JPH0160062B2 - - Google Patents
Info
- Publication number
- JPH0160062B2 JPH0160062B2 JP55116541A JP11654180A JPH0160062B2 JP H0160062 B2 JPH0160062 B2 JP H0160062B2 JP 55116541 A JP55116541 A JP 55116541A JP 11654180 A JP11654180 A JP 11654180A JP H0160062 B2 JPH0160062 B2 JP H0160062B2
- Authority
- JP
- Japan
- Prior art keywords
- weight
- parts
- acrylate
- polycarbonate
- methacrylate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001577 copolymer Polymers 0.000 claims description 40
- 229920000515 polycarbonate Polymers 0.000 claims description 40
- 239000004417 polycarbonate Substances 0.000 claims description 40
- 239000000203 mixture Substances 0.000 claims description 30
- 125000003118 aryl group Chemical group 0.000 claims description 20
- -1 polyethylene Polymers 0.000 claims description 20
- 229920000098 polyolefin Polymers 0.000 claims description 13
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical group COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 10
- 239000004698 Polyethylene Substances 0.000 claims description 10
- 239000004743 Polypropylene Substances 0.000 claims description 10
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 claims description 10
- 229920000573 polyethylene Polymers 0.000 claims description 10
- 229920001155 polypropylene Polymers 0.000 claims description 10
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 6
- 150000002989 phenols Chemical class 0.000 claims description 6
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 claims description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 claims description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 claims description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 claims description 4
- VDYWHVQKENANGY-UHFFFAOYSA-N 1,3-Butyleneglycol dimethacrylate Chemical compound CC(=C)C(=O)OC(C)CCOC(=O)C(C)=C VDYWHVQKENANGY-UHFFFAOYSA-N 0.000 claims description 2
- RUMACXVDVNRZJZ-UHFFFAOYSA-N 2-methylpropyl 2-methylprop-2-enoate Chemical compound CC(C)COC(=O)C(C)=C RUMACXVDVNRZJZ-UHFFFAOYSA-N 0.000 claims description 2
- CFVWNXQPGQOHRJ-UHFFFAOYSA-N 2-methylpropyl prop-2-enoate Chemical compound CC(C)COC(=O)C=C CFVWNXQPGQOHRJ-UHFFFAOYSA-N 0.000 claims description 2
- FQMIAEWUVYWVNB-UHFFFAOYSA-N 3-prop-2-enoyloxybutyl prop-2-enoate Chemical compound C=CC(=O)OC(C)CCOC(=O)C=C FQMIAEWUVYWVNB-UHFFFAOYSA-N 0.000 claims description 2
- JHWGFJBTMHEZME-UHFFFAOYSA-N 4-prop-2-enoyloxybutyl prop-2-enoate Chemical compound C=CC(=O)OCCCCOC(=O)C=C JHWGFJBTMHEZME-UHFFFAOYSA-N 0.000 claims description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 claims description 2
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 claims description 2
- 150000002734 metacrylic acid derivatives Chemical class 0.000 claims description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 claims description 2
- 239000001294 propane Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 description 16
- 238000009863 impact test Methods 0.000 description 11
- 229920005668 polycarbonate resin Polymers 0.000 description 8
- 239000004431 polycarbonate resin Substances 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 5
- 230000032683 aging Effects 0.000 description 4
- 229920005606 polypropylene copolymer Polymers 0.000 description 4
- 239000000463 material Substances 0.000 description 3
