JPH0134230B2 - - Google Patents
Info
- Publication number
- JPH0134230B2 JPH0134230B2 JP56058389A JP5838981A JPH0134230B2 JP H0134230 B2 JPH0134230 B2 JP H0134230B2 JP 56058389 A JP56058389 A JP 56058389A JP 5838981 A JP5838981 A JP 5838981A JP H0134230 B2 JPH0134230 B2 JP H0134230B2
- Authority
- JP
- Japan
- Prior art keywords
- amino
- group
- trideoxy
- methylkanamycin
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000003277 amino group Chemical group 0.000 claims description 36
- 150000001875 compounds Chemical class 0.000 claims description 32
- 125000006239 protecting group Chemical group 0.000 claims description 26
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 17
- 238000005917 acylation reaction Methods 0.000 claims description 10
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 8
- 238000007796 conventional method Methods 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 230000010933 acylation Effects 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 238000000034 method Methods 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 20
- 235000011114 ammonium hydroxide Nutrition 0.000 description 20
- 239000000203 mixture Substances 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- -1 3-amino-2-hydroxypropionyl Chemical group 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 11
- 241000894006 Bacteria Species 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 230000000844 anti-bacterial effect Effects 0.000 description 7
- SKKLOUVUUNMCJE-FQSMHNGLSA-N kanamycin B Chemical class N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SKKLOUVUUNMCJE-FQSMHNGLSA-N 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 5
- 229960001192 bekanamycin Drugs 0.000 description 5
- 229920001429 chelating resin Polymers 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 229930182824 kanamycin B Natural products 0.000 description 5
- 239000002994 raw material Substances 0.000 description 5
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 239000003242 anti bacterial agent Substances 0.000 description 4
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- JJCQSGDBDPYCEO-XVZSLQNASA-N dibekacin Chemical compound O1[C@H](CN)CC[C@@H](N)[C@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N JJCQSGDBDPYCEO-XVZSLQNASA-N 0.000 description 4
- 238000000921 elemental analysis Methods 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000001228 spectrum Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- STSCVKRWJPWALQ-UHFFFAOYSA-N TRIFLUOROACETIC ACID ETHYL ESTER Chemical compound CCOC(=O)C(F)(F)F STSCVKRWJPWALQ-UHFFFAOYSA-N 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000005170 cycloalkyloxycarbonyl group Chemical group 0.000 description 3
- 229960003807 dibekacin Drugs 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 3
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- IWBTVBUNSFJIIE-UHFFFAOYSA-N alpha-Oxy-delta-amino-butan-alpha-carbonsaeure Natural products NCCCC(O)C(O)=O IWBTVBUNSFJIIE-UHFFFAOYSA-N 0.000 description 2
- 229940126574 aminoglycoside antibiotic Drugs 0.000 description 2
