JPS6131861B2 - - Google Patents
Info
- Publication number
- JPS6131861B2 JPS6131861B2 JP52108386A JP10838677A JPS6131861B2 JP S6131861 B2 JPS6131861 B2 JP S6131861B2 JP 52108386 A JP52108386 A JP 52108386A JP 10838677 A JP10838677 A JP 10838677A JP S6131861 B2 JPS6131861 B2 JP S6131861B2
- Authority
- JP
- Japan
- Prior art keywords
- dye
- group
- layer
- solution
- silver halide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 claims description 138
- 150000001875 compounds Chemical class 0.000 claims description 54
- 239000000987 azo dye Substances 0.000 claims description 33
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- 229910052757 nitrogen Inorganic materials 0.000 claims description 19
- 125000004429 atom Chemical group 0.000 claims description 13
- 239000002243 precursor Substances 0.000 claims description 12
- 125000000623 heterocyclic group Chemical group 0.000 claims description 11
- 229910052799 carbon Inorganic materials 0.000 claims description 10
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- 239000010410 layer Substances 0.000 description 142
- -1 silver halide Chemical class 0.000 description 80
- 229910052709 silver Inorganic materials 0.000 description 71
- 239000004332 silver Substances 0.000 description 71
- 239000000203 mixture Substances 0.000 description 65
- 239000000839 emulsion Substances 0.000 description 62
- 239000000243 solution Substances 0.000 description 59
- 108010010803 Gelatin Proteins 0.000 description 46
- 229920000159 gelatin Polymers 0.000 description 46
- 239000008273 gelatin Substances 0.000 description 46
- 235000019322 gelatine Nutrition 0.000 description 46
- 235000011852 gelatine desserts Nutrition 0.000 description 46
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 41
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- 238000012545 processing Methods 0.000 description 26
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 25
- 239000000047 product Substances 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 23
- 239000007787 solid Substances 0.000 description 23
- 229910021645 metal ion Inorganic materials 0.000 description 22
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 238000000034 method Methods 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- 238000003756 stirring Methods 0.000 description 17
- 238000011161 development Methods 0.000 description 16
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 15
- 239000000463 material Substances 0.000 description 15
- 238000012546 transfer Methods 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- 238000012360 testing method Methods 0.000 description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 13
- 125000000217 alkyl group Chemical group 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 12
- 229920006267 polyester film Polymers 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 238000011160 research Methods 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 11
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 11
- 238000000576 coating method Methods 0.000 description 11
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 10
- 150000002500 ions Chemical class 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 9
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000012670 alkaline solution Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000011248 coating agent Substances 0.000 description 9
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- 235000019441 ethanol Nutrition 0.000 description 8
- 238000001465 metallisation Methods 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- 150000004696 coordination complex Chemical class 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 238000010521 absorption reaction Methods 0.000 description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 6
- 238000009792 diffusion process Methods 0.000 description 6
- 239000004816 latex Substances 0.000 description 6
- 229920000126 latex Polymers 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 239000004408 titanium dioxide Substances 0.000 description 6
- DSVIHYOAKPVFEH-UHFFFAOYSA-N 4-(hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(CO)CN1C1=CC=CC=C1 DSVIHYOAKPVFEH-UHFFFAOYSA-N 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 5
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 5
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 5