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 229920001897 terpolymer Polymers 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- MLDIQALUMKMHCC-UHFFFAOYSA-N 4,4-Bis(4-hydroxyphenyl)heptane Chemical compound C=1C=C(O)C=CC=1C(CCC)(CCC)C1=CC=C(O)C=C1 MLDIQALUMKMHCC-UHFFFAOYSA-N 0.000 description 1
- UGJDYDMDCFFNGY-UHFFFAOYSA-N BrC1(CC(=CC(C1(O)O)(Br)Br)C(C)C)Br Chemical compound BrC1(CC(=CC(C1(O)O)(Br)Br)C(C)C)Br UGJDYDMDCFFNGY-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004653 carbonic acids Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J23/00—Details of transit-time tubes of the types covered by group H01J25/00
- H01J23/02—Electrodes; Magnetic control means; Screens
- H01J23/08—Focusing arrangements, e.g. for concentrating stream of electrons, for preventing spreading of stream
- H01J23/087—Magnetic focusing arrangements
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01F—MAGNETS; INDUCTANCES; TRANSFORMERS; SELECTION OF MATERIALS FOR THEIR MAGNETIC PROPERTIES
- H01F7/00—Magnets
- H01F7/02—Permanent magnets [PM]
- H01F7/0273—Magnetic circuits with PM for magnetic field generation
- H01F7/0278—Magnetic circuits with PM for magnetic field generation for generating uniform fields, focusing, deflecting electrically charged particles
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/069,825 US4245058A (en) | 1979-08-27 | 1979-08-27 | Polycarbonate compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5649751A JPS5649751A (en) | 1981-05-06 |
| JPH0160062B2 true JPH0160062B2 (US07714131-20100511-C00001.png) | 1989-12-20 |
Family
ID=22091444
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP11654180A Granted JPS5649751A (en) | 1979-08-27 | 1980-08-26 | Polycarbonate composition |
Country Status (9)
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4340683A (en) * | 1979-08-27 | 1982-07-20 | General Electric Company | Polycarbonate compositions |
| US4299928A (en) * | 1980-03-14 | 1981-11-10 | Mobay Chemical Corporation | Impact modified polycarbonates |
| US4378449A (en) * | 1980-03-14 | 1983-03-29 | Mobay Chemical Corporation | Impact modified polycarbonates |
| JPS57125251A (en) * | 1981-01-27 | 1982-08-04 | Teijin Chem Ltd | Polycarbonate resin composition |
| WO1982002897A1 (en) * | 1981-02-26 | 1982-09-02 | Gen Electric | Compositions of an aromatic carbonate polymer,a butadiene styrene copolymer and an acrylate copolymer |
| DE3118526A1 (de) * | 1981-05-09 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | "thermoplastische formmassen aus polycarbonat, polyalkylenterephthalat und pfropfpolymerisat" |
| JPS5834850A (ja) * | 1981-08-24 | 1983-03-01 | Teijin Chem Ltd | ポリカ−ボネ−ト樹脂組成物 |
| US4390657A (en) * | 1981-10-19 | 1983-06-28 | General Electric Company | Composition of polycarbonate, an ABS resin and an acrylate-methacrylate interpolymer |
| US4397982A (en) * | 1981-10-30 | 1983-08-09 | General Electric Company | Compositions |
| US4430475A (en) | 1981-12-31 | 1984-02-07 | Mobay Chemical Corporation | Alkylated aromatic polycarbonate compositions of improved impact strength |
| US4401785A (en) * | 1982-01-29 | 1983-08-30 | General Electric Company | Polyolefin-poly(ester-carbonate) composition |
| US4464512A (en) * | 1982-01-29 | 1984-08-07 | General Electric Company | Composition comprising an aromatic polyester-carbonate resin and a linear low density polyolefin polymer |
