JP5715646B2 - 殺菌・殺カビ性ヘテロ環式化合物 - Google Patents
殺菌・殺カビ性ヘテロ環式化合物 Download PDFInfo
- Publication number
 - JP5715646B2 JP5715646B2 JP2012548142A JP2012548142A JP5715646B2 JP 5715646 B2 JP5715646 B2 JP 5715646B2 JP 2012548142 A JP2012548142 A JP 2012548142A JP 2012548142 A JP2012548142 A JP 2012548142A JP 5715646 B2 JP5715646 B2 JP 5715646B2
 - Authority
 - JP
 - Japan
 - Prior art keywords
 - formula
 - compound
 - ring
 - alkyl
 - independently
 - Prior art date
 - Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
 - Expired - Fee Related
 
Links
- 230000000844 anti-bacterial effect Effects 0.000 title claims description 89
 - 230000000855 fungicidal effect Effects 0.000 title description 86
 - 150000002391 heterocyclic compounds Chemical class 0.000 title description 6
 - 150000001875 compounds Chemical class 0.000 claims description 491
 - -1 cyano, hydroxy Chemical group 0.000 claims description 230
 - 239000000203 mixture Substances 0.000 claims description 124
 - 125000000217 alkyl group Chemical group 0.000 claims description 91
 - 239000003899 bactericide agent Substances 0.000 claims description 74
 - 238000000034 method Methods 0.000 claims description 73
 - 229910052736 halogen Inorganic materials 0.000 claims description 68
 - 150000002367 halogens Chemical class 0.000 claims description 68
 - 125000003545 alkoxy group Chemical group 0.000 claims description 60
 - 150000001721 carbon Chemical group 0.000 claims description 59
 - 150000003839 salts Chemical class 0.000 claims description 36
 - 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 31
 - 201000010099 disease Diseases 0.000 claims description 30
 - 239000007787 solid Substances 0.000 claims description 30
 - 239000007788 liquid Substances 0.000 claims description 29
 - OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 26
 - 239000003085 diluting agent Substances 0.000 claims description 26
 - 150000001204 N-oxides Chemical class 0.000 claims description 25
 - 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 20
 - 239000004094 surface-active agent Substances 0.000 claims description 20
 - 229910052794 bromium Inorganic materials 0.000 claims description 15
 - 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 14
 - 229910052801 chlorine Inorganic materials 0.000 claims description 12
 - 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 9
 - 229910052731 fluorine Inorganic materials 0.000 claims description 7
 - 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 6
 - 244000000004 fungal plant pathogen Species 0.000 claims description 6
 - IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims description 5
 - IHWDAPFDNLKOQW-UHFFFAOYSA-N 1-[2-acetyl-4-[4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]diazinan-1-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone Chemical compound CC(=O)N1CC(C=2SC=C(N=2)C=2CC(ON=2)C=2C(=CC=CC=2F)F)CCN1C(=O)CN1N=C(C(F)(F)F)C=C1C IHWDAPFDNLKOQW-UHFFFAOYSA-N 0.000 claims description 2
 - LUWYYWRUWNBSGP-UHFFFAOYSA-N 1-[4-[4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]diazinan-1-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone Chemical compound CC1=CC(C(F)(F)F)=NN1CC(=O)N1NCC(C=2SC=C(N=2)C=2CC(ON=2)C=2C(=CC=CC=2F)F)CC1 LUWYYWRUWNBSGP-UHFFFAOYSA-N 0.000 claims description 2
 - 239000000417 fungicide Substances 0.000 description 302
 - SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 161
 - OIPMQULDKWSNGX-UHFFFAOYSA-N bis[[ethoxy(oxo)phosphaniumyl]oxy]alumanyloxy-ethoxy-oxophosphanium Chemical compound [Al+3].CCO[P+]([O-])=O.CCO[P+]([O-])=O.CCO[P+]([O-])=O OIPMQULDKWSNGX-UHFFFAOYSA-N 0.000 description 129
 - YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 88
 - 125000001424 substituent group Chemical group 0.000 description 86
 - 229910052799 carbon Inorganic materials 0.000 description 71
 - RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 62
 - 125000004433 nitrogen atom Chemical group N* 0.000 description 60
 - 241000894006 Bacteria Species 0.000 description 56
 - 125000004093 cyano group Chemical group *C#N 0.000 description 56
 - 125000004429 atom Chemical group 0.000 description 53
 - XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 53
 - 125000000623 heterocyclic group Chemical group 0.000 description 49
 - 150000001412 amines Chemical class 0.000 description 48
 - 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 47
 - 238000002360 preparation method Methods 0.000 description 47
 - 239000011541 reaction mixture Substances 0.000 description 47
 - 241000196324 Embryophyta Species 0.000 description 45
 - 125000005842 heteroatom Chemical group 0.000 description 45
 - WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 43
 - 238000006243 chemical reaction Methods 0.000 description 43
 - XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 39
 - OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
 - ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 39
 - ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 39
 - 229910052757 nitrogen Inorganic materials 0.000 description 37
 - WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
 - 239000002253 acid Substances 0.000 description 36
 - 229910052739 hydrogen Inorganic materials 0.000 description 36
 - 125000004122 cyclic group Chemical group 0.000 description 34
 - 239000003921 oil Substances 0.000 description 34
 - 235000019198 oils Nutrition 0.000 description 34
 - 230000002829 reductive effect Effects 0.000 description 34
 - 125000001624 naphthyl group Chemical group 0.000 description 33
 - 239000000047 product Substances 0.000 description 33
 - 229920006395 saturated elastomer Polymers 0.000 description 30
 - BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 29
 - 230000015572 biosynthetic process Effects 0.000 description 28
 - 125000004432 carbon atom Chemical group C* 0.000 description 28
 - 229910052760 oxygen Inorganic materials 0.000 description 28
 - HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
 - 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 description 26
 - 241000233866 Fungi Species 0.000 description 26
 - VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
 - CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 26
 - 239000002585 base Substances 0.000 description 26
 - 239000002904 solvent Substances 0.000 description 26
 - 238000009472 formulation Methods 0.000 description 25
 - 125000001188 haloalkyl group Chemical group 0.000 description 25
 - 239000000243 solution Substances 0.000 description 25
 - LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
 - 238000012360 testing method Methods 0.000 description 23
 - 229940125782 compound 2 Drugs 0.000 description 22
 - 230000012010 growth Effects 0.000 description 22
 - KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 21
 - JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 21
 - YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
 - 239000004480 active ingredient Substances 0.000 description 21
 - 229940125904 compound 1 Drugs 0.000 description 21
 - 229940126214 compound 3 Drugs 0.000 description 21
 - 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 description 20
 - AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 20
 - VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 20
 - FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 19
 - 229910052717 sulfur Inorganic materials 0.000 description 19
 - IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
 - 230000002538 fungal effect Effects 0.000 description 18
 - 125000004434 sulfur atom Chemical group 0.000 description 18
 - 238000003786 synthesis reaction Methods 0.000 description 18
 - 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 17
 - KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 17
 - YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 17
 - 229930182558 Sterol Natural products 0.000 description 17
 - 235000003702 sterols Nutrition 0.000 description 17
 - 239000000725 suspension Substances 0.000 description 17
 - VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 16
 - 239000000460 chlorine Substances 0.000 description 16
 - 230000005764 inhibitory process Effects 0.000 description 16
 - 235000011181 potassium carbonates Nutrition 0.000 description 16
 - 150000003432 sterols Chemical class 0.000 description 16
 - 238000006467 substitution reaction Methods 0.000 description 16
 - YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 16
 - FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 15
 - 125000004663 dialkyl amino group Chemical group 0.000 description 15
 - 125000004438 haloalkoxy group Chemical group 0.000 description 15
 - 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 15
 - QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 15
 - 239000000126 substance Substances 0.000 description 15
 - 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 14
 - HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
 - 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 14
 - 150000001408 amides Chemical class 0.000 description 14
 - 125000002619 bicyclic group Chemical group 0.000 description 14
 - 239000003153 chemical reaction reagent Substances 0.000 description 14
 - 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 14
 - 125000000753 cycloalkyl group Chemical group 0.000 description 14
 - 229910052943 magnesium sulfate Inorganic materials 0.000 description 13
 - 235000019341 magnesium sulphate Nutrition 0.000 description 13
 - 239000000463 material Substances 0.000 description 13
 - 229910000027 potassium carbonate Inorganic materials 0.000 description 13
 - JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 12
 - CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
 - 125000003282 alkyl amino group Chemical group 0.000 description 12
 - 125000005120 alkyl cycloalkyl alkyl group Chemical group 0.000 description 12
 - 125000000000 cycloalkoxy group Chemical group 0.000 description 12
 - 125000000524 functional group Chemical group 0.000 description 12
 - 125000002887 hydroxy group Chemical group [H]O* 0.000 description 12
 - 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 description 11
 - MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 11
 - DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 11
 - 125000004414 alkyl thio group Chemical group 0.000 description 11
 - 239000003112 inhibitor Substances 0.000 description 11
 - 239000000543 intermediate Substances 0.000 description 11
 - 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 description 10
 - 125000006643 (C2-C6) haloalkenyl group Chemical group 0.000 description 10
 - 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 10
 - 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 10
 - IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
 - ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 10
 - NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 10
 - XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 10
 - 125000006615 aromatic heterocyclic group Chemical group 0.000 description 10
 - 125000003118 aryl group Chemical group 0.000 description 10
 - 150000003857 carboxamides Chemical class 0.000 description 10
 - 239000003795 chemical substances by application Substances 0.000 description 10
 - 125000004473 dialkylaminocarbonyl group Chemical group 0.000 description 10
 - 239000003208 petroleum Substances 0.000 description 10
 - UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 10
 - 239000002516 radical scavenger Substances 0.000 description 10
 - 125000004665 trialkylsilyl group Chemical group 0.000 description 10
 - NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 9
 - 230000009471 action Effects 0.000 description 9
 - 235000014113 dietary fatty acids Nutrition 0.000 description 9
 - 239000000194 fatty acid Substances 0.000 description 9
 - 229930195729 fatty acid Natural products 0.000 description 9
 - 125000005347 halocycloalkyl group Chemical group 0.000 description 9
 - RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 9
 - 230000002401 inhibitory effect Effects 0.000 description 9
 - 239000012044 organic layer Substances 0.000 description 9
 - 238000000746 purification Methods 0.000 description 9
 - 238000010898 silica gel chromatography Methods 0.000 description 9
 - 239000011780 sodium chloride Substances 0.000 description 9
 - 229910052721 tungsten Inorganic materials 0.000 description 9
 - 125000004768 (C1-C4) alkylsulfinyl group Chemical group 0.000 description 8
 - 125000004771 (C1-C4) haloalkylsulfinyl group Chemical group 0.000 description 8
 - 125000004737 (C1-C6) haloalkoxy group Chemical group 0.000 description 8
 - GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 8
 - CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
 - QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
 - VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
 - 101150065749 Churc1 gene Proteins 0.000 description 8
 - XUMBMVFBXHLACL-UHFFFAOYSA-N Melanin Chemical compound O=C1C(=O)C(C2=CNC3=C(C(C(=O)C4=C32)=O)C)=C2C4=CNC2=C1C XUMBMVFBXHLACL-UHFFFAOYSA-N 0.000 description 8
 - 102100038239 Protein Churchill Human genes 0.000 description 8
 - UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
 - 150000001336 alkenes Chemical class 0.000 description 8
 - 125000003342 alkenyl group Chemical group 0.000 description 8
 - 125000004183 alkoxy alkyl group Chemical group 0.000 description 8
 - CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 8
 - 238000010168 coupling process Methods 0.000 description 8
 - 125000005112 cycloalkylalkoxy group Chemical group 0.000 description 8
 - 238000011161 development Methods 0.000 description 8
 - 230000018109 developmental process Effects 0.000 description 8
 - AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 8
 - 238000007429 general method Methods 0.000 description 8
 - 125000000262 haloalkenyl group Chemical group 0.000 description 8
 - 244000052769 pathogen Species 0.000 description 8
 - 230000008569 process Effects 0.000 description 8
 - 230000001954 sterilising effect Effects 0.000 description 8
 - 238000011282 treatment Methods 0.000 description 8
 - XTFIVUDBNACUBN-UHFFFAOYSA-N 1,3,5-trinitro-1,3,5-triazinane Chemical compound [O-][N+](=O)N1CN([N+]([O-])=O)CN([N+]([O-])=O)C1 XTFIVUDBNACUBN-UHFFFAOYSA-N 0.000 description 7
 - HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 7
 - 239000005909 Kieselgur Substances 0.000 description 7
 - AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 7
 - 125000006350 alkyl thio alkyl group Chemical group 0.000 description 7
 - 238000013459 approach Methods 0.000 description 7
 - 150000001732 carboxylic acid derivatives Chemical class 0.000 description 7
 - 230000008878 coupling Effects 0.000 description 7
 - 238000005859 coupling reaction Methods 0.000 description 7
 - 125000004858 cycloalkoxyalkyl group Chemical group 0.000 description 7
 - 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 7
 - 230000008099 melanin synthesis Effects 0.000 description 7
 - 239000012528 membrane Substances 0.000 description 7
 - 150000002825 nitriles Chemical group 0.000 description 7
 - 125000004430 oxygen atom Chemical group O* 0.000 description 7
 - 150000003904 phospholipids Chemical class 0.000 description 7
 - 125000006239 protecting group Chemical group 0.000 description 7
 - 230000029058 respiratory gaseous exchange Effects 0.000 description 7
 - 125000006677 (C1-C3) haloalkoxy group Chemical group 0.000 description 6
 - 125000006700 (C1-C6) alkylthio group Chemical group 0.000 description 6
 - 125000006771 (C1-C6) haloalkylthio group Chemical group 0.000 description 6
 - 125000006766 (C2-C6) alkynyloxy group Chemical group 0.000 description 6
 - 125000006765 (C2-C6) haloalkenyloxy group Chemical group 0.000 description 6
 - NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 6
 - YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 6
 - QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
 - 0 C*c1cc([N+])cc(C)c1C(CC(C)=C)[U] Chemical compound C*c1cc([N+])cc(C)c1C(CC(C)=C)[U] 0.000 description 6
 - 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 description 6
 - 125000003320 C2-C6 alkenyloxy group Chemical group 0.000 description 6
 - 102000004190 Enzymes Human genes 0.000 description 6
 - 108090000790 Enzymes Proteins 0.000 description 6
 - LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
 - 102000029749 Microtubule Human genes 0.000 description 6
 - 108091022875 Microtubule Proteins 0.000 description 6
 - 241000233614 Phytophthora Species 0.000 description 6
 - GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 6
 - KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
 - 240000003768 Solanum lycopersicum Species 0.000 description 6
 - XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
 - 150000001299 aldehydes Chemical class 0.000 description 6
 - 125000005081 alkoxyalkoxyalkyl group Chemical group 0.000 description 6
