JPS6011065B2 - モノアゾ系の水溶性反応性染料の製法 - Google Patents
モノアゾ系の水溶性反応性染料の製法Info
- Publication number
- JPS6011065B2 JPS6011065B2 JP48005364A JP536473A JPS6011065B2 JP S6011065 B2 JPS6011065 B2 JP S6011065B2 JP 48005364 A JP48005364 A JP 48005364A JP 536473 A JP536473 A JP 536473A JP S6011065 B2 JPS6011065 B2 JP S6011065B2
- Authority
- JP
- Japan
- Prior art keywords
- methyl
- formula
- methylsulfonyl
- pyrimidinyl
- dye
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 239000000985 reactive dye Substances 0.000 title description 4
- -1 heterocyclic hydrocarbon Chemical class 0.000 claims description 78
- 239000000975 dye Substances 0.000 claims description 46
- 125000001424 substituent group Chemical group 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- 150000001412 amines Chemical class 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 125000002723 alicyclic group Chemical group 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 239000000987 azo dye Substances 0.000 claims description 2
- 238000004132 cross linking Methods 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000005597 hydrazone group Chemical class 0.000 claims description 2
- 150000002430 hydrocarbons Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 5
- 125000001624 naphthyl group Chemical group 0.000 claims 1
- 239000002253 acid Substances 0.000 description 20
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- 239000000843 powder Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 7
- 238000004043 dyeing Methods 0.000 description 7
- 239000001632 sodium acetate Substances 0.000 description 7
- 235000017281 sodium acetate Nutrition 0.000 description 7
- 229920003043 Cellulose fiber Polymers 0.000 description 6
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 6
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 230000008878 coupling Effects 0.000 description 6
- 238000010168 coupling process Methods 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 239000012954 diazonium Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical class [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 229920002678 cellulose Polymers 0.000 description 5
- 239000001913 cellulose Substances 0.000 description 5
- 150000001875 compounds Chemical group 0.000 description 5
- 150000001989 diazonium salts Chemical class 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 4
- 150000003918 triazines Chemical class 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 239000001103 potassium chloride Substances 0.000 description 3
- 235000011164 potassium chloride Nutrition 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 2
- YXYCPKOAGWDZKX-UHFFFAOYSA-N 2,4-difluoro-5-(trifluoromethyl)pyrimidine Chemical compound FC1=NC=C(C(F)(F)F)C(F)=N1 YXYCPKOAGWDZKX-UHFFFAOYSA-N 0.000 description 2
- FKSSZHRRUUZKCM-UHFFFAOYSA-N 2,4-difluoro-6-(trifluoromethyl)pyrimidine Chemical compound FC1=CC(C(F)(F)F)=NC(F)=N1 FKSSZHRRUUZKCM-UHFFFAOYSA-N 0.000 description 2
- ZCHHTEOFXSGDMW-UHFFFAOYSA-N 2,4-difluoro-6-phenylpyrimidine Chemical compound FC1=NC(F)=CC(C=2C=CC=CC=2)=N1 ZCHHTEOFXSGDMW-UHFFFAOYSA-N 0.000 description 2
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 2
- WKYVSKBDVIVQMM-UHFFFAOYSA-N 2-[(4-aminobenzoyl)amino]naphthalene-1,5-disulfonic acid Chemical compound C1=CC(N)=CC=C1C(=O)NC1=CC=C(C(=CC=C2)S(O)(=O)=O)C2=C1S(O)(=O)=O WKYVSKBDVIVQMM-UHFFFAOYSA-N 0.000 description 2
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 2
