JPH0146053B2 - - Google Patents
Info
- Publication number
- JPH0146053B2 JPH0146053B2 JP58169321A JP16932183A JPH0146053B2 JP H0146053 B2 JPH0146053 B2 JP H0146053B2 JP 58169321 A JP58169321 A JP 58169321A JP 16932183 A JP16932183 A JP 16932183A JP H0146053 B2 JPH0146053 B2 JP H0146053B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- silver
- dye
- gelatin
- heat
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 silver halide Chemical class 0.000 claims description 110
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 58
- 239000000463 material Substances 0.000 claims description 57
- 108010010803 Gelatin Proteins 0.000 claims description 56
- 229920000159 gelatin Polymers 0.000 claims description 56
- 239000008273 gelatin Substances 0.000 claims description 56
- 235000019322 gelatine Nutrition 0.000 claims description 56
- 235000011852 gelatine desserts Nutrition 0.000 claims description 56
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 49
- 229910052709 silver Inorganic materials 0.000 claims description 42
- 239000004332 silver Substances 0.000 claims description 42
- 238000006116 polymerization reaction Methods 0.000 claims description 27
- 239000003638 chemical reducing agent Substances 0.000 claims description 22
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 claims description 21
- 239000011230 binding agent Substances 0.000 claims description 20
- 239000010410 layer Substances 0.000 description 56
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 55
- 239000000975 dye Substances 0.000 description 49
- 239000000126 substance Substances 0.000 description 37
- 125000000217 alkyl group Chemical group 0.000 description 32
- 238000000034 method Methods 0.000 description 28
- 150000001875 compounds Chemical class 0.000 description 25
- 239000000839 emulsion Substances 0.000 description 19
- 125000003545 alkoxy group Chemical group 0.000 description 18
- 125000004432 carbon atom Chemical group C* 0.000 description 18
- 125000001424 substituent group Chemical group 0.000 description 18
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 16
- 238000011161 development Methods 0.000 description 16
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 15
- 150000003839 salts Chemical class 0.000 description 15
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 14
- 239000003795 chemical substances by application Substances 0.000 description 14
- 238000012546 transfer Methods 0.000 description 14
- 229920000642 polymer Polymers 0.000 description 13
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 13
- 125000003118 aryl group Chemical group 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 12
- 239000000243 solution Substances 0.000 description 10
- IBWXIFXUDGADCV-UHFFFAOYSA-N 2h-benzotriazole;silver Chemical compound [Ag].C1=CC=C2NN=NC2=C1 IBWXIFXUDGADCV-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 9
- 238000000576 coating method Methods 0.000 description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 9
- 125000005843 halogen group Chemical group 0.000 description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 9
- 238000007127 saponification reaction Methods 0.000 description 9
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical group NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 8
- 150000003863 ammonium salts Chemical class 0.000 description 8
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 8
- 239000011248 coating agent Substances 0.000 description 8
- 230000002209 hydrophobic effect Effects 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 7
- 229910052740 iodine Inorganic materials 0.000 description 7
- 125000005647 linker group Chemical group 0.000 description 7
- 239000000123 paper Substances 0.000 description 7
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 7
- 229920000139 polyethylene terephthalate Polymers 0.000 description 7
- 239000005020 polyethylene terephthalate Substances 0.000 description 7
- 239000002243 precursor Substances 0.000 description 7
- 159000000000 sodium salts Chemical class 0.000 description 7
- 229920002554 vinyl polymer Polymers 0.000 description 7
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 6
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 6
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 150000003378 silver Chemical class 0.000 description 6
- AOPRXJXHLWYPQR-UHFFFAOYSA-N 2-phenoxyacetamide Chemical group NC(=O)COC1=CC=CC=C1 AOPRXJXHLWYPQR-UHFFFAOYSA-N 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 206010070834 Sensitisation Diseases 0.000 description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 238000009792 diffusion process Methods 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 5
- 230000008313 sensitization Effects 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- QGKMIGUHVLGJBR-UHFFFAOYSA-M (4z)-1-(3-methylbutyl)-4-[[1-(3-methylbutyl)quinolin-1-ium-4-yl]methylidene]quinoline;iodide Chemical compound [I-].C12=CC=CC=C2N(CCC(C)C)C=CC1=CC1=CC=[N+](CCC(C)C)C2=CC=CC=C12 QGKMIGUHVLGJBR-UHFFFAOYSA-M 0.000 description 4
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 125000001769 aryl amino group Chemical group 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical class C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 4
- DKPFZGUDAPQIHT-UHFFFAOYSA-N butyl acetate Chemical compound CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- 230000001808 coupling effect Effects 0.000 description 4
- ILRSCQWREDREME-UHFFFAOYSA-N dodecanamide Chemical compound CCCCCCCCCCCC(N)=O ILRSCQWREDREME-UHFFFAOYSA-N 0.000 description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 4
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 4
- 229940124530 sulfonamide Drugs 0.000 description 4
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 4
- 125000003944 tolyl group Chemical group 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 3
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- JKFYKCYQEWQPTM-UHFFFAOYSA-N 2-azaniumyl-2-(4-fluorophenyl)acetate Chemical compound OC(=O)C(N)C1=CC=C(F)C=C1 JKFYKCYQEWQPTM-UHFFFAOYSA-N 0.000 description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- 229910021612 Silver iodide Inorganic materials 0.000 description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 3
- 229910001864 baryta Inorganic materials 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 3
- 239000011630 iodine Chemical group 0.000 description 3
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 3
- 229920000620 organic polymer Polymers 0.000 description 3
- 238000005691 oxidative coupling reaction Methods 0.000 description 3
- 238000005191 phase separation Methods 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical compound [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 3
- 229940045105 silver iodide Drugs 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- 239000003232 water-soluble binding agent Substances 0.000 description 3
