JPH0411546B2 - - Google Patents
Info
- Publication number
- JPH0411546B2 JPH0411546B2 JP57196885A JP19688582A JPH0411546B2 JP H0411546 B2 JPH0411546 B2 JP H0411546B2 JP 57196885 A JP57196885 A JP 57196885A JP 19688582 A JP19688582 A JP 19688582A JP H0411546 B2 JPH0411546 B2 JP H0411546B2
- Authority
- JP
- Japan
- Prior art keywords
- formula
- compound
- lower alkyl
- hydrogen
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- KEIQPPQTKPFHLZ-UHFFFAOYSA-N 3-piperidin-4-yl-1,2-benzoxazole Chemical class C1CNCCC1C1=NOC2=CC=CC=C12 KEIQPPQTKPFHLZ-UHFFFAOYSA-N 0.000 claims abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 118
- 125000000217 alkyl group Chemical group 0.000 claims description 107
- 150000001875 compounds Chemical class 0.000 claims description 99
- -1 cyano, cyanomethyl Chemical group 0.000 claims description 65
- 239000001257 hydrogen Substances 0.000 claims description 59
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 39
- 239000002253 acid Substances 0.000 claims description 37
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 37
- 229910052736 halogen Inorganic materials 0.000 claims description 36
- 150000002367 halogens Chemical class 0.000 claims description 36
- 150000003839 salts Chemical class 0.000 claims description 31
- 125000003342 alkenyl group Chemical group 0.000 claims description 19
- 125000003545 alkoxy group Chemical group 0.000 claims description 19
- 239000002585 base Substances 0.000 claims description 19
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 18
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 16
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- 239000003513 alkali Substances 0.000 claims description 13
- 230000003287 optical effect Effects 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- KTZQTRPPVKQPFO-UHFFFAOYSA-N 1,2-benzoxazole Chemical compound C1=CC=C2C=NOC2=C1 KTZQTRPPVKQPFO-UHFFFAOYSA-N 0.000 claims description 11
- 150000001350 alkyl halides Chemical class 0.000 claims description 10
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 9
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 8
- JMANVNJQNLATNU-UHFFFAOYSA-N glycolonitrile Natural products N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 claims description 8
- 230000007062 hydrolysis Effects 0.000 claims description 8
- 238000006460 hydrolysis reaction Methods 0.000 claims description 8
- 150000007513 acids Chemical class 0.000 claims description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 6
- 239000011707 mineral Substances 0.000 claims description 6
- 239000004342 Benzoyl peroxide Substances 0.000 claims description 5
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 claims description 5
- 235000019400 benzoyl peroxide Nutrition 0.000 claims description 5
- 125000001246 bromo group Chemical group Br* 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 230000020335 dealkylation Effects 0.000 claims description 4
- 238000006900 dealkylation reaction Methods 0.000 claims description 4
- 150000004678 hydrides Chemical class 0.000 claims description 4
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 3
- 230000000202 analgesic effect Effects 0.000 claims description 3
- 238000006264 debenzylation reaction Methods 0.000 claims description 3
- 229910052731 fluorine Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 239000011737 fluorine Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims 11
- 150000002431 hydrogen Chemical group 0.000 claims 11
- 125000004093 cyano group Chemical group *C#N 0.000 claims 9
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims 5
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims 3
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims 3
- FROSFTKTGXTIDY-UHFFFAOYSA-N 5-methyl-3-(1-methylpiperidin-4-yl)-1,2-benzoxazole Chemical compound C1CN(C)CCC1C1=NOC2=CC=C(C)C=C12 FROSFTKTGXTIDY-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical group COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 claims 1
- 230000003020 moisturizing effect Effects 0.000 claims 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 18
- 238000002360 preparation method Methods 0.000 abstract description 5
- 239000000543 intermediate Substances 0.000 abstract description 3
- 230000036407 pain Effects 0.000 abstract description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 131
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 127
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 111
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 103
- 239000003921 oil Substances 0.000 description 75
- 239000000047 product Substances 0.000 description 71
- 229910052757 nitrogen Inorganic materials 0.000 description 69
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 66
- 239000000203 mixture Substances 0.000 description 65
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 63
- 238000000921 elemental analysis Methods 0.000 description 59
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 59
- 239000000243 solution Substances 0.000 description 59
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 54
- 239000007787 solid Substances 0.000 description 54
- 238000010992 reflux Methods 0.000 description 51
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- 238000006243 chemical reaction Methods 0.000 description 48
- 239000002904 solvent Substances 0.000 description 48
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 44
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 42
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- 239000011541 reaction mixture Substances 0.000 description 40
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 33
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 33
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 30
- 229910000027 potassium carbonate Inorganic materials 0.000 description 29
- 235000011181 potassium carbonates Nutrition 0.000 description 29
