KR20150082613A - 인간 포스파티딜이노시톨 3-키나제 델타의 퓨린 억제제 - Google Patents
인간 포스파티딜이노시톨 3-키나제 델타의 퓨린 억제제 Download PDFInfo
- Publication number
- KR20150082613A KR20150082613A KR1020157015530A KR20157015530A KR20150082613A KR 20150082613 A KR20150082613 A KR 20150082613A KR 1020157015530 A KR1020157015530 A KR 1020157015530A KR 20157015530 A KR20157015530 A KR 20157015530A KR 20150082613 A KR20150082613 A KR 20150082613A
- Authority
- KR
- South Korea
- Prior art keywords
- oxy
- methyl
- purine
- alkyl
- pyrrolidin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 title claims description 32
- 108091007960 PI3Ks Proteins 0.000 title description 10
- 239000003112 inhibitor Substances 0.000 title description 9
- 108090000430 Phosphatidylinositol 3-kinases Proteins 0.000 title description 6
- 102000003993 Phosphatidylinositol 3-kinases Human genes 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 claims abstract description 272
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 26
- 238000011282 treatment Methods 0.000 claims abstract description 17
- 230000001404 mediated effect Effects 0.000 claims abstract description 15
- 208000006673 asthma Diseases 0.000 claims abstract description 14
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 13
- 201000011510 cancer Diseases 0.000 claims abstract description 10
- 102100036056 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform Human genes 0.000 claims abstract 5
- 101710204747 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform Proteins 0.000 claims abstract 5
- -1 chloro, methyl Chemical group 0.000 claims description 665
- 125000000217 alkyl group Chemical group 0.000 claims description 615
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 266
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 151
- 206010057190 Respiratory tract infections Diseases 0.000 claims description 122
- 125000001072 heteroaryl group Chemical group 0.000 claims description 98
- 125000003118 aryl group Chemical group 0.000 claims description 91
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 81
- 229910005965 SO 2 Inorganic materials 0.000 claims description 74
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 66
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 51
- 229910052739 hydrogen Inorganic materials 0.000 claims description 47
- NYCVCXMSZNOGDH-UHFFFAOYSA-N pyrrolidine-1-carboxylic acid Chemical compound OC(=O)N1CCCC1 NYCVCXMSZNOGDH-UHFFFAOYSA-N 0.000 claims description 45
- 239000001257 hydrogen Substances 0.000 claims description 43
- 238000000034 method Methods 0.000 claims description 42
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 40
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 38
- 125000004104 aryloxy group Chemical group 0.000 claims description 37
- 125000001424 substituent group Chemical group 0.000 claims description 37
- 125000006652 (C3-C12) cycloalkyl group Chemical group 0.000 claims description 35
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 34
- 150000003839 salts Chemical class 0.000 claims description 34
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 33
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 33
- 229910052736 halogen Inorganic materials 0.000 claims description 31
- 150000002367 halogens Chemical class 0.000 claims description 31
- 125000004404 heteroalkyl group Chemical group 0.000 claims description 31
- 150000002431 hydrogen Chemical class 0.000 claims description 30
- WSFSSNUMVMOOMR-BJUDXGSMSA-N methanone Chemical compound O=[11CH2] WSFSSNUMVMOOMR-BJUDXGSMSA-N 0.000 claims description 25
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 25
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 24
- 239000003814 drug Substances 0.000 claims description 23
- 229910052799 carbon Inorganic materials 0.000 claims description 22
- 125000004076 pyridyl group Chemical group 0.000 claims description 22
- 125000005195 alkyl amino carbonyloxy group Chemical group 0.000 claims description 21
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 20
- 229910052760 oxygen Inorganic materials 0.000 claims description 20
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 20
- 125000003282 alkyl amino group Chemical group 0.000 claims description 19
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Natural products C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 19
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 18
- 229910052757 nitrogen Inorganic materials 0.000 claims description 18
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 18
- 239000008194 pharmaceutical composition Substances 0.000 claims description 17
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 16
- 125000000304 alkynyl group Chemical group 0.000 claims description 16
- 125000003386 piperidinyl group Chemical group 0.000 claims description 15
- UFUASNAHBMBJIX-UHFFFAOYSA-N propan-1-one Chemical compound CC[C]=O UFUASNAHBMBJIX-UHFFFAOYSA-N 0.000 claims description 14
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 13
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 13
- 125000001153 fluoro group Chemical group F* 0.000 claims description 13
- 125000005843 halogen group Chemical group 0.000 claims description 13
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 241000124008 Mammalia Species 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 11
- 208000023275 Autoimmune disease Diseases 0.000 claims description 11
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 11
- 125000002883 imidazolyl group Chemical group 0.000 claims description 11
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 11
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 11
- 229910052717 sulfur Inorganic materials 0.000 claims description 11
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 10
- GHVNFZFCNZKVNT-UHFFFAOYSA-N decanoic acid Chemical compound CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 claims description 10
- 125000005143 heteroarylsulfonyl group Chemical group 0.000 claims description 10
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 10
- WAKRNLOCXPOXIF-UHFFFAOYSA-N 2-(2-methylpyrimidin-5-yl)-7H-purine Chemical compound CC1=NC=C(C=N1)C1=NC=C2N=CNC2=N1 WAKRNLOCXPOXIF-UHFFFAOYSA-N 0.000 claims description 9
- 125000002393 azetidinyl group Chemical group 0.000 claims description 9
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 9
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 claims description 8
- 208000035475 disorder Diseases 0.000 claims description 8
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 8
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 8
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 7
- CZVCGJBESNRLEQ-UHFFFAOYSA-N 7h-purine;pyrimidine Chemical compound C1=CN=CN=C1.C1=NC=C2NC=NC2=N1 CZVCGJBESNRLEQ-UHFFFAOYSA-N 0.000 claims description 7
- 125000004419 alkynylene group Chemical group 0.000 claims description 7
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 7
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 7
- 125000002346 iodo group Chemical group I* 0.000 claims description 7
- 206010039073 rheumatoid arthritis Diseases 0.000 claims description 7
- 229940124597 therapeutic agent Drugs 0.000 claims description 7
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 125000002757 morpholinyl group Chemical group 0.000 claims description 6
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 5
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 5
- CFPBYGKISUKURJ-UHFFFAOYSA-N 3h-quinolin-2-one Chemical compound C1=CC=CC2=NC(=O)CC=C21 CFPBYGKISUKURJ-UHFFFAOYSA-N 0.000 claims description 5
- 125000006374 C2-C10 alkenyl group Chemical group 0.000 claims description 5
- 150000001408 amides Chemical class 0.000 claims description 5
- 206010003246 arthritis Diseases 0.000 claims description 5
- KKLHCMCSZHFUHY-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1 KKLHCMCSZHFUHY-UHFFFAOYSA-N 0.000 claims description 5
- 239000003937 drug carrier Substances 0.000 claims description 5
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 claims description 5
- AGRIQBHIKABLPJ-UHFFFAOYSA-N 1-Pyrrolidinecarboxaldehyde Chemical compound O=CN1CCCC1 AGRIQBHIKABLPJ-UHFFFAOYSA-N 0.000 claims description 4
- YDLKIGGNLFRWPO-UHFFFAOYSA-N 2-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurine Chemical compound C(C)N1N=CC(=C1C)C1=NC=C2N=CN(C2=N1)C YDLKIGGNLFRWPO-UHFFFAOYSA-N 0.000 claims description 4
- OXQQJJYRHLUXHI-UHFFFAOYSA-N 2-methoxy-5-[9-methyl-6-(1-propanoylpyrrolidin-3-yl)oxypurin-8-yl]pyridine-3-carbonitrile Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=C(C(OC)=NC=1)C#N)N2C OXQQJJYRHLUXHI-UHFFFAOYSA-N 0.000 claims description 4
- XIKVRCRSYNDODR-UHFFFAOYSA-N 5-[6-[1-(cyclopropanecarbonyl)pyrrolidin-3-yl]oxy-9-ethylpurin-8-yl]-2-methoxypyridine-3-carbonitrile Chemical compound N1=CN=C2N(CC)C(C=3C=C(C(OC)=NC=3)C#N)=NC2=C1OC(C1)CCN1C(=O)C1CC1 XIKVRCRSYNDODR-UHFFFAOYSA-N 0.000 claims description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 4
- SRJXXDDAMCNELH-UHFFFAOYSA-N azetidin-1-yl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C(=O)N1CCC1 SRJXXDDAMCNELH-UHFFFAOYSA-N 0.000 claims description 4
- KJQHNHJNXPNQRK-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxy-2-methylpyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1C)CCN1C(=O)C1CC1 KJQHNHJNXPNQRK-UHFFFAOYSA-N 0.000 claims description 4
- YYFMBLFGZRGPNE-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxy-4-fluoropyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C(C1)F)CN1C(=O)C1CC1 YYFMBLFGZRGPNE-UHFFFAOYSA-N 0.000 claims description 4
- PZPZKFQGUCXWQH-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxy-4-methylpyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C(C1)C)CN1C(=O)C1CC1 PZPZKFQGUCXWQH-UHFFFAOYSA-N 0.000 claims description 4
- KHRIEONTLHPNDX-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-[4-(trifluoromethyl)phenyl]purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=CC(=CC=3)C(F)(F)F)=NC2=C1OC(C1)CCN1C(=O)C1CC1 KHRIEONTLHPNDX-UHFFFAOYSA-N 0.000 claims description 4
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 4
- 230000005764 inhibitory process Effects 0.000 claims description 4
- CWWDHYLFFAUMFN-UHFFFAOYSA-N 8-(1-ethyl-5-methylpyrazol-4-yl)-9-methyl-6-pyrrolidin-3-yloxypurine Chemical compound CCN1N=CC(C=2N(C3=NC=NC(OC4CNCC4)=C3N=2)C)=C1C CWWDHYLFFAUMFN-UHFFFAOYSA-N 0.000 claims description 3
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 3
- 125000005144 cycloalkylsulfonyl group Chemical group 0.000 claims description 3
- QSNHBBRYLWUGKQ-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-[6-(trifluoromethyl)pyridin-3-yl]purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(=CC=3)C(F)(F)F)=NC2=C1OC(C1)CCN1C(=O)C1CC1 QSNHBBRYLWUGKQ-UHFFFAOYSA-N 0.000 claims description 3
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 3
- 125000003003 spiro group Chemical group 0.000 claims description 3
- ZKQNLXGACSUWHP-UHFFFAOYSA-N 1-[3-(8-cyclopropyl-9-methylpurin-6-yl)oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C1CC1)N2C ZKQNLXGACSUWHP-UHFFFAOYSA-N 0.000 claims description 2
- FBVXSZSWFRWVJX-UHFFFAOYSA-N 1-[3-(8-iodo-9-methylpurin-6-yl)oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(I)N2C FBVXSZSWFRWVJX-UHFFFAOYSA-N 0.000 claims description 2
- MNGYUMAPTXRHRH-UHFFFAOYSA-N 1-[3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C1=C(N(CC)N=C1)C)N2C MNGYUMAPTXRHRH-UHFFFAOYSA-N 0.000 claims description 2
- CFUCFPVYEDQNTK-UHFFFAOYSA-N 1-[3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-propylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound N1=CN=C2N(CCC)C(C3=C(N(CC)N=C3)C)=NC2=C1OC1CCN(C(=O)CC)C1 CFUCFPVYEDQNTK-UHFFFAOYSA-N 0.000 claims description 2
- JBZHXXPKJHJKGS-UHFFFAOYSA-N 1-[3-[8-(1-tert-butylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C1=CN(N=C1)C(C)(C)C)N2C JBZHXXPKJHJKGS-UHFFFAOYSA-N 0.000 claims description 2
- MAGPRRMLAMDPPE-UHFFFAOYSA-N 1-[3-[8-(1h-indazol-5-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=C3C=NNC3=CC=1)N2C MAGPRRMLAMDPPE-UHFFFAOYSA-N 0.000 claims description 2
- JGCKEPAGXKCVDS-UHFFFAOYSA-N 1-[3-[8-(1h-indazol-6-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=C3NN=CC3=CC=1)N2C JGCKEPAGXKCVDS-UHFFFAOYSA-N 0.000 claims description 2
- BLBBNQVTYJJHDE-UHFFFAOYSA-N 1-[3-[8-(1h-indol-5-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=C3C=CNC3=CC=1)N2C BLBBNQVTYJJHDE-UHFFFAOYSA-N 0.000 claims description 2
- BGYCJOBUBJHUBY-UHFFFAOYSA-N 1-[3-[8-(1h-indol-6-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=C3NC=CC3=CC=1)N2C BGYCJOBUBJHUBY-UHFFFAOYSA-N 0.000 claims description 2
- IYBXWBAUMUJBPB-UHFFFAOYSA-N 1-[3-[8-(2,3-dimethylphenoxy)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(OC=1C(=C(C)C=CC=1)C)N2C IYBXWBAUMUJBPB-UHFFFAOYSA-N 0.000 claims description 2
- AQYCUMQONQZZEU-UHFFFAOYSA-N 1-[3-[8-(2-methylpyrimidin-5-yl)-9-propylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound N1=CN=C2N(CCC)C(C=3C=NC(C)=NC=3)=NC2=C1OC1CCN(C(=O)CC)C1 AQYCUMQONQZZEU-UHFFFAOYSA-N 0.000 claims description 2
- NQSSKRZDCWPXMA-UHFFFAOYSA-N 1-[3-[8-(3,6-dihydro-2h-pyran-4-yl)-9-ethylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1CCOCC=1)N2CC NQSSKRZDCWPXMA-UHFFFAOYSA-N 0.000 claims description 2
- IDQMQFUODDQCGQ-UHFFFAOYSA-N 1-[3-[8-(3-fluoro-4-methoxyphenoxy)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(OC=1C=C(F)C(OC)=CC=1)N2C IDQMQFUODDQCGQ-UHFFFAOYSA-N 0.000 claims description 2
- YDOQNNQYXJGZFF-UHFFFAOYSA-N 1-[3-[8-(3-fluoro-4-methoxyphenyl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=C(F)C(OC)=CC=1)N2C YDOQNNQYXJGZFF-UHFFFAOYSA-N 0.000 claims description 2
- SYBCUOVCLVVGGZ-UHFFFAOYSA-N 1-[3-[8-(3-fluoro-5-hydroxyphenyl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=C(F)C=C(O)C=1)N2C SYBCUOVCLVVGGZ-UHFFFAOYSA-N 0.000 claims description 2
- XPWCASWTMFFOAW-UHFFFAOYSA-N 1-[3-[8-(3-fluoro-5-methoxyphenoxy)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(OC=1C=C(OC)C=C(F)C=1)N2C XPWCASWTMFFOAW-UHFFFAOYSA-N 0.000 claims description 2
- QQYOXUCLCCYTCB-UHFFFAOYSA-N 1-[3-[8-(4-methoxy-3-methylphenyl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=C(C)C(OC)=CC=1)N2C QQYOXUCLCCYTCB-UHFFFAOYSA-N 0.000 claims description 2
- UYHMJQWCKNOWPI-UHFFFAOYSA-N 1-[3-[8-(5-aminopyridin-3-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=C(N)C=NC=1)N2C UYHMJQWCKNOWPI-UHFFFAOYSA-N 0.000 claims description 2
- BRCHZFYEKARLPL-UHFFFAOYSA-N 1-[3-[8-(5-fluoro-6-methoxypyridin-3-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=C(F)C(OC)=NC=1)N2C BRCHZFYEKARLPL-UHFFFAOYSA-N 0.000 claims description 2
- GTKSBHRIRKXPRM-UHFFFAOYSA-N 1-[3-[8-(6-chloropyridin-3-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=NC(Cl)=CC=1)N2C GTKSBHRIRKXPRM-UHFFFAOYSA-N 0.000 claims description 2
- SHSWEZJMUGMIGS-UHFFFAOYSA-N 1-[3-[8-(6-methoxypyridin-3-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=NC(OC)=CC=1)N2C SHSWEZJMUGMIGS-UHFFFAOYSA-N 0.000 claims description 2
- DUAHEWVIPDLLGK-UHFFFAOYSA-N 1-[3-[8-(difluoromethyl)-9-ethylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C(F)F)N2CC DUAHEWVIPDLLGK-UHFFFAOYSA-N 0.000 claims description 2
- MHJGPHWENGUXEN-UHFFFAOYSA-N 1-[3-[8-[4-methoxy-3-(trifluoromethyl)phenyl]-9-methylpurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=C(C(OC)=CC=1)C(F)(F)F)N2C MHJGPHWENGUXEN-UHFFFAOYSA-N 0.000 claims description 2
- NYHAFWSIXMKBSR-UHFFFAOYSA-N 1-[3-[9-ethyl-8-(2-methylpropyl)purin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(CC(C)C)N2CC NYHAFWSIXMKBSR-UHFFFAOYSA-N 0.000 claims description 2
- AZBPJWIFVPUIAI-UHFFFAOYSA-N 1-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]-3-methylbut-2-en-1-one Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC1CCN(C(=O)C=C(C)C)C1 AZBPJWIFVPUIAI-UHFFFAOYSA-N 0.000 claims description 2