- 229920003169 water-soluble polymer Polymers 0.000 description 3
- AFBBKYQYNPNMAT-UHFFFAOYSA-N 1h-1,2,4-triazol-1-ium-3-thiolate Chemical compound SC=1N=CNN=1 AFBBKYQYNPNMAT-UHFFFAOYSA-N 0.000 description 2
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 2
- SGWZVZZVXOJRAQ-UHFFFAOYSA-N 2,6-Dimethyl-1,4-benzenediol Chemical compound CC1=CC(O)=CC(C)=C1O SGWZVZZVXOJRAQ-UHFFFAOYSA-N 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 2
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 2
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical group COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- VYCUUOHOBUPEPJ-UHFFFAOYSA-N 2-phenoxybutanamide Chemical compound CCC(C(N)=O)OC1=CC=CC=C1 VYCUUOHOBUPEPJ-UHFFFAOYSA-N 0.000 description 2
- IMLAIXAZMVDRGA-UHFFFAOYSA-N 2-phenoxyethanamine Chemical group NCCOC1=CC=CC=C1 IMLAIXAZMVDRGA-UHFFFAOYSA-N 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- DNMNQAUVYXEIKX-UHFFFAOYSA-N 2H-benzotriazol-4-ol silver Chemical compound [Ag].Oc1cccc2[nH]nnc12 DNMNQAUVYXEIKX-UHFFFAOYSA-N 0.000 description 2
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 2
- MLCZOHLVCQVKPI-UHFFFAOYSA-N 4-methyl-2h-benzotriazole;silver Chemical compound [Ag].CC1=CC=CC2=C1N=NN2 MLCZOHLVCQVKPI-UHFFFAOYSA-N 0.000 description 2
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 2
- VPKWVNHDLVBJNG-UHFFFAOYSA-N 5-nitro-2H-benzotriazol-4-ol silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)[N+](=O)[O-] VPKWVNHDLVBJNG-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- DZHNOPAFFBNBKJ-UHFFFAOYSA-N CCN.CS(N)(=O)=O Chemical group CCN.CS(N)(=O)=O DZHNOPAFFBNBKJ-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical compound CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- LQZMLBORDGWNPD-UHFFFAOYSA-N N-iodosuccinimide Chemical compound IN1C(=O)CCC1=O LQZMLBORDGWNPD-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- BGNXCDMCOKJUMV-UHFFFAOYSA-N Tert-Butylhydroquinone Chemical compound CC(C)(C)C1=CC(O)=CC=C1O BGNXCDMCOKJUMV-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 2
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 2
- 125000003289 ascorbyl group Chemical class [H]O[C@@]([H])(C([H])([H])O*)[C@@]1([H])OC(=O)C(O*)=C1O* 0.000 description 2
- CJPQIRJHIZUAQP-MRXNPFEDSA-N benalaxyl-M Chemical compound CC=1C=CC=C(C)C=1N([C@H](C)C(=O)OC)C(=O)CC1=CC=CC=C1 CJPQIRJHIZUAQP-MRXNPFEDSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000003245 coal Substances 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- PFURGBBHAOXLIO-UHFFFAOYSA-N cyclohexane-1,2-diol Chemical compound OC1CCCCC1O PFURGBBHAOXLIO-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- JRBPAEWTRLWTQC-UHFFFAOYSA-N dodecylamine Chemical group CCCCCCCCCCCCN JRBPAEWTRLWTQC-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000001240 enamine group Chemical group 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 2
- 229960005219 gentisic acid Drugs 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000009477 glass transition Effects 0.000 description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 2
- 229910052737 gold Inorganic materials 0.000 description 2
- 239000010931 gold Substances 0.000 description 2
- 229920000578 graft copolymer Polymers 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 150000007857 hydrazones Chemical class 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 125000005462 imide group Chemical group 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N iodoform Chemical compound IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- DZVCFNFOPIZQKX-LTHRDKTGSA-M merocyanine Chemical compound [Na+].O=C1N(CCCC)C(=O)N(CCCC)C(=O)C1=C\C=C\C=C/1N(CCCS([O-])(=O)=O)C2=CC=CC=C2O\1 DZVCFNFOPIZQKX-LTHRDKTGSA-M 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 125000001419 myristoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- HRRDCWDFRIJIQZ-UHFFFAOYSA-N naphthalene-1,8-dicarboxylic acid Chemical compound C1=CC(C(O)=O)=C2C(C(=O)O)=CC=CC2=C1 HRRDCWDFRIJIQZ-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003219 pyrazolines Chemical class 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 230000001235 sensitizing effect Effects 0.000 description 2
- 229910001961 silver nitrate Inorganic materials 0.000 description 2
- 239000002356 single layer Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000004964 sulfoalkyl group Chemical group 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- 235000010215 titanium dioxide Nutrition 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- 125000006679 α-naphthoxycarbonyl group Chemical group 0.000 description 2
- OSMSPFWHQWDGGP-UHFFFAOYSA-N (4-morpholin-4-ylphenyl)sulfamic acid Chemical compound C1=CC(NS(=O)(=O)O)=CC=C1N1CCOCC1 OSMSPFWHQWDGGP-UHFFFAOYSA-N 0.000 description 1
- GVTLFGJNTIRUEG-ZHACJKMWSA-N (e)-n-(3-methoxyphenyl)-3-phenylprop-2-enamide Chemical compound COC1=CC=CC(NC(=O)\C=C\C=2C=CC=CC=2)=C1 GVTLFGJNTIRUEG-ZHACJKMWSA-N 0.000 description 1
- HGRZLIGHKHRTRE-UHFFFAOYSA-N 1,2,3,4-tetrabromobutane Chemical compound BrCC(Br)C(Br)CBr HGRZLIGHKHRTRE-UHFFFAOYSA-N 0.000 description 1
- OWQPOVKKUWUEKE-UHFFFAOYSA-N 1,2,3-benzotriazine Chemical compound N1=NN=CC2=CC=CC=C21 OWQPOVKKUWUEKE-UHFFFAOYSA-N 0.000 description 1
- IZQGCATXOBZJQL-UHFFFAOYSA-N 1,3-benzothiazine-2,4-dione Chemical compound C1=CC=C2SC(=O)NC(=O)C2=C1 IZQGCATXOBZJQL-UHFFFAOYSA-N 0.000 description 1
- STOQYCJHYNCPTL-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione;silver Chemical compound [Ag].C1=CC=C2NC(=S)NC2=C1 STOQYCJHYNCPTL-UHFFFAOYSA-N 0.000 description 1
- ODIRBFFBCSTPTO-UHFFFAOYSA-N 1,3-selenazole Chemical compound C1=C[se]C=N1 ODIRBFFBCSTPTO-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- TXCHYYGSRHDEBU-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yldiazenyl)naphthalen-2-ol silver Chemical compound [Ag].OC1=C(N=NC2=CC=C3NN=NC3=C2)C2=CC=CC=C2C=C1 TXCHYYGSRHDEBU-UHFFFAOYSA-N 0.000 description 1
- QBBHFJWNZUCJOX-UHFFFAOYSA-N 1-(4-amino-n-ethylanilino)propane-2-sulfonic acid Chemical compound OS(=O)(=O)C(C)CN(CC)C1=CC=C(N)C=C1 QBBHFJWNZUCJOX-UHFFFAOYSA-N 0.000 description 1
- ZPANWZBSGMDWON-UHFFFAOYSA-N 1-[(2-hydroxynaphthalen-1-yl)methyl]naphthalen-2-ol Chemical compound C1=CC=C2C(CC3=C4C=CC=CC4=CC=C3O)=C(O)C=CC2=C1 ZPANWZBSGMDWON-UHFFFAOYSA-N 0.000 description 1
- IQIOOZJZTRAXTO-UHFFFAOYSA-M 1-ethyl-2H-1,3-thiazol-2-ylium bromide Chemical compound [Br-].CCS1=CC=N[CH+]1 IQIOOZJZTRAXTO-UHFFFAOYSA-M 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical class OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- KGLPWQKSKUVKMJ-UHFFFAOYSA-N 2,3-dihydrophthalazine-1,4-dione Chemical compound C1=CC=C2C(=O)NNC(=O)C2=C1 KGLPWQKSKUVKMJ-UHFFFAOYSA-N 0.000 description 1
- CTOQUCNYLFHOAH-UHFFFAOYSA-N 2,3-dihydropyrrolo[2,3-d]triazole-5,6-dithione Chemical compound N1NN=C2C(=S)C(=S)N=C21 CTOQUCNYLFHOAH-UHFFFAOYSA-N 0.000 description 1
- GLDQAMYCGOIJDV-UHFFFAOYSA-N 2,3-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=CC(O)=C1O GLDQAMYCGOIJDV-UHFFFAOYSA-N 0.000 description 1