- 235000011130 ammonium sulphate Nutrition 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 229910052802 copper Inorganic materials 0.000 description 5
- 239000010949 copper Substances 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 238000005259 measurement Methods 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 230000003595 spectral effect Effects 0.000 description 5
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical group NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- BARQCCZSFFMSMT-UHFFFAOYSA-N benzyl-[3-(2,5-dioxopyrrol-1-yl)propyl]-dimethylazanium Chemical compound C=1C=CC=CC=1C[N+](C)(C)CCCN1C(=O)C=CC1=O BARQCCZSFFMSMT-UHFFFAOYSA-N 0.000 description 4
- 239000013522 chelant Substances 0.000 description 4
- 229940126086 compound 21 Drugs 0.000 description 4
- 239000012954 diazonium Substances 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 238000003384 imaging method Methods 0.000 description 4
- 239000003446 ligand Substances 0.000 description 4
- 229910052759 nickel Inorganic materials 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 125000003226 pyrazolyl group Chemical group 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 230000003381 solubilizing effect Effects 0.000 description 4
- 229940124530 sulfonamide Drugs 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- OQNCPSHYLBEOGZ-UHFFFAOYSA-N 2,3-didodecylbenzene-1,4-diol Chemical compound CCCCCCCCCCCCC1=C(O)C=CC(O)=C1CCCCCCCCCCCC OQNCPSHYLBEOGZ-UHFFFAOYSA-N 0.000 description 3
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 3
- VQIKSXMEABWWFE-UHFFFAOYSA-N 4-[3-methyl-5-oxo-4-(pyridin-2-yldiazenyl)-4h-pyrazol-1-yl]benzenesulfonyl chloride Chemical compound CC1=NN(C=2C=CC(=CC=2)S(Cl)(=O)=O)C(=O)C1N=NC1=CC=CC=N1 VQIKSXMEABWWFE-UHFFFAOYSA-N 0.000 description 3
- LRUDIIUSNGCQKF-UHFFFAOYSA-N 5-methyl-1H-benzotriazole Chemical compound C1=C(C)C=CC2=NNN=C21 LRUDIIUSNGCQKF-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- BGNXCDMCOKJUMV-UHFFFAOYSA-N Tert-Butylhydroquinone Chemical compound CC(C)(C)C1=CC(O)=CC=C1O BGNXCDMCOKJUMV-UHFFFAOYSA-N 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000007853 buffer solution Substances 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 229940125846 compound 25 Drugs 0.000 description 3
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 150000001989 diazonium salts Chemical class 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N divinylbenzene Substances C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000011229 interlayer Substances 0.000 description 3
- 125000005647 linker group Chemical group 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- BMGNSKKZFQMGDH-FDGPNNRMSA-L nickel(2+);(z)-4-oxopent-2-en-2-olate Chemical compound [Ni+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O BMGNSKKZFQMGDH-FDGPNNRMSA-L 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000008363 phosphate buffer Substances 0.000 description 3
- 229920000139 polyethylene terephthalate Polymers 0.000 description 3
- 239000005020 polyethylene terephthalate Substances 0.000 description 3
- NWELCUKYUCBVKK-UHFFFAOYSA-N pyridin-2-ylhydrazine Chemical compound NNC1=CC=CC=N1 NWELCUKYUCBVKK-UHFFFAOYSA-N 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 3
- 125000000565 sulfonamide group Chemical group 0.000 description 3
- 150000003456 sulfonamides Chemical group 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 150000003852 triazoles Chemical group 0.000 description 3
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 2
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 2
- GMEWXTUITOHSIL-UHFFFAOYSA-N 2,5-dihydroxy-4-octadecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCCCCCCCC1=CC(O)=C(S(O)(=O)=O)C=C1O GMEWXTUITOHSIL-UHFFFAOYSA-N 0.000 description 2
- SYFKLYMNYUZNTM-UHFFFAOYSA-N 3-[[3-hydroxy-6-[(2-hydroxy-4-nitrophenyl)diazenyl]pyridin-2-yl]carbamoyl]benzenesulfonyl fluoride Chemical compound FS(=O)(=O)C=1C=C(C(=O)NC2=NC(=CC=C2O)N=NC2=C(C=C(C=C2)[N+](=O)[O-])O)C=CC=1 SYFKLYMNYUZNTM-UHFFFAOYSA-N 0.000 description 2
- GRFNBEZIAWKNCO-UHFFFAOYSA-N 3-pyridinol Chemical compound OC1=CC=CN=C1 GRFNBEZIAWKNCO-UHFFFAOYSA-N 0.000 description 2
- SJSJAWHHGDPBOC-UHFFFAOYSA-N 4,4-dimethyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(C)CN1C1=CC=CC=C1 SJSJAWHHGDPBOC-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical class OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 229940126208 compound 22 Drugs 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 2