- 239000002647 aminoglycoside antibiotic agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 239000002246 antineoplastic agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- UTUVRPOLEMRKQC-XDJMXTNXSA-N arbekacin sulfate Chemical compound OS(O)(=O)=O.O([C@@H]1[C@@H](N)C[C@H]([C@@H]([C@H]1O)O[C@@H]1[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O1)O)NC(=O)[C@@H](O)CCN)[C@H]1O[C@H](CN)CC[C@H]1N UTUVRPOLEMRKQC-XDJMXTNXSA-N 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 229940127089 cytotoxic agent Drugs 0.000 description 2
- 229940058499 habekacin Drugs 0.000 description 2
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 238000010647 peptide synthesis reaction Methods 0.000 description 2
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- QQWYQAQQADNEIC-UHFFFAOYSA-N tert-butyl [[cyano(phenyl)methylidene]amino] carbonate Chemical compound CC(C)(C)OC(=O)ON=C(C#N)C1=CC=CC=C1 QQWYQAQQADNEIC-UHFFFAOYSA-N 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 1
- XXMFJKNOJSDQBM-UHFFFAOYSA-N 2,2,2-trifluoroacetic acid;hydrate Chemical compound [OH3+].[O-]C(=O)C(F)(F)F XXMFJKNOJSDQBM-UHFFFAOYSA-N 0.000 description 1
- UNUQXLJLWDXYIS-UHFFFAOYSA-N 2-(aminomethyl)-6-[2,4-diamino-5-[4-amino-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexyl]oxyoxane-3,4,5-triol Chemical compound OC1C(O)C(O)C(CN)OC1OC1C(N)CC(N)C(OC2C(C(N)C(O)C(CO)O2)O)C1 UNUQXLJLWDXYIS-UHFFFAOYSA-N 0.000 description 1
- WUTLNOPJONZVEX-UHFFFAOYSA-N 2-hydroxy-3-[(4-methoxyphenyl)methoxycarbonylamino]propanoic acid Chemical compound COC1=CC=C(COC(=O)NCC(O)C(O)=O)C=C1 WUTLNOPJONZVEX-UHFFFAOYSA-N 0.000 description 1
- SJZRECIVHVDYJC-UHFFFAOYSA-N 4-hydroxybutyric acid Chemical compound OCCCC(O)=O SJZRECIVHVDYJC-UHFFFAOYSA-N 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 102000004357 Transferases Human genes 0.000 description 1
- 108090000992 Transferases Proteins 0.000 description 1
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940126575 aminoglycoside Drugs 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 229960005397 arbekacin Drugs 0.000 description 1
- MKKYBZZTJQGVCD-XTCKQBCOSA-N arbekacin Chemical compound O([C@@H]1[C@@H](N)C[C@H]([C@@H]([C@H]1O)O[C@@H]1[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O1)O)NC(=O)[C@@H](O)CCN)[C@H]1O[C@H](CN)CC[C@H]1N MKKYBZZTJQGVCD-XTCKQBCOSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229940099690 malic acid Drugs 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- PGXWDLGWMQIXDT-UHFFFAOYSA-N methylsulfinylmethane;hydrate Chemical compound O.CS(C)=O PGXWDLGWMQIXDT-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- FEMOMIGRRWSMCU-UHFFFAOYSA-N ninhydrin Chemical compound C1=CC=C2C(=O)C(O)(O)C(=O)C2=C1 FEMOMIGRRWSMCU-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000006916 nutrient agar Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000005328 phosphinyl group Chemical group [PH2](=O)* 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- RUPAXCPQAAOIPB-UHFFFAOYSA-N tert-butyl formate Chemical group CC(C)(C)OC=O RUPAXCPQAAOIPB-UHFFFAOYSA-N 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
Classifications
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Saccharide Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP56058389A JPS57175198A (en) | 1981-04-20 | 1981-04-20 | 1-n-acyl derivative of 5,3,4-trideoxy-6-n-methylkanamycin b and their preparation |
