GB1313469A - Bis-triazinylamino-stilbene derivatives - Google Patents
Bis-triazinylamino-stilbene derivativesInfo
- Publication number
- GB1313469A GB1313469A GB4293071A GB4293071A GB1313469A GB 1313469 A GB1313469 A GB 1313469A GB 4293071 A GB4293071 A GB 4293071A GB 4293071 A GB4293071 A GB 4293071A GB 1313469 A GB1313469 A GB 1313469A
- Authority
- GB
- United Kingdom
- Prior art keywords
- lower alkyl
- alkoxy
- salt
- compounds
- triazinylamino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- RWFZHFYWPYSEOZ-UHFFFAOYSA-N 1,2-diphenyl-N,N'-bis(triazin-4-yl)ethene-1,2-diamine Chemical class N1=NN=C(C=C1)NC(=C(C1=CC=CC=C1)NC1=NN=NC=C1)C1=CC=CC=C1 RWFZHFYWPYSEOZ-UHFFFAOYSA-N 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 abstract 7
- 125000003545 alkoxy group Chemical group 0.000 abstract 4
- 150000001875 compounds Chemical class 0.000 abstract 4
- 150000004820 halides Chemical class 0.000 abstract 3
- 150000003839 salts Chemical class 0.000 abstract 3
- 239000002253 acid Substances 0.000 abstract 2
- 150000001412 amines Chemical class 0.000 abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- 150000002367 halogens Chemical class 0.000 abstract 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 abstract 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 2
- NVLVJHQJUHUFAC-UHFFFAOYSA-N 3-aminobenzene-1,2-disulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1S(O)(=O)=O NVLVJHQJUHUFAC-UHFFFAOYSA-N 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract 1
- 150000001342 alkaline earth metals Chemical class 0.000 abstract 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 230000003287 optical effect Effects 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/68—Triazinylamino stilbenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Paper (AREA)
- Detergent Compositions (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1372170A CH539641A (de) | 1970-09-16 | 1970-09-16 | Verfahren zur Herstellung neuer Bis-(triazinylamino)-stilbensulfonsäuren |
| CH1787570 | 1970-12-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1313469A true GB1313469A (en) | 1973-04-11 |
Family
ID=25712901
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB4293071A Expired GB1313469A (en) | 1970-09-16 | 1971-09-15 | Bis-triazinylamino-stilbene derivatives |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4252604A (enExample) |
| JP (1) | JPS5426572B1 (enExample) |
| BE (1) | BE772543A (enExample) |
| CA (1) | CA972365A (enExample) |
| CY (1) | CY870A (enExample) |
| DD (1) | DD101158A5 (enExample) |
| DE (1) | DE2145384C3 (enExample) |
| ES (1) | ES395057A1 (enExample) |
| FR (1) | FR2107684A5 (enExample) |
| GB (1) | GB1313469A (enExample) |
| HK (1) | HK52376A (enExample) |
| IT (1) | IT942451B (enExample) |
| KE (1) | KE2654A (enExample) |
| NL (1) | NL157597B (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3956283A (en) | 1973-05-22 | 1976-05-11 | Sandoz Ltd. | Bis-(triazinylamino)-stillene derivatives |
| US4025507A (en) | 1973-07-02 | 1977-05-24 | Sandoz Ltd. | Bis-(triazinylamino) stilbene compounds |
| GB2293381A (en) * | 1994-09-21 | 1996-03-27 | Ciba Geigy | Triazinyl-amino-stilbene sulphonic acid fluorescent whitening agents |
| US6426382B1 (en) | 1998-06-22 | 2002-07-30 | Clariant Finance (Bvi) Limited | Polycationic polymer salts, their production and use |