- MICDVUDJBHIFHA-UHFFFAOYSA-N 4-amino-2,5-dimethoxybenzenesulfonic acid Chemical compound COC1=CC(S(O)(=O)=O)=C(OC)C=C1N MICDVUDJBHIFHA-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 235000019646 color tone Nutrition 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- XXPDBLUZJRXNNZ-UHFFFAOYSA-N promethazine hydrochloride Chemical class Cl.C1=CC=C2N(CC(C)N(C)C)C3=CC=CC=C3SC2=C1 XXPDBLUZJRXNNZ-UHFFFAOYSA-N 0.000 description 2
- 239000004627 regenerated cellulose Substances 0.000 description 2
- 238000009938 salting Methods 0.000 description 2
- 238000005185 salting out Methods 0.000 description 2
- 238000010186 staining Methods 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- CVXIRTCLVZZRKV-UHFFFAOYSA-N 1,4-dichlorophthalazine-6-carbonyl chloride Chemical compound ClC1=NN=C(Cl)C2=CC(C(=O)Cl)=CC=C21 CVXIRTCLVZZRKV-UHFFFAOYSA-N 0.000 description 1
- KESAPMAPWGLLQL-UHFFFAOYSA-N 2,2,3,3-tetrafluorocyclobutane-1-carbonyl chloride Chemical compound FC1(F)CC(C(Cl)=O)C1(F)F KESAPMAPWGLLQL-UHFFFAOYSA-N 0.000 description 1
- BCOSEZGCLGPUSL-UHFFFAOYSA-N 2,3,3-trichloroprop-2-enoyl chloride Chemical compound ClC(Cl)=C(Cl)C(Cl)=O BCOSEZGCLGPUSL-UHFFFAOYSA-N 0.000 description 1
- QRXNZLRJSQBDJD-UHFFFAOYSA-N 2,3,5-tris(methylsulfonyl)pyrazine Chemical compound CS(=O)(=O)C1=CN=C(S(C)(=O)=O)C(S(C)(=O)=O)=N1 QRXNZLRJSQBDJD-UHFFFAOYSA-N 0.000 description 1
- BYVKICLDZSJHAA-UHFFFAOYSA-N 2,3-dibromoquinoxaline-6-carbonyl bromide Chemical compound N1=C(Br)C(Br)=NC2=CC(C(=O)Br)=CC=C21 BYVKICLDZSJHAA-UHFFFAOYSA-N 0.000 description 1
- NGCRLFIYVFOUMZ-UHFFFAOYSA-N 2,3-dichloroquinoxaline-6-carbonyl chloride Chemical compound N1=C(Cl)C(Cl)=NC2=CC(C(=O)Cl)=CC=C21 NGCRLFIYVFOUMZ-UHFFFAOYSA-N 0.000 description 1
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 1
- KZMWBUVUQLGBBP-UHFFFAOYSA-N 2,4,5,6-tetrafluoropyrimidine Chemical class FC1=NC(F)=C(F)C(F)=N1 KZMWBUVUQLGBBP-UHFFFAOYSA-N 0.000 description 1
- OQNKONMCYMWUGP-UHFFFAOYSA-N 2,4,5,6-tetrakis(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=NC(S(C)(=O)=O)=C(S(C)(=O)=O)C(S(C)(=O)=O)=N1 OQNKONMCYMWUGP-UHFFFAOYSA-N 0.000 description 1
- BIMGULMREAFXSC-UHFFFAOYSA-N 2,4,5-trifluoro-6-methylpyrimidine Chemical compound CC1=NC(F)=NC(F)=C1F BIMGULMREAFXSC-UHFFFAOYSA-N 0.000 description 1
- VHYBUUMUUNCHCK-UHFFFAOYSA-N 2,4,6-tribromo-1,3,5-triazine Chemical compound BrC1=NC(Br)=NC(Br)=N1 VHYBUUMUUNCHCK-UHFFFAOYSA-N 0.000 description 1
- XJNDXSGINZSFDF-UHFFFAOYSA-N 2,4,6-trichloropyrimidine-5-carbonyl chloride Chemical compound ClC(=O)C1=C(Cl)N=C(Cl)N=C1Cl XJNDXSGINZSFDF-UHFFFAOYSA-N 0.000 description 1
- LUOWQRCVEYJUJS-UHFFFAOYSA-N 2,4,6-trifluoro-5-(trifluoromethyl)pyrimidine Chemical compound FC1=NC(F)=C(C(F)(F)F)C(F)=N1 LUOWQRCVEYJUJS-UHFFFAOYSA-N 0.000 description 1
- AZVALKSFVWAVOL-UHFFFAOYSA-N 2,4,6-trifluoro-5-methylpyrimidine Chemical compound CC1=C(F)N=C(F)N=C1F AZVALKSFVWAVOL-UHFFFAOYSA-N 0.000 description 1
- CZHWBISSOIPPNL-UHFFFAOYSA-N 2,4,6-trifluoro-5-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=C(F)N=C(F)N=C1F CZHWBISSOIPPNL-UHFFFAOYSA-N 0.000 description 1
- MLLSXQLOUGEEGV-UHFFFAOYSA-N 2,4,6-trifluoro-5-nitropyrimidine Chemical compound [O-][N+](=O)C1=C(F)N=C(F)N=C1F MLLSXQLOUGEEGV-UHFFFAOYSA-N 0.000 description 1
- JOYWMWSTASJQHZ-UHFFFAOYSA-N 2,4,6-trifluoropyrimidine-5-carbonitrile Chemical compound FC1=NC(F)=C(C#N)C(F)=N1 JOYWMWSTASJQHZ-UHFFFAOYSA-N 0.000 description 1