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 26
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 26
- 239000000725 suspension Substances 0.000 description 26
- 238000003756 stirring Methods 0.000 description 25
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 23
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 22
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 22
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 21
- 235000017557 sodium bicarbonate Nutrition 0.000 description 21
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 21
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 20
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 20
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 19
- 239000002244 precipitate Substances 0.000 description 18
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 17
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 17
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 15
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 15
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 15
- 239000007788 liquid Substances 0.000 description 14
- 238000001953 recrystallisation Methods 0.000 description 14
- 238000007363 ring formation reaction Methods 0.000 description 14
- 229960001701 chloroform Drugs 0.000 description 13
- 239000000284 extract Substances 0.000 description 13
- 150000002923 oximes Chemical class 0.000 description 13
- 239000000523 sample Substances 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 11
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 10
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 10
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 10
- 239000005695 Ammonium acetate Substances 0.000 description 10
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 10
- 235000019257 ammonium acetate Nutrition 0.000 description 10
- 229940043376 ammonium acetate Drugs 0.000 description 10
- 239000012259 ether extract Substances 0.000 description 10
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 10
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 10
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 10
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 10
- 239000013078 crystal Substances 0.000 description 9
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 8
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 8
- 235000011054 acetic acid Nutrition 0.000 description 8
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 8
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical compound OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 8
- 239000012312 sodium hydride Substances 0.000 description 8
- 229910000104 sodium hydride Inorganic materials 0.000 description 8
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 239000001530 fumaric acid Substances 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- YXTROGRGRSPWKL-UHFFFAOYSA-N 1-benzoylpiperidine Chemical compound C=1C=CC=CC=1C(=O)N1CCCCC1 YXTROGRGRSPWKL-UHFFFAOYSA-N 0.000 description 6
- 239000000538 analytical sample Substances 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 6
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 6
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 6
- 239000002027 dichloromethane extract Substances 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 6
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 6
- HTXWKZDRDRFVHN-UHFFFAOYSA-N 2-methyloxiran-2-ol Chemical compound CC1(O)CO1 HTXWKZDRDRFVHN-UHFFFAOYSA-N 0.000 description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 5
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000000370 acceptor Substances 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 235000019253 formic acid Nutrition 0.000 description 5
- 150000008282 halocarbons Chemical class 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000004533 oil dispersion Substances 0.000 description 5
- 239000011736 potassium bicarbonate Substances 0.000 description 5
- 235000015497 potassium bicarbonate Nutrition 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- 239000012258 stirred mixture Substances 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 5
- GESVWEJAHMSMSK-UHFFFAOYSA-N 1-[4-(2-hydroxy-5-methoxybenzoyl)piperidin-1-yl]ethanone Chemical compound COC1=CC=C(O)C(C(=O)C2CCN(CC2)C(C)=O)=C1 GESVWEJAHMSMSK-UHFFFAOYSA-N 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000006184 cosolvent Substances 0.000 description 4
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 4
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 4
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- DDRCHUGHUHZNKZ-UHFFFAOYSA-N phenyl(piperidin-4-yl)methanone Chemical compound C=1C=CC=CC=1C(=O)C1CCNCC1 DDRCHUGHUHZNKZ-UHFFFAOYSA-N 0.000 description 4
- 239000003880 polar aprotic solvent Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- MSCURGXTUQIQQN-UHFFFAOYSA-N (2-fluorophenyl)-(1-methylpiperidin-4-yl)methanone Chemical compound C1CN(C)CCC1C(=O)C1=CC=CC=C1F MSCURGXTUQIQQN-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- GVHAOAXQBDXPKG-UHFFFAOYSA-N 1-[4-(2,4-dichlorobenzoyl)piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C(=O)C1=CC=C(Cl)C=C1Cl GVHAOAXQBDXPKG-UHFFFAOYSA-N 0.000 description 3
- YIELGQWFNQRQGV-UHFFFAOYSA-N 1-[4-(2-hydroxy-4-methoxybenzoyl)piperidin-1-yl]ethanone Chemical compound OC1=CC(OC)=CC=C1C(=O)C1CCN(C(C)=O)CC1 YIELGQWFNQRQGV-UHFFFAOYSA-N 0.000 description 3
- BIOJZRDPHAAHAN-UHFFFAOYSA-N 1-[4-(5-fluoro-2-hydroxybenzoyl)piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C(=O)C1=CC(F)=CC=C1O BIOJZRDPHAAHAN-UHFFFAOYSA-N 0.000 description 3
- FFESGTAUFAZQRI-UHFFFAOYSA-N 3-piperidin-1-yl-1,2-benzoxazole Chemical compound C1CCCCN1C1=NOC2=CC=CC=C12 FFESGTAUFAZQRI-UHFFFAOYSA-N 0.000 description 3
- MYGXGCCFTPKWIH-UHFFFAOYSA-N 4-chloro-1-methylpiperidine Chemical compound CN1CCC(Cl)CC1 MYGXGCCFTPKWIH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 3