- 235000019796 monopotassium phosphate Nutrition 0.000 description 2
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical compound N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- PJNZPQUBCPKICU-UHFFFAOYSA-N phosphoric acid;potassium Chemical compound [K].OP(O)(O)=O PJNZPQUBCPKICU-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- MCSKRVKAXABJLX-UHFFFAOYSA-N pyrazolo[3,4-d]triazole Chemical class N1=NN=C2N=NC=C21 MCSKRVKAXABJLX-UHFFFAOYSA-N 0.000 description 2
- 238000006748 scratching Methods 0.000 description 2
- 230000002393 scratching effect Effects 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 229940001482 sodium sulfite Drugs 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 238000001308 synthesis method Methods 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 2
- 239000001043 yellow dye Substances 0.000 description 2
- 239000001052 yellow pigment Substances 0.000 description 2
- CWGBFIRHYJNILV-UHFFFAOYSA-N (1,4-diphenyl-1,2,4-triazol-4-ium-3-yl)-phenylazanide Chemical compound C=1C=CC=CC=1[N-]C1=NN(C=2C=CC=CC=2)C=[N+]1C1=CC=CC=C1 CWGBFIRHYJNILV-UHFFFAOYSA-N 0.000 description 1
- YNLZQSXUZWRKPF-UHFFFAOYSA-N (2-nitropyridin-3-yl)hydrazine Chemical compound NNC1=CC=CN=C1[N+]([O-])=O YNLZQSXUZWRKPF-UHFFFAOYSA-N 0.000 description 1
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- HICRQFTZLUNHEA-UHFFFAOYSA-N (5-carboxy-2-hydroxy-4-nitrophenyl)azanium;chloride Chemical compound [Cl-].[NH3+]C1=CC(C(O)=O)=C([N+]([O-])=O)C=C1O HICRQFTZLUNHEA-UHFFFAOYSA-N 0.000 description 1
- DDWAPSXNXHYQLK-UHFFFAOYSA-N (5-nitropyridin-2-yl)hydrazine Chemical compound NNC1=CC=C([N+]([O-])=O)C=N1 DDWAPSXNXHYQLK-UHFFFAOYSA-N 0.000 description 1
- KETQAJRQOHHATG-UHFFFAOYSA-N 1,2-naphthoquinone Chemical compound C1=CC=C2C(=O)C(=O)C=CC2=C1 KETQAJRQOHHATG-UHFFFAOYSA-N 0.000 description 1
- 229940105324 1,2-naphthoquinone Drugs 0.000 description 1
- KAMCBFNNGGVPPW-UHFFFAOYSA-N 1-(ethenylsulfonylmethoxymethylsulfonyl)ethene Chemical compound C=CS(=O)(=O)COCS(=O)(=O)C=C KAMCBFNNGGVPPW-UHFFFAOYSA-N 0.000 description 1
- YNUYXVPPMWSPPF-UHFFFAOYSA-N 1-[3-(5-amino-2-methoxyphenyl)-6-methylpyrazolo[5,1-c][1,2,4]triazol-1-yl]ethanone Chemical compound COC1=CC=C(N)C=C1C1=NN(C(C)=O)C2=CC(C)=NN12 YNUYXVPPMWSPPF-UHFFFAOYSA-N 0.000 description 1
- UCOJJXSOXHUJJY-UHFFFAOYSA-N 1-[azido(ethoxy)phosphoryl]oxyethane Chemical compound CCOP(=O)(OCC)N=[N+]=[N-] UCOJJXSOXHUJJY-UHFFFAOYSA-N 0.000 description 1
- LYKTYUAWYTYSQA-UHFFFAOYSA-N 1-butylnaphthalene-2-carboxamide Chemical compound C(CCC)C1=C(C=CC2=CC=CC=C12)C(=O)N LYKTYUAWYTYSQA-UHFFFAOYSA-N 0.000 description 1
- JBXGQAYHMVWZED-UHFFFAOYSA-N 2,3-dihydroxybutanedioic acid;nitric acid Chemical compound O[N+]([O-])=O.OC(=O)C(O)C(O)C(O)=O JBXGQAYHMVWZED-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- JHKKTXXMAQLGJB-UHFFFAOYSA-N 2-(methylamino)phenol Chemical compound CNC1=CC=CC=C1O JHKKTXXMAQLGJB-UHFFFAOYSA-N 0.000 description 1
- MXZROAOUCUVNHX-UHFFFAOYSA-N 2-Aminopropanol Chemical compound CCC(N)O MXZROAOUCUVNHX-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- KBKXDMHYXAJPPM-UHFFFAOYSA-N 2-[4-hydroxy-3-[(5-nitropyridin-2-yl)diazenyl]naphthalen-1-yl]oxypropanoic acid Chemical compound C(=O)(O)C(C)OC1=CC(=C(C2=CC=CC=C12)O)N=NC1=NC=C(C=C1)[N+](=O)[O-] KBKXDMHYXAJPPM-UHFFFAOYSA-N 0.000 description 1
- BMTSZVZQNMNPCT-UHFFFAOYSA-N 2-aminopyridin-3-ol Chemical compound NC1=NC=CC=C1O BMTSZVZQNMNPCT-UHFFFAOYSA-N 0.000 description 1
- BAZVFQBTJPBRTJ-UHFFFAOYSA-N 2-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Cl)N=C1 BAZVFQBTJPBRTJ-UHFFFAOYSA-N 0.000 description 1
- ZNQOWAYHQGMKBF-UHFFFAOYSA-N 2-dodecylbenzene-1,4-diol Chemical compound CCCCCCCCCCCCC1=CC(O)=CC=C1O ZNQOWAYHQGMKBF-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- ZPGHDPUCQANFAD-UHFFFAOYSA-N 3-chlorosulfonylbenzenesulfonyl fluoride Chemical compound FS(=O)(=O)C1=CC=CC(S(Cl)(=O)=O)=C1 ZPGHDPUCQANFAD-UHFFFAOYSA-N 0.000 description 1
- ZYZOMPZZWUWKLH-UHFFFAOYSA-N 3-fluorosulfonylbenzoyl chloride Chemical compound FS(=O)(=O)C1=CC=CC(C(Cl)=O)=C1 ZYZOMPZZWUWKLH-UHFFFAOYSA-N 0.000 description 1
- WIHFUBJAJLFZKI-UHFFFAOYSA-N 4,4-dibromo-1h-pyrazol-5-one Chemical compound BrC1(Br)C=NNC1=O WIHFUBJAJLFZKI-UHFFFAOYSA-N 0.000 description 1