| US6911116B2 (en) | 1999-12-22 | 2005-06-28 | Clariant Finance (Bvi) Limited | Cationically modified white pigments, their production and use |
| US7019134B2 (en) | 1999-12-22 | 2006-03-28 | Clariant Finance (Bvi) Limited | Amphoteric optical brighteners, their aqueous solutions, their production and their use |
| EP2781648A1 (en) | 2013-03-21 | 2014-09-24 | Clariant International Ltd. | Optical brightening agents for high quality ink-jet printing |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH582275A5 (enExample) * | 1973-02-02 | 1976-11-30 | Ciba Geigy Ag | |
| CH597204A5 (enExample) * | 1973-02-16 | 1978-03-31 | Sandoz Ag | |
| US4468341A (en) * | 1983-10-27 | 1984-08-28 | Ciba-Geigy Corporation | Stable purified aqueous solutions of fluorescent whitening agent |
| DE3502038A1 (de) * | 1985-01-23 | 1986-07-24 | Sandoz-Patent-GmbH, 7850 Lörrach | Waessrige aufhellerpraeparate und deren verwendung im papierstrich |
| GB9611614D0 (en) * | 1996-06-04 | 1996-08-07 | Ciba Geigy Ag | Process for inhibiting the effect of flourescent whitening agents |
| CN109776757B (zh) * | 2019-01-15 | 2021-06-08 | 陕西科技大学 | 一种含二苯甲酮的纸张表面聚氨酯荧光增白乳液的制备方法及其应用 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL121058C (enExample) * | 1958-11-05 | |||
| GB1008457A (en) * | 1963-04-12 | 1965-10-27 | Gen Aniline & Film Corp | Improvements in or relating to stilbene-cyanuric compounds |
| US3479349A (en) * | 1967-08-03 | 1969-11-18 | Geigy Chem Corp | Polysulfonated bis-s-triazinylamino-stilbene-2,2'-disulfonic acids |
| NL6911102A (enExample) * | 1968-07-29 | 1970-02-02 | ||
| CH508641A (de) * | 1968-08-06 | 1971-06-15 | Sandoz Ag | Verfahren zur Herstellung neuer fluoreszierender Verbindungen |
| US3600385A (en) * | 1968-12-16 | 1971-08-17 | American Cyanamid Co | Bis-(triazinylamino) stilbene derivatives for optical brightening |
| CH582275A5 (enExample) * | 1973-02-02 | 1976-11-30 | Ciba Geigy Ag |
-
1971
- 1971-09-07 IT IT69954/71A patent/IT942451B/it active
- 1971-09-10 DE DE2145384A patent/DE2145384C3/de not_active Expired
- 1971-09-13 BE BE772543A patent/BE772543A/xx not_active IP Right Cessation
- 1971-09-14 JP JP7163671A patent/JPS5426572B1/ja active Pending
- 1971-09-14 ES ES395057A patent/ES395057A1/es not_active Expired
- 1971-09-15 DD DD157738A patent/DD101158A5/xx unknown
- 1971-09-15 CY CY870A patent/CY870A/xx unknown
- 1971-09-15 FR FR7133196A patent/FR2107684A5/fr not_active Expired
- 1971-09-15 CA CA122,879A patent/CA972365A/en not_active Expired
- 1971-09-15 GB GB4293071A patent/GB1313469A/en not_active Expired
- 1971-09-15 NL NL7112658.A patent/NL157597B/xx not_active IP Right Cessation
-
1976
- 1976-07-28 KE KE2654*UA patent/KE2654A/xx unknown
- 1976-08-19 HK HK523/76*UA patent/HK52376A/xx unknown
-
1977
- 1977-08-30 US US05/829,241 patent/US4252604A/en not_active Expired - Lifetime
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3956283A (en) | 1973-05-22 | 1976-05-11 | Sandoz Ltd. | Bis-(triazinylamino)-stillene derivatives |
| US4025507A (en) | 1973-07-02 | 1977-05-24 | Sandoz Ltd. | Bis-(triazinylamino) stilbene compounds |
| GB2293381A (en) * | 1994-09-21 | 1996-03-27 | Ciba Geigy | Triazinyl-amino-stilbene sulphonic acid fluorescent whitening agents |