- VAOWDUICNHWGRL-UHFFFAOYSA-N 2,4,6-tris(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=CC(S(C)(=O)=O)=NC(S(C)(=O)=O)=N1 VAOWDUICNHWGRL-UHFFFAOYSA-N 0.000 description 1
- HICXVCLBOSYEAA-UHFFFAOYSA-N 2,4-bis(benzenesulfonyl)-5-chloro-6-methylpyrimidine Chemical compound ClC=1C(C)=NC(S(=O)(=O)C=2C=CC=CC=2)=NC=1S(=O)(=O)C1=CC=CC=C1 HICXVCLBOSYEAA-UHFFFAOYSA-N 0.000 description 1
- MIVVPUZFDSCZJE-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)-1,3,5-triazine Chemical compound CS(=O)(=O)C1=NC=NC(S(C)(=O)=O)=N1 MIVVPUZFDSCZJE-UHFFFAOYSA-N 0.000 description 1
- VFVBRPVPRYWTCL-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)-6-(2,2,2-trichloroethoxy)-1,3,5-triazine Chemical compound CS(=O)(=O)C1=NC(OCC(Cl)(Cl)Cl)=NC(S(C)(=O)=O)=N1 VFVBRPVPRYWTCL-UHFFFAOYSA-N 0.000 description 1
- FNSNECVCDMIFBA-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)-6-phenoxy-1,3,5-triazine Chemical compound CS(=O)(=O)C1=NC(S(=O)(=O)C)=NC(OC=2C=CC=CC=2)=N1 FNSNECVCDMIFBA-UHFFFAOYSA-N 0.000 description 1
- CVXWQOAPKWGRTD-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)pyrimidine-5-sulfonyl chloride Chemical compound CS(=O)(=O)C1=NC=C(S(Cl)(=O)=O)C(S(C)(=O)=O)=N1 CVXWQOAPKWGRTD-UHFFFAOYSA-N 0.000 description 1
- YWURJMDYDBXTLA-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)quinazoline Chemical compound C1=CC=CC2=NC(S(=O)(=O)C)=NC(S(C)(=O)=O)=C21 YWURJMDYDBXTLA-UHFFFAOYSA-N 0.000 description 1
- ASVUGJYHCBOWLZ-UHFFFAOYSA-N 2,4-bis(trichloromethylsulfonyl)quinoline Chemical compound C1=CC=CC2=NC(S(=O)(=O)C(Cl)(Cl)Cl)=CC(S(=O)(=O)C(Cl)(Cl)Cl)=C21 ASVUGJYHCBOWLZ-UHFFFAOYSA-N 0.000 description 1
- BTTNYQZNBZNDOR-UHFFFAOYSA-N 2,4-dichloropyrimidine Chemical class ClC1=CC=NC(Cl)=N1 BTTNYQZNBZNDOR-UHFFFAOYSA-N 0.000 description 1
- DZTIFMWYYHCREC-UHFFFAOYSA-N 2,4-dichloropyrimidine-5-carbonyl chloride Chemical compound ClC(=O)C1=CN=C(Cl)N=C1Cl DZTIFMWYYHCREC-UHFFFAOYSA-N 0.000 description 1
- NIAMELKDNLLWRH-UHFFFAOYSA-N 2,4-difluoro-5-methylpyrimidine Chemical compound CC1=CN=C(F)N=C1F NIAMELKDNLLWRH-UHFFFAOYSA-N 0.000 description 1
- GJOGRJUICNPNSV-UHFFFAOYSA-N 2,4-difluoro-5-phenylpyrimidine Chemical compound FC1=NC(F)=NC=C1C1=CC=CC=C1 GJOGRJUICNPNSV-UHFFFAOYSA-N 0.000 description 1
- YKLOPWRWWFKUBX-UHFFFAOYSA-N 2,4-difluoro-6-methylpyrimidine Chemical compound CC1=CC(F)=NC(F)=N1 YKLOPWRWWFKUBX-UHFFFAOYSA-N 0.000 description 1
- AOSHQVWIJNXEMB-UHFFFAOYSA-N 2,4-difluoropyrimidine-5-carbonitrile Chemical compound FC1=NC=C(C#N)C(F)=N1 AOSHQVWIJNXEMB-UHFFFAOYSA-N 0.000 description 1
- YSKSNCNLMXAQLP-UHFFFAOYSA-N 2,6-bis(methylsulfonyl)pyridine-4-carbonyl chloride Chemical compound CS(=O)(=O)C1=CC(C(Cl)=O)=CC(S(C)(=O)=O)=N1 YSKSNCNLMXAQLP-UHFFFAOYSA-N 0.000 description 1
- YZRMBOOBRWRVJU-UHFFFAOYSA-N 2,6-bis(methylsulfonyl)pyrimidine-4-carbonyl chloride Chemical compound CS(=O)(=O)C1=CC(C(Cl)=O)=NC(S(C)(=O)=O)=N1 YZRMBOOBRWRVJU-UHFFFAOYSA-N 0.000 description 1
- PLVFHLAXDQSLCL-UHFFFAOYSA-N 2,6-dichloro-1h-triazin-4-amine Chemical compound NC1=NN(Cl)NC(Cl)=C1 PLVFHLAXDQSLCL-UHFFFAOYSA-N 0.000 description 1
- AMBBZHXGKGNTMI-UHFFFAOYSA-N 2,6-dichloro-4-ethoxy-1h-triazine Chemical compound CCOC1=NN(Cl)NC(Cl)=C1 AMBBZHXGKGNTMI-UHFFFAOYSA-N 0.000 description 1
- NNZQKAANXSXDNP-UHFFFAOYSA-N 2,6-dichloro-4-ethylsulfanyl-1h-triazine Chemical compound CCSC1=NN(Cl)NC(Cl)=C1 NNZQKAANXSXDNP-UHFFFAOYSA-N 0.000 description 1
- IOXIFBCDVPDGJV-UHFFFAOYSA-N 2,6-dichloro-4-methoxy-1h-triazine Chemical compound COC1=NN(Cl)NC(Cl)=C1 IOXIFBCDVPDGJV-UHFFFAOYSA-N 0.000 description 1