- CPHGOBGXZQKCKI-UHFFFAOYSA-N 4,5-diphenyl-1h-imidazole Chemical compound N1C=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 CPHGOBGXZQKCKI-UHFFFAOYSA-N 0.000 description 1
- XHVLAPJHAVJEBM-UHFFFAOYSA-N 4-(4,4-dibromo-3-methyl-5-oxopyrazol-1-yl)benzenesulfonic acid Chemical compound O=C1C(Br)(Br)C(C)=NN1C1=CC=C(S(O)(=O)=O)C=C1 XHVLAPJHAVJEBM-UHFFFAOYSA-N 0.000 description 1
- WKVOVBKDJSXTKU-UHFFFAOYSA-N 4-[3-methyl-5-oxo-4-(pyridin-2-yldiazenyl)-4h-pyrazol-1-yl]benzenesulfonic acid Chemical compound CC1=NN(C=2C=CC(=CC=2)S(O)(=O)=O)C(=O)C1N=NC1=CC=CC=N1 WKVOVBKDJSXTKU-UHFFFAOYSA-N 0.000 description 1
- LQPYPLBCZNOKKA-UHFFFAOYSA-N 4-amino-n-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1-hydroxynaphthalene-2-carboxamide Chemical compound CCC(C)(C)C1=CC(C(C)(C)CC)=CC=C1OCCCCNC(=O)C1=CC(N)=C(C=CC=C2)C2=C1O LQPYPLBCZNOKKA-UHFFFAOYSA-N 0.000 description 1
- GEXKWBTVJBDQIB-UHFFFAOYSA-N 4-n-ethoxy-4-n-ethyl-2-methoxybenzene-1,4-diamine Chemical compound CCON(CC)C1=CC=C(N)C(OC)=C1 GEXKWBTVJBDQIB-UHFFFAOYSA-N 0.000 description 1
- MARUHZGHZWCEQU-UHFFFAOYSA-N 5-phenyl-2h-tetrazole Chemical compound C1=CC=CC=C1C1=NNN=N1 MARUHZGHZWCEQU-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- 206010013496 Disturbance in attention Diseases 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- FOIXSVOLVBLSDH-UHFFFAOYSA-N Silver ion Chemical compound [Ag+] FOIXSVOLVBLSDH-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- MQRWBMAEBQOWAF-UHFFFAOYSA-N acetic acid;nickel Chemical compound [Ni].CC(O)=O.CC(O)=O MQRWBMAEBQOWAF-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229960003116 amyl nitrite Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940101006 anhydrous sodium sulfite Drugs 0.000 description 1
- 238000000429 assembly Methods 0.000 description 1
- 230000000712 assembly Effects 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- KHBQMWCZKVMBLN-IDEBNGHGSA-N benzenesulfonamide Chemical compound NS(=O)(=O)[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 KHBQMWCZKVMBLN-IDEBNGHGSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- KGNDCEVUMONOKF-UGPLYTSKSA-N benzyl n-[(2r)-1-[(2s,4r)-2-[[(2s)-6-amino-1-(1,3-benzoxazol-2-yl)-1,1-dihydroxyhexan-2-yl]carbamoyl]-4-[(4-methylphenyl)methoxy]pyrrolidin-1-yl]-1-oxo-4-phenylbutan-2-yl]carbamate Chemical compound C1=CC(C)=CC=C1CO[C@H]1CN(C(=O)[C@@H](CCC=2C=CC=CC=2)NC(=O)OCC=2C=CC=CC=2)[C@H](C(=O)N[C@@H](CCCCN)C(O)(O)C=2OC3=CC=CC=C3N=2)C1 KGNDCEVUMONOKF-UGPLYTSKSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 239000008366 buffered solution Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 230000009920 chelation Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229910001431 copper ion Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical compound OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 description 1
- 238000007646 gravure printing Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N hydroquinone methyl ether Natural products COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 230000003100 immobilizing effect Effects 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- VVSVSDMTNHEMNF-UHFFFAOYSA-N n-(2-amino-4-nitrophenyl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C([N+]([O-])=O)C=C1N VVSVSDMTNHEMNF-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- CSDTZUBPSYWZDX-UHFFFAOYSA-N n-pentyl nitrite Chemical compound CCCCCON=O CSDTZUBPSYWZDX-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229940078494 nickel acetate Drugs 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/02—Photosensitive materials characterised by the image-forming section
- G03C8/08—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of organic compounds
- G03C8/10—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of organic compounds of dyes or their precursors
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Plural Heterocyclic Compounds (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB37653/76A GB1585178A (en) | 1976-09-10 | 1976-09-10 | Photographic materials |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5335533A JPS5335533A (en) | 1978-04-03 |
| JPS6131861B2 true JPS6131861B2 (enExample) | 1986-07-23 |
Family
ID=10398016
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP10838677A Granted JPS5335533A (en) | 1976-09-10 | 1977-09-10 | Photographic element |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US4142891A (enExample) |
| JP (1) | JPS5335533A (enExample) |