- YNOLINLXOHNAOX-UHFFFAOYSA-N 1-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=NC(C)=NC=1)N2CC YNOLINLXOHNAOX-UHFFFAOYSA-N 0.000 claims description 2
- YSNFQMYIOFYSQP-UHFFFAOYSA-N 1-[3-[9-ethyl-8-(6-methoxypyridin-3-yl)purin-6-yl]oxypyrrolidin-1-yl]-2-methylpropan-1-one Chemical compound N1=CN=C2N(CC)C(C=3C=NC(OC)=CC=3)=NC2=C1OC1CCN(C(=O)C(C)C)C1 YSNFQMYIOFYSQP-UHFFFAOYSA-N 0.000 claims description 2
- PZNJWWCYQHJKQH-UHFFFAOYSA-N 1-[3-[9-ethyl-8-(trifluoromethyl)purin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C(F)(F)F)N2CC PZNJWWCYQHJKQH-UHFFFAOYSA-N 0.000 claims description 2
- PECPLZJZYKUHKH-UHFFFAOYSA-N 1-[3-[9-methyl-8-(1-phenylpyrazol-4-yl)purin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C1=CN(N=C1)C=1C=CC=CC=1)N2C PECPLZJZYKUHKH-UHFFFAOYSA-N 0.000 claims description 2
- BLIKUWWKRGOCGS-UHFFFAOYSA-N 1-[3-[9-methyl-8-(2-methylpropyl)purin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(CC(C)C)N2C BLIKUWWKRGOCGS-UHFFFAOYSA-N 0.000 claims description 2
- VLXPWSLFJZYRMM-UHFFFAOYSA-N 1-[3-[9-methyl-8-(2-methylpyrimidin-5-yl)oxypurin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(OC=1C=NC(C)=NC=1)N2C VLXPWSLFJZYRMM-UHFFFAOYSA-N 0.000 claims description 2
- HJUDSEREIMMUTN-UHFFFAOYSA-N 1-[3-[9-methyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=NC(C)=NC=1)N2C HJUDSEREIMMUTN-UHFFFAOYSA-N 0.000 claims description 2
- YKZHMKAMGZQYLG-UHFFFAOYSA-N 1-[3-[9-methyl-8-(4-methylsulfonylphenyl)purin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=CC(=CC=1)S(C)(=O)=O)N2C YKZHMKAMGZQYLG-UHFFFAOYSA-N 0.000 claims description 2
- AQEIWFRZEFTHIM-UHFFFAOYSA-N 1-[3-[9-methyl-8-(5-methyl-1-phenylpyrazol-4-yl)purin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C1=C(N(N=C1)C=1C=CC=CC=1)C)N2C AQEIWFRZEFTHIM-UHFFFAOYSA-N 0.000 claims description 2
- CGMBLXAYLNQDKR-UHFFFAOYSA-N 1-[3-[9-methyl-8-(6-methylpyridin-3-yl)purin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=NC(C)=CC=1)N2C CGMBLXAYLNQDKR-UHFFFAOYSA-N 0.000 claims description 2
- QXCDAKCDUTWWFF-UHFFFAOYSA-N 1-[3-[9-methyl-8-(trifluoromethyl)purin-6-yl]oxypyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C(F)(F)F)N2C QXCDAKCDUTWWFF-UHFFFAOYSA-N 0.000 claims description 2
- WJCVCEFMJZIVDX-UHFFFAOYSA-N 1-[3-[[8-(1-ethyl-5-methylpyrazol-4-yl)-7h-purin-6-yl]oxy]pyrrolidin-1-yl]propan-1-one Chemical compound C1N(C(=O)CC)CCC1OC1=NC=NC2=C1NC(C1=C(N(CC)N=C1)C)=N2 WJCVCEFMJZIVDX-UHFFFAOYSA-N 0.000 claims description 2
- ZDGNLHKLCQVHPS-UHFFFAOYSA-N 1-[4-[8-(1-ethyl-5-methylpyrazol-3-yl)-9-methylpurin-6-yl]oxypiperidin-1-yl]propan-1-one Chemical compound C1CN(C(=O)CC)CCC1OC1=NC=NC2=C1N=C(C1=NN(CC)C(C)=C1)N2C ZDGNLHKLCQVHPS-UHFFFAOYSA-N 0.000 claims description 2
- MCLXGVNIBMHMNS-UHFFFAOYSA-N 1-methylpyrazolo[3,4-d]pyrimidine Chemical compound N1=CN=C2N(C)N=CC2=C1 MCLXGVNIBMHMNS-UHFFFAOYSA-N 0.000 claims description 2
- FFOVFIRMBLLEJP-UHFFFAOYSA-N 2,3,4,7-tetrahydro-1h-purine Chemical compound N1CNC=C2NC=NC21 FFOVFIRMBLLEJP-UHFFFAOYSA-N 0.000 claims description 2
- GIVOGGAEBFBQRY-UHFFFAOYSA-N 3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxy-n-methyl-n-phenylpyrrolidine-1-carboxamide Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C(=O)N(C)C1=CC=CC=C1 GIVOGGAEBFBQRY-UHFFFAOYSA-N 0.000 claims description 2
- HYZVYAPATCJLAU-UHFFFAOYSA-N 3-aminobutanal Chemical compound CC(N)CC=O HYZVYAPATCJLAU-UHFFFAOYSA-N 0.000 claims description 2
- BHXHOQNSZIVOER-UHFFFAOYSA-N 4-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxy-n-methyl-n-phenylpiperidine-1-carboxamide Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(CC1)CCN1C(=O)N(C)C1=CC=CC=C1 BHXHOQNSZIVOER-UHFFFAOYSA-N 0.000 claims description 2
- HLQYMJBLZXMUMO-UHFFFAOYSA-N 6-(1-benzyl-4,4-dimethylpyrrolidin-3-yl)oxy-9-ethyl-8-(2-methylpyrimidin-5-yl)purine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C(C1)(C)C)CN1CC1=CC=CC=C1 HLQYMJBLZXMUMO-UHFFFAOYSA-N 0.000 claims description 2
- IIYZILPSCTXHAL-UHFFFAOYSA-N 7h-purine;pyridine Chemical compound C1=CC=NC=C1.C1=NC=C2NC=NC2=N1 IIYZILPSCTXHAL-UHFFFAOYSA-N 0.000 claims description 2
- OLNWYVKNFPNTJB-UHFFFAOYSA-N 8-(1-ethyl-5-methylpyrazol-4-yl)-9-methyl-6-(1-propylpyrrolidin-3-yl)oxypurine Chemical compound C1N(CCC)CCC1OC1=NC=NC2=C1N=C(C1=C(N(CC)N=C1)C)N2C OLNWYVKNFPNTJB-UHFFFAOYSA-N 0.000 claims description 2
- BIKKSFLJMFTBII-UHFFFAOYSA-N 8-(1-ethyl-5-methylpyrazol-4-yl)-9-methyl-6-(1-pyridin-2-ylpyrrolidin-3-yl)oxypurine Chemical compound CCN1N=CC(C=2N(C3=NC=NC(OC4CN(CC4)C=4N=CC=CC=4)=C3N=2)C)=C1C BIKKSFLJMFTBII-UHFFFAOYSA-N 0.000 claims description 2
- NSYZIWZUEJHJHC-UHFFFAOYSA-N 9-ethyl-6-(1-ethylsulfonylpyrrolidin-3-yl)oxy-8-(2-methylpyrimidin-5-yl)purine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC1CCN(S(=O)(=O)CC)C1 NSYZIWZUEJHJHC-UHFFFAOYSA-N 0.000 claims description 2
- IFFAUMIRKQDPET-UHFFFAOYSA-N 9-ethyl-6-[1-(2-methylphenyl)pyrrolidin-3-yl]oxy-8-(2-methylpyrimidin-5-yl)purine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C1=CC=CC=C1C IFFAUMIRKQDPET-UHFFFAOYSA-N 0.000 claims description 2
- ODVVLUBUZHEIGH-UHFFFAOYSA-N 9-ethyl-6-[1-(4-fluorophenyl)pyrrolidin-3-yl]oxy-8-(2-methylpyrimidin-5-yl)purine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C1=CC=C(F)C=C1 ODVVLUBUZHEIGH-UHFFFAOYSA-N 0.000 claims description 2
- AYYVRZSTWQLNCQ-UHFFFAOYSA-N 9-ethyl-6-[1-(4-methylpyridin-2-yl)pyrrolidin-3-yl]oxy-8-(2-methylpyrimidin-5-yl)purine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C1=CC(C)=CC=N1 AYYVRZSTWQLNCQ-UHFFFAOYSA-N 0.000 claims description 2
- HCCKZLORQINBOV-UHFFFAOYSA-N 9-ethyl-8-(2-methylpyrimidin-5-yl)-6-(1-phenylpyrrolidin-3-yl)oxypurine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C1=CC=CC=C1 HCCKZLORQINBOV-UHFFFAOYSA-N 0.000 claims description 2
- SZBMHDCOVGGKPI-UHFFFAOYSA-N 9-ethyl-8-(2-methylpyrimidin-5-yl)-6-(1-pyrazin-2-ylpyrrolidin-3-yl)oxypurine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C1=CN=CC=N1 SZBMHDCOVGGKPI-UHFFFAOYSA-N 0.000 claims description 2
- XNJSHIQIUVFZLL-UHFFFAOYSA-N 9-ethyl-8-(2-methylpyrimidin-5-yl)-6-(1-pyridin-2-ylpiperidin-3-yl)oxypurine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCCN1C1=CC=CC=N1 XNJSHIQIUVFZLL-UHFFFAOYSA-N 0.000 claims description 2
- XDAONEQQEZTBBL-UHFFFAOYSA-N 9-ethyl-8-(2-methylpyrimidin-5-yl)-6-(1-pyridin-2-ylpyrrolidin-3-yl)oxypurine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C1=CC=CC=N1 XDAONEQQEZTBBL-UHFFFAOYSA-N 0.000 claims description 2
- QZZFFVIJUPQWRU-UHFFFAOYSA-N 9-ethyl-8-(2-methylpyrimidin-5-yl)-6-(1-pyridin-3-ylpyrrolidin-3-yl)oxypurine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C1=CC=CN=C1 QZZFFVIJUPQWRU-UHFFFAOYSA-N 0.000 claims description 2
- PUWPBXQOVDGQMG-UHFFFAOYSA-N 9-ethyl-8-(2-methylpyrimidin-5-yl)-6-(1-pyrimidin-5-ylpyrrolidin-3-yl)oxypurine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C1=CN=CN=C1 PUWPBXQOVDGQMG-UHFFFAOYSA-N 0.000 claims description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims description 2
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 claims description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 claims description 2
- 201000001263 Psoriatic Arthritis Diseases 0.000 claims description 2
- 208000036824 Psoriatic arthropathy Diseases 0.000 claims description 2
- NVSPJDGXKBDYIZ-UHFFFAOYSA-N [1,2,4]triazolo[4,3-a]pyrazine Chemical compound C1=NC=CN2C=NN=C21 NVSPJDGXKBDYIZ-UHFFFAOYSA-N 0.000 claims description 2
- SAWHZQXWEWBBKZ-UHFFFAOYSA-N [3-[8-(5-chloro-6-methoxypyridin-3-yl)-9-ethylpurin-6-yl]oxypyrrolidin-1-yl]-cyclopropylmethanone Chemical compound N1=CN=C2N(CC)C(C=3C=C(Cl)C(OC)=NC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1 SAWHZQXWEWBBKZ-UHFFFAOYSA-N 0.000 claims description 2
- SIFZJUXKBMILIA-UHFFFAOYSA-N [3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]-(1-methylcyclobutyl)methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C(=O)C1(C)CCC1 SIFZJUXKBMILIA-UHFFFAOYSA-N 0.000 claims description 2
- MDXLUXBVEBQEMB-UHFFFAOYSA-N [3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]-(2-methylcyclopropyl)methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1C MDXLUXBVEBQEMB-UHFFFAOYSA-N 0.000 claims description 2
- PNGBSTRVQGLGNA-UHFFFAOYSA-N [3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]-(3-methylcyclobutyl)methanone Chemical compound CCN1C(=NC2=C(OC3CCN(C3)C(=O)C3CC(C)C3)N=CN=C12)C1=CN=C(C)N=C1 PNGBSTRVQGLGNA-UHFFFAOYSA-N 0.000 claims description 2
- ZJOFXUHWYKVIDA-UHFFFAOYSA-N [3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]-(oxolan-3-yl)methanone Chemical compound C(C)N1C2=NC=NC(=C2N=C1C=1C=NC(=NC1)C)OC1CN(CC1)C(=O)C1COCC1 ZJOFXUHWYKVIDA-UHFFFAOYSA-N 0.000 claims description 2
- NTHXSXRLPCUXNU-UHFFFAOYSA-N [3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]-piperidin-1-ylmethanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C(=O)N1CCCCC1 NTHXSXRLPCUXNU-UHFFFAOYSA-N 0.000 claims description 2
- VKJRJIHIGQSVCI-UHFFFAOYSA-N azetidin-3-yl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C(=O)C1CNC1 VKJRJIHIGQSVCI-UHFFFAOYSA-N 0.000 claims description 2
- KVVMXWRFYAGASO-UHFFFAOYSA-N azetidine-1-carboxylic acid Chemical compound OC(=O)N1CCC1 KVVMXWRFYAGASO-UHFFFAOYSA-N 0.000 claims description 2
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- MHMDULHMMKCWHI-UHFFFAOYSA-N cyclopropyl-[3-[8-(2,4-dimethylpyrimidin-5-yl)-9-ethylpurin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C(=NC(C)=NC=3)C)=NC2=C1OC(C1)CCN1C(=O)C1CC1 MHMDULHMMKCWHI-UHFFFAOYSA-N 0.000 claims description 2
- WNROTAFRDFHHQG-UHFFFAOYSA-N cyclopropyl-[3-[8-[6-(difluoromethoxy)pyridin-3-yl]-9-ethylpurin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(OC(F)F)=CC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1 WNROTAFRDFHHQG-UHFFFAOYSA-N 0.000 claims description 2
- PIEMGRLPIFKFCC-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(2-methoxypyridin-4-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=C(OC)N=CC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1 PIEMGRLPIFKFCC-UHFFFAOYSA-N 0.000 claims description 2
- FETKZAKWDUVVHD-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(2-methoxypyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(OC)=NC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1 FETKZAKWDUVVHD-UHFFFAOYSA-N 0.000 claims description 2
- KWAGUAVWLVQEDU-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxy-3-methylpyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)(C)CCN1C(=O)C1CC1 KWAGUAVWLVQEDU-UHFFFAOYSA-N 0.000 claims description 2
- PULXYFGNEXICSE-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxy-4-hydroxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C(C1)O)CN1C(=O)C1CC1 PULXYFGNEXICSE-UHFFFAOYSA-N 0.000 claims description 2
- DFMSPLZYMXNENJ-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxy-4-methoxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C(C1)OC)CN1C(=O)C1CC1 DFMSPLZYMXNENJ-UHFFFAOYSA-N 0.000 claims description 2
- UUNVASWXAXWTEY-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(3-fluoro-4-methoxyphenyl)purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=C(F)C(OC)=CC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1 UUNVASWXAXWTEY-UHFFFAOYSA-N 0.000 claims description 2
- CNTXNESSHOHLEW-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(5-fluoro-6-methoxypyridin-3-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=C(F)C(OC)=NC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1 CNTXNESSHOHLEW-UHFFFAOYSA-N 0.000 claims description 2
- BYSLNESALSJTON-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(5-fluoro-6-methylpyridin-3-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=C(F)C(C)=NC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1 BYSLNESALSJTON-UHFFFAOYSA-N 0.000 claims description 2
- NGDWEBKYJKMJHO-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(5-methoxypyridin-2-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3N=CC(OC)=CC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1 NGDWEBKYJKMJHO-UHFFFAOYSA-N 0.000 claims description 2
- LTASRDZYZYDOTK-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(6-methoxy-5-methylpyridin-3-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=C(C)C(OC)=NC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1 LTASRDZYZYDOTK-UHFFFAOYSA-N 0.000 claims description 2
- QOXGOSFAOKMVHJ-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-(6-methoxypyridin-3-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=NC(OC)=CC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1 QOXGOSFAOKMVHJ-UHFFFAOYSA-N 0.000 claims description 2
- BIBRYXAKJKJADR-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-[2-(trifluoromethyl)pyrimidin-5-yl]purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound C1(CC1)C(=O)N1CC(CC1)OC1=C2N=C(N(C2=NC=N1)CC)C=1C=NC(=NC=1)C(F)(F)F BIBRYXAKJKJADR-UHFFFAOYSA-N 0.000 claims description 2
- ANDMMOADHUFNJW-UHFFFAOYSA-N cyclopropyl-[3-[9-ethyl-8-[4-(trifluoromethoxy)phenyl]purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound N1=CN=C2N(CC)C(C=3C=CC(OC(F)(F)F)=CC=3)=NC2=C1OC(C1)CCN1C(=O)C1CC1 ANDMMOADHUFNJW-UHFFFAOYSA-N 0.000 claims description 2
- FTOWJKKXVOQWPJ-UHFFFAOYSA-N cyclopropyl-[3-ethyl-4-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone Chemical compound CCC1CN(C(=O)C2CC2)CC1OC(C=1N=2)=NC=NC=1N(CC)C=2C1=CN=C(C)N=C1 FTOWJKKXVOQWPJ-UHFFFAOYSA-N 0.000 claims description 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N gamma-butyrolactam Natural products O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 claims description 2
- 238000007429 general method Methods 0.000 claims description 2
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 claims description 2
- LCEDQNDDFOCWGG-UHFFFAOYSA-N morpholine-4-carbaldehyde Chemical compound O=CN1CCOCC1 LCEDQNDDFOCWGG-UHFFFAOYSA-N 0.000 claims description 2
- BTIHTOMTGBLSBP-UHFFFAOYSA-N n-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxycyclobutyl]ethanesulfonamide Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC1CC(NS(=O)(=O)CC)C1 BTIHTOMTGBLSBP-UHFFFAOYSA-N 0.000 claims description 2
- WIILISIYKGTXPH-UHFFFAOYSA-N n-[4-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxycyclohexyl]cyclopropanecarboxamide Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(CC1)CCC1NC(=O)C1CC1 WIILISIYKGTXPH-UHFFFAOYSA-N 0.000 claims description 2
- OJWPCUYSBMLDOJ-UHFFFAOYSA-N n-[4-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxycyclohexyl]propanamide Chemical compound C1CC(NC(=O)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=NC(C)=NC=1)N2CC OJWPCUYSBMLDOJ-UHFFFAOYSA-N 0.000 claims description 2
- UDKHLQJHBRZYHS-UHFFFAOYSA-N n-ethyl-3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxy-n-methylpyrrolidine-1-carboxamide Chemical compound C1N(C(=O)N(C)CC)CCC1OC1=NC=NC2=C1N=C(C=1C=NC(C)=NC=1)N2CC UDKHLQJHBRZYHS-UHFFFAOYSA-N 0.000 claims description 2
- DGOYLVBDCVINQZ-UHFFFAOYSA-N oxane-4-carboxamide Chemical compound NC(=O)C1CCOCC1 DGOYLVBDCVINQZ-UHFFFAOYSA-N 0.000 claims description 2
- WSDQIHATCCOMLH-UHFFFAOYSA-N phenyl n-(3,5-dichlorophenyl)carbamate Chemical compound ClC1=CC(Cl)=CC(NC(=O)OC=2C=CC=CC=2)=C1 WSDQIHATCCOMLH-UHFFFAOYSA-N 0.000 claims description 2
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 claims description 2
- LCDCPQHFCOBUEF-UHFFFAOYSA-N pyrrolidine-1-carboxamide Chemical compound NC(=O)N1CCCC1 LCDCPQHFCOBUEF-UHFFFAOYSA-N 0.000 claims description 2
- RQPODSPSPMZFCA-UHFFFAOYSA-N tert-butyl 3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxy-2-methylpyrrolidine-1-carboxylate Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC1CCN(C(=O)OC(C)(C)C)C1C RQPODSPSPMZFCA-UHFFFAOYSA-N 0.000 claims description 2