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- 229930006000 Sucrose Natural products 0.000 description 3
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 3
- BMWDKNJLXMCLEF-UHFFFAOYSA-N [4-(1,2-benzoxazol-3-yl)piperidin-1-yl] benzoate Chemical compound C1CC(C=2C3=CC=CC=C3ON=2)CCN1OC(=O)C1=CC=CC=C1 BMWDKNJLXMCLEF-UHFFFAOYSA-N 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- 239000003637 basic solution Substances 0.000 description 3
- 150000008316 benzisoxazoles Chemical class 0.000 description 3
- LDECUSDQMXVUMP-UHFFFAOYSA-N benzyl 3-[6-[[2-(butylamino)-1-[3-methoxycarbonyl-4-(2-methoxy-2-oxoethoxy)phenyl]-2-oxoethyl]-hexylamino]-6-oxohexyl]-4-methyl-2-oxo-6-(4-phenylphenyl)-1,6-dihydropyrimidine-5-carboxylate Chemical compound O=C1NC(C=2C=CC(=CC=2)C=2C=CC=CC=2)C(C(=O)OCC=2C=CC=CC=2)=C(C)N1CCCCCC(=O)N(CCCCCC)C(C(=O)NCCCC)C1=CC=C(OCC(=O)OC)C(C(=O)OC)=C1 LDECUSDQMXVUMP-UHFFFAOYSA-N 0.000 description 3
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- VGHOWOWLIXPTOA-UHFFFAOYSA-N cyclohexane;toluene Chemical compound C1CCCCC1.CC1=CC=CC=C1 VGHOWOWLIXPTOA-UHFFFAOYSA-N 0.000 description 3
- 238000010908 decantation Methods 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- 239000002198 insoluble material Substances 0.000 description 3
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 3
- 235000017550 sodium carbonate Nutrition 0.000 description 3
- 239000005720 sucrose Substances 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- NWJJDOWECWUOAI-UHFFFAOYSA-N (2,6-difluorophenyl)-(1-methylpiperidin-4-yl)methanone Chemical compound C1CN(C)CCC1C(=O)C1=C(F)C=CC=C1F NWJJDOWECWUOAI-UHFFFAOYSA-N 0.000 description 2
- MEKSXLSAYLIUHI-UHFFFAOYSA-N (2-hydroxy-4-methoxyphenyl)-piperidin-4-ylmethanone Chemical compound OC1=CC(OC)=CC=C1C(=O)C1CCNCC1 MEKSXLSAYLIUHI-UHFFFAOYSA-N 0.000 description 2
- AGIQIOSHSMJYJP-UHFFFAOYSA-N 1,2,4-Trimethoxybenzene Chemical compound COC1=CC=C(OC)C(OC)=C1 AGIQIOSHSMJYJP-UHFFFAOYSA-N 0.000 description 2
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 description 2
- OHBQPCCCRFSCAX-UHFFFAOYSA-N 1,4-Dimethoxybenzene Chemical compound COC1=CC=C(OC)C=C1 OHBQPCCCRFSCAX-UHFFFAOYSA-N 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 2
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 2
- UGPWQEIGJWVJDR-UHFFFAOYSA-N 1-[4-(2,4-difluorobenzoyl)piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C(=O)C1=CC=C(F)C=C1F UGPWQEIGJWVJDR-UHFFFAOYSA-N 0.000 description 2
- JIBRSFJGGDKKTI-UHFFFAOYSA-N 1-[4-(5,6-dimethoxy-1,2-benzoxazol-3-yl)piperidin-1-yl]ethanone Chemical compound C1=2C=C(OC)C(OC)=CC=2ON=C1C1CCN(C(C)=O)CC1 JIBRSFJGGDKKTI-UHFFFAOYSA-N 0.000 description 2
- VTKDVMLLKOMPKX-UHFFFAOYSA-N 1-[4-[C-(5-fluoro-2-hydroxyphenyl)-N-hydroxycarbonimidoyl]piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C(=NO)C1=CC(F)=CC=C1O VTKDVMLLKOMPKX-UHFFFAOYSA-N 0.000 description 2
- YMAZXLDRWLCPOU-UHFFFAOYSA-N 1-[4-[N-hydroxy-C-(2-hydroxy-5-methoxyphenyl)carbonimidoyl]piperidin-1-yl]ethanone Chemical compound COC1=CC=C(O)C(C(=NO)C2CCN(CC2)C(C)=O)=C1 YMAZXLDRWLCPOU-UHFFFAOYSA-N 0.000 description 2
- OHCPVLJEAHBMEG-UHFFFAOYSA-N 1-acetylpiperidine-4-carbonyl chloride Chemical compound CC(=O)N1CCC(C(Cl)=O)CC1 OHCPVLJEAHBMEG-UHFFFAOYSA-N 0.000 description 2
- WFCLWJHOKCQYOQ-UHFFFAOYSA-N 1-acetylpiperidine-4-carboxylic acid Chemical compound CC(=O)N1CCC(C(O)=O)CC1 WFCLWJHOKCQYOQ-UHFFFAOYSA-N 0.000 description 2
- XGFKZJZVLQPJKL-UHFFFAOYSA-N 1-formylpiperidine-4-carbonyl chloride Chemical compound ClC(=O)C1CCN(C=O)CC1 XGFKZJZVLQPJKL-UHFFFAOYSA-N 0.000 description 2
- IZNTWTMLHCGAJU-UHFFFAOYSA-N 1-formylpiperidine-4-carboxylic acid Chemical compound OC(=O)C1CCN(C=O)CC1 IZNTWTMLHCGAJU-UHFFFAOYSA-N 0.000 description 2
- QSZCGGBDNYTQHH-UHFFFAOYSA-N 2,3-dimethoxyphenol Chemical group COC1=CC=CC(O)=C1OC QSZCGGBDNYTQHH-UHFFFAOYSA-N 0.000 description 2
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- VCRMDHQFVLSAJS-UHFFFAOYSA-N 4-(1,2-benzoxazol-3-yl)piperidine-1-carbonitrile Chemical compound C1CN(C#N)CCC1C1=NOC2=CC=CC=C12 VCRMDHQFVLSAJS-UHFFFAOYSA-N 0.000 description 2
- RKHYAWDTYSVSRI-UHFFFAOYSA-N 4-(2,4-dichlorobenzoyl)piperidine-1-carbaldehyde Chemical compound ClC1=CC(Cl)=CC=C1C(=O)C1CCN(C=O)CC1 RKHYAWDTYSVSRI-UHFFFAOYSA-N 0.000 description 2
- CWPSRUREOSBKBQ-UHFFFAOYSA-N 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride Chemical compound Cl.N=1OC2=CC(F)=CC=C2C=1C1CCNCC1 CWPSRUREOSBKBQ-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 241000212342 Sium Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 229910000095 alkaline earth hydride Inorganic materials 0.000 description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 2
- 229940035676 analgesics Drugs 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000000730 antalgic agent Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- NKWPZUCBCARRDP-UHFFFAOYSA-L calcium bicarbonate Chemical compound [Ca+2].OC([O-])=O.OC([O-])=O NKWPZUCBCARRDP-UHFFFAOYSA-L 0.000 description 2
- 229910000020 calcium bicarbonate Inorganic materials 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 2
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 229940117389 dichlorobenzene Drugs 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- PONZRICWSLHAHB-UHFFFAOYSA-N ethoxyethane;hydrobromide Chemical class Br.CCOCC PONZRICWSLHAHB-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000005171 halobenzenes Chemical class 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 150000002576 ketones Chemical group 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- BQDCUHVQLBLIMY-UHFFFAOYSA-N n-[(2,4-dichlorophenyl)-piperidin-4-ylmethylidene]hydroxylamine Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=NO)C1CCNCC1 BQDCUHVQLBLIMY-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- ABUYPZMWYIVOKQ-UHFFFAOYSA-N phenyl carbonobromidate Chemical compound BrC(=O)OC1=CC=CC=C1 ABUYPZMWYIVOKQ-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 150000003053 piperidines Chemical class 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000008174 sterile solution Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- AAWZDTNXLSGCEK-WYWMIBKRSA-N (-)-quinic acid Chemical compound O[C@@H]1C[C@](O)(C(O)=O)C[C@@H](O)[C@H]1O AAWZDTNXLSGCEK-WYWMIBKRSA-N 0.000 description 1