- BHAFVZAFEVCQGJ-UHFFFAOYSA-N 2,6-dichloro-4-phenylsulfanyl-1h-triazine Chemical compound ClN1NC(Cl)=CC(SC=2C=CC=CC=2)=N1 BHAFVZAFEVCQGJ-UHFFFAOYSA-N 0.000 description 1
- CTSJEGLSMYPRJK-UHFFFAOYSA-N 2,6-dichloro-n-methyl-1h-triazin-4-amine Chemical compound CNC1=NN(Cl)NC(Cl)=C1 CTSJEGLSMYPRJK-UHFFFAOYSA-N 0.000 description 1
- WULMCOUFBKKFQE-UHFFFAOYSA-N 2,6-dichloro-n-phenyl-1h-triazin-4-amine Chemical compound ClN1NC(Cl)=CC(NC=2C=CC=CC=2)=N1 WULMCOUFBKKFQE-UHFFFAOYSA-N 0.000 description 1
- WFJGZGDYFGUMCA-UHFFFAOYSA-N 2,6-difluoropyrimidine-4-carbonitrile Chemical compound FC1=CC(C#N)=NC(F)=N1 WFJGZGDYFGUMCA-UHFFFAOYSA-N 0.000 description 1
- IDDLHNUKISKRRT-UHFFFAOYSA-N 2-(4-chloro-6-methylpyrimidin-2-yl)sulfonylethanesulfonic acid Chemical compound CC1=CC(Cl)=NC(S(=O)(=O)CCS(O)(=O)=O)=N1 IDDLHNUKISKRRT-UHFFFAOYSA-N 0.000 description 1
- FAUYZTIBIRCNPZ-UHFFFAOYSA-N 2-(benzenesulfonyl)-4,5-dichloro-6-methylpyrimidine Chemical compound ClC1=C(Cl)C(C)=NC(S(=O)(=O)C=2C=CC=CC=2)=N1 FAUYZTIBIRCNPZ-UHFFFAOYSA-N 0.000 description 1
- IJXOQDQYOMRDSO-UHFFFAOYSA-N 2-(benzenesulfonyl)-4,5-dichloropyrimidine Chemical compound N1=C(Cl)C(Cl)=CN=C1S(=O)(=O)C1=CC=CC=C1 IJXOQDQYOMRDSO-UHFFFAOYSA-N 0.000 description 1
- GSCQMQCAMLKDEI-UHFFFAOYSA-N 2-(benzenesulfonyl)-4-chloropyrimidine Chemical compound ClC1=CC=NC(S(=O)(=O)C=2C=CC=CC=2)=N1 GSCQMQCAMLKDEI-UHFFFAOYSA-N 0.000 description 1
- ZYVDXPBGWGSPGT-UHFFFAOYSA-N 2-chloro-4-methylpyrimidine-5-carbonyl chloride Chemical compound CC1=NC(Cl)=NC=C1C(Cl)=O ZYVDXPBGWGSPGT-UHFFFAOYSA-N 0.000 description 1
- ZXTHWIZHGLNEPG-UHFFFAOYSA-N 2-phenyl-4,5-dihydro-1,3-oxazole Chemical compound O1CCN=C1C1=CC=CC=C1 ZXTHWIZHGLNEPG-UHFFFAOYSA-N 0.000 description 1
- CTSAKABLTRMUQJ-UHFFFAOYSA-N 2-sulfonyl-3h-1,3-benzothiazole Chemical class C1=CC=C2SC(=S(=O)=O)NC2=C1 CTSAKABLTRMUQJ-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 description 1
- MMMMMCGTIBEFTA-UHFFFAOYSA-N 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carbonyl chloride Chemical compound CS(=O)(=O)C1=NSC(S(C)(=O)=O)=C1C(Cl)=O MMMMMCGTIBEFTA-UHFFFAOYSA-N 0.000 description 1
- QTAGZDNCORZVNJ-UHFFFAOYSA-N 3,6-bis(trichloromethylsulfonyl)pyridazine Chemical compound ClC(Cl)(Cl)S(=O)(=O)C1=CC=C(S(=O)(=O)C(Cl)(Cl)Cl)N=N1 QTAGZDNCORZVNJ-UHFFFAOYSA-N 0.000 description 1
- QPZGKMLYCRNKCK-UHFFFAOYSA-N 3-(benzenesulfonyl)propanoyl chloride Chemical compound ClC(=O)CCS(=O)(=O)C1=CC=CC=C1 QPZGKMLYCRNKCK-UHFFFAOYSA-N 0.000 description 1
- NVLVJHQJUHUFAC-UHFFFAOYSA-N 3-aminobenzene-1,2-disulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1S(O)(=O)=O NVLVJHQJUHUFAC-UHFFFAOYSA-N 0.000 description 1
- LGRADEJSUVWVBW-UHFFFAOYSA-N 3-bromoquinoxaline-6-carbonyl bromide Chemical compound N1=CC(Br)=NC2=CC(C(=O)Br)=CC=C21 LGRADEJSUVWVBW-UHFFFAOYSA-N 0.000 description 1
- BUHGCLPAHGFCLE-UHFFFAOYSA-N 3-chloro-6-methylsulfonylpyridazine Chemical compound CS(=O)(=O)C1=CC=C(Cl)N=N1 BUHGCLPAHGFCLE-UHFFFAOYSA-N 0.000 description 1
- INUNLMUAPJVRME-UHFFFAOYSA-N 3-chloropropanoyl chloride Chemical compound ClCCC(Cl)=O INUNLMUAPJVRME-UHFFFAOYSA-N 0.000 description 1
- QIMCIIVGSIZXFU-UHFFFAOYSA-N 3-chloroquinoxaline-2-carbonyl chloride Chemical compound C1=CC=C2N=C(Cl)C(C(=O)Cl)=NC2=C1 QIMCIIVGSIZXFU-UHFFFAOYSA-N 0.000 description 1
- CGIHHZTTZZMCRK-UHFFFAOYSA-N 3-chloroquinoxaline-6-carbonyl chloride Chemical compound N1=CC(Cl)=NC2=CC(C(=O)Cl)=CC=C21 CGIHHZTTZZMCRK-UHFFFAOYSA-N 0.000 description 1
