CY870A - Bis-(triazinylamino)-stilbene derivatives - Google Patents
Bis-(triazinylamino)-stilbene derivativesInfo
- Publication number
- CY870A CY870A CY870A CY87071A CY870A CY 870 A CY870 A CY 870A CY 870 A CY870 A CY 870A CY 87071 A CY87071 A CY 87071A CY 870 A CY870 A CY 870A
- Authority
- CY
- Cyprus
- Prior art keywords
- triazinylamino
- bis
- stilbene derivatives
- stilbene
- derivatives
- Prior art date
Links
- RWFZHFYWPYSEOZ-UHFFFAOYSA-N 1,2-diphenyl-N,N'-bis(triazin-4-yl)ethene-1,2-diamine Chemical class N1=NN=C(C=C1)NC(=C(C1=CC=CC=C1)NC1=NN=NC=C1)C1=CC=CC=C1 RWFZHFYWPYSEOZ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/68—Triazinylamino stilbenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Paper (AREA)
- Detergent Compositions (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1372170A CH539641A (de) | 1970-09-16 | 1970-09-16 | Verfahren zur Herstellung neuer Bis-(triazinylamino)-stilbensulfonsäuren |
| CH1787570 | 1970-12-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CY870A true CY870A (en) | 1976-12-17 |
Family
ID=25712901
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CY870A CY870A (en) | 1970-09-16 | 1971-09-15 | Bis-(triazinylamino)-stilbene derivatives |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4252604A (enExample) |
| JP (1) | JPS5426572B1 (enExample) |
| BE (1) | BE772543A (enExample) |
| CA (1) | CA972365A (enExample) |
| CY (1) | CY870A (enExample) |
| DD (1) | DD101158A5 (enExample) |
| DE (1) | DE2145384C3 (enExample) |
| ES (1) | ES395057A1 (enExample) |
| FR (1) | FR2107684A5 (enExample) |
| GB (1) | GB1313469A (enExample) |
| HK (1) | HK52376A (enExample) |
| IT (1) | IT942451B (enExample) |
| KE (1) | KE2654A (enExample) |
| NL (1) | NL157597B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH582275A5 (enExample) * | 1973-02-02 | 1976-11-30 | Ciba Geigy Ag | |
| CH597204A5 (enExample) * | 1973-02-16 | 1978-03-31 | Sandoz Ag | |
| CH583211A5 (enExample) * | 1973-05-22 | 1976-12-31 | Sandoz Ag | |
| CH583212A5 (enExample) * | 1973-07-02 | 1976-12-31 | Sandoz Ag | |
| US4468341A (en) * | 1983-10-27 | 1984-08-28 | Ciba-Geigy Corporation | Stable purified aqueous solutions of fluorescent whitening agent |
| DE3502038A1 (de) * | 1985-01-23 | 1986-07-24 | Sandoz-Patent-GmbH, 7850 Lörrach | Waessrige aufhellerpraeparate und deren verwendung im papierstrich |
| GB9418958D0 (en) * | 1994-09-21 | 1994-11-09 | Ciba Geigy Ag | Fluorescent whitening agents |
| GB9611614D0 (en) * | 1996-06-04 | 1996-08-07 | Ciba Geigy Ag | Process for inhibiting the effect of flourescent whitening agents |
| GB9813248D0 (en) | 1998-06-22 | 1998-08-19 | Clariant Int Ltd | Improvements in or relating to organic compounds |
| GB9930247D0 (en) | 1999-12-22 | 2000-02-09 | Clariant Int Ltd | Improvements in or relating to organic compounds |
| GB9930177D0 (en) | 1999-12-22 | 2000-02-09 | Clariant Int Ltd | Improvements in or relating to organic compounds |
| PT2781648E (pt) | 2013-03-21 | 2016-03-07 | Clariant Int Ltd | Agentes de branqueamento ótico para impressão a jato de tinta de alta qualidade |
| CN109776757B (zh) * | 2019-01-15 | 2021-06-08 | 陕西科技大学 | 一种含二苯甲酮的纸张表面聚氨酯荧光增白乳液的制备方法及其应用 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL245010A (enExample) * | 1958-11-05 | |||
| GB1008457A (en) * | 1963-04-12 | 1965-10-27 | Gen Aniline & Film Corp | Improvements in or relating to stilbene-cyanuric compounds |