| AU (1) | AU516154B2 (enExample) |
| BE (1) | BE858623A (enExample) |
| CA (1) | CA1082175A (enExample) |
| CH (1) | CH624228A5 (enExample) |
| DE (1) | DE2740719A1 (enExample) |
| FR (1) | FR2364492A1 (enExample) |
| GB (1) | GB1585178A (enExample) |
| NL (1) | NL168960C (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS61170578U (enExample) * | 1985-04-15 | 1986-10-22 |
Families Citing this family (67)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4273853A (en) * | 1979-03-30 | 1981-06-16 | Eastman Kodak Company | Metal complexes of copolymers comprising vinylimidazole and their use in photographic elements |
| US4195994A (en) * | 1977-08-05 | 1980-04-01 | Eastman Kodak Company | Photographic products and processes employing nondiffusible 6-arylazo-2-amino-3-pyridinol dye-releasing compounds and precursors thereof |
| US4207104A (en) * | 1977-09-12 | 1980-06-10 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible heterocyclylazonaphthol dye-releasing compounds |
| US4148643A (en) * | 1978-04-03 | 1979-04-10 | Eastman Kodak Company | Photographic products and processes employing nondiffusible azo dye-releasing compounds |
| US4204993A (en) * | 1978-07-24 | 1980-05-27 | Eastman Kodak Company | Nondiffusible 6-arylazo-2-amino-3-pyridinol dye-releasing compounds |
| US4239847A (en) * | 1978-09-21 | 1980-12-16 | Eastman Kodak Company | Photographic elements containing polymers which coordinate with metal ions |
| US4299895A (en) * | 1978-09-21 | 1981-11-10 | Eastman Kodak Company | Photographic elements containing polymers which coordinate with metal ions |
| JPS5559461A (en) * | 1978-10-30 | 1980-05-02 | Fuji Photo Film Co Ltd | Photographic material for color diffusion transfer method |
| US4273706A (en) * | 1979-01-09 | 1981-06-16 | Eastman Kodak Company | Nondiffusible heterocyclylazonaphthol dye-releasing compounds |
| US4282305A (en) * | 1979-01-15 | 1981-08-04 | Eastman Kodak Company | Receiving elements for image transfer film units |
| US4228070A (en) * | 1979-02-28 | 1980-10-14 | Eastman Kodak Company | Purification of photographic image-forming sulfonamido compounds employing immiscible solvents |
| US4248956A (en) * | 1979-03-02 | 1981-02-03 | Eastman Kodak Company | Photographic products and processes employing heterocyclic azo dye developer compounds |
| JPS5945136B2 (ja) * | 1979-04-05 | 1984-11-05 | 富士写真フイルム株式会社 | カラ−拡散転写用写真感光シ−ト |
| US4250238A (en) * | 1979-10-01 | 1981-02-10 | Eastman Kodak Company | Photographic products and processes employing novel dye developer compounds |
| US4287292A (en) * | 1980-08-01 | 1981-09-01 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 6-arylazo-3-pyridinol magenta dye-releasing compounds and precursors thereof |
| US4358404A (en) * | 1980-08-01 | 1982-11-09 | Eastman Kodak Company | Nondiffusible 6-arylazo-3-pyridinol |
| CA1172629A (en) * | 1980-11-24 | 1984-08-14 | Joseph Bailey | Photographic products employing nondiffusible metal- complexed azo dye-releasing compounds and precursors thereof |
| DE3115648A1 (de) * | 1981-04-18 | 1982-11-04 | Agfa-Gevaert Ag, 5090 Leverkusen | Farbfotografisches aufzeichnungsmaterial |
| JPS57111534A (en) * | 1980-12-27 | 1982-07-12 | Konishiroku Photo Ind Co Ltd | Photographic sensitive element |
| DE3107540A1 (de) * | 1981-02-27 | 1982-09-16 | Agfa-Gevaert Ag, 5090 Leverkusen | Farbfotografisches aufzeichnungsmaterial |
| US4363865A (en) * | 1981-03-04 | 1982-12-14 | Eastman Kodak Company | Imido methyl blocked photographic dyes and dye releasing compounds |
| US4396546A (en) * | 1981-04-29 | 1983-08-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 6-(2-thienylazo)-3-pyridinol cyan dye-releasing compounds and precursors thereof |
| US4385104A (en) * | 1981-04-29 | 1983-05-24 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 6-(2-thienylazo)-3-pyridinol cyan dye-releasing compounds and precursors thereof |
| US4346161A (en) * | 1981-04-29 | 1982-08-24 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 6-(2-thienylazo)-3-pyridinol cyan dye-releasing compounds and precursors thereof |
| JPS57189138A (en) * | 1981-05-19 | 1982-11-20 | Fuji Photo Film Co Ltd | Photographic recording material containing novel coordinated polymer |
| US4357411A (en) * | 1981-07-13 | 1982-11-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 2-(2-pyridylazo)-4,5-bis(tertiary amino)phenol black dye-releasing compounds and precursors thereof |