- JFZFRIKFAXTVMP-UHFFFAOYSA-N 2,4-bis(3-tert-butyl-2-hydroxy-5-methylphenyl)-3-methylbicyclo[3.1.1]hepta-1,3,5-trien-6-ol Chemical compound C1C2=C(C1=C(C(=C2C1=C(C(=CC(=C1)C)C(C)(C)C)O)C)C1=C(C(=CC(=C1)C)C(C)(C)C)O)O JFZFRIKFAXTVMP-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- LXWZXEJDKYWBOW-UHFFFAOYSA-N 2,4-ditert-butyl-6-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]phenol Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC(CC=2C(=C(C=C(C=2)C(C)(C)C)C(C)(C)C)O)=C1O LXWZXEJDKYWBOW-UHFFFAOYSA-N 0.000 description 1
- QHPKIUDQDCWRKO-UHFFFAOYSA-N 2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)propan-2-yl]phenol Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(C(C)(C)C=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 QHPKIUDQDCWRKO-UHFFFAOYSA-N 0.000 description 1
- PYMWDAQVSJGRIA-UHFFFAOYSA-N 2-(1-bromo-6-methylcyclohexa-2,4-dien-1-yl)acetamide Chemical compound CC1C=CC=CC1(Br)CC(N)=O PYMWDAQVSJGRIA-UHFFFAOYSA-N 0.000 description 1
- DUUBQTCYVNKWFW-UHFFFAOYSA-N 2-(1-hydroxy-4-methoxynaphthalen-2-yl)-4-methoxynaphthalen-1-ol Chemical group C1=CC=CC2=C(O)C(C=3C=C(C4=CC=CC=C4C=3O)OC)=CC(OC)=C21 DUUBQTCYVNKWFW-UHFFFAOYSA-N 0.000 description 1
- AGUJUBACOOIWDV-UHFFFAOYSA-N 2-(1-hydroxynaphthalen-2-yl)naphthalen-1-ol Chemical group C1=CC=CC2=C(O)C(C3=C(C4=CC=CC=C4C=C3)O)=CC=C21 AGUJUBACOOIWDV-UHFFFAOYSA-N 0.000 description 1
- DUIMITDEOYCHER-UHFFFAOYSA-N 2-(2H-benzotriazol-5-yldiazenyl)-4-methoxynaphthalen-1-ol silver Chemical compound N1N=NC2=C1C=CC(=C2)N=NC2=C(C1=CC=CC=C1C(=C2)OC)O.[Ag] DUIMITDEOYCHER-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- WFXLRLQSHRNHCE-UHFFFAOYSA-N 2-(4-amino-n-ethylanilino)ethanol Chemical compound OCCN(CC)C1=CC=C(N)C=C1 WFXLRLQSHRNHCE-UHFFFAOYSA-N 0.000 description 1
- YUUNLFNRYZDMQC-UHFFFAOYSA-N 2-(4-hydroxy-2H-benzotriazol-5-yl)acetic acid silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)CC(=O)O YUUNLFNRYZDMQC-UHFFFAOYSA-N 0.000 description 1
- BBFDQRZRKYWUHY-UHFFFAOYSA-N 2-[(1-hydroxynaphthalen-2-yl)methyl]naphthalen-1-ol Chemical class C1=CC2=CC=CC=C2C(O)=C1CC1=CC=C(C=CC=C2)C2=C1O BBFDQRZRKYWUHY-UHFFFAOYSA-N 0.000 description 1
- PVMAFQFVCVBLNU-UHFFFAOYSA-N 2-[(4-hydroxy-2H-benzotriazol-5-yl)oxy]acetic acid silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)OCC(=O)O PVMAFQFVCVBLNU-UHFFFAOYSA-N 0.000 description 1
- AYNDSQMEJOTQIT-UHFFFAOYSA-N 2-[(6-nitro-2h-benzotriazol-5-yl)oxy]acetic acid;silver Chemical compound [Ag].C1=C([N+]([O-])=O)C(OCC(=O)O)=CC2=NNN=C21 AYNDSQMEJOTQIT-UHFFFAOYSA-N 0.000 description 1
- SZAQZZKNQILGPU-UHFFFAOYSA-N 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methylpropyl]-4,6-dimethylphenol Chemical compound C=1C(C)=CC(C)=C(O)C=1C(C(C)C)C1=CC(C)=CC(C)=C1O SZAQZZKNQILGPU-UHFFFAOYSA-N 0.000 description 1
- RPWDFMGIRPZGTI-UHFFFAOYSA-N 2-[1-(2-hydroxy-3,5-dimethylphenyl)-3,5,5-trimethylhexyl]-4,6-dimethylphenol Chemical compound C=1C(C)=CC(C)=C(O)C=1C(CC(C)CC(C)(C)C)C1=CC(C)=CC(C)=C1O RPWDFMGIRPZGTI-UHFFFAOYSA-N 0.000 description 1
- YAQLSKVCTLCIIE-UHFFFAOYSA-N 2-bromobutyric acid Chemical compound CCC(Br)C(O)=O YAQLSKVCTLCIIE-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- MARXMDRWROUXMD-UHFFFAOYSA-N 2-bromoisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(Br)C(=O)C2=C1 MARXMDRWROUXMD-UHFFFAOYSA-N 0.000 description 1
- CQJNLNKTOGXYCH-UHFFFAOYSA-N 2-bromophthalazin-1-one Chemical compound C1=CC=C2C(=O)N(Br)N=CC2=C1 CQJNLNKTOGXYCH-UHFFFAOYSA-N 0.000 description 1
- SZTBMYHIYNGYIA-UHFFFAOYSA-M 2-chloroacrylate Chemical compound [O-]C(=O)C(Cl)=C SZTBMYHIYNGYIA-UHFFFAOYSA-M 0.000 description 1
- KSBRTGXRNZVPAT-UHFFFAOYSA-N 2-chlorophthalazin-1-one Chemical compound C1=CC=C2C(=O)N(Cl)N=CC2=C1 KSBRTGXRNZVPAT-UHFFFAOYSA-N 0.000 description 1
- VKNASXZDGZNEDA-UHFFFAOYSA-N 2-cyanoethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCC#N VKNASXZDGZNEDA-UHFFFAOYSA-N 0.000 description 1
- KTWCUGUUDHJVIH-UHFFFAOYSA-N 2-hydroxybenzo[de]isoquinoline-1,3-dione Chemical compound C1=CC(C(N(O)C2=O)=O)=C3C2=CC=CC3=C1 KTWCUGUUDHJVIH-UHFFFAOYSA-N 0.000 description 1
- RUKISNQKOIKZGT-UHFFFAOYSA-N 2-nitrodiphenylamine Chemical compound [O-][N+](=O)C1=CC=CC=C1NC1=CC=CC=C1 RUKISNQKOIKZGT-UHFFFAOYSA-N 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- UGWULZWUXSCWPX-UHFFFAOYSA-N 2-sulfanylideneimidazolidin-4-one Chemical class O=C1CNC(=S)N1 UGWULZWUXSCWPX-UHFFFAOYSA-N 0.000 description 1
- UHSLAFBDUFODHO-UHFFFAOYSA-N 2-tert-butyl-4-[2-(3-tert-butyl-4-hydroxy-5-methylphenyl)propan-2-yl]-6-methylphenol Chemical compound CC(C)(C)C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C(O)=C(C)C=2)C(C)(C)C)=C1 UHSLAFBDUFODHO-UHFFFAOYSA-N 0.000 description 1
- VQYCQWZFTSTAIQ-UHFFFAOYSA-N 2H-benzotriazol-5-ol silver Chemical compound [Ag].OC1=CC2=C(NN=N2)C=C1 VQYCQWZFTSTAIQ-UHFFFAOYSA-N 0.000 description 1
- UFIAWLACMHGBIS-UHFFFAOYSA-N 2H-benzotriazole-4,6-diol silver Chemical compound [Ag].OC1=CC(=CC=2NN=NC21)O UFIAWLACMHGBIS-UHFFFAOYSA-N 0.000 description 1
- CMLFRMDBDNHMRA-UHFFFAOYSA-N 2h-1,2-benzoxazine Chemical compound C1=CC=C2C=CNOC2=C1 CMLFRMDBDNHMRA-UHFFFAOYSA-N 0.000 description 1
- XNCKHHMKNFNDQZ-UHFFFAOYSA-N 2h-benzotriazole-4-sulfonamide Chemical compound NS(=O)(=O)C1=CC=CC2=NNN=C12 XNCKHHMKNFNDQZ-UHFFFAOYSA-N 0.000 description 1
- PLYFWZGSBMDRKW-UHFFFAOYSA-N 2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].OS(=O)(=O)C1=CC=CC2=NNN=C12 PLYFWZGSBMDRKW-UHFFFAOYSA-N 0.000 description 1
- ZSZHFJYOWDHCSN-UHFFFAOYSA-N 2h-benzotriazole-5-carboxamide;silver Chemical compound [Ag].C1=C(C(=O)N)C=CC2=NNN=C21 ZSZHFJYOWDHCSN-UHFFFAOYSA-N 0.000 description 1
- VAVIJGPIFNIPSG-UHFFFAOYSA-N 2h-benzotriazole-5-carboxylic acid;silver Chemical compound [Ag].C1=C(C(=O)O)C=CC2=NNN=C21 VAVIJGPIFNIPSG-UHFFFAOYSA-N 0.000 description 1
- MMSSUHGNWNZJRZ-UHFFFAOYSA-N 2h-benzotriazole-5-sulfonic acid;silver Chemical compound [Ag].C1=C(S(=O)(=O)O)C=CC2=NNN=C21 MMSSUHGNWNZJRZ-UHFFFAOYSA-N 0.000 description 1
- LYAMXYCEJLUZSA-UHFFFAOYSA-N 2h-benzotriazole;silver Chemical class [Ag].[Ag].C1=CC=CC2=NNN=C21 LYAMXYCEJLUZSA-UHFFFAOYSA-N 0.000 description 1
- XOHUESSDMRKYEV-UHFFFAOYSA-N 2h-phthalazin-1-one;silver Chemical compound [Ag].C1=CC=C2C(=O)NN=CC2=C1 XOHUESSDMRKYEV-UHFFFAOYSA-N 0.000 description 1
- QGGXUUYCRXZROA-UHFFFAOYSA-N 3,4-bis(methoxycarbonyl)benzenesulfonic acid Chemical compound COC(=O)C1=CC=C(S(O)(=O)=O)C=C1C(=O)OC QGGXUUYCRXZROA-UHFFFAOYSA-N 0.000 description 1
- IBSUMVZKDLDAEK-UHFFFAOYSA-N 3-(n-ethyl-3-methylanilino)propane-1-sulfonic acid Chemical compound OS(=O)(=O)CCCN(CC)C1=CC=CC(C)=C1 IBSUMVZKDLDAEK-UHFFFAOYSA-N 0.000 description 1
- OGMRHLUHIHYVRU-UHFFFAOYSA-M 3-methyl-1,3-thiazol-3-ium;bromide Chemical compound [Br-].C[N+]=1C=CSC=1 OGMRHLUHIHYVRU-UHFFFAOYSA-M 0.000 description 1
- VLJXXKKOSFGPHI-UHFFFAOYSA-N 3-methylhexane Chemical compound CCCC(C)CC VLJXXKKOSFGPHI-UHFFFAOYSA-N 0.000 description 1