 - 125000000278 alkyl amino alkyl group Chemical group 0.000 description 6
 - 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 6
 - 125000005196 alkyl carbonyloxy group Chemical group 0.000 description 6
 - 125000005133 alkynyloxy group Chemical group 0.000 description 6
 - 230000000975 bioactive effect Effects 0.000 description 6
 - 230000006696 biosynthetic metabolic pathway Effects 0.000 description 6
 - DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 6
 - 125000006310 cycloalkyl amino group Chemical group 0.000 description 6
 - 125000005366 cycloalkylthio group Chemical group 0.000 description 6
 - 239000000645 desinfectant Substances 0.000 description 6
 - 150000002148 esters Chemical class 0.000 description 6
 - 238000001914 filtration Methods 0.000 description 6
 - 125000000232 haloalkynyl group Chemical group 0.000 description 6
 - 125000004435 hydrogen atom Chemical group [H]* 0.000 description 6
 - 229910052740 iodine Inorganic materials 0.000 description 6
 - 125000003971 isoxazolinyl group Chemical group 0.000 description 6
 - 150000002576 ketones Chemical class 0.000 description 6
 - 230000007246 mechanism Effects 0.000 description 6
 - 210000004688 microtubule Anatomy 0.000 description 6
 - JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 6
 - CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
 - 229920000642 polymer Polymers 0.000 description 6
 - 229910000029 sodium carbonate Inorganic materials 0.000 description 6
 - 235000017550 sodium carbonate Nutrition 0.000 description 6
 - 239000012312 sodium hydride Substances 0.000 description 6
 - 229910000104 sodium hydride Inorganic materials 0.000 description 6
 - ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 6
 - YLZGKZDEFJIHIJ-UHFFFAOYSA-N (1-methylbenzimidazol-2-yl) carbamate Chemical compound C1=CC=C2N(C)C(OC(N)=O)=NC2=C1 YLZGKZDEFJIHIJ-UHFFFAOYSA-N 0.000 description 5
 - ZMYFCFLJBGAQRS-IAGOWNOFSA-N (2S,3R)-epoxiconazole Chemical compound C1=CC(F)=CC=C1[C@]1(CN2N=CN=C2)[C@@H](C=2C(=CC=CC=2)Cl)O1 ZMYFCFLJBGAQRS-IAGOWNOFSA-N 0.000 description 5
 - PPDBOQMNKNNODG-NTEUORMPSA-N (5E)-5-(4-chlorobenzylidene)-2,2-dimethyl-1-(1,2,4-triazol-1-ylmethyl)cyclopentanol Chemical compound C1=NC=NN1CC1(O)C(C)(C)CC\C1=C/C1=CC=C(Cl)C=C1 PPDBOQMNKNNODG-NTEUORMPSA-N 0.000 description 5
 - 125000006656 (C2-C4) alkenyl group Chemical group 0.000 description 5
 - 125000006650 (C2-C4) alkynyl group Chemical group 0.000 description 5
 - PXMNMQRDXWABCY-UHFFFAOYSA-N 1-(4-chlorophenyl)-4,4-dimethyl-3-(1H-1,2,4-triazol-1-ylmethyl)pentan-3-ol Chemical compound C1=NC=NN1CC(O)(C(C)(C)C)CCC1=CC=C(Cl)C=C1 PXMNMQRDXWABCY-UHFFFAOYSA-N 0.000 description 5
 - MNHVNIJQQRJYDH-UHFFFAOYSA-N 2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2-dihydro-1,2,4-triazole-3-thione Chemical compound N1=CNC(=S)N1CC(C1(Cl)CC1)(O)CC1=CC=CC=C1Cl MNHVNIJQQRJYDH-UHFFFAOYSA-N 0.000 description 5
 - LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 5
 - PCCSBWNGDMYFCW-UHFFFAOYSA-N 5-methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-1,3-oxazolidine-2,4-dione Chemical compound O=C1C(C)(C=2C=CC(OC=3C=CC=CC=3)=CC=2)OC(=O)N1NC1=CC=CC=C1 PCCSBWNGDMYFCW-UHFFFAOYSA-N 0.000 description 5
 - CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 5
 - 125000004648 C2-C8 alkenyl group Chemical group 0.000 description 5
 - 239000005762 Dimoxystrobin Substances 0.000 description 5
 - 239000005772 Famoxadone Substances 0.000 description 5
 - 235000007688 Lycopersicon esculentum Nutrition 0.000 description 5
 - 239000005868 Metconazole Substances 0.000 description 5
 - CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 5
 - 239000005818 Picoxystrobin Substances 0.000 description 5
 - 239000002202 Polyethylene glycol Substances 0.000 description 5
 - 239000005822 Propiconazole Substances 0.000 description 5
 - 239000005825 Prothioconazole Substances 0.000 description 5
 - 239000005869 Pyraclostrobin Substances 0.000 description 5
 - 239000005839 Tebuconazole Substances 0.000 description 5
 - 239000005857 Trifloxystrobin Substances 0.000 description 5
 - 239000005859 Triticonazole Substances 0.000 description 5
 - 150000007513 acids Chemical class 0.000 description 5
 - 125000003302 alkenyloxy group Chemical group 0.000 description 5
 - 125000005083 alkoxyalkoxy group Chemical group 0.000 description 5
 - 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 5
 - 125000004687 alkyl sulfinyl alkyl group Chemical group 0.000 description 5
 - 125000004656 alkyl sulfonylamino group Chemical group 0.000 description 5
 - 239000003242 anti bacterial agent Substances 0.000 description 5
 - 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
 - GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
 - 125000002837 carbocyclic group Chemical group 0.000 description 5
 - 210000004027 cell Anatomy 0.000 description 5
 - 210000002421 cell wall Anatomy 0.000 description 5
 - 150000001880 copper compounds Chemical class 0.000 description 5
 - 125000005201 cycloalkylcarbonyloxy group Chemical group 0.000 description 5
 - ACMXQHFNODYQAT-UHFFFAOYSA-N cyflufenamid Chemical compound FC1=CC=C(C(F)(F)F)C(C(NOCC2CC2)=NC(=O)CC=2C=CC=CC=2)=C1F ACMXQHFNODYQAT-UHFFFAOYSA-N 0.000 description 5
 - 238000010511 deprotection reaction Methods 0.000 description 5
 - SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 5
 - WXUZAHCNPWONDH-DYTRJAOYSA-N dimoxystrobin Chemical compound CNC(=O)C(=N\OC)\C1=CC=CC=C1COC1=CC(C)=CC=C1C WXUZAHCNPWONDH-DYTRJAOYSA-N 0.000 description 5
 - 239000012990 dithiocarbamate Substances 0.000 description 5
 - 235000013399 edible fruits Nutrition 0.000 description 5
 - 239000004495 emulsifiable concentrate Substances 0.000 description 5
 - 125000004995 haloalkylthio group Chemical group 0.000 description 5
 - 239000001257 hydrogen Substances 0.000 description 5
 - 230000007062 hydrolysis Effects 0.000 description 5
 - 238000006460 hydrolysis reaction Methods 0.000 description 5
 - XWPZUHJBOLQNMN-UHFFFAOYSA-N metconazole Chemical compound C1=NC=NN1CC1(O)C(C)(C)CCC1CC1=CC=C(Cl)C=C1 XWPZUHJBOLQNMN-UHFFFAOYSA-N 0.000 description 5
 - 230000003647 oxidation Effects 0.000 description 5
 - 238000007254 oxidation reaction Methods 0.000 description 5
 - XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 5
 - IBSNKSODLGJUMQ-SDNWHVSQSA-N picoxystrobin Chemical compound CO\C=C(\C(=O)OC)C1=CC=CC=C1COC1=CC=CC(C(F)(F)F)=N1 IBSNKSODLGJUMQ-SDNWHVSQSA-N 0.000 description 5
 - 125000003386 piperidinyl group Chemical group 0.000 description 5
 - 229920001223 polyethylene glycol Polymers 0.000 description 5
 - 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
 - STJLVHWMYQXCPB-UHFFFAOYSA-N propiconazole Chemical compound O1C(CCC)COC1(C=1C(=CC(Cl)=CC=1)Cl)CN1N=CN=C1 STJLVHWMYQXCPB-UHFFFAOYSA-N 0.000 description 5
 - HZRSNVGNWUDEFX-UHFFFAOYSA-N pyraclostrobin Chemical compound COC(=O)N(OC)C1=CC=CC=C1COC1=NN(C=2C=CC(Cl)=CC=2)C=C1 HZRSNVGNWUDEFX-UHFFFAOYSA-N 0.000 description 5
 - 150000003254 radicals Chemical class 0.000 description 5
 - 239000003206 sterilizing agent Substances 0.000 description 5
 - UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 5
 - ONCZDRURRATYFI-TVJDWZFNSA-N trifloxystrobin Chemical compound CO\N=C(\C(=O)OC)C1=CC=CC=C1CO\N=C(/C)C1=CC=CC(C(F)(F)F)=C1 ONCZDRURRATYFI-TVJDWZFNSA-N 0.000 description 5
 - OILXMJHPFNGGTO-UHFFFAOYSA-N (22E)-(24xi)-24-methylcholesta-5,22-dien-3beta-ol Natural products C1C=C2CC(O)CCC2(C)C2C1C1CCC(C(C)C=CC(C)C(C)C)C1(C)CC2 OILXMJHPFNGGTO-UHFFFAOYSA-N 0.000 description 4
 - RQOCXCFLRBRBCS-UHFFFAOYSA-N (22E)-cholesta-5,7,22-trien-3beta-ol Natural products C1C(O)CCC2(C)C(CCC3(C(C(C)C=CCC(C)C)CCC33)C)C3=CC=C21 RQOCXCFLRBRBCS-UHFFFAOYSA-N 0.000 description 4
 - RYAUSSKQMZRMAI-ALOPSCKCSA-N (2S,6R)-4-[3-(4-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine Chemical compound C=1C=C(C(C)(C)C)C=CC=1CC(C)CN1C[C@H](C)O[C@H](C)C1 RYAUSSKQMZRMAI-ALOPSCKCSA-N 0.000 description 4
 - 125000004741 (C1-C6) haloalkylsulfonyl group Chemical group 0.000 description 4
 - LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 4
 - UFNOUKDBUJZYDE-UHFFFAOYSA-N 2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol Chemical compound C1=NC=NN1CC(O)(C=1C=CC(Cl)=CC=1)C(C)C1CC1 UFNOUKDBUJZYDE-UHFFFAOYSA-N 0.000 description 4
 - WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 4
 - OQMZNAMGEHIHNN-UHFFFAOYSA-N 7-Dehydrostigmasterol Natural products C1C(O)CCC2(C)C(CCC3(C(C(C)C=CC(CC)C(C)C)CCC33)C)C3=CC=C21 OQMZNAMGEHIHNN-UHFFFAOYSA-N 0.000 description 4
 - VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 4
 - 239000005730 Azoxystrobin Substances 0.000 description 4
 - WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
 - 125000004649 C2-C8 alkynyl group Chemical group 0.000 description 4
 - 239000005757 Cyproconazole Substances 0.000 description 4
 - QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
 - 239000005767 Epoxiconazole Substances 0.000 description 4
 - DNVPQKQSNYMLRS-NXVQYWJNSA-N Ergosterol Natural products CC(C)[C@@H](C)C=C[C@H](C)[C@H]1CC[C@H]2C3=CC=C4C[C@@H](O)CC[C@]4(C)[C@@H]3CC[C@]12C DNVPQKQSNYMLRS-NXVQYWJNSA-N 0.000 description 4
 - IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
 - 239000005778 Fenpropimorph Substances 0.000 description 4
 - 101000615488 Homo sapiens Methyl-CpG-binding domain protein 2 Proteins 0.000 description 4
 - OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
 - 102100021299 Methyl-CpG-binding domain protein 2 Human genes 0.000 description 4
 - UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
 - 102000004316 Oxidoreductases Human genes 0.000 description 4
 - 108090000854 Oxidoreductases Proteins 0.000 description 4
 - KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
 - ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
 - NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
 - 241000233622 Phytophthora infestans Species 0.000 description 4
 - GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
 - OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
 - SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
 - 102000005782 Squalene Monooxygenase Human genes 0.000 description 4
 - 108020003891 Squalene monooxygenase Proteins 0.000 description 4
 - QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
 - 241000700605 Viruses Species 0.000 description 4
 - 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 4
 - 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 description 4
 - 125000002947 alkylene group Chemical group 0.000 description 4
 - 229910021529 ammonia Inorganic materials 0.000 description 4
 - 229940088710 antibiotic agent Drugs 0.000 description 4
 - 239000012298 atmosphere Substances 0.000 description 4
 - WFDXOXNFNRHQEC-GHRIWEEISA-N azoxystrobin Chemical compound CO\C=C(\C(=O)OC)C1=CC=CC=C1OC1=CC(OC=2C(=CC=CC=2)C#N)=NC=N1 WFDXOXNFNRHQEC-GHRIWEEISA-N 0.000 description 4
 - 230000003115 biocidal effect Effects 0.000 description 4
 - 150000004649 carbonic acid derivatives Chemical class 0.000 description 4
 - 230000032823 cell division Effects 0.000 description 4
 - 238000006352 cycloaddition reaction Methods 0.000 description 4
 - 125000006254 cycloalkyl carbonyl group Chemical group 0.000 description 4
 - 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 4
 - 230000034994 death Effects 0.000 description 4
 - FBOUIAKEJMZPQG-BLXFFLACSA-N diniconazole-M Chemical compound C1=NC=NN1/C([C@H](O)C(C)(C)C)=C/C1=CC=C(Cl)C=C1Cl FBOUIAKEJMZPQG-BLXFFLACSA-N 0.000 description 4
 - 230000000694 effects Effects 0.000 description 4
 - DNVPQKQSNYMLRS-SOWFXMKYSA-N ergosterol Chemical compound C1[C@@H](O)CC[C@]2(C)[C@H](CC[C@]3([C@H]([C@H](C)/C=C/[C@@H](C)C(C)C)CC[C@H]33)C)C3=CC=C21 DNVPQKQSNYMLRS-SOWFXMKYSA-N 0.000 description 4
 - 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
 - 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 4
 - 238000001704 evaporation Methods 0.000 description 4
 - 230000008020 evaporation Effects 0.000 description 4
 - 239000000284 extract Substances 0.000 description 4
 - 150000004665 fatty acids Chemical class 0.000 description 4
 - FQKUGOMFVDPBIZ-UHFFFAOYSA-N flusilazole Chemical compound C=1C=C(F)C=CC=1[Si](C=1C=CC(F)=CC=1)(C)CN1C=NC=N1 FQKUGOMFVDPBIZ-UHFFFAOYSA-N 0.000 description 4
 - 239000006260 foam Substances 0.000 description 4
 - 125000005640 glucopyranosyl group Chemical group 0.000 description 4
 - 150000002314 glycerols Chemical class 0.000 description 4
 - 239000008187 granular material Substances 0.000 description 4
 - 125000004994 halo alkoxy alkyl group Chemical group 0.000 description 4
 - 150000004679 hydroxides Chemical class 0.000 description 4
 - 208000015181 infectious disease Diseases 0.000 description 4
 - CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 4
 - 239000010410 layer Substances 0.000 description 4
 - 238000004519 manufacturing process Methods 0.000 description 4
 - 238000002156 mixing Methods 0.000 description 4
 - 125000002757 morpholinyl group Chemical group 0.000 description 4
 - 239000002736 nonionic surfactant Substances 0.000 description 4
 - 239000003960 organic solvent Substances 0.000 description 4
 - 230000010627 oxidative phosphorylation Effects 0.000 description 4
 - 239000000575 pesticide Substances 0.000 description 4
 - 150000003014 phosphoric acid esters Chemical class 0.000 description 4
 - CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 4
 - 239000000843 powder Substances 0.000 description 4
 - VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 4
 - 150000003230 pyrimidines Chemical class 0.000 description 4
 - 125000000719 pyrrolidinyl group Chemical group 0.000 description 4
 - 238000006722 reduction reaction Methods 0.000 description 4
 - 125000006413 ring segment Chemical group 0.000 description 4
 - 235000017557 sodium bicarbonate Nutrition 0.000 description 4
 - 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
 - 239000007921 spray Substances 0.000 description 4
 - 238000005507 spraying Methods 0.000 description 4
 - 150000003871 sulfonates Chemical class 0.000 description 4
 - 150000003467 sulfuric acid derivatives Chemical class 0.000 description 4
 - 238000005987 sulfurization reaction Methods 0.000 description 4
 - 230000014616 translation Effects 0.000 description 4
 - 150000003852 triazoles Chemical class 0.000 description 4
 - JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Polymers OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 3
 - 125000004455 (C1-C3) alkylthio group Chemical group 0.000 description 3
 - 125000004890 (C1-C6) alkylamino group Chemical group 0.000 description 3
 - 125000006767 (C2-C6) haloalkynyloxy group Chemical group 0.000 description 3
 - QWEWLLNSJDTOKH-UHFFFAOYSA-N 1,3-thiazole-2-carboxamide Chemical compound NC(=O)C1=NC=CS1 QWEWLLNSJDTOKH-UHFFFAOYSA-N 0.000 description 3
 - WKBPZYKAUNRMKP-UHFFFAOYSA-N 1-[2-(2,4-dichlorophenyl)pentyl]1,2,4-triazole Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(CCC)CN1C=NC=N1 WKBPZYKAUNRMKP-UHFFFAOYSA-N 0.000 description 3
 - MGNFYQILYYYUBS-UHFFFAOYSA-N 1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine Chemical compound C=1C=C(C(C)(C)C)C=CC=1CC(C)CN1CCCCC1 MGNFYQILYYYUBS-UHFFFAOYSA-N 0.000 description 3
 - QSAVFYHNMVEIET-UHFFFAOYSA-N 1-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]ethanone Chemical compound C1C(C(=O)C)=NOC1C1=C(F)C=CC=C1F QSAVFYHNMVEIET-UHFFFAOYSA-N 0.000 description 3
 - PFFIDZXUXFLSSR-UHFFFAOYSA-N 1-methyl-N-[2-(4-methylpentan-2-yl)-3-thienyl]-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound S1C=CC(NC(=O)C=2C(=NN(C)C=2)C(F)(F)F)=C1C(C)CC(C)C PFFIDZXUXFLSSR-UHFFFAOYSA-N 0.000 description 3
 - RQDJADAKIFFEKQ-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(Cl)=CC=C1CCC(C=1C=CC=CC=1)(C#N)CN1N=CN=C1 RQDJADAKIFFEKQ-UHFFFAOYSA-N 0.000 description 3
 - WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
 - YCIPQJTZJGUXND-UHFFFAOYSA-N Aglaia odorata Alkaloid Natural products C1=CC(OC)=CC=C1C1(C(C=2C(=O)N3CCCC3=NC=22)C=3C=CC=CC=3)C2(O)C2=C(OC)C=C(OC)C=C2O1 YCIPQJTZJGUXND-UHFFFAOYSA-N 0.000 description 3
 - 108700003918 Bacillus Thuringiensis insecticidal crystal Proteins 0.000 description 3
 - UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
 - 239000005740 Boscalid Substances 0.000 description 3
 - 241000123650 Botrytis cinerea Species 0.000 description 3
 - 125000004399 C1-C4 alkenyl group Chemical group 0.000 description 3
 - KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
 - TWFZGCMQGLPBSX-UHFFFAOYSA-N Carbendazim Natural products C1=CC=C2NC(NC(=O)OC)=NC2=C1 TWFZGCMQGLPBSX-UHFFFAOYSA-N 0.000 description 3
 - KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
 - 239000005747 Chlorothalonil Substances 0.000 description 3
 - RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
 - 102000053602 DNA Human genes 0.000 description 3
 - 108020004414 DNA Proteins 0.000 description 3
 - RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 3
 - 102000015782 Electron Transport Complex III Human genes 0.000 description 3
