KE2654A - Bis-(triazinylamino)-stilbene derivatives - Google Patents
Bis-(triazinylamino)-stilbene derivativesInfo
- Publication number
- KE2654A KE2654A KE2654*UA KE265476A KE2654A KE 2654 A KE2654 A KE 2654A KE 265476 A KE265476 A KE 265476A KE 2654 A KE2654 A KE 2654A
- Authority
- KE
- Kenya
- Prior art keywords
- triazinylamino
- bis
- stilbene derivatives
- stilbene
- derivatives
- Prior art date
Links
- RWFZHFYWPYSEOZ-UHFFFAOYSA-N 1,2-diphenyl-N,N'-bis(triazin-4-yl)ethene-1,2-diamine Chemical class N1=NN=C(C=C1)NC(=C(C1=CC=CC=C1)NC1=NN=NC=C1)C1=CC=CC=C1 RWFZHFYWPYSEOZ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/68—Triazinylamino stilbenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Paper (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1372170A CH539641A (de) | 1970-09-16 | 1970-09-16 | Verfahren zur Herstellung neuer Bis-(triazinylamino)-stilbensulfonsäuren |
| CH1787570 | 1970-12-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KE2654A true KE2654A (en) | 1976-08-13 |
Family
ID=25712901
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KE2654*UA KE2654A (en) | 1970-09-16 | 1976-07-28 | Bis-(triazinylamino)-stilbene derivatives |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4252604A (enExample) |
| JP (1) | JPS5426572B1 (enExample) |
| BE (1) | BE772543A (enExample) |
| CA (1) | CA972365A (enExample) |
| CY (1) | CY870A (enExample) |
| DD (1) | DD101158A5 (enExample) |
| DE (1) | DE2145384C3 (enExample) |
| ES (1) | ES395057A1 (enExample) |
| FR (1) | FR2107684A5 (enExample) |
| GB (1) | GB1313469A (enExample) |
| HK (1) | HK52376A (enExample) |
| IT (1) | IT942451B (enExample) |
| KE (1) | KE2654A (enExample) |
| NL (1) | NL157597B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH582275A5 (enExample) * | 1973-02-02 | 1976-11-30 | Ciba Geigy Ag | |
| CH597204A5 (enExample) * | 1973-02-16 | 1978-03-31 | Sandoz Ag | |
| CH583211A5 (enExample) | 1973-05-22 | 1976-12-31 | Sandoz Ag | |
| CH583212A5 (enExample) | 1973-07-02 | 1976-12-31 | Sandoz Ag | |
| US4468341A (en) * | 1983-10-27 | 1984-08-28 | Ciba-Geigy Corporation | Stable purified aqueous solutions of fluorescent whitening agent |
| DE3502038A1 (de) * | 1985-01-23 | 1986-07-24 | Sandoz-Patent-GmbH, 7850 Lörrach | Waessrige aufhellerpraeparate und deren verwendung im papierstrich |
| GB9418958D0 (en) * | 1994-09-21 | 1994-11-09 | Ciba Geigy Ag | Fluorescent whitening agents |
| GB9611614D0 (en) * | 1996-06-04 | 1996-08-07 | Ciba Geigy Ag | Process for inhibiting the effect of flourescent whitening agents |
| GB9813248D0 (en) | 1998-06-22 | 1998-08-19 | Clariant Int Ltd | Improvements in or relating to organic compounds |
| GB9930177D0 (en) | 1999-12-22 | 2000-02-09 | Clariant Int Ltd | Improvements in or relating to organic compounds |
| GB9930247D0 (en) | 1999-12-22 | 2000-02-09 | Clariant Int Ltd | Improvements in or relating to organic compounds |
| EP2781648B1 (en) | 2013-03-21 | 2016-01-06 | Clariant International Ltd. | Optical brightening agents for high quality ink-jet printing |
| CN109776757B (zh) * | 2019-01-15 | 2021-06-08 | 陕西科技大学 | 一种含二苯甲酮的纸张表面聚氨酯荧光增白乳液的制备方法及其应用 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL245010A (enExample) * | 1958-11-05 | |||
| GB1008457A (en) * | 1963-04-12 | 1965-10-27 | Gen Aniline & Film Corp | Improvements in or relating to stilbene-cyanuric compounds |