- GPJUVPHNQFWGKA-UHFFFAOYSA-N 3h-1,3-benzothiazole-2-thione;silver Chemical compound [Ag].C1=CC=C2SC(=S)NC2=C1 GPJUVPHNQFWGKA-UHFFFAOYSA-N 0.000 description 1
- AMHVHKFKFDBCTE-UHFFFAOYSA-N 3h-1,3-benzoxazole-2-thione;silver Chemical compound [Ag].C1=CC=C2OC(S)=NC2=C1 AMHVHKFKFDBCTE-UHFFFAOYSA-N 0.000 description 1
- KVUKKQPCWRVNSK-UHFFFAOYSA-N 4-(4-hydroxy-2H-benzotriazol-5-yl)benzenesulfonic acid silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)C2=CC=C(C=C2)S(=O)(=O)O KVUKKQPCWRVNSK-UHFFFAOYSA-N 0.000 description 1
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 1
- BOTGCZBEERTTDQ-UHFFFAOYSA-N 4-Methoxy-1-naphthol Chemical compound C1=CC=C2C(OC)=CC=C(O)C2=C1 BOTGCZBEERTTDQ-UHFFFAOYSA-N 0.000 description 1
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 1
- ZYKBEIDPRRYKKQ-UHFFFAOYSA-N 4-[4-(diethylamino)-2-methylphenyl]imino-1-oxo-n-phenylnaphthalene-2-carboxamide Chemical group CC1=CC(N(CC)CC)=CC=C1N=C1C2=CC=CC=C2C(=O)C(C(=O)NC=2C=CC=CC=2)=C1 ZYKBEIDPRRYKKQ-UHFFFAOYSA-N 0.000 description 1
- ABJQKDJOYSQVFX-UHFFFAOYSA-N 4-aminonaphthalen-1-ol Chemical compound C1=CC=C2C(N)=CC=C(O)C2=C1 ABJQKDJOYSQVFX-UHFFFAOYSA-N 0.000 description 1
- SIAWREHSHSMIHY-UHFFFAOYSA-N 4-bromo-2h-benzotriazole;silver Chemical compound [Ag].BrC1=CC=CC2=NNN=C12 SIAWREHSHSMIHY-UHFFFAOYSA-N 0.000 description 1
- XPBQQAHIVODAIC-UHFFFAOYSA-N 4-bromobutylbenzene Chemical compound BrCCCCC1=CC=CC=C1 XPBQQAHIVODAIC-UHFFFAOYSA-N 0.000 description 1
- GUVYHKPLQUZCCX-UHFFFAOYSA-N 4-hydroxy-2H-benzotriazole-5-carbonitrile silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)C#N GUVYHKPLQUZCCX-UHFFFAOYSA-N 0.000 description 1
- LETYJLSIDFTIJM-UHFFFAOYSA-N 4-hydroxy-2H-benzotriazole-5-carboxylic acid silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)C(=O)O LETYJLSIDFTIJM-UHFFFAOYSA-N 0.000 description 1
- YRRCATIIGZMMIW-UHFFFAOYSA-N 4-hydroxy-2H-benzotriazole-5-sulfonic acid silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)S(=O)(=O)O YRRCATIIGZMMIW-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- ZFIQGRISGKSVAG-UHFFFAOYSA-N 4-methylaminophenol Chemical compound CNC1=CC=C(O)C=C1 ZFIQGRISGKSVAG-UHFFFAOYSA-N 0.000 description 1
- ZWCMMQVXOLIGTG-UHFFFAOYSA-N 4-methylsulfonyl-2h-benzotriazole Chemical compound CS(=O)(=O)C1=CC=CC2=NNN=C12 ZWCMMQVXOLIGTG-UHFFFAOYSA-N 0.000 description 1
- FXKQPQOOZSXQAG-UHFFFAOYSA-N 4-methyltriazine Chemical compound CC1=CC=NN=N1 FXKQPQOOZSXQAG-UHFFFAOYSA-N 0.000 description 1
- XBTWVJKPQPQTDW-UHFFFAOYSA-N 4-n,4-n-diethyl-2-methylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C(C)=C1 XBTWVJKPQPQTDW-UHFFFAOYSA-N 0.000 description 1
- QNGVNLMMEQUVQK-UHFFFAOYSA-N 4-n,4-n-diethylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C=C1 QNGVNLMMEQUVQK-UHFFFAOYSA-N 0.000 description 1
- FFAJEKUNEVVYCW-UHFFFAOYSA-N 4-n-ethyl-4-n-(2-methoxyethyl)-2-methylbenzene-1,4-diamine Chemical compound COCCN(CC)C1=CC=C(N)C(C)=C1 FFAJEKUNEVVYCW-UHFFFAOYSA-N 0.000 description 1
- UTMDJGPRCLQPBT-UHFFFAOYSA-N 4-nitro-1h-1,2,3-benzotriazole Chemical class [O-][N+](=O)C1=CC=CC2=NNN=C12 UTMDJGPRCLQPBT-UHFFFAOYSA-N 0.000 description 1
- XHQIJHOXQWEWNO-UHFFFAOYSA-N 4-nitro-2h-benzotriazole;silver Chemical compound [Ag].[O-][N+](=O)C1=CC=CC2=NNN=C12 XHQIJHOXQWEWNO-UHFFFAOYSA-N 0.000 description 1
- UWAZUCRCJKCIAZ-UHFFFAOYSA-N 5,7-dinitro-2H-benzotriazol-4-ol silver Chemical compound OC1=C(C=C(C=2NN=NC21)[N+](=O)[O-])[N+](=O)[O-].[Ag] UWAZUCRCJKCIAZ-UHFFFAOYSA-N 0.000 description 1
- LCVPUZZJHISVIL-UHFFFAOYSA-N 5-(2-ethoxy-2-oxoethoxy)-2h-benzotriazole-4-carboxylic acid;silver Chemical compound [Ag].OC(=O)C1=C(OCC(=O)OCC)C=CC2=NNN=C21 LCVPUZZJHISVIL-UHFFFAOYSA-N 0.000 description 1
- KOHQEDCONWTWEQ-UHFFFAOYSA-N 5-(2-ethoxy-2-oxoethoxy)-2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].OS(=O)(=O)C1=C(OCC(=O)OCC)C=CC2=NNN=C21 KOHQEDCONWTWEQ-UHFFFAOYSA-N 0.000 description 1
- OGGACJRXFMCVRC-UHFFFAOYSA-N 5-(2-ethoxy-2-oxoethyl)-2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].OS(=O)(=O)C1=C(CC(=O)OCC)C=CC2=NNN=C21 OGGACJRXFMCVRC-UHFFFAOYSA-N 0.000 description 1
- QIUIIIPBGSHQFY-UHFFFAOYSA-N 5-(4-nitrophenyl)-2H-benzotriazol-4-ol silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)C2=CC=C(C=C2)[N+](=O)[O-] QIUIIIPBGSHQFY-UHFFFAOYSA-N 0.000 description 1
- UWBZQBXZSLYATH-UHFFFAOYSA-N 5-(4-nitrophenyl)-2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].C1=CC2=NNN=C2C(S(=O)(=O)O)=C1C1=CC=C([N+]([O-])=O)C=C1 UWBZQBXZSLYATH-UHFFFAOYSA-N 0.000 description 1
- UXYCQFBMYVHWCD-UHFFFAOYSA-N 5-(carboxymethyl)-2h-benzotriazole-4-carboxylic acid;silver Chemical compound [Ag].OC(=O)C1=C(CC(=O)O)C=CC2=NNN=C21 UXYCQFBMYVHWCD-UHFFFAOYSA-N 0.000 description 1
- CNGYZEMWVAWWOB-VAWYXSNFSA-N 5-[[4-anilino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-[(e)-2-[4-[[4-anilino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid Chemical compound N=1C(NC=2C=C(C(\C=C\C=3C(=CC(NC=4N=C(N=C(NC=5C=CC=CC=5)N=4)N(CCO)CCO)=CC=3)S(O)(=O)=O)=CC=2)S(O)(=O)=O)=NC(N(CCO)CCO)=NC=1NC1=CC=CC=C1 CNGYZEMWVAWWOB-VAWYXSNFSA-N 0.000 description 1
- GEPQDSDPIKTAQZ-UHFFFAOYSA-N 5-acetamido-2h-benzotriazole-4-carboxylic acid;silver Chemical compound [Ag].OC(=O)C1=C(NC(=O)C)C=CC2=NNN=C21 GEPQDSDPIKTAQZ-UHFFFAOYSA-N 0.000 description 1
- HKYVZSAUMXEWSM-UHFFFAOYSA-N 5-acetamido-2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].OS(=O)(=O)C1=C(NC(=O)C)C=CC2=NNN=C21 HKYVZSAUMXEWSM-UHFFFAOYSA-N 0.000 description 1
- VXADKSZHKMWPPQ-UHFFFAOYSA-N 5-amino-2H-benzotriazol-4-ol silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)N VXADKSZHKMWPPQ-UHFFFAOYSA-N 0.000 description 1
- HQONCMUTVXCNKO-UHFFFAOYSA-N 5-amino-2h-benzotriazole-4-carboxylic acid;silver Chemical compound [Ag].OC(=O)C1=C(N)C=CC2=NNN=C21 HQONCMUTVXCNKO-UHFFFAOYSA-N 0.000 description 1
- PUUBBNLVXJJRKR-UHFFFAOYSA-N 5-amino-2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].OS(=O)(=O)C1=C(N)C=CC2=NNN=C21 PUUBBNLVXJJRKR-UHFFFAOYSA-N 0.000 description 1
- HGKMUJVZOYHQLE-UHFFFAOYSA-N 5-chloro-2H-benzotriazol-4-ol silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)Cl HGKMUJVZOYHQLE-UHFFFAOYSA-N 0.000 description 1
- FKQVBYIFZVIJAB-UHFFFAOYSA-N 5-chloro-2h-benzotriazole-4-carboxylic acid;silver Chemical compound [Ag].OC(=O)C1=C(Cl)C=CC2=NNN=C12 FKQVBYIFZVIJAB-UHFFFAOYSA-N 0.000 description 1
- WXHAFROXDSNSNA-UHFFFAOYSA-N 5-chloro-2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].OS(=O)(=O)C1=C(Cl)C=CC2=NNN=C12 WXHAFROXDSNSNA-UHFFFAOYSA-N 0.000 description 1
- VYLMOMINLRGEMR-UHFFFAOYSA-N 5-chloro-4,6-dinitro-2h-benzotriazole;silver Chemical compound [Ag].[O-][N+](=O)C1=C(Cl)C([N+](=O)[O-])=CC2=NNN=C21 VYLMOMINLRGEMR-UHFFFAOYSA-N 0.000 description 1
- NBWYUUUULKYVMY-UHFFFAOYSA-N 5-chloro-6-nitro-2h-benzotriazole;silver Chemical compound [Ag].C1=C(Cl)C([N+](=O)[O-])=CC2=NNN=C21 NBWYUUUULKYVMY-UHFFFAOYSA-N 0.000 description 1
- NUNXISICBRDBPK-UHFFFAOYSA-N 5-cyano-2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].OS(=O)(=O)C1=C(C#N)C=CC2=NNN=C12 NUNXISICBRDBPK-UHFFFAOYSA-N 0.000 description 1