 - 108010024882 Electron Transport Complex III Proteins 0.000 description 3
 - 241001522296 Erithacus rubecula Species 0.000 description 3
 - 241000221785 Erysiphales Species 0.000 description 3
 - 239000005775 Fenbuconazole Substances 0.000 description 3
 - 239000005777 Fenpropidin Substances 0.000 description 3
 - SQUHHTBVTRBESD-UHFFFAOYSA-N Hexa-Ac-myo-Inositol Natural products CC(=O)OC1C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O SQUHHTBVTRBESD-UHFFFAOYSA-N 0.000 description 3
 - UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
 - 239000005796 Ipconazole Substances 0.000 description 3
 - KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
 - 241000233654 Oomycetes Species 0.000 description 3
 - 239000005813 Penconazole Substances 0.000 description 3
 - 239000005816 Penthiopyrad Substances 0.000 description 3
 - 241000233679 Peronosporaceae Species 0.000 description 3
 - 229930182764 Polyoxin Natural products 0.000 description 3
 - 239000005820 Prochloraz Substances 0.000 description 3
 - DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
 - QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
 - 238000006069 Suzuki reaction reaction Methods 0.000 description 3
 - GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 3
 - 102100029677 Trehalase Human genes 0.000 description 3
 - 108010087472 Trehalase Proteins 0.000 description 3
 - 102000004243 Tubulin Human genes 0.000 description 3
 - 108090000704 Tubulin Proteins 0.000 description 3
 - 208000013521 Visual disease Diseases 0.000 description 3
 - 235000009754 Vitis X bourquina Nutrition 0.000 description 3
 - 235000012333 Vitis X labruscana Nutrition 0.000 description 3
 - 240000006365 Vitis vinifera Species 0.000 description 3
 - 235000014787 Vitis vinifera Nutrition 0.000 description 3
 - 241000607479 Yersinia pestis Species 0.000 description 3
 - 230000002159 abnormal effect Effects 0.000 description 3
 - 239000000654 additive Substances 0.000 description 3
 - 150000001298 alcohols Chemical class 0.000 description 3
 - 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
 - 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 3
 - 125000004644 alkyl sulfinyl group Chemical group 0.000 description 3
 - 125000000304 alkynyl group Chemical group 0.000 description 3
 - 150000008064 anhydrides Chemical class 0.000 description 3
 - 239000003945 anionic surfactant Substances 0.000 description 3
 - 230000009286 beneficial effect Effects 0.000 description 3
 - 208000036815 beta tubulin Diseases 0.000 description 3
 - 230000004071 biological effect Effects 0.000 description 3
 - 230000001851 biosynthetic effect Effects 0.000 description 3
 - 229940118790 boscalid Drugs 0.000 description 3
 - WYEMLYFITZORAB-UHFFFAOYSA-N boscalid Chemical group C1=CC(Cl)=CC=C1C1=CC=CC=C1NC(=O)C1=CC=CN=C1Cl WYEMLYFITZORAB-UHFFFAOYSA-N 0.000 description 3
 - 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
 - JNPZQRQPIHJYNM-UHFFFAOYSA-N carbendazim Chemical compound C1=C[CH]C2=NC(NC(=O)OC)=NC2=C1 JNPZQRQPIHJYNM-UHFFFAOYSA-N 0.000 description 3
 - 239000006013 carbendazim Substances 0.000 description 3
 - ULDHMXUKGWMISQ-UHFFFAOYSA-N carvone Chemical compound CC(=C)C1CC=C(C)C(=O)C1 ULDHMXUKGWMISQ-UHFFFAOYSA-N 0.000 description 3
 - 239000003093 cationic surfactant Substances 0.000 description 3
 - KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 3
 - APEJMQOBVMLION-UHFFFAOYSA-N cinnamamide Chemical compound NC(=O)C=CC1=CC=CC=C1 APEJMQOBVMLION-UHFFFAOYSA-N 0.000 description 3
 - KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
 - 238000013329 compounding Methods 0.000 description 3
 - 238000010276 construction Methods 0.000 description 3
 - 239000010949 copper Substances 0.000 description 3
 - 229910052802 copper Inorganic materials 0.000 description 3
 - 239000013078 crystal Substances 0.000 description 3
 - 238000002425 crystallisation Methods 0.000 description 3
 - 230000008025 crystallization Effects 0.000 description 3
 - 125000006448 cycloalkyl cycloalkyl group Chemical group 0.000 description 3
 - 230000007123 defense Effects 0.000 description 3
 - RAFNCPHFRHZCPS-UHFFFAOYSA-N di(imidazol-1-yl)methanethione Chemical compound C1=CN=CN1C(=S)N1C=CN=C1 RAFNCPHFRHZCPS-UHFFFAOYSA-N 0.000 description 3
 - BQYJATMQXGBDHF-UHFFFAOYSA-N difenoconazole Chemical compound O1C(C)COC1(C=1C(=CC(OC=2C=CC(Cl)=CC=2)=CC=1)Cl)CN1N=CN=C1 BQYJATMQXGBDHF-UHFFFAOYSA-N 0.000 description 3
 - 229940079593 drug Drugs 0.000 description 3
 - 239000003814 drug Substances 0.000 description 3
 - 239000003995 emulsifying agent Substances 0.000 description 3
 - 230000000967 entomopathogenic effect Effects 0.000 description 3
 - 230000007613 environmental effect Effects 0.000 description 3
 - NYPJDWWKZLNGGM-UHFFFAOYSA-N fenvalerate Aalpha Natural products C=1C=C(Cl)C=CC=1C(C(C)C)C(=O)OC(C#N)C(C=1)=CC=CC=1OC1=CC=CC=C1 NYPJDWWKZLNGGM-UHFFFAOYSA-N 0.000 description 3
 - 239000001963 growth medium Substances 0.000 description 3
 - 150000004820 halides Chemical class 0.000 description 3
 - 125000005291 haloalkenyloxy group Chemical group 0.000 description 3
 - 125000004992 haloalkylamino group Chemical group 0.000 description 3
 - 125000005203 haloalkylcarbonyloxy group Chemical group 0.000 description 3
 - 125000004441 haloalkylsulfonyl group Chemical group 0.000 description 3
 - 125000005292 haloalkynyloxy group Chemical group 0.000 description 3
 - 125000004461 halocycloalkylalkyl group Chemical group 0.000 description 3
 - 125000005843 halogen group Chemical group 0.000 description 3
 - 239000004009 herbicide Substances 0.000 description 3
 - 229910000037 hydrogen sulfide Inorganic materials 0.000 description 3
 - 150000002460 imidazoles Chemical class 0.000 description 3
 - 230000001939 inductive effect Effects 0.000 description 3
 - 239000004615 ingredient Substances 0.000 description 3
 - 229960000367 inositol Drugs 0.000 description 3
 - CDAISMWEOUEBRE-GPIVLXJGSA-N inositol Chemical compound O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@@H]1O CDAISMWEOUEBRE-GPIVLXJGSA-N 0.000 description 3
 - 239000002917 insecticide Substances 0.000 description 3
 - 230000010189 intracellular transport Effects 0.000 description 3
 - QTYCMDBMOLSEAM-UHFFFAOYSA-N ipconazole Chemical compound C1=NC=NN1CC1(O)C(C(C)C)CCC1CC1=CC=C(Cl)C=C1 QTYCMDBMOLSEAM-UHFFFAOYSA-N 0.000 description 3
 - CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 3
 - 230000000670 limiting effect Effects 0.000 description 3
 - 230000003859 lipid peroxidation Effects 0.000 description 3
 - 239000002609 medium Substances 0.000 description 3
 - 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 3
 - 235000006408 oxalic acid Nutrition 0.000 description 3
 - 150000002923 oximes Chemical class 0.000 description 3
 - 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
 - 239000002245 particle Substances 0.000 description 3
 - 230000008506 pathogenesis Effects 0.000 description 3
 - 239000008188 pellet Substances 0.000 description 3
 - ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
 - YEBIHIICWDDQOL-YBHNRIQQSA-N polyoxin Polymers O[C@@H]1[C@H](O)[C@@H](C(C=O)N)O[C@H]1N1C(=O)NC(=O)C(C(O)=O)=C1 YEBIHIICWDDQOL-YBHNRIQQSA-N 0.000 description 3
 - 238000012545 processing Methods 0.000 description 3
 - TVLSRXXIMLFWEO-UHFFFAOYSA-N prochloraz Chemical compound C1=CN=CN1C(=O)N(CCC)CCOC1=C(Cl)C=C(Cl)C=C1Cl TVLSRXXIMLFWEO-UHFFFAOYSA-N 0.000 description 3
 - NPCOQXAVBJJZBQ-UHFFFAOYSA-N reduced coenzyme Q9 Natural products COC1=C(O)C(C)=C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(O)=C1OC NPCOQXAVBJJZBQ-UHFFFAOYSA-N 0.000 description 3
 - 230000009467 reduction Effects 0.000 description 3
 - 230000027756 respiratory electron transport chain Effects 0.000 description 3
 - 238000007363 ring formation reaction Methods 0.000 description 3
 - CDAISMWEOUEBRE-UHFFFAOYSA-N scyllo-inosotol Natural products OC1C(O)C(O)C(O)C(O)C1O CDAISMWEOUEBRE-UHFFFAOYSA-N 0.000 description 3
 - 239000002689 soil Substances 0.000 description 3
 - 239000011877 solvent mixture Substances 0.000 description 3
 - 238000010561 standard procedure Methods 0.000 description 3
 - 230000002195 synergetic effect Effects 0.000 description 3
 - 150000003512 tertiary amines Chemical class 0.000 description 3
 - JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
 - VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
 - 230000009466 transformation Effects 0.000 description 3
 - 229940040064 ubiquinol Drugs 0.000 description 3
 - QNTNKSLOFHEFPK-UPTCCGCDSA-N ubiquinol-10 Chemical compound COC1=C(O)C(C)=C(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)C(O)=C1OC QNTNKSLOFHEFPK-UPTCCGCDSA-N 0.000 description 3
 - 235000013311 vegetables Nutrition 0.000 description 3
 - 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
 - YNWVFADWVLCOPU-MDWZMJQESA-N (1E)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol Chemical compound C1=NC=NN1/C(C(O)C(C)(C)C)=C/C1=CC=C(Cl)C=C1 YNWVFADWVLCOPU-MDWZMJQESA-N 0.000 description 2
 - NHOWDZOIZKMVAI-UHFFFAOYSA-N (2-chlorophenyl)(4-chlorophenyl)pyrimidin-5-ylmethanol Chemical compound C=1N=CN=CC=1C(C=1C(=CC=CC=1)Cl)(O)C1=CC=C(Cl)C=C1 NHOWDZOIZKMVAI-UHFFFAOYSA-N 0.000 description 2
 - SAPGTCDSBGMXCD-UHFFFAOYSA-N (2-chlorophenyl)-(4-fluorophenyl)-pyrimidin-5-ylmethanol Chemical compound C=1N=CN=CC=1C(C=1C(=CC=CC=1)Cl)(O)C1=CC=C(F)C=C1 SAPGTCDSBGMXCD-UHFFFAOYSA-N 0.000 description 2
 - RPAJSBKBKSSMLJ-DFWYDOINSA-N (2s)-2-aminopentanedioic acid;hydrochloride Chemical class Cl.OC(=O)[C@@H](N)CCC(O)=O RPAJSBKBKSSMLJ-DFWYDOINSA-N 0.000 description 2
 - LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 2
 - 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 description 2
 - 125000006798 (C1-C6) haloalkylamino group Chemical group 0.000 description 2
 - 125000006729 (C2-C5) alkenyl group Chemical group 0.000 description 2
 - HWUGBMMPIAIJJC-UHFFFAOYSA-N 1,2,3,5,6,6a-hexahydropyrrolo[3,4-c]pyrrole Chemical compound N1CC2CNCC2=C1 HWUGBMMPIAIJJC-UHFFFAOYSA-N 0.000 description 2
 - FNQJDLTXOVEEFB-UHFFFAOYSA-N 1,2,3-benzothiadiazole Chemical compound C1=CC=C2SN=NC2=C1 FNQJDLTXOVEEFB-UHFFFAOYSA-N 0.000 description 2
 - OWQPOVKKUWUEKE-UHFFFAOYSA-N 1,2,3-benzotriazine Chemical compound N1=NN=CC2=CC=CC=C21 OWQPOVKKUWUEKE-UHFFFAOYSA-N 0.000 description 2
 - JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
 - ARXKVVRQIIOZGF-UHFFFAOYSA-N 1,2,4-butanetriol Chemical compound OCCC(O)CO ARXKVVRQIIOZGF-UHFFFAOYSA-N 0.000 description 2
 - YGTAZGSLCXNBQL-UHFFFAOYSA-N 1,2,4-thiadiazole Chemical compound C=1N=CSN=1 YGTAZGSLCXNBQL-UHFFFAOYSA-N 0.000 description 2
 - CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical compound C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 description 2
 - JLHMJWHSBYZWJJ-UHFFFAOYSA-N 1,2-thiazole 1-oxide Chemical compound O=S1C=CC=N1 JLHMJWHSBYZWJJ-UHFFFAOYSA-N 0.000 description 2
 - IMLSAISZLJGWPP-UHFFFAOYSA-N 1,3-dithiolane Chemical compound C1CSCS1 IMLSAISZLJGWPP-UHFFFAOYSA-N 0.000 description 2
 - LQDARGUHUSPFNL-UHFFFAOYSA-N 1-[2-(2,4-dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)propyl]1,2,4-triazole Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(COC(F)(F)C(F)F)CN1C=NC=N1 LQDARGUHUSPFNL-UHFFFAOYSA-N 0.000 description 2
 - 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
 - WNWHHMBRJJOGFJ-UHFFFAOYSA-N 16-methylheptadecan-1-ol Chemical compound CC(C)CCCCCCCCCCCCCCCO WNWHHMBRJJOGFJ-UHFFFAOYSA-N 0.000 description 2
 - HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 2
 - QMQZIXCNLUPEIN-UHFFFAOYSA-N 1h-imidazole-2-carbonitrile Chemical compound N#CC1=NC=CN1 QMQZIXCNLUPEIN-UHFFFAOYSA-N 0.000 description 2
 - BNYCHCAYYYRJSH-UHFFFAOYSA-N 1h-pyrazole-5-carboxamide Chemical compound NC(=O)C1=CC=NN1 BNYCHCAYYYRJSH-UHFFFAOYSA-N 0.000 description 2
 - AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 2
 - YTOPFCCWCSOHFV-UHFFFAOYSA-N 2,6-dimethyl-4-tridecylmorpholine Chemical compound CCCCCCCCCCCCCN1CC(C)OC(C)C1 YTOPFCCWCSOHFV-UHFFFAOYSA-N 0.000 description 2
 - KWLVWJPJKJMCSH-UHFFFAOYSA-N 2-(4-chlorophenyl)-N-{2-[3-methoxy-4-(prop-2-yn-1-yloxy)phenyl]ethyl}-2-(prop-2-yn-1-yloxy)acetamide Chemical compound C1=C(OCC#C)C(OC)=CC(CCNC(=O)C(OCC#C)C=2C=CC(Cl)=CC=2)=C1 KWLVWJPJKJMCSH-UHFFFAOYSA-N 0.000 description 2
 - XREBYUVOZCUOES-UHFFFAOYSA-N 2-(dimethylamino)-n-hydroxy-2-oxoethanimidoyl chloride Chemical compound CN(C)C(=O)C(Cl)=NO XREBYUVOZCUOES-UHFFFAOYSA-N 0.000 description 2
 - IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical compound O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 description 2
 - PGONUFQCBRMACB-UHFFFAOYSA-N 2-bromo-1-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]ethanone Chemical compound FC1=CC=CC(F)=C1C1ON=C(C(=O)CBr)C1 PGONUFQCBRMACB-UHFFFAOYSA-N 0.000 description 2
 - SFHOANYKPCNYMB-UHFFFAOYSA-N 2-ethenyl-1,3-difluorobenzene Chemical compound FC1=CC=CC(F)=C1C=C SFHOANYKPCNYMB-UHFFFAOYSA-N 0.000 description 2
 - YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 description 2
 - IRTLROCMFSDSNF-UHFFFAOYSA-N 2-phenyl-1h-pyrrole Chemical compound C1=CNC(C=2C=CC=CC=2)=C1 IRTLROCMFSDSNF-UHFFFAOYSA-N 0.000 description 2
 - WAIIVJKIXMLKTR-UHFFFAOYSA-N 2h-triazole-4-sulfonamide Chemical compound NS(=O)(=O)C1=CNN=N1 WAIIVJKIXMLKTR-UHFFFAOYSA-N 0.000 description 2
 - MBMDRPGKRRJGSQ-UHFFFAOYSA-N 3,4-dihydrodioxazine Chemical compound C1NOOC=C1 MBMDRPGKRRJGSQ-UHFFFAOYSA-N 0.000 description 2
 - SOUGWDPPRBKJEX-UHFFFAOYSA-N 3,5-dichloro-N-(1-chloro-3-methyl-2-oxopentan-3-yl)-4-methylbenzamide Chemical group ClCC(=O)C(C)(CC)NC(=O)C1=CC(Cl)=C(C)C(Cl)=C1 SOUGWDPPRBKJEX-UHFFFAOYSA-N 0.000 description 2
 - CAAMSDWKXXPUJR-UHFFFAOYSA-N 3,5-dihydro-4H-imidazol-4-one Chemical compound O=C1CNC=N1 CAAMSDWKXXPUJR-UHFFFAOYSA-N 0.000 description 2
 - FSCWZHGZWWDELK-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl-2,4-oxazolidinedione Chemical compound O=C1C(C)(C=C)OC(=O)N1C1=CC(Cl)=CC(Cl)=C1 FSCWZHGZWWDELK-UHFFFAOYSA-N 0.000 description 2
 - YNSCKPCDFIDINW-UHFFFAOYSA-N 3-[[2-[[1-[2-(dimethylamino)acetyl]-6-methoxy-4,4-dimethyl-2,3-dihydroquinolin-7-yl]amino]-7h-pyrrolo[2,3-d]pyrimidin-4-yl]amino]thiophene-2-carboxamide Chemical compound COC1=CC(C(CCN2C(=O)CN(C)C)(C)C)=C2C=C1NC(N=C1NC=CC1=1)=NC=1NC=1C=CSC=1C(N)=O YNSCKPCDFIDINW-UHFFFAOYSA-N 0.000 description 2
 - NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
 - SBUKOHLFHYSZNG-UHFFFAOYSA-N 4-dodecyl-2,6-dimethylmorpholine Chemical compound CCCCCCCCCCCCN1CC(C)OC(C)C1 SBUKOHLFHYSZNG-UHFFFAOYSA-N 0.000 description 2
 - YSNAXTIONZCKDI-UHFFFAOYSA-N 4-hydroxypyridazine-1,2-dicarboxylic acid Chemical compound C1=CN(N(C=C1O)C(=O)O)C(=O)O YSNAXTIONZCKDI-UHFFFAOYSA-N 0.000 description 2
 - QGDHHMJMYURFLO-UHFFFAOYSA-N 5-(2,6-difluorophenyl)-n,n-dimethyl-4,5-dihydro-1,2-oxazole-3-carboxamide Chemical compound C1C(C(=O)N(C)C)=NOC1C1=C(F)C=CC=C1F QGDHHMJMYURFLO-UHFFFAOYSA-N 0.000 description 2
 - GOFJDXZZHFNFLV-UHFFFAOYSA-N 5-fluoro-1,3-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrazole-4-carboxamide Chemical compound CC(C)CC(C)C1=CC=CC=C1NC(=O)C1=C(F)N(C)N=C1C GOFJDXZZHFNFLV-UHFFFAOYSA-N 0.000 description 2
 - 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
 - 125000003341 7 membered heterocyclic group Chemical group 0.000 description 2
 - UHYISDCXHNDRHZ-UHFFFAOYSA-N 7h-[1,3]thiazolo[5,4-e]benzotriazole Chemical compound C1=CC2=NCSC2=C2N=NN=C21 UHYISDCXHNDRHZ-UHFFFAOYSA-N 0.000 description 2
 - 230000002407 ATP formation Effects 0.000 description 2
 - ZKHQWZAMYRWXGA-KQYNXXCUSA-J ATP(4-) Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O)[C@@H](O)[C@H]1O ZKHQWZAMYRWXGA-KQYNXXCUSA-J 0.000 description 2
 - 239000005660 Abamectin Substances 0.000 description 2
 - 239000005964 Acibenzolar-S-methyl Substances 0.000 description 2
 - ZKHQWZAMYRWXGA-UHFFFAOYSA-N Adenosine triphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(=O)OP(O)(O)=O)C(O)C1O ZKHQWZAMYRWXGA-UHFFFAOYSA-N 0.000 description 2
 - 241000223600 Alternaria Species 0.000 description 2
 - 241000213004 Alternaria solani Species 0.000 description 2
 - 241000193388 Bacillus thuringiensis Species 0.000 description 2
 - 241000221198 Basidiomycota Species 0.000 description 2
 - 239000005734 Benalaxyl Substances 0.000 description 2
 - KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 2
 - 241001480061 Blumeria graminis Species 0.000 description 2
 - 241001465180 Botrytis Species 0.000 description 2
 - FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
 - VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
 - 239000005745 Captan Substances 0.000 description 2
 - BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
 - 239000005746 Carboxin Substances 0.000 description 2
 - 241000222199 Colletotrichum Species 0.000 description 2
 - 239000005749 Copper compound Substances 0.000 description 2
 - JJLJMEJHUUYSSY-UHFFFAOYSA-L Copper hydroxide Chemical compound [OH-].[OH-].[Cu+2] JJLJMEJHUUYSSY-UHFFFAOYSA-L 0.000 description 2
 - 239000005750 Copper hydroxide Substances 0.000 description 2