- BNHOHUPUVSMISJ-UHFFFAOYSA-N (1-benzylpiperidin-4-yl)-(2-hydroxy-4-methoxyphenyl)methanone Chemical compound OC1=CC(OC)=CC=C1C(=O)C1CCN(CC=2C=CC=CC=2)CC1 BNHOHUPUVSMISJ-UHFFFAOYSA-N 0.000 description 1
- IIFNUKMZTPHHKE-UHFFFAOYSA-N (1-benzylpiperidin-4-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C(CC1)CCN1CC1=CC=CC=C1 IIFNUKMZTPHHKE-UHFFFAOYSA-N 0.000 description 1
- PFCKBHHYNAQGBM-UHFFFAOYSA-N (2,4-dichlorophenyl)-piperidin-4-ylmethanone;hydrochloride Chemical compound Cl.ClC1=CC(Cl)=CC=C1C(=O)C1CCNCC1 PFCKBHHYNAQGBM-UHFFFAOYSA-N 0.000 description 1
- IKAKWNLZMONDBR-UHFFFAOYSA-N (2,4-difluorophenyl)-[1-(hydroxyiminomethyl)piperidin-4-yl]methanone Chemical compound C1CN(C=NO)CCC1C(=O)C1=CC=C(F)C=C1F IKAKWNLZMONDBR-UHFFFAOYSA-N 0.000 description 1
- VMHMXAUPNGTCDC-UHFFFAOYSA-N (2-chloro-5-methylphenyl)-(1-methylpiperidin-4-yl)methanone Chemical compound C1CN(C)CCC1C(=O)C1=CC(C)=CC=C1Cl VMHMXAUPNGTCDC-UHFFFAOYSA-N 0.000 description 1
- NWVKAOJRWMSFMU-UHFFFAOYSA-N (2-fluorophenyl)-(1-methylpiperidin-4-yl)methanone;hydrochloride Chemical compound Cl.C1CN(C)CCC1C(=O)C1=CC=CC=C1F NWVKAOJRWMSFMU-UHFFFAOYSA-N 0.000 description 1
- XAJLGRLXDBNIMJ-UHFFFAOYSA-N (2-hydroxypiperidin-1-yl)-phenylmethanone Chemical compound OC1CCCCN1C(=O)C1=CC=CC=C1 XAJLGRLXDBNIMJ-UHFFFAOYSA-N 0.000 description 1
- QGPTXZSKULEDPT-WLHGVMLRSA-N (e)-but-2-enedioic acid;(2,4-difluorophenyl)-piperidin-4-ylmethanone Chemical compound OC(=O)\C=C\C(O)=O.FC1=CC(F)=CC=C1C(=O)C1CCNCC1 QGPTXZSKULEDPT-WLHGVMLRSA-N 0.000 description 1
- UHKCLNXNFJTQAQ-WLHGVMLRSA-N (e)-but-2-enedioic acid;(2-chloro-5-methylphenyl)-(1-methylpiperidin-4-yl)methanone Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C)CCC1C(=O)C1=CC(C)=CC=C1Cl UHKCLNXNFJTQAQ-WLHGVMLRSA-N 0.000 description 1
- SJSOBOVMGRXUHV-WLHGVMLRSA-N (e)-but-2-enedioic acid;5-methyl-3-(1-methylpiperidin-4-yl)-1,2-benzoxazole Chemical compound OC(=O)\C=C\C(O)=O.C1CN(C)CCC1C1=NOC2=CC=C(C)C=C12 SJSOBOVMGRXUHV-WLHGVMLRSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- WOSQDCFVYQABKO-UHFFFAOYSA-N 1,2-benzoxazol-2-ium;chloride Chemical compound Cl.C1=CC=C2C=NOC2=C1 WOSQDCFVYQABKO-UHFFFAOYSA-N 0.000 description 1
- GOYDNIKZWGIXJT-UHFFFAOYSA-N 1,2-difluorobenzene Chemical compound FC1=CC=CC=C1F GOYDNIKZWGIXJT-UHFFFAOYSA-N 0.000 description 1
- UEMGWPRHOOEKTA-UHFFFAOYSA-N 1,3-difluorobenzene Chemical compound FC1=CC=CC(F)=C1 UEMGWPRHOOEKTA-UHFFFAOYSA-N 0.000 description 1
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 1
- UMGAJRBKZNAFDD-UHFFFAOYSA-N 1-(4-fluorophenyl)-2-piperidin-1-ium-1-ylethanone;chloride Chemical compound Cl.C1=CC(F)=CC=C1C(=O)CN1CCCCC1 UMGAJRBKZNAFDD-UHFFFAOYSA-N 0.000 description 1
- PZNSVLCWHLHDLK-UHFFFAOYSA-N 1-[4-(5-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C1=NOC2=CC=C(F)C=C12 PZNSVLCWHLHDLK-UHFFFAOYSA-N 0.000 description 1
- OJGYXYVIEJXRRP-UHFFFAOYSA-N 1-[4-(5-methoxy-1,2-benzoxazol-3-yl)piperidin-1-yl]ethanone Chemical compound C12=CC(OC)=CC=C2ON=C1C1CCN(C(C)=O)CC1 OJGYXYVIEJXRRP-UHFFFAOYSA-N 0.000 description 1
- JMJCZMKHWUOKOG-UHFFFAOYSA-N 1-[4-(6-methoxy-1,2-benzoxazol-3-yl)piperidin-1-yl]ethanone Chemical compound N=1OC2=CC(OC)=CC=C2C=1C1CCN(C(C)=O)CC1 JMJCZMKHWUOKOG-UHFFFAOYSA-N 0.000 description 1
- QMFONGBMNSYADJ-UHFFFAOYSA-N 1-[4-[c-(2,4-dichlorophenyl)-n-hydroxycarbonimidoyl]piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C(=NO)C1=CC=C(Cl)C=C1Cl QMFONGBMNSYADJ-UHFFFAOYSA-N 0.000 description 1
- GYSCBCSGKXNZRH-UHFFFAOYSA-N 1-benzothiophene-2-carboxamide Chemical compound C1=CC=C2SC(C(=O)N)=CC2=C1 GYSCBCSGKXNZRH-UHFFFAOYSA-N 0.000 description 1
- NZVZVGPYTICZBZ-UHFFFAOYSA-N 1-benzylpiperidine Chemical compound C=1C=CC=CC=1CN1CCCCC1 NZVZVGPYTICZBZ-UHFFFAOYSA-N 0.000 description 1
- CAFAOQIVXSSFSY-UHFFFAOYSA-N 1-ethoxyethanol Chemical compound CCOC(C)O CAFAOQIVXSSFSY-UHFFFAOYSA-N 0.000 description 1
- VIPWUFMFHBIKQI-UHFFFAOYSA-N 1-fluoro-4-methoxybenzene Chemical compound COC1=CC=C(F)C=C1 VIPWUFMFHBIKQI-UHFFFAOYSA-N 0.000 description 1
- LYUPJHVGLFETDG-UHFFFAOYSA-N 1-phenylbutan-2-ol Chemical compound CCC(O)CC1=CC=CC=C1 LYUPJHVGLFETDG-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- BNBRIFIJRKJGEI-UHFFFAOYSA-N 2,6-difluorobenzonitrile Chemical compound FC1=CC=CC(F)=C1C#N BNBRIFIJRKJGEI-UHFFFAOYSA-N 0.000 description 1
- HGMLECXOAXPNAA-UHFFFAOYSA-M 2-(1,2-benzoxazol-3-yl)-1,5-dimethylpiperidin-1-ium-1-carbonitrile;chloride Chemical compound [Cl-].N#C[N+]1(C)CC(C)CCC1C1=NOC2=CC=CC=C12 HGMLECXOAXPNAA-UHFFFAOYSA-M 0.000 description 1
- XSJBDPMDVRYRHH-UHFFFAOYSA-N 2-(1,2-benzoxazol-3-yl)piperidine-1-carboxylic acid Chemical compound OC(=O)N1CCCCC1C1=NOC2=CC=CC=C12 XSJBDPMDVRYRHH-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- SVSLGDLAWNRNLC-LVEZLNDCSA-N 2-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-n,n-diethylethanamine;(e)-but-2-enedioic acid Chemical compound OC(=O)\C=C\C(O)=O.OC(=O)\C=C\C(O)=O.C1CN(CCN(CC)CC)CCC1C1=NOC2=CC=CC=C12 SVSLGDLAWNRNLC-LVEZLNDCSA-N 0.000 description 1
- OYAJTKJJNALILJ-UHFFFAOYSA-N 2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]acetonitrile Chemical compound N=1OC2=CC(F)=CC=C2C=1C1CCN(CC#N)CC1 OYAJTKJJNALILJ-UHFFFAOYSA-N 0.000 description 1
- ZTIPZBJOLLKLTB-UHFFFAOYSA-N 2-chloro-5-methylbenzonitrile Chemical compound CC1=CC=C(Cl)C(C#N)=C1 ZTIPZBJOLLKLTB-UHFFFAOYSA-N 0.000 description 1
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- GKTPHOZVNCQSBC-UHFFFAOYSA-N 3-(1-benzylpiperidin-4-yl)-1,2-benzoxazole Chemical compound C1CC(C=2C3=CC=CC=C3ON=2)CCN1CC1=CC=CC=C1 GKTPHOZVNCQSBC-UHFFFAOYSA-N 0.000 description 1