- IDYWQTUXKZTZLQ-UHFFFAOYSA-N 5-methoxy-2H-benzotriazol-4-ol silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)OC IDYWQTUXKZTZLQ-UHFFFAOYSA-N 0.000 description 1
- HLDWGAUXHLROCB-UHFFFAOYSA-N 5-methoxy-2h-benzotriazole-4-carboxylic acid;silver Chemical compound [Ag].OC(=O)C1=C(OC)C=CC2=NNN=C21 HLDWGAUXHLROCB-UHFFFAOYSA-N 0.000 description 1
- RNUNNQMSQDZTGA-UHFFFAOYSA-N 5-methoxy-2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].OS(=O)(=O)C1=C(OC)C=CC2=NNN=C21 RNUNNQMSQDZTGA-UHFFFAOYSA-N 0.000 description 1
- JAVSUZRJEUOVIW-UHFFFAOYSA-N 5-methoxy-4,6-dinitro-2h-benzotriazole;silver Chemical compound [Ag].[O-][N+](=O)C1=C(OC)C([N+]([O-])=O)=CC2=NNN=C21 JAVSUZRJEUOVIW-UHFFFAOYSA-N 0.000 description 1
- FKAXDTZKJSWMMA-UHFFFAOYSA-N 5-methoxy-6-nitro-2h-benzotriazole;silver Chemical compound [Ag].C1=C([N+]([O-])=O)C(OC)=CC2=NNN=C21 FKAXDTZKJSWMMA-UHFFFAOYSA-N 0.000 description 1
- NJPMMJJVLGNCON-UHFFFAOYSA-N 5-methyl-2,3-dihydrotriazolo[4,5-d]pyrimidin-7-one;silver Chemical compound [Ag].O=C1N=C(C)N=C2NNN=C21 NJPMMJJVLGNCON-UHFFFAOYSA-N 0.000 description 1
- FEDXQJCJZHSFJC-UHFFFAOYSA-N 5-methyl-2H-benzotriazol-4-ol silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)C FEDXQJCJZHSFJC-UHFFFAOYSA-N 0.000 description 1
- ZOOABFASFMLFTR-UHFFFAOYSA-N 5-methyl-2h-benzotriazole-4-carboxylic acid;silver Chemical compound [Ag].OC(=O)C1=C(C)C=CC2=NNN=C21 ZOOABFASFMLFTR-UHFFFAOYSA-N 0.000 description 1
- UVEGBIASMHQMQJ-UHFFFAOYSA-N 5-methyl-2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].OS(=O)(=O)C1=C(C)C=CC2=NNN=C21 UVEGBIASMHQMQJ-UHFFFAOYSA-N 0.000 description 1
- FDFNTSAWIDKMFP-UHFFFAOYSA-N 5-methyl-6-nitro-2h-benzotriazole;silver Chemical compound [Ag].C1=C([N+]([O-])=O)C(C)=CC2=NNN=C21 FDFNTSAWIDKMFP-UHFFFAOYSA-N 0.000 description 1
- RGOGABLRYTZMFT-UHFFFAOYSA-N 5-methyl-7-sulfo-2h-benzotriazole-4-carboxylic acid;silver Chemical compound [Ag].OC(=O)C1=C(C)C=C(S(O)(=O)=O)C2=NNN=C21 RGOGABLRYTZMFT-UHFFFAOYSA-N 0.000 description 1
- KEACENITOZRSJT-UHFFFAOYSA-N 5-nitro-2h-benzotriazole-4-carboxylic acid;silver Chemical compound [Ag].OC(=O)C1=C([N+]([O-])=O)C=CC2=NNN=C12 KEACENITOZRSJT-UHFFFAOYSA-N 0.000 description 1
- BBGRQUUSRRKFSS-UHFFFAOYSA-N 5-nitro-2h-benzotriazole;silver Chemical compound [Ag].C1=C([N+](=O)[O-])C=CC2=NNN=C21 BBGRQUUSRRKFSS-UHFFFAOYSA-N 0.000 description 1
- GWXIEDHZMGXUKM-UHFFFAOYSA-N 5-phenyl-2H-benzotriazol-4-ol silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)C2=CC=CC=C2 GWXIEDHZMGXUKM-UHFFFAOYSA-N 0.000 description 1
- QRCYCQILRCMCEG-UHFFFAOYSA-N 5-phenyl-2h-benzotriazole-4-carboxylic acid;silver Chemical compound [Ag].C1=CC2=NNN=C2C(C(=O)O)=C1C1=CC=CC=C1 QRCYCQILRCMCEG-UHFFFAOYSA-N 0.000 description 1
- HDGFGYSIIXYKBT-UHFFFAOYSA-N 5-phenyl-2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].C1=CC2=NNN=C2C(S(=O)(=O)O)=C1C1=CC=CC=C1 HDGFGYSIIXYKBT-UHFFFAOYSA-N 0.000 description 1
- OORIFUHRGQKYEV-UHFFFAOYSA-N 6-bromo-1-(6-bromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol Chemical group BrC1=CC=C2C(C3=C4C=CC(Br)=CC4=CC=C3O)=C(O)C=CC2=C1 OORIFUHRGQKYEV-UHFFFAOYSA-N 0.000 description 1
- QSHQKZDOLGDGLD-UHFFFAOYSA-N 6-chloro-5-methoxy-2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].OS(=O)(=O)C1=C(OC)C(Cl)=CC2=NNN=C21 QSHQKZDOLGDGLD-UHFFFAOYSA-N 0.000 description 1
- LLKFECWNVQJWQC-UHFFFAOYSA-N 6-chloro-5-nitro-2H-benzotriazol-4-ol silver Chemical compound OC1=C(C(=CC=2NN=NC21)Cl)[N+](=O)[O-].[Ag] LLKFECWNVQJWQC-UHFFFAOYSA-N 0.000 description 1
- ICTRITZRUJGWEW-UHFFFAOYSA-N 6-chloro-7-sulfo-2h-benzotriazole-5-carboxylic acid;silver Chemical compound [Ag].OS(=O)(=O)C1=C(Cl)C(C(=O)O)=CC2=NNN=C21 ICTRITZRUJGWEW-UHFFFAOYSA-N 0.000 description 1
- STZPIDYYPWJEJM-UHFFFAOYSA-N 6-hydroxy-2H-benzotriazole-5-carboxylic acid silver Chemical compound [Ag].C(=O)(O)C1=CC2=C(NN=N2)C=C1O STZPIDYYPWJEJM-UHFFFAOYSA-N 0.000 description 1
- QKBLSRCBFAWSPP-UHFFFAOYSA-N 6-methyl-5-nitro-2H-benzotriazol-4-ol silver Chemical compound OC1=C(C(=CC=2NN=NC21)C)[N+](=O)[O-].[Ag] QKBLSRCBFAWSPP-UHFFFAOYSA-N 0.000 description 1
- XAHAETYYVLNATP-UHFFFAOYSA-N 6-nitro-1-(6-nitronaphthalen-1-yl)-3H-naphthalene-2,2-diol Chemical group [N+](=O)([O-])C1=CC2=CCC(C(=C2C=C1)C1=CC=CC2=CC(=CC=C12)[N+](=O)[O-])(O)O XAHAETYYVLNATP-UHFFFAOYSA-N 0.000 description 1
- JEOQXAQUIVZJNX-UHFFFAOYSA-N 6-nitro-2h-benzotriazol-5-amine;silver Chemical compound [Ag].C1=C([N+]([O-])=O)C(N)=CC2=NNN=C21 JEOQXAQUIVZJNX-UHFFFAOYSA-N 0.000 description 1
- VUKLGFRIKFBJFN-UHFFFAOYSA-N 6-nitro-2h-benzotriazole-4-carbonitrile;silver Chemical compound [Ag].C1=C([N+](=O)[O-])C=C(C#N)C2=NNN=C21 VUKLGFRIKFBJFN-UHFFFAOYSA-N 0.000 description 1
- SLBUGEPSVBECEY-UHFFFAOYSA-N 6-nitro-2h-benzotriazole-4-carboxamide;silver Chemical compound [Ag].NC(=O)C1=CC([N+]([O-])=O)=CC2=NNN=C12 SLBUGEPSVBECEY-UHFFFAOYSA-N 0.000 description 1
- KGULHBNUPVIMGA-UHFFFAOYSA-N 6-nitro-2h-benzotriazole-4-carboxylic acid;silver Chemical compound [Ag].OC(=O)C1=CC([N+]([O-])=O)=CC2=NNN=C12 KGULHBNUPVIMGA-UHFFFAOYSA-N 0.000 description 1
- RHUWUZKMDYIXLX-UHFFFAOYSA-N 6-nitro-2h-benzotriazole-4-sulfonamide;silver Chemical compound [Ag].NS(=O)(=O)C1=CC([N+]([O-])=O)=CC2=NNN=C12 RHUWUZKMDYIXLX-UHFFFAOYSA-N 0.000 description 1
- GCWOEXFAHBQLHJ-UHFFFAOYSA-N 6-nitro-2h-benzotriazole-4-sulfonic acid;silver Chemical compound [Ag].OS(=O)(=O)C1=CC([N+]([O-])=O)=CC2=NNN=C12 GCWOEXFAHBQLHJ-UHFFFAOYSA-N 0.000 description 1
- ZDVKOEIQMMTAHO-UHFFFAOYSA-N 6-nitro-2h-benzotriazole-5-carboxylic acid;silver Chemical compound [Ag].C1=C([N+]([O-])=O)C(C(=O)O)=CC2=NNN=C21 ZDVKOEIQMMTAHO-UHFFFAOYSA-N 0.000 description 1
- DQQIEVWEHGOQJV-UHFFFAOYSA-N 6-nitro-4-phenyl-2h-benzotriazole;silver Chemical compound [Ag].C12=NNN=C2C=C([N+](=O)[O-])C=C1C1=CC=CC=C1 DQQIEVWEHGOQJV-UHFFFAOYSA-N 0.000 description 1
- SSWWADQTDCUWBN-UHFFFAOYSA-N 7-nitro-2H-benzotriazol-4-ol silver Chemical compound OC1=CC=C(C=2NN=NC21)[N+](=O)[O-].[Ag] SSWWADQTDCUWBN-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- AXVCDCGTJGNMKM-UHFFFAOYSA-L C(C=1C(C(=O)[O-])=CC=CC1)(=O)[O-].[Ag+2] Chemical compound C(C=1C(C(=O)[O-])=CC=CC1)(=O)[O-].[Ag+2] AXVCDCGTJGNMKM-UHFFFAOYSA-L 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- 239000004709 Chlorinated polyethylene Substances 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 206010073306 Exposure to radiation Diseases 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- OILIPECUNDBBML-UHFFFAOYSA-N N-(4-hydroxy-2H-benzotriazol-5-yl)acetamide silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)NC(C)=O OILIPECUNDBBML-UHFFFAOYSA-N 0.000 description 1
- TVFMLNOEHZSWHS-UHFFFAOYSA-N N-(4-hydroxy-2H-benzotriazol-5-yl)benzenesulfonamide silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)NS(=O)(=O)C2=CC=CC=C2 TVFMLNOEHZSWHS-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- 229920002732 Polyanhydride Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 1
- XOXLDCZKFZMLML-UHFFFAOYSA-N [4-(diethylamino)-2-methylphenyl]sulfamic acid Chemical compound CCN(CC)C1=CC=C(NS(O)(=O)=O)C(C)=C1 XOXLDCZKFZMLML-UHFFFAOYSA-N 0.000 description 1