| GB2293381B (en) * | 1994-09-21 | 1996-08-21 | Ciba Geigy | Triazinyl-amino-stilbene sulphonic acid Fluorescent Whitening Agents |
| US5656760A (en) * | 1994-09-21 | 1997-08-12 | Ciba-Geigy Corporation | Fluorescent whitening agents |
| US6426382B1 (en) | 1998-06-22 | 2002-07-30 | Clariant Finance (Bvi) Limited | Polycationic polymer salts, their production and use |
| US6911116B2 (en) | 1999-12-22 | 2005-06-28 | Clariant Finance (Bvi) Limited | Cationically modified white pigments, their production and use |
| US7019134B2 (en) | 1999-12-22 | 2006-03-28 | Clariant Finance (Bvi) Limited | Amphoteric optical brighteners, their aqueous solutions, their production and their use |
| EP2781648A1 (en) | 2013-03-21 | 2014-09-24 | Clariant International Ltd. | Optical brightening agents for high quality ink-jet printing |
| WO2014146798A1 (en) | 2013-03-21 | 2014-09-25 | Archroma Ip Gmbh | Optical brightening agents for high quality ink-jet printing |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5426572B1 (enExample) | 1979-09-05 |
| FR2107684A5 (enExample) | 1972-05-05 |
| BE772543A (fr) | 1972-01-17 |
| HK52376A (en) | 1976-08-27 |
| ES395057A1 (es) | 1974-11-16 |
| DE2145384C3 (de) | 1981-06-11 |
| DE2145384A1 (de) | 1972-03-30 |
| CY870A (en) | 1976-12-17 |
| NL7112658A (enExample) | 1972-03-20 |
| DE2145384B2 (de) | 1980-08-14 |
| CA972365A (en) | 1975-08-05 |
| KE2654A (en) | 1976-08-13 |
| NL157597B (nl) | 1978-08-15 |
| DD101158A5 (enExample) | 1973-10-20 |
| US4252604A (en) | 1981-02-24 |
| IT942451B (it) | 1973-03-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1132082A (en) | The manufacture of pyrimidine derivatives | |
| GB1313469A (en) | Bis-triazinylamino-stilbene derivatives | |
| GB1024917A (en) | Pyridazones and compositions containing them for influencing plant growth | |
| GB1266291A (enExample) | ||
| GB1185950A (en) | Phenylhydrazones of 1,2-Dicarbonyl Compounds | |
| GB1368568A (en) | 3,5-dialkyl-4-hydroxyphenyl alkanoic acid ester of 2,4,6-tris hydroxyethylamino of derivatives of triazine | |
| GB1226250A (enExample) | ||
| GB1301210A (en) | Process for the production of novel triazole compounds | |
| GB1209146A (en) | Substituted tetraazaindene compounds and their use as stabilizers for photographic silver halide emulsions | |
| GB1243276A (en) | Novel triazinyl stilbene derivatives | |
| SE7413025L (enExample) | ||
| GB1173806A (en) | Brightening Agents | |
| GB1096301A (en) | 1,4-benzodioxane derivatives | |
| GB1308101A (en) | Amidophenylisothioureas a process for their preparation and their use as fungicides | |
| GB1501043A (en) | 4,4'-bis-(s-triazin-6-yl-amino)-stilbene-2,2'-disulphonic acid | |
| GB1350757A (en) | Optical brightening agents | |
| GB1516753A (en) | 2,4-diamino-5-benzylpyrimidines | |
| GB1366004A (en) | Bis-s-triazinylamino-stilbene-2 2-disulphonic acids | |
| GB1296080A (enExample) | ||
| GB1052877A (enExample) | ||
| GB1429614A (en) | Anticolour fogging agents for colour photographic materials | |
| GB1213285A (en) | Substituted s-triazines | |
| GB1191465A (en) | A process for the preparation of Dicarboxylic Acid Derivatives of Substituted S-Triazines | |
| GB1164594A (en) | Biologically Active Substituted S-Traizines | |
| GB1241520A (en) | Benzophenazine-di-n-oxides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PE20 | Patent expired after termination of 20 years |