JPS54151955A - Production of 9-styrylanthracene and relative compounds - Google Patents
Production of 9-styrylanthracene and relative compoundsInfo
- Publication number
- JPS54151955A JPS54151955A JP5796278A JP5796278A JPS54151955A JP S54151955 A JPS54151955 A JP S54151955A JP 5796278 A JP5796278 A JP 5796278A JP 5796278 A JP5796278 A JP 5796278A JP S54151955 A JPS54151955 A JP S54151955A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- solution
- aldehyde
- dispersion
- strong
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001875 compounds Chemical class 0.000 title abstract 6
- HCSGQHDONHRJCM-CCEZHUSRSA-N 9-[(e)-2-phenylethenyl]anthracene Chemical compound C=12C=CC=CC2=CC2=CC=CC=C2C=1\C=C\C1=CC=CC=C1 HCSGQHDONHRJCM-CCEZHUSRSA-N 0.000 title 1
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 abstract 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 abstract 3
- 239000002585 base Substances 0.000 abstract 2
- 239000006185 dispersion Substances 0.000 abstract 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 abstract 2
- -1 N-ethylcarbazolyl Chemical group 0.000 abstract 1
- 239000003513 alkali Substances 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- ZDXDKCJCSZZBDU-UHFFFAOYSA-N anthracen-9-ylmethylphosphonic acid Chemical compound C1=CC=C2C(CP(O)(=O)O)=C(C=CC=C3)C3=CC2=C1 ZDXDKCJCSZZBDU-UHFFFAOYSA-N 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 239000006227 byproduct Substances 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- 239000000047 product Substances 0.000 abstract 1
- 239000002994 raw material Substances 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Photoreceptors In Electrophotography (AREA)
- Indole Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5796278A JPS54151955A (en) | 1978-05-16 | 1978-05-16 | Production of 9-styrylanthracene and relative compounds |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5796278A JPS54151955A (en) | 1978-05-16 | 1978-05-16 | Production of 9-styrylanthracene and relative compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS54151955A true JPS54151955A (en) | 1979-11-29 |
| JPS6216934B2 JPS6216934B2 (en, 2012) | 1987-04-15 |
Family
ID=13070629
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP5796278A Granted JPS54151955A (en) | 1978-05-16 | 1978-05-16 | Production of 9-styrylanthracene and relative compounds |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS54151955A (en, 2012) |
Cited By (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5049464A (en) * | 1988-12-29 | 1991-09-17 | Canon Kabushiki Kaisha | Photosensitive member for electrophotography |
| US5079118A (en) * | 1989-01-20 | 1992-01-07 | Canon Kabushiki Kaisha | Photosensitive member for electrophotography with substituted pyrene |
| US5098809A (en) * | 1989-03-03 | 1992-03-24 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member containing a substituted fluorine compound |
| US5176976A (en) * | 1990-04-09 | 1993-01-05 | Canon Kabushiki Kaisha | Organic electronic material and electrophotographic photosensitive member containing same |
| US5238765A (en) * | 1990-03-30 | 1993-08-24 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member |
| US5262261A (en) * | 1988-12-29 | 1993-11-16 | Canon Kabushiki Kaisha | Photosensitive member for electrophotography |
| US5484673A (en) * | 1990-07-10 | 1996-01-16 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member |
| US5486439A (en) * | 1993-02-09 | 1996-01-23 | Canon Kabushiki Kaisha | Electrophotographic with polycarbonate having charge transporting group |
| US5616442A (en) * | 1993-06-30 | 1997-04-01 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member and electrophotographic apparatus using same |
| US5756248A (en) * | 1995-09-06 | 1998-05-26 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member and apparatus and process cartridge provided with the same |
| US5932383A (en) * | 1996-08-08 | 1999-08-03 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member and process cartridge and electrophotographic apparatus including same |
| US6818368B2 (en) | 2000-04-14 | 2004-11-16 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member, process cartridge, and electrophotographic apparatus |
| US7175956B2 (en) | 2002-09-04 | 2007-02-13 | Sharp Kabushiki Kaisha | Organic photoconductive material, electrophotographic photoreceptor comprising the same, and image-forming apparatus |
| US7364823B2 (en) | 2004-03-30 | 2008-04-29 | Sharp Kabushiki Kaisha | Amine compound, electrophotographic photoreceptor using the amine compound and image forming apparatus having the same |