- HFNOQOKWCDZPFP-UHFFFAOYSA-N tert-butyl 3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxy-4-fluoropyrrolidine-1-carboxylate Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC1CN(C(=O)OC(C)(C)C)CC1F HFNOQOKWCDZPFP-UHFFFAOYSA-N 0.000 claims description 2
- MFTILFWJXRZNNC-UHFFFAOYSA-N tert-butyl 3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxy-4-hydroxypyrrolidine-1-carboxylate Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC1CN(C(=O)OC(C)(C)C)CC1O MFTILFWJXRZNNC-UHFFFAOYSA-N 0.000 claims description 2
- DDWBRNXDKNIQDY-UHFFFAOYSA-N thieno[2,3-d]pyrimidine Chemical compound N1=CN=C2SC=CC2=C1 DDWBRNXDKNIQDY-UHFFFAOYSA-N 0.000 claims description 2
- 125000003652 trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 4
- 208000027771 Obstructive airways disease Diseases 0.000 claims 2
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims 1
- 208000000884 Airway Obstruction Diseases 0.000 claims 1
- 230000036428 airway hyperreactivity Effects 0.000 claims 1
- 201000009961 allergic asthma Diseases 0.000 claims 1
- 230000001668 ameliorated effect Effects 0.000 claims 1
- 206010006451 bronchitis Diseases 0.000 claims 1
- 208000023819 chronic asthma Diseases 0.000 claims 1
- 239000000428 dust Substances 0.000 claims 1
- 208000024711 extrinsic asthma Diseases 0.000 claims 1
- 208000030603 inherited susceptibility to asthma Diseases 0.000 claims 1
- 230000000306 recurrent effect Effects 0.000 claims 1
- 201000010099 disease Diseases 0.000 abstract description 16
- 206010061218 Inflammation Diseases 0.000 abstract description 3
- 230000004054 inflammatory process Effects 0.000 abstract description 3
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 abstract description 2
- 229940124780 PI3K delta inhibitor Drugs 0.000 abstract description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 174
- 239000000203 mixture Substances 0.000 description 169
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 148
- 239000000243 solution Substances 0.000 description 131
- 238000002360 preparation method Methods 0.000 description 91
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 81
- 239000000543 intermediate Substances 0.000 description 80
- 206010012812 Diffuse cutaneous mastocytosis Diseases 0.000 description 77
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 74
- 238000006243 chemical reaction Methods 0.000 description 69
- 235000019439 ethyl acetate Nutrition 0.000 description 60
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 53
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 48
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 47
- 239000011541 reaction mixture Substances 0.000 description 47
- 239000011734 sodium Substances 0.000 description 46
- 230000000875 corresponding effect Effects 0.000 description 38
- 239000000284 extract Substances 0.000 description 35
- 239000000725 suspension Substances 0.000 description 34
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 33
- 238000004587 chromatography analysis Methods 0.000 description 33
- 229920006395 saturated elastomer Polymers 0.000 description 32
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 28
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 230000002829 reductive effect Effects 0.000 description 25
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 25
- 125000000623 heterocyclic group Chemical group 0.000 description 24
- 238000003756 stirring Methods 0.000 description 23
- 229910000104 sodium hydride Inorganic materials 0.000 description 22
- 229910004298 SiO 2 Inorganic materials 0.000 description 21
- 125000004432 carbon atom Chemical group C* 0.000 description 21
- 239000002904 solvent Substances 0.000 description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 20
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 19
- 239000002245 particle Substances 0.000 description 19
- 239000003208 petroleum Substances 0.000 description 19
- 239000012453 solvate Substances 0.000 description 19
- 238000000746 purification Methods 0.000 description 18
- 238000004007 reversed phase HPLC Methods 0.000 description 18
- 239000000741 silica gel Substances 0.000 description 18
- 229910002027 silica gel Inorganic materials 0.000 description 18
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 17
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 17
- 238000010568 chiral column chromatography Methods 0.000 description 17
- 239000002480 mineral oil Substances 0.000 description 17
- 235000010446 mineral oil Nutrition 0.000 description 17
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 16
- 239000000460 chlorine Substances 0.000 description 16
- 239000006184 cosolvent Substances 0.000 description 16
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 15
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 15
- 239000000651 prodrug Substances 0.000 description 15
- 229940002612 prodrug Drugs 0.000 description 15
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 14
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 14
- 239000007787 solid Substances 0.000 description 14
- 239000012298 atmosphere Substances 0.000 description 13
- 239000012267 brine Substances 0.000 description 13
- 125000004122 cyclic group Chemical group 0.000 description 13
- 230000000694 effects Effects 0.000 description 13
- 239000000706 filtrate Substances 0.000 description 13
- 125000005842 heteroatom Chemical group 0.000 description 13
- 239000012071 phase Substances 0.000 description 13
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 13
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 13
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 238000003556 assay Methods 0.000 description 12
- 125000002619 bicyclic group Chemical group 0.000 description 12
- 230000015572 biosynthetic process Effects 0.000 description 12
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 11
- PAQZWJGSJMLPMG-UHFFFAOYSA-N 2,4,6-tripropyl-1,3,5,2$l^{5},4$l^{5},6$l^{5}-trioxatriphosphinane 2,4,6-trioxide Chemical compound CCCP1(=O)OP(=O)(CCC)OP(=O)(CCC)O1 PAQZWJGSJMLPMG-UHFFFAOYSA-N 0.000 description 11
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- 239000003607 modifier Substances 0.000 description 11
- 125000000335 thiazolyl group Chemical group 0.000 description 11
- 239000004480 active ingredient Substances 0.000 description 10
- 229940079593 drug Drugs 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 10
- 210000000813 small intestine Anatomy 0.000 description 10
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 9
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 150000001412 amines Chemical class 0.000 description 9
- 239000003153 chemical reaction reagent Substances 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- QWXYZCJEXYQNEI-OSZHWHEXSA-N intermediate I Chemical compound COC(=O)[C@@]1(C=O)[C@H]2CC=[N+](C\C2=C\C)CCc2c1[nH]c1ccccc21 QWXYZCJEXYQNEI-OSZHWHEXSA-N 0.000 description 9
- 125000002950 monocyclic group Chemical group 0.000 description 9
- 239000012044 organic layer Substances 0.000 description 9
- 239000000546 pharmaceutical excipient Substances 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 239000012312 sodium hydride Substances 0.000 description 9
- 206010039491 Sarcoma Diseases 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 239000013543 active substance Substances 0.000 description 8
- 208000009956 adenocarcinoma Diseases 0.000 description 8
- 125000004429 atom Chemical group 0.000 description 8
- 238000009472 formulation Methods 0.000 description 8
- 150000003840 hydrochlorides Chemical class 0.000 description 8
- 238000001727 in vivo Methods 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 235000019198 oils Nutrition 0.000 description 8
- 238000003786 synthesis reaction Methods 0.000 description 8
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 7
- 239000007821 HATU Substances 0.000 description 7
- 102000038030 PI3Ks Human genes 0.000 description 7
- 238000013459 approach Methods 0.000 description 7
- 230000002401 inhibitory effect Effects 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- DKPZUBJRAYHHQC-LURJTMIESA-N 1-[(3s)-3-hydroxypyrrolidin-1-yl]propan-1-one Chemical compound CCC(=O)N1CC[C@H](O)C1 DKPZUBJRAYHHQC-LURJTMIESA-N 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 6
- 125000003342 alkenyl group Chemical group 0.000 description 6
- 229910052786 argon Inorganic materials 0.000 description 6
- 150000001721 carbon Chemical group 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 6
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 6
- 125000001188 haloalkyl group Chemical group 0.000 description 6
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 125000004043 oxo group Chemical group O=* 0.000 description 6
- 239000003380 propellant Substances 0.000 description 6
- 230000002441 reversible effect Effects 0.000 description 6
- APCBTRDHCDOPNY-ZETCQYMHSA-N tert-butyl (3s)-3-hydroxypyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CC[C@H](O)C1 APCBTRDHCDOPNY-ZETCQYMHSA-N 0.000 description 6
- 206010025323 Lymphomas Diseases 0.000 description 5
- 102000001708 Protein Isoforms Human genes 0.000 description 5
- 108010029485 Protein Isoforms Proteins 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 125000002837 carbocyclic group Chemical group 0.000 description 5
- 239000007859 condensation product Substances 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 150000004665 fatty acids Chemical class 0.000 description 5
- 206010016629 fibroma Diseases 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000000796 flavoring agent Substances 0.000 description 5
- 125000002541 furyl group Chemical group 0.000 description 5
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 5
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 5
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 5
- 231100000252 nontoxic Toxicity 0.000 description 5
- 230000003000 nontoxic effect Effects 0.000 description 5
- 230000003287 optical effect Effects 0.000 description 5
- 239000003755 preservative agent Substances 0.000 description 5
- 239000003765 sweetening agent Substances 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- ZKBQDFAWXLTYKS-UHFFFAOYSA-N 6-Chloro-1H-purine Chemical compound ClC1=NC=NC2=C1NC=N2 ZKBQDFAWXLTYKS-UHFFFAOYSA-N 0.000 description 4
- CSCQRGAUEMMNAS-UHFFFAOYSA-N 6-chloro-4-n-ethylpyrimidine-4,5-diamine Chemical compound CCNC1=NC=NC(Cl)=C1N CSCQRGAUEMMNAS-UHFFFAOYSA-N 0.000 description 4
- YSKHRCGNQFWRFM-UHFFFAOYSA-N 6-chloro-9-ethylpurine Chemical compound N1=CN=C2N(CC)C=NC2=C1Cl YSKHRCGNQFWRFM-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- 201000009030 Carcinoma Diseases 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- 241000282412 Homo Species 0.000 description 4
- 206010024612 Lipoma Diseases 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000002947 alkylene group Chemical group 0.000 description 4
- 239000007900 aqueous suspension Substances 0.000 description 4
- 150000001502 aryl halides Chemical class 0.000 description 4
- 238000010256 biochemical assay Methods 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 4
- 210000004027 cell Anatomy 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000013058 crude material Substances 0.000 description 4
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 4
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 4
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 235000003599 food sweetener Nutrition 0.000 description 4
- 201000011066 hemangioma Diseases 0.000 description 4
- 238000002868 homogeneous time resolved fluorescence Methods 0.000 description 4
- 125000001041 indolyl group Chemical group 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 230000036961 partial effect Effects 0.000 description 4
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 4
- 125000004193 piperazinyl group Chemical group 0.000 description 4
- 238000002953 preparative HPLC Methods 0.000 description 4
- 230000002265 prevention Effects 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 150000003235 pyrrolidines Chemical class 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 230000004044 response Effects 0.000 description 4
- 206010041823 squamous cell carcinoma Diseases 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- 239000000375 suspending agent Substances 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 4
- 239000000080 wetting agent Substances 0.000 description 4
- BTJLWJOEZRVRNL-UHFFFAOYSA-N (2-methylpyrimidin-5-yl)boronic acid Chemical compound CC1=NC=C(B(O)O)C=N1 BTJLWJOEZRVRNL-UHFFFAOYSA-N 0.000 description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 3
- 125000006654 (C3-C12) heteroaryl group Chemical group 0.000 description 3
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 3
- KSXGQRBTBLQJEF-UHFFFAOYSA-N 3-methoxyazetidine;hydrochloride Chemical compound Cl.COC1CNC1 KSXGQRBTBLQJEF-UHFFFAOYSA-N 0.000 description 3
- UEZNSCCMEMUEMO-UHFFFAOYSA-N 6-chloro-9-methylpurine Chemical compound N1=CN=C2N(C)C=NC2=C1Cl UEZNSCCMEMUEMO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 3
- 201000004624 Dermatitis Diseases 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- 201000004681 Psoriasis Diseases 0.000 description 3
- 206010039085 Rhinitis allergic Diseases 0.000 description 3
- 206010039710 Scleroderma Diseases 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000000443 aerosol Substances 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 201000010105 allergic rhinitis Diseases 0.000 description 3
- 230000001363 autoimmune Effects 0.000 description 3
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical group OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 125000000638 benzylaminocarbonyl group Chemical group C(C1=CC=CC=C1)NC(=O)* 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 208000019065 cervical carcinoma Diseases 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 3
- 125000006638 cyclopentyl carbonyl group Chemical group 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 229940112141 dry powder inhaler Drugs 0.000 description 3
- 125000006260 ethylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000004672 ethylcarbonyl group Chemical group [H]C([H])([H])C([H])([H])C(*)=O 0.000 description 3
- MNJVRJDLRVPLFE-UHFFFAOYSA-N etoricoxib Chemical compound C1=NC(C)=CC=C1C1=NC=C(Cl)C=C1C1=CC=C(S(C)(=O)=O)C=C1 MNJVRJDLRVPLFE-UHFFFAOYSA-N 0.000 description 3
- 235000013355 food flavoring agent Nutrition 0.000 description 3
- 239000007903 gelatin capsule Substances 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 238000001802 infusion Methods 0.000 description 3
- 125000006328 iso-butylcarbonyl group Chemical group [H]C([H])([H])C([H])(C(*)=O)C([H])([H])[H] 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- 150000002513 isocyanates Chemical class 0.000 description 3
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 3
- 229940057995 liquid paraffin Drugs 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 230000014759 maintenance of location Effects 0.000 description 3
- 201000001441 melanoma Diseases 0.000 description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 3
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000004006 olive oil Substances 0.000 description 3
- 235000008390 olive oil Nutrition 0.000 description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 238000012746 preparative thin layer chromatography Methods 0.000 description 3
- 150000003141 primary amines Chemical class 0.000 description 3
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000011593 sulfur Chemical group 0.000 description 3
- 125000001544 thienyl group Chemical group 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- 230000000699 topical effect Effects 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 3