 - 239000005752 Copper oxychloride Substances 0.000 description 2
 - 241000371644 Curvularia ravenelii Species 0.000 description 2
 - XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical group N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 2
 - 239000005758 Cyprodinil Substances 0.000 description 2
 - 108010052832 Cytochromes Proteins 0.000 description 2
 - 102000018832 Cytochromes Human genes 0.000 description 2
 - FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
 - 101710088194 Dehydrogenase Proteins 0.000 description 2
 - XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
 - 239000005765 Dodemorph Substances 0.000 description 2
 - 239000005769 Etridiazole Substances 0.000 description 2
 - 239000005780 Fluazinam Substances 0.000 description 2
 - 239000005784 Fluoxastrobin Substances 0.000 description 2
 - 239000005785 Fluquinconazole Substances 0.000 description 2
 - ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
 - VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
 - 241000223221 Fusarium oxysporum Species 0.000 description 2
 - PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
 - 241000555709 Guignardia Species 0.000 description 2
 - 244000020551 Helianthus annuus Species 0.000 description 2
 - 235000003222 Helianthus annuus Nutrition 0.000 description 2
 - MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
 - 239000005867 Iprodione Substances 0.000 description 2
 - WLLGXSLBOPFWQV-UHFFFAOYSA-N MGK 264 Chemical compound C1=CC2CC1C1C2C(=O)N(CC(CC)CCCC)C1=O WLLGXSLBOPFWQV-UHFFFAOYSA-N 0.000 description 2
 - 239000005802 Mancozeb Substances 0.000 description 2
 - 239000005807 Metalaxyl Substances 0.000 description 2
 - 241001465754 Metazoa Species 0.000 description 2
 - 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
 - LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
 - SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
 - CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
 - KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
 - 241000682645 Phakopsora pachyrhizi Species 0.000 description 2
 - 206010035148 Plague Diseases 0.000 description 2
 - 241001281803 Plasmopara viticola Species 0.000 description 2
 - 239000004372 Polyvinyl alcohol Substances 0.000 description 2
 - 239000005823 Propineb Substances 0.000 description 2
 - 241000589615 Pseudomonas syringae Species 0.000 description 2
 - 241000520648 Pyrenophora teres Species 0.000 description 2
 - CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
 - 241001361634 Rhizoctonia Species 0.000 description 2
 - VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
 - 229930182692 Strobilurin Natural products 0.000 description 2
 - 239000005840 Tetraconazole Substances 0.000 description 2
 - YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
 - GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
 - 239000005846 Triadimenol Substances 0.000 description 2
 - 239000005848 Tribasic copper sulfate Substances 0.000 description 2
 - 239000005858 Triflumizole Substances 0.000 description 2
 - DRTQHJPVMGBUCF-XVFCMESISA-N Uridine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-XVFCMESISA-N 0.000 description 2
 - 240000008042 Zea mays Species 0.000 description 2
 - 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
 - 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
 - XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
 - 239000005863 Zoxamide Substances 0.000 description 2
 - 230000000895 acaricidal effect Effects 0.000 description 2
 - 239000000642 acaricide Substances 0.000 description 2
 - 230000002378 acidificating effect Effects 0.000 description 2
 - 238000005054 agglomeration Methods 0.000 description 2
 - 230000002776 aggregation Effects 0.000 description 2
 - 229910052783 alkali metal Inorganic materials 0.000 description 2
 - 125000004450 alkenylene group Chemical group 0.000 description 2
 - 125000005195 alkyl amino carbonyloxy group Chemical group 0.000 description 2
 - 150000004996 alkyl benzenes Chemical class 0.000 description 2
 - 125000005130 alkyl carbonyl thio group Chemical group 0.000 description 2
 - 150000001350 alkyl halides Chemical class 0.000 description 2
 - 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
 - 229940100198 alkylating agent Drugs 0.000 description 2
 - 239000002168 alkylating agent Substances 0.000 description 2
 - HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
 - 150000003978 alpha-halocarboxylic acids Chemical class 0.000 description 2
 - 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
 - 238000010640 amide synthesis reaction Methods 0.000 description 2
 - 150000001409 amidines Chemical class 0.000 description 2
 - 125000006242 amine protecting group Chemical group 0.000 description 2
 - 239000002518 antifoaming agent Substances 0.000 description 2
 - 239000008346 aqueous phase Substances 0.000 description 2
 - QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
 - AKNQMEBLVAMSNZ-UHFFFAOYSA-N azaconazole Chemical compound ClC1=CC(Cl)=CC=C1C1(CN2N=CN=C2)OCCO1 AKNQMEBLVAMSNZ-UHFFFAOYSA-N 0.000 description 2
 - 229950000294 azaconazole Drugs 0.000 description 2
 - 150000003851 azoles Chemical class 0.000 description 2
 - 229940097012 bacillus thuringiensis Drugs 0.000 description 2
 - AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 2
 - 230000008901 benefit Effects 0.000 description 2
 - RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 2
 - 150000001556 benzimidazoles Chemical class 0.000 description 2
 - RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 2
 - 239000012965 benzophenone Substances 0.000 description 2
 - MITFXPHMIHQXPI-UHFFFAOYSA-N benzoxaprofen Natural products N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 description 2
 - PUJDIJCNWFYVJX-UHFFFAOYSA-N benzyl carbamate Chemical compound NC(=O)OCC1=CC=CC=C1 PUJDIJCNWFYVJX-UHFFFAOYSA-N 0.000 description 2
 - 239000004305 biphenyl Substances 0.000 description 2
 - 235000010290 biphenyl Nutrition 0.000 description 2
 - 125000005621 boronate group Chemical class 0.000 description 2
 - 125000005620 boronic acid group Chemical class 0.000 description 2
 - DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 2
 - 229930188620 butyrolactone Natural products 0.000 description 2
 - KBPLFHHGFOOTCA-UHFFFAOYSA-N caprylic alcohol Natural products CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
 - 229940117949 captan Drugs 0.000 description 2
 - 239000004202 carbamide Substances 0.000 description 2
 - NBYQXBYMEUOBON-UHFFFAOYSA-N carbamothioyl chloride Chemical compound NC(Cl)=S NBYQXBYMEUOBON-UHFFFAOYSA-N 0.000 description 2
 - 150000001722 carbon compounds Chemical class 0.000 description 2
 - PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
 - GYSSRZJIHXQEHQ-UHFFFAOYSA-N carboxin Chemical compound S1CCOC(C)=C1C(=O)NC1=CC=CC=C1 GYSSRZJIHXQEHQ-UHFFFAOYSA-N 0.000 description 2
 - 239000000969 carrier Substances 0.000 description 2
 - 239000003054 catalyst Substances 0.000 description 2
 - 210000000170 cell membrane Anatomy 0.000 description 2
 - 235000013339 cereals Nutrition 0.000 description 2
 - 150000001805 chlorine compounds Chemical class 0.000 description 2
 - HKMOPYJWSFRURD-UHFFFAOYSA-N chloro hypochlorite;copper Chemical compound [Cu].ClOCl HKMOPYJWSFRURD-UHFFFAOYSA-N 0.000 description 2
 - MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
 - 238000004587 chromatography analysis Methods 0.000 description 2
 - 229960004022 clotrimazole Drugs 0.000 description 2
 - VNFPBHJOKIVQEB-UHFFFAOYSA-N clotrimazole Chemical compound ClC1=CC=CC=C1C(N1C=NC=C1)(C=1C=CC=CC=1)C1=CC=CC=C1 VNFPBHJOKIVQEB-UHFFFAOYSA-N 0.000 description 2
 - 238000004440 column chromatography Methods 0.000 description 2
 - 238000006482 condensation reaction Methods 0.000 description 2
 - 238000001816 cooling Methods 0.000 description 2
 - 229910001956 copper hydroxide Inorganic materials 0.000 description 2
 - 229910000365 copper sulfate Inorganic materials 0.000 description 2
 - ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
 - 235000005822 corn Nutrition 0.000 description 2
 - 239000012043 crude product Substances 0.000 description 2
 - RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
 - 125000000392 cycloalkenyl group Chemical group 0.000 description 2
 - 125000005167 cycloalkylaminocarbonyl group Chemical group 0.000 description 2
 - 125000005144 cycloalkylsulfonyl group Chemical group 0.000 description 2
 - JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
 - AIMMVWOEOZMVMS-UHFFFAOYSA-N cyclopropanecarboxamide Chemical compound NC(=O)C1CC1 AIMMVWOEOZMVMS-UHFFFAOYSA-N 0.000 description 2
 - 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 2
 - HAORKNGNJCEJBX-UHFFFAOYSA-N cyprodinil Chemical compound N=1C(C)=CC(C2CC2)=NC=1NC1=CC=CC=C1 HAORKNGNJCEJBX-UHFFFAOYSA-N 0.000 description 2
 - MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
 - 230000017858 demethylation Effects 0.000 description 2
 - 238000010520 demethylation reaction Methods 0.000 description 2
 - 230000008021 deposition Effects 0.000 description 2
 - SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 2
 - NOACAPZPSKBVSY-UHFFFAOYSA-N diethyl 4-[4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]diazinane-1,2-dicarboxylate Chemical compound C1N(C(=O)OCC)N(C(=O)OCC)CCC1C1=NC(C=2CC(ON=2)C=2C(=CC=CC=2F)F)=CS1 NOACAPZPSKBVSY-UHFFFAOYSA-N 0.000 description 2
 - LTVOKYUPTHZZQH-UHFFFAOYSA-N difluoromethane Chemical group F[C]F LTVOKYUPTHZZQH-UHFFFAOYSA-N 0.000 description 2
 - 238000006471 dimerization reaction Methods 0.000 description 2
 - XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
 - 239000006185 dispersion Substances 0.000 description 2
 - JMXKCYUTURMERF-UHFFFAOYSA-N dodemorph Chemical compound C1C(C)OC(C)CN1C1CCCCCCCCCCC1 JMXKCYUTURMERF-UHFFFAOYSA-N 0.000 description 2
 - 238000001035 drying Methods 0.000 description 2
 - 239000000839 emulsion Substances 0.000 description 2
 - 238000005516 engineering process Methods 0.000 description 2
 - VMNULHCTRPXWFJ-UJSVPXBISA-N enoxastrobin Chemical compound CO\C=C(\C(=O)OC)C1=CC=CC=C1CO\N=C(/C)\C=C\C1=CC=C(Cl)C=C1 VMNULHCTRPXWFJ-UJSVPXBISA-N 0.000 description 2
 - HHANFBCPXVLWNI-UHFFFAOYSA-N ethyl 5-[4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]oxazinane-2-carboxylate Chemical compound C1ON(C(=O)OCC)CCC1C1=NC(C=2CC(ON=2)C=2C(=CC=CC=2F)F)=CS1 HHANFBCPXVLWNI-UHFFFAOYSA-N 0.000 description 2
 - KOJIZHCIEPOMNE-UHFFFAOYSA-N ethyl 5-carbamothioyloxazinane-2-carboxylate Chemical compound CCOC(=O)N1CCC(C(N)=S)CO1 KOJIZHCIEPOMNE-UHFFFAOYSA-N 0.000 description 2
 - 125000006125 ethylsulfonyl group Chemical group 0.000 description 2
 - KQTVWCSONPJJPE-UHFFFAOYSA-N etridiazole Chemical compound CCOC1=NC(C(Cl)(Cl)Cl)=NS1 KQTVWCSONPJJPE-UHFFFAOYSA-N 0.000 description 2
 - 238000002474 experimental method Methods 0.000 description 2
 - 239000000706 filtrate Substances 0.000 description 2
 - UZCGKGPEKUCDTF-UHFFFAOYSA-N fluazinam Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=C(Cl)C([N+]([O-])=O)=C1NC1=NC=C(C(F)(F)F)C=C1Cl UZCGKGPEKUCDTF-UHFFFAOYSA-N 0.000 description 2
 - UFEODZBUAFNAEU-NLRVBDNBSA-N fluoxastrobin Chemical compound C=1C=CC=C(OC=2C(=C(OC=3C(=CC=CC=3)Cl)N=CN=2)F)C=1C(=N/OC)\C1=NOCCO1 UFEODZBUAFNAEU-NLRVBDNBSA-N 0.000 description 2
 - IJJVMEJXYNJXOJ-UHFFFAOYSA-N fluquinconazole Chemical compound C=1C=C(Cl)C=C(Cl)C=1N1C(=O)C2=CC(F)=CC=C2N=C1N1C=NC=N1 IJJVMEJXYNJXOJ-UHFFFAOYSA-N 0.000 description 2
 - 238000005755 formation reaction Methods 0.000 description 2
 - 239000007789 gas Substances 0.000 description 2
 - 238000000227 grinding Methods 0.000 description 2
 - 125000004440 haloalkylsulfinyl group Chemical group 0.000 description 2
 - CATSNJVOTSVZJV-UHFFFAOYSA-N heptan-2-one Chemical compound CCCCCC(C)=O CATSNJVOTSVZJV-UHFFFAOYSA-N 0.000 description 2
 - BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
 - ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
 - AOGQPLXWSUTHQB-UHFFFAOYSA-N hexyl acetate Chemical compound CCCCCCOC(C)=O AOGQPLXWSUTHQB-UHFFFAOYSA-N 0.000 description 2
 - XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
 - 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
 - WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 2
 - AGKSTYPVMZODRV-UHFFFAOYSA-N imibenconazole Chemical compound C1=CC(Cl)=CC=C1CSC(CN1N=CN=C1)=NC1=CC=C(Cl)C=C1Cl AGKSTYPVMZODRV-UHFFFAOYSA-N 0.000 description 2
 - 150000002466 imines Chemical class 0.000 description 2
 - RONFGUROBZGJKP-UHFFFAOYSA-N iminoctadine Chemical compound NC(N)=NCCCCCCCCNCCCCCCCCN=C(N)N RONFGUROBZGJKP-UHFFFAOYSA-N 0.000 description 2
 - 150000007529 inorganic bases Chemical class 0.000 description 2
 - ONUFESLQCSAYKA-UHFFFAOYSA-N iprodione Chemical compound O=C1N(C(=O)NC(C)C)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 ONUFESLQCSAYKA-UHFFFAOYSA-N 0.000 description 2
 - MLFHJEHSLIIPHL-UHFFFAOYSA-N isoamyl acetate Chemical compound CC(C)CCOC(C)=O MLFHJEHSLIIPHL-UHFFFAOYSA-N 0.000 description 2
 - ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
 - HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
 - 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
 - JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
 - 229920005610 lignin Chemical class 0.000 description 2
 - XMGQYMWWDOXHJM-UHFFFAOYSA-N limonene Chemical compound CC(=C)C1CCC(C)=CC1 XMGQYMWWDOXHJM-UHFFFAOYSA-N 0.000 description 2
 - VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
 - 239000011976 maleic acid Substances 0.000 description 2
 - 230000008018 melting Effects 0.000 description 2
 - 238000002844 melting Methods 0.000 description 2
 - BCTQJXQXJVLSIG-UHFFFAOYSA-N mepronil Chemical compound CC(C)OC1=CC=CC(NC(=O)C=2C(=CC=CC=2)C)=C1 BCTQJXQXJVLSIG-UHFFFAOYSA-N 0.000 description 2
 - BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 2
 - ZQEIXNIJLIKNTD-GFCCVEGCSA-N metalaxyl-M Chemical compound COCC(=O)N([C@H](C)C(=O)OC)C1=C(C)C=CC=C1C ZQEIXNIJLIKNTD-GFCCVEGCSA-N 0.000 description 2
 - AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 2
 - QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
 - BYFVQGSSOPBYMR-UHFFFAOYSA-N methoxycarbamic acid Chemical compound CONC(O)=O BYFVQGSSOPBYMR-UHFFFAOYSA-N 0.000 description 2
 - 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
 - ZQEIXNIJLIKNTD-UHFFFAOYSA-N methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate Chemical compound COCC(=O)N(C(C)C(=O)OC)C1=C(C)C=CC=C1C ZQEIXNIJLIKNTD-UHFFFAOYSA-N 0.000 description 2
 - CJPQIRJHIZUAQP-UHFFFAOYSA-N methyl N-(2,6-dimethylphenyl)-N-(phenylacetyl)alaninate Chemical compound CC=1C=CC=C(C)C=1N(C(C)C(=O)OC)C(=O)CC1=CC=CC=C1 CJPQIRJHIZUAQP-UHFFFAOYSA-N 0.000 description 2
 - BSDQITJYKQHXQR-UHFFFAOYSA-N methyl prop-2-eneperoxoate Chemical compound COOC(=O)C=C BSDQITJYKQHXQR-UHFFFAOYSA-N 0.000 description 2
 - 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 2
 - 239000004530 micro-emulsion Substances 0.000 description 2
 - 210000003470 mitochondria Anatomy 0.000 description 2
 - 210000001700 mitochondrial membrane Anatomy 0.000 description 2
 - 230000006540 mitochondrial respiration Effects 0.000 description 2
 - 230000008811 mitochondrial respiratory chain Effects 0.000 description 2
 - 230000011278 mitosis Effects 0.000 description 2
 - 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
 - 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
 - AEXITZJSLGALNH-UHFFFAOYSA-N n'-hydroxyethanimidamide Chemical compound CC(N)=NO AEXITZJSLGALNH-UHFFFAOYSA-N 0.000 description 2
 - IWWKIOTVAJOMJT-UHFFFAOYSA-N n-(2,2,2-trichloro-1-morpholin-4-ylethyl)formamide Chemical compound O=CNC(C(Cl)(Cl)Cl)N1CCOCC1 IWWKIOTVAJOMJT-UHFFFAOYSA-N 0.000 description 2
 - XGXNTJHZPBRBHJ-UHFFFAOYSA-N n-phenylpyrimidin-2-amine Chemical compound N=1C=CC=NC=1NC1=CC=CC=C1 XGXNTJHZPBRBHJ-UHFFFAOYSA-N 0.000 description 2
 - 239000005645 nematicide Substances 0.000 description 2
 - 229930027945 nicotinamide-adenine dinucleotide Natural products 0.000 description 2
 - BOPGDPNILDQYTO-NNYOXOHSSA-N nicotinamide-adenine dinucleotide Chemical compound C1=CCC(C(=O)N)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2[C@H]([C@@H](O)[C@@H](O2)N2C3=NC=NC(N)=C3N=C2)O)O1 BOPGDPNILDQYTO-NNYOXOHSSA-N 0.000 description 2
 - GJQIMXVRFNLMTB-UHFFFAOYSA-N nonyl acetate Chemical compound CCCCCCCCCOC(C)=O GJQIMXVRFNLMTB-UHFFFAOYSA-N 0.000 description 2
 - 238000007344 nucleophilic reaction Methods 0.000 description 2
 - 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
 - YLYBTZIQSIBWLI-UHFFFAOYSA-N octyl acetate Chemical compound CCCCCCCCOC(C)=O YLYBTZIQSIBWLI-UHFFFAOYSA-N 0.000 description 2
 - UWVQIROCRJWDKL-UHFFFAOYSA-N oxadixyl Chemical compound CC=1C=CC=C(C)C=1N(C(=O)COC)N1CCOC1=O UWVQIROCRJWDKL-UHFFFAOYSA-N 0.000 description 2
 - OZQGLZFAWYKKLQ-UHFFFAOYSA-N oxazinane Chemical group C1CCONC1 OZQGLZFAWYKKLQ-UHFFFAOYSA-N 0.000 description 2
 - 239000001301 oxygen Substances 0.000 description 2
 - 229910052763 palladium Inorganic materials 0.000 description 2