| US3479349A (en) * | 1967-08-03 | 1969-11-18 | Geigy Chem Corp | Polysulfonated bis-s-triazinylamino-stilbene-2,2'-disulfonic acids |
| NL6911102A (enExample) * | 1968-07-29 | 1970-02-02 | ||
| CH508641A (de) * | 1968-08-06 | 1971-06-15 | Sandoz Ag | Verfahren zur Herstellung neuer fluoreszierender Verbindungen |
| US3600385A (en) * | 1968-12-16 | 1971-08-17 | American Cyanamid Co | Bis-(triazinylamino) stilbene derivatives for optical brightening |
| CH582275A5 (enExample) * | 1973-02-02 | 1976-11-30 | Ciba Geigy Ag |
-
1971
- 1971-09-07 IT IT69954/71A patent/IT942451B/it active
- 1971-09-10 DE DE2145384A patent/DE2145384C3/de not_active Expired
- 1971-09-13 BE BE772543A patent/BE772543A/xx not_active IP Right Cessation
- 1971-09-14 JP JP7163671A patent/JPS5426572B1/ja active Pending
- 1971-09-14 ES ES395057A patent/ES395057A1/es not_active Expired
- 1971-09-15 CA CA122,879A patent/CA972365A/en not_active Expired
- 1971-09-15 FR FR7133196A patent/FR2107684A5/fr not_active Expired
- 1971-09-15 NL NL7112658.A patent/NL157597B/xx not_active IP Right Cessation
- 1971-09-15 DD DD157738A patent/DD101158A5/xx unknown
- 1971-09-15 CY CY870A patent/CY870A/xx unknown
- 1971-09-15 GB GB4293071A patent/GB1313469A/en not_active Expired
-
1976
- 1976-07-28 KE KE2654*UA patent/KE2654A/xx unknown
- 1976-08-19 HK HK523/76*UA patent/HK52376A/xx unknown
-
1977
- 1977-08-30 US US05/829,241 patent/US4252604A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE772543A (fr) | 1972-01-17 |
| HK52376A (en) | 1976-08-27 |
| DE2145384A1 (de) | 1972-03-30 |
| DD101158A5 (enExample) | 1973-10-20 |
| ES395057A1 (es) | 1974-11-16 |
| US4252604A (en) | 1981-02-24 |
| GB1313469A (en) | 1973-04-11 |
| CY870A (en) | 1976-12-17 |
| CA972365A (en) | 1975-08-05 |
| DE2145384C3 (de) | 1981-06-11 |
| IT942451B (it) | 1973-03-20 |
| NL157597B (nl) | 1978-08-15 |
| DE2145384B2 (de) | 1980-08-14 |
| FR2107684A5 (enExample) | 1972-05-05 |
| JPS5426572B1 (enExample) | 1979-09-05 |
| NL7112658A (enExample) | 1972-03-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA714729B (en) | Novel benzcyclobutene derivatives | |
| GB1364563A (en) | Interferometer | |
| JPS51526A (en) | Okisazoriruukumarin no seizoho | |
| IE35639B1 (en) | Pyridoquinoline derivatives | |
| ZA711533B (en) | Phenyl derivatives | |
| KE2654A (en) | Bis-(triazinylamino)-stilbene derivatives | |
| IL37829A0 (en) | Monomethylamino compounds | |
| ZA717693B (en) | N-substituted-2-carboxy-1-azacyclic compounds | |
| CY787A (en) | Novel phtalimidine compounds | |
| ZA718157B (en) | Prostglandin analogs | |
| KE2770A (en) | Benzobicycloalkane compounds | |
| JPS5192364A (en) | Goseisenizairyo no kyujinsenshokuho | |
| HK27776A (en) | Diazabicycloundecapentene derivative | |
| AU3731471A (en) | Bis-triazole compounds | |
| ZA711840B (en) | Pge3-type compounds | |
| ZA717018B (en) | Anthelmintic thiocyanatobenzothiazoles | |
| ZA718586B (en) | Antidote compounds | |
| ZA716654B (en) | Basic thienylalkane derivatives | |
| ZA713111B (en) | Substituted carbamoyloxyphenylurea derivatives | |
| IL36933A (en) | 1-phenoxy-3-amino-propan-2-ol derivatives | |
| MY7600251A (en) | Bis-(triazinylamino)stilbenb-derivatives | |
| PH11679A (en) | Oxazolidine derivative | |
| ZA717307B (en) | Novel alkyl-steroids | |
| IE35863B1 (en) | Benzobicycloalkane compounds | |
| IE35865L (en) | Benzobicycloalkane compounds |