| JPS58147451A (ja) * | 1982-02-27 | 1983-09-02 | Idemitsu Petrochem Co Ltd | ポリカ−ボネ−ト系樹脂組成物 |
| US4515921A (en) * | 1982-07-21 | 1985-05-07 | Mobay Chemical Corporation | Polycarbonate compositions having a high impact strength and melt flow rate |
| US4562222A (en) * | 1982-09-23 | 1985-12-31 | General Electric Company | Polycarbonate resin mixtures |
| EP0106097B1 (en) * | 1982-09-23 | 1987-05-13 | General Electric Company | Polycarbonate resin mixtures |
| US4456725A (en) * | 1982-12-20 | 1984-06-26 | General Electric Company | Compositions comprising polycarbonates, acrylate resins, and aliphatic hydrocarbons |
| US4520164A (en) * | 1982-12-22 | 1985-05-28 | General Electric Company | Blends of aromatic polycarbonate resins, polyolefins and olefin copolymers, and acrylate interpolymer resins |
| US4532282A (en) * | 1983-03-16 | 1985-07-30 | General Electric Company | Blends of aromatic polycarbonate resin, olefin polymers or copolymers and acrylate- or methacrylate-copolymer resins |
| JPS59191758A (ja) * | 1983-04-15 | 1984-10-30 | Idemitsu Petrochem Co Ltd | ポリカ−ボネ−ト樹脂組成物 |
| US4677162A (en) * | 1983-04-15 | 1987-06-30 | Mobay Corporation | Polycarbonate blends having low gloss |
| US4548991A (en) * | 1983-05-09 | 1985-10-22 | The Dow Chemical Company | Blends of polycarbonate or polyestercarbonate with 4-methyl-1-pentene polymers |
| US4704432A (en) * | 1983-05-09 | 1987-11-03 | The Dow Chemical Company | Blends of polyestercarbonate with 4-methyl-1-pentene polymers |
| US4847153A (en) * | 1983-07-13 | 1989-07-11 | Mobay Corporation | Metal plated molded compositions containing polycarbonate and a certain ABS resin |
| JPS6020956A (ja) * | 1983-07-15 | 1985-02-02 | Teijin Chem Ltd | 艶消しポリカ−ボネ−ト樹脂組成物 |
| US4581397A (en) * | 1983-09-29 | 1986-04-08 | Mobay Corporation | Stabilized polycarbonate composition |
| DE3518538A1 (de) * | 1985-05-23 | 1986-11-27 | Röhm GmbH, 6100 Darmstadt | Vertraegliche polymermischungen |
| DE3743199A1 (de) * | 1987-12-19 | 1989-06-29 | Roehm Gmbh | Schlagzaeh-modifizierungsmittel fuer kunststoffe |
| US5219935A (en) * | 1987-12-19 | 1993-06-15 | Rohm Gmbh | Impact modified synthetic resins |
| US5352500A (en) * | 1988-02-08 | 1994-10-04 | Rohm And Haas Company | Thermoplastic polymer compositions containing melt-rheology modifiers |
| US5416148B1 (en) * | 1994-09-09 | 1999-03-02 | Dow Chemical Co | Blends of polycarbonate and ethylene polymers |
| CA2215401A1 (en) * | 1995-04-07 | 1996-10-10 | Hani Farah | Blends of polycarbonate and linear ethylene polymers |
| WO2013100452A1 (ko) * | 2011-12-29 | 2013-07-04 | 제일모직주식회사 | 열경화성 수지의 제조방법 및 이의 성형품 |
| US10385206B2 (en) * | 2014-12-02 | 2019-08-20 | Teijin Limited | Polycarbonate resin composition and molded article thereof |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3431224A (en) * | 1962-07-11 | 1969-03-04 | Gen Electric | Polycarbonate resin mixtures |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL294840A (US07714131-20100511-C00001.png) * | 1962-07-04 | |||
| GB982753A (en) * | 1962-11-10 | 1965-02-10 | Canadian Ind | Improvements in and relating to polyolefine compositions |
| GB1182807A (en) * | 1967-08-03 | 1970-03-04 | Ici Ltd | Thermoplastic Polymeric Compositions |
| BE782372R (en) * | 1968-04-15 | 1972-10-20 | Monsanto Co | Thermoplastic resin compsn - contg liquid acrylic ester (co) polymer as lubricant |