- VTYXKZPSXBROIH-UHFFFAOYSA-N [4-(diethylamino)phenyl]sulfamic acid Chemical compound CCN(CC)C1=CC=C(NS(O)(=O)=O)C=C1 VTYXKZPSXBROIH-UHFFFAOYSA-N 0.000 description 1
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 1
- XCFIVNQHHFZRNR-UHFFFAOYSA-N [Ag].Cl[IH]Br Chemical compound [Ag].Cl[IH]Br XCFIVNQHHFZRNR-UHFFFAOYSA-N 0.000 description 1
- HOLVRJRSWZOAJU-UHFFFAOYSA-N [Ag].ICl Chemical compound [Ag].ICl HOLVRJRSWZOAJU-UHFFFAOYSA-N 0.000 description 1
- ZGVBHHHBVGJRGU-UHFFFAOYSA-N [Cl-].C(CCCCC)C1=C(C([NH2+]C=C)(CCCCCC)CCCCCC)C=CC=C1 Chemical compound [Cl-].C(CCCCC)C1=C(C([NH2+]C=C)(CCCCCC)CCCCCC)C=CC=C1 ZGVBHHHBVGJRGU-UHFFFAOYSA-N 0.000 description 1
- NZHXEWZGTQSYJM-UHFFFAOYSA-N [bromo(diphenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Br)C1=CC=CC=C1 NZHXEWZGTQSYJM-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 238000006359 acetalization reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 150000003927 aminopyridines Chemical class 0.000 description 1
- 150000005010 aminoquinolines Chemical class 0.000 description 1
- 239000001000 anthraquinone dye Substances 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 238000000498 ball milling Methods 0.000 description 1
- 150000007656 barbituric acids Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- CCGGDOVGIDSGQN-UHFFFAOYSA-N benzo[f][1,2]benzoxazine-1,2-dione Chemical compound C1=CC=CC2=C(C(C(=O)NO3)=O)C3=CC=C21 CCGGDOVGIDSGQN-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- UUZYBYIOAZTMGC-UHFFFAOYSA-M benzyl(trimethyl)azanium;bromide Chemical compound [Br-].C[N+](C)(C)CC1=CC=CC=C1 UUZYBYIOAZTMGC-UHFFFAOYSA-M 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229950005228 bromoform Drugs 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical group CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- 150000001661 cadmium Chemical class 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- AJPXTSMULZANCB-UHFFFAOYSA-N chlorohydroquinone Chemical compound OC1=CC=C(O)C(Cl)=C1 AJPXTSMULZANCB-UHFFFAOYSA-N 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000002508 contact lithography Methods 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 238000007766 curtain coating Methods 0.000 description 1
- 229920005994 diacetyl cellulose Polymers 0.000 description 1
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylphenylamine Natural products CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- GWZCCUDJHOGOSO-UHFFFAOYSA-N diphenic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=CC=C1C(O)=O GWZCCUDJHOGOSO-UHFFFAOYSA-N 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 229930004069 diterpene Natural products 0.000 description 1
- 150000004141 diterpene derivatives Chemical class 0.000 description 1
- JOXWSDNHLSQKCC-UHFFFAOYSA-N ethenesulfonamide Chemical class NS(=O)(=O)C=C JOXWSDNHLSQKCC-UHFFFAOYSA-N 0.000 description 1
- WILQTVNGLALUHI-UHFFFAOYSA-N ethyl 2-(4-hydroxy-2H-benzotriazol-5-yl)acetate silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)CC(=O)OCC WILQTVNGLALUHI-UHFFFAOYSA-N 0.000 description 1
- CCPIHSHZRPPEIW-UHFFFAOYSA-N ethyl 2-[(4-hydroxy-2H-benzotriazol-5-yl)oxy]acetate silver Chemical compound [Ag].OC1=C(C=CC=2NN=NC21)OCC(=O)OCC CCPIHSHZRPPEIW-UHFFFAOYSA-N 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- VUFOSBDICLTFMS-UHFFFAOYSA-M ethyl-hexadecyl-dimethylazanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)CC VUFOSBDICLTFMS-UHFFFAOYSA-M 0.000 description 1
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Chemical compound CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Polymers [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- PWSKHLMYTZNYKO-UHFFFAOYSA-N heptane-1,7-diamine Chemical compound NCCCCCCCN PWSKHLMYTZNYKO-UHFFFAOYSA-N 0.000 description 1
- 229920001477 hydrophilic polymer Polymers 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- PTFYQSWHBLOXRZ-UHFFFAOYSA-N imidazo[4,5-e]indazole Chemical class C1=CC2=NC=NC2=C2C=NN=C21 PTFYQSWHBLOXRZ-UHFFFAOYSA-N 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 150000002473 indoazoles Chemical class 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 229910001502 inorganic halide Inorganic materials 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- XUPFNPFFFUXGMP-UHFFFAOYSA-N isoindole-1,3-dione;silver Chemical compound [Ag].C1=CC=C2C(=O)NC(=O)C2=C1 XUPFNPFFFUXGMP-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- AZEPWULHRMVZQR-UHFFFAOYSA-M lithium;dodecanoate Chemical compound [Li+].CCCCCCCCCCCC([O-])=O AZEPWULHRMVZQR-UHFFFAOYSA-M 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 125000005439 maleimidyl group Chemical class C1(C=CC(N1*)=O)=O 0.000 description 1
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical class N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- DDIZAANNODHTRB-UHFFFAOYSA-N methyl p-anisate Chemical compound COC(=O)C1=CC=C(OC)C=C1 DDIZAANNODHTRB-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- OTVPURYEWXIAKH-UHFFFAOYSA-N n,n-dibromobenzenesulfonamide Chemical compound BrN(Br)S(=O)(=O)C1=CC=CC=C1 OTVPURYEWXIAKH-UHFFFAOYSA-N 0.000 description 1
- 229940088644 n,n-dimethylacrylamide Drugs 0.000 description 1
- YLGYACDQVQQZSW-UHFFFAOYSA-N n,n-dimethylprop-2-enamide Chemical compound CN(C)C(=O)C=C YLGYACDQVQQZSW-UHFFFAOYSA-N 0.000 description 1
- AIKOWPMUHAOTCV-UHFFFAOYSA-N n-(2h-benzotriazol-5-yl)-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide;silver Chemical compound [Ag].C1=CC(N(C)C)=CC=C1N=NC1=CC=C(C(=O)NC2=CC3=NNN=C3C=C2)C=C1 AIKOWPMUHAOTCV-UHFFFAOYSA-N 0.000 description 1
- YBSCQRRTOGYRQG-UHFFFAOYSA-N n-(2h-benzotriazol-5-yl)acetamide;silver Chemical compound [Ag].C1=C(NC(=O)C)C=CC2=NNN=C21 YBSCQRRTOGYRQG-UHFFFAOYSA-N 0.000 description 1
- HAYLIGDJFXRLMU-UHFFFAOYSA-N n-(3,5-dibromo-4-hydroxyphenyl)-4-methylbenzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC1=CC(Br)=C(O)C(Br)=C1 HAYLIGDJFXRLMU-UHFFFAOYSA-N 0.000 description 1
- BHKFPZZHMAIRGJ-UHFFFAOYSA-N n-[4-(diethylamino)-2-methylphenyl]-1-phenylmethanesulfonamide Chemical compound CC1=CC(N(CC)CC)=CC=C1NS(=O)(=O)CC1=CC=CC=C1 BHKFPZZHMAIRGJ-UHFFFAOYSA-N 0.000 description 1
- DVNYDODOESWBJY-UHFFFAOYSA-N n-bromo-n-methylbenzenesulfonamide Chemical compound CN(Br)S(=O)(=O)C1=CC=CC=C1 DVNYDODOESWBJY-UHFFFAOYSA-N 0.000 description 1
- FWLGGSWAIHNLLW-UHFFFAOYSA-N n-bromo-n-phenylacetamide Chemical compound CC(=O)N(Br)C1=CC=CC=C1 FWLGGSWAIHNLLW-UHFFFAOYSA-N 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 239000005445 natural material Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- BIAGWOZIXODKKS-UHFFFAOYSA-N oxadiazole-4-thiol;silver Chemical compound [Ag].SC1=CON=N1 BIAGWOZIXODKKS-UHFFFAOYSA-N 0.000 description 1
- 150000001475 oxazolidinediones Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 150000004989 p-phenylenediamines Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 1
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 1
- 229920000779 poly(divinylbenzene) Polymers 0.000 description 1