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- GGZXJZZUBNDABX-ZETCQYMHSA-N (3s)-1-propylpyrrolidin-3-ol Chemical compound CCCN1CC[C@H](O)C1 GGZXJZZUBNDABX-ZETCQYMHSA-N 0.000 description 2
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 description 2
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 2
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 2
- YFMFNYKEUDLDTL-UHFFFAOYSA-N 1,1,1,2,3,3,3-heptafluoropropane Chemical compound FC(F)(F)C(F)C(F)(F)F YFMFNYKEUDLDTL-UHFFFAOYSA-N 0.000 description 2
- LVGUZGTVOIAKKC-UHFFFAOYSA-N 1,1,1,2-tetrafluoroethane Chemical compound FCC(F)(F)F LVGUZGTVOIAKKC-UHFFFAOYSA-N 0.000 description 2
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 2
- 125000005848 1-(alkoxycarbonyloxy)ethyl group Chemical group 0.000 description 2
- CLPRUSDTBLKDJO-UHFFFAOYSA-N 1-benzyl-4,4-dimethylpyrrolidin-3-ol Chemical compound C1C(O)C(C)(C)CN1CC1=CC=CC=C1 CLPRUSDTBLKDJO-UHFFFAOYSA-N 0.000 description 2
- CWLUFVAFWWNXJZ-UHFFFAOYSA-N 1-hydroxypyrrolidine Chemical compound ON1CCCC1 CWLUFVAFWWNXJZ-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- QWBBPBRQALCEIZ-UHFFFAOYSA-N 2,3-dimethylphenol Chemical compound CC1=CC=CC(O)=C1C QWBBPBRQALCEIZ-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- DCGQVDFBDSTUML-AWEZNQCLSA-N 2-[(3S)-3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxypiperidine-1-carbonyl]chromen-4-one Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)O[C@@H]1CN(CCC1)C(=O)C=1OC2=CC=CC=C2C(C=1)=O DCGQVDFBDSTUML-AWEZNQCLSA-N 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- LNJMHEJAYSYZKK-UHFFFAOYSA-N 2-methylpyrimidine Chemical compound CC1=NC=CC=N1 LNJMHEJAYSYZKK-UHFFFAOYSA-N 0.000 description 2
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 2
- VTNULXUEOJMRKZ-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-(2H-tetrazol-5-ylmethyl)benzamide Chemical compound N=1NN=NC=1CNC(C1=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F)=O VTNULXUEOJMRKZ-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- IJVFHCSUEBAAOZ-UHFFFAOYSA-N 3-fluoro-2-nitropyridine Chemical compound [O-][N+](=O)C1=NC=CC=C1F IJVFHCSUEBAAOZ-UHFFFAOYSA-N 0.000 description 2
- HCTISZQLTGAYOX-UHFFFAOYSA-N 4,6-dichloro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=C(Cl)N=CN=C1Cl HCTISZQLTGAYOX-UHFFFAOYSA-N 0.000 description 2
- NIGDWBHWHVHOAD-UHFFFAOYSA-N 4,6-dichloropyrimidin-5-amine Chemical compound NC1=C(Cl)N=CN=C1Cl NIGDWBHWHVHOAD-UHFFFAOYSA-N 0.000 description 2
- DEEKHWQPVDFTOZ-UHFFFAOYSA-N 4-(difluoromethyl)pyrrolidin-3-ol Chemical compound OC1CNCC1C(F)F DEEKHWQPVDFTOZ-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-dimethylaminopyridine Substances CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- NEDJTEXNSTUKHW-UHFFFAOYSA-N 5-bromo-2-methylpyrimidine Chemical compound CC1=NC=C(Br)C=N1 NEDJTEXNSTUKHW-UHFFFAOYSA-N 0.000 description 2
- CZRXJWUUKBREQH-UHFFFAOYSA-N 6-chloro-8-(difluoromethyl)-9-ethylpurine Chemical compound N1=CN=C2N(CC)C(C(F)F)=NC2=C1Cl CZRXJWUUKBREQH-UHFFFAOYSA-N 0.000 description 2
- UIXQGCXEKVBHLI-UHFFFAOYSA-N 6-chloro-9-ethyl-8-(2-methylpropyl)purine Chemical compound N1=CN=C2N(CC)C(CC(C)C)=NC2=C1Cl UIXQGCXEKVBHLI-UHFFFAOYSA-N 0.000 description 2
- WTKJUAMZWVAYLG-UHFFFAOYSA-N 6-chloro-9-ethyl-8-(2-methylpyrimidin-5-yl)purine Chemical compound N=1C2=C(Cl)N=CN=C2N(CC)C=1C1=CN=C(C)N=C1 WTKJUAMZWVAYLG-UHFFFAOYSA-N 0.000 description 2
- GPMPXKNHAQGMNX-UHFFFAOYSA-N 6-chloro-9-ethyl-8-iodopurine Chemical compound N1=CN=C2N(CC)C(I)=NC2=C1Cl GPMPXKNHAQGMNX-UHFFFAOYSA-N 0.000 description 2
- HNNXHPMIAWIPTR-UHFFFAOYSA-N 6-chloro-9-methyl-8-methylsulfanylpurine Chemical compound N1=CN=C2N(C)C(SC)=NC2=C1Cl HNNXHPMIAWIPTR-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 2
- WFBSWCYEELMJOC-ZETCQYMHSA-N 9-ethyl-8-iodo-6-[(3s)-pyrrolidin-3-yl]oxypurine Chemical compound N1=CN=C2N(CC)C(I)=NC2=C1O[C@H]1CCNC1 WFBSWCYEELMJOC-ZETCQYMHSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 201000003076 Angiosarcoma Diseases 0.000 description 2
- 102000001381 Arachidonate 5-Lipoxygenase Human genes 0.000 description 2
- 108010093579 Arachidonate 5-lipoxygenase Proteins 0.000 description 2
- 235000003911 Arachis Nutrition 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- ATXBXOZISWOEQX-HAQNSBGRSA-N CCn1c(nc2c(O[C@H]3C[C@H](N)C3)ncnc12)-c1cnc(C)nc1 Chemical compound CCn1c(nc2c(O[C@H]3C[C@H](N)C3)ncnc12)-c1cnc(C)nc1 ATXBXOZISWOEQX-HAQNSBGRSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 208000006332 Choriocarcinoma Diseases 0.000 description 2
- 206010008909 Chronic Hepatitis Diseases 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- 206010012504 Dermatophytosis Diseases 0.000 description 2
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- 201000008808 Fibrosarcoma Diseases 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 208000032612 Glial tumor Diseases 0.000 description 2
- 206010018338 Glioma Diseases 0.000 description 2
- 208000002927 Hamartoma Diseases 0.000 description 2
- 208000001258 Hemangiosarcoma Diseases 0.000 description 2
- 101000595746 Homo sapiens Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform Proteins 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 108090000723 Insulin-Like Growth Factor I Proteins 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- 208000007766 Kaposi sarcoma Diseases 0.000 description 2
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 241001460074 Microsporum distortum Species 0.000 description 2
- 208000034578 Multiple myelomas Diseases 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- 239000005642 Oleic acid Substances 0.000 description 2
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 2
- 206010033128 Ovarian cancer Diseases 0.000 description 2
- 101150037263 PIP2 gene Proteins 0.000 description 2
- 101150003085 Pdcl gene Proteins 0.000 description 2
- 241000721454 Pemphigus Species 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 206010035226 Plasma cell myeloma Diseases 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 206010037660 Pyrexia Diseases 0.000 description 2
- 101100262439 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) UBA2 gene Proteins 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- 201000009594 Systemic Scleroderma Diseases 0.000 description 2
- 206010042953 Systemic sclerosis Diseases 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 206010043276 Teratoma Diseases 0.000 description 2
- 208000002474 Tinea Diseases 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 206010047642 Vitiligo Diseases 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 239000000048 adrenergic agonist Substances 0.000 description 2
- 229940126157 adrenergic receptor agonist Drugs 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- NDAUXUAQIAJITI-UHFFFAOYSA-N albuterol Chemical compound CC(C)(C)NCC(O)C1=CC=C(O)C(CO)=C1 NDAUXUAQIAJITI-UHFFFAOYSA-N 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 125000000266 alpha-aminoacyl group Chemical group 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 125000004069 aziridinyl group Chemical group 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 229910000389 calcium phosphate Inorganic materials 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 238000000423 cell based assay Methods 0.000 description 2
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000002648 combination therapy Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 229940111134 coxibs Drugs 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 2
- 125000006637 cyclobutyl carbonyl group Chemical group 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 125000006639 cyclohexyl carbonyl group Chemical group 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000003255 cyclooxygenase 2 inhibitor Substances 0.000 description 2
- HBUCQYGZPFIHMM-JTQLQIEISA-N cyclopropyl-[(3s)-3-(9-ethyl-8-iodopurin-6-yl)oxypyrrolidin-1-yl]methanone Chemical compound C([C@@H](C1)OC2=C3N=C(I)N(C3=NC=N2)CC)CN1C(=O)C1CC1 HBUCQYGZPFIHMM-JTQLQIEISA-N 0.000 description 2
- 229910052805 deuterium Inorganic materials 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000037213 diet Effects 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 239000000890 drug combination Substances 0.000 description 2
- 238000009510 drug design Methods 0.000 description 2
- 230000004064 dysfunction Effects 0.000 description 2
- 239000003974 emollient agent Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 208000005017 glioblastoma Diseases 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 206010073071 hepatocellular carcinoma Diseases 0.000 description 2
- 231100000844 hepatocellular carcinoma Toxicity 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 150000005828 hydrofluoroalkanes Chemical class 0.000 description 2
- 230000003463 hyperproliferative effect Effects 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000000099 in vitro assay Methods 0.000 description 2
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 2
- 208000027866 inflammatory disease Diseases 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 230000000155 isotopic effect Effects 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- 201000010260 leiomyoma Diseases 0.000 description 2
- 230000000670 limiting effect Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 206010027191 meningioma Diseases 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 239000011259 mixed solution Substances 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- CPGWSLFYXMRNDV-UHFFFAOYSA-N n-methyl-n-phenylcarbamoyl chloride Chemical compound ClC(=O)N(C)C1=CC=CC=C1 CPGWSLFYXMRNDV-UHFFFAOYSA-N 0.000 description 2
- 239000000346 nonvolatile oil Substances 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 2
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 2
- 201000008968 osteosarcoma Diseases 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- 239000008177 pharmaceutical agent Substances 0.000 description 2
- 125000003367 polycyclic group Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 150000003212 purines Chemical class 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- 201000009410 rhabdomyosarcoma Diseases 0.000 description 2
- 125000006413 ring segment Chemical group 0.000 description 2
- 229960002052 salbutamol Drugs 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 2
- 235000011069 sorbitan monooleate Nutrition 0.000 description 2
- 239000001593 sorbitan monooleate Substances 0.000 description 2
- 229940035049 sorbitan monooleate Drugs 0.000 description 2
- OGNAOIGAPPSUMG-UHFFFAOYSA-N spiro[2.2]pentane Chemical compound C1CC11CC1 OGNAOIGAPPSUMG-UHFFFAOYSA-N 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 238000004808 supercritical fluid chromatography Methods 0.000 description 2
- 208000011580 syndromic disease Diseases 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- KLDUDWPAKYJTAG-JTQLQIEISA-N tert-butyl (3s)-3-(9-ethyl-8-iodopurin-6-yl)oxypyrrolidine-1-carboxylate Chemical compound N1=CN=C2N(CC)C(I)=NC2=C1O[C@H]1CCN(C(=O)OC(C)(C)C)C1 KLDUDWPAKYJTAG-JTQLQIEISA-N 0.000 description 2
- MKRJRMARSARGCB-UHFFFAOYSA-N tert-butyl 3,3-difluoro-4-hydroxypyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CC(O)C(F)(F)C1 MKRJRMARSARGCB-UHFFFAOYSA-N 0.000 description 2
- YBTXFRMIDRBSDO-UHFFFAOYSA-N tert-butyl 3,3-difluoro-4-phenylmethoxypyrrolidine-1-carboxylate Chemical compound FC1(F)CN(C(=O)OC(C)(C)C)CC1OCC1=CC=CC=C1 YBTXFRMIDRBSDO-UHFFFAOYSA-N 0.000 description 2
- APCBTRDHCDOPNY-UHFFFAOYSA-N tert-butyl 3-hydroxypyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(O)C1 APCBTRDHCDOPNY-UHFFFAOYSA-N 0.000 description 2
- FPFWWPZOUAYHDV-UHFFFAOYSA-N tert-butyl 3-oxo-4-phenylmethoxypyrrolidine-1-carboxylate Chemical compound O=C1CN(C(=O)OC(C)(C)C)CC1OCC1=CC=CC=C1 FPFWWPZOUAYHDV-UHFFFAOYSA-N 0.000 description 2
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 2
- YAPQBXQYLJRXSA-UHFFFAOYSA-N theobromine Chemical compound CN1C(=O)NC(=O)C2=C1N=CN2C YAPQBXQYLJRXSA-UHFFFAOYSA-N 0.000 description 2
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 125000001425 triazolyl group Chemical group 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 230000002485 urinary effect Effects 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- XWTYSIMOBUGWOL-UHFFFAOYSA-N (+-)-Terbutaline Chemical compound CC(C)(C)NCC(O)C1=CC(O)=CC(O)=C1 XWTYSIMOBUGWOL-UHFFFAOYSA-N 0.000 description 1
- IYXUFOCLMOXQSL-UHFFFAOYSA-N (2,2-difluoroacetyl) 2,2-difluoroacetate Chemical compound FC(F)C(=O)OC(=O)C(F)F IYXUFOCLMOXQSL-UHFFFAOYSA-N 0.000 description 1
- KLLYGDXCCNXESW-UHFFFAOYSA-N (2-fluoroacetyl) 2-fluoroacetate Chemical compound FCC(=O)OC(=O)CF KLLYGDXCCNXESW-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- RDJGLLICXDHJDY-NSHDSACASA-N (2s)-2-(3-phenoxyphenyl)propanoic acid Chemical compound OC(=O)[C@@H](C)C1=CC=CC(OC=2C=CC=CC=2)=C1 RDJGLLICXDHJDY-NSHDSACASA-N 0.000 description 1
- IILGLPAJXQMKGQ-UHFFFAOYSA-N (3-fluoro-4-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1F IILGLPAJXQMKGQ-UHFFFAOYSA-N 0.000 description 1
- ZWHOTPNCEFWATE-CQSZACIVSA-N (3R)-3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-phenylpyrrolidine-1-carboxamide Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)O[C@H]1CN(CC1)C(=O)NC1=CC=CC=C1 ZWHOTPNCEFWATE-CQSZACIVSA-N 0.000 description 1
- SNAKUPLQASYKTC-AWEZNQCLSA-N (3S)-3-[[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxymethyl]-N-phenylpiperidine-1-carboxamide Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC[C@@H]1CN(CCC1)C(=O)NC1=CC=CC=C1 SNAKUPLQASYKTC-AWEZNQCLSA-N 0.000 description 1
- VWPCGQVPQIUEKU-TYSVMGFPSA-N (3S,4R)-4-(fluoromethyl)pyrrolidin-3-ol hydrochloride Chemical compound Cl.FC[C@H]1[C@@H](CNC1)O VWPCGQVPQIUEKU-TYSVMGFPSA-N 0.000 description 1
- ZIXJBZRHEOKPLP-PHDIDXHHSA-N (3S,4R)-4-ethylpyrrolidin-3-ol Chemical compound CC[C@@H]1CNC[C@H]1O ZIXJBZRHEOKPLP-PHDIDXHHSA-N 0.000 description 1
- PTYCBNUHKXMSSA-WHFBIAKZSA-N (3r,4s)-4-methylpyrrolidin-3-ol Chemical compound C[C@H]1CNC[C@@H]1O PTYCBNUHKXMSSA-WHFBIAKZSA-N 0.000 description 1
- 125000006526 (C1-C2) alkyl group Chemical group 0.000 description 1
- 125000005862 (C1-C6)alkanoyl group Chemical group 0.000 description 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 1
- 125000005845 (C2-C12)alkanoyloxymethyl group Chemical group 0.000 description 1
- 125000006555 (C3-C5) cycloalkyl group Chemical group 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- 125000006705 (C5-C7) cycloalkyl group Chemical group 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- 125000004605 1,2,3,4-tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- POFFJVRXOKDESI-UHFFFAOYSA-N 1,3,5,7-tetraoxa-4-silaspiro[3.3]heptane-2,6-dione Chemical compound O1C(=O)O[Si]21OC(=O)O2 POFFJVRXOKDESI-UHFFFAOYSA-N 0.000 description 1
- JBCFJMYPJJWIRG-UHFFFAOYSA-N 1,3-oxazole-4-carboxylic acid Chemical compound OC(=O)C1=COC=N1 JBCFJMYPJJWIRG-UHFFFAOYSA-N 0.000 description 1
- FZWPOVPBHOSLFN-UHFFFAOYSA-N 1,4-dioxa-9-azaspiro[4.5]decane Chemical compound O1CCOC11CNCCC1 FZWPOVPBHOSLFN-UHFFFAOYSA-N 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- GZGPRZYZKBQPBQ-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]decane Chemical compound O1CCOC11CCCCC1 GZGPRZYZKBQPBQ-UHFFFAOYSA-N 0.000 description 1
- ITFXDMMGMUVIDF-UHFFFAOYSA-N 1,7-diazaspiro[4.4]nonane Chemical compound C1CCNC21CNCC2 ITFXDMMGMUVIDF-UHFFFAOYSA-N 0.000 description 1
- RHRMCNWRSJMIFI-UHFFFAOYSA-N 1,9-diazaspiro[4.5]decane Chemical compound C1CCNC21CNCCC2 RHRMCNWRSJMIFI-UHFFFAOYSA-N 0.000 description 1
- XLTAYZVSYHTRHI-UHFFFAOYSA-N 1,9-diazaspiro[5.5]undecane Chemical compound N1CCCCC11CCNCC1 XLTAYZVSYHTRHI-UHFFFAOYSA-N 0.000 description 1
