CA972365A - Bis-(triazinylamino)-stilbenesulphonic acids - Google Patents
Bis-(triazinylamino)-stilbenesulphonic acidsInfo
- Publication number
- CA972365A CA972365A CA122,879A CA122879A CA972365A CA 972365 A CA972365 A CA 972365A CA 122879 A CA122879 A CA 122879A CA 972365 A CA972365 A CA 972365A
- Authority
- CA
- Canada
- Prior art keywords
- stilbenesulphonic
- triazinylamino
- bis
- acids
- stilbenesulphonic acids
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- IGSBYLVSOWFBKT-UHFFFAOYSA-N N1=NN=C(C=C1)NC(=C(C=1C(=CC=CC1)S(=O)(=O)O)NC1=NN=NC=C1)C1=CC=CC=C1 Chemical class N1=NN=C(C=C1)NC(=C(C=1C(=CC=CC1)S(=O)(=O)O)NC1=NN=NC=C1)C1=CC=CC=C1 IGSBYLVSOWFBKT-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/68—Triazinylamino stilbenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Paper (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1372170A CH539641A (de) | 1970-09-16 | 1970-09-16 | Verfahren zur Herstellung neuer Bis-(triazinylamino)-stilbensulfonsäuren |
| CH1787570 | 1970-12-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA972365A true CA972365A (en) | 1975-08-05 |
Family
ID=25712901
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA122,879A Expired CA972365A (en) | 1970-09-16 | 1971-09-15 | Bis-(triazinylamino)-stilbenesulphonic acids |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4252604A (enExample) |
| JP (1) | JPS5426572B1 (enExample) |
| BE (1) | BE772543A (enExample) |
| CA (1) | CA972365A (enExample) |
| CY (1) | CY870A (enExample) |
| DD (1) | DD101158A5 (enExample) |
| DE (1) | DE2145384C3 (enExample) |
| ES (1) | ES395057A1 (enExample) |
| FR (1) | FR2107684A5 (enExample) |
| GB (1) | GB1313469A (enExample) |
| HK (1) | HK52376A (enExample) |
| IT (1) | IT942451B (enExample) |
| KE (1) | KE2654A (enExample) |
| NL (1) | NL157597B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH582275A5 (enExample) * | 1973-02-02 | 1976-11-30 | Ciba Geigy Ag | |
| CH597204A5 (enExample) * | 1973-02-16 | 1978-03-31 | Sandoz Ag | |
| CH583211A5 (enExample) | 1973-05-22 | 1976-12-31 | Sandoz Ag | |
| CH583212A5 (enExample) * | 1973-07-02 | 1976-12-31 | Sandoz Ag | |
| US4468341A (en) * | 1983-10-27 | 1984-08-28 | Ciba-Geigy Corporation | Stable purified aqueous solutions of fluorescent whitening agent |
| DE3502038A1 (de) * | 1985-01-23 | 1986-07-24 | Sandoz-Patent-GmbH, 7850 Lörrach | Waessrige aufhellerpraeparate und deren verwendung im papierstrich |
| GB9418958D0 (en) * | 1994-09-21 | 1994-11-09 | Ciba Geigy Ag | Fluorescent whitening agents |
| GB9611614D0 (en) * | 1996-06-04 | 1996-08-07 | Ciba Geigy Ag | Process for inhibiting the effect of flourescent whitening agents |
| GB9813248D0 (en) | 1998-06-22 | 1998-08-19 | Clariant Int Ltd | Improvements in or relating to organic compounds |
| GB9930247D0 (en) | 1999-12-22 | 2000-02-09 | Clariant Int Ltd | Improvements in or relating to organic compounds |
| GB9930177D0 (en) | 1999-12-22 | 2000-02-09 | Clariant Int Ltd | Improvements in or relating to organic compounds |
| ES2566109T3 (es) | 2013-03-21 | 2016-04-11 | Archroma Ip Gmbh | Agentes abrillantadores ópticos para impresión por chorro de tinta de alta calidad |
| CN109776757B (zh) * | 2019-01-15 | 2021-06-08 | 陕西科技大学 | 一种含二苯甲酮的纸张表面聚氨酯荧光增白乳液的制备方法及其应用 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL121058C (enExample) * | 1958-11-05 | |||
| GB1008457A (en) * | 1963-04-12 | 1965-10-27 | Gen Aniline & Film Corp | Improvements in or relating to stilbene-cyanuric compounds |