- 229920001483 poly(ethyl methacrylate) polymer Polymers 0.000 description 1
- 229920000205 poly(isobutyl methacrylate) Polymers 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920006289 polycarbonate film Polymers 0.000 description 1
- 229920002776 polycyclohexyl methacrylate Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000002861 polymer material Substances 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 229920002717 polyvinylpyridine Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- NDGRWYRVNANFNB-UHFFFAOYSA-N pyrazolidin-3-one Chemical class O=C1CCNN1 NDGRWYRVNANFNB-UHFFFAOYSA-N 0.000 description 1
- MCSKRVKAXABJLX-UHFFFAOYSA-N pyrazolo[3,4-d]triazole Chemical class N1=NN=C2N=NC=C21 MCSKRVKAXABJLX-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- GJAWHXHKYYXBSV-UHFFFAOYSA-N quinolinic acid Chemical compound OC(=O)C1=CC=CN=C1C(O)=O GJAWHXHKYYXBSV-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- KIWUVOGUEXMXSV-UHFFFAOYSA-N rhodanine Chemical class O=C1CSC(=S)N1 KIWUVOGUEXMXSV-UHFFFAOYSA-N 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- AQRYNYUOKMNDDV-UHFFFAOYSA-M silver behenate Chemical compound [Ag+].CCCCCCCCCCCCCCCCCCCCCC([O-])=O AQRYNYUOKMNDDV-UHFFFAOYSA-M 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 229940100890 silver compound Drugs 0.000 description 1
- 150000003379 silver compounds Chemical class 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- NUMJVUZSWZLKTF-XVSDJDOKSA-M silver;(5z,8z,11z,14z)-icosa-5,8,11,14-tetraenoate Chemical compound [Ag+].CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC([O-])=O NUMJVUZSWZLKTF-XVSDJDOKSA-M 0.000 description 1
- KZNAFUWGUKKVCW-UHFFFAOYSA-N silver;2-(4-sulfo-2h-benzotriazol-5-yl)acetic acid Chemical compound [Ag].OS(=O)(=O)C1=C(CC(=O)O)C=CC2=NNN=C21 KZNAFUWGUKKVCW-UHFFFAOYSA-N 0.000 description 1
- XNAILVDMCFZEHQ-UHFFFAOYSA-N silver;2-[(4-sulfo-2h-benzotriazol-5-yl)oxy]acetic acid Chemical compound [Ag].OS(=O)(=O)C1=C(OCC(=O)O)C=CC2=NNN=C21 XNAILVDMCFZEHQ-UHFFFAOYSA-N 0.000 description 1
- SUEXRGWLMCSHTR-UHFFFAOYSA-N silver;3-(1h-1,2,4-triazol-5-yl)benzenethiol Chemical compound [Ag].SC1=CC=CC(C=2NN=CN=2)=C1 SUEXRGWLMCSHTR-UHFFFAOYSA-N 0.000 description 1
- ARIXIMPNXJBOMG-UHFFFAOYSA-N silver;5-(4-sulfophenyl)-2h-benzotriazole-4-sulfonic acid Chemical compound [Ag].C1=CC(S(=O)(=O)O)=CC=C1C1=C(S(O)(=O)=O)C2=NNN=C2C=C1 ARIXIMPNXJBOMG-UHFFFAOYSA-N 0.000 description 1
- CLDWGXZGFUNWKB-UHFFFAOYSA-M silver;benzoate Chemical compound [Ag+].[O-]C(=O)C1=CC=CC=C1 CLDWGXZGFUNWKB-UHFFFAOYSA-M 0.000 description 1
- MNMYRUHURLPFQW-UHFFFAOYSA-M silver;dodecanoate Chemical compound [Ag+].CCCCCCCCCCCC([O-])=O MNMYRUHURLPFQW-UHFFFAOYSA-M 0.000 description 1
- LTYHQUJGIQUHMS-UHFFFAOYSA-M silver;hexadecanoate Chemical compound [Ag+].CCCCCCCCCCCCCCCC([O-])=O LTYHQUJGIQUHMS-UHFFFAOYSA-M 0.000 description 1
- ORYURPRSXLUCSS-UHFFFAOYSA-M silver;octadecanoate Chemical compound [Ag+].CCCCCCCCCCCCCCCCCC([O-])=O ORYURPRSXLUCSS-UHFFFAOYSA-M 0.000 description 1
- OHGHHPYRRURLHR-UHFFFAOYSA-M silver;tetradecanoate Chemical compound [Ag+].CCCCCCCCCCCCCC([O-])=O OHGHHPYRRURLHR-UHFFFAOYSA-M 0.000 description 1
- MWASJOFAOJVIGL-UHFFFAOYSA-M sodium;2h-benzotriazole-4-carboxylate Chemical compound [Na+].[O-]C(=O)C1=CC=CC2=C1N=NN2 MWASJOFAOJVIGL-UHFFFAOYSA-M 0.000 description 1
- BMSYVBIRKCPKBD-UHFFFAOYSA-M sodium;n-[4-(diethylamino)-2-methylphenyl]sulfamate Chemical compound [Na+].CCN(CC)C1=CC=C(NS([O-])(=O)=O)C(C)=C1 BMSYVBIRKCPKBD-UHFFFAOYSA-M 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- BUUPQKDIAURBJP-UHFFFAOYSA-N sulfinic acid Chemical compound OS=O BUUPQKDIAURBJP-UHFFFAOYSA-N 0.000 description 1
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000004250 tert-Butylhydroquinone Substances 0.000 description 1
- RKSOPLXZQNSWAS-UHFFFAOYSA-N tert-butyl bromide Chemical compound CC(C)(C)Br RKSOPLXZQNSWAS-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 235000019281 tert-butylhydroquinone Nutrition 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- LIXPXSXEKKHIRR-UHFFFAOYSA-M tetraethylphosphanium;bromide Chemical compound [Br-].CC[P+](CC)(CC)CC LIXPXSXEKKHIRR-UHFFFAOYSA-M 0.000 description 1
- DDFYFBUWEBINLX-UHFFFAOYSA-M tetramethylammonium bromide Chemical compound [Br-].C[N+](C)(C)C DDFYFBUWEBINLX-UHFFFAOYSA-M 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 150000001467 thiazolidinediones Chemical class 0.000 description 1
- CBDKQYKMCICBOF-UHFFFAOYSA-N thiazoline Chemical compound C1CN=CS1 CBDKQYKMCICBOF-UHFFFAOYSA-N 0.000 description 1
- 125000003396 thiol group Chemical class [H]S* 0.000 description 1
- ZEMGGZBWXRYJHK-UHFFFAOYSA-N thiouracil Chemical compound O=C1C=CNC(=S)N1 ZEMGGZBWXRYJHK-UHFFFAOYSA-N 0.000 description 1
- 229950000329 thiouracil Drugs 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- YFDSDPIBEUFTMI-UHFFFAOYSA-N tribromoethanol Chemical compound OCC(Br)(Br)Br YFDSDPIBEUFTMI-UHFFFAOYSA-N 0.000 description 1
- 229950004616 tribromoethanol Drugs 0.000 description 1
- GNMJFQWRASXXMS-UHFFFAOYSA-M trimethyl(phenyl)azanium;bromide Chemical compound [Br-].C[N+](C)(C)C1=CC=CC=C1 GNMJFQWRASXXMS-UHFFFAOYSA-M 0.000 description 1
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 1
- INDZTCRIYSRWOH-UHFFFAOYSA-N undec-10-enyl carbamimidothioate;hydroiodide Chemical compound I.NC(=N)SCCCCCCCCCC=C INDZTCRIYSRWOH-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/494—Silver salt compositions other than silver halide emulsions; Photothermographic systems ; Thermographic systems using noble metal compounds
- G03C1/498—Photothermographic systems, e.g. dry silver
- G03C1/49836—Additives
- G03C1/49863—Inert additives, e.g. surfactants, binders
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/04—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein with macromolecular additives; with layer-forming substances
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C2200/00—Details
- G03C2200/27—Gelatine content
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C2200/00—Details
- G03C2200/50—Polyvinyl alcohol
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP58169321A JPS6061747A (ja) | 1983-09-16 | 1983-09-16 | 熱現像感光材料 |
| US06/650,815 US4584267A (en) | 1983-09-16 | 1984-09-13 | Thermally developable, light-sensitive material |
| EP19840306324 EP0136142B1 (en) | 1983-09-16 | 1984-09-14 | Thermally developable, light-sensitive material |
| DE8484306324T DE3481936D1 (de) | 1983-09-16 | 1984-09-14 | Waermeentwickelbares lichtempfindliches material. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP58169321A JPS6061747A (ja) | 1983-09-16 | 1983-09-16 | 熱現像感光材料 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS6061747A JPS6061747A (ja) | 1985-04-09 |
| JPH0146053B2 true JPH0146053B2 (enFirst) | 1989-10-05 |
Family
ID=15884374
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP58169321A Granted JPS6061747A (ja) | 1983-09-16 | 1983-09-16 | 熱現像感光材料 |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4584267A (enFirst) |