 - 238000010651 palladium-catalyzed cross coupling reaction Methods 0.000 description 2
 - NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical group [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
 - 239000012188 paraffin wax Substances 0.000 description 2
 - 230000001717 pathogenic effect Effects 0.000 description 2
 - UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 2
 - XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
 - XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
 - 230000000704 physical effect Effects 0.000 description 2
 - IBBMAWULFFBRKK-UHFFFAOYSA-N picolinamide Chemical compound NC(=O)C1=CC=CC=N1 IBBMAWULFFBRKK-UHFFFAOYSA-N 0.000 description 2
 - 150000004885 piperazines Chemical class 0.000 description 2
 - 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
 - 229920002689 polyvinyl acetate Polymers 0.000 description 2
 - 239000011118 polyvinyl acetate Substances 0.000 description 2
 - 229920002451 polyvinyl alcohol Polymers 0.000 description 2
 - 239000002243 precursor Substances 0.000 description 2
 - QXJKBPAVAHBARF-BETUJISGSA-N procymidone Chemical compound O=C([C@]1(C)C[C@@]1(C1=O)C)N1C1=CC(Cl)=CC(Cl)=C1 QXJKBPAVAHBARF-BETUJISGSA-N 0.000 description 2
 - BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
 - KKMLIVYBGSAJPM-UHFFFAOYSA-L propineb Chemical compound [Zn+2].[S-]C(=S)NC(C)CNC([S-])=S KKMLIVYBGSAJPM-UHFFFAOYSA-L 0.000 description 2
 - QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
 - 229940080818 propionamide Drugs 0.000 description 2
 - 102000004169 proteins and genes Human genes 0.000 description 2
 - 108090000623 proteins and genes Proteins 0.000 description 2
 - 150000003222 pyridines Chemical class 0.000 description 2
 - 125000004076 pyridyl group Chemical group 0.000 description 2
 - FUXJMHXHGDAHPD-UHFFFAOYSA-N pyrimidine-2-carboxamide Chemical compound NC(=O)C1=NC=CC=N1 FUXJMHXHGDAHPD-UHFFFAOYSA-N 0.000 description 2
 - QJBZDBLBQWFTPZ-UHFFFAOYSA-N pyrrolnitrin Chemical compound [O-][N+](=O)C1=C(Cl)C=CC=C1C1=CNC=C1Cl QJBZDBLBQWFTPZ-UHFFFAOYSA-N 0.000 description 2
 - WUKKREVJKMPFTB-UHFFFAOYSA-N pyrrolo[2,3-h]quinolin-2-one Chemical compound C1=C2N=CC=C2C2=NC(=O)C=CC2=C1 WUKKREVJKMPFTB-UHFFFAOYSA-N 0.000 description 2
 - 239000012429 reaction media Substances 0.000 description 2
 - 238000010992 reflux Methods 0.000 description 2
 - 229920002477 rna polymer Polymers 0.000 description 2
 - YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
 - 238000000926 separation method Methods 0.000 description 2
 - 239000002002 slurry Substances 0.000 description 2
 - 239000001632 sodium acetate Substances 0.000 description 2
 - 235000017281 sodium acetate Nutrition 0.000 description 2
 - 239000008247 solid mixture Substances 0.000 description 2
 - 241000894007 species Species 0.000 description 2
 - PUYXTUJWRLOUCW-UHFFFAOYSA-N spiroxamine Chemical compound O1C(CN(CC)CCC)COC11CCC(C(C)(C)C)CC1 PUYXTUJWRLOUCW-UHFFFAOYSA-N 0.000 description 2
 - 238000003756 stirring Methods 0.000 description 2
 - UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 2
 - 150000003900 succinic acid esters Chemical class 0.000 description 2
 - NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 2
 - 150000003457 sulfones Chemical class 0.000 description 2
 - 239000011593 sulfur Substances 0.000 description 2
 - 230000001629 suppression Effects 0.000 description 2
 - 239000004546 suspension concentrate Substances 0.000 description 2
 - XLNZEKHULJKQBA-UHFFFAOYSA-N terbufos Chemical compound CCOP(=S)(OCC)SCSC(C)(C)C XLNZEKHULJKQBA-UHFFFAOYSA-N 0.000 description 2
 - DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
 - UFYSEVXVEXCQSJ-UHFFFAOYSA-N tert-butyl (ethoxycarbonylamino) carbonate Chemical compound CCOC(=O)NOC(=O)OC(C)(C)C UFYSEVXVEXCQSJ-UHFFFAOYSA-N 0.000 description 2
 - 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
 - LITQZINTSYBKIU-UHFFFAOYSA-F tetracopper;hexahydroxide;sulfate Chemical compound [OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Cu+2].[Cu+2].[Cu+2].[Cu+2].[O-]S([O-])(=O)=O LITQZINTSYBKIU-UHFFFAOYSA-F 0.000 description 2
 - 229940072172 tetracycline antibiotic Drugs 0.000 description 2
 - INWVNNCOIIHEPX-UHFFFAOYSA-N thiadiazole-4-carboxamide Chemical compound NC(=O)C1=CSN=N1 INWVNNCOIIHEPX-UHFFFAOYSA-N 0.000 description 2
 - 150000003556 thioamides Chemical class 0.000 description 2
 - 150000003573 thiols Chemical class 0.000 description 2
 - FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
 - YFNCATAIYKQPOO-UHFFFAOYSA-N thiophanate Chemical compound CCOC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OCC YFNCATAIYKQPOO-UHFFFAOYSA-N 0.000 description 2
 - 238000000844 transformation Methods 0.000 description 2
 - URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 description 2
 - BAZVSMNPJJMILC-UHFFFAOYSA-N triadimenol Chemical compound C1=NC=NN1C(C(O)C(C)(C)C)OC1=CC=C(Cl)C=C1 BAZVSMNPJJMILC-UHFFFAOYSA-N 0.000 description 2
 - YWBFPKPWMSWWEA-UHFFFAOYSA-O triazolopyrimidine Chemical compound BrC1=CC=CC(C=2N=C3N=CN[N+]3=C(NCC=3C=CN=CC=3)C=2)=C1 YWBFPKPWMSWWEA-UHFFFAOYSA-O 0.000 description 2
 - MCVUKOYZUCWLQQ-UHFFFAOYSA-N tridecylbenzene Chemical compound CCCCCCCCCCCCCC1=CC=CC=C1 MCVUKOYZUCWLQQ-UHFFFAOYSA-N 0.000 description 2
 - 125000002827 triflate group Chemical class FC(S(=O)(=O)O*)(F)F 0.000 description 2
 - HSMVPDGQOIQYSR-KGENOOAVSA-N triflumizole Chemical compound C1=CN=CN1C(/COCCC)=N/C1=CC=C(Cl)C=C1C(F)(F)F HSMVPDGQOIQYSR-KGENOOAVSA-N 0.000 description 2
 - PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 2
 - NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
 - 238000005406 washing Methods 0.000 description 2
 - 239000001993 wax Substances 0.000 description 2
 - 239000008096 xylene Substances 0.000 description 2
 - 229910052727 yttrium Inorganic materials 0.000 description 2
 - FJBGIXKIXPUXBY-UHFFFAOYSA-N {2-[3-(4-chlorophenyl)propyl]-2,4,4-trimethyl-1,3-oxazolidin-3-yl}(imidazol-1-yl)methanone Chemical compound C1=CN=CN1C(=O)N1C(C)(C)COC1(C)CCCC1=CC=C(Cl)C=C1 FJBGIXKIXPUXBY-UHFFFAOYSA-N 0.000 description 2
 - SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 description 1
 - BQPPJGMMIYJVBR-UHFFFAOYSA-N (10S)-3c-Acetoxy-4.4.10r.13c.14t-pentamethyl-17c-((R)-1.5-dimethyl-hexen-(4)-yl)-(5tH)-Delta8-tetradecahydro-1H-cyclopenta[a]phenanthren Natural products CC12CCC(OC(C)=O)C(C)(C)C1CCC1=C2CCC2(C)C(C(CCC=C(C)C)C)CCC21C BQPPJGMMIYJVBR-UHFFFAOYSA-N 0.000 description 1
 - ZXQYGBMAQZUVMI-RDDWSQKMSA-N (1S)-cis-(alphaR)-cyhalothrin Chemical compound CC1(C)[C@H](\C=C(/Cl)C(F)(F)F)[C@@H]1C(=O)O[C@@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 ZXQYGBMAQZUVMI-RDDWSQKMSA-N 0.000 description 1
 - AGMMRUPNXPWLGF-AATRIKPKSA-N (2,3,5,6-tetrafluoro-4-methylphenyl)methyl 2,2-dimethyl-3-[(e)-prop-1-enyl]cyclopropane-1-carboxylate Chemical compound CC1(C)C(/C=C/C)C1C(=O)OCC1=C(F)C(F)=C(C)C(F)=C1F AGMMRUPNXPWLGF-AATRIKPKSA-N 0.000 description 1
 - MYUPFXPCYUISAG-UHFFFAOYSA-N (2,4-dichlorophenyl)(phenyl)pyrimidin-5-ylmethanol Chemical compound C=1N=CN=CC=1C(C=1C(=CC(Cl)=CC=1)Cl)(O)C1=CC=CC=C1 MYUPFXPCYUISAG-UHFFFAOYSA-N 0.000 description 1
 - QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
 - LZTIMERBDGGAJD-SNAWJCMRSA-N (2e)-2-(nitromethylidene)-1,3-thiazinane Chemical compound [O-][N+](=O)\C=C1/NCCCS1 LZTIMERBDGGAJD-SNAWJCMRSA-N 0.000 description 1
 - MJYQFWSXKFLTAY-OVEQLNGDSA-N (2r,3r)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]butane-1,4-diol;(2r,3r,4s,5s,6r)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O.C1=C(O)C(OC)=CC(C[C@@H](CO)[C@H](CO)CC=2C=C(OC)C(O)=CC=2)=C1 MJYQFWSXKFLTAY-OVEQLNGDSA-N 0.000 description 1
 - CXNPLSGKWMLZPZ-GIFSMMMISA-N (2r,3r,6s)-3-[[(3s)-3-amino-5-[carbamimidoyl(methyl)amino]pentanoyl]amino]-6-(4-amino-2-oxopyrimidin-1-yl)-3,6-dihydro-2h-pyran-2-carboxylic acid Chemical group O1[C@@H](C(O)=O)[C@H](NC(=O)C[C@@H](N)CCN(C)C(N)=N)C=C[C@H]1N1C(=O)N=C(N)C=C1 CXNPLSGKWMLZPZ-GIFSMMMISA-N 0.000 description 1
 - XDEHMKQLKPZERH-BYPYZUCNSA-N (2s)-2-amino-3-methylbutanamide Chemical compound CC(C)[C@H](N)C(N)=O XDEHMKQLKPZERH-BYPYZUCNSA-N 0.000 description 1
 - CHGIKSSZNBCNDW-UHFFFAOYSA-N (3beta,5alpha)-4,4-Dimethylcholesta-8,24-dien-3-ol Natural products CC12CCC(O)C(C)(C)C1CCC1=C2CCC2(C)C(C(CCC=C(C)C)C)CCC21 CHGIKSSZNBCNDW-UHFFFAOYSA-N 0.000 description 1
 - XUNYDVLIZWUPAW-UHFFFAOYSA-N (4-chlorophenyl) n-(4-methylphenyl)sulfonylcarbamate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)OC1=CC=C(Cl)C=C1 XUNYDVLIZWUPAW-UHFFFAOYSA-N 0.000 description 1
 - NDYMQOUYJJXCKJ-UHFFFAOYSA-N (4-fluorophenyl)-morpholin-4-ylmethanone Chemical compound C1=CC(F)=CC=C1C(=O)N1CCOCC1 NDYMQOUYJJXCKJ-UHFFFAOYSA-N 0.000 description 1
 - ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
 - 125000004845 (C1-C6) alkylsulfonylamino group Chemical group 0.000 description 1
 - 125000004749 (C1-C6) haloalkylsulfinyl group Chemical group 0.000 description 1
 - 125000006730 (C2-C5) alkynyl group Chemical group 0.000 description 1
 - 125000006825 (C2-C5) haloalkyl group Chemical group 0.000 description 1
 - 125000006546 (C4-C10) cycloalkyl group Chemical group 0.000 description 1
 - WCXDHFDTOYPNIE-RIYZIHGNSA-N (E)-acetamiprid Chemical compound N#C/N=C(\C)N(C)CC1=CC=C(Cl)N=C1 WCXDHFDTOYPNIE-RIYZIHGNSA-N 0.000 description 1
 - CFRPSFYHXJZSBI-DHZHZOJOSA-N (E)-nitenpyram Chemical compound [O-][N+](=O)/C=C(\NC)N(CC)CC1=CC=C(Cl)N=C1 CFRPSFYHXJZSBI-DHZHZOJOSA-N 0.000 description 1
 - IQVNEKKDSLOHHK-FNCQTZNRSA-N (E,E)-hydramethylnon Chemical compound N1CC(C)(C)CNC1=NN=C(/C=C/C=1C=CC(=CC=1)C(F)(F)F)\C=C\C1=CC=C(C(F)(F)F)C=C1 IQVNEKKDSLOHHK-FNCQTZNRSA-N 0.000 description 1
 - QNBTYORWCCMPQP-JXAWBTAJSA-N (Z)-dimethomorph Chemical compound C1=C(OC)C(OC)=CC=C1C(\C=1C=CC(Cl)=CC=1)=C/C(=O)N1CCOCC1 QNBTYORWCCMPQP-JXAWBTAJSA-N 0.000 description 1
 - HOKKPVIRMVDYPB-UVTDQMKNSA-N (Z)-thiacloprid Chemical compound C1=NC(Cl)=CC=C1CN1C(=N/C#N)/SCC1 HOKKPVIRMVDYPB-UVTDQMKNSA-N 0.000 description 1
 - CKPCAYZTYMHQEX-NBVRZTHBSA-N (e)-1-(2,4-dichlorophenyl)-n-methoxy-2-pyridin-3-ylethanimine Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=N/OC)/CC1=CC=CN=C1 CKPCAYZTYMHQEX-NBVRZTHBSA-N 0.000 description 1
 - GVTLFGJNTIRUEG-ZHACJKMWSA-N (e)-n-(3-methoxyphenyl)-3-phenylprop-2-enamide Chemical compound COC1=CC=CC(NC(=O)\C=C\C=2C=CC=CC=2)=C1 GVTLFGJNTIRUEG-ZHACJKMWSA-N 0.000 description 1
 - IAKOZHOLGAGEJT-UHFFFAOYSA-N 1,1,1-trichloro-2,2-bis(p-methoxyphenyl)-Ethane Chemical compound C1=CC(OC)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(OC)C=C1 IAKOZHOLGAGEJT-UHFFFAOYSA-N 0.000 description 1
 - UZHVXJZEHGSWQV-UHFFFAOYSA-N 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole Chemical compound C1NCC2CCCC21 UZHVXJZEHGSWQV-UHFFFAOYSA-N 0.000 description 1
 - QFCMBRXRVQRSSF-UHFFFAOYSA-N 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole Chemical group C1NCC2CNCC21 QFCMBRXRVQRSSF-UHFFFAOYSA-N 0.000 description 1
 - JQIZHNLEFQMDCQ-UHFFFAOYSA-N 1,2,3,4-tetrahydropyridazine Chemical compound C1CC=CNN1 JQIZHNLEFQMDCQ-UHFFFAOYSA-N 0.000 description 1
 - ZZXUZKXVROWEIF-UHFFFAOYSA-N 1,2-butylene carbonate Chemical compound CCC1COC(=O)O1 ZZXUZKXVROWEIF-UHFFFAOYSA-N 0.000 description 1
 - LQQKDSXCDXHLLF-UHFFFAOYSA-N 1,3-dibromopropan-2-one Chemical compound BrCC(=O)CBr LQQKDSXCDXHLLF-UHFFFAOYSA-N 0.000 description 1
 - LQPOOAJESJYDLS-UHFFFAOYSA-N 1,3-oxazinane Chemical group C1CNCOC1 LQPOOAJESJYDLS-UHFFFAOYSA-N 0.000 description 1
 - PLCMVACJJSYDFV-UHFFFAOYSA-N 1,3-oxazole-2-carboxamide Chemical compound NC(=O)C1=NC=CO1 PLCMVACJJSYDFV-UHFFFAOYSA-N 0.000 description 1
 - RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
 - ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical class BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
 - XFRVVPUIAFSTFO-UHFFFAOYSA-N 1-Tridecanol Chemical compound CCCCCCCCCCCCCO XFRVVPUIAFSTFO-UHFFFAOYSA-N 0.000 description 1
 - ZZVVDIVWGXTDRQ-UHFFFAOYSA-N 1-[(4-tert-butylphenyl)methylsulfanyl]-1-butylsulfanyl-n-pyridin-3-ylmethanimine Chemical compound C=1C=CN=CC=1N=C(SCCCC)SCC1=CC=C(C(C)(C)C)C=C1 ZZVVDIVWGXTDRQ-UHFFFAOYSA-N 0.000 description 1
 - VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
 - YIKWKLYQRFRGPM-UHFFFAOYSA-N 1-dodecylguanidine acetate Chemical compound CC(O)=O.CCCCCCCCCCCCN=C(N)N YIKWKLYQRFRGPM-UHFFFAOYSA-N 0.000 description 1
 - AKUNSTOMHUXJOZ-UHFFFAOYSA-N 1-hydroperoxybutane Chemical compound CCCCOO AKUNSTOMHUXJOZ-UHFFFAOYSA-N 0.000 description 1
 - NFGXHKASABOEEW-UHFFFAOYSA-N 1-methylethyl 11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate Chemical compound COC(C)(C)CCCC(C)CC=CC(C)=CC(=O)OC(C)C NFGXHKASABOEEW-UHFFFAOYSA-N 0.000 description 1
 - 125000006017 1-propenyl group Chemical group 0.000 description 1
 - 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
 - LEZWWPYKPKIXLL-UHFFFAOYSA-N 1-{2-(4-chlorobenzyloxy)-2-(2,4-dichlorophenyl)ethyl}imidazole Chemical compound C1=CC(Cl)=CC=C1COC(C=1C(=CC(Cl)=CC=1)Cl)CN1C=NC=C1 LEZWWPYKPKIXLL-UHFFFAOYSA-N 0.000 description 1
 - XYTLYKGXLMKYMV-UHFFFAOYSA-N 14alpha-methylzymosterol Natural products CC12CCC(O)CC1CCC1=C2CCC2(C)C(C(CCC=C(C)C)C)CCC21C XYTLYKGXLMKYMV-UHFFFAOYSA-N 0.000 description 1
 - KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 1
 - JYLLSRXJCBEPFX-UHFFFAOYSA-N 1h-imidazole-2-carbothioamide Chemical compound NC(=S)C1=NC=CN1 JYLLSRXJCBEPFX-UHFFFAOYSA-N 0.000 description 1
 - DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 1
 - AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 1
 - LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
 - JKTAIYGNOFSMCE-UHFFFAOYSA-N 2,3-di(nonyl)phenol Chemical compound CCCCCCCCCC1=CC=CC(O)=C1CCCCCCCCC JKTAIYGNOFSMCE-UHFFFAOYSA-N 0.000 description 1
 - QFUSCYRJMXLNRB-UHFFFAOYSA-N 2,6-dinitroaniline Chemical class NC1=C([N+]([O-])=O)C=CC=C1[N+]([O-])=O QFUSCYRJMXLNRB-UHFFFAOYSA-N 0.000 description 1
 - JNYAEWCLZODPBN-UHFFFAOYSA-N 2-(1,2-dihydroxyethyl)oxolane-3,4-diol Polymers OCC(O)C1OCC(O)C1O JNYAEWCLZODPBN-UHFFFAOYSA-N 0.000 description 1
 - STMIIPIFODONDC-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(O)(CCCC)CN1C=NC=N1 STMIIPIFODONDC-UHFFFAOYSA-N 0.000 description 1
 - IEORSVTYLWZQJQ-UHFFFAOYSA-N 2-(2-nonylphenoxy)ethanol Chemical compound CCCCCCCCCC1=CC=CC=C1OCCO IEORSVTYLWZQJQ-UHFFFAOYSA-N 0.000 description 1
 - PGOOBECODWQEAB-FIBGUPNXSA-N 2-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-nitro-3-(trideuteriomethyl)guanidine Chemical compound [2H]C([2H])([2H])NC(N[N+]([O-])=O)=NCC1=CN=C(Cl)S1 PGOOBECODWQEAB-FIBGUPNXSA-N 0.000 description 1
 - FEBUJFMRSBAMES-UHFFFAOYSA-N 2-[(2-{[3,5-dihydroxy-2-(hydroxymethyl)-6-phosphanyloxan-4-yl]oxy}-3,5-dihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-4-yl)oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl phosphinite Chemical compound OC1C(O)C(O)C(CO)OC1OCC1C(O)C(OC2C(C(OP)C(O)C(CO)O2)O)C(O)C(OC2C(C(CO)OC(P)C2O)O)O1 FEBUJFMRSBAMES-UHFFFAOYSA-N 0.000 description 1
 - RBHQAIFXLJIFFM-UHFFFAOYSA-N 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid Chemical compound CC1=CC(C(F)(F)F)=NN1CC(O)=O RBHQAIFXLJIFFM-UHFFFAOYSA-N 0.000 description 1
 - ZCOXUPVESDJDHX-UHFFFAOYSA-N 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetyl chloride Chemical compound CC1=CC(C(F)(F)F)=NN1CC(Cl)=O ZCOXUPVESDJDHX-UHFFFAOYSA-N 0.000 description 1
 - ZQMRDENWZKMOTM-UHFFFAOYSA-N 2-butoxy-6-iodo-3-propylchromen-4-one Chemical compound C1=C(I)C=C2C(=O)C(CCC)=C(OCCCC)OC2=C1 ZQMRDENWZKMOTM-UHFFFAOYSA-N 0.000 description 1
 - FVBQCAJBCWTPCQ-UHFFFAOYSA-N 2-chloro-1-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]ethanone Chemical compound FC1=CC=CC(F)=C1C1ON=C(C(=O)CCl)C1 FVBQCAJBCWTPCQ-UHFFFAOYSA-N 0.000 description 1
 - FEFZGUWAYDEBHK-UHFFFAOYSA-N 2-cyano-n'-hydroxyethanimidamide Chemical compound ON=C(N)CC#N FEFZGUWAYDEBHK-UHFFFAOYSA-N 0.000 description 1
 - CYEJMVLDXAUOPN-UHFFFAOYSA-N 2-dodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC=C1O CYEJMVLDXAUOPN-UHFFFAOYSA-N 0.000 description 1
 - ZDOOQPFIGYHZFV-UHFFFAOYSA-N 2-ethyl-4-[(4-phenoxyphenoxy)methyl]-1,3-dioxolane Chemical compound O1C(CC)OCC1COC(C=C1)=CC=C1OC1=CC=CC=C1 ZDOOQPFIGYHZFV-UHFFFAOYSA-N 0.000 description 1
 - 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
 - 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
 - 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
 - 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
 - LOSKNFQZTWYZHI-UHFFFAOYSA-N 2-pyrazol-1-ylacetic acid Chemical compound OC(=O)CN1C=CC=N1 LOSKNFQZTWYZHI-UHFFFAOYSA-N 0.000 description 1
 - OZYYDDJMGFFTGA-UHFFFAOYSA-N 3,3a,4,5,6,6a-hexahydro-2h-cyclopenta[d][1,2]oxazole Chemical compound C1NOC2CCCC21 OZYYDDJMGFFTGA-UHFFFAOYSA-N 0.000 description 1
 - UXGHOOUJCOOIBB-UHFFFAOYSA-N 3,3a,4,5,6,6a-hexahydro-2h-pyrrolo[3,4-d][1,2]oxazole Chemical group O1NCC2CNCC21 UXGHOOUJCOOIBB-UHFFFAOYSA-N 0.000 description 1
 - OVFHHJZHXHZIHT-UHFFFAOYSA-N 3-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one Chemical compound ClC1=CC(Cl)=CC=C1N1C(=O)C2=CC=CC=C2N=C1N1N=CN=C1 OVFHHJZHXHZIHT-UHFFFAOYSA-N 0.000 description 1