| US7416824B2 (en) | 2003-05-12 | 2008-08-26 | Sharp Kabushiki Kaisha | Organic photoconductive material electrophotographic photoreceptor and image forming apparatus using the same |
| US7429439B2 (en) | 2003-11-19 | 2008-09-30 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image forming apparatus provided with the same |
| US7457565B2 (en) | 2004-01-29 | 2008-11-25 | Sharp Kabushiki Kaisha | Image forming apparatus |
| US7534539B2 (en) | 2003-06-03 | 2009-05-19 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image forming apparatus having the same |
| US7563548B2 (en) | 2003-12-01 | 2009-07-21 | Sharp Kabushiki Kaisha | Amine compound, manufacturing method thereof, electrophotographic photoreceptor using amine compound and image forming apparatus having the same |
| US7588871B2 (en) | 2003-10-08 | 2009-09-15 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image forming apparatus provided with the same |
| US7615326B2 (en) | 2006-06-02 | 2009-11-10 | Sharp Kabushiki Kaisha | Electrophotographic photoconductor and image forming apparatus |
| US7625681B2 (en) | 2005-06-01 | 2009-12-01 | Sharp Kabushiki Kaisha | Asymmetric bis-hydroxyenamine compound, electrophotographic photoreceptor and image forming apparatus |
| US7754403B2 (en) | 2006-03-03 | 2010-07-13 | Sharp Kabushiki Kaisha | Electrophotoconductor and image forming apparatus |
| US7794907B2 (en) | 2004-09-07 | 2010-09-14 | Sharp Kabushiki Kaisha | Hydrazone compound, electrophotographic photoreceptor comprising the hydrazone compound, and image forming apparatus equipped with the electrophotographic photoreceptor |
| US7803507B2 (en) | 2003-02-07 | 2010-09-28 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image forming apparatus including the same |
| US8465890B2 (en) | 2010-08-30 | 2013-06-18 | Sharp Kabushiki Kaisha | Electrophotographic photoconductor and image forming apparatus including the same, and coating solution for undercoat layer formation in electrophotographic photoconductor |
| US8546049B2 (en) | 2010-12-21 | 2013-10-01 | Sharp Kabushiki Kaisha | Electrophotographic photoconductor and image forming apparatus using the same |
| US8568946B2 (en) | 2009-03-19 | 2013-10-29 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image formation device comprising same |
| US9663447B2 (en) | 2013-12-27 | 2017-05-30 | S-Printing Solution Co., Ltd. | Asymmetric butadiene-based charge transport compound, electrophotographic photoreceptor containing same, and image forming apparatus |
-
1978
- 1978-05-16 JP JP5796278A patent/JPS54151955A/ja active Granted
Cited By (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5049464A (en) * | 1988-12-29 | 1991-09-17 | Canon Kabushiki Kaisha | Photosensitive member for electrophotography |
| US5262261A (en) * | 1988-12-29 | 1993-11-16 | Canon Kabushiki Kaisha | Photosensitive member for electrophotography |
| US5079118A (en) * | 1989-01-20 | 1992-01-07 | Canon Kabushiki Kaisha | Photosensitive member for electrophotography with substituted pyrene |
| US5098809A (en) * | 1989-03-03 | 1992-03-24 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member containing a substituted fluorine compound |
| US5238765A (en) * | 1990-03-30 | 1993-08-24 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member |
| US5176976A (en) * | 1990-04-09 | 1993-01-05 | Canon Kabushiki Kaisha | Organic electronic material and electrophotographic photosensitive member containing same |
| US5484673A (en) * | 1990-07-10 | 1996-01-16 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member |
| US5677095A (en) * | 1990-07-10 | 1997-10-14 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member |
| US5486439A (en) * | 1993-02-09 | 1996-01-23 | Canon Kabushiki Kaisha | Electrophotographic with polycarbonate having charge transporting group |
| US5616442A (en) * | 1993-06-30 | 1997-04-01 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member and electrophotographic apparatus using same |
| US5756248A (en) * | 1995-09-06 | 1998-05-26 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member and apparatus and process cartridge provided with the same |
| US5932383A (en) * | 1996-08-08 | 1999-08-03 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member and process cartridge and electrophotographic apparatus including same |
| US6818368B2 (en) | 2000-04-14 | 2004-11-16 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member, process cartridge, and electrophotographic apparatus |
| US7175956B2 (en) | 2002-09-04 | 2007-02-13 | Sharp Kabushiki Kaisha | Organic photoconductive material, electrophotographic photoreceptor comprising the same, and image-forming apparatus |