| EP (1) | EP0136142B1 (enFirst) |
| JP (1) | JPS6061747A (enFirst) |
| DE (1) | DE3481936D1 (enFirst) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60119554A (ja) * | 1983-12-02 | 1985-06-27 | Konishiroku Photo Ind Co Ltd | 熱現像カラ−感光材料 |
| JPS60120357A (ja) * | 1983-12-05 | 1985-06-27 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS61153631A (ja) * | 1984-11-30 | 1986-07-12 | Fuji Photo Film Co Ltd | 熱現像カラ−感光材料 |
| JPS61176932A (ja) * | 1985-01-31 | 1986-08-08 | Konishiroku Photo Ind Co Ltd | 熱現像カラ−感光材料 |
| US4775613A (en) * | 1985-03-30 | 1988-10-04 | Fuji Photo Film Co., Ltd. | Heat-developable light-sensitive material |
| JPS61250636A (ja) | 1985-04-30 | 1986-11-07 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| DE3518113C2 (de) * | 1985-05-21 | 1987-03-19 | Felix Schoeller jr. GmbH & Co KG, 4500 Osnabrück | Trägermaterial für thermisch entwickelbare fotografische Aufzeichnungsmaterialien |
| JPS62141549A (ja) * | 1985-12-14 | 1987-06-25 | Konishiroku Photo Ind Co Ltd | 熱現像カラ−感光材料 |
| DE3781378T2 (de) * | 1986-11-06 | 1993-03-18 | Konishiroku Photo Ind | Waermeentwickelbares farbphotographisches material und verfahren zur bildherstellung. |
| JPS63314540A (ja) * | 1987-06-17 | 1988-12-22 | Fuji Photo Film Co Ltd | 感光材料 |
| US4840884A (en) * | 1987-10-19 | 1989-06-20 | Eastman Kodak Company | Photographic element and process comprising a dye releasing group |
| US4828971A (en) * | 1988-03-24 | 1989-05-09 | Eastman Kodak Company | Thermally processable element comprising a backing layer |
| US5051349A (en) * | 1989-03-09 | 1991-09-24 | Fuji Photo Film Co., Ltd. | Heat developable color photosensitive material with saccharide |
| US6277537B1 (en) | 1991-12-06 | 2001-08-21 | Eastman Kodak Company | Dye diffusion image separation systems with thermal solvents |
| US5270145A (en) * | 1991-12-06 | 1993-12-14 | Eastman Kodak Company | Heat image separation system |
| US5215837A (en) * | 1992-03-30 | 1993-06-01 | Chakalis Arthur T | Direct pigment photographic printing |
| US5356750A (en) * | 1992-12-21 | 1994-10-18 | Eastman Kodak Company | Dye releasing couplers for heat image separation systems |
| US5340613A (en) * | 1993-03-12 | 1994-08-23 | Minnesota Mining And Manufacturing Company | Process for simultaneously coating multiple layers of thermoreversible organogels and coated articles produced thereby |
| WO1994025900A1 (en) * | 1993-04-26 | 1994-11-10 | Minnesota Mining And Manufacturing Company | Photothermographic elements |
| US5480761A (en) * | 1993-06-08 | 1996-01-02 | Eastman Kodak Company | Aliphatic hydroxyl hydrogen bond donating groups on thermal solvents for image separation systems |
| US5468587A (en) * | 1993-06-08 | 1995-11-21 | Eastman Kodak Company | Hydrogen bond accepting groups on thermal solvents for image separation systems |
| US5480760A (en) * | 1993-06-08 | 1996-01-02 | Eastman Kodak Company | Sulfamoyl hydrogen bond donating groups on thermal solvents for image separation systems |
| US5470688A (en) * | 1994-05-27 | 1995-11-28 | Eastman Kodak Company | Heat development of elements containing methine-dye releasing couplers |
| US5455140A (en) * | 1994-05-27 | 1995-10-03 | Eastman Kodak Company | Methine-dye releasing couplers for heat image separation systems |
| US6132949A (en) * | 1996-12-25 | 2000-10-17 | Fuji Photo Film Co., Ltd. | Photothermographic material |
| JP2000035631A (ja) | 1998-05-11 | 2000-02-02 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| US7023594B2 (en) * | 2000-06-23 | 2006-04-04 | E-Vision, Llc | Electro-optic lens with integrated components |
| CN1216857C (zh) * | 2000-02-17 | 2005-08-31 | 布里斯托尔-迈尔斯斯奎布公司 | 由苯胺得到的甲状腺受体配体 |
| US6790569B2 (en) | 2000-06-13 | 2004-09-14 | Eastman Kodak Company | Color photothermographic elements comprising phenolic thermal solvents |
| US6841343B2 (en) | 2002-07-11 | 2005-01-11 | Eastman Kodak Company | Black-and-white organic solvent-based photothermographic materials containing mercaptotriazole toners |
| US6713240B2 (en) | 2002-07-11 | 2004-03-30 | Eastman Kodak Company | Black-and-white aqueous photothermographic materials containing mercaptotriazole toners |
| EP1384731B1 (en) * | 2002-07-23 | 2005-12-14 | Kuraray Co., Ltd. | Polyvinyl acetal and its use |
| US20050106514A1 (en) * | 2003-11-17 | 2005-05-19 | Eastman Kodak Company | Stabilized high-speed thermally developable emulsions and photothermographic materials |
| WO2008054654A2 (en) * | 2006-10-27 | 2008-05-08 | Pixeloptics, Inc. | Spectacle hinge for providing on off power |
| US8536087B2 (en) | 2010-04-08 | 2013-09-17 | International Imaging Materials, Inc. | Thermographic imaging element |
| CZ304011B6 (cs) * | 2012-10-10 | 2013-08-14 | Ceské vysoké ucení technické v Praze, Fakulta jaderná a fyzikálne inzenýrská | Zpusob orientacního stanovení kontaminace pudy nebo vody polychlorovanými bifenyly a zarízení |
| WO2022271595A1 (en) | 2021-06-23 | 2022-12-29 | International Imaging Materials, Inc. | Thermographic imaging element |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3561967A (en) * | 1966-08-31 | 1971-02-09 | Fuji Photo Film Co Ltd | Photographic light-sensitive silver halide elements |
| US3637394A (en) * | 1968-04-22 | 1972-01-25 | Eastman Kodak Co | Photographic elements containing synthetic polymeric vehicles |
| JPS5836764B2 (ja) * | 1977-04-08 | 1983-08-11 | 富士写真フイルム株式会社 | 熱現像感光材料 |
| JPS5828742A (ja) * | 1981-07-31 | 1983-02-19 | Konishiroku Photo Ind Co Ltd | 熱現像による画像形成方法 |
-
1983
- 1983-09-16 JP JP58169321A patent/JPS6061747A/ja active Granted
-
1984
- 1984-09-13 US US06/650,815 patent/US4584267A/en not_active Expired - Fee Related
- 1984-09-14 EP EP19840306324 patent/EP0136142B1/en not_active Expired
- 1984-09-14 DE DE8484306324T patent/DE3481936D1/de not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| EP0136142A3 (en) | 1986-11-20 |
| US4584267A (en) | 1986-04-22 |
| EP0136142B1 (en) | 1990-04-11 |
| JPS6061747A (ja) | 1985-04-09 |
| DE3481936D1 (de) | 1990-05-17 |
| EP0136142A2 (en) | 1985-04-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0146053B2 (enFirst) | ||
| US4770989A (en) | Heat-developable color photosensitive element | |
| JPH0257298B2 (enFirst) | ||
| JPH0554667B2 (enFirst) | ||
| US5071740A (en) | Heat developable color photosensitive material | |
| JPH027052B2 (enFirst) | ||
| JPH0690487B2 (ja) | 熱現像感光材料 | |
| JPH0477892B2 (enFirst) | ||
| JPH0587819B2 (enFirst) | ||
| JPH0812412B2 (ja) | 熱現像処理安定性及び長期保存安定性の優れた熱現像感光材料 | |
| JPH0685075B2 (ja) | 熱現像感光材料 | |
| JPH0345820B2 (enFirst) | ||
| JPH0413702B2 (enFirst) | ||
| JPH0146057B2 (enFirst) | ||
| JPH0146054B2 (enFirst) | ||
| JPH061364B2 (ja) | 熱現像感光材料 | |
| JPH0513300B2 (enFirst) | ||
| JPH0427538B2 (enFirst) | ||
| JPH0345819B2 (enFirst) | ||
| JPH0723956B2 (ja) | 熱現像カラ−感光材料 | |
| JPH0612431B2 (ja) | 熱現像カラ−感光材料 | |
| JPH0530259B2 (enFirst) | ||
| JPH0554104B2 (enFirst) | ||
| JPH0365534B2 (enFirst) | ||
| JPH0548900B2 (enFirst) |