 - BZGLBXYQOMFXAU-UHFFFAOYSA-N 3-(2-methylpiperidin-1-yl)propyl 3,4-dichlorobenzoate Chemical compound CC1CCCCN1CCCOC(=O)C1=CC=C(Cl)C(Cl)=C1 BZGLBXYQOMFXAU-UHFFFAOYSA-N 0.000 description 1
 - XTDZGXBTXBEZDN-UHFFFAOYSA-N 3-(difluoromethyl)-N-(9-isopropyl-1,2,3,4-tetrahydro-1,4-methanonaphthalen-5-yl)-1-methylpyrazole-4-carboxamide Chemical compound CC(C)C1C2CCC1C1=C2C=CC=C1NC(=O)C1=CN(C)N=C1C(F)F XTDZGXBTXBEZDN-UHFFFAOYSA-N 0.000 description 1
 - FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
 - YPZHJCZTJAIDSY-UHFFFAOYSA-N 3-[2-(diazinan-4-yl)-1,3-thiazol-4-yl]-5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazole Chemical compound FC1=CC=CC(F)=C1C1ON=C(C=2N=C(SC=2)C2CNNCC2)C1 YPZHJCZTJAIDSY-UHFFFAOYSA-N 0.000 description 1
 - DHTJFQWHCVTNRY-UHFFFAOYSA-N 3-[5-(4-chlorophenyl)-2,3-dimethyl-1,2-oxazolidin-3-yl]pyridine Chemical compound CN1OC(C=2C=CC(Cl)=CC=2)CC1(C)C1=CC=CN=C1 DHTJFQWHCVTNRY-UHFFFAOYSA-N 0.000 description 1
 - BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
 - IAPUXXZOKAZTNA-UHFFFAOYSA-N 3-chloro-n-hydroxy-2-oxopropanimidoyl chloride Chemical compound ON=C(Cl)C(=O)CCl IAPUXXZOKAZTNA-UHFFFAOYSA-N 0.000 description 1
 - WYVVKGNFXHOCQV-UHFFFAOYSA-N 3-iodoprop-2-yn-1-yl butylcarbamate Chemical compound CCCCNC(=O)OCC#CI WYVVKGNFXHOCQV-UHFFFAOYSA-N 0.000 description 1
 - FPTJELQXIUUCEY-UHFFFAOYSA-N 3beta-Hydroxy-lanostan Natural products C1CC2C(C)(C)C(O)CCC2(C)C2C1C1(C)CCC(C(C)CCCC(C)C)C1(C)CC2 FPTJELQXIUUCEY-UHFFFAOYSA-N 0.000 description 1
 - WEQPBCSPRXFQQS-UHFFFAOYSA-N 4,5-dihydro-1,2-oxazole Chemical compound C1CC=NO1 WEQPBCSPRXFQQS-UHFFFAOYSA-N 0.000 description 1
 - FLUWOKHEJWMMEE-UHFFFAOYSA-N 4,5-dihydro-1,2-oxazole-3-carboxamide Chemical class NC(=O)C1=NOCC1 FLUWOKHEJWMMEE-UHFFFAOYSA-N 0.000 description 1
 - VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 1
 - 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
 - 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
 - JYCQQPHGFMYQCF-UHFFFAOYSA-N 4-tert-Octylphenol monoethoxylate Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 JYCQQPHGFMYQCF-UHFFFAOYSA-N 0.000 description 1
 - 101710169336 5'-deoxyadenosine deaminase Proteins 0.000 description 1
 - UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
 - VXTTTWQTHJHGDN-UHFFFAOYSA-N 5-[4-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-1,3-thiazol-2-yl]oxazinane Chemical compound FC1=CC=CC(F)=C1C1ON=C(C=2N=C(SC=2)C2CONCC2)C1 VXTTTWQTHJHGDN-UHFFFAOYSA-N 0.000 description 1
 - ZOCSXAVNDGMNBV-UHFFFAOYSA-N 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(trifluoromethyl)sulfinyl]-1H-pyrazole-3-carbonitrile Chemical compound NC1=C(S(=O)C(F)(F)F)C(C#N)=NN1C1=C(Cl)C=C(C(F)(F)F)C=C1Cl ZOCSXAVNDGMNBV-UHFFFAOYSA-N 0.000 description 1
 - XJFIKRXIJXAJGH-UHFFFAOYSA-N 5-chloro-1,3-dihydroimidazo[4,5-b]pyridin-2-one Chemical group ClC1=CC=C2NC(=O)NC2=N1 XJFIKRXIJXAJGH-UHFFFAOYSA-N 0.000 description 1
 - WWJLCYHYLZZXBE-UHFFFAOYSA-N 5-chloro-1,3-dihydroindol-2-one Chemical compound ClC1=CC=C2NC(=O)CC2=C1 WWJLCYHYLZZXBE-UHFFFAOYSA-N 0.000 description 1
 - IOGCHBMFOXWVLY-UHFFFAOYSA-N 5-fluoro-1,3-dimethylpyrazole-4-carboxamide Chemical compound CC1=NN(C)C(F)=C1C(N)=O IOGCHBMFOXWVLY-UHFFFAOYSA-N 0.000 description 1
 - IBSREHMXUMOFBB-JFUDTMANSA-N 5u8924t11h Chemical compound O1[C@@H](C)[C@H](O)[C@@H](OC)C[C@@H]1O[C@@H]1[C@@H](OC)C[C@H](O[C@@H]2C(=C/C[C@@H]3C[C@@H](C[C@@]4(O3)C=C[C@H](C)[C@@H](C(C)C)O4)OC(=O)[C@@H]3C=C(C)[C@@H](O)[C@H]4OC\C([C@@]34O)=C/C=C/[C@@H]2C)/C)O[C@H]1C.C1=C[C@H](C)[C@@H]([C@@H](C)CC)O[C@]11O[C@H](C\C=C(C)\[C@@H](O[C@@H]2O[C@@H](C)[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](OC)C3)[C@@H](OC)C2)[C@@H](C)\C=C\C=C/2[C@]3([C@H](C(=O)O4)C=C(C)[C@@H](O)[C@H]3OC\2)O)C[C@H]4C1 IBSREHMXUMOFBB-JFUDTMANSA-N 0.000 description 1
 - YLOOFEXWGHVZRU-UHFFFAOYSA-N 6,7-dibromo-2-propoxy-3-propylthieno[3,2-d]pyrimidin-4-one Chemical compound O=C1N(CCC)C(OCCC)=NC2=C1SC(Br)=C2Br YLOOFEXWGHVZRU-UHFFFAOYSA-N 0.000 description 1
 - QQLGQHGKSPJXTO-UHFFFAOYSA-N 6,8-diiodo-2-propoxy-3-propylquinazolin-4-one Chemical compound C1=C(I)C=C2C(=O)N(CCC)C(OCCC)=NC2=C1I QQLGQHGKSPJXTO-UHFFFAOYSA-N 0.000 description 1
 - GFALABICUSQHNW-UHFFFAOYSA-N 6-bromo-2-propoxy-3-propylpyrido[2,3-d]pyrimidin-4-one Chemical compound C1=C(Br)C=C2C(=O)N(CCC)C(OCCC)=NC2=N1 GFALABICUSQHNW-UHFFFAOYSA-N 0.000 description 1
 - FVQAEZOUDXAZGN-UHFFFAOYSA-N 6-bromo-2-propoxy-3-propylquinazolin-4-one Chemical compound C1=C(Br)C=C2C(=O)N(CCC)C(OCCC)=NC2=C1 FVQAEZOUDXAZGN-UHFFFAOYSA-N 0.000 description 1
 - SHIIIVHYHHZLFW-UHFFFAOYSA-N 6-bromo-2-propoxy-3-propylthieno[2,3-d]pyrimidin-4-one Chemical compound O=C1N(CCC)C(OCCC)=NC2=C1C=C(Br)S2 SHIIIVHYHHZLFW-UHFFFAOYSA-N 0.000 description 1
 - IXRUZEMDNAMNFO-UHFFFAOYSA-N 6-chloro-2-propoxy-3-propylthieno[2,3-d]pyrimidin-4-one Chemical compound O=C1N(CCC)C(OCCC)=NC2=C1C=C(Cl)S2 IXRUZEMDNAMNFO-UHFFFAOYSA-N 0.000 description 1
 - OMTYROZFKUXLAQ-UHFFFAOYSA-N 7-bromo-2-propoxy-3-propylthieno[3,2-d]pyrimidin-4-one Chemical compound O=C1N(CCC)C(OCCC)=NC2=C1SC=C2Br OMTYROZFKUXLAQ-UHFFFAOYSA-N 0.000 description 1
 - ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
 - PLLBRTOLHQQAQQ-UHFFFAOYSA-N 8-methylnonan-1-ol Chemical compound CC(C)CCCCCCCO PLLBRTOLHQQAQQ-UHFFFAOYSA-N 0.000 description 1
 - 239000005875 Acetamiprid Substances 0.000 description 1
 - 241001133760 Acoelorraphe Species 0.000 description 1
 - 102000055025 Adenosine deaminases Human genes 0.000 description 1
 - GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
 - 239000005995 Aluminium silicate Substances 0.000 description 1
 - 239000005727 Amisulbrom Substances 0.000 description 1
 - 244000105624 Arachis hypogaea Species 0.000 description 1
 - 241000235349 Ascomycota Species 0.000 description 1
 - 239000005878 Azadirachtin Substances 0.000 description 1
 - 241000193363 Bacillus thuringiensis serovar aizawai Species 0.000 description 1
 - 241001147758 Bacillus thuringiensis serovar kurstaki Species 0.000 description 1
 - 239000005735 Benalaxyl-M Substances 0.000 description 1
 - 239000005884 Beta-Cyfluthrin Substances 0.000 description 1
 - BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
 - 239000005653 Bifenazate Substances 0.000 description 1
 - 239000005874 Bifenthrin Substances 0.000 description 1
 - 239000005738 Bixafen Substances 0.000 description 1
 - 240000002791 Brassica napus Species 0.000 description 1
 - 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
 - 241000233685 Bremia lactucae Species 0.000 description 1
 - 239000005885 Buprofezin Substances 0.000 description 1
 - 125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 description 1
 - KPHATKPOJFGEAO-UHFFFAOYSA-N CC(C1)=NOC1c1ccccc1 Chemical compound CC(C1)=NOC1c1ccccc1 KPHATKPOJFGEAO-UHFFFAOYSA-N 0.000 description 1
 - XHUWAENUBYGSEE-ZETCQYMHSA-N CC(C1)=NO[C@]1(C=C)C#N Chemical compound CC(C1)=NO[C@]1(C=C)C#N XHUWAENUBYGSEE-ZETCQYMHSA-N 0.000 description 1
 - NYWYSQXYHKEKQW-CQSZACIVSA-O CC(C1)=[NH+]O[C@]1(c(cccc1)c1N1C2=CC2)C1=O Chemical compound CC(C1)=[NH+]O[C@]1(c(cccc1)c1N1C2=CC2)C1=O NYWYSQXYHKEKQW-CQSZACIVSA-O 0.000 description 1
 - SSUFDOMYCBCHML-UHFFFAOYSA-N CCCCC[S](=O)=O Chemical class CCCCC[S](=O)=O SSUFDOMYCBCHML-UHFFFAOYSA-N 0.000 description 1
 - ZNUCPDVZIIZEJE-UHFFFAOYSA-N CCN(C(CC(C)=N1)(C1=C)c1c2cccc1)C2=O Chemical compound CCN(C(CC(C)=N1)(C1=C)c1c2cccc1)C2=O ZNUCPDVZIIZEJE-UHFFFAOYSA-N 0.000 description 1
 - JFLRKDZMHNBDQS-UCQUSYKYSA-N CC[C@H]1CCC[C@@H]([C@H](C(=O)C2=C[C@H]3[C@@H]4C[C@@H](C[C@H]4C(=C[C@H]3[C@@H]2CC(=O)O1)C)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)OC)OC)OC)C)O[C@H]6CC[C@@H]([C@H](O6)C)N(C)C.CC[C@H]1CCC[C@@H]([C@H](C(=O)C2=C[C@H]3[C@@H]4C[C@@H](C[C@H]4C=C[C@H]3C2CC(=O)O1)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)OC)OC)OC)C)O[C@H]6CC[C@@H]([C@H](O6)C)N(C)C Chemical compound CC[C@H]1CCC[C@@H]([C@H](C(=O)C2=C[C@H]3[C@@H]4C[C@@H](C[C@H]4C(=C[C@H]3[C@@H]2CC(=O)O1)C)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)OC)OC)OC)C)O[C@H]6CC[C@@H]([C@H](O6)C)N(C)C.CC[C@H]1CCC[C@@H]([C@H](C(=O)C2=C[C@H]3[C@@H]4C[C@@H](C[C@H]4C=C[C@H]3C2CC(=O)O1)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)OC)OC)OC)C)O[C@H]6CC[C@@H]([C@H](O6)C)N(C)C JFLRKDZMHNBDQS-UCQUSYKYSA-N 0.000 description 1
 - 235000006810 Caesalpinia ciliata Nutrition 0.000 description 1
 - 241000059739 Caesalpinia ciliata Species 0.000 description 1
 - OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
 - 244000020518 Carthamus tinctorius Species 0.000 description 1
 - 235000003255 Carthamus tinctorius Nutrition 0.000 description 1
 - 239000005973 Carvone Substances 0.000 description 1
 - 241000530549 Cercospora beticola Species 0.000 description 1
 - 102000005469 Chitin Synthase Human genes 0.000 description 1
 - 108700040089 Chitin synthases Proteins 0.000 description 1
 - 239000005886 Chlorantraniliprole Substances 0.000 description 1
 - 239000005944 Chlorpyrifos Substances 0.000 description 1
 - 239000005945 Chlorpyrifos-methyl Substances 0.000 description 1
 - 239000005887 Chromafenozide Substances 0.000 description 1
 - 239000005888 Clothianidin Substances 0.000 description 1
 - 244000060011 Cocos nucifera Species 0.000 description 1
 - 235000013162 Cocos nucifera Nutrition 0.000 description 1
 - 241000222235 Colletotrichum orbiculare Species 0.000 description 1
 - JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
 - 241001135545 Cydia pomonella granulovirus Species 0.000 description 1
 - 239000005946 Cypermethrin Substances 0.000 description 1
 - 239000005891 Cyromazine Substances 0.000 description 1
 - 102000002004 Cytochrome P-450 Enzyme System Human genes 0.000 description 1
 - 108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 1
 - 102100030497 Cytochrome c Human genes 0.000 description 1
 - 108010075031 Cytochromes c Proteins 0.000 description 1
 - FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
 - 102000004163 DNA-directed RNA polymerases Human genes 0.000 description 1
 - 108090000626 DNA-directed RNA polymerases Proteins 0.000 description 1
 - 239000005892 Deltamethrin Substances 0.000 description 1
 - 229940122680 Demethylase inhibitor Drugs 0.000 description 1
 - 239000004375 Dextrin Substances 0.000 description 1
 - 229920001353 Dextrin Polymers 0.000 description 1
 - FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
 - 239000005893 Diflubenzuron Substances 0.000 description 1
 - BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
 - 239000005947 Dimethoate Substances 0.000 description 1
 - 239000005761 Dimethomorph Substances 0.000 description 1
 - 239000005764 Dithianon Substances 0.000 description 1
 - SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
 - 239000005766 Dodine Substances 0.000 description 1
 - 239000005894 Emamectin Substances 0.000 description 1
 - 241000588694 Erwinia amylovora Species 0.000 description 1
 - 241000221787 Erysiphe Species 0.000 description 1
 - 241000896222 Erysiphe polygoni Species 0.000 description 1
 - 239000005895 Esfenvalerate Substances 0.000 description 1
 - VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
 - 239000005977 Ethylene Substances 0.000 description 1
 - 239000005774 Fenamidone Substances 0.000 description 1
 - 239000005899 Fipronil Substances 0.000 description 1
 - 239000005900 Flonicamid Substances 0.000 description 1
 - 239000005901 Flubendiamide Substances 0.000 description 1
 - 239000005781 Fludioxonil Substances 0.000 description 1
 - 239000005782 Fluopicolide Substances 0.000 description 1
 - 239000005783 Fluopyram Substances 0.000 description 1
 - PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
 - 239000005786 Flutolanil Substances 0.000 description 1
 - 239000005791 Fuberidazole Substances 0.000 description 1
 - 241000223218 Fusarium Species 0.000 description 1
 - 241000223195 Fusarium graminearum Species 0.000 description 1
 - 108091006027 G proteins Proteins 0.000 description 1
 - 102000030782 GTP binding Human genes 0.000 description 1
 - 108091000058 GTP-Binding Proteins 0.000 description 1
 - 241001620302 Glomerella <beetle> Species 0.000 description 1
 - BKLIAINBCQPSOV-UHFFFAOYSA-N Gluanol Natural products CC(C)CC=CC(C)C1CCC2(C)C3=C(CCC12C)C4(C)CCC(O)C(C)(C)C4CC3 BKLIAINBCQPSOV-UHFFFAOYSA-N 0.000 description 1
 - 244000068988 Glycine max Species 0.000 description 1
 - 235000010469 Glycine max Nutrition 0.000 description 1
 - 239000007818 Grignard reagent Substances 0.000 description 1
 - 241000701443 Helicoverpa zea single nucleopolyhedrovirus Species 0.000 description 1
 - 241001181532 Hemileia vastatrix Species 0.000 description 1
 - 241000238631 Hexapoda Species 0.000 description 1
 - 241000549404 Hyaloperonospora parasitica Species 0.000 description 1
 - 102000004867 Hydro-Lyases Human genes 0.000 description 1
 - 108090001042 Hydro-Lyases Proteins 0.000 description 1
 - WFJNHVWTKZUUTR-QAMTZSDWSA-N Hydrocinchonine Chemical compound C1=CC=C2C([C@H](O)[C@H]3C[C@@H]4CCN3C[C@@H]4CC)=CC=NC2=C1 WFJNHVWTKZUUTR-QAMTZSDWSA-N 0.000 description 1
 - AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
 - DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
 - 239000005906 Imidacloprid Substances 0.000 description 1
 - FKWDSATZSMJRLC-UHFFFAOYSA-N Iminoctadine acetate Chemical compound CC([O-])=O.CC([O-])=O.CC([O-])=O.NC([NH3+])=NCCCCCCCC[NH2+]CCCCCCCCN=C(N)[NH3+] FKWDSATZSMJRLC-UHFFFAOYSA-N 0.000 description 1
 - 239000005907 Indoxacarb Substances 0.000 description 1
 - KGEKLUUHTZCSIP-UHFFFAOYSA-N Isobornyl acetate Natural products C1CC2(C)C(OC(=O)C)CC1C2(C)C KGEKLUUHTZCSIP-UHFFFAOYSA-N 0.000 description 1
 - 239000004440 Isodecyl alcohol Substances 0.000 description 1
 - 102000004195 Isomerases Human genes 0.000 description 1
 - 108090000769 Isomerases Proteins 0.000 description 1
 - 239000005799 Isopyrazam Substances 0.000 description 1
 - 238000005659 Kindler reaction Methods 0.000 description 1
 - FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
 - GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
 - 239000004166 Lanolin Chemical class 0.000 description 1
 - LOPKHWOTGJIQLC-UHFFFAOYSA-N Lanosterol Natural products CC(CCC=C(C)C)C1CCC2(C)C3=C(CCC12C)C4(C)CCC(C)(O)C(C)(C)C4CC3 LOPKHWOTGJIQLC-UHFFFAOYSA-N 0.000 description 1
 - 229920001732 Lignosulfonate Polymers 0.000 description 1
 - 241000337544 Limnoriidae Species 0.000 description 1
 - WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
 - 239000005912 Lufenuron Substances 0.000 description 1
 - 241001344131 Magnaporthe grisea Species 0.000 description 1
 - FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
 - 239000005949 Malathion Substances 0.000 description 1
 - 239000005805 Mepanipyrim Substances 0.000 description 1
 - 239000005914 Metaflumizone Substances 0.000 description 1
 - MIFOMMKAVSCNKQ-HWIUFGAZSA-N Metaflumizone Chemical compound C1=CC(OC(F)(F)F)=CC=C1NC(=O)N\N=C(C=1C=C(C=CC=1)C(F)(F)F)\CC1=CC=C(C#N)C=C1 MIFOMMKAVSCNKQ-HWIUFGAZSA-N 0.000 description 1
 - 239000005808 Metalaxyl-M Substances 0.000 description 1
 - BYBLEWFAAKGYCD-UHFFFAOYSA-N Miconazole Chemical compound ClC1=CC(Cl)=CC=C1COC(C=1C(=CC(Cl)=CC=1)Cl)CN1C=NC=C1 BYBLEWFAAKGYCD-UHFFFAOYSA-N 0.000 description 1
 - 241001518731 Monilinia fructicola Species 0.000 description 1
 - GEEFYZZDEIFBHP-UHFFFAOYSA-N N-[11-(dibromomethylidene)-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound FC(F)(F)C1=NN(C)C=C1C(=O)NC1=CC=CC2=C1C1CCC2C1=C(Br)Br GEEFYZZDEIFBHP-UHFFFAOYSA-N 0.000 description 1
 - CCCGEKHKTPTUHJ-UHFFFAOYSA-N N-[9-(dichloromethylene)-1,2,3,4-tetrahydro-1,4-methanonaphthalen-5-yl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide Chemical compound FC(F)C1=NN(C)C=C1C(=O)NC1=CC=CC2=C1C1CCC2C1=C(Cl)Cl CCCGEKHKTPTUHJ-UHFFFAOYSA-N 0.000 description 1
 - NQRFDNJEBWAUBL-UHFFFAOYSA-N N-[cyano(2-thienyl)methyl]-4-ethyl-2-(ethylamino)-1,3-thiazole-5-carboxamide Chemical compound S1C(NCC)=NC(CC)=C1C(=O)NC(C#N)C1=CC=CS1 NQRFDNJEBWAUBL-UHFFFAOYSA-N 0.000 description 1
 - 102000006746 NADH Dehydrogenase Human genes 0.000 description 1
 - 108010086428 NADH Dehydrogenase Proteins 0.000 description 1
 - CAHGCLMLTWQZNJ-UHFFFAOYSA-N Nerifoliol Natural products CC12CCC(O)C(C)(C)C1CCC1=C2CCC2(C)C(C(CCC=C(C)C)C)CCC21C CAHGCLMLTWQZNJ-UHFFFAOYSA-N 0.000 description 1
 - GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
 - 241001668536 Oculimacula yallundae Species 0.000 description 1
 - 240000007817 Olea europaea Species 0.000 description 1
 - 235000019502 Orange oil Nutrition 0.000 description 1
 - 239000005950 Oxamyl Substances 0.000 description 1
 - 239000004100 Oxytetracycline Substances 0.000 description 1
 - 239000005815 Penflufen Substances 0.000 description 1
 - 241001223281 Peronospora Species 0.000 description 1
 - 241000582441 Peronospora tabacina Species 0.000 description 1
 - YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
 - 239000005921 Phosmet Substances 0.000 description 1
 - 241000233616 Phytophthora capsici Species 0.000 description 1
 - 241000233618 Phytophthora cinnamomi Species 0.000 description 1
 - 241000233624 Phytophthora megasperma Species 0.000 description 1