- FTIBOKLBBNLDFA-UHFFFAOYSA-N 3-(1-hydroxypiperidin-4-yl)-1,2-benzoxazole Chemical compound C1CN(O)CCC1C1=NOC2=CC=CC=C12 FTIBOKLBBNLDFA-UHFFFAOYSA-N 0.000 description 1
- WFFFPWPBWOZRPU-UHFFFAOYSA-N 3-(1-hydroxypiperidin-4-yl)-1,2-benzoxazole;hydrochloride Chemical compound Cl.C1CN(O)CCC1C1=NOC2=CC=CC=C12 WFFFPWPBWOZRPU-UHFFFAOYSA-N 0.000 description 1
- VQWDHKXDNJREDM-UHFFFAOYSA-N 3-(1-methylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride Chemical compound Cl.C1CN(C)CCC1C1=NOC2=CC=CC=C12 VQWDHKXDNJREDM-UHFFFAOYSA-N 0.000 description 1
- DLNNDDZTZMLQCH-UHFFFAOYSA-N 3-[1-(2-phenylethyl)piperidin-4-yl]-1,2-benzoxazole;hydrochloride Chemical compound Cl.C1CC(C=2C3=CC=CC=C3ON=2)CCN1CCC1=CC=CC=C1 DLNNDDZTZMLQCH-UHFFFAOYSA-N 0.000 description 1
- ILGARTOALLEIHF-UHFFFAOYSA-N 3-[2-(cyclopropylmethyl)piperidin-4-yl]-1,2-benzoxazole;hydrochloride Chemical compound Cl.C1C(C=2C3=CC=CC=C3ON=2)CCNC1CC1CC1 ILGARTOALLEIHF-UHFFFAOYSA-N 0.000 description 1
- QVCMETYMXNIRBA-LVEZLNDCSA-N 3-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-n,n-diethylpropan-1-amine;(e)-but-2-enedioic acid Chemical compound OC(=O)\C=C\C(O)=O.OC(=O)\C=C\C(O)=O.C1CN(CCCN(CC)CC)CCC1C1=NOC2=CC=CC=C12 QVCMETYMXNIRBA-LVEZLNDCSA-N 0.000 description 1
- ZZCYTEKVAGTACO-LVEZLNDCSA-N 3-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-n,n-dimethylpropan-1-amine;(e)-but-2-enedioic acid Chemical compound OC(=O)\C=C\C(O)=O.OC(=O)\C=C\C(O)=O.C1CN(CCCN(C)C)CCC1C1=NOC2=CC=CC=C12 ZZCYTEKVAGTACO-LVEZLNDCSA-N 0.000 description 1
- WVUULNDRFBHTFG-UHFFFAOYSA-N 3-chloro-n,n-diethylpropan-1-amine Chemical compound CCN(CC)CCCCl WVUULNDRFBHTFG-UHFFFAOYSA-N 0.000 description 1
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- TVZSLVGHVCAWDY-UHFFFAOYSA-N 3-piperidin-4-yl-1,2-benzoxazol-5-ol;hydrobromide Chemical compound Br.C12=CC(O)=CC=C2ON=C1C1CCNCC1 TVZSLVGHVCAWDY-UHFFFAOYSA-N 0.000 description 1
- KROBPWSMNYYYTJ-UHFFFAOYSA-N 4-(2-hydroxy-4-methoxybenzoyl)piperidine-1-carboxylic acid Chemical compound OC1=CC(OC)=CC=C1C(=O)C1CCN(C(O)=O)CC1 KROBPWSMNYYYTJ-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- ZNGFLEBEZMXHBF-UHFFFAOYSA-N 4-(5-methyl-1,2-benzoxazol-3-yl)piperidine-1-carbonitrile Chemical compound C12=CC(C)=CC=C2ON=C1C1CCN(C#N)CC1 ZNGFLEBEZMXHBF-UHFFFAOYSA-N 0.000 description 1
- HEOVAIUROCTBOA-UHFFFAOYSA-N 4-(6-chloro-1,2-benzoxazol-3-yl)piperidine-1-carbaldehyde Chemical compound N=1OC2=CC(Cl)=CC=C2C=1C1CCN(C=O)CC1 HEOVAIUROCTBOA-UHFFFAOYSA-N 0.000 description 1
- XUIHSDIRUQGIBM-UHFFFAOYSA-N 4-(6-fluoro-1,2-benzoxazol-3-yl)piperidine-1-carbaldehyde Chemical compound N=1OC2=CC(F)=CC=C2C=1C1CCN(C=O)CC1 XUIHSDIRUQGIBM-UHFFFAOYSA-N 0.000 description 1
- ZBGHUSHLZYUWSR-UHFFFAOYSA-N 4-[c-(2,4-dichlorophenyl)-n-hydroxycarbonimidoyl]piperidine-1-carbaldehyde Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=NO)C1CCN(C=O)CC1 ZBGHUSHLZYUWSR-UHFFFAOYSA-N 0.000 description 1
- HSOGSIWLKVVHQQ-UHFFFAOYSA-N 4-fluoro-3-(1-methylpiperidin-4-yl)-1,2-benzoxazole Chemical compound C1CN(C)CCC1C1=NOC2=CC=CC(F)=C12 HSOGSIWLKVVHQQ-UHFFFAOYSA-N 0.000 description 1
- LYPZWZFFDGCDLK-UHFFFAOYSA-N 4-fluoro-3-(1-methylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride Chemical compound Cl.C1CN(C)CCC1C1=NOC2=CC=CC(F)=C12 LYPZWZFFDGCDLK-UHFFFAOYSA-N 0.000 description 1
- TZCMGPJERRJNNQ-UHFFFAOYSA-N 5,6-dimethoxy-3-piperidin-4-yl-1,2-benzoxazole;hydrobromide Chemical compound Br.C1=2C=C(OC)C(OC)=CC=2ON=C1C1CCNCC1 TZCMGPJERRJNNQ-UHFFFAOYSA-N 0.000 description 1
- HSOJFILHZZEWJT-UHFFFAOYSA-N 5-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride Chemical compound Cl.C12=CC(F)=CC=C2ON=C1C1CCNCC1 HSOJFILHZZEWJT-UHFFFAOYSA-N 0.000 description 1
- IKKJRRZJRGMHIL-UHFFFAOYSA-N 5-methoxy-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride Chemical compound Cl.C12=CC(OC)=CC=C2ON=C1C1CCNCC1 IKKJRRZJRGMHIL-UHFFFAOYSA-N 0.000 description 1
- CONKBQPVFMXDOV-QHCPKHFHSA-N 6-[(5S)-5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C[C@H]1CN(C(O1)=O)C1=CC2=C(NC(O2)=O)C=C1 CONKBQPVFMXDOV-QHCPKHFHSA-N 0.000 description 1
- ZCKSQWQFXUWOEF-UHFFFAOYSA-N 6-chloro-3-piperidin-1-ium-4-yl-1,2-benzoxazole;chloride Chemical compound Cl.N=1OC2=CC(Cl)=CC=C2C=1C1CCNCC1 ZCKSQWQFXUWOEF-UHFFFAOYSA-N 0.000 description 1
- VCXOIADMZMLVLV-UHFFFAOYSA-N 6-chloro-3-piperidin-1-yl-1,2-benzoxazole Chemical compound N=1OC2=CC(Cl)=CC=C2C=1N1CCCCC1 VCXOIADMZMLVLV-UHFFFAOYSA-N 0.000 description 1
- DNXQAJSZBSKIDF-UHFFFAOYSA-N 6-fluoro-3-piperidin-1-yl-1,2-benzoxazole Chemical compound N=1OC2=CC(F)=CC=C2C=1N1CCCCC1 DNXQAJSZBSKIDF-UHFFFAOYSA-N 0.000 description 1
- PPLJSLRWXLGBJS-UHFFFAOYSA-N 6-methoxy-3-piperidin-4-yl-1,2-benzoxazole;hydrobromide Chemical compound Br.N=1OC2=CC(OC)=CC=C2C=1C1CCNCC1 PPLJSLRWXLGBJS-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 240000000662 Anethum graveolens Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VFTOGHIDEOGKRP-UHFFFAOYSA-N C(C)(=O)O.C(C)(=O)N1CCC(CC1)C(C1=C(C=CC(=C1)OC)O)=NO Chemical compound C(C)(=O)O.C(C)(=O)N1CCC(CC1)C(C1=C(C=CC(=C1)OC)O)=NO VFTOGHIDEOGKRP-UHFFFAOYSA-N 0.000 description 1
- 241000305772 Chionis Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-N Decanoic acid Natural products CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 1
- 241000257465 Echinoidea Species 0.000 description 1
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000016257 Mentha pulegium Nutrition 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- PTQCSYGNHKAEAL-UHFFFAOYSA-N OC=O.C=1C=C(Cl)C=C(Cl)C=1C(=NO)C1CCN(C=O)CC1 Chemical compound OC=O.C=1C=C(Cl)C=C(Cl)C=1C(=NO)C1CCN(C=O)CC1 PTQCSYGNHKAEAL-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- SKZKKFZAGNVIMN-UHFFFAOYSA-N Salicilamide Chemical compound NC(=O)C1=CC=CC=C1O SKZKKFZAGNVIMN-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- ZFXNQVKIENOWIT-UHFFFAOYSA-N [I].C1CCOC1 Chemical compound [I].C1CCOC1 ZFXNQVKIENOWIT-UHFFFAOYSA-N 0.000 description 1