- 125000005860 1-((C1-C6)alkanoyloxy)ethyl group Chemical group 0.000 description 1
- 125000005851 1-(N-(alkoxycarbonyl)amino)ethyl group Chemical group 0.000 description 1
- SUZOCIFIGKCISE-UHFFFAOYSA-N 1-(dimethylamino)propan-1-ol Chemical compound CCC(O)N(C)C SUZOCIFIGKCISE-UHFFFAOYSA-N 0.000 description 1
- WNWHABMAFRGPLU-VIFPVBQESA-N 1-[(3S)-3-(9-methyl-8-methylsulfonylpurin-6-yl)oxypyrrolidin-1-yl]propan-1-one Chemical compound CCC(=O)N1CC[C@@H](C1)Oc1ncnc2n(C)c(nc12)S(C)(=O)=O WNWHABMAFRGPLU-VIFPVBQESA-N 0.000 description 1
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 1
- YXEFFHITYOBLCN-UHFFFAOYSA-N 1-adamantyl(butyl)phosphane Chemical compound C1C(C2)CC3CC2CC1(PCCCC)C3 YXEFFHITYOBLCN-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- ZQXCQTAELHSNAT-UHFFFAOYSA-N 1-chloro-3-nitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(C(F)(F)F)=C1 ZQXCQTAELHSNAT-UHFFFAOYSA-N 0.000 description 1
- VSWPGAIWKHPTKX-UHFFFAOYSA-N 1-methyl-10-[2-(4-methyl-1-piperazinyl)-1-oxoethyl]-5H-thieno[3,4-b][1,5]benzodiazepin-4-one Chemical compound C1CN(C)CCN1CC(=O)N1C2=CC=CC=C2NC(=O)C2=CSC(C)=C21 VSWPGAIWKHPTKX-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- WLDPWZQYAVZTTP-UHFFFAOYSA-N 1-methyl-imidazole-2-carboxylic acid Chemical compound CN1C=CN=C1C(O)=O WLDPWZQYAVZTTP-UHFFFAOYSA-N 0.000 description 1
- QHPMPGYFWNHQKR-UHFFFAOYSA-N 1-oxa-8-azaspiro[5.5]undecane Chemical compound O1CCCCC11CNCCC1 QHPMPGYFWNHQKR-UHFFFAOYSA-N 0.000 description 1
- BLXRCCOYFVHFFD-UHFFFAOYSA-N 1-oxa-9-azaspiro[4.5]decane Chemical compound C1CCOC21CNCCC2 BLXRCCOYFVHFFD-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- KIPSRYDSZQRPEA-UHFFFAOYSA-N 2,2,2-trifluoroethanamine Chemical compound NCC(F)(F)F KIPSRYDSZQRPEA-UHFFFAOYSA-N 0.000 description 1
- WYZZNMWIWHRXRM-UHFFFAOYSA-N 2,8-diazaspiro[4.5]decane Chemical compound C1NCCC21CCNCC2 WYZZNMWIWHRXRM-UHFFFAOYSA-N 0.000 description 1
- BCDGPDCQBUYTMH-UHFFFAOYSA-N 2,8-diazaspiro[5.5]undecane Chemical compound C1CCNCC21CNCCC2 BCDGPDCQBUYTMH-UHFFFAOYSA-N 0.000 description 1
- SGLTYXRTDQXURA-UHFFFAOYSA-N 2,9-diazaspiro[4.5]decane Chemical compound C1NCCC21CNCCC2 SGLTYXRTDQXURA-UHFFFAOYSA-N 0.000 description 1
- ATRQECRSCHYSNP-UHFFFAOYSA-N 2-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC=CC=N1 ATRQECRSCHYSNP-UHFFFAOYSA-N 0.000 description 1
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 1
- RNIUHIHTGPHJEN-AWEZNQCLSA-N 2-[(3S)-1-[2-(3,4-dichlorophenyl)acetyl]piperidin-3-yl]oxy-6-(trifluoromethyl)pyridine-4-carbonitrile Chemical compound ClC=1C=C(C=CC=1Cl)CC(=O)N1C[C@H](CCC1)OC=1C=C(C#N)C=C(N=1)C(F)(F)F RNIUHIHTGPHJEN-AWEZNQCLSA-N 0.000 description 1
- IMRWILPUOVGIMU-UHFFFAOYSA-N 2-bromopyridine Chemical compound BrC1=CC=CC=N1 IMRWILPUOVGIMU-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- ZXGHKJHRHVDMSW-UHFFFAOYSA-N 2-chloro-5-methoxypyridine Chemical compound COC1=CC=C(Cl)N=C1 ZXGHKJHRHVDMSW-UHFFFAOYSA-N 0.000 description 1
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 1
- LLMVVTRTVIMYAG-UHFFFAOYSA-N 2-chloropyrimidine-4,6-diamine Chemical compound NC1=CC(N)=NC(Cl)=N1 LLMVVTRTVIMYAG-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- 229940013085 2-diethylaminoethanol Drugs 0.000 description 1
- XOHBENIMDRFUIH-UHFFFAOYSA-N 2-isocyanato-2,4,4-trimethylpentane Chemical compound CC(C)(C)CC(C)(C)N=C=O XOHBENIMDRFUIH-UHFFFAOYSA-N 0.000 description 1
- QOGNDJLSYMJGPP-UHFFFAOYSA-N 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical compound C1=NC(OC)=CC=C1B1OC(C)(C)C(C)(C)O1 QOGNDJLSYMJGPP-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000006026 2-methyl-1-butenyl group Chemical group 0.000 description 1
- ARDULWLULNPQBX-UHFFFAOYSA-N 2-oxa-9-azaspiro[4.5]decane Chemical compound C1OCCC21CNCCC2 ARDULWLULNPQBX-UHFFFAOYSA-N 0.000 description 1
- YVWATSXVUOJOIG-UHFFFAOYSA-N 3,6-dihydro-2h-pyran-4-ylboronic acid Chemical compound OB(O)C1=CCOCC1 YVWATSXVUOJOIG-UHFFFAOYSA-N 0.000 description 1
- LIDBMZYKSAXTQG-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-(2-sulfamoylethyl)benzamide Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(C(=O)NCCS(N)(=O)=O)C=CC=1 LIDBMZYKSAXTQG-UHFFFAOYSA-N 0.000 description 1
- ZUNFPBNHELLPPP-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-[2-(dimethylamino)ethyl]benzamide Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(C(=O)NCCN(C)C)C=CC=1 ZUNFPBNHELLPPP-UHFFFAOYSA-N 0.000 description 1
- WQYAZBFZFIUIPL-UHFFFAOYSA-N 3-fluoroazetidine Chemical compound FC1CNC1 WQYAZBFZFIUIPL-UHFFFAOYSA-N 0.000 description 1
- FPGGLMIYNLQOID-UHFFFAOYSA-N 3h-pyridin-2-one Chemical compound O=C1CC=CC=N1 FPGGLMIYNLQOID-UHFFFAOYSA-N 0.000 description 1
- WEQPBCSPRXFQQS-UHFFFAOYSA-N 4,5-dihydro-1,2-oxazole Chemical compound C1CC=NO1 WEQPBCSPRXFQQS-UHFFFAOYSA-N 0.000 description 1
- ROCFULKBKUAPCQ-UHFFFAOYSA-N 4-(difluoromethyl)pyrrolidin-3-ol;hydrochloride Chemical compound Cl.OC1CNCC1C(F)F ROCFULKBKUAPCQ-UHFFFAOYSA-N 0.000 description 1
- BGNGWHSBYQYVRX-UHFFFAOYSA-N 4-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=C(C=O)C=C1 BGNGWHSBYQYVRX-UHFFFAOYSA-N 0.000 description 1
- UHCSNYCGGADDBF-UHFFFAOYSA-N 4-(fluoromethyl)pyrrolidin-3-ol Chemical compound OC1CNCC1CF UHCSNYCGGADDBF-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- JVVRCYWZTJLJSG-UHFFFAOYSA-N 4-dimethylaminophenol Chemical compound CN(C)C1=CC=C(O)C=C1 JVVRCYWZTJLJSG-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-M 4-hydroxybenzoate Chemical compound OC1=CC=C(C([O-])=O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-M 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- SWBUHQQTIPEPMK-UHFFFAOYSA-N 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine Chemical compound C1NCCN2C=CN=C21 SWBUHQQTIPEPMK-UHFFFAOYSA-N 0.000 description 1
- PJJGZPJJTHBVMX-UHFFFAOYSA-N 5,7-Dihydroxyisoflavone Chemical compound C=1C(O)=CC(O)=C(C2=O)C=1OC=C2C1=CC=CC=C1 PJJGZPJJTHBVMX-UHFFFAOYSA-N 0.000 description 1
- 102000004023 5-Lipoxygenase-Activating Proteins Human genes 0.000 description 1
- 108090000411 5-Lipoxygenase-Activating Proteins Proteins 0.000 description 1
- BHIQRZLQBMERJY-UHFFFAOYSA-N 5-azaspiro[2.4]heptan-7-ol Chemical compound OC1CNCC11CC1 BHIQRZLQBMERJY-UHFFFAOYSA-N 0.000 description 1
- ZEZKXPQIDURFKA-UHFFFAOYSA-N 5-bromo-2-iodopyrimidine Chemical compound BrC1=CN=C(I)N=C1 ZEZKXPQIDURFKA-UHFFFAOYSA-N 0.000 description 1
- RIYBSFHJIOZYLD-UHFFFAOYSA-N 6-chloro-4-n-methylpyrimidine-4,5-diamine Chemical compound CNC1=NC=NC(Cl)=C1N RIYBSFHJIOZYLD-UHFFFAOYSA-N 0.000 description 1
- MTYPIBSGQRCYNF-UHFFFAOYSA-N 6-chloro-8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurine Chemical compound CCN1N=CC(C=2N(C3=NC=NC(Cl)=C3N=2)C)=C1C MTYPIBSGQRCYNF-UHFFFAOYSA-N 0.000 description 1
- WPSMFQSTHPULFA-UHFFFAOYSA-N 6-chloro-8-iodo-9-methylpurine Chemical compound N1=CN=C2N(C)C(I)=NC2=C1Cl WPSMFQSTHPULFA-UHFFFAOYSA-N 0.000 description 1
- JFNGZOFTWBIHPK-UHFFFAOYSA-N 6-chloro-9-methyl-8-[6-(trifluoromethyl)pyridin-3-yl]purine Chemical compound N=1C2=C(Cl)N=CN=C2N(C)C=1C1=CC=C(C(F)(F)F)N=C1 JFNGZOFTWBIHPK-UHFFFAOYSA-N 0.000 description 1
- HJCNZFOBWVEBNC-UHFFFAOYSA-N 6-chloro-n-methyl-5-nitropyrimidin-4-amine Chemical compound CNC1=NC=NC(Cl)=C1[N+]([O-])=O HJCNZFOBWVEBNC-UHFFFAOYSA-N 0.000 description 1
- UUENRKYQSYDJLI-UHFFFAOYSA-N 6-methoxy-5-methylpyridine-3-carbaldehyde Chemical compound COC1=NC=C(C=O)C=C1C UUENRKYQSYDJLI-UHFFFAOYSA-N 0.000 description 1
- TZQRCUHHXSMEFM-UHFFFAOYSA-N 7H-purine pyrrolidine Chemical compound N1=CN=C2N=CNC2=C1.N1CCCC1 TZQRCUHHXSMEFM-UHFFFAOYSA-N 0.000 description 1
- OBAMMCCFRNFEPN-UHFFFAOYSA-N 8-chloro-2-iodo-7h-purine Chemical compound IC1=NC=C2NC(Cl)=NC2=N1 OBAMMCCFRNFEPN-UHFFFAOYSA-N 0.000 description 1
- UIAMGTICRKXQPF-QMMMGPOBSA-N 9-ethyl-6-[(3s)-pyrrolidin-3-yl]oxypurine Chemical compound N1=CN=C2N(CC)C=NC2=C1O[C@H]1CCNC1 UIAMGTICRKXQPF-QMMMGPOBSA-N 0.000 description 1
- SDCKOAWCRDBNAB-UHFFFAOYSA-N 9-ethyl-6-[1-(3-fluorophenyl)pyrrolidin-3-yl]oxy-8-(2-methylpyrimidin-5-yl)purine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC(C1)CCN1C1=CC=CC(F)=C1 SDCKOAWCRDBNAB-UHFFFAOYSA-N 0.000 description 1
- QUTPPYSQBZJFFK-ZDUSSCGKSA-N 9-ethyl-8-(2-methylpyrimidin-5-yl)-6-[(3s)-piperidin-3-yl]oxypurine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1O[C@H]1CCCNC1 QUTPPYSQBZJFFK-ZDUSSCGKSA-N 0.000 description 1
- BAFQTDBNTPECHS-UHFFFAOYSA-N 9-ethyl-8-(2-methylpyrimidin-5-yl)-6-pyrrolidin-3-yloxypurine Chemical compound N1=CN=C2N(CC)C(C=3C=NC(C)=NC=3)=NC2=C1OC1CCNC1 BAFQTDBNTPECHS-UHFFFAOYSA-N 0.000 description 1
- HQVXGEVNBAUNFG-UHFFFAOYSA-N 9-ethyl-8-iodopurine Chemical compound C(C)N1C2=NC=NC=C2N=C1I HQVXGEVNBAUNFG-UHFFFAOYSA-N 0.000 description 1
- CHVNAJCSHLYMRZ-UHFFFAOYSA-N 9-methyl-8-methylsulfanylpurine Chemical compound N1=CN=C2N(C)C(SC)=NC2=C1 CHVNAJCSHLYMRZ-UHFFFAOYSA-N 0.000 description 1
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 description 1
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 description 1
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 1
- 206010001233 Adenoma benign Diseases 0.000 description 1
- 206010001367 Adrenal insufficiency Diseases 0.000 description 1
- 201000004384 Alopecia Diseases 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 208000033116 Asbestos intoxication Diseases 0.000 description 1
- 108010011485 Aspartame Proteins 0.000 description 1
- 206010003571 Astrocytoma Diseases 0.000 description 1
- 206010050245 Autoimmune thrombocytopenia Diseases 0.000 description 1
- MBUVEWMHONZEQD-UHFFFAOYSA-N Azeptin Chemical compound C1CN(C)CCCC1N1C(=O)C2=CC=CC=C2C(CC=2C=CC(Cl)=CC=2)=N1 MBUVEWMHONZEQD-UHFFFAOYSA-N 0.000 description 1
- 208000010839 B-cell chronic lymphocytic leukemia Diseases 0.000 description 1
- 206010004146 Basal cell carcinoma Diseases 0.000 description 1
- KUVIULQEHSCUHY-XYWKZLDCSA-N Beclometasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(Cl)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)COC(=O)CC)(OC(=O)CC)[C@@]1(C)C[C@@H]2O KUVIULQEHSCUHY-XYWKZLDCSA-N 0.000 description 1
- 208000009137 Behcet syndrome Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 208000008439 Biliary Liver Cirrhosis Diseases 0.000 description 1
- 208000033222 Biliary cirrhosis primary Diseases 0.000 description 1
- 206010073106 Bone giant cell tumour malignant Diseases 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 208000014644 Brain disease Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VOVIALXJUBGFJZ-KWVAZRHASA-N Budesonide Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1C[C@H]3OC(CCC)O[C@@]3(C(=O)CO)[C@@]1(C)C[C@@H]2O VOVIALXJUBGFJZ-KWVAZRHASA-N 0.000 description 1
- KHYRNTMLUPVHDB-UHFFFAOYSA-N C(C)(=O)O.C(CCC)PC12CC3CC(CC(C1)C3)C2 Chemical compound C(C)(=O)O.C(CCC)PC12CC3CC(CC(C1)C3)C2 KHYRNTMLUPVHDB-UHFFFAOYSA-N 0.000 description 1
- LDZSDXOIBCRZEW-UHFFFAOYSA-N C=1C2(C=C3C=CC=CC=13)CCC2 Chemical compound C=1C2(C=C3C=CC=CC=13)CCC2 LDZSDXOIBCRZEW-UHFFFAOYSA-N 0.000 description 1
- 229940124292 CD20 monoclonal antibody Drugs 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 206010007275 Carcinoid tumour Diseases 0.000 description 1
- 208000009458 Carcinoma in Situ Diseases 0.000 description 1
- ZKLPARSLTMPFCP-UHFFFAOYSA-N Cetirizine Chemical compound C1CN(CCOCC(=O)O)CCN1C(C=1C=CC(Cl)=CC=1)C1=CC=CC=C1 ZKLPARSLTMPFCP-UHFFFAOYSA-N 0.000 description 1
- GHOKWGTUZJEAQD-UHFFFAOYSA-N Chick antidermatitis factor Natural products OCC(C)(C)C(O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-UHFFFAOYSA-N 0.000 description 1
- 201000005262 Chondroma Diseases 0.000 description 1
- 208000005243 Chondrosarcoma Diseases 0.000 description 1
- 201000009047 Chordoma Diseases 0.000 description 1
- 206010009900 Colitis ulcerative Diseases 0.000 description 1
- 206010048832 Colon adenoma Diseases 0.000 description 1
- 206010010356 Congenital anomaly Diseases 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 208000011231 Crohn disease Diseases 0.000 description 1
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- 102000010918 Cysteinyl leukotriene receptors Human genes 0.000 description 1
- 108050001116 Cysteinyl leukotriene receptors Proteins 0.000 description 1
- 102100034032 Cytohesin-3 Human genes 0.000 description 1
- 101710160297 Cytohesin-3 Proteins 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- 206010012438 Dermatitis atopic Diseases 0.000 description 1
- 206010013457 Dissociation Diseases 0.000 description 1
- 201000009051 Embryonal Carcinoma Diseases 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 208000032274 Encephalopathy Diseases 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 108010008165 Etanercept Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 229910052693 Europium Inorganic materials 0.000 description 1
- 208000006168 Ewing Sarcoma Diseases 0.000 description 1
- OMQOYEFUIXXTNY-UHFFFAOYSA-N FC(F)(F)C1=NC=CC=C1.CC1(OBOC1(C)C)C Chemical compound FC(F)(F)C1=NC=CC=C1.CC1(OBOC1(C)C)C OMQOYEFUIXXTNY-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 208000007659 Fibroadenoma Diseases 0.000 description 1
- 230000005526 G1 to G0 transition Effects 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 208000007569 Giant Cell Tumors Diseases 0.000 description 1
- 201000005409 Gliomatosis cerebri Diseases 0.000 description 1
- 206010018364 Glomerulonephritis Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 108010068370 Glutens Proteins 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- VPNYRYCIDCJBOM-UHFFFAOYSA-M Glycopyrronium bromide Chemical compound [Br-].C1[N+](C)(C)CCC1OC(=O)C(O)(C=1C=CC=CC=1)C1CCCC1 VPNYRYCIDCJBOM-UHFFFAOYSA-M 0.000 description 1
- 206010018691 Granuloma Diseases 0.000 description 1
- 208000003807 Graves Disease Diseases 0.000 description 1
- 208000015023 Graves' disease Diseases 0.000 description 1
- 208000035895 Guillain-Barré syndrome Diseases 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 208000030836 Hashimoto thyroiditis Diseases 0.000 description 1
- 208000035186 Hemolytic Autoimmune Anemia Diseases 0.000 description 1
- 206010019629 Hepatic adenoma Diseases 0.000 description 1
- 206010019755 Hepatitis chronic active Diseases 0.000 description 1
- 102000003834 Histamine H1 Receptors Human genes 0.000 description 1
- 108090000110 Histamine H1 Receptors Proteins 0.000 description 1
- 208000017604 Hodgkin disease Diseases 0.000 description 1
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 1
- 208000013016 Hypoglycemia Diseases 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 1
- 206010022489 Insulin Resistance Diseases 0.000 description 1
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 description 1
- 208000002260 Keloid Diseases 0.000 description 1
- 206010023330 Keloid scar Diseases 0.000 description 1
- 150000008575 L-amino acids Chemical class 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- 239000004395 L-leucine Substances 0.000 description 1
- 235000019454 L-leucine Nutrition 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 1
- VVNCNSJFMMFHPL-GSVOUGTGSA-N L-penicillamine Chemical compound CC(C)(S)[C@H](N)C(O)=O VVNCNSJFMMFHPL-GSVOUGTGSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 208000002404 Liver Cell Adenoma Diseases 0.000 description 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 1
- 208000031422 Lymphocytic Chronic B-Cell Leukemia Diseases 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 208000006644 Malignant Fibrous Histiocytoma Diseases 0.000 description 1
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 1
- ZRVUJXDFFKFLMG-UHFFFAOYSA-N Meloxicam Chemical compound OC=1C2=CC=CC=C2S(=O)(=O)N(C)C=1C(=O)NC1=NC=C(C)S1 ZRVUJXDFFKFLMG-UHFFFAOYSA-N 0.000 description 1
- 206010027406 Mesothelioma Diseases 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- 206010049567 Miller Fisher syndrome Diseases 0.000 description 1
