | 1991-08-23 | 2005-12-07 | Nps Pharmaceuticals, Inc. | Screening method for calcium receptor active molecules |
| US6011068A (en) | 1991-08-23 | 2000-01-04 | Nps Pharmaceuticals, Inc. | Calcium receptor-active molecules |
| KR100296899B1 (ko) | 1993-02-23 | 2001-10-24 | 쉘비 칼베르그 모르스 | 칼슘수용체활성분자 |
| AU3414295A (en) | 1994-08-19 | 1996-03-14 | Nps Pharmaceuticals, Inc. | Methods and compounds active at metabotropic glutamate receptors useful for treatment of neurological disorders and diseases |
| AU3642795A (en) | 1994-09-27 | 1996-04-19 | Merck & Co., Inc. | Endothelin receptor antagonists for the treatment of emesis |
| NZ297157A (en) | 1994-10-21 | 1999-08-30 | Nps Pharma Inc | Amine derivatives with calcium ion receptor activity; medicaments containing such compounds |
| US5585388A (en) | 1995-04-07 | 1996-12-17 | Sibia Neurosciences, Inc. | Substituted pyridines useful as modulators of acetylcholine receptors |
| ES2308779T3 (es) | 1995-07-26 | 2008-12-01 | Astrazeneca Ab | Receptores quimericos y metodos para identificar compuestos activos en los receptores de glutamato metabotropico y el uso de tales compuestos en el tratamiento de trastornos y enfermedades neurologicas. |
| WO1997037967A1 (en) | 1996-04-09 | 1997-10-16 | Nps Pharmaceuticals, Inc. | Calcilytic compounds |
| AU731146C (en) | 1996-05-01 | 2005-02-03 | Nps Pharmaceuticals, Inc. | Inorganic ion receptor-active compounds |
| US6362231B1 (en) | 1996-07-08 | 2002-03-26 | Nps Pharmaceuticals, Inc. | Calcium receptor active compounds |
| RU2203272C2 (ru) | 1997-02-21 | 2003-04-27 | Байер Акциенгезелльшафт | Замещенные бициклические соединения, исходные и промежуточные продукты для их получения и фармацевтическая композиция на их основе |
| UY24949A1 (es) | 1997-04-08 | 2001-04-30 | Smithkline Beecham Corp | Compuestos calcilíticos |
| CA2296014A1 (en) | 1997-07-03 | 1999-01-14 | Frank W. Hobbs | Aryl-and arylamino-substituted heterocycles as corticotropin releasing hormone antagonists |
| CA2325587A1 (en) * | 1998-03-25 | 1999-09-30 | Mendi Higgins | Imidazolone anorectic agents: ii. phenyl derivatives |
| CA2340341A1 (en) | 1998-08-12 | 2000-02-24 | Smithkline Beecham Corporation | Calcilytic compounds |
| CA2347092A1 (en) | 1998-10-14 | 2000-04-20 | Ortho-Mcneil Pharmaceutical, Inc. | 1,2-disubstituted cyclopropanes |
| PL350428A1 (en) | 1999-02-24 | 2002-12-16 | Hoffmann La Roche | 3-phenylpyridine derivatives and their use as nk-1 receptor antagonists |
| CN1131212C (zh) | 1999-02-24 | 2003-12-17 | 弗·哈夫曼-拉罗切有限公司 | 苯基-和吡啶基衍生物 |
| EP1074539B1 (en) | 1999-08-04 | 2007-10-17 | Sumitomo Chemical Company, Limited | Process for producing optically active 3,3,3,-trifluoro-2-hydroxy-2-methylpropionic acid, and salt thereof |
| DE10028575A1 (de) | 2000-06-14 | 2002-03-14 | Basf Ag | Integrinliganden |
| FR2800735B1 (fr) | 1999-11-09 | 2002-02-01 | Centre Nat Rech Scient | Nouvelles aralkyle-1,2-diamines possedant une activite calcimimetique et leur mode de preparation |
| DE50011851D1 (de) | 1999-12-18 | 2006-01-19 | Wella Ag | 2-Aminoalkyl-1,4-diaminobenzol-Derivate und diese Verbindungen enthaltende Färbemittel |