- WGLGAMYMALNKFI-UHFFFAOYSA-N [[(1-acetylpiperidin-4-yl)-(2-hydroxy-4-methoxyphenyl)methylidene]amino] acetate Chemical compound OC1=CC(OC)=CC=C1C(=NOC(C)=O)C1CCN(C(C)=O)CC1 WGLGAMYMALNKFI-UHFFFAOYSA-N 0.000 description 1
- OZILBVTVQBXLTN-UHFFFAOYSA-N [[(1-acetylpiperidin-4-yl)-(5-fluoro-2-hydroxyphenyl)methylidene]amino] acetate Chemical compound CC(=O)ON=C(C1CCN(CC1)C(C)=O)c1cc(F)ccc1O OZILBVTVQBXLTN-UHFFFAOYSA-N 0.000 description 1
- LECIAANNZJDWCH-UHFFFAOYSA-N acetic acid 1-[4-[N-hydroxy-C-(2-hydroxy-4,5-dimethoxyphenyl)carbonimidoyl]piperidin-1-yl]ethanone Chemical compound C(C)(=O)O.C(C)(=O)N1CCC(CC1)C(C1=C(C=C(C(=C1)OC)OC)O)=NO LECIAANNZJDWCH-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- ORWKVZNEPHTCQE-UHFFFAOYSA-N acetic formic anhydride Chemical compound CC(=O)OC=O ORWKVZNEPHTCQE-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- PPQREHKVAOVYBT-UHFFFAOYSA-H aluminium carbonate Inorganic materials [Al+3].[Al+3].[O-]C([O-])=O.[O-]C([O-])=O.[O-]C([O-])=O PPQREHKVAOVYBT-UHFFFAOYSA-H 0.000 description 1
- 229940118662 aluminum carbonate Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000036592 analgesia Effects 0.000 description 1
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical group COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- NHMMJHHJXWPHHV-UHFFFAOYSA-N benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate Chemical compound N=1OC2=CC(OC)=CC=C2C=1C(CC1)CCN1C(=O)OCC1=CC=CC=C1 NHMMJHHJXWPHHV-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 238000005574 benzylation reaction Methods 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012455 biphasic mixture Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 238000003763 carbonization Methods 0.000 description 1
- GUPWNYUKYICHQX-UHFFFAOYSA-N carbonobromidic acid Chemical class OC(Br)=O GUPWNYUKYICHQX-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229940047583 cetamide Drugs 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 235000015218 chewing gum Nutrition 0.000 description 1
- 239000002036 chloroform fraction Substances 0.000 description 1
- ZVTQWXCKQTUVPY-UHFFFAOYSA-N chloromethylcyclopropane Chemical compound ClCC1CC1 ZVTQWXCKQTUVPY-UHFFFAOYSA-N 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229940127573 compound 38 Drugs 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000003074 decanoyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(*)=O 0.000 description 1
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- JHAYEQICABJSTP-UHFFFAOYSA-N decoquinate Chemical group N1C=C(C(=O)OCC)C(=O)C2=C1C=C(OCC)C(OCCCCCCCCCC)=C2 JHAYEQICABJSTP-UHFFFAOYSA-N 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000001891 dimethoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- MYTMXVHNEWBFAL-UHFFFAOYSA-L dipotassium;carbonate;hydrate Chemical compound O.[K+].[K+].[O-]C([O-])=O MYTMXVHNEWBFAL-UHFFFAOYSA-L 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- UZUODNWWWUQRIR-UHFFFAOYSA-L disodium;3-aminonaphthalene-1,5-disulfonate Chemical compound [Na+].[Na+].C1=CC=C(S([O-])(=O)=O)C2=CC(N)=CC(S([O-])(=O)=O)=C21 UZUODNWWWUQRIR-UHFFFAOYSA-L 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- RWLDAJMGAVDXSH-UHFFFAOYSA-N ethane-1,1,2-tricarboxylic acid Chemical compound OC(=O)CC(C(O)=O)C(O)=O RWLDAJMGAVDXSH-UHFFFAOYSA-N 0.000 description 1
- LBAQSKZHMLAFHH-UHFFFAOYSA-N ethoxyethane;hydron;chloride Chemical compound Cl.CCOCC LBAQSKZHMLAFHH-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- VGGRCVDNFAQIKO-UHFFFAOYSA-N formic anhydride Chemical compound O=COC=O VGGRCVDNFAQIKO-UHFFFAOYSA-N 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000002035 hexane extract Substances 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- RBBOWEDMXHTEPA-UHFFFAOYSA-N hexane;toluene Chemical compound CCCCCC.CC1=CC=CC=C1 RBBOWEDMXHTEPA-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 235000001050 hortel pimenta Nutrition 0.000 description 1
- BICAGYDGRXJYGD-UHFFFAOYSA-N hydrobromide;hydrochloride Chemical compound Cl.Br BICAGYDGRXJYGD-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 239000002655 kraft paper Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- XMGQYMWWDOXHJM-UHFFFAOYSA-N limonene Chemical compound CC(=C)C1CCC(C)=CC1 XMGQYMWWDOXHJM-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical class [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 229960001047 methyl salicylate Drugs 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- 229960001952 metrifonate Drugs 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- CCLBQTCJIJHCFE-UHFFFAOYSA-N n-(piperidin-4-ylmethylidene)hydroxylamine Chemical compound ON=CC1CCNCC1 CCLBQTCJIJHCFE-UHFFFAOYSA-N 0.000 description 1
- WOMDIPRBFFVCLD-UHFFFAOYSA-N n-[(2,4-dichlorophenyl)-piperidin-4-ylmethylidene]hydroxylamine;hydrochloride Chemical compound Cl.C=1C=C(Cl)C=C(Cl)C=1C(=NO)C1CCNCC1 WOMDIPRBFFVCLD-UHFFFAOYSA-N 0.000 description 1
- DAQWROFRHWHKFE-UHFFFAOYSA-N n-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine Chemical compound C=1C=C(F)C=C(F)C=1C(=NO)C1CCNCC1 DAQWROFRHWHKFE-UHFFFAOYSA-N 0.000 description 1
- BCJPWIZVJRVFDN-UHFFFAOYSA-N n-[(4-fluorophenyl)-(1-methylpiperidin-4-yl)methylidene]hydroxylamine Chemical compound C1CN(C)CCC1C(=NO)C1=CC=C(F)C=C1 BCJPWIZVJRVFDN-UHFFFAOYSA-N 0.000 description 1
- UVXXXESJTHCKLS-UHFFFAOYSA-N n-[phenyl(piperidin-1-yl)methylidene]hydroxylamine Chemical compound C=1C=CC=CC=1C(=NO)N1CCCCC1 UVXXXESJTHCKLS-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- DISPOJHKKXSCLS-UHFFFAOYSA-N n-diaminophosphorylmethanamine Chemical compound CNP(N)(N)=O DISPOJHKKXSCLS-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000005187 nonenyl group Chemical group C(=CCCCCCCC)* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000000346 nonvolatile oil Substances 0.000 description 1
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 1
