MD2103G2 - Composition of balsam - Google Patents
Composition of balsam Download PDFInfo
- Publication number
- MD2103G2 MD2103G2 MDA20020115A MD20020115A MD2103G2 MD 2103 G2 MD2103 G2 MD 2103G2 MD A20020115 A MDA20020115 A MD A20020115A MD 20020115 A MD20020115 A MD 20020115A MD 2103 G2 MD2103 G2 MD 2103G2
- Authority
- MD
- Moldova
- Prior art keywords
- alcoholized
- herb
- liquorice
- caramel
- john
- Prior art date
Links
- 235000007173 Abies balsamea Nutrition 0.000 title 1
- 239000004857 Balsam Substances 0.000 title 1
- 244000018716 Impatiens biflora Species 0.000 title 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 abstract 6
- MIDXCONKKJTLDX-UHFFFAOYSA-N 3,5-dimethylcyclopentane-1,2-dione Chemical compound CC1CC(C)C(=O)C1=O MIDXCONKKJTLDX-UHFFFAOYSA-N 0.000 abstract 2
- 240000000073 Achillea millefolium Species 0.000 abstract 2
- 235000007754 Achillea millefolium Nutrition 0.000 abstract 2
- 244000205574 Acorus calamus Species 0.000 abstract 2
- 244000303040 Glycyrrhiza glabra Species 0.000 abstract 2
- 235000006200 Glycyrrhiza glabra Nutrition 0.000 abstract 2
- 235000017309 Hypericum perforatum Nutrition 0.000 abstract 2
- 244000141009 Hypericum perforatum Species 0.000 abstract 2
- 235000006679 Mentha X verticillata Nutrition 0.000 abstract 2
- 235000002899 Mentha suaveolens Nutrition 0.000 abstract 2
- 235000001636 Mentha x rotundifolia Nutrition 0.000 abstract 2
- 235000011203 Origanum Nutrition 0.000 abstract 2
- 240000000783 Origanum majorana Species 0.000 abstract 2
- 235000008331 Pinus X rigitaeda Nutrition 0.000 abstract 2
- 241000018646 Pinus brutia Species 0.000 abstract 2
- 235000011613 Pinus brutia Nutrition 0.000 abstract 2
- 235000015197 apple juice Nutrition 0.000 abstract 2
- 235000013532 brandy Nutrition 0.000 abstract 2
- 235000013736 caramel Nutrition 0.000 abstract 2
- LPLVUJXQOOQHMX-QWBHMCJMSA-N glycyrrhizinic acid Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@H](O[C@@H]1O[C@@H]1C([C@H]2[C@]([C@@H]3[C@@]([C@@]4(CC[C@@]5(C)CC[C@@](C)(C[C@H]5C4=CC3=O)C(O)=O)C)(C)CC2)(C)CC1)(C)C)C(O)=O)[C@@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O LPLVUJXQOOQHMX-QWBHMCJMSA-N 0.000 abstract 2
- 235000019674 grape juice Nutrition 0.000 abstract 2
- 235000011477 liquorice Nutrition 0.000 abstract 2
- 239000002994 raw material Substances 0.000 abstract 2
- 235000000346 sugar Nutrition 0.000 abstract 2
- 235000013334 alcoholic beverage Nutrition 0.000 abstract 1
- 235000015165 citric acid Nutrition 0.000 abstract 1
- 239000012467 final product Substances 0.000 abstract 1
- 235000008216 herbs Nutrition 0.000 abstract 1
- 239000004615 ingredient Substances 0.000 abstract 1
Landscapes
- Alcoholic Beverages (AREA)
Abstract
The invention refers to the alcoholic beverage industry.Summary of the invention consists in that the composition contains hydroalcoholic macerate of vegetal raw material: sweet flag calamus rhizome, brandy mint leaves, liquorice, pine buds, herbs of marjoram, St. John's wort, milfoil, as well as alcoholized apple juice, alcoholized grape juice, sugar, caramel, citric acid and hydroalcoholic solution; the vegetal raw material and the ingredients are taken in the following ratio for 1000 L of final product, in kg: sweet flag calamus rhizome 0,050…0,075; brandy mint leaves 0,51…0,71; liquorice 0,85…1,15; pine buds 0,04…0,06; marjoram herb 0,25…0,35; St. John's wort herb 0,55…0,77; milfoil herb 0,55…0,74; sugar 68,30…89,80; caramel 8,50…11,50; citric acid 0,07…0,11; in L: alcoholized apple juice 68,0…92,0; alcoholized grape juice 153,0…207,0; hydroalcoholic solution the rest, up to the strength of 42,0±0,3% vol.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| MDA20020115A MD2103G2 (en) | 2002-04-05 | 2002-04-05 | Composition of balsam |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| MDA20020115A MD2103G2 (en) | 2002-04-05 | 2002-04-05 | Composition of balsam |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| MD2103F1 MD2103F1 (en) | 2003-02-28 |
| MD2103G2 true MD2103G2 (en) | 2003-08-31 |
Family
ID=19740063
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MDA20020115A MD2103G2 (en) | 2002-04-05 | 2002-04-05 | Composition of balsam |
Country Status (1)
| Country | Link |
|---|---|
| MD (1) | MD2103G2 (en) |
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MD2384G2 (en) * | 2003-03-05 | 2004-08-31 | Владимир КАРАУШ | Balsam composition |
| MD2383G2 (en) * | 2003-03-05 | 2004-09-30 | Владимир КАРАУШ | Balsam composition |