| US3479349A (en) * | 1967-08-03 | 1969-11-18 | Geigy Chem Corp | Polysulfonated bis-s-triazinylamino-stilbene-2,2'-disulfonic acids |
| NL6911102A (enExample) * | 1968-07-29 | 1970-02-02 | ||
| CH508641A (de) * | 1968-08-06 | 1971-06-15 | Sandoz Ag | Verfahren zur Herstellung neuer fluoreszierender Verbindungen |
| US3600385A (en) * | 1968-12-16 | 1971-08-17 | American Cyanamid Co | Bis-(triazinylamino) stilbene derivatives for optical brightening |
| CH582275A5 (enExample) * | 1973-02-02 | 1976-11-30 | Ciba Geigy Ag |
-
1971
- 1971-09-07 IT IT69954/71A patent/IT942451B/it active
- 1971-09-10 DE DE2145384A patent/DE2145384C3/de not_active Expired
- 1971-09-13 BE BE772543A patent/BE772543A/xx not_active IP Right Cessation
- 1971-09-14 ES ES395057A patent/ES395057A1/es not_active Expired
- 1971-09-14 JP JP7163671A patent/JPS5426572B1/ja active Pending
- 1971-09-15 CA CA122,879A patent/CA972365A/en not_active Expired
- 1971-09-15 FR FR7133196A patent/FR2107684A5/fr not_active Expired
- 1971-09-15 GB GB4293071A patent/GB1313469A/en not_active Expired
- 1971-09-15 DD DD157738A patent/DD101158A5/xx unknown
- 1971-09-15 NL NL7112658.A patent/NL157597B/xx not_active IP Right Cessation
- 1971-09-15 CY CY870A patent/CY870A/xx unknown
-
1976
- 1976-07-28 KE KE2654*UA patent/KE2654A/xx unknown
- 1976-08-19 HK HK523/76*UA patent/HK52376A/xx unknown
-
1977
- 1977-08-30 US US05/829,241 patent/US4252604A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NL7112658A (enExample) | 1972-03-20 |
| DE2145384A1 (de) | 1972-03-30 |
| NL157597B (nl) | 1978-08-15 |
| HK52376A (en) | 1976-08-27 |
| CY870A (en) | 1976-12-17 |
| IT942451B (it) | 1973-03-20 |
| DE2145384C3 (de) | 1981-06-11 |
| JPS5426572B1 (enExample) | 1979-09-05 |
| GB1313469A (en) | 1973-04-11 |
| FR2107684A5 (enExample) | 1972-05-05 |
| KE2654A (en) | 1976-08-13 |
| BE772543A (fr) | 1972-01-17 |
| US4252604A (en) | 1981-02-24 |
| DE2145384B2 (de) | 1980-08-14 |
| ES395057A1 (es) | 1974-11-16 |
| DD101158A5 (enExample) | 1973-10-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA923906A (en) | 2-arylalkanoic acids | |
| AU432259B1 (en) | Novel substituted chrysanthemates | |
| CA972365A (en) | Bis-(triazinylamino)-stilbenesulphonic acids | |
| CA995229A (en) | Mono-chromone-2-carboxylic acids | |
| CA984408A (en) | Hydroxycrotonic acids | |
| CA931164A (en) | Produits polyfluoroamines sulfoxyles | |
| CA942748A (en) | 1-aziridinylcarbonyl substituted-3-quinolinecarboxylic acid compounds | |
| AU2843371A (en) | Novel compounds | |
| AU461210B2 (en) | Novel benzimidazols | |
| AU474182B2 (en) | New bis-(triazinylamino)-stilbenesulphonic acids | |
| CA948204A (en) | Substituted beta-arylamidoacrylic acids | |
| CA834731A (en) | N-1-acyl-3-indolyl acids | |
| CA857885A (en) | Aminonaphthalene-sulphonic acids | |
| AU446362B2 (en) | Adamantylcarboxamidophenylalkanoic acids | |
| CA842264A (en) | Substituted 4-phenyl-cyclohexene-carboxylic acids | |
| CA832450A (en) | Substituted chloro-sulphamylanthranilic acids | |
| AU460526B2 (en) | Substituted biphenyleneacetic acids | |
| AU3545671A (en) | Novel alkyl-steroids | |
| AU437136B2 (en) | New sulfamyl-anthranilic acids | |
| AU455885B2 (en) | New sulfamylbenzoic acids | |
| AU2189070A (en) | Cephalosporantic acids | |
| AU1302770A (en) | Adamantylcarboxamidophenylalkanoic acids | |
| AU3302571A (en) | Substituted biphenyleneacetic acids | |
| AU1416070A (en) | New sulfamyl-anthranilic acids | |
| AU3004171A (en) | New sulfamylbenzoic acids |