- 239000007968 orange flavor Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- NGRNBVDYWKRIAB-UHFFFAOYSA-N phenyl 4-(1,2-benzoxazol-3-yl)piperidine-1-carboxylate Chemical compound C1CC(C=2C3=CC=CC=C3ON=2)CCN1C(=O)OC1=CC=CC=C1 NGRNBVDYWKRIAB-UHFFFAOYSA-N 0.000 description 1
- HUCOHLPCYIFQHX-UHFFFAOYSA-N phenyl 4-(4-fluoro-1,2-benzoxazol-3-yl)piperidine-1-carboxylate Chemical compound C1=2C(F)=CC=CC=2ON=C1C(CC1)CCN1C(=O)OC1=CC=CC=C1 HUCOHLPCYIFQHX-UHFFFAOYSA-N 0.000 description 1
- GGZDLAOKPXEJCP-UHFFFAOYSA-N phenyl piperidine-1-carboxylate Chemical compound C1CCCCN1C(=O)OC1=CC=CC=C1 GGZDLAOKPXEJCP-UHFFFAOYSA-N 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- AKEKKCGPLHMFCI-UHFFFAOYSA-L potassium sodium hydrogen carbonate Chemical compound [Na+].[K+].OC([O-])=O.OC([O-])=O AKEKKCGPLHMFCI-UHFFFAOYSA-L 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- DOKHEARVIDLSFF-UHFFFAOYSA-N prop-1-en-1-ol Chemical compound CC=CO DOKHEARVIDLSFF-UHFFFAOYSA-N 0.000 description 1
- XTUSEBKMEQERQV-UHFFFAOYSA-N propan-2-ol;hydrate Chemical compound O.CC(C)O XTUSEBKMEQERQV-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 238000012289 standard assay Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- NFACJZMKEDPNKN-UHFFFAOYSA-N trichlorfon Chemical compound COP(=O)(OC)C(O)C(Cl)(Cl)Cl NFACJZMKEDPNKN-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 235000012773 waffles Nutrition 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/26—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by nitrogen atoms
- C07D211/28—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by nitrogen atoms to which a second hetero atom is attached
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/30—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom
- C07D211/32—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pain & Pain Management (AREA)
- Medicinal Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US319871 | 1981-11-12 | ||
| US06/319,871 US4355037A (en) | 1981-11-12 | 1981-11-12 | 3-(4-Piperidyl)-1,2-benzisoxales |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5890582A JPS5890582A (ja) | 1983-05-30 |
| JPH0411546B2 true JPH0411546B2 (enExample) | 1992-02-28 |
Family
ID=23243957
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP57196885A Granted JPS5890582A (ja) | 1981-11-12 | 1982-11-11 | 3−(4−ピペリジル)−1,2−ベンズイソキサゾ−ル化合物 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4355037A (enExample) |
| EP (1) | EP0080104B1 (enExample) |
| JP (1) | JPS5890582A (enExample) |
| KR (1) | KR880002012B1 (enExample) |
| AT (1) | ATE39251T1 (enExample) |
| AU (2) | AU567865B2 (enExample) |
| CA (1) | CA1215066A (enExample) |
| DE (1) | DE3279282D1 (enExample) |
| ES (3) | ES517245A0 (enExample) |
| IE (1) | IE54857B1 (enExample) |
| ZA (1) | ZA828281B (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5835177A (ja) * | 1981-08-26 | 1983-03-01 | Dainippon Pharmaceut Co Ltd | 2−環状アミノ−2−(1,2−ベンズイソキサゾ−ル−3−イル)酢酸エステル類並びにその酸付加塩類および第4級アンモニウム塩類 |
| US4355037A (en) * | 1981-11-12 | 1982-10-19 | Hoechst-Roussel Pharmaceuticals | 3-(4-Piperidyl)-1,2-benzisoxales |
| US4408054A (en) * | 1981-11-12 | 1983-10-04 | Hoechst-Roussel Pharmaceuticals Inc. | Oximes of 4-benzoyl-piperidines |
| US4528376A (en) * | 1982-08-11 | 1985-07-09 | Hoechst-Roussel Pharmaceuticals Inc. | 3-(4-Piperidyl)-1,2-benzisoxazoles |
| US4458076A (en) * | 1983-05-31 | 1984-07-03 | Hoechst-Roussel Pharmaceuticals | 3-(4-Piperidinyl)-1,2-benzisothiazoles |
| US4528292A (en) * | 1984-04-23 | 1985-07-09 | Hoechst-Roussel Pharmaceuticals Inc. | Antihypertensive 1,2-benzisothiazole piperidines |
| US4590196A (en) * | 1984-08-23 | 1986-05-20 | Bristol-Myers Company | Analgesic 1,2-benzisothiazol-3-ylpiperazine derivatives |
| ATE61054T1 (de) * | 1985-01-23 | 1991-03-15 | Hoechst Roussel Pharma | 3-piperidinyl- 1h-indazole, verfahren zu deren herstellung und deren anwendung als arzneimittel. |
| US5057611A (en) * | 1985-04-22 | 1991-10-15 | Hoechst-Roussel Pharmaceuticals Inc. | Benzoylpiperidines |
| EP0243184A3 (en) * | 1986-04-25 | 1989-05-10 | Roussel-Uclaf | Pesticidal compounds |
| JPS63185141A (ja) * | 1987-01-27 | 1988-07-30 | Daikin Ind Ltd | 空気調和機のデ−タ伝送方式 |
| CA1335289C (en) * | 1987-10-26 | 1995-04-18 | Fujio Antoku | Piperidinyl benzisoxazole derivatives, their production and pharmaceutical use |
| GR1000667B (el) * | 1988-03-21 | 1992-09-25 | Janssen Pharmaceutica Nv | Μεθοδος παρασκευης 3-πιπεριδινυλο-1,2-βενζισοξαζολων. |
| FR2641278B1 (fr) * | 1989-01-05 | 1991-03-22 | Lipha | Piperidines, procedes de preparation et medicaments les contenant |
| US5776963A (en) * | 1989-05-19 | 1998-07-07 | Hoechst Marion Roussel, Inc. | 3-(heteroaryl)-1- (2,3-dihydro-1h-isoindol-2-yl)alkyl!pyrrolidines and 3-(heteroaryl)-1- (2,3-dihydro-1h-indol-1-yl)alkyl!pyrrolidines and related compounds and their therapeutic untility |
| US5561128A (en) * | 1989-05-19 | 1996-10-01 | Hoechst-Roussel Pharmaceuticals, Inc. | N-[(4-(heteroaryl)-1-piperidinyl)alkyl]-10,11-dihydro-5H-dibenz[B,F]azepines and related compounds and their therapeutic utility |
| DK0402644T3 (da) * | 1989-05-19 | 1996-01-02 | Hoechst Roussel Pharma | N-(Aryloxyalkyl)-heteroarylpiperidiner og -heteroarylpiperaziner, fremgangsmåde til deres fremstilli ng samt deres anvendelse som medikamenter |
| US5364866A (en) * | 1989-05-19 | 1994-11-15 | Hoechst-Roussel Pharmaceuticals, Inc. | Heteroarylpiperidines, pyrrolidines and piperazines and their use as antipsychotics and analetics |
| FR2654104B1 (fr) * | 1989-11-07 | 1992-01-03 | Adir | Nouveaux derives du 1,2-benzisoxazole, leurs procedes de preparation et les compositions pharmaceutiques qui les contiennent. |
| NZ236501A (en) * | 1989-12-21 | 1992-12-23 | Merrell Dow Pharma | Piperidine derivatives and antithrombotic compositions |
| FR2671350A1 (fr) * | 1991-01-08 | 1992-07-10 | Adir | Nouveaux derives de benzisoxazole et de benzisothiazole, leur procede de preparation, et les compositions pharmaceutiques les renfermant. |
