JPS5777651A - Indane derivative and its preparation - Google Patents
Indane derivative and its preparationInfo
- Publication number
- JPS5777651A JPS5777651A JP55154394A JP15439480A JPS5777651A JP S5777651 A JPS5777651 A JP S5777651A JP 55154394 A JP55154394 A JP 55154394A JP 15439480 A JP15439480 A JP 15439480A JP S5777651 A JPS5777651 A JP S5777651A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- formulai
- lower alkyl
- reducing conditions
- indane derivative
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 125000003392 indanyl group Chemical class C1(CCC2=CC=CC=C12)* 0.000 title 1
- 102000004190 Enzymes Human genes 0.000 abstract 2
- 108090000790 Enzymes Proteins 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- 101800004538 Bradykinin Proteins 0.000 abstract 1
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 abstract 1
- 206010020772 Hypertension Diseases 0.000 abstract 1
- 102100035792 Kininogen-1 Human genes 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 229940039227 diagnostic agent Drugs 0.000 abstract 1
- 239000000032 diagnostic agent Substances 0.000 abstract 1
- 229960001269 glycine hydrochloride Drugs 0.000 abstract 1
- -1 hydride compound Chemical class 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- 150000002468 indanes Chemical class 0.000 abstract 1
- 230000002401 inhibitory effect Effects 0.000 abstract 1
- 231100000053 low toxicity Toxicity 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 239000003960 organic solvent Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract 1
Landscapes
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Peptides Or Proteins (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (34)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP55154394A JPS5777651A (en) | 1980-10-31 | 1980-10-31 | Indane derivative and its preparation |
| AU76521/81A AU543804B2 (en) | 1980-10-31 | 1981-10-16 | Amides having bicyclic substituents on nitrogen |
| US06/312,639 US4822818A (en) | 1980-10-31 | 1981-10-19 | Bicycle compounds, their production and use |
| ZA817253A ZA817253B (en) | 1980-10-31 | 1981-10-20 | Bicyclic compounds,their production and use |
| DE8181304940T DE3165862D1 (en) | 1980-10-31 | 1981-10-21 | Bicyclic compounds, their production and use |
| AT81304940T ATE9220T1 (de) | 1980-10-31 | 1981-10-21 | Bizyklische verbindungen, ihre herstellung und verwendung. |
| EP81304940A EP0051391B1 (en) | 1980-10-31 | 1981-10-21 | Bicyclic compounds, their production and use |
| IE2471/81A IE51918B1 (en) | 1980-10-31 | 1981-10-21 | Bicyclic compounds their production and use |
| GB8131719A GB2086393B (en) | 1980-10-31 | 1981-10-21 | Bicyclic compounds |
| FI813383A FI73698C (fi) | 1980-10-31 | 1981-10-28 | Foerfarande foer framstaellning av nya farmaceutiskt verksamma n-indanylglycinderivat. |
| PH26409A PH18357A (en) | 1980-10-31 | 1981-10-28 | Bicyclic compounds,their production and use |
| DK478181A DK164917C (da) | 1980-10-31 | 1981-10-29 | Analogifremgangsmaade til fremstilling af bicyklisk substituerede dipeptidderivater og deres farmaceutisk acceptable salte |
| MX7586A MX154997A (es) | 1980-10-31 | 1981-10-29 | Procedimiento para preparar compuestos biciclicos |
| NO813662A NO155133C (no) | 1980-10-31 | 1981-10-29 | Analogifremgangsmaate for fremstilling av terapeutisk virksomme dicykliske forbindelser. |
| HU813176A HU183652B (en) | 1980-10-31 | 1981-10-29 | Process for preparing bicyclic compounds |
| GR66380A GR75368B (enExample) | 1980-10-31 | 1981-10-29 | |
| SU813350151A SU1271372A3 (ru) | 1980-10-31 | 1981-10-29 | Способ получени бициклического соединени или его фармацевтически приемлемых солей |
| CA000389042A CA1287444C (en) | 1980-10-31 | 1981-10-29 | Bicyclic compounds, their production and use |
| KR1019810004142A KR880000890B1 (ko) | 1980-10-31 | 1981-10-29 | 두고리 화합물의 제조방법 |
| IL64168A IL64168A0 (en) | 1980-10-31 | 1981-10-30 | Carboxamidoindan and naphthalene derivatives,their production and pharmaceutical compositions containing them |
| ES506714A ES8306710A1 (es) | 1980-10-31 | 1981-10-30 | Un procedimiento para obtener compuestos biciclicos |
| NZ198826A NZ198826A (en) | 1980-10-31 | 1981-10-30 | Bicyclic compounds and pharmaceutical compositions |
| PT73912A PT73912B (en) | 1980-10-31 | 1981-10-30 | Bicyclic compounds their production and use |