| NL8103639A NL8103639A (nl) | 1980-08-12 | 1981-07-31 | Nieuwe 1-n-(alfa-hydroxy-omega-aminoalkanoyl)-derivaten van 5,3',4'-trideoxy-,5,3',4'-trideoxy-6'-methyl-of 5,3',4',6"-tetradeoxykanamycine-b, en werkwijze voor het bereiden daarvan. |
| KR1019810002784A KR850000979B1 (ko) | 1980-08-12 | 1981-07-31 | 5, 3', 4'-트리데옥시-또는 5, 3', 4'-트리데옥시-6'-N-메틸-또는 5, 3', 4', 6"-테트라데옥시-카나마이신 B의 1-N-(α-히드록시-ω-아미노알카노일)유도체의 제조방법 |
| IT09493/81A IT1167959B (it) | 1980-08-12 | 1981-08-07 | 1-n-(alfa-idrossi-omega-amminoalcanoil) derivati della 5,3',4',-trideossi- 0 5,3',4'-trideossi-6'-n-metil- 0 5,3',4',6-tetradeossi-kanamicina b e produzione di essi |
| CH5133/81A CH648564A5 (de) | 1980-08-12 | 1981-08-10 | Gegebenenfalls 1-n-acyliertes 5,3,4-trideoxy- oder 5,3,4-trideoxy-6-n-methyl- oder 5,3,4,6-tetradeoxykanamycin-b und verfahren zu dessen herstellung. |
| FR8115781A FR2491073A1 (fr) | 1980-08-12 | 1981-08-10 | Nouveaux derives 1-n- (a-hydroxy-o-aminoalcanoyl des 5,3',4'-tridesoxy- ou 5,3',4'-tridesoxy-6'-n-methyl- ou 5,3',4',6''-tetradesoxykanamycine b, leurs procedes de production et les compositions antibacteriennes les renfermant |
| GB8124490A GB2082575B (en) | 1980-08-12 | 1981-08-11 | 1-n-(hydroxy-w-aminoalkanoyl) derivatives of deoxykanamycin b compounds |
| DE19813152755 DE3152755C2 (de) | 1980-08-12 | 1981-08-11 | 5,3'4,6a-Tetradesoxy-kanamycin b, dessen 1-N-Ä(s)-4-Amino-2-hydroxybutyrylderivat, Verfahren zu deren Herstellung und diese Verbindungen enthaltende antibakterielle Mittel |
| ES504697A ES8301486A1 (es) | 1980-08-12 | 1981-08-11 | Nuevos derivados 1-n-(x-hidroxi-w-aminoalcanoil)de 5,3'4'- tridesoxi-o 5,3,4'-tridesoxi-6'-n-metil-o 5,3',4',6 -tetra- desoxi-kanamicina b y produccion de los mismos |
| DE3131731A DE3131731C2 (de) | 1980-08-12 | 1981-08-11 | An der 6'- oder/und 1-Aminogruppe substituierte 5,3',4'-Tridesoxykanamycine B, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende antibakterielle Mittel |
| CA000383690A CA1175816A (en) | 1980-08-12 | 1981-08-12 | 1-N-(.alpha.-HYDROXY-.omega.-AMINOALKANOYL) DERIVATIVES OF 5, 3',4'-TRIDEOXY- OR 5,3',4'-TRIDEOXY-6'-N-METHYL- OR 5,3',4',6"-TETRADEOXY-KANAMYCIN B AND PRODUCTION THEREOF |
| ES514622A ES8308334A1 (es) | 1980-08-12 | 1982-07-31 | "proceso para la produccion de 5,3',4'-tridesoxi-6'-n-metilkanamicina b". |
| ES514621A ES8401093A1 (es) | 1980-08-12 | 1982-07-31 | "proceso para la produccion de 5,3',4',6"-tetradesoxikanamicina b". |
| ES514620A ES8401092A1 (es) | 1980-08-12 | 1982-07-31 | "proceso para la produccion de una 1-n-(-hidroxi-aminoalcanoil)-5,3',4'-tridesoxi-6'-n-metilkanamicina b". |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP56058389A JPS57175198A (en) | 1981-04-20 | 1981-04-20 | 1-n-acyl derivative of 5,3,4-trideoxy-6-n-methylkanamycin b and their preparation |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS57175198A JPS57175198A (en) | 1982-10-28 |
| JPH0134230B2 true JPH0134230B2 (US08080257-20111220-C00005.png) | 1989-07-18 |
Family
ID=13082982
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP56058389A Granted JPS57175198A (en) | 1980-08-12 | 1981-04-20 | 1-n-acyl derivative of 5,3,4-trideoxy-6-n-methylkanamycin b and their preparation |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS57175198A (US08080257-20111220-C00005.png) |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5148634A (en) * | 1974-10-08 | 1976-04-26 | Microbial Chem Res Found | Taiseikinnyukona 11nn * arufua hidorokishi omega aminoashiru * 6**nn mechiru 3* *hh jideokishikanamaishin b no seizoho |