- 208000003250 Mixed connective tissue disease Diseases 0.000 description 1
- UCHDWCPVSPXUMX-TZIWLTJVSA-N Montelukast Chemical compound CC(C)(O)C1=CC=CC=C1CC[C@H](C=1C=C(\C=C\C=2N=C3C=C(Cl)C=CC3=CC=2)C=CC=1)SCC1(CC(O)=O)CC1 UCHDWCPVSPXUMX-TZIWLTJVSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 229940121948 Muscarinic receptor antagonist Drugs 0.000 description 1
- 201000003793 Myelodysplastic syndrome Diseases 0.000 description 1
- 208000014767 Myeloproliferative disease Diseases 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- 125000005855 N,N-di(C1-C2)alkylcarbamoyl-(C1-C2)alkyl group Chemical group 0.000 description 1
- 125000005850 N-(alkoxycarbonyl)aminomethyl group Chemical group 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- LOUUTVNXNCQVPW-UHFFFAOYSA-N N1=CC=CC=C1.CC1(OBOC1(C)C)C Chemical compound N1=CC=CC=C1.CC1(OBOC1(C)C)C LOUUTVNXNCQVPW-UHFFFAOYSA-N 0.000 description 1
- GXSALSRGMZHECJ-UHFFFAOYSA-N N1=CN=C2NC=NC2=C1.FC(C1=CC=CC=N1)(F)F Chemical compound N1=CN=C2NC=NC2=C1.FC(C1=CC=CC=N1)(F)F GXSALSRGMZHECJ-UHFFFAOYSA-N 0.000 description 1
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 description 1
- JAUOIFJMECXRGI-UHFFFAOYSA-N Neoclaritin Chemical compound C=1C(Cl)=CC=C2C=1CCC1=CC=CN=C1C2=C1CCNCC1 JAUOIFJMECXRGI-UHFFFAOYSA-N 0.000 description 1
- 206010029260 Neuroblastoma Diseases 0.000 description 1
- 201000004404 Neurofibroma Diseases 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 1
- 206010031149 Osteitis Diseases 0.000 description 1
- 208000000035 Osteochondroma Diseases 0.000 description 1
- 206010061535 Ovarian neoplasm Diseases 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 102100038332 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform Human genes 0.000 description 1
- 101710093328 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform Proteins 0.000 description 1
- 229940123932 Phosphodiesterase 4 inhibitor Drugs 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 208000012654 Primary biliary cholangitis Diseases 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 206010063837 Reperfusion injury Diseases 0.000 description 1
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 1
- 201000000582 Retinoblastoma Diseases 0.000 description 1
- 208000005678 Rhabdomyoma Diseases 0.000 description 1
- XYONNSVDNIRXKZ-UHFFFAOYSA-N S-methyl methanethiosulfonate Chemical compound CSS(C)(=O)=O XYONNSVDNIRXKZ-UHFFFAOYSA-N 0.000 description 1
- GIIZNNXWQWCKIB-UHFFFAOYSA-N Serevent Chemical compound C1=C(O)C(CO)=CC(C(O)CNCCCCCCOCCCCC=2C=CC=CC=2)=C1 GIIZNNXWQWCKIB-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 208000021386 Sjogren Syndrome Diseases 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 102000013275 Somatomedins Human genes 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 108010090804 Streptavidin Proteins 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 238000006069 Suzuki reaction reaction Methods 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- 208000031981 Thrombocytopenic Idiopathic Purpura Diseases 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- DRUIESSIVFYOMK-UHFFFAOYSA-N Trichloroacetonitrile Chemical compound ClC(Cl)(Cl)C#N DRUIESSIVFYOMK-UHFFFAOYSA-N 0.000 description 1
- 208000005448 Trichomonas Infections Diseases 0.000 description 1
- 206010044620 Trichomoniasis Diseases 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 201000006704 Ulcerative Colitis Diseases 0.000 description 1
- 208000015778 Undifferentiated pleomorphic sarcoma Diseases 0.000 description 1
- 206010047115 Vasculitis Diseases 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- 208000008383 Wilms tumor Diseases 0.000 description 1
- HUCJFAOMUPXHDK-UHFFFAOYSA-N Xylometazoline Chemical compound CC1=CC(C(C)(C)C)=CC(C)=C1CC1=NCCN1 HUCJFAOMUPXHDK-UHFFFAOYSA-N 0.000 description 1
- YEEZWCHGZNKEEK-UHFFFAOYSA-N Zafirlukast Chemical compound COC1=CC(C(=O)NS(=O)(=O)C=2C(=CC=CC=2)C)=CC=C1CC(C1=C2)=CN(C)C1=CC=C2NC(=O)OC1CCCC1 YEEZWCHGZNKEEK-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- WERKSKAQRVDLDW-ANOHMWSOSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO WERKSKAQRVDLDW-ANOHMWSOSA-N 0.000 description 1
- WGCOQYDRMPFAMN-ZDUSSCGKSA-N [(3S)-3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxypiperidin-1-yl]-pyrimidin-5-ylmethanone Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)O[C@@H]1CN(CCC1)C(=O)C=1C=NC=NC=1 WGCOQYDRMPFAMN-ZDUSSCGKSA-N 0.000 description 1
- ZUWYYXGDXPVZBZ-HNNXBMFYSA-N [(3s)-3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]-imidazol-1-ylmethanone Chemical compound C([C@@H](C1)OC2=C3N=C(N(C3=NC=N2)CC)C=2C=NC(C)=NC=2)CN1C(=O)N1C=CN=C1 ZUWYYXGDXPVZBZ-HNNXBMFYSA-N 0.000 description 1
- ZEEBGORNQSEQBE-UHFFFAOYSA-N [2-(3-phenylphenoxy)-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound C1(=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F)C1=CC=CC=C1 ZEEBGORNQSEQBE-UHFFFAOYSA-N 0.000 description 1
- UJQAHAANAPEYLR-UHFFFAOYSA-N [2-chloro-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-dicyclohexylphosphane Chemical group CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C1=CC=CC(Cl)=C1P(C1CCCCC1)C1CCCCC1 UJQAHAANAPEYLR-UHFFFAOYSA-N 0.000 description 1
- ABRVLXLNVJHDRQ-UHFFFAOYSA-N [2-pyridin-3-yl-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound FC(C1=CC(=CC(=N1)C=1C=NC=CC=1)CN)(F)F ABRVLXLNVJHDRQ-UHFFFAOYSA-N 0.000 description 1
- VOQHHELXYARECQ-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl] carbonochloridate Chemical compound FC(F)(F)C1=CC=CC(OC(Cl)=O)=C1 VOQHHELXYARECQ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- XLAKJQPTOJHYDR-QTQXQZBYSA-M aclidinium bromide Chemical compound [Br-].C([C@@H](C(CC1)CC2)OC(=O)C(O)(C=3SC=CC=3)C=3SC=CC=3)[N+]21CCCOC1=CC=CC=C1 XLAKJQPTOJHYDR-QTQXQZBYSA-M 0.000 description 1
- 229960005012 aclidinium bromide Drugs 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 208000038016 acute inflammation Diseases 0.000 description 1
- 230000006022 acute inflammation Effects 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000001919 adrenal effect Effects 0.000 description 1
- 208000017515 adrenocortical insufficiency Diseases 0.000 description 1
- 201000000028 adult respiratory distress syndrome Diseases 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000004450 alkenylene group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000005206 alkoxycarbonyloxymethyl group Chemical group 0.000 description 1
- 125000005055 alkyl alkoxy group Chemical group 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 208000028004 allergic respiratory disease Diseases 0.000 description 1
- 231100000360 alopecia Toxicity 0.000 description 1
- 102000030619 alpha-1 Adrenergic Receptor Human genes 0.000 description 1
- 108020004102 alpha-1 Adrenergic Receptor Proteins 0.000 description 1
- 102000030484 alpha-2 Adrenergic Receptor Human genes 0.000 description 1
- 108020004101 alpha-2 Adrenergic Receptor Proteins 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- FQPFAHBPWDRTLU-UHFFFAOYSA-N aminophylline Chemical compound NCCN.O=C1N(C)C(=O)N(C)C2=C1NC=N2.O=C1N(C)C(=O)N(C)C2=C1NC=N2 FQPFAHBPWDRTLU-UHFFFAOYSA-N 0.000 description 1
- 229960003556 aminophylline Drugs 0.000 description 1
- 150000005005 aminopyrimidines Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 208000007502 anemia Diseases 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000005251 aryl acyl group Chemical group 0.000 description 1
- 238000006254 arylation reaction Methods 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 206010003441 asbestosis Diseases 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 239000000605 aspartame Substances 0.000 description 1
- IAOZJIPTCAWIRG-QWRGUYRKSA-N aspartame Chemical compound OC(=O)C[C@H](N)C(=O)N[C@H](C(=O)OC)CC1=CC=CC=C1 IAOZJIPTCAWIRG-QWRGUYRKSA-N 0.000 description 1
- 235000010357 aspartame Nutrition 0.000 description 1
- 229960003438 aspartame Drugs 0.000 description 1
- 238000003149 assay kit Methods 0.000 description 1
- GXDALQBWZGODGZ-UHFFFAOYSA-N astemizole Chemical compound C1=CC(OC)=CC=C1CCN1CCC(NC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 GXDALQBWZGODGZ-UHFFFAOYSA-N 0.000 description 1
- 239000000305 astragalus gummifer gum Substances 0.000 description 1
- 201000008937 atopic dermatitis Diseases 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 201000000448 autoimmune hemolytic anemia Diseases 0.000 description 1
- 208000037979 autoimmune inflammatory disease Diseases 0.000 description 1
- 229960004574 azelastine Drugs 0.000 description 1
- 125000003725 azepanyl group Chemical group 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 229950000210 beclometasone dipropionate Drugs 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000004601 benzofurazanyl group Chemical group N1=C2C(=NO1)C(=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000004599 benzpyrazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- XWEVOJNCVKQTRG-UHFFFAOYSA-N benzyl 3-ethyl-4-hydroxypyrrolidine-1-carboxylate Chemical compound C1C(O)C(CC)CN1C(=O)OCC1=CC=CC=C1 XWEVOJNCVKQTRG-UHFFFAOYSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 150000005347 biaryls Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 239000012472 biological sample Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 239000010839 body fluid Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 208000018339 bone inflammation disease Diseases 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- GXJABQQUPOEUTA-RDJZCZTQSA-N bortezomib Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)B(O)O)NC(=O)C=1N=CC=NC=1)C1=CC=CC=C1 GXJABQQUPOEUTA-RDJZCZTQSA-N 0.000 description 1
- 229960001467 bortezomib Drugs 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 201000003149 breast fibroadenoma Diseases 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 210000000621 bronchi Anatomy 0.000 description 1
- 208000003362 bronchogenic carcinoma Diseases 0.000 description 1
- 201000002143 bronchus adenoma Diseases 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 229960004436 budesonide Drugs 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 229960001948 caffeine Drugs 0.000 description 1
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000004452 carbocyclyl group Chemical group 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 230000006315 carbonylation Effects 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 208000002458 carcinoid tumor Diseases 0.000 description 1
- 210000000845 cartilage Anatomy 0.000 description 1
- 229960000590 celecoxib Drugs 0.000 description 1
- RZEKVGVHFLEQIL-UHFFFAOYSA-N celecoxib Chemical compound C1=CC(C)=CC=C1C1=CC(C(F)(F)F)=NN1C1=CC=C(S(N)(=O)=O)C=C1 RZEKVGVHFLEQIL-UHFFFAOYSA-N 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 208000015114 central nervous system disease Diseases 0.000 description 1
- 229960001803 cetirizine Drugs 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 238000004296 chiral HPLC Methods 0.000 description 1
- 208000006990 cholangiocarcinoma Diseases 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 201000005217 chondroblastoma Diseases 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 208000032852 chronic lymphocytic leukemia Diseases 0.000 description 1
- 208000009060 clear cell adenocarcinoma Diseases 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 229940126142 compound 16 Drugs 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 229960000265 cromoglicic acid Drugs 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 239000012045 crude solution Substances 0.000 description 1
- 208000035250 cutaneous malignant susceptibility to 1 melanoma Diseases 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- WEPUZBYKXNKSDH-UHFFFAOYSA-N cyclopentanecarbonyl chloride Chemical compound ClC(=O)C1CCCC1 WEPUZBYKXNKSDH-UHFFFAOYSA-N 0.000 description 1
- QCVBLBMNIPLGBL-UHFFFAOYSA-N cyclopropyl-(3-ethyl-4-hydroxypyrrolidin-1-yl)methanone Chemical compound C1C(O)C(CC)CN1C(=O)C1CC1 QCVBLBMNIPLGBL-UHFFFAOYSA-N 0.000 description 1
- LGJDNKPNLLEPIF-RNFRBKRXSA-N cyclopropyl-[(3R,4S)-3-(difluoromethyl)-4-hydroxypyrrolidin-1-yl]methanone Chemical compound C1(CC1)C(=O)N1C[C@H]([C@@H](C1)O)C(F)F LGJDNKPNLLEPIF-RNFRBKRXSA-N 0.000 description 1
- YZVLWWGEFRBCOU-HTQZYQBOSA-N cyclopropyl-[(3R,4S)-3-(fluoromethyl)-4-hydroxypyrrolidin-1-yl]methanone Chemical compound C1(CC1)C(=O)N1C[C@H]([C@@H](C1)O)CF YZVLWWGEFRBCOU-HTQZYQBOSA-N 0.000 description 1
- QCVBLBMNIPLGBL-VXNVDRBHSA-N cyclopropyl-[(3R,4S)-3-ethyl-4-hydroxypyrrolidin-1-yl]methanone Chemical compound C1(CC1)C(=O)N1C[C@H]([C@@H](C1)O)CC QCVBLBMNIPLGBL-VXNVDRBHSA-N 0.000 description 1
- WLVKDFJTYKELLQ-UHFFFAOYSA-N cyclopropylboronic acid Chemical compound OB(O)C1CC1 WLVKDFJTYKELLQ-UHFFFAOYSA-N 0.000 description 1
- KWGRBVOPPLSCSI-UHFFFAOYSA-N d-ephedrine Natural products CNC(C)C(O)C1=CC=CC=C1 KWGRBVOPPLSCSI-UHFFFAOYSA-N 0.000 description 1
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 201000001981 dermatomyositis Diseases 0.000 description 1
- 229960001271 desloratadine Drugs 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- DCOPUUMXTXDBNB-UHFFFAOYSA-N diclofenac Chemical compound OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl DCOPUUMXTXDBNB-UHFFFAOYSA-N 0.000 description 1
- 229960001259 diclofenac Drugs 0.000 description 1
- 125000006001 difluoroethyl group Chemical group 0.000 description 1
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- 125000005047 dihydroimidazolyl group Chemical group N1(CNC=C1)* 0.000 description 1
- 125000001070 dihydroindolyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000005049 dihydrooxadiazolyl group Chemical group O1N(NC=C1)* 0.000 description 1
- 125000005050 dihydrooxazolyl group Chemical group O1C(NC=C1)* 0.000 description 1
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 1
- 125000005051 dihydropyrazinyl group Chemical group N1(CC=NC=C1)* 0.000 description 1
- 125000005052 dihydropyrazolyl group Chemical group N1(NCC=C1)* 0.000 description 1
- 125000004655 dihydropyridinyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 125000005053 dihydropyrimidinyl group Chemical group N1(CN=CC=C1)* 0.000 description 1
- 125000005054 dihydropyrrolyl group Chemical group [H]C1=C([H])C([H])([H])C([H])([H])N1* 0.000 description 1
- 125000005044 dihydroquinolinyl group Chemical group N1(CC=CC2=CC=CC=C12)* 0.000 description 1
- 125000005057 dihydrothienyl group Chemical group S1C(CC=C1)* 0.000 description 1
- 125000005058 dihydrotriazolyl group Chemical group N1(NNC=C1)* 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- AXAZMDOAUQTMOW-UHFFFAOYSA-N dimethylzinc Chemical compound C[Zn]C AXAZMDOAUQTMOW-UHFFFAOYSA-N 0.000 description 1
- 208000037765 diseases and disorders Diseases 0.000 description 1
- VLARUOGDXDTHEH-UHFFFAOYSA-L disodium cromoglycate Chemical compound [Na+].[Na+].O1C(C([O-])=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C([O-])=O)O2 VLARUOGDXDTHEH-UHFFFAOYSA-L 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 208000018459 dissociative disease Diseases 0.000 description 1
- DLNKOYKMWOXYQA-UHFFFAOYSA-N dl-pseudophenylpropanolamine Natural products CC(N)C(O)C1=CC=CC=C1 DLNKOYKMWOXYQA-UHFFFAOYSA-N 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000003821 enantio-separation Methods 0.000 description 1
- 229940073621 enbrel Drugs 0.000 description 1
- 230000002124 endocrine Effects 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- XWBDWHCCBGMXKG-UHFFFAOYSA-N ethanamine;hydron;chloride Chemical compound Cl.CCN XWBDWHCCBGMXKG-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- OTCUHRIIVIPBID-UHFFFAOYSA-N ethyl 2-methylpyrimidine-5-carboxylate Chemical compound CCOC(=O)C1=CN=C(C)N=C1 OTCUHRIIVIPBID-UHFFFAOYSA-N 0.000 description 1