| AU462964B2 (en) * | 1972-01-03 | 1975-06-25 | General Electric Company | An improved polycarbonate molding composition |
| US3801673A (en) * | 1972-01-03 | 1974-04-02 | Gen Electric | Process for preparing polycarbonate alloys |
| CA1019876A (en) * | 1972-01-24 | 1977-10-25 | Robert L. Lauchlan | Modified polycarbonate compositions |
| JPS5128112B2 (US07714131-20100511-C00001.png) * | 1972-06-13 | 1976-08-17 | ||
| DE2320786A1 (de) * | 1973-04-25 | 1974-11-14 | Texaco Development Corp | Polycarbonatharz - zusammensetzung erhoehter schlagzaehigkeit |
| US4148842A (en) * | 1978-06-15 | 1979-04-10 | Stauffer Chemical Company | Blends of a polycarbonate resin and interpolymer modifier |
-
1979
- 1979-08-27 US US06/069,825 patent/US4245058A/en not_active Expired - Lifetime
-
1980
- 1980-08-15 GB GB8026650A patent/GB2057463B/en not_active Expired
- 1980-08-21 DE DE3031560A patent/DE3031560C2/de not_active Expired - Lifetime
- 1980-08-26 AU AU61741/80A patent/AU539150B2/en not_active Expired
- 1980-08-26 JP JP11654180A patent/JPS5649751A/ja active Granted
- 1980-08-26 FR FR8018516A patent/FR2464285B1/fr not_active Expired
- 1980-08-26 NL NLAANVRAGE8004812,A patent/NL187636C/xx not_active IP Right Cessation
- 1980-08-27 BR BR8005451A patent/BR8005451A/pt not_active IP Right Cessation
- 1980-08-27 MX MX183704A patent/MX155421A/es unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3431224A (en) * | 1962-07-11 | 1969-03-04 | Gen Electric | Polycarbonate resin mixtures |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3031560A1 (de) | 1981-03-19 |
| NL187636C (nl) | 1991-12-02 |
| US4245058A (en) | 1981-01-13 |
| JPS5649751A (en) | 1981-05-06 |
| DE3031560C2 (de) | 1994-02-24 |
| GB2057463B (en) | 1983-05-18 |
| GB2057463A (en) | 1981-04-01 |
| NL8004812A (nl) | 1981-03-03 |
| BR8005451A (pt) | 1981-03-10 |
| FR2464285A1 (fr) | 1981-03-06 |
| FR2464285B1 (fr) | 1986-06-06 |
| AU6174180A (en) | 1981-03-05 |
| AU539150B2 (en) | 1984-09-13 |
| NL187636B (nl) | 1991-07-01 |
| MX155421A (es) | 1988-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0160062B2 (US07714131-20100511-C00001.png) | ||
| US4260693A (en) | Polycarbonate compositions | |
| US4320212A (en) | Ternary polycarbonate compositions containing polyacrylate and thermoplastic polyester | |
| US4263416A (en) | Polycarbonate compositions | |
| US4263415A (en) | Polycarbonate compositions | |
| JPH02380B2 (US07714131-20100511-C00001.png) | ||
| US4251647A (en) | Ternary polycarbonate compositions | |
| US4496693A (en) | Compatibilization of polycarbonate blends | |
| US4255534A (en) | Binary polycarbonate compositions | |
| US4340683A (en) | Polycarbonate compositions | |
| US4539358A (en) | Polycarbonate compositions | |
| EP0085046B1 (en) | Polycarbonate compositions | |
| JPH0639747A (ja) | 電動工具の外殻 | |
| CA1145092A (en) | Polycarbonate compositions | |
| CA1145093A (en) | Polycarbonate compositions | |
| AU543450B2 (en) | Ternary polycarbonate compositions containing polyacrylate and thermoplastic polyester | |
| AU543449B2 (en) | Polycarbonate compositions | |
| JPS63199752A (ja) | ２成分系ポリカーボネートブレンド | |
| CA1145091A (en) | Polycarbonate compositions | |
| JPS58500367A (ja) | 組成物 | |
| US4552924A (en) | Compatibilization of polycarbonate blends | |
| AU8147582A (en) | Compositions of an aromatic carbonate polymer, a butadiene styrene copolymer and an acrylate copolymer |