| ES515269A ES515269A0 (es) | 1980-10-31 | 1982-08-26 | Un procedimiento para obtener compuestos biciclicos derivados del indano o benzociclohexano. |
| US06/494,061 US4474692A (en) | 1980-10-31 | 1983-05-12 | L-Alanyl-N-(indan-2-yl)glycine, its esters and salts thereof |
| ES524148A ES524148A0 (es) | 1980-10-31 | 1983-07-15 | Un procedimiento para obtener compuestos biciclicos derivados del indano o benzociclohexano |
| PH29829A PH21390A (en) | 1980-10-31 | 1983-10-12 | Process for producing l-alanyl-n-(indian-2-yl)glycine derivatives |
| CA000468185A CA1287446C (en) | 1980-10-31 | 1984-11-19 | Bicyclic compounds, their production and use |
| MY500/85A MY8500500A (en) | 1980-10-31 | 1985-12-30 | Bicyclic compounds their production and use |
| NO862859A NO157103C (no) | 1980-10-31 | 1986-07-15 | Analogifremgangsmÿte for fremstilling av terapeutisk virksomme dicykliske forbindelser. |
| KR1019860009085A KR880001007B1 (ko) | 1980-10-31 | 1986-10-29 | 비사이클릭 화합물의 제조 방법 |
| HK198/87A HK19887A (en) | 1980-10-31 | 1987-03-05 | Bicyclic compounds their production and use |
| MX661087A MX6610A (es) | 1980-10-31 | 1987-05-22 | Compuestos biciclicos y procedimiento para su preparacion |
| US07/302,940 US5098892A (en) | 1980-10-31 | 1989-01-30 | Process for preparation of bicyclic compounds |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP55154394A JPS5777651A (en) | 1980-10-31 | 1980-10-31 | Indane derivative and its preparation |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5777651A true JPS5777651A (en) | 1982-05-15 |
| JPS6212800B2 JPS6212800B2 (enExample) | 1987-03-20 |
Family
ID=15583174
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP55154394A Granted JPS5777651A (en) | 1980-10-31 | 1980-10-31 | Indane derivative and its preparation |
Country Status (4)
| Country | Link |
|---|---|
| JP (1) | JPS5777651A (enExample) |
| MX (1) | MX6610A (enExample) |
| SU (1) | SU1271372A3 (enExample) |
| ZA (1) | ZA817253B (enExample) |
-
1980
- 1980-10-31 JP JP55154394A patent/JPS5777651A/ja active Granted
-
1981
- 1981-10-20 ZA ZA817253A patent/ZA817253B/xx unknown
- 1981-10-29 SU SU813350151A patent/SU1271372A3/ru active
-
1987
- 1987-05-22 MX MX661087A patent/MX6610A/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA817253B (en) | 1982-09-29 |
| MX6610A (es) | 1993-11-01 |
| JPS6212800B2 (enExample) | 1987-03-20 |
| SU1271372A3 (ru) | 1986-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ATE87473T1 (de) | Arzneimittel zur inhibition von hautfalte. | |
| JPS5759894A (en) | Cephalosporin for oral administration | |
| JPS5777651A (en) | Indane derivative and its preparation | |
| JPS5697266A (en) | Proline derivative and its preparation | |
| JPS57118563A (en) | Indole derivative and preparation of peptide | |
| JPS5716852A (en) | Nitrile derivative, its preparation, and fibrosis suppressing agent containing the same | |
| JPS57192340A (en) | Isoprenylamine derivative | |
| JPS57123157A (en) | Indane derivative and its preparation | |
| JPS56104883A (en) | Novel pyridinecarboxamide derivative and its preparation | |
| JPS5649373A (en) | N-((4-thiazolidinyl)carbonyl)amino acid derivative | |
| JPS55147257A (en) | Pyroglutamic acid derivative, its preparation and pharmaceutical composition containing it as effective component | |
| JPS55151555A (en) | Proline derivatives and their production | |
| JPS55133343A (en) | Thiopronine derivative | |
| JPS5782314A (en) | Carcinostatic agent | |
| ES8304924A1 (es) | Un procedimiento para la preparacion de nuevos derivados del acido glutamil-diaminopimelico que contiene una b-lactama. | |
| ES8303297A1 (es) | Un procedimiento para la preparacion de un nuevo reptido activo. | |
| JPS55145669A (en) | 8,10-diazaprostanoic acid derivative and its preparation | |
| JPS56158753A (en) | Kyotorphin derivative | |
| JPS5412369A (en) | Preparation of thienylacetic acid | |
| JPS57122041A (en) | Phenylclohexane derivative | |
| JPS57183757A (en) | 5-oxopyrrolidine derivative, antiulcer comprising it as active ingredient, and its preparation | |
| JPS57203050A (en) | Alicyclic compound and its preparation | |
| JPS5540601A (en) | New 3-(3,4-dihydroxyphenyl)serine derivative | |
| EP0273732A3 (en) | Streptovaricin c derivatives as anti-aids virus agents | |
| DE3261643D1 (en) | New peptide, process for preparation thereof and use thereof |