- PEOQPQHZHDFVIL-UHFFFAOYSA-N ethyl 3-hydroxycyclopentane-1-carboxylate Chemical compound CCOC(=O)C1CCC(O)C1 PEOQPQHZHDFVIL-UHFFFAOYSA-N 0.000 description 1
- JIHFMAVLBZTLOR-LBPRGKRZSA-N ethyl 9-ethyl-6-[(3s)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]oxypurine-8-carboxylate Chemical compound N1=CN=C2N(CC)C(C(=O)OCC)=NC2=C1O[C@H]1CCN(C(=O)OC(C)(C)C)C1 JIHFMAVLBZTLOR-LBPRGKRZSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 229960004945 etoricoxib Drugs 0.000 description 1
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 229960001419 fenoprofen Drugs 0.000 description 1
- RWTNPBWLLIMQHL-UHFFFAOYSA-N fexofenadine Chemical compound C1=CC(C(C)(C(O)=O)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 RWTNPBWLLIMQHL-UHFFFAOYSA-N 0.000 description 1
- 229960003592 fexofenadine Drugs 0.000 description 1
- RFHAOTPXVQNOHP-UHFFFAOYSA-N fluconazole Chemical compound C1=NC=NN1CC(C=1C(=CC(F)=CC=1)F)(O)CN1C=NC=N1 RFHAOTPXVQNOHP-UHFFFAOYSA-N 0.000 description 1
- 229960004884 fluconazole Drugs 0.000 description 1
- 229960000390 fludarabine Drugs 0.000 description 1
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 1
- SYTBZMRGLBWNTM-UHFFFAOYSA-N flurbiprofen Chemical compound FC1=CC(C(C(O)=O)C)=CC=C1C1=CC=CC=C1 SYTBZMRGLBWNTM-UHFFFAOYSA-N 0.000 description 1
- 229960000289 fluticasone propionate Drugs 0.000 description 1
- WMWTYOKRWGGJOA-CENSZEJFSA-N fluticasone propionate Chemical compound C1([C@@H](F)C2)=CC(=O)C=C[C@]1(C)[C@]1(F)[C@@H]2[C@@H]2C[C@@H](C)[C@@](C(=O)SCF)(OC(=O)CC)[C@@]2(C)C[C@@H]1O WMWTYOKRWGGJOA-CENSZEJFSA-N 0.000 description 1
- BPZSYCZIITTYBL-UHFFFAOYSA-N formoterol Chemical compound C1=CC(OC)=CC=C1CC(C)NCC(O)C1=CC=C(O)C(NC=O)=C1 BPZSYCZIITTYBL-UHFFFAOYSA-N 0.000 description 1
- 229960002848 formoterol Drugs 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- YRTCKZIKGWZNCU-UHFFFAOYSA-N furo[3,2-b]pyridine Chemical compound C1=CC=C2OC=CC2=N1 YRTCKZIKGWZNCU-UHFFFAOYSA-N 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 239000003862 glucocorticoid Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 235000021312 gluten Nutrition 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 229940015042 glycopyrrolate Drugs 0.000 description 1
- 125000003147 glycosyl group Chemical group 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 208000006454 hepatitis Diseases 0.000 description 1
- 208000006359 hepatoblastoma Diseases 0.000 description 1
- 201000002735 hepatocellular adenoma Diseases 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 125000004474 heteroalkylene group Chemical group 0.000 description 1
- 125000005549 heteroarylene group Chemical group 0.000 description 1
- 125000005885 heterocycloalkylalkyl group Chemical group 0.000 description 1
- 150000004687 hexahydrates Chemical class 0.000 description 1
- 125000004634 hexahydroazepinyl group Chemical group N1(CCCCCC1)* 0.000 description 1
- FBPFZTCFMRRESA-UHFFFAOYSA-N hexane-1,2,3,4,5,6-hexol Chemical compound OCC(O)C(O)C(O)C(O)CO FBPFZTCFMRRESA-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004871 hexylcarbonyl group Chemical group C(CCCCC)C(=O)* 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- XGIHQYAWBCFNPY-AZOCGYLKSA-N hydrabamine Chemical compound C([C@@H]12)CC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC[C@@]1(C)CNCCNC[C@@]1(C)[C@@H]2CCC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC1 XGIHQYAWBCFNPY-AZOCGYLKSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- BNRNAKTVFSZAFA-UHFFFAOYSA-N hydrindane Chemical compound C1CCCC2CCCC21 BNRNAKTVFSZAFA-UHFFFAOYSA-N 0.000 description 1
- 229960000443 hydrochloric acid Drugs 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- XXSMGPRMXLTPCZ-UHFFFAOYSA-N hydroxychloroquine Chemical compound ClC1=CC=C2C(NC(C)CCCN(CCO)CC)=CC=NC2=C1 XXSMGPRMXLTPCZ-UHFFFAOYSA-N 0.000 description 1
- 229960004171 hydroxychloroquine Drugs 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 206010020718 hyperplasia Diseases 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 229960001680 ibuprofen Drugs 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- UFBBWLWUIISIPW-UHFFFAOYSA-N imidazo[2,1-b][1,3]thiazole Chemical compound C1=CSC2=NC=CN21 UFBBWLWUIISIPW-UHFFFAOYSA-N 0.000 description 1
- XBECWGJPSXHFCS-UHFFFAOYSA-N imidazole-1-carbaldehyde Chemical compound O=CN1C=CN=C1 XBECWGJPSXHFCS-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 208000026278 immune system disease Diseases 0.000 description 1
- 201000004933 in situ carcinoma Diseases 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 208000000509 infertility Diseases 0.000 description 1
- 230000036512 infertility Effects 0.000 description 1
- 231100000535 infertility Toxicity 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 229940102213 injectable suspension Drugs 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 230000026045 iodination Effects 0.000 description 1
- 238000006192 iodination reaction Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229960001361 ipratropium bromide Drugs 0.000 description 1
- KEWHKYJURDBRMN-ZEODDXGYSA-M ipratropium bromide hydrate Chemical compound O.[Br-].O([C@H]1C[C@H]2CC[C@@H](C1)[N@@+]2(C)C(C)C)C(=O)C(CO)C1=CC=CC=C1 KEWHKYJURDBRMN-ZEODDXGYSA-M 0.000 description 1
- 208000002551 irritable bowel syndrome Diseases 0.000 description 1
- 208000028867 ischemia Diseases 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 1
- 229960001317 isoprenaline Drugs 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 229940039009 isoproterenol Drugs 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 210000001117 keloid Anatomy 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- DKYWVDODHFEZIM-UHFFFAOYSA-N ketoprofen Chemical compound OC(=O)C(C)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 DKYWVDODHFEZIM-UHFFFAOYSA-N 0.000 description 1
- 229960000991 ketoprofen Drugs 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229960000448 lactic acid Drugs 0.000 description 1
- 210000002429 large intestine Anatomy 0.000 description 1
- VHOGYURTWQBHIL-UHFFFAOYSA-N leflunomide Chemical compound O1N=CC(C(=O)NC=2C=CC(=CC=2)C(F)(F)F)=C1C VHOGYURTWQBHIL-UHFFFAOYSA-N 0.000 description 1
- 229960000681 leflunomide Drugs 0.000 description 1
- 229960003136 leucine Drugs 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 210000000265 leukocyte Anatomy 0.000 description 1
- 150000002617 leukotrienes Chemical class 0.000 description 1
- 206010024627 liposarcoma Diseases 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 229960003088 loratadine Drugs 0.000 description 1
- JCCNYMKQOSZNPW-UHFFFAOYSA-N loratadine Chemical compound C1CN(C(=O)OCC)CCC1=C1C2=NC=CC=C2CCC2=CC(Cl)=CC=C21 JCCNYMKQOSZNPW-UHFFFAOYSA-N 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 201000005296 lung carcinoma Diseases 0.000 description 1
- 208000003747 lymphoid leukemia Diseases 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229940099690 malic acid Drugs 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 201000004593 malignant giant cell tumor Diseases 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 150000002696 manganese Chemical class 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229960003464 mefenamic acid Drugs 0.000 description 1
- 229960001929 meloxicam Drugs 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 210000002418 meninge Anatomy 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- LMOINURANNBYCM-UHFFFAOYSA-N metaproterenol Chemical compound CC(C)NCC(O)C1=CC(O)=CC(O)=C1 LMOINURANNBYCM-UHFFFAOYSA-N 0.000 description 1
- 229940071648 metered dose inhaler Drugs 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 229960000485 methotrexate Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- JNMIXMFEVJHFNY-UHFFFAOYSA-M methyl(triphenyl)phosphanium;iodide Chemical compound [I-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 JNMIXMFEVJHFNY-UHFFFAOYSA-M 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 239000004530 micro-emulsion Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229960005127 montelukast Drugs 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 239000002324 mouth wash Substances 0.000 description 1
- 229940051866 mouthwash Drugs 0.000 description 1
- 201000010879 mucinous adenocarcinoma Diseases 0.000 description 1
- 201000006417 multiple sclerosis Diseases 0.000 description 1
- 206010028417 myasthenia gravis Diseases 0.000 description 1
- 208000025113 myeloid leukemia Diseases 0.000 description 1
- 208000009091 myxoma Diseases 0.000 description 1
- QKYWADPCTHTJHQ-UHFFFAOYSA-N n,2-dimethylpropan-1-amine Chemical compound CNCC(C)C QKYWADPCTHTJHQ-UHFFFAOYSA-N 0.000 description 1
- DAZXVJBJRMWXJP-UHFFFAOYSA-N n,n-dimethylethylamine Chemical compound CCN(C)C DAZXVJBJRMWXJP-UHFFFAOYSA-N 0.000 description 1
- 125000004370 n-butenyl group Chemical group [H]\C([H])=C(/[H])C([H])([H])C([H])([H])* 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N n-methylpropan-2-amine Chemical compound CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- UYYCVBASZNFFRX-UHFFFAOYSA-N n-propan-2-ylcyclohexanamine Chemical compound CC(C)NC1CCCCC1 UYYCVBASZNFFRX-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 229960002009 naproxen Drugs 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-M naproxen(1-) Chemical compound C1=C([C@H](C)C([O-])=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-M 0.000 description 1
- 210000000653 nervous system Anatomy 0.000 description 1
- 208000007538 neurilemmoma Diseases 0.000 description 1
- 201000004662 neurofibroma of spinal cord Diseases 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- UMRZSTCPUPJPOJ-KNVOCYPGSA-N norbornane Chemical compound C1C[C@H]2CC[C@@H]1C2 UMRZSTCPUPJPOJ-KNVOCYPGSA-N 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 229960002657 orciprenaline Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- 208000008798 osteoma Diseases 0.000 description 1
- 210000003101 oviduct Anatomy 0.000 description 1
- RYGUCYSSMOFTSH-UHFFFAOYSA-N oxane-4-carbonyl chloride Chemical compound ClC(=O)C1CCOCC1 RYGUCYSSMOFTSH-UHFFFAOYSA-N 0.000 description 1
- AVPKHOTUOHDTLW-UHFFFAOYSA-N oxane-4-carboxylic acid Chemical compound OC(=O)C1CCOCC1 AVPKHOTUOHDTLW-UHFFFAOYSA-N 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 238000007243 oxidative cyclization reaction Methods 0.000 description 1
- 229960001609 oxitropium bromide Drugs 0.000 description 1
- LCELQERNWLBPSY-KHSTUMNDSA-M oxitropium bromide Chemical compound [Br-].C1([C@@H](CO)C(=O)O[C@H]2C[C@@H]3[N+]([C@H](C2)[C@@H]2[C@H]3O2)(C)CC)=CC=CC=C1 LCELQERNWLBPSY-KHSTUMNDSA-M 0.000 description 1
- BEEDODBODQVSIM-UHFFFAOYSA-N oxymetazoline hydrochloride Chemical compound Cl.CC1=CC(C(C)(C)C)=C(O)C(C)=C1CC1=NCCN1 BEEDODBODQVSIM-UHFFFAOYSA-N 0.000 description 1
- 229960005162 oxymetazoline hydrochloride Drugs 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 229940055726 pantothenic acid Drugs 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 229960001639 penicillamine Drugs 0.000 description 1
- 229940083251 peripheral vasodilators purine derivative Drugs 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229960002895 phenylbutazone Drugs 0.000 description 1
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- DLNKOYKMWOXYQA-APPZFPTMSA-N phenylpropanolamine Chemical compound C[C@@H](N)[C@H](O)C1=CC=CC=C1 DLNKOYKMWOXYQA-APPZFPTMSA-N 0.000 description 1
- 229960000395 phenylpropanolamine Drugs 0.000 description 1
- 208000028591 pheochromocytoma Diseases 0.000 description 1
- 125000001095 phosphatidyl group Chemical group 0.000 description 1
- 239000002587 phosphodiesterase IV inhibitor Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- RMHMFHUVIITRHF-UHFFFAOYSA-N pirenzepine Chemical compound C1CN(C)CCN1CC(=O)N1C2=NC=CC=C2NC(=O)C2=CC=CC=C21 RMHMFHUVIITRHF-UHFFFAOYSA-N 0.000 description 1
- 229960004633 pirenzepine Drugs 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- UAJUXJSXCLUTNU-UHFFFAOYSA-N pranlukast Chemical compound C=1C=C(OCCCCC=2C=CC=CC=2)C=CC=1C(=O)NC(C=1)=CC=C(C(C=2)=O)C=1OC=2C=1N=NNN=1 UAJUXJSXCLUTNU-UHFFFAOYSA-N 0.000 description 1
- 229960004583 pranlukast Drugs 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 229960005205 prednisolone Drugs 0.000 description 1
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 1
- 229960004618 prednisone Drugs 0.000 description 1
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- JCRIVQIOJSSCQD-UHFFFAOYSA-N propylhexedrine Chemical compound CNC(C)CC1CCCCC1 JCRIVQIOJSSCQD-UHFFFAOYSA-N 0.000 description 1
- 229960000786 propylhexedrine Drugs 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 229940127293 prostanoid Drugs 0.000 description 1
- 150000003814 prostanoids Chemical class 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 201000005825 prostate adenocarcinoma Diseases 0.000 description 1
- 230000001012 protector Effects 0.000 description 1
- KWGRBVOPPLSCSI-WCBMZHEXSA-N pseudoephedrine Chemical compound CN[C@@H](C)[C@@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WCBMZHEXSA-N 0.000 description 1
- 229960003908 pseudoephedrine Drugs 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 1
- SBMSLRMNBSMKQC-UHFFFAOYSA-N pyrrolidin-1-amine Chemical compound NN1CCCC1 SBMSLRMNBSMKQC-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011535 reaction buffer Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229940116176 remicade Drugs 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 201000004335 respiratory allergy Diseases 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229960004641 rituximab Drugs 0.000 description 1
- 229960000371 rofecoxib Drugs 0.000 description 1
- RZJQGNCSTQAWON-UHFFFAOYSA-N rofecoxib Chemical compound C1=CC(S(=O)(=O)C)=CC=C1C1=C(C=2C=CC=CC=2)C(=O)OC1 RZJQGNCSTQAWON-UHFFFAOYSA-N 0.000 description 1
- MNDBXUUTURYVHR-UHFFFAOYSA-N roflumilast Chemical compound FC(F)OC1=CC=C(C(=O)NC=2C(=CN=CC=2Cl)Cl)C=C1OCC1CC1 MNDBXUUTURYVHR-UHFFFAOYSA-N 0.000 description 1
- 229960002586 roflumilast Drugs 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 229960004017 salmeterol Drugs 0.000 description 1
- 201000000980 schizophrenia Diseases 0.000 description 1
- 206010039667 schwannoma Diseases 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 238000011450 sequencing therapy Methods 0.000 description 1
- 208000004548 serous cystadenocarcinoma Diseases 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 210000003625 skull Anatomy 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910001467 sodium calcium phosphate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- CTDQAGUNKPRERK-UHFFFAOYSA-N spirodecane Chemical compound C1CCCC21CCCCC2 CTDQAGUNKPRERK-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- 210000002536 stromal cell Anatomy 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000005846 sugar alcohols Chemical class 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 230000002889 sympathetic effect Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 125000006253 t-butylcarbonyl group Chemical group [H]C([H])([H])C(C(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229950004351 telenzepine Drugs 0.000 description 1
- 229960000195 terbutaline Drugs 0.000 description 1
- IHFXPVJTEHEPDE-ZIAGYGMSSA-N tert-butyl (3R,4R)-3-hydroxy-4-phenylmethoxypyrrolidine-1-carboxylate Chemical compound C(C1=CC=CC=C1)O[C@@H]1CN(C[C@H]1O)C(=O)OC(C)(C)C IHFXPVJTEHEPDE-ZIAGYGMSSA-N 0.000 description 1
- KTBDFQPHEPDHQW-RNFRBKRXSA-N tert-butyl (3r,4r)-3-fluoro-4-hydroxypyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1C[C@@H](O)[C@H](F)C1 KTBDFQPHEPDHQW-RNFRBKRXSA-N 0.000 description 1