| MD2797G2 (en) * | 2004-12-10 | 2006-01-31 | Владимир КАРАУШ | Balsam |
| MD2776G2 (en) * | 2004-12-10 | 2006-01-31 | Владимир КАРАУШ | Balsam |
| MD2777G2 (en) * | 2004-12-10 | 2006-01-31 | Владимир КАРАУШ | Balsam |
| MD3186G2 (en) * | 2005-11-25 | 2007-06-30 | Владимир КАРАУШ | Phytotherapeutic composition |
| MD3207G2 (en) * | 2005-11-25 | 2007-07-31 | Владимир КАРАУШ | Phytotherapeutic composition |
| MD3206G2 (en) * | 2005-11-25 | 2007-07-31 | Владимир КАРАУШ | Phytotherapeutic composition |
| MD3205G2 (en) * | 2005-11-25 | 2007-07-31 | Владимир КАРАУШ | Phytotherapeutic composition |
| MD3227G2 (en) * | 2005-12-01 | 2007-08-31 | Владимир КАРАУШ | Phytotherapeutic composition |
| MD670Z (en) * | 2012-11-06 | 2014-03-31 | Валериу РУДИК | Balm |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MD1216Z (en) * | 2017-04-12 | 2018-07-31 | Владимир КАРАУШ | Balsam with aphrodisiac effect |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2031107C1 (en) * | 1992-07-16 | 1995-03-20 | Харьковское производственное объединение спиртовой и ликеро-водочной промышленности | Composition of components for balsam |
| MD1702F1 (en) * | 2000-07-20 | 2001-07-31 | Vladimir CARAUS | Composition of ingredients for preparation of a therapeutic-prophylactic balm |
-
2002
- 2002-04-05 MD MDA20020115A patent/MD2103G2/en not_active IP Right Cessation
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2031107C1 (en) * | 1992-07-16 | 1995-03-20 | Харьковское производственное объединение спиртовой и ликеро-водочной промышленности | Composition of components for balsam |
| MD1702F1 (en) * | 2000-07-20 | 2001-07-31 | Vladimir CARAUS | Composition of ingredients for preparation of a therapeutic-prophylactic balm |
| MD1702G2 (en) * | 2000-07-20 | 2002-01-31 | Владимир КАРАУШ | Composition of ingredients for preparation of a therapeutic-prophylactic balm |
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MD2384G2 (en) * | 2003-03-05 | 2004-08-31 | Владимир КАРАУШ | Balsam composition |
| MD2383G2 (en) * | 2003-03-05 | 2004-09-30 | Владимир КАРАУШ | Balsam composition |
| MD2797G2 (en) * | 2004-12-10 | 2006-01-31 | Владимир КАРАУШ | Balsam |
| MD2776G2 (en) * | 2004-12-10 | 2006-01-31 | Владимир КАРАУШ | Balsam |
| MD2777G2 (en) * | 2004-12-10 | 2006-01-31 | Владимир КАРАУШ | Balsam |
| MD3186G2 (en) * | 2005-11-25 | 2007-06-30 | Владимир КАРАУШ | Phytotherapeutic composition |
| MD3207G2 (en) * | 2005-11-25 | 2007-07-31 | Владимир КАРАУШ | Phytotherapeutic composition |
| MD3206G2 (en) * | 2005-11-25 | 2007-07-31 | Владимир КАРАУШ | Phytotherapeutic composition |
| MD3205G2 (en) * | 2005-11-25 | 2007-07-31 | Владимир КАРАУШ | Phytotherapeutic composition |
| MD3227G2 (en) * | 2005-12-01 | 2007-08-31 | Владимир КАРАУШ | Phytotherapeutic composition |
| MD670Z (en) * | 2012-11-06 | 2014-03-31 | Валериу РУДИК | Balm |
Also Published As
| Publication number | Publication date |
|---|---|
| MD2103F1 (en) | 2003-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| MD2103F1 (en) | Composition of balsam | |
| MD2775G2 (en) | Balsam | |
| MD1702F1 (en) | Composition of ingredients for preparation of a therapeutic-prophylactic balm | |
| MD2797G2 (en) | Balsam | |
| MD2383F1 (en) | Balsam composition | |
| MD2798G2 (en) | Balsam | |
| MD2384F1 (en) | Balsam composition | |
| RU2064495C1 (en) | Composition of semisweet liqueur "tcharodeika" | |
| MD2777G2 (en) | Balsam | |
| MD2776G2 (en) | Balsam | |
| RU94022981A (en) | COMPOSITION OF INGREDIENTS FOR A HALF-CONCENT "CHARODEYKA" | |
| MD52Z (en) | Balsam | |
| MD2911G2 (en) | Balsam | |
| RU2000103719A (en) | KHABAROVSKY BALM | |
| RU2137828C1 (en) | Composition for sweet liqueur "yagoda taezhnaya" | |
| RU2034917C1 (en) | Bitter liqueur | |
| RU2022006C1 (en) | Balsam | |
| MD2834G2 (en) | Balsam | |
| RU2093555C1 (en) | Composition of bitter liqueur "taras bulba" | |
| RU2041937C1 (en) | Composition of ingredients for preparing of bitter liqueur | |
| MD2641G2 (en) | Alcoholic beverage | |
| MD2675G2 (en) | Alcoholic beverage | |
| MD2640G2 (en) | Alcoholic beverage | |
| RU2109046C1 (en) | Composition for wine drink "aigul" | |
| MD2077G2 (en) | Composition of balsam |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| KA4A | Patent for invention lapsed due to non-payment of fees (with right of restoration) | ||
| MM4A | Patent for invention definitely lapsed due to non-payment of fees |