- MNRJWEIGUPDQQW-UHFFFAOYSA-N 3-ethylsulfonylpropanoyl chloride Chemical compound CCS(=O)(=O)CCC(Cl)=O MNRJWEIGUPDQQW-UHFFFAOYSA-N 0.000 description 1
- ZRPJLDDUZPWQGQ-UHFFFAOYSA-N 4,5-dichloro-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=NC(Cl)=C(Cl)C(S(C)(=O)=O)=N1 ZRPJLDDUZPWQGQ-UHFFFAOYSA-N 0.000 description 1
- TVFFVYDLWNCZBH-UHFFFAOYSA-N 4,5-dichloro-2-ethylsulfonyl-6-methylpyrimidine Chemical compound CCS(=O)(=O)C1=NC(C)=C(Cl)C(Cl)=N1 TVFFVYDLWNCZBH-UHFFFAOYSA-N 0.000 description 1
- KMFAWGFSESRBPG-UHFFFAOYSA-N 4,5-dichloro-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC=C(Cl)C(Cl)=N1 KMFAWGFSESRBPG-UHFFFAOYSA-N 0.000 description 1
- YJPYVNMIARMZEK-UHFFFAOYSA-N 4,5-dichloro-6-(chloromethyl)-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC(Cl)=C(Cl)C(CCl)=N1 YJPYVNMIARMZEK-UHFFFAOYSA-N 0.000 description 1
- NZXOCWXWWQNPOF-UHFFFAOYSA-N 4,5-dichloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1Cl NZXOCWXWWQNPOF-UHFFFAOYSA-N 0.000 description 1
- FBDGJZXFKQZWLX-UHFFFAOYSA-N 4,6-bis(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=CC(S(C)(=O)=O)=NC=N1 FBDGJZXFKQZWLX-UHFFFAOYSA-N 0.000 description 1
- DROUVIKCNOHKBA-UHFFFAOYSA-N 4,6-dichloro-2-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=NC(Cl)=CC(Cl)=N1 DROUVIKCNOHKBA-UHFFFAOYSA-N 0.000 description 1
- SLCUSSPKUGKMGA-UHFFFAOYSA-N 4-bromo-2,6-difluoropyrimidine Chemical compound FC1=CC(Br)=NC(F)=N1 SLCUSSPKUGKMGA-UHFFFAOYSA-N 0.000 description 1
- ZRWALVBIVUPROW-UHFFFAOYSA-N 4-chloro-2,6-bis(methylsulfonyl)pyrimidine-5-carbonyl chloride Chemical compound CS(=O)(=O)C1=NC(Cl)=C(C(Cl)=O)C(S(C)(=O)=O)=N1 ZRWALVBIVUPROW-UHFFFAOYSA-N 0.000 description 1
- VJMKIDUNVPFBOB-UHFFFAOYSA-N 4-chloro-2,6-difluoro-5-methylpyrimidine Chemical compound CC1=C(F)N=C(F)N=C1Cl VJMKIDUNVPFBOB-UHFFFAOYSA-N 0.000 description 1
- POWFLCAWHSPOHP-UHFFFAOYSA-N 4-chloro-2-methylpyrimidine-5-carbonyl chloride Chemical compound CC1=NC=C(C(Cl)=O)C(Cl)=N1 POWFLCAWHSPOHP-UHFFFAOYSA-N 0.000 description 1
- YKMVEIGVJFBXDC-UHFFFAOYSA-N 4-chloro-2-methylsulfonylpyrimidine-5-carboxylic acid Chemical compound CS(=O)(=O)C1=NC=C(C(O)=O)C(Cl)=N1 YKMVEIGVJFBXDC-UHFFFAOYSA-N 0.000 description 1
- VKWPQCFXZKWBJR-UHFFFAOYSA-N 4-chloro-5,6-dimethyl-2-methylsulfonylpyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(Cl)=C1C VKWPQCFXZKWBJR-UHFFFAOYSA-N 0.000 description 1
- OLOLDTJCNAOMQJ-UHFFFAOYSA-N 4-chloro-6-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=CC(Cl)=NC(S(C)(=O)=O)=N1 OLOLDTJCNAOMQJ-UHFFFAOYSA-N 0.000 description 1
- LNJVTFNEAPYZIU-UHFFFAOYSA-N 4-chloro-6-methylsulfonylpyrimidine Chemical compound CS(=O)(=O)C1=CC(Cl)=NC=N1 LNJVTFNEAPYZIU-UHFFFAOYSA-N 0.000 description 1
- UYCCTQPHCSKTTN-UHFFFAOYSA-N 4-methyl-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CC1=CC(S(C)(=O)=O)=NC(S(C)(=O)=O)=N1 UYCCTQPHCSKTTN-UHFFFAOYSA-N 0.000 description 1
- WZAGWFIDIMWLIY-UHFFFAOYSA-N 4-methyl-3,6-bis(methylsulfonyl)pyridazine Chemical compound CC1=CC(S(C)(=O)=O)=NN=C1S(C)(=O)=O WZAGWFIDIMWLIY-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- ZBTCTILYGQNVOJ-UHFFFAOYSA-N 5-bromo-2,4-difluoro-6-methylpyrimidine Chemical compound CC1=NC(F)=NC(F)=C1Br ZBTCTILYGQNVOJ-UHFFFAOYSA-N 0.000 description 1
- RQYBTXRFJGTRFK-UHFFFAOYSA-N 5-chloro-2,4,6-trifluoro-1-methyl-2h-pyrimidine Chemical compound CN1C(F)N=C(F)C(Cl)=C1F RQYBTXRFJGTRFK-UHFFFAOYSA-N 0.000 description 1
- GOYNRDSJTYLXBU-UHFFFAOYSA-N 5-chloro-2,4,6-trifluoropyrimidine Chemical compound FC1=NC(F)=C(Cl)C(F)=N1 GOYNRDSJTYLXBU-UHFFFAOYSA-N 0.000 description 1