| US4368154A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible bridged azoaminophenol magenta dye-releasing compounds and precursors thereof |
| US4357410A (en) * | 1981-07-13 | 1982-11-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazo(dialkylamino) phenol magenta dye-releasing compounds and precursors thereof |
| US4366218A (en) * | 1981-07-13 | 1982-12-28 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible bridged azdaminophenol magenta dye-releasing compounds and precursors thereof |
| US4357412A (en) * | 1981-07-13 | 1982-11-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible bridged azoaminophenol magenta dye-releasing compounds and precursors thereof |
| US4368249A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazo(dialkylamino)phenol magenta dye-releasing compounds and precursors thereof |
| US4368153A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 2-(2-pyridylazo)-4,5-bis(tertiary amino)phenol black dye-releasing compounds and precursors thereof |
| US4367174A (en) * | 1981-07-13 | 1983-01-04 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazo(dialkylamino)phenol magenta dye-releasing compounds and precursors thereof |
| US4368248A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 2-(2-pyridylazo)-4,5-bis(tertiary amino)phenol black dye-releasing compounds and precursors thereof |
| CA1247916A (en) * | 1981-09-02 | 1989-01-03 | Jasbir Sidhu | Method of forming a photographic image dye |
| DE3200705A1 (de) * | 1982-01-13 | 1983-07-21 | Agfa-Gevaert Ag, 5090 Leverkusen | Farbfotografisches aufzeichnungsmaterial |
| JPS58163938A (ja) * | 1982-03-24 | 1983-09-28 | Fuji Photo Film Co Ltd | カラ−拡散転写用写真要素 |
| US4495100A (en) * | 1982-05-21 | 1985-01-22 | Eastman Kodak Company | Non-diffusible cyan compound capable of releasing a 6-heterocyclylazo-3-pyridinol |
| US4495098A (en) * | 1982-05-21 | 1985-01-22 | Eastman Kodak Company | Coordination complexes of polyvalent metal ions and cyan dye-releasing compounds comprising a 6-heterocyclazo-3-pyridinol |
| US4495099A (en) * | 1982-05-21 | 1985-01-22 | Eastman Kodak Company | Non-diffusible magenta compound capable of releasing a 4-(2-heterocyclazo)phenol having a heterocyclic ring fused thereto |
| US4420550A (en) * | 1982-05-21 | 1983-12-13 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible magenta dye-releasing compounds and precursors thereof |
| US4436799A (en) | 1982-05-21 | 1984-03-13 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible magenta dye-releasing compounds and precursors thereof |
| US4476207A (en) * | 1982-05-21 | 1984-10-09 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible cyan dye-releasing compounds and precursors thereof |
| US4419435A (en) * | 1982-05-21 | 1983-12-06 | Eastman Kodak Company | Photographic products and processes employing 6-heterocyclylazo-3-pyridinol nondiffusible cyan dye-releasing compounds and precursors thereof |
| DE3332991A1 (de) * | 1982-09-13 | 1984-03-15 | Konishiroku Photo Industry Co., Ltd., Tokyo | Verfahren zur bildung eines farbdiffusionsuebertragungsbildes durch warmentwickeln |
| JPS59124337A (ja) * | 1982-12-30 | 1984-07-18 | Konishiroku Photo Ind Co Ltd | 熱現像カラ−拡散転写画像形成方法 |
| JPS5948765A (ja) * | 1982-09-13 | 1984-03-21 | Konishiroku Photo Ind Co Ltd | 熱現像カラ−拡散転写画像形成方法 |
| JPS59164553A (ja) * | 1983-03-08 | 1984-09-17 | Fuji Photo Film Co Ltd | カラ−写真感光材料 |
| DE3312500A1 (de) * | 1983-04-07 | 1984-10-11 | Agfa-Gevaert Ag, 5090 Leverkusen | Chelatisierbare azofarbstoffe, deren verwendung zur bilderzeugung und ein farbfotografisches aufzeichnungsmaterial mit farbabspaltern, die die chelatisierbaren farbstoffe freisetzten |
| DE3322058A1 (de) * | 1983-06-18 | 1984-12-20 | Agfa-Gevaert Ag, 5090 Leverkusen | Mit metallionen chelatisierbare oder chelatisierte monoazofarbstoffe, deren verwendung zur bilderzeugung, ein farbfotografisches aufzeichnungsmaterial mit farbabspaltern, die die farbstoffe freisetzen, und ein farbbild mit einer bildmaessigen verteilung von nickelkomplexen der farbstoffe |
| DE3464417D1 (en) * | 1983-08-18 | 1987-07-30 | Agfa Gevaert Ag | Colour-photographic recording material with dye-releasing compounds releasing 6-aryl-azo-2-amino-3 pyridinol dyes forming chelates with metal ions, and a colour picture with an image-wise distribution of nickel complexes of the dyes |
| DE3424899A1 (de) * | 1984-07-06 | 1986-02-06 | Agfa-Gevaert Ag, 5090 Leverkusen | Farbfotografisches aufzeichnungsmaterial |