| FR2809396B1 (fr) | 2000-05-24 | 2005-10-14 | Centre Nat Rech Scient | Nouvelles molecules possedant une activite calcimimetique et leur mode de preparation |
| DE10028402A1 (de) | 2000-06-13 | 2001-12-20 | Merck Patent Gmbh | Pyridin-2-yl-aminoalkycarbonylglycyl-beta-alanin und Derivate |
| EP1289960A2 (en) | 2000-06-15 | 2003-03-12 | Pharmacia Corporation | Cycloalkyl alkanoic acids as integrin receptor antagonists |
| JPWO2003020723A1 (ja) | 2001-08-30 | 2004-12-16 | 協和醗酵工業株式会社 | [1,2,4]トリアゾロ[1,5−a]ピリミジン誘導体 |
| US6908935B2 (en) * | 2002-05-23 | 2005-06-21 | Amgen Inc. | Calcium receptor modulating agents |
| US7176322B2 (en) | 2002-05-23 | 2007-02-13 | Amgen Inc. | Calcium receptor modulating agents |
-
2003
- 2003-05-22 US US10/444,946 patent/US6908935B2/en not_active Expired - Lifetime
- 2003-05-23 PL PL03376438A patent/PL376438A1/xx unknown
- 2003-05-23 AU AU2003233671A patent/AU2003233671B2/en not_active Ceased
- 2003-05-23 MX MXPA04011471A patent/MXPA04011471A/es active IP Right Grant
- 2003-05-23 CA CA2486399A patent/CA2486399C/en not_active Expired - Fee Related
- 2003-05-23 JP JP2004507434A patent/JP4486882B2/ja not_active Expired - Fee Related
- 2003-05-23 WO PCT/US2003/016401 patent/WO2003099776A1/en not_active Ceased
- 2003-05-23 EP EP03729111A patent/EP1509497A1/en not_active Withdrawn
-
2005
- 2005-02-18 US US11/061,084 patent/US7196102B2/en not_active Expired - Fee Related
-
2007
- 2007-01-30 US US11/700,336 patent/US7524873B2/en not_active Expired - Fee Related
-
2010
- 2010-02-10 JP JP2010027494A patent/JP2010150268A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US7196102B2 (en) | 2007-03-27 |
| AU2003233671A1 (en) | 2003-12-12 |
| AU2003233671B2 (en) | 2007-08-16 |
| JP2005527625A (ja) | 2005-09-15 |
| WO2003099776A1 (en) | 2003-12-04 |
| CA2486399A1 (en) | 2003-12-04 |
| US6908935B2 (en) | 2005-06-21 |
| AU2003233671B8 (en) | 2003-12-12 |
| US20050143426A1 (en) | 2005-06-30 |
| US7524873B2 (en) | 2009-04-28 |
| CA2486399C (en) | 2010-07-20 |
| JP2010150268A (ja) | 2010-07-08 |
| JP4486882B2 (ja) | 2010-06-23 |
| US20070142381A1 (en) | 2007-06-21 |
| EP1509497A1 (en) | 2005-03-02 |
| PL376438A1 (en) | 2005-12-27 |
| US20040082625A1 (en) | 2004-04-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| MXPA04011471A (es) | Arilalquilaminas moduladoras de receptor de calcio. | |
| CA2485685C (en) | Calcium receptor modulating agents | |
| AU2004212490B2 (en) | Vanilloid receptor ligands and their use in treatments | |
| RU2188188C2 (ru) | Трехзамещенные фенильные производные | |
| US20050165015A1 (en) | Vanilloid receptor ligands and their use in treatments | |
| CA2396257A1 (en) | Novel compounds and compositions as protease inhibitors | |
| US20050165028A1 (en) | Vanilloid receptor ligands and their use in treatments | |
| US8778941B2 (en) | TRPM8 antagonists and their use in treatments | |
| EP1818333A1 (en) | Vanilloid receptor ligands and their use in treatments | |
| MXPA06009057A (en) | Vanilloid receptor ligands and their use in treatments |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG | Grant or registration |