- MAXQBMZDVBHSLW-KNVOCYPGSA-N tert-butyl (3r,4s)-3,4-dihydroxypyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1C[C@H](O)[C@H](O)C1 MAXQBMZDVBHSLW-KNVOCYPGSA-N 0.000 description 1
- KWMWWLAQPUYWJL-NSHDSACASA-N tert-butyl (3s)-3-(9-ethylpurin-6-yl)oxypyrrolidine-1-carboxylate Chemical compound N1=CN=C2N(CC)C=NC2=C1O[C@H]1CCN(C(=O)OC(C)(C)C)C1 KWMWWLAQPUYWJL-NSHDSACASA-N 0.000 description 1
- KPQWMDVIZNUHDC-AWEZNQCLSA-N tert-butyl (3s)-3-[9-ethyl-8-[6-(trifluoromethyl)pyridin-3-yl]purin-6-yl]oxypyrrolidine-1-carboxylate Chemical compound N1=CN=C2N(CC)C(C=3C=NC(=CC=3)C(F)(F)F)=NC2=C1O[C@H]1CCN(C(=O)OC(C)(C)C)C1 KPQWMDVIZNUHDC-AWEZNQCLSA-N 0.000 description 1
- UIJXHKXIOCDSEB-QMMMGPOBSA-N tert-butyl (3s)-3-hydroxypiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC[C@H](O)C1 UIJXHKXIOCDSEB-QMMMGPOBSA-N 0.000 description 1
- QZVCJLUVFPPQLX-ZETCQYMHSA-N tert-butyl (3s)-3-sulfanylpyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CC[C@H](S)C1 QZVCJLUVFPPQLX-ZETCQYMHSA-N 0.000 description 1
- PZSWUWNDHUSEDC-QWHCGFSZSA-N tert-butyl (3s,4r)-3-[tert-butyl(dimethyl)silyl]oxy-4-formylpyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C=O)C1 PZSWUWNDHUSEDC-QWHCGFSZSA-N 0.000 description 1
- FXYJNVGRFDRSKS-UHFFFAOYSA-N tert-butyl 3-hydroxy-3-methylpyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(C)(O)C1 FXYJNVGRFDRSKS-UHFFFAOYSA-N 0.000 description 1
- WKKIHGBRNBOCMB-UHFFFAOYSA-N tert-butyl 3-hydroxy-7-azabicyclo[2.2.1]heptane-7-carboxylate Chemical compound C1CC2C(O)CC1N2C(=O)OC(C)(C)C WKKIHGBRNBOCMB-UHFFFAOYSA-N 0.000 description 1
- PXTONRTYYUAUJU-UHFFFAOYSA-N tert-butyl 3-methylidenepyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=C)C1 PXTONRTYYUAUJU-UHFFFAOYSA-N 0.000 description 1
- JQXFBJIDTLTFNU-UHFFFAOYSA-N tert-butyl 3-methylpyrrolidine-1-carboxylate Chemical compound CC1CCN(C(=O)OC(C)(C)C)C1 JQXFBJIDTLTFNU-UHFFFAOYSA-N 0.000 description 1
- XWIJVOQGKJHEAJ-UHFFFAOYSA-N tert-butyl 3-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate Chemical compound C1CC2C(=O)CC1N2C(=O)OC(C)(C)C XWIJVOQGKJHEAJ-UHFFFAOYSA-N 0.000 description 1
- JSOMVCDXPUXKIC-UHFFFAOYSA-N tert-butyl 3-oxopyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)C1 JSOMVCDXPUXKIC-UHFFFAOYSA-N 0.000 description 1
- VSOCEFVTECWTPF-UHFFFAOYSA-N tert-butyl 4-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypiperidine-1-carboxylate Chemical compound CCN1C(=NC2=C(OC3CCN(CC3)C(=O)OC(C)(C)C)N=CN=C12)C1=CN=C(C)N=C1 VSOCEFVTECWTPF-UHFFFAOYSA-N 0.000 description 1
- PWQLFIKTGRINFF-UHFFFAOYSA-N tert-butyl 4-hydroxypiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(O)CC1 PWQLFIKTGRINFF-UHFFFAOYSA-N 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- BJORNXNYWNIWEY-UHFFFAOYSA-N tetrahydrozoline hydrochloride Chemical compound Cl.N1CCN=C1C1C2=CC=CC=C2CCC1 BJORNXNYWNIWEY-UHFFFAOYSA-N 0.000 description 1
- 229940021790 tetrahydrozoline hydrochloride Drugs 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 229960004559 theobromine Drugs 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- DBDCNCCRPKTRSD-UHFFFAOYSA-N thieno[3,2-b]pyridine Chemical compound C1=CC=C2SC=CC2=N1 DBDCNCCRPKTRSD-UHFFFAOYSA-N 0.000 description 1
- 229940125670 thienopyridine Drugs 0.000 description 1
- 239000002175 thienopyridine Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 206010044412 transitional cell carcinoma Diseases 0.000 description 1
- YNDXUCZADRHECN-JNQJZLCISA-N triamcinolone acetonide Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H]3OC(C)(C)O[C@@]3(C(=O)CO)[C@@]1(C)C[C@@H]2O YNDXUCZADRHECN-JNQJZLCISA-N 0.000 description 1
- 229960002117 triamcinolone acetonide Drugs 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- GRGCWBWNLSTIEN-UHFFFAOYSA-N trifluoromethanesulfonyl chloride Chemical compound FC(F)(F)S(Cl)(=O)=O GRGCWBWNLSTIEN-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 1
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Substances C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 1
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Substances C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 1
- 235000011178 triphosphate Nutrition 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 208000022271 tubular adenoma Diseases 0.000 description 1
- 208000001072 type 2 diabetes mellitus Diseases 0.000 description 1
- 210000003708 urethra Anatomy 0.000 description 1
- 210000001215 vagina Anatomy 0.000 description 1
- 229960002004 valdecoxib Drugs 0.000 description 1
- LNPDTQAFDNKSHK-UHFFFAOYSA-N valdecoxib Chemical compound CC=1ON=C(C=2C=CC=CC=2)C=1C1=CC=C(S(N)(=O)=O)C=C1 LNPDTQAFDNKSHK-UHFFFAOYSA-N 0.000 description 1
- 239000005526 vasoconstrictor agent Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000002424 x-ray crystallography Methods 0.000 description 1
- UGOMMVLRQDMAQQ-UHFFFAOYSA-N xphos Chemical compound CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 UGOMMVLRQDMAQQ-UHFFFAOYSA-N 0.000 description 1
- 229960004764 zafirlukast Drugs 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 125000005863 α-amino(C1-C4)alkanoyl group Chemical group 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/519—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim ortho- or peri-condensed with heterocyclic rings
- A61K31/52—Purines, e.g. adenine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/519—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim ortho- or peri-condensed with heterocyclic rings
- A61K31/52—Purines, e.g. adenine
- A61K31/522—Purines, e.g. adenine having oxo groups directly attached to the heterocyclic ring, e.g. hypoxanthine, guanine, acyclovir
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/535—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one oxygen as the ring hetero atoms, e.g. 1,2-oxazines
- A61K31/5375—1,4-Oxazines, e.g. morpholine
- A61K31/5377—1,4-Oxazines, e.g. morpholine not condensed and containing further heterocyclic rings, e.g. timolol
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K45/00—Medicinal preparations containing active ingredients not provided for in groups A61K31/00 - A61K41/00
- A61K45/06—Mixtures of active ingredients without chemical characterisation, e.g. antiphlogistics and cardiaca
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/06—Antiasthmatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
- A61P17/06—Antipsoriatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
- C07D473/06—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/28—Oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/28—Oxygen atom
- C07D473/30—Oxygen atom attached in position 6, e.g. hypoxanthine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/36—Sulfur atom
- C07D473/38—Sulfur atom attached in position 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D519/00—Heterocyclic compounds containing more than one system of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring system not provided for in groups C07D453/00 or C07D455/00
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Epidemiology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Immunology (AREA)
- Pulmonology (AREA)
- Rheumatology (AREA)
- Pain & Pain Management (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Physical Education & Sports Medicine (AREA)
- Dermatology (AREA)
- Transplantation (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201261727416P | 2012-11-16 | 2012-11-16 | |
| US61/727,416 | 2012-11-16 | ||
| PCT/CN2013/001394 WO2014075392A1 (en) | 2012-11-16 | 2013-11-15 | Purine inhibitors of human phosphatidylinositol 3-kinase delta |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20150082613A true KR20150082613A (ko) | 2015-07-15 |
Family
ID=50730541
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020157015530A Withdrawn KR20150082613A (ko) | 2012-11-16 | 2013-11-15 | 인간 포스파티딜이노시톨 3-키나제 델타의 퓨린 억제제 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US9730940B2 (https=) |
| EP (1) | EP2920171B1 (https=) |
| JP (1) | JP6297582B2 (https=) |
| KR (1) | KR20150082613A (https=) |
| CN (1) | CN104918939B (https=) |
| AU (1) | AU2013347538B2 (https=) |
| BR (1) | BR112015011148A8 (https=) |
| CA (1) | CA2891009A1 (https=) |
| MX (1) | MX2015006191A (https=) |
| RU (1) | RU2658006C2 (https=) |
| WO (1) | WO2014075392A1 (https=) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW201444821A (zh) | 2013-03-13 | 2014-12-01 | Janssen Pharmaceutica Nv | 經取代之哌啶化合物及其作為食慾素受體調節劑之用途 |
| TW201444849A (zh) | 2013-03-13 | 2014-12-01 | Janssen Pharmaceutica Nv | 經取代的7-氮雜雙環類及其作為食慾激素受體調節劑之用途 |
| TWI621618B (zh) | 2013-03-13 | 2018-04-21 | 比利時商健生藥品公司 | 經取代2-氮雜雙環類及其作為食慾素受體調控劑之用途 |
| SI3077395T1 (en) | 2013-12-05 | 2018-03-30 | Pfizer Inc. | Pyrrolo(2,3-d)pyrimidinyl, pyrrolo(2,3-b)pyrazinyl and pyrrolo(2,3-d)pyridinyl acrylamides |
| SG11201607183PA (en) | 2014-03-06 | 2016-10-28 | Shanghai Haiyan Pharmaceutical Technology Co Ltd | Piperidine derivatives as orexin receptor antagonist |
| CN104030998B (zh) * | 2014-06-05 | 2015-11-18 | 华东师范大学 | 4-多氟烷基-4,5-二取代异噁唑衍生物及其制备方法 |
| WO2016020784A1 (en) | 2014-08-05 | 2016-02-11 | Pfizer Inc. | N-acylpyrrolidine ether tropomyosin-related kinase inhibitors |
| KR102455043B1 (ko) | 2014-09-11 | 2022-10-13 | 얀센 파마슈티카 엔.브이. | 치환된 2-아자바이사이클 및 오렉신 수용체 조절제로서의 이의 용도 |
| CN107912040B (zh) * | 2014-10-10 | 2021-04-06 | 基因泰克公司 | 作为组蛋白脱甲基酶抑制剂的吡咯烷酰胺化合物 |
| WO2017134053A1 (en) * | 2016-02-04 | 2017-08-10 | Chiesi Farmaceutici S.P.A. | Pyrazole derivatives as phosphoinositide 3-kinases inhibitors |
| WO2017166104A1 (en) * | 2016-03-30 | 2017-10-05 | Merck Sharp & Dohme Corp. | Purine inhibitors of human phosphatidylinositol 3-kinase delta |
| EP3512857B1 (en) * | 2016-09-14 | 2021-02-24 | Janssen Pharmaceutica NV | Spiro bicyclic inhibitors of menin-mll interaction |
| US10494370B2 (en) * | 2017-08-16 | 2019-12-03 | Bristol-Myers Squibb Company | Toll-like receptor 7 (TLR7) agonists having a pyridine or pyrazine moiety, conjugates thereof, and methods and uses therefor |
| TW202525813A (zh) | 2019-12-19 | 2025-07-01 | 比利時商健生藥品公司 | 經取代之直鏈螺環接衍生物 |
| CN113620976B (zh) * | 2020-05-09 | 2023-09-26 | 中国医学科学院药物研究所 | 噻唑并嘧啶类化合物及其制备方法、用途和药物组合物 |
| JP7736782B2 (ja) * | 2021-03-29 | 2025-09-09 | 株式会社カネカ | (2-メチルピリミジン-5-イル)ボロン酸誘導体の製造方法 |
| CN113072480B (zh) * | 2021-04-13 | 2022-09-30 | 常州佳德医药科技有限公司 | 一种手性(-)-5-氮杂螺[2.4]庚烷-7-醇、制备方法及应用 |
| WO2024083237A1 (en) * | 2022-10-20 | 2024-04-25 | Impact Therapeutics (Shanghai) , Inc | Substituted heteroaryl bicyclic compounds as usp1 inhibitors and the use thereof |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PT95516A (pt) * | 1989-10-06 | 1991-08-14 | Wellcome Found | Processo para a preparacao de derivados de 2',3'-didesoxi nucleosidos 6-substituidos |
| US5670501A (en) | 1994-09-01 | 1997-09-23 | Discovery Therapeutics, Inc. | N-substituted 9-alkyladenines |
| GEP20084317B (en) * | 2000-04-25 | 2008-02-25 | Icos Corp | Inhibitors of human phosphatidyl-inositol 3-kinase delta |
| US20020119443A1 (en) * | 2000-07-21 | 2002-08-29 | Gilead Sciences, Inc. | Prodrugs of phosphonate nucleotide analogues and methods for selecting and making same |
| SE0300456D0 (sv) * | 2003-02-19 | 2003-02-19 | Astrazeneca Ab | Novel compounds |
| CA2525207A1 (en) * | 2003-06-12 | 2004-12-23 | Novo Nordisk A/S | Substituted piperidine carbamates for use as inhibitors of hormone sensitive lipase |
| CA2565037A1 (en) | 2004-04-28 | 2005-11-10 | Cv Therapeutics, Inc. | Purine derivatives as a1 adenosine receptor antagonists |
| EA201501088A1 (ru) * | 2006-08-08 | 2017-01-30 | Миллениум Фармасьютикалз, Инк. | Гетероарильные соединения, применяемые в качестве ингибиторов e1 активирующих ферментов |
| US8008307B2 (en) * | 2006-08-08 | 2011-08-30 | Millennium Pharmaceuticals, Inc. | Heteroaryl compounds useful as inhibitors of E1 activating enzymes |
| US8513221B2 (en) * | 2008-07-07 | 2013-08-20 | Xcovery Holding, LLC | PI3K isoform selective inhibitors |
| US8759359B2 (en) * | 2009-12-18 | 2014-06-24 | Incyte Corporation | Substituted heteroaryl fused derivatives as PI3K inhibitors |
| MX2012015143A (es) * | 2010-06-30 | 2013-07-03 | Amgen Inc | Compuestos heterociclicos que contienen nitrogeno como inhibidores de pi3k delta. |
| UA112517C2 (uk) * | 2010-07-06 | 2016-09-26 | Новартіс Аг | Тетрагідропіридопіримідинові похідні |
| CA2812091C (en) * | 2010-09-14 | 2020-03-24 | Exelixis, Inc. | Inhibitors of pi3k-delta and methods of their use and manufacture |
| EP2616442B8 (en) | 2010-09-14 | 2018-10-17 | Exelixis, Inc. | Inhibitors of pi3k-delta and methods of their use and manufacture |
| CN102838600A (zh) * | 2011-06-24 | 2012-12-26 | 山东亨利医药科技有限责任公司 | 苯基喹唑啉类PI3Kδ抑制剂 |
-
2013
- 2013-11-15 BR BR112015011148A patent/BR112015011148A8/pt not_active Application Discontinuation
- 2013-11-15 US US14/443,294 patent/US9730940B2/en active Active
- 2013-11-15 MX MX2015006191A patent/MX2015006191A/es unknown
- 2013-11-15 WO PCT/CN2013/001394 patent/WO2014075392A1/en not_active Ceased
- 2013-11-15 CA CA2891009A patent/CA2891009A1/en not_active Abandoned
- 2013-11-15 RU RU2015122895A patent/RU2658006C2/ru not_active IP Right Cessation
- 2013-11-15 CN CN201380070648.XA patent/CN104918939B/zh not_active Expired - Fee Related
- 2013-11-15 JP JP2015542134A patent/JP6297582B2/ja not_active Expired - Fee Related
- 2013-11-15 AU AU2013347538A patent/AU2013347538B2/en not_active Ceased
- 2013-11-15 EP EP13855335.9A patent/EP2920171B1/en active Active
- 2013-11-15 KR KR1020157015530A patent/KR20150082613A/ko not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| EP2920171B1 (en) | 2018-08-29 |
| AU2013347538A1 (en) | 2015-05-07 |
| MX2015006191A (es) | 2015-08-10 |
| US9730940B2 (en) | 2017-08-15 |
| CN104918939B (zh) | 2018-08-28 |
| BR112015011148A8 (pt) | 2019-10-01 |
| CN104918939A (zh) | 2015-09-16 |
| RU2015122895A (ru) | 2017-01-10 |
| AU2013347538B2 (en) | 2017-04-27 |
| JP6297582B2 (ja) | 2018-03-20 |
| BR112015011148A2 (pt) | 2017-07-11 |
| EP2920171A4 (en) | 2016-06-22 |
| CA2891009A1 (en) | 2014-05-22 |
| EP2920171A1 (en) | 2015-09-23 |
| RU2658006C2 (ru) | 2018-06-19 |
| JP2015537010A (ja) | 2015-12-24 |
| WO2014075392A1 (en) | 2014-05-22 |
| US20150353552A1 (en) | 2015-12-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP6297582B2 (ja) | ヒトホスファチジルイノシトール3−キナーゼデルタのプリン阻害剤 | |
| AU2013347539B2 (en) | Purine inhibitors of human phosphatidylinositol 3-kinase delta | |
| KR101862493B1 (ko) | Fgfr4 억제제로서의 고리-융합된 비시클릭 피리딜 유도체 | |
| RU2553681C2 (ru) | N-содержащие гетероарильные производные в качестве ингибиторов jak3 киназы | |
| EP3154976B1 (en) | Purine inhibitors of human phosphatidylinositol 3-kinase delta | |
| JP2025122005A (ja) | Btk阻害因子とe3リガーゼリガンドとのコンジュゲーションによるブルトンチロシンキナーゼ(btk)の分解及び使用方法 | |
| WO2022134641A1 (zh) | 芳香杂环类化合物、药物组合物及其应用 | |
| CN113683629B (zh) | 取代的杂芳基化合物及其组合物和用途 | |
| US12180226B2 (en) | Spirotricycle RIPK1 inhibitors and methods of uses thereof | |
| EA050708B1 (ru) | Деградация тирозинкиназы брутона (btk) посредством конъюгации ингибиторов btk с лигандом лигазы е3 и способы применения | |
| TW202225163A (zh) | 芳香雜環類化合物、藥物組合物及其應用 | |
| KR20150130310A (ko) | 야누스 키나제 억제제로서의 같은자리 치환된 시아노에틸피라졸로 피리돈 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0105 | International application |
Patent event date: 20150611 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PG1501 | Laying open of application | ||
| A201 | Request for examination | ||
| PA0201 | Request for examination |
Patent event code: PA02012R01D Patent event date: 20181107 Comment text: Request for Examination of Application |
|
| PC1202 | Submission of document of withdrawal before decision of registration |
Comment text: [Withdrawal of Procedure relating to Patent, etc.] Withdrawal (Abandonment) Patent event code: PC12021R01D Patent event date: 20191125 |
|
| WITB | Written withdrawal of application |