| US4559291A (en) * | 1984-12-28 | 1985-12-17 | Eastman Kodak Company | Ligands for metallizable dyes |
| US4680356A (en) * | 1985-01-02 | 1987-07-14 | Eastman Kodak Company | Colorless ligand-releasing monomers and polymers and their use to provide dyes with metal ions |
| US4555478A (en) * | 1985-01-02 | 1985-11-26 | Eastman Kodak Company | Photographic element and process for providing metal complex color images |
| US4557998A (en) * | 1985-01-02 | 1985-12-10 | Eastman Kodak Company | Colorless ligand-releasing monomers and polymers and their use to provide dyes with metal ions |
| US4555477A (en) * | 1985-01-02 | 1985-11-26 | Eastman Kodak Company | Photographic element and process utilizing metal complex color masking dyes |
| JPS61250636A (ja) | 1985-04-30 | 1986-11-07 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS61273542A (ja) * | 1985-05-30 | 1986-12-03 | Fuji Photo Film Co Ltd | カラ−感光材料 |
| JPH083621B2 (ja) | 1985-07-31 | 1996-01-17 | 富士写真フイルム株式会社 | 画像形成方法 |
| JPS62252483A (ja) * | 1986-04-24 | 1987-11-04 | Fuji Photo Film Co Ltd | 記録液 |
| JP2597908B2 (ja) | 1989-04-25 | 1997-04-09 | 富士写真フイルム株式会社 | ハロゲン化銀カラー写真感光材料 |
| US5717725A (en) * | 1992-03-12 | 1998-02-10 | Ntp Incorporated | System for wireless transmission and receiving of information through a computer bus interface and method of operation |
| US5745532A (en) * | 1992-03-12 | 1998-04-28 | Ntp Incorporated | System for wireless transmission and receiving of information and method of operation thereof |
| US6272190B1 (en) | 1992-03-12 | 2001-08-07 | Ntp Incorporated | System for wireless transmission and receiving of information and method of operation thereof |
| JP2002220543A (ja) * | 2001-01-24 | 2002-08-09 | Fuji Photo Film Co Ltd | アゾ化合物、該アゾ化合物の互変異性体、金属含有アゾ化合物、アゾ化合物の製造方法、及び金属含有アゾ化合物の製造方法 |
| GB0314368D0 (en) * | 2003-06-20 | 2003-07-23 | Avecia Ltd | Composition, use and process |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2348417A (en) * | 1941-05-21 | 1944-05-09 | Research Corp | Arsanilic acid azo sulphonamide compound |
| US2495244A (en) * | 1944-10-06 | 1950-01-24 | Ciba Ltd | Ester-like derivatives of azo dyestuffs |
| FR1124882A (fr) | 1954-05-25 | 1956-10-19 | Bayer Ag | Colorants o, o'-dihydroxyazoïques, leurs composés complexes métalliques et leur procédé de production |
| US2830042A (en) * | 1955-01-18 | 1958-04-08 | Bayer Ag | Monoazo dyestuffs |
| BE571946A (enExample) * | 1957-10-11 | |||
| FR1200358A (fr) | 1958-04-24 | 1959-12-21 | Cfmc | Nouveaux colorants azoïques métallisables et métallifères; application à la teinture |
| US2983608A (en) * | 1958-10-06 | 1961-05-09 | Eastman Kodak Co | Yellow-colored magenta-forming couplers |
| NL247649A (enExample) * | 1959-01-26 | |||
| NL252552A (enExample) | 1959-06-12 | |||
| US3097196A (en) * | 1959-11-12 | 1963-07-09 | Eastman Kodak Co | Ni complexes of monoazo compounds prepared from a benzothiazole compound and an alphanaphthol compound |
| US3563739A (en) * | 1965-09-13 | 1971-02-16 | Polaroid Corp | Novel products,processes and compositions comprising metal-complexed dye developers |
| US3453107A (en) * | 1965-09-13 | 1969-07-01 | Polaroid Corp | Novel photographic products,processes and compositions |
| US3443939A (en) * | 1967-07-24 | 1969-05-13 | Polaroid Corp | Differential mobility of color moiety in color transfer |
| US3931144A (en) * | 1973-02-12 | 1976-01-06 | Eastman Kodak Company | Magenta image-providing phenylazonaphthyl dyes |
| US3929760A (en) * | 1973-02-12 | 1975-12-30 | Eastman Kodak Co | Cyan image-providing phenylazonaphthyl dyes |
| US3980479A (en) * | 1974-10-02 | 1976-09-14 | Eastman Kodak Company | Positive-working immobile photographic compounds which cleave by intramolecular nucleophilic displacement in alkali unless oxidized |
| US4013635A (en) * | 1975-02-26 | 1977-03-22 | Eastman Kodak Company | Cyan azo dye-providing compounds |
| DE2608052C2 (de) * | 1976-02-27 | 1982-12-30 | Vereinigte Glaswerke Gmbh, 5100 Aachen | Flüssigkeitspumpe für das schmelzflüssige Metall einer Floatglasanlage |
| US4147544A (en) * | 1977-09-12 | 1979-04-03 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazonaphthol dye-releasing compounds |
| US4148641A (en) * | 1977-09-12 | 1979-04-10 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazopyrazole or pyrimidylazopyrazole dye-releasing compounds |
-