| JPS5459255A (en) * | 1977-10-14 | 1979-05-12 | Suami T | 55deoxykanamicin b and production thereof |
-
1981
- 1981-04-20 JP JP56058389A patent/JPS57175198A/ja active Granted
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5148634A (en) * | 1974-10-08 | 1976-04-26 | Microbial Chem Res Found | Taiseikinnyukona 11nn * arufua hidorokishi omega aminoashiru * 6**nn mechiru 3* *hh jideokishikanamaishin b no seizoho |
| JPS5459255A (en) * | 1977-10-14 | 1979-05-12 | Suami T | 55deoxykanamicin b and production thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS57175198A (en) | 1982-10-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB2036020A (en) | Production of a selectively protected n-acylated derivatives of an aminoglycosidic antibiotic | |
| US4055715A (en) | Method of producing 1-N-[L-(-)-α-hydroxy-γ-aminobutyryl]XK-62-2 | |
| US3808198A (en) | Lividomycin b derivatives | |
| US4170642A (en) | Derivatives of kanamycin A | |
| US3872079A (en) | Semisynthetic derivatives of tobramycin | |
| US4195171A (en) | Derivatives of an antibiotic XK-62-2 and process for the production thereof | |
| US4547492A (en) | 1-N-(ω-Amino-α-hydroxyalkanoyl-2',3'-dideoxykanamycin A and pharmaceutical composition containing same | |
| CA1175818A (en) | Derivatives of istamycins a and b and their preparation | |
| KR840001622B1 (ko) | 3-0-데메틸 이스타마이신 b의 제조방법 | |
| US3939143A (en) | 1-N-isoserylkanamycins and the production thereof | |
| US4169942A (en) | Fortimicin derivatives and method for production thereof | |
| US4008362A (en) | 1-N-((S)-α-substituted-ω-aminoacyl)-neamine or -ribostamycin and the production thereof | |
| JPH0134230B2 (US08080257-20111220-C00005.png) | ||
| IE47271B1 (en) | Process for the preparation of 1-n-acyl-aminoglycosides | |
| US4140849A (en) | Kanamycin C derivatives | |
| JPH0764866B2 (ja) | １−ｎ−（４−アミノ−３−フルオロ−２−ヒドロキシブチリル）カナマイシン類 | |
| US4132846A (en) | 1-N-(α-Hydroxy-β-aminopropionyl) XK-62-2 and method of production thereof | |
| EP0108563B1 (en) | 3-demethoxyistamycin b and its 2"-n-formimidoyl derivative | |
| US4008218A (en) | 1-N-((S)-α-substituted-ω-aminoacyl)-neamine or -ribostamycin and the production thereof | |
| US4214077A (en) | 1-N-Substituted derivatives of seldomycin factor 5 | |
| US4268664A (en) | Process for the preparation of 1-N-isoseryl- or 1-N-(L-4-amino-2-hydroxybutyryl)-3',4'-dideoxykanamycin B and intermediates thereof | |
| US4332794A (en) | 6"-Deoxydibekacin, 4",6"-dideoxydibekacin and 1-N-aminoacyl derivatives thereof, and the production of these new compounds | |
| EP0236942B1 (en) | 2'-deamino-2'-hydroxyistamycin bo derivatives of low toxicity | |
| FI56388C (fi) | Foerfarande foer framstaellning av en ny terapeutiskt anvaendbar 1-n-ny-amino-alfa-hydroxibutyryl-substituerad kanamycin(a eller b)-foerening | |
| US4410516A (en) | 1-N(αHydroxy-ω-aminoalkanoyl) derivatives of 5,3',4'-trideoxy- or 5,3', 4'-trideoxy-6'-N- methyl- or 5, 3', 4',6"-tetradeoxykannamyci B and production thereof |