| JP2800953B2 (ja) * | 1990-07-06 | 1998-09-21 | 住友製薬株式会社 | 新規なイミド誘導体 |
| US5055476A (en) * | 1990-08-13 | 1991-10-08 | Hoechst-Roussel Pharmaceuticals Incorporated | 3-(1,2-benzisoxazol-3-yl)-4-pyridinamines and derivatives |
| US7091199B1 (en) | 1999-09-14 | 2006-08-15 | Aventis Pharmaceuticals Inc. | Thienoisoxazole phenoxy unsubstituted ethyl and propyl derivatives useful as d4 antagonists |
| US7253165B2 (en) * | 1999-09-14 | 2007-08-07 | Aventis Pharmaceuticals Inc. | Benzisoxazolyl-, pyridoisoxazolyl-and benzthienyl-phenoxy derivatives useful as D4 antagonists |
| US7125903B1 (en) | 1999-09-14 | 2006-10-24 | Aventis Pharmaceuticals Inc. | Thienoisoxazolyl-and thienylpyrrazolyl-phenoxy substituted propyl derivatives useful as D4 antagonists |
| AU2000255635A1 (en) | 2000-05-05 | 2001-11-20 | Rpg Life Sciences Limited | A process for the preparation of anti-pschotic 3-(2-(4-(6-fluoro-1,2-benzisoxazol-3-yl)-1-piperidinyl)ethyl -6,7,8,9-tetrahydro-2-methyl-4h-pyridol(1,2,-a)pyrimidin-4- one |
| CN111518019B (zh) * | 2019-02-01 | 2023-10-24 | 江苏豪森药业集团有限公司 | 一种棕榈酸帕里哌酮中间体的制备方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2517695A (en) * | 1945-07-13 | 1950-08-08 | Ciba Pharm Prod Inc | Production of 1-alkyl 4-phenylpiperidyl 4-ketones |
| JPS5545545B2 (enExample) * | 1972-03-17 | 1980-11-18 | ||
| DE2245971A1 (de) * | 1972-07-13 | 1974-03-14 | Merck Patent Gmbh | Isoxazolderivate und verfahren zu ihrer herstellung |
| US4217349A (en) * | 1974-07-01 | 1980-08-12 | Sumitomo Chemical Company, Limited | Benzisoxazole derivatives |
| US4335127A (en) * | 1979-01-08 | 1982-06-15 | Janssen Pharmaceutica, N.V. | Piperidinylalkyl quinazoline compounds, composition and method of use |
| US4342870A (en) * | 1980-03-28 | 1982-08-03 | Janssen Pharmaceutica N.V. | Novel 3-(1-piperidinylalkyl)-4H-pyrido[1,2-a]pyrimidin-4-one derivatives |
| US4355037A (en) * | 1981-11-12 | 1982-10-19 | Hoechst-Roussel Pharmaceuticals | 3-(4-Piperidyl)-1,2-benzisoxales |
| US4352811A (en) * | 1981-11-12 | 1982-10-05 | Hoechst-Roussel Pharmaceuticals Inc. | 3-(1-Substituted-4-piperidyl)-1,2-benzisoxazoles |
-
1981
- 1981-11-12 US US06/319,871 patent/US4355037A/en not_active Expired - Lifetime
-
1982
- 1982-11-09 AT AT82110318T patent/ATE39251T1/de not_active IP Right Cessation
- 1982-11-09 DE DE8282110318T patent/DE3279282D1/de not_active Expired
- 1982-11-09 EP EP82110318A patent/EP0080104B1/en not_active Expired
- 1982-11-10 CA CA000415352A patent/CA1215066A/en not_active Expired
- 1982-11-10 KR KR8205082A patent/KR880002012B1/ko not_active Expired
- 1982-11-10 ES ES517245A patent/ES517245A0/es active Granted
- 1982-11-11 JP JP57196885A patent/JPS5890582A/ja active Granted
- 1982-11-11 IE IE2684/82A patent/IE54857B1/en not_active IP Right Cessation
- 1982-11-11 ZA ZA828281A patent/ZA828281B/xx unknown
- 1982-11-11 AU AU90390/82A patent/AU567865B2/en not_active Ceased
-
1984
- 1984-02-01 ES ES529370A patent/ES529370A0/es active Granted
- 1984-02-01 ES ES529369A patent/ES529369A0/es active Granted
-
1988
- 1988-02-08 AU AU11385/88A patent/AU612621B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| ES8601193A1 (es) | 1985-09-16 |
| ES8507519A1 (es) | 1985-09-01 |
| AU612621B2 (en) | 1991-07-18 |
| IE54857B1 (en) | 1990-02-28 |
| ES529370A0 (es) | 1985-09-01 |
| ES529369A0 (es) | 1985-09-16 |
| EP0080104A3 (en) | 1983-08-24 |
| ES8405791A1 (es) | 1984-06-16 |
| JPS5890582A (ja) | 1983-05-30 |
| ATE39251T1 (de) | 1988-12-15 |
| ES517245A0 (es) | 1984-06-16 |
| AU9039082A (en) | 1983-05-19 |
| KR840002377A (ko) | 1984-06-25 |
| CA1215066A (en) | 1986-12-09 |
| US4355037A (en) | 1982-10-19 |
| EP0080104B1 (en) | 1988-12-14 |
| KR880002012B1 (ko) | 1988-10-12 |
| EP0080104A2 (en) | 1983-06-01 |
| AU1138588A (en) | 1988-05-19 |
| AU567865B2 (en) | 1987-12-10 |
| IE822684L (en) | 1983-05-12 |
| ZA828281B (en) | 1983-09-28 |
| DE3279282D1 (en) | 1989-01-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0411546B2 (enExample) | ||
| RU2062776C1 (ru) | Способ получения замещенных n-(арилоксиалкил)-гетероарилпиперидина или гетероарилпиперазина | |
| US4352811A (en) | 3-(1-Substituted-4-piperidyl)-1,2-benzisoxazoles | |
| JP2722279B2 (ja) | アミノメチレンで置換した非芳香族複素環式化合物及びサブスタンスpのアンタゴニストとしての使用 | |
| JPH051792B2 (enExample) | ||
| US5633266A (en) | Azacyclic compounds compositions containing them and their use as tachykinin antagonists | |
| US5674889A (en) | Aromatic compounds, compositions containing them and their use in therapy | |
| US4670447A (en) | Antipsychotic 3-(piperidinyl)- and 3-(pyrrolidinyl)-1H-indazoles | |
| TWI353834B (en) | Aryl- and heteroarylpiperidinecarboxylate derivati | |
| EP0127167A2 (en) | 3-(4-Piperidinyl)-1,2-benzisothiazoles and derivatives, a process for their preparation and their use as medicaments | |
| JP2001504129A (ja) | ピリジン―2―イル―メチルアミン誘導体、それらの製造方法および医薬としてのそれらの適用 | |
| CN1329609A (zh) | 用作多巴胺d3受体调制剂(精神抑制药)的四氢苯并氮杂䓬衍生物 | |
| US4408054A (en) | Oximes of 4-benzoyl-piperidines | |
| EP0552213A1 (en) | 1,2,5,6-tetrahydropyridine oxime derivatives | |
| US4528376A (en) | 3-(4-Piperidyl)-1,2-benzisoxazoles | |
| US4469869A (en) | 3-(4-Piperidinium)-1,2-benzisoxazoles | |
| US4408053A (en) | (4-Piperidyl)-substituted phenyl ketones | |
| EP0091512A2 (en) | 6-Fluoro-3-(3-(1-heterocyclo)propyl)-1,2-benzisoxazoles, a process for their preparation, pharmaceutical compositions thereof and their use as medicaments | |
| KR880002592B1 (ko) | 벤조일 피페리딘 | |
| WO2002072567A2 (en) | Heterocyclic compounds, process for their preparation and pharmaceutical compositions containing them | |
| JPS58177989A (ja) | 1−〔3−(6−フルオロ−1,2−ベンズイソキサゾ−ル−3−イル)プロピル〕−4−ヒドロキシ−4−フエニルピペリジン | |
| US4810792A (en) | Piperidine intermediates | |
| US4524074A (en) | 3-(4-Piperidinyl)-1,2-benzisothiazoles | |
| WO1994005646A1 (fr) | Derive de carboxamide a activite optique | |
| US4558056A (en) | Analgesic 3-(4-piperidinyl)-1,2-benzisothiazoles |