| US7803507B2 (en) | 2003-02-07 | 2010-09-28 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image forming apparatus including the same |
| US7416824B2 (en) | 2003-05-12 | 2008-08-26 | Sharp Kabushiki Kaisha | Organic photoconductive material electrophotographic photoreceptor and image forming apparatus using the same |
| US7534539B2 (en) | 2003-06-03 | 2009-05-19 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image forming apparatus having the same |
| US7588871B2 (en) | 2003-10-08 | 2009-09-15 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image forming apparatus provided with the same |
| US7429439B2 (en) | 2003-11-19 | 2008-09-30 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image forming apparatus provided with the same |
| US7563548B2 (en) | 2003-12-01 | 2009-07-21 | Sharp Kabushiki Kaisha | Amine compound, manufacturing method thereof, electrophotographic photoreceptor using amine compound and image forming apparatus having the same |
| US7457565B2 (en) | 2004-01-29 | 2008-11-25 | Sharp Kabushiki Kaisha | Image forming apparatus |
| US7364823B2 (en) | 2004-03-30 | 2008-04-29 | Sharp Kabushiki Kaisha | Amine compound, electrophotographic photoreceptor using the amine compound and image forming apparatus having the same |
| US7794907B2 (en) | 2004-09-07 | 2010-09-14 | Sharp Kabushiki Kaisha | Hydrazone compound, electrophotographic photoreceptor comprising the hydrazone compound, and image forming apparatus equipped with the electrophotographic photoreceptor |
| US7625681B2 (en) | 2005-06-01 | 2009-12-01 | Sharp Kabushiki Kaisha | Asymmetric bis-hydroxyenamine compound, electrophotographic photoreceptor and image forming apparatus |
| US7754403B2 (en) | 2006-03-03 | 2010-07-13 | Sharp Kabushiki Kaisha | Electrophotoconductor and image forming apparatus |
| US7615326B2 (en) | 2006-06-02 | 2009-11-10 | Sharp Kabushiki Kaisha | Electrophotographic photoconductor and image forming apparatus |
| US8568946B2 (en) | 2009-03-19 | 2013-10-29 | Sharp Kabushiki Kaisha | Electrophotographic photoreceptor and image formation device comprising same |
| US8465890B2 (en) | 2010-08-30 | 2013-06-18 | Sharp Kabushiki Kaisha | Electrophotographic photoconductor and image forming apparatus including the same, and coating solution for undercoat layer formation in electrophotographic photoconductor |
| US8546049B2 (en) | 2010-12-21 | 2013-10-01 | Sharp Kabushiki Kaisha | Electrophotographic photoconductor and image forming apparatus using the same |
| US9663447B2 (en) | 2013-12-27 | 2017-05-30 | S-Printing Solution Co., Ltd. | Asymmetric butadiene-based charge transport compound, electrophotographic photoreceptor containing same, and image forming apparatus |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6216934B2 (en, 2012) | 1987-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS54151955A (en) | Production of 9-styrylanthracene and relative compounds | |
| JPS54148788A (en) | 1,2-disubstituted-4-halogenoimidazole-5-acetic acid derivative and its preparation | |
| JPS57192392A (en) | Production of 3-alkoxymethylcephalosporin | |
| JPS5767555A (en) | Production of s-(aminoalkyl)thiosulfate salt | |
| JPS5524125A (en) | Preparation of substituted diphenyl ether | |
| JPS5517324A (en) | Preparation of thiophosphoric acid ester | |
| JPS5758645A (en) | Preparation of carbonate | |
| JPS5795992A (en) | Novel derivative of cephamycin c and its preparation | |
| JPS57142929A (en) | Forming method of dipentaerythritol or ditrimethylolalkane as by-product at given ratio | |
| JPS5547651A (en) | Production of sulfoxyimine | |
| JPS5770883A (en) | (2-thienylseleno)acetic acid and its preparation | |
| JPS567785A (en) | Preparation of theobromine derivative | |
| JPS5643250A (en) | Preparation of substituted phenylacetic acid or its salt | |
| JPS57169458A (en) | Preparation of indole derivative | |
| GB2011415A (en) | Process for the Production of Thiophosphoric Acid Esters | |
| JPS5543004A (en) | Preparation of alpha-thio-gammadelta-unsaturated carbonyl compound | |
| JPS554346A (en) | Preparation of cephapirin sodium | |
| JPS5540617A (en) | Mitomycin derivative | |
| JPS5620556A (en) | Production of alpha-halogeno-beta-alanine | |
| JPS5531029A (en) | Preparation of 4-substituted amido-3-arylamino-5- pyrazolones | |
| JPS57179154A (en) | Preparation of 2,2'-dihydroxy-1,1'-dinaphthyl disulfide | |
| JPS54112807A (en) | Preparation of alpha-thio-gamma,delta-unsaturated carbonyl compounds | |
| JPS5594374A (en) | Preparation of orotic acid | |
| JPS55127366A (en) | Preparation of 4-(3-isopropylamino-2-hydroxypropoxy)-indole | |
| JPS54141723A (en) | Preparation of beta-hydroxyamino acid |