- HLWJZTCAFDZNCD-UHFFFAOYSA-N 5-chloro-2,4,6-tris(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=NC(S(C)(=O)=O)=C(Cl)C(S(C)(=O)=O)=N1 HLWJZTCAFDZNCD-UHFFFAOYSA-N 0.000 description 1
- GNDKYGCYDWCLHH-UHFFFAOYSA-N 5-chloro-2,4-bis(methylsulfonyl)pyrimidine Chemical compound CS(=O)(=O)C1=NC=C(Cl)C(S(C)(=O)=O)=N1 GNDKYGCYDWCLHH-UHFFFAOYSA-N 0.000 description 1
- LTRDQYKIIGULAQ-UHFFFAOYSA-N 5-chloro-2,4-difluoro-6-(trifluoromethyl)pyrimidine Chemical compound FC1=NC(F)=C(Cl)C(C(F)(F)F)=N1 LTRDQYKIIGULAQ-UHFFFAOYSA-N 0.000 description 1
- RMULVUFPLMJWOK-UHFFFAOYSA-N 5-chloro-2,4-difluoro-6-methylpyrimidine Chemical compound CC1=NC(F)=NC(F)=C1Cl RMULVUFPLMJWOK-UHFFFAOYSA-N 0.000 description 1
- XZSZSTCLQANXKU-UHFFFAOYSA-N 5-chloro-2,4-difluoropyrimidine Chemical compound FC1=NC=C(Cl)C(F)=N1 XZSZSTCLQANXKU-UHFFFAOYSA-N 0.000 description 1
- FCMIDLUGAKOJNR-UHFFFAOYSA-N 5-chloro-4-methyl-2,6-bis(methylsulfonyl)pyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC(S(C)(=O)=O)=C1Cl FCMIDLUGAKOJNR-UHFFFAOYSA-N 0.000 description 1
- 125000004008 6 membered carbocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- LBHNEMHEEUVVHG-UHFFFAOYSA-N 7-[(4-aminobenzoyl)amino]naphthalene-1,3-disulfonic acid Chemical compound C1=CC(N)=CC=C1C(=O)NC1=CC=C(C=C(C=C2S(O)(=O)=O)S(O)(=O)=O)C2=C1 LBHNEMHEEUVVHG-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 241000208202 Linaceae Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- GEKOHRZGXRUJIN-UHFFFAOYSA-N chloromethane;sulfurochloridic acid Chemical compound ClC.OS(Cl)(=O)=O GEKOHRZGXRUJIN-UHFFFAOYSA-N 0.000 description 1
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical class [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-O hydrazinium(1+) Chemical compound [NH3+]N OAKJQQAXSVQMHS-UHFFFAOYSA-O 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- YSEQKGHEMQCJCC-UHFFFAOYSA-N methyl 2,6-difluoropyrimidine-4-carboxylate Chemical compound COC(=O)C1=CC(F)=NC(F)=N1 YSEQKGHEMQCJCC-UHFFFAOYSA-N 0.000 description 1
- YIROBCYPXUTGAN-UHFFFAOYSA-N methyl 5-chloro-2,6-difluoropyrimidine-4-carboxylate Chemical compound COC(=O)C1=NC(F)=NC(F)=C1Cl YIROBCYPXUTGAN-UHFFFAOYSA-N 0.000 description 1
- FSQBCNBFHWRUGG-UHFFFAOYSA-N methyl 6-chloro-2-methylsulfonylpyrimidine-4-carboxylate Chemical compound COC(=O)C1=CC(Cl)=NC(S(C)(=O)=O)=N1 FSQBCNBFHWRUGG-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical group 0.000 description 1
- PLXPTFQGYWXIEA-UHFFFAOYSA-N nitroformonitrile Chemical compound [O-][N+](=O)C#N PLXPTFQGYWXIEA-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- REEZZSHJLXOIHL-UHFFFAOYSA-N octanoyl chloride Chemical compound CCCCCCCC(Cl)=O REEZZSHJLXOIHL-UHFFFAOYSA-N 0.000 description 1
- RDOWQLZANAYVLL-UHFFFAOYSA-N phenanthrridine Natural products C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920006306 polyurethane fiber Polymers 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000002893 slag Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- SEEPANYCNGTZFQ-UHFFFAOYSA-N sulfadiazine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=NC=CC=N1 SEEPANYCNGTZFQ-UHFFFAOYSA-N 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/002—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the linkage of the reactive group being alternatively specified
- C09B62/006—Azodyes
- C09B62/008—Monoazo dyes
- C09B62/0086—Monoazo dyes with coupling component containing a reactive methylene group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722201280 DE2201280A1 (de) | 1972-01-12 | 1972-01-12 | Wasserloesliche reaktivfarbstoffe der monoazoreihe und verfahren zu ihrer herstellung |
