JPS54151946A - Alpha-sulfonyl-alpha-aromatic group substituted propionic acid derivative - Google Patents
Alpha-sulfonyl-alpha-aromatic group substituted propionic acid derivativeInfo
- Publication number
- JPS54151946A JPS54151946A JP5719978A JP5719978A JPS54151946A JP S54151946 A JPS54151946 A JP S54151946A JP 5719978 A JP5719978 A JP 5719978A JP 5719978 A JP5719978 A JP 5719978A JP S54151946 A JPS54151946 A JP S54151946A
- Authority
- JP
- Japan
- Prior art keywords
- formula
- compound
- alpha
- aromatic group
- sulfonyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000005599 propionic acid derivatives Chemical class 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 125000003118 aryl group Chemical group 0.000 abstract 2
- 239000002904 solvent Substances 0.000 abstract 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 abstract 2
- 239000004342 Benzoyl peroxide Substances 0.000 abstract 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 abstract 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 abstract 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 1
- 229940035676 analgesics Drugs 0.000 abstract 1
- 150000001450 anions Chemical class 0.000 abstract 1
- 239000000730 antalgic agent Substances 0.000 abstract 1
- 230000001741 anti-phlogistic effect Effects 0.000 abstract 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 abstract 1
- 235000019400 benzoyl peroxide Nutrition 0.000 abstract 1
- 239000003054 catalyst Substances 0.000 abstract 1
- -1 chlorine Chemical class 0.000 abstract 1
- 229910052801 chlorine Inorganic materials 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 abstract 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 238000000034 method Methods 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 238000006467 substitution reaction Methods 0.000 abstract 1
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 abstract 1
Landscapes
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5719978A JPS54151946A (en) | 1978-05-16 | 1978-05-16 | Alpha-sulfonyl-alpha-aromatic group substituted propionic acid derivative |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5719978A JPS54151946A (en) | 1978-05-16 | 1978-05-16 | Alpha-sulfonyl-alpha-aromatic group substituted propionic acid derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS54151946A true JPS54151946A (en) | 1979-11-29 |
| JPS5748113B2 JPS5748113B2 (enExample) | 1982-10-14 |
Family
ID=13048814
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP5719978A Granted JPS54151946A (en) | 1978-05-16 | 1978-05-16 | Alpha-sulfonyl-alpha-aromatic group substituted propionic acid derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS54151946A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS62192912U (enExample) * | 1986-05-30 | 1987-12-08 |
-
1978
- 1978-05-16 JP JP5719978A patent/JPS54151946A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5748113B2 (enExample) | 1982-10-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5278848A (en) | Preparation of novel propionic acid ester derivatives | |
| JPS52131540A (en) | Phenoxyvaleric acid derivatives and herbicides therefrom | |
| PH15864A (en) | 2-(2-alkoxy-methyl)-2-hydroxy-6-7 benzomorphans and salts thereof | |
| JPS54151946A (en) | Alpha-sulfonyl-alpha-aromatic group substituted propionic acid derivative | |
| ES480827A1 (es) | Procedimiento para la preparacion de acidos fenilaminotiofe-noaceticos. | |
| JPS52111528A (en) | Phenoxyphenoxyalkane carboxylic acid derivatives and herbicidal compos ition containing the same | |
| IE792508L (en) | Piperidylindoles | |
| JPS5473775A (en) | Isoxazoline-3-one derivative | |
| JPS57142966A (en) | (1-alkyl-2-pyrrolyl)glyoxylic acid amide derivative | |
| JPS54128599A (en) | Pyrrolobenzazepin derivative | |
| JPS5555135A (en) | Preparation of d-2-(6-methoxy-2-naphthyl)-propionic acid | |
| JPS579757A (en) | Alpha-sulfonyl 2-fluoro-4-biphenylyl acetic acid derivative | |
| JPS5287129A (en) | 4-trifluoromethyl phenoxy phenoxyankane carboxylic acid | |
| JPS56123937A (en) | Preparation of cyclohexene derivative | |
| JPS54119428A (en) | Novel benzoic acid derivative | |
| JPS53111063A (en) | Alpha-phenoxypropionic acid derivatives, their preparation and herbicides | |
| JPS5616446A (en) | Novel derivative of terephthalic acid and its preparation | |
| JPS568385A (en) | 2-allyl-imidazo 1,2-a imidazole derivative | |
| JPS53130634A (en) | Novel 2-(3-phenoxyphenyl) propionic acid ester derivatives | |
| JPS5382761A (en) | Novel maphthyl propionic acid ester derivs. | |
| JPS5795976A (en) | Piperidinophenylcarboxylic acid derivative and its preparation | |
| JPS5745151A (en) | Alpha-sulfonyl 2-fluoro-4-biphenylyl propionic acid derivative | |
| JPS54138600A (en) | Benzo-azabicyclo3,3,1-nonane derivative | |
| JPS5490158A (en) | Novel benzoylphenoxyacetic acid derivatives | |
| JPS54112867A (en) | 1,3-dithiethane compound and its preparation |