| US3479349A (en) * | 1967-08-03 | 1969-11-18 | Geigy Chem Corp | Polysulfonated bis-s-triazinylamino-stilbene-2,2'-disulfonic acids |
| NL6911102A (enExample) * | 1968-07-29 | 1970-02-02 | ||
| CH508641A (de) * | 1968-08-06 | 1971-06-15 | Sandoz Ag | Verfahren zur Herstellung neuer fluoreszierender Verbindungen |
| US3600385A (en) * | 1968-12-16 | 1971-08-17 | American Cyanamid Co | Bis-(triazinylamino) stilbene derivatives for optical brightening |
| CH582275A5 (enExample) * | 1973-02-02 | 1976-11-30 | Ciba Geigy Ag |
-
1971
- 1971-09-07 IT IT69954/71A patent/IT942451B/it active
- 1971-09-10 DE DE2145384A patent/DE2145384C3/de not_active Expired
- 1971-09-13 BE BE772543A patent/BE772543A/xx not_active IP Right Cessation
- 1971-09-14 ES ES395057A patent/ES395057A1/es not_active Expired
- 1971-09-14 JP JP7163671A patent/JPS5426572B1/ja active Pending
- 1971-09-15 CY CY870A patent/CY870A/xx unknown
- 1971-09-15 NL NL7112658.A patent/NL157597B/xx not_active IP Right Cessation
- 1971-09-15 DD DD157738A patent/DD101158A5/xx unknown
- 1971-09-15 FR FR7133196A patent/FR2107684A5/fr not_active Expired
- 1971-09-15 CA CA122,879A patent/CA972365A/en not_active Expired
- 1971-09-15 GB GB4293071A patent/GB1313469A/en not_active Expired
-
1976
- 1976-07-28 KE KE2654*UA patent/KE2654A/xx unknown
- 1976-08-19 HK HK523/76*UA patent/HK52376A/xx unknown
-
1977
- 1977-08-30 US US05/829,241 patent/US4252604A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| HK52376A (en) | 1976-08-27 |
| DE2145384A1 (de) | 1972-03-30 |
| GB1313469A (en) | 1973-04-11 |
| DD101158A5 (enExample) | 1973-10-20 |
| FR2107684A5 (enExample) | 1972-05-05 |
| IT942451B (it) | 1973-03-20 |
| DE2145384C3 (de) | 1981-06-11 |
| JPS5426572B1 (enExample) | 1979-09-05 |
| NL157597B (nl) | 1978-08-15 |
| KE2654A (en) | 1976-08-13 |
| BE772543A (fr) | 1972-01-17 |
| ES395057A1 (es) | 1974-11-16 |
| CA972365A (en) | 1975-08-05 |
| DE2145384B2 (de) | 1980-08-14 |
| NL7112658A (enExample) | 1972-03-20 |
| US4252604A (en) | 1981-02-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA714729B (en) | Novel benzcyclobutene derivatives | |
| GB1364563A (en) | Interferometer | |
| JPS51526A (en) | Okisazoriruukumarin no seizoho | |
| ZA711533B (en) | Phenyl derivatives | |
| KE2654A (en) | Bis-(triazinylamino)-stilbene derivatives | |
| ZA715707B (en) | Monomethylamino compounds | |
| ZA717693B (en) | N-substituted-2-carboxy-1-azacyclic compounds | |
| CY787A (en) | Novel phtalimidine compounds | |
| ZA718157B (en) | Prostglandin analogs | |
| KE2770A (en) | Benzobicycloalkane compounds | |
| JPS5192364A (en) | Goseisenizairyo no kyujinsenshokuho | |
| HK27776A (en) | Diazabicycloundecapentene derivative | |
| AU3731471A (en) | Bis-triazole compounds | |
| ZA711840B (en) | Pge3-type compounds | |
| ZA717018B (en) | Anthelmintic thiocyanatobenzothiazoles | |
| ZA718586B (en) | Antidote compounds | |
| ZA716654B (en) | Basic thienylalkane derivatives | |
| ZA713111B (en) | Substituted carbamoyloxyphenylurea derivatives | |
| IL36933A0 (en) | 1-phenoxy-3-amino-propan-2-ol derivatives | |
| MY7600251A (en) | Bis-(triazinylamino)stilbenb-derivatives | |
| PH11679A (en) | Oxazolidine derivative | |
| ZA717307B (en) | Novel alkyl-steroids | |
| IE35865L (en) | Benzobicycloalkane compounds | |
| IE35863L (en) | Benzobicycloalkane compounds | |
| CA847362A (en) | Bis-(hydroxyphenylalkyleneyl)alkyl isocyanurates |