| DE2201280.2 | 1972-01-12 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS4880877A JPS4880877A (enExample) | 1973-10-29 |
| JPS6011065B2 true JPS6011065B2 (ja) | 1985-03-22 |
Family
ID=5832796
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP48005364A Expired JPS6011065B2 (ja) | 1972-01-12 | 1973-01-10 | モノアゾ系の水溶性反応性染料の製法 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3957751A (enExample) |
| JP (1) | JPS6011065B2 (enExample) |
| AR (1) | AR193312A1 (enExample) |
| BR (1) | BR7300222D0 (enExample) |
| CH (1) | CH582738A5 (enExample) |
| DE (1) | DE2201280A1 (enExample) |
| FR (1) | FR2168022B1 (enExample) |
| GB (1) | GB1406913A (enExample) |
| IN (1) | IN139721B (enExample) |
| IT (1) | IT978096B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2807260C2 (de) * | 1978-02-21 | 1986-10-09 | Hoechst Ag, 6230 Frankfurt | Wasserlösliche Farbstoffe, Verfahren zu deren Herstellung, ihre Verwendung als faserreaktive Farbstoffe zum Färben und Bedrucken von Fasermaterialien |
| US4301071A (en) * | 1979-12-05 | 1981-11-17 | Eastman Kodak Company | Azo dyes from aniline having 1 or 2 sulfated hydroxyalkoxycarbonyl or N-(hydroxyalkyl)carbamoyl groups on its ring |
| US4301068A (en) * | 1979-12-05 | 1981-11-17 | Eastman Kodak Company | Azo dyes from a 2-aminothiophene having 1 or 2 sulfated hydroxyalkoxycarbonyl or N-(hydrocyalkyl) carbamoyl groups on its ring |
| US4302390A (en) * | 1979-12-05 | 1981-11-24 | Eastman Kodak Company | Azo dyes with sulfate groups on the diazotized 2-amino thiazol and 5-amino isothiazol moiety and with aniline, tetrahydroquinoline and benzomorpholine couplers |
| US4301070A (en) * | 1979-12-05 | 1981-11-17 | Eastman Kodak Company | Azo dyes from a 5-aminopyrazole bearing 1 to 2 sulfated hydroxyalkoxycarbonyl or N-(hydroxyalkyl) carbamoyl groups on its ring |
| US4302387A (en) * | 1979-12-05 | 1981-11-24 | Eastman Kodak Company | Azo dyes from 1,3,4-thiadiazol-2-yl and 1,2,4-thiadiazol-5-yl moieties bearing sulfated hydroxyalkoxycarbonyl or N-(hydroxyalkyl)carbamoyl groups on their rings |
| US4374769A (en) * | 1981-06-17 | 1983-02-22 | Eastman Kodak Company | Water-soluble tris phenyl bisazo dyes for polyamide fibers |
| DE3372292D1 (en) * | 1982-12-20 | 1987-08-06 | Ciba Geigy Ag | Reactive dyes, their preparation and their use |
| US5182275A (en) * | 1987-07-13 | 1993-01-26 | Hoechst-Roussel Pharmaceuticals Incorporated | Dihydro-4(hydroxyalkyeneamino)quinolines |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2670265A (en) * | 1954-02-23 | Process | ||
| US2211339A (en) * | 1939-04-15 | 1940-08-13 | Eastman Kodak Co | Azo compounds and material colored therewith |
| US2556743A (en) * | 1948-07-16 | 1951-06-12 | American Cyanamid Co | Metallized azo dyes |
| US2863860A (en) * | 1955-06-29 | 1958-12-09 | Ici Ltd | New monoazo compounds |
| US2969351A (en) * | 1957-03-11 | 1961-01-24 | Durand & Huguenin Ag | New metalliferous ortho:ortho'-dihydroxy-monoazo-dyestuffs |
| DE1262475B (de) * | 1962-02-08 | 1968-03-07 | Hoechst Ag | Verfahren zur Herstellung von organischen Farbstoffen |
| DE1280448B (de) * | 1962-10-03 | 1968-10-17 | Hoechst Ag | Verfahren zur Herstellung von Azofarbstoffen |
| DE1291036B (de) * | 1964-02-28 | 1969-03-20 | Hoechst Ag | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen |
| FR1470022A (fr) * | 1966-02-24 | 1967-02-17 | Nouveaux colorants azoïques, leur production et applications | |
| DE1644157C3 (de) * | 1966-05-03 | 1975-04-24 | Farbwerke Hoechst Ag Vormals Meister Lucius & Bruening, 6000 Frankfurt | Wasserlösliche Monoazoreaktivfarbstoffe und Verfahren zur Herstellung dieser Farbstoffe |
| US3655642A (en) * | 1968-08-24 | 1972-04-11 | Hoechst Ag | Water-soluble monoazo dyestuffs containing a naphthalene diazo component |
| CS153538B2 (enExample) * | 1969-03-10 | 1974-02-25 |
-
1972
- 1972-01-12 DE DE19722201280 patent/DE2201280A1/de active Pending
-
1973
- 1973-01-09 IN IN65/CAL/73A patent/IN139721B/en unknown
- 1973-01-10 CH CH28873A patent/CH582738A5/xx not_active IP Right Cessation
- 1973-01-10 AR AR246055A patent/AR193312A1/es active
- 1973-01-10 JP JP48005364A patent/JPS6011065B2/ja not_active Expired
- 1973-01-10 US US05/322,374 patent/US3957751A/en not_active Expired - Lifetime
- 1973-01-10 IT IT19136/73A patent/IT978096B/it active
- 1973-01-11 BR BR73222A patent/BR7300222D0/pt unknown
- 1973-01-11 GB GB155973A patent/GB1406913A/en not_active Expired
- 1973-01-12 FR FR7301056A patent/FR2168022B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2168022B1 (enExample) | 1976-11-05 |
| FR2168022A1 (enExample) | 1973-08-24 |
| DE2201280A1 (de) | 1973-07-19 |
| JPS4880877A (enExample) | 1973-10-29 |
| IN139721B (enExample) | 1976-07-24 |
| GB1406913A (en) | 1975-09-17 |
| AR193312A1 (es) | 1973-04-11 |
| IT978096B (it) | 1974-09-20 |
| US3957751A (en) | 1976-05-18 |
| CH582738A5 (enExample) | 1976-12-15 |
| BR7300222D0 (pt) | 1973-09-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS603109B2 (ja) | 新規な反応性染料及びその製法 | |
| JP4099230B2 (ja) | アミノナフタレンスルホン酸カップリング成分を有する反応性アゾ染料及びその中間体 | |
| JPH0251565A (ja) | アゾ染料 | |
| JPH05125288A (ja) | 反応性アゾ染料 | |
| US3518245A (en) | Azo dyestuffs and their metal complex compounds | |
| JPS6147177B2 (enExample) | ||
| JPS6011065B2 (ja) | モノアゾ系の水溶性反応性染料の製法 | |
| JPS5930859A (ja) | モノアゾ染料,その製法及び用途 | |
| US4801693A (en) | Substituted sulfobenzene and triazine-containing reactive dyes | |
| US4089895A (en) | 1-Amino-4-methoxybenzene-2,5-disulfonic acid | |
| US3625935A (en) | 1:2-chromium complexes of a monoazo dyestuff and a disazo dyestuff | |
| US3202650A (en) | Metal-containing reactive azo dyes | |
| US4067864A (en) | Fiber-reactive 2-hydroxy-pyrid-6-on-(3)-yl azo dyestuffs | |
| JPH0244862B2 (enExample) | ||
| US5175263A (en) | Water-soluble azo compounds, having a fiber-reactive group of the vinylsulfone series in the diazo component and having a phenoxy- or aralkyloxy-substituted chloro-s-triazinylamino-naphthol sulfonic acid coupling component, suitable as dyestuffs | |
| JPH06220348A (ja) | 繊維反応性染料 | |
| JPH07113090B2 (ja) | 水溶性着色化合物及び該化合物を染料として使用する方法 | |
| US4092308A (en) | 4-Sulphomethyl substituted hydroxypyridone azo dyestuffs | |
| JPS6353231B2 (enExample) | ||
| US3870695A (en) | Heavy metal complexes of azo dyestuffs containing a 2-amino-3-hydroxypyridine as coupling component | |
| US4210582A (en) | Water-soluble pyrazolone-imide containing azo dyestuffs | |
| US3869440A (en) | Metal-complex azo dyestuffs containing a 5-substituted-2,3-dihydroxypyridine as coupling component | |
| US2910464A (en) | Triazine monoazo-dyestuffs | |
| JPS6019342B2 (ja) | 反応性染料及びその製造法 | |
| US3126369A (en) | Oh nhxr |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A02 | Decision of refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A02 Effective date: 19820817 |