1976
- 1976-09-10 GB GB37653/76A patent/GB1585178A/en not_active Expired
-
1977
- 1977-08-05 US US05/822,188 patent/US4142891A/en not_active Expired - Lifetime
- 1977-08-18 CA CA284,981A patent/CA1082175A/en not_active Expired
- 1977-09-09 NL NLAANVRAGE7709926,A patent/NL168960C/xx not_active IP Right Cessation
- 1977-09-09 CH CH1108677A patent/CH624228A5/fr not_active IP Right Cessation
- 1977-09-09 DE DE19772740719 patent/DE2740719A1/de not_active Withdrawn
- 1977-09-10 JP JP10838677A patent/JPS5335533A/ja active Granted
- 1977-09-12 FR FR7727422A patent/FR2364492A1/fr active Granted
- 1977-09-12 BE BE180846A patent/BE858623A/xx not_active IP Right Cessation
- 1977-09-12 AU AU28709/77A patent/AU516154B2/en not_active Expired
-
1979
- 1979-03-23 US US06/023,430 patent/US4272434A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS61170578U (enExample) * | 1985-04-15 | 1986-10-22 |
Also Published As
| Publication number | Publication date |
|---|---|
| CH624228A5 (enExample) | 1981-07-15 |
| AU516154B2 (en) | 1981-05-21 |
| DE2740719A1 (de) | 1978-03-16 |
| US4272434A (en) | 1981-06-09 |
| FR2364492B1 (enExample) | 1983-03-18 |
| US4142891A (en) | 1979-03-06 |
| NL168960C (nl) | 1982-05-17 |
| NL168960B (nl) | 1981-12-16 |
| GB1585178A (en) | 1981-02-25 |
| CA1082175A (en) | 1980-07-22 |
| BE858623A (fr) | 1978-03-13 |
| NL7709926A (nl) | 1978-03-14 |
| FR2364492A1 (fr) | 1978-04-07 |
| JPS5335533A (en) | 1978-04-03 |
| AU2870977A (en) | 1979-03-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6131861B2 (enExample) | ||
| US4426326A (en) | Nondiffusible metal-complexed azo dye-releasing compounds | |
| US4562139A (en) | Photographic products employing novel nondiffusible metal complexes of azo dyes | |
| JPS6314345B2 (enExample) | ||
| US4204870A (en) | Photographic products and processes employing novel nondiffusible heterocyclyazonaphthol dye-releasing compounds | |
| US4871654A (en) | Photographic element incorporating redox compounds for use in a dye diffusion transfer process | |
| US4013633A (en) | Yellow azopyrazoline dye releasing redox compounds for photographic color transfer | |
| US4148642A (en) | Photographic products and processes employing nondiffusible 1-arylazo-4-isoquinolinol dye-releasing compounds | |
| US4147544A (en) | Photographic products and processes employing novel nondiffusible pyridylazonaphthol dye-releasing compounds | |
| US4148643A (en) | Photographic products and processes employing nondiffusible azo dye-releasing compounds | |
| US4269924A (en) | Photographic material suited for the production of multicolor images by means of diffusion transfer of complexed silver halide | |
| US4195994A (en) | Photographic products and processes employing nondiffusible 6-arylazo-2-amino-3-pyridinol dye-releasing compounds and precursors thereof | |
| US4420550A (en) | Photographic products and processes employing novel nondiffusible magenta dye-releasing compounds and precursors thereof | |
| US4407931A (en) | Photographic products and processes employing nondiffusible yellow azo metal complexed dye-releasing compounds and precursors thereof | |
| US4183753A (en) | Photographic products and processes employing metal complexed azo dyes | |
| US4183755A (en) | Photographic products and processes employing metal complexable nondiffusible azo dye-releasing compounds | |
| US4419435A (en) | Photographic products and processes employing 6-heterocyclylazo-3-pyridinol nondiffusible cyan dye-releasing compounds and precursors thereof | |
| US4204993A (en) | Nondiffusible 6-arylazo-2-amino-3-pyridinol dye-releasing compounds | |
| US4436799A (en) | Photographic products and processes employing novel nondiffusible magenta dye-releasing compounds and precursors thereof | |
| US4148641A (en) | Photographic products and processes employing novel nondiffusible pyridylazopyrazole or pyrimidylazopyrazole dye-releasing compounds | |
| US4165238A (en) | Photographic products and processes employing novel nondiffusible pyridylazonaphthol dye-releasing compounds | |
| US4548888A (en) | Photographic products employing novel nondiffusible hydrazone dye-releasing compounds | |
| US4228073A (en) | Nondiffusible azo dye-releasing compounds | |
| JPS6336655B2 (enExample) | ||
| US4165987A (en) | Photographic products and processes employing novel nondiffusible pyridylazopyrazole or pyrimidylazopyrazole dye-releasing compounds |