 - 241000233629 Phytophthora parasitica Species 0.000 description 1
 - 241001337928 Podosphaera leucotricha Species 0.000 description 1
 - 239000004349 Polyvinylpyrrolidone-vinyl acetate copolymer Substances 0.000 description 1
 - ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
 - 239000005821 Propamocarb Substances 0.000 description 1
 - 102000001253 Protein Kinase Human genes 0.000 description 1
 - 241001281802 Pseudoperonospora Species 0.000 description 1
 - 241000221300 Puccinia Species 0.000 description 1
 - 241000343500 Puccinia arachidis Species 0.000 description 1
 - 241000221301 Puccinia graminis Species 0.000 description 1
 - 241001123559 Puccinia hordei Species 0.000 description 1
 - 239000005925 Pymetrozine Substances 0.000 description 1
 - 241000190117 Pyrenophora tritici-repentis Species 0.000 description 1
 - 239000005828 Pyrimethanil Substances 0.000 description 1
 - MWMQNVGAHVXSPE-UHFFFAOYSA-N Pyriprole Chemical compound ClC=1C=C(C(F)(F)F)C=C(Cl)C=1N1N=C(C#N)C(SC(F)F)=C1NCC1=CC=CC=N1 MWMQNVGAHVXSPE-UHFFFAOYSA-N 0.000 description 1
 - 239000005927 Pyriproxyfen Substances 0.000 description 1
 - 241000918585 Pythium aphanidermatum Species 0.000 description 1
 - 239000005831 Quinoxyfen Substances 0.000 description 1
 - IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
 - 235000019484 Rapeseed oil Nutrition 0.000 description 1
 - 241000813090 Rhizoctonia solani Species 0.000 description 1
 - 241001518834 Rutstroemia Species 0.000 description 1
 - 229930001406 Ryanodine Natural products 0.000 description 1
 - 229920002305 Schizophyllan Polymers 0.000 description 1
 - 241000221662 Sclerotinia Species 0.000 description 1
 - 244000000231 Sesamum indicum Species 0.000 description 1
 - 235000003434 Sesamum indicum Nutrition 0.000 description 1
 - 239000005835 Silthiofam Substances 0.000 description 1
 - PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
 - UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
 - DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
 - FBPFZTCFMRRESA-NQAPHZHOSA-N Sorbitol Polymers OCC(O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-NQAPHZHOSA-N 0.000 description 1
 - 241000592344 Spermatophyta Species 0.000 description 1
 - 239000005930 Spinosad Substances 0.000 description 1
 - 239000005837 Spiroxamine Substances 0.000 description 1
 - 229920002472 Starch Polymers 0.000 description 1
 - 102000019259 Succinate Dehydrogenase Human genes 0.000 description 1
 - 108010012901 Succinate Dehydrogenase Proteins 0.000 description 1
 - 229930006000 Sucrose Natural products 0.000 description 1
 - CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
 - ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
 - FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
 - 239000005937 Tebufenozide Substances 0.000 description 1
 - 239000005938 Teflubenzuron Substances 0.000 description 1
 - 239000005940 Thiacloprid Substances 0.000 description 1
 - 239000005941 Thiamethoxam Substances 0.000 description 1
 - 239000005842 Thiophanate-methyl Substances 0.000 description 1
 - 239000005843 Thiram Substances 0.000 description 1
 - ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
 - 101710183280 Topoisomerase Proteins 0.000 description 1
 - 239000005847 Triazoxide Substances 0.000 description 1
 - 239000005942 Triflumuron Substances 0.000 description 1
 - 244000098338 Triticum aestivum Species 0.000 description 1
 - 241000510929 Uncinula Species 0.000 description 1
 - 229930195482 Validamycin Natural products 0.000 description 1
 - 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 1
 - 241000228452 Venturia inaequalis Species 0.000 description 1
 - 241001123668 Verticillium dahliae Species 0.000 description 1
 - 241000589636 Xanthomonas campestris Species 0.000 description 1
 - 239000005870 Ziram Substances 0.000 description 1
 - 239000001940 [(1R,4S,6R)-1,7,7-trimethyl-6-bicyclo[2.2.1]heptanyl] acetate Substances 0.000 description 1
 - 239000001089 [(2R)-oxolan-2-yl]methanol Substances 0.000 description 1
 - QQODLKZGRKWIFG-RUTXASTPSA-N [(R)-cyano-(4-fluoro-3-phenoxyphenyl)methyl] (1S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)C(C=C(Cl)Cl)[C@@H]1C(=O)O[C@@H](C#N)C1=CC=C(F)C(OC=2C=CC=CC=2)=C1 QQODLKZGRKWIFG-RUTXASTPSA-N 0.000 description 1
 - 229950008167 abamectin Drugs 0.000 description 1
 - YASYVMFAVPKPKE-UHFFFAOYSA-N acephate Chemical compound COP(=O)(SC)NC(C)=O YASYVMFAVPKPKE-UHFFFAOYSA-N 0.000 description 1
 - 150000001242 acetic acid derivatives Chemical class 0.000 description 1
 - ZCZSIDMEHXZRLG-UHFFFAOYSA-N acetic acid heptyl ester Natural products CCCCCCCOC(C)=O ZCZSIDMEHXZRLG-UHFFFAOYSA-N 0.000 description 1
 - 239000003377 acid catalyst Substances 0.000 description 1
 - 238000005903 acid hydrolysis reaction Methods 0.000 description 1
 - 239000012190 activator Substances 0.000 description 1
 - 239000013543 active substance Substances 0.000 description 1
 - 230000000996 additive effect Effects 0.000 description 1
 - 125000001931 aliphatic group Chemical group 0.000 description 1
 - 150000001340 alkali metals Chemical class 0.000 description 1
 - 150000001345 alkine derivatives Chemical class 0.000 description 1
 - 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
 - 229920000180 alkyd Polymers 0.000 description 1
 - NMPVEAUIHMEAQP-UHFFFAOYSA-N alpha-bromo-acetaldehyde Natural products BrCC=O NMPVEAUIHMEAQP-UHFFFAOYSA-N 0.000 description 1
 - 235000012211 aluminium silicate Nutrition 0.000 description 1
 - 150000001413 amino acids Chemical class 0.000 description 1
 - 125000003277 amino group Chemical group 0.000 description 1
 - 125000004103 aminoalkyl group Chemical group 0.000 description 1
 - 238000005902 aminomethylation reaction Methods 0.000 description 1
 - BREATYVWRHIPIY-UHFFFAOYSA-N amisulbrom Chemical group CN(C)S(=O)(=O)N1C=NC(S(=O)(=O)N2C3=CC(F)=CC=C3C(Br)=C2C)=N1 BREATYVWRHIPIY-UHFFFAOYSA-N 0.000 description 1
 - IMHBYKMAHXWHRP-UHFFFAOYSA-N anilazine Chemical compound ClC1=CC=CC=C1NC1=NC(Cl)=NC(Cl)=N1 IMHBYKMAHXWHRP-UHFFFAOYSA-N 0.000 description 1
 - 125000000129 anionic group Chemical group 0.000 description 1
 - 230000002528 anti-freeze Effects 0.000 description 1
 - 239000000010 aprotic solvent Substances 0.000 description 1
 - 239000011260 aqueous acid Substances 0.000 description 1
 - 239000012223 aqueous fraction Substances 0.000 description 1
 - 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
 - 238000000065 atmospheric pressure chemical ionisation Methods 0.000 description 1
 - 229960000892 attapulgite Drugs 0.000 description 1
 - 239000005667 attractant Substances 0.000 description 1
 - RRZXIRBKKLTSOM-XPNPUAGNSA-N avermectin B1a Chemical compound C1=C[C@H](C)[C@@H]([C@@H](C)CC)O[C@]11O[C@H](C\C=C(C)\[C@@H](O[C@@H]2O[C@@H](C)[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](OC)C3)[C@@H](OC)C2)[C@@H](C)\C=C\C=C/2[C@]3([C@H](C(=O)O4)C=C(C)[C@@H](O)[C@H]3OC\2)O)C[C@H]4C1 RRZXIRBKKLTSOM-XPNPUAGNSA-N 0.000 description 1
 - VEHPJKVTJQSSKL-UHFFFAOYSA-N azadirachtin Natural products O1C2(C)C(C3(C=COC3O3)O)CC3C21C1(C)C(O)C(OCC2(OC(C)=O)C(CC3OC(=O)C(C)=CC)OC(C)=O)C2C32COC(C(=O)OC)(O)C12 VEHPJKVTJQSSKL-UHFFFAOYSA-N 0.000 description 1
 - FTNJWQUOZFUQQJ-NDAWSKJSSA-N azadirachtin A Chemical compound C([C@@H]([C@]1(C=CO[C@H]1O1)O)[C@]2(C)O3)[C@H]1[C@]23[C@]1(C)[C@H](O)[C@H](OC[C@@]2([C@@H](C[C@@H]3OC(=O)C(\C)=C\C)OC(C)=O)C(=O)OC)[C@@H]2[C@]32CO[C@@](C(=O)OC)(O)[C@@H]12 FTNJWQUOZFUQQJ-NDAWSKJSSA-N 0.000 description 1
 - FTNJWQUOZFUQQJ-IRYYUVNJSA-N azadirachtin A Natural products C([C@@H]([C@]1(C=CO[C@H]1O1)O)[C@]2(C)O3)[C@H]1[C@]23[C@]1(C)[C@H](O)[C@H](OC[C@@]2([C@@H](C[C@@H]3OC(=O)C(\C)=C/C)OC(C)=O)C(=O)OC)[C@@H]2[C@]32CO[C@@](C(=O)OC)(O)[C@@H]12 FTNJWQUOZFUQQJ-IRYYUVNJSA-N 0.000 description 1
 - CJJOSEISRRTUQB-UHFFFAOYSA-N azinphos-methyl Chemical group C1=CC=C2C(=O)N(CSP(=S)(OC)OC)N=NC2=C1 CJJOSEISRRTUQB-UHFFFAOYSA-N 0.000 description 1
 - 244000052616 bacterial pathogen Species 0.000 description 1
 - 238000007630 basic procedure Methods 0.000 description 1
 - 235000015278 beef Nutrition 0.000 description 1
 - CJPQIRJHIZUAQP-MRXNPFEDSA-N benalaxyl-M Chemical compound CC=1C=CC=C(C)C=1N([C@H](C)C(=O)OC)C(=O)CC1=CC=CC=C1 CJPQIRJHIZUAQP-MRXNPFEDSA-N 0.000 description 1
 - 239000000440 bentonite Substances 0.000 description 1
 - 229910000278 bentonite Inorganic materials 0.000 description 1
 - SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
 - 235000019445 benzyl alcohol Nutrition 0.000 description 1
 - DRTQHJPVMGBUCF-PSQAKQOGSA-N beta-L-uridine Natural products O[C@H]1[C@@H](O)[C@H](CO)O[C@@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-PSQAKQOGSA-N 0.000 description 1
 - 125000002618 bicyclic heterocycle group Chemical group 0.000 description 1
 - VHLKTXFWDRXILV-UHFFFAOYSA-N bifenazate Chemical compound C1=C(NNC(=O)OC(C)C)C(OC)=CC=C1C1=CC=CC=C1 VHLKTXFWDRXILV-UHFFFAOYSA-N 0.000 description 1
 - OMFRMAHOUUJSGP-IRHGGOMRSA-N bifenthrin Chemical compound C1=CC=C(C=2C=CC=CC=2)C(C)=C1COC(=O)[C@@H]1[C@H](\C=C(/Cl)C(F)(F)F)C1(C)C OMFRMAHOUUJSGP-IRHGGOMRSA-N 0.000 description 1
 - 239000003124 biologic agent Substances 0.000 description 1
 - 230000031018 biological processes and functions Effects 0.000 description 1
 - 230000000853 biopesticidal effect Effects 0.000 description 1
 - LDLMOOXUCMHBMZ-UHFFFAOYSA-N bixafen Chemical compound FC(F)C1=NN(C)C=C1C(=O)NC1=CC=C(F)C=C1C1=CC=C(Cl)C(Cl)=C1 LDLMOOXUCMHBMZ-UHFFFAOYSA-N 0.000 description 1
 - CXNPLSGKWMLZPZ-UHFFFAOYSA-N blasticidin-S Natural products O1C(C(O)=O)C(NC(=O)CC(N)CCN(C)C(N)=N)C=CC1N1C(=O)N=C(N)C=C1 CXNPLSGKWMLZPZ-UHFFFAOYSA-N 0.000 description 1
 - 229920001400 block copolymer Polymers 0.000 description 1
 - 238000006664 bond formation reaction Methods 0.000 description 1
 - ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
 - 239000006172 buffering agent Substances 0.000 description 1
 - 244000309464 bull Species 0.000 description 1
 - PRLVTUNWOQKEAI-VKAVYKQESA-N buprofezin Chemical compound O=C1N(C(C)C)\C(=N\C(C)(C)C)SCN1C1=CC=CC=C1 PRLVTUNWOQKEAI-VKAVYKQESA-N 0.000 description 1
 - 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
 - 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
 - 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
 - 239000006227 byproduct Substances 0.000 description 1
 - 239000011575 calcium Substances 0.000 description 1
 - 229910052791 calcium Inorganic materials 0.000 description 1
 - 229910000019 calcium carbonate Inorganic materials 0.000 description 1
 - 235000010216 calcium carbonate Nutrition 0.000 description 1
 - 239000002775 capsule Substances 0.000 description 1
 - 235000013877 carbamide Nutrition 0.000 description 1
 - DUEPRVBVGDRKAG-UHFFFAOYSA-N carbofuran Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 DUEPRVBVGDRKAG-UHFFFAOYSA-N 0.000 description 1
 - 150000001720 carbohydrates Chemical class 0.000 description 1
 - QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
 - 150000001728 carbonyl compounds Chemical class 0.000 description 1
 - 150000001735 carboxylic acids Chemical class 0.000 description 1
 - IRUJZVNXZWPBMU-UHFFFAOYSA-N cartap Chemical compound NC(=O)SCC(N(C)C)CSC(N)=O IRUJZVNXZWPBMU-UHFFFAOYSA-N 0.000 description 1
 - 239000004359 castor oil Substances 0.000 description 1
 - 235000019438 castor oil Nutrition 0.000 description 1
 - 230000003197 catalytic effect Effects 0.000 description 1
 - 125000002091 cationic group Chemical group 0.000 description 1
 - 230000005754 cellular signaling Effects 0.000 description 1
 - 239000001913 cellulose Substances 0.000 description 1
 - 229920002678 cellulose Polymers 0.000 description 1
 - 235000010980 cellulose Nutrition 0.000 description 1
 - 229960000541 cetyl alcohol Drugs 0.000 description 1
 - 150000001793 charged compounds Chemical class 0.000 description 1
 - 238000003889 chemical engineering Methods 0.000 description 1
 - PSOVNZZNOMJUBI-UHFFFAOYSA-N chlorantraniliprole Chemical compound CNC(=O)C1=CC(Cl)=CC(C)=C1NC(=O)C1=CC(Br)=NN1C1=NC=CC=C1Cl PSOVNZZNOMJUBI-UHFFFAOYSA-N 0.000 description 1
 - CWFOCCVIPCEQCK-UHFFFAOYSA-N chlorfenapyr Chemical compound BrC1=C(C(F)(F)F)N(COCC)C(C=2C=CC(Cl)=CC=2)=C1C#N CWFOCCVIPCEQCK-UHFFFAOYSA-N 0.000 description 1
 - UISUNVFOGSJSKD-UHFFFAOYSA-N chlorfluazuron Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=C1Cl)=CC(Cl)=C1OC1=NC=C(C(F)(F)F)C=C1Cl UISUNVFOGSJSKD-UHFFFAOYSA-N 0.000 description 1
 - 125000001309 chloro group Chemical group Cl* 0.000 description 1
 - BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
 - SBPBAQFWLVIOKP-UHFFFAOYSA-N chlorpyrifos Chemical compound CCOP(=S)(OCC)OC1=NC(Cl)=C(Cl)C=C1Cl SBPBAQFWLVIOKP-UHFFFAOYSA-N 0.000 description 1
 - HPNSNYBUADCFDR-UHFFFAOYSA-N chromafenozide Chemical compound CC1=CC(C)=CC(C(=O)N(NC(=O)C=2C(=C3CCCOC3=CC=2)C)C(C)(C)C)=C1 HPNSNYBUADCFDR-UHFFFAOYSA-N 0.000 description 1
 - KMPWYEUPVWOPIM-UHFFFAOYSA-N cinchonidine Natural products C1=CC=C2C(C(C3N4CCC(C(C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-UHFFFAOYSA-N 0.000 description 1
 - KMPWYEUPVWOPIM-LSOMNZGLSA-N cinchonine Chemical compound C1=CC=C2C([C@@H]([C@H]3N4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-LSOMNZGLSA-N 0.000 description 1
 - LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
 - 239000011248 coating agent Substances 0.000 description 1
 - 238000000576 coating method Methods 0.000 description 1
 - 235000012716 cod liver oil Nutrition 0.000 description 1
 - 239000003026 cod liver oil Substances 0.000 description 1
 - 238000004891 communication Methods 0.000 description 1
 - 229940126209 compound 43b Drugs 0.000 description 1
 - 239000012141 concentrate Substances 0.000 description 1
 - 239000000470 constituent Substances 0.000 description 1
 - 238000007796 conventional method Methods 0.000 description 1
 - 230000010485 coping Effects 0.000 description 1
 - 239000006184 cosolvent Substances 0.000 description 1
 - 235000012343 cottonseed oil Nutrition 0.000 description 1
 - 238000012272 crop production Methods 0.000 description 1
 - 238000006880 cross-coupling reaction Methods 0.000 description 1
 - OUYYNZDOJHSQBW-UHFFFAOYSA-N cyanomethanimidamide Chemical compound NC(=N)C#N OUYYNZDOJHSQBW-UHFFFAOYSA-N 0.000 description 1
 - DVBUIBGJRQBEDP-UHFFFAOYSA-N cyantraniliprole Chemical compound CNC(=O)C1=CC(C#N)=CC(C)=C1NC(=O)C1=CC(Br)=NN1C1=NC=CC=C1Cl DVBUIBGJRQBEDP-UHFFFAOYSA-N 0.000 description 1
 - 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
 - HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
 - 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
 - 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
 - 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 1
 - 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
 - 125000006638 cyclopentyl carbonyl group Chemical group 0.000 description 1
 - 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
 - 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
 - 125000006317 cyclopropyl amino group Chemical group 0.000 description 1
 - 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 description 1
 - 125000006450 cyclopropyl cyclopropyl group Chemical group 0.000 description 1
 - 125000004859 cyclopropyloxymethyl group Chemical group C1(CC1)OC* 0.000 description 1
 - 229960001591 cyfluthrin Drugs 0.000 description 1
 - QQODLKZGRKWIFG-QSFXBCCZSA-N cyfluthrin Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@H]1C(=O)O[C@@H](C#N)C1=CC=C(F)C(OC=2C=CC=CC=2)=C1 QQODLKZGRKWIFG-QSFXBCCZSA-N 0.000 description 1
 - ZXQYGBMAQZUVMI-UNOMPAQXSA-N cyhalothrin Chemical compound CC1(C)C(\C=C(/Cl)C(F)(F)F)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 ZXQYGBMAQZUVMI-UNOMPAQXSA-N 0.000 description 1
 - 229960005424 cypermethrin Drugs 0.000 description 1
 - KAATUXNTWXVJKI-UHFFFAOYSA-N cypermethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 KAATUXNTWXVJKI-UHFFFAOYSA-N 0.000 description 1
 - LVQDKIWDGQRHTE-UHFFFAOYSA-N cyromazine Chemical compound NC1=NC(N)=NC(NC2CC2)=N1 LVQDKIWDGQRHTE-UHFFFAOYSA-N 0.000 description 1
 - 229950000775 cyromazine Drugs 0.000 description 1
 - 229960002483 decamethrin Drugs 0.000 description 1
 - 230000008260 defense mechanism Effects 0.000 description 1
 - 230000000593 degrading effect Effects 0.000 description 1
 - 238000006356 dehydrogenation reaction Methods 0.000 description 1
 - OWZREIFADZCYQD-NSHGMRRFSA-N deltamethrin Chemical compound CC1(C)[C@@H](C=C(Br)Br)[C@H]1C(=O)O[C@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 OWZREIFADZCYQD-NSHGMRRFSA-N 0.000 description 1
 - 239000003599 detergent Substances 0.000 description 1
 - 235000019425 dextrin Nutrition 0.000 description 1
 - WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 1
 - 125000005202 dialkylaminocarbonyloxy group Chemical group 0.000 description 1
 - GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
 - 150000004985 diamines Chemical class 0.000 description 1
 - HTFFABIIOAKIBH-UHFFFAOYSA-N diazinane Chemical group C1CCNNC1 HTFFABIIOAKIBH-UHFFFAOYSA-N 0.000 description 1
 - FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
 - 238000006193 diazotization reaction Methods 0.000 description 1
 - FJBFPHVGVWTDIP-UHFFFAOYSA-N dibromomethane Chemical group BrCBr FJBFPHVGVWTDIP-UHFFFAOYSA-N 0.000 description 1
 - PFBUKDPBVNJDEW-UHFFFAOYSA-N dichlorocarbene Chemical group Cl[C]Cl PFBUKDPBVNJDEW-UHFFFAOYSA-N 0.000 description 1
 - 150000001993 dienes Chemical class 0.000 description 1
 - ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
 - JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
 - CDRRZHFFGHHNAA-UHFFFAOYSA-N diethyl 4-carbamothioyldiazinane-1,2-dicarboxylate Chemical compound CCOC(=O)N1CCC(C(N)=S)CN1C(=O)OCC CDRRZHFFGHHNAA-UHFFFAOYSA-N 0.000 description 1
 - LBYLEXHHYKPXAZ-UHFFFAOYSA-N diethyl 4-cyanodiazinane-1,2-dicarboxylate Chemical compound CCOC(=O)N1CCC(C#N)CN1C(=O)OCC LBYLEXHHYKPXAZ-UHFFFAOYSA-N 0.000 description 1
 - HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
 - 229940019503 diflubenzuron Drugs 0.000 description 1
 - 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 description 1
 - 125000004212 difluorophenyl group Chemical group 0.000 description 1
 - WFJNHVWTKZUUTR-UHFFFAOYSA-N dihydrocinchonidine Natural products C1=CC=C2C(C(O)C3CC4CCN3CC4CC)=CC=NC2=C1 WFJNHVWTKZUUTR-UHFFFAOYSA-N 0.000 description 1
 - QBSJHOGDIUQWTH-UHFFFAOYSA-N dihydrolanosterol Natural products CC(C)CCCC(C)C1CCC2(C)C3=C(CCC12C)C4(C)CCC(C)(O)C(C)(C)C4CC3 QBSJHOGDIUQWTH-UHFFFAOYSA-N 0.000 description 1
 - 238000010790 dilution Methods 0.000 description 1
 - 239000012895 dilution Substances 0.000 description 1
 - MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
 - FFHWGQQFANVOHV-UHFFFAOYSA-N dimethyldioxirane Chemical compound CC1(C)OO1 FFHWGQQFANVOHV-UHFFFAOYSA-N 0.000 description 1
 - ATUOYWHBWRKTHZ-UHFFFAOYSA-N dimethylmethane Natural products CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 1
 - YKBZOVFACRVRJN-UHFFFAOYSA-N dinotefuran Chemical compound [O-][N+](=O)\N=C(/NC)NCC1CCOC1 YKBZOVFACRVRJN-UHFFFAOYSA-N 0.000 description 1
 - 150000004844 dioxiranes Chemical class 0.000 description 1
 - SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
 - 239000004491 dispersible concentrate Substances 0.000 description 1
 - 239000002270 dispersing agent Substances 0.000 description 1
 - 238000004090 dissolution Methods 0.000 description 1
 - 238000004821 distillation Methods 0.000 description 1
 - PYZSVQVRHDXQSL-UHFFFAOYSA-N dithianon Chemical compound S1C(C#N)=C(C#N)SC2=C1C(=O)C1=CC=CC=C1C2=O PYZSVQVRHDXQSL-UHFFFAOYSA-N 0.000 description 1
 - 150000004659 dithiocarbamates Chemical class 0.000 description 1
 - LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
 - 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
 - 238000009837 dry grinding Methods 0.000 description 1
 - GCKZANITAMOIAR-XWVCPFKXSA-N dsstox_cid_14566 Chemical compound [O-]C(=O)C1=CC=CC=C1.C1=C[C@H](C)[C@@H]([C@@H](C)CC)O[C@]11O[C@H](C\C=C(C)\[C@@H](O[C@@H]2O[C@@H](C)[C@H](O[C@@H]3O[C@@H](C)[C@H]([NH2+]C)[C@@H](OC)C3)[C@@H](OC)C2)[C@@H](C)\C=C\C=C/2[C@]3([C@H](C(=O)O4)C=C(C)[C@@H](O)[C@H]3OC\2)O)C[C@H]4C1 GCKZANITAMOIAR-XWVCPFKXSA-N 0.000 description 1
 - 239000000428 dust Substances 0.000 description 1
 - XJLZCPIILZRCPS-ANMPWZFDSA-N eburicol Chemical compound C([C@@]12C)C[C@H](O)C(C)(C)[C@@H]1CCC1=C2CC[C@]2(C)[C@@H]([C@H](C)CCC(=C)C(C)C)CC[C@]21C XJLZCPIILZRCPS-ANMPWZFDSA-N 0.000 description 1
 - 229960003913 econazole Drugs 0.000 description 1
 - AWZOLILCOUMRDG-UHFFFAOYSA-N edifenphos Chemical compound C=1C=CC=CC=1SP(=O)(OCC)SC1=CC=CC=C1 AWZOLILCOUMRDG-UHFFFAOYSA-N 0.000 description 1
 - 238000007350 electrophilic reaction Methods 0.000 description 1
 - 230000008030 elimination Effects 0.000 description 1
 - 238000003379 elimination reaction Methods 0.000 description 1
 - 238000010828 elution Methods 0.000 description 1
 - 238000005538 encapsulation Methods 0.000 description 1
 - RDYMFSUJUZBWLH-SVWSLYAFSA-N endosulfan Chemical compound C([C@@H]12)OS(=O)OC[C@@H]1[C@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl RDYMFSUJUZBWLH-SVWSLYAFSA-N 0.000 description 1
 - NYPJDWWKZLNGGM-RPWUZVMVSA-N esfenvalerate Chemical compound C=1C([C@@H](C#N)OC(=O)[C@@H](C(C)C)C=2C=CC(Cl)=CC=2)=CC=CC=1OC1=CC=CC=C1 NYPJDWWKZLNGGM-RPWUZVMVSA-N 0.000 description 1
 - 238000010931 ester hydrolysis Methods 0.000 description 1
 - DWRKFAJEBUWTQM-UHFFFAOYSA-N etaconazole Chemical compound O1C(CC)COC1(C=1C(=CC(Cl)=CC=1)Cl)CN1N=CN=C1 DWRKFAJEBUWTQM-UHFFFAOYSA-N 0.000 description 1
 - 150000002170 ethers Chemical class 0.000 description 1
 - UXOLDCOJRAMLTQ-UTCJRWHESA-N ethyl (2z)-2-chloro-2-hydroxyiminoacetate Chemical group CCOC(=O)C(\Cl)=N\O UXOLDCOJRAMLTQ-UTCJRWHESA-N 0.000 description 1
 - GUMAKXNSWBTURZ-UHFFFAOYSA-N ethyl 5-cyanooxazinane-2-carboxylate Chemical compound CCOC(=O)N1CCC(C#N)CO1 GUMAKXNSWBTURZ-UHFFFAOYSA-N 0.000 description 1
 - 239000002024 ethyl acetate extract Substances 0.000 description 1
 - RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
 - 125000006437 ethyl cyclopropyl group Chemical group 0.000 description 1
 - VGEWEGHHYWGXGG-UHFFFAOYSA-N ethyl n-hydroxycarbamate Chemical compound CCOC(=O)NO VGEWEGHHYWGXGG-UHFFFAOYSA-N 0.000 description 1
 - 238000000605 extraction Methods 0.000 description 1
 - 239000003925 fat Substances 0.000 description 1
 - 230000004136 fatty acid synthesis Effects 0.000 description 1
 - 150000002194 fatty esters Chemical class 0.000 description 1
 - LMVPQMGRYSRMIW-KRWDZBQOSA-N fenamidone Chemical compound O=C([C@@](C)(N=C1SC)C=2C=CC=CC=2)N1NC1=CC=CC=C1 LMVPQMGRYSRMIW-KRWDZBQOSA-N 0.000 description 1
 - UTOHZQYBSYOOGC-UHFFFAOYSA-N fenpyrazamine Chemical compound O=C1N(C(C)C)N(C(=O)SCC=C)C(N)=C1C1=CC=CC=C1C UTOHZQYBSYOOGC-UHFFFAOYSA-N 0.000 description 1
 - WDQNIWFZKXZFAY-UHFFFAOYSA-M fentin acetate Chemical compound CC([O-])=O.C1=CC=CC=C1[Sn+](C=1C=CC=CC=1)C1=CC=CC=C1 WDQNIWFZKXZFAY-UHFFFAOYSA-M 0.000 description 1
 - NJVOZLGKTAPUTQ-UHFFFAOYSA-M fentin chloride Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 NJVOZLGKTAPUTQ-UHFFFAOYSA-M 0.000 description 1
 - BFWMWWXRWVJXSE-UHFFFAOYSA-M fentin hydroxide Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(O)C1=CC=CC=C1 BFWMWWXRWVJXSE-UHFFFAOYSA-M 0.000 description 1
 - 229940013764 fipronil Drugs 0.000 description 1
 - 235000021323 fish oil Nutrition 0.000 description 1
 - 235000004426 flaxseed Nutrition 0.000 description 1
 - RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 description 1
 - 230000009969 flowable effect Effects 0.000 description 1
 - ZGNITFSDLCMLGI-UHFFFAOYSA-N flubendiamide Chemical compound CC1=CC(C(F)(C(F)(F)F)C(F)(F)F)=CC=C1NC(=O)C1=CC=CC(I)=C1C(=O)NC(C)(C)CS(C)(=O)=O ZGNITFSDLCMLGI-UHFFFAOYSA-N 0.000 description 1
 - MUJOIMFVNIBMKC-UHFFFAOYSA-N fludioxonil Chemical compound C=12OC(F)(F)OC2=CC=CC=1C1=CNC=C1C#N MUJOIMFVNIBMKC-UHFFFAOYSA-N 0.000 description 1
 - GJEREQYJIQASAW-UHFFFAOYSA-N flufenerim Chemical compound CC(F)C1=NC=NC(NCCC=2C=CC(OC(F)(F)F)=CC=2)=C1Cl GJEREQYJIQASAW-UHFFFAOYSA-N 0.000 description 1
 - RYLHNOVXKPXDIP-UHFFFAOYSA-N flufenoxuron Chemical compound C=1C=C(NC(=O)NC(=O)C=2C(=CC=CC=2F)F)C(F)=CC=1OC1=CC=C(C(F)(F)F)C=C1Cl RYLHNOVXKPXDIP-UHFFFAOYSA-N 0.000 description 1
 - GBOYJIHYACSLGN-UHFFFAOYSA-N fluopicolide Chemical compound ClC1=CC(C(F)(F)F)=CN=C1CNC(=O)C1=C(Cl)C=CC=C1Cl GBOYJIHYACSLGN-UHFFFAOYSA-N 0.000 description 1
 - KVDJTXBXMWJJEF-UHFFFAOYSA-N fluopyram Chemical compound ClC1=CC(C(F)(F)F)=CN=C1CCNC(=O)C1=CC=CC=C1C(F)(F)F KVDJTXBXMWJJEF-UHFFFAOYSA-N 0.000 description 1
 - 239000011737 fluorine Substances 0.000 description 1
 - PTCGDEVVHUXTMP-UHFFFAOYSA-N flutolanil Chemical compound CC(C)OC1=CC=CC(NC(=O)C=2C(=CC=CC=2)C(F)(F)F)=C1 PTCGDEVVHUXTMP-UHFFFAOYSA-N 0.000 description 1
 - 238000005187 foaming Methods 0.000 description 1
 - 238000001640 fractional crystallisation Methods 0.000 description 1
 - 239000012634 fragment Substances 0.000 description 1
 - 230000008014 freezing Effects 0.000 description 1
 - 238000007710 freezing Methods 0.000 description 1
 - UYJUZNLFJAWNEZ-UHFFFAOYSA-N fuberidazole Chemical compound C1=COC(C=2NC3=CC=CC=C3N=2)=C1 UYJUZNLFJAWNEZ-UHFFFAOYSA-N 0.000 description 1
 - 239000001530 fumaric acid Substances 0.000 description 1
 - TVFIYRKPCACCNL-UHFFFAOYSA-N furan-2-carboxamide Chemical compound NC(=O)C1=CC=CO1 TVFIYRKPCACCNL-UHFFFAOYSA-N 0.000 description 1
 - 239000000499 gel Substances 0.000 description 1
 - 230000035784 germination Effects 0.000 description 1
 - 235000011187 glycerol Nutrition 0.000 description 1
 - ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
 - 235000013773 glyceryl triacetate Nutrition 0.000 description 1
 - 150000004795 grignard reagents Chemical class 0.000 description 1
 - 239000003630 growth substance Substances 0.000 description 1
 - 239000010440 gypsum Substances 0.000 description 1
 - 229910052602 gypsum Inorganic materials 0.000 description 1
 - 125000006485 halo alkoxy phenyl group Chemical group 0.000 description 1
 - 125000005221 halo alkyl carbonyl amino group Chemical group 0.000 description 1
 - 150000008282 halocarbons Chemical class 0.000 description 1
 - CNKHSLKYRMDDNQ-UHFFFAOYSA-N halofenozide Chemical compound C=1C=CC=CC=1C(=O)N(C(C)(C)C)NC(=O)C1=CC=C(Cl)C=C1 CNKHSLKYRMDDNQ-UHFFFAOYSA-N 0.000 description 1
 - 230000026030 halogenation Effects 0.000 description 1
 - 238000005658 halogenation reaction Methods 0.000 description 1
 - 238000010438 heat treatment Methods 0.000 description 1
 - JPXGPRBLTIYFQG-UHFFFAOYSA-N heptan-4-yl acetate Chemical compound CCCC(CCC)OC(C)=O JPXGPRBLTIYFQG-UHFFFAOYSA-N 0.000 description 1
 - 230000002363 herbicidal effect Effects 0.000 description 1
 - RGNPBRKPHBKNKX-UHFFFAOYSA-N hexaflumuron Chemical compound C1=C(Cl)C(OC(F)(F)C(F)F)=C(Cl)C=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F RGNPBRKPHBKNKX-UHFFFAOYSA-N 0.000 description 1
 - 125000006038 hexenyl group Chemical group 0.000 description 1
 - 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
 - 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
 - 125000005980 hexynyl group Chemical group 0.000 description 1
 - 238000004128 high performance liquid chromatography Methods 0.000 description 1
 - 150000002429 hydrazines Chemical class 0.000 description 1
 - 150000007857 hydrazones Chemical class 0.000 description 1
 - 150000004678 hydrides Chemical class 0.000 description 1
 - 150000003840 hydrochlorides Chemical class 0.000 description 1
 - XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
 - WTDHULULXKLSOZ-UHFFFAOYSA-N hydroxylamine hydrochloride Substances Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 1
 - 229940056881 imidacloprid Drugs 0.000 description 1
 - YWTYJOPNNQFBPC-UHFFFAOYSA-N imidacloprid Chemical compound [O-][N+](=O)\N=C1/NCCN1CC1=CC=C(Cl)N=C1 YWTYJOPNNQFBPC-UHFFFAOYSA-N 0.000 description 1
 - 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 1
 - 239000012535 impurity Substances 0.000 description 1
 - VBCVPMMZEGZULK-NRFANRHFSA-N indoxacarb Chemical compound C([C@@]1(OC2)C(=O)OC)C3=CC(Cl)=CC=C3C1=NN2C(=O)N(C(=O)OC)C1=CC=C(OC(F)(F)F)C=C1 VBCVPMMZEGZULK-NRFANRHFSA-N 0.000 description 1
 - 238000001802 infusion Methods 0.000 description 1
 - 150000002484 inorganic compounds Chemical class 0.000 description 1
 - 229910010272 inorganic material Inorganic materials 0.000 description 1
 - 230000002452 interceptive effect Effects 0.000 description 1
 - 239000011630 iodine Substances 0.000 description 1
 - 150000002500 ions Chemical class 0.000 description 1
 - JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
 - WPOOICLZIIBUBM-UHFFFAOYSA-H iron;iron(3+);methyl-dioxido-oxo-$l^{5}-arsane Chemical compound [Fe].[Fe+3].[Fe+3].C[As]([O-])([O-])=O.C[As]([O-])([O-])=O.C[As]([O-])([O-])=O WPOOICLZIIBUBM-UHFFFAOYSA-H 0.000 description 1
 - 230000002262 irrigation Effects 0.000 description 1
 - 238000003973 irrigation Methods 0.000 description 1
 - 239000003621 irrigation water Substances 0.000 description 1
 - 229940117955 isoamyl acetate Drugs 0.000 description 1
 - 229940035429 isobutyl alcohol Drugs 0.000 description 1
 - 239000012948 isocyanate Substances 0.000 description 1
 - 150000002513 isocyanates Chemical class 0.000 description 1
 - HOQADATXFBOEGG-UHFFFAOYSA-N isofenphos Chemical compound CCOP(=S)(NC(C)C)OC1=CC=CC=C1C(=O)OC(C)C HOQADATXFBOEGG-UHFFFAOYSA-N 0.000 description 1
 - 238000002955 isolation Methods 0.000 description 1
 - UFHLMYOGRXOCSL-UHFFFAOYSA-N isoprothiolane Chemical compound CC(C)OC(=O)C(C(=O)OC(C)C)=C1SCCS1 UFHLMYOGRXOCSL-UHFFFAOYSA-N 0.000 description 1
 - 150000002540 isothiocyanates Chemical class 0.000 description 1
 - NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
 - PVTHJAPFENJVNC-MHRBZPPQSA-N kasugamycin Chemical group N[C@H]1C[C@H](NC(=N)C(O)=O)[C@@H](C)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O PVTHJAPFENJVNC-MHRBZPPQSA-N 0.000 description 1
 - 239000004310 lactic acid Substances 0.000 description 1
 - 235000014655 lactic acid Nutrition 0.000 description 1
 - 150000003903 lactic acid esters Chemical class 0.000 description 1
 - 239000008101 lactose Substances 0.000 description 1
 - 239000005910 lambda-Cyhalothrin Substances 0.000 description 1
 - 229940039717 lanolin Drugs 0.000 description 1
 - 235000019388 lanolin Nutrition 0.000 description 1
 - CAHGCLMLTWQZNJ-RGEKOYMOSA-N lanosterol Chemical compound C([C@]12C)C[C@@H](O)C(C)(C)[C@H]1CCC1=C2CC[C@]2(C)[C@H]([C@H](CCC=C(C)C)C)CC[C@@]21C CAHGCLMLTWQZNJ-RGEKOYMOSA-N 0.000 description 1
 - 229940058690 lanosterol Drugs 0.000 description 1
 - 231100001231 less toxic Toxicity 0.000 description 1
 - 229940087305 limonene Drugs 0.000 description 1
 - 235000001510 limonene Nutrition 0.000 description 1
 - 150000002632 lipids Chemical class 0.000 description 1
 - 239000007791 liquid phase Substances 0.000 description 1
 - 229910052744 lithium Inorganic materials 0.000 description 1
 - 229960000521 lufenuron Drugs 0.000 description 1
 - PWPJGUXAGUPAHP-UHFFFAOYSA-N lufenuron Chemical compound C1=C(Cl)C(OC(F)(F)C(C(F)(F)F)F)=CC(Cl)=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F PWPJGUXAGUPAHP-UHFFFAOYSA-N 0.000 description 1
 - 239000011777 magnesium Substances 0.000 description 1
 - 229910052749 magnesium Inorganic materials 0.000 description 1
 - NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
 - 229960000453 malathion Drugs 0.000 description 1
 - MAGPZHKLEZXLNU-UHFFFAOYSA-N mandelamide Chemical compound NC(=O)C(O)C1=CC=CC=C1 MAGPZHKLEZXLNU-UHFFFAOYSA-N 0.000 description 1
 - 229960002510 mandelic acid Drugs 0.000 description 1
 - 238000004949 mass spectrometry Methods 0.000 description 1
 - 239000008204 material by function Substances 0.000 description 1
 - 230000010534 mechanism of action Effects 0.000 description 1
 - 239000000155 melt Substances 0.000 description 1
 - CIFWZNRJIBNXRE-UHFFFAOYSA-N mepanipyrim Chemical compound CC#CC1=CC(C)=NC(NC=2C=CC=CC=2)=N1 CIFWZNRJIBNXRE-UHFFFAOYSA-N 0.000 description 1
 - 238000003328 mesylation reaction Methods 0.000 description 1
 - NNKVPIKMPCQWCG-UHFFFAOYSA-N methamidophos Chemical compound COP(N)(=O)SC NNKVPIKMPCQWCG-UHFFFAOYSA-N 0.000 description 1
 - VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
 - MEBQXILRKZHVCX-UHFFFAOYSA-N methidathion Chemical compound COC1=NN(CSP(=S)(OC)OC)C(=O)S1 MEBQXILRKZHVCX-UHFFFAOYSA-N 0.000 description 1
 - 229930182817 methionine Natural products 0.000 description 1
 - 229950003442 methoprene Drugs 0.000 description 1
 - 229930002897 methoprene Natural products 0.000 description 1
 - QCAWEPFNJXQPAN-UHFFFAOYSA-N methoxyfenozide Chemical compound COC1=CC=CC(C(=O)NN(C(=O)C=2C=C(C)C=C(C)C=2)C(C)(C)C)=C1C QCAWEPFNJXQPAN-UHFFFAOYSA-N 0.000 description 1
 - URXNNPCNKVAQRA-RGEXLXHISA-N methyl (Z)-2-[2-[[5-(4-chlorophenyl)-2-methylpyrazol-3-yl]oxymethyl]phenyl]-3-methoxyprop-2-enoate Chemical compound CO\C=C(/C(=O)OC)c1ccccc1COc1cc(nn1C)-c1ccc(Cl)cc1 URXNNPCNKVAQRA-RGEXLXHISA-N 0.000 description 1
 - KBHDSWIXRODKSZ-UHFFFAOYSA-N methyl 5-chloro-2-(trifluoromethylsulfonylamino)benzoate Chemical compound COC(=O)C1=CC(Cl)=CC=C1NS(=O)(=O)C(F)(F)F KBHDSWIXRODKSZ-UHFFFAOYSA-N 0.000 description 1
 - 150000004702 methyl esters Chemical class 0.000 description 1
 - NOHQWVGQVFRXLV-UHFFFAOYSA-N methyl n-[2-[[5-(4-chlorophenyl)-2-methylpyrazol-3-yl]oxymethyl]phenyl]-n-methoxycarbamate Chemical compound COC(=O)N(OC)C1=CC=CC=C1COC1=CC(C=2C=CC(Cl)=CC=2)=NN1C NOHQWVGQVFRXLV-UHFFFAOYSA-N 0.000 description 1
 - MTIIEXDARCCRDH-UHFFFAOYSA-N methyl n-hydroxycarbamate Chemical compound COC(=O)NO MTIIEXDARCCRDH-UHFFFAOYSA-N 0.000 description 1
 - 229960001952 metrifonate Drugs 0.000 description 1
 - 239000010445 mica Substances 0.000 description 1
 - 229910052618 mica group Inorganic materials 0.000 description 1
 - 229960002509 miconazole Drugs 0.000 description 1
 - 244000005700 microbiome Species 0.000 description 1
 - CKVMAPHTVCTEMM-ALPQRHTBSA-N milbemycin oxime Chemical compound O1[C@H](C)[C@@H](C)CC[C@@]11O[C@H](C\C=C(C)\C[C@@H](C)\C=C\C=C/2[C@]3([C@H](C(=O)O4)C=C(C)C(=N/O)/[C@H]3OC\2)O)C[C@H]4C1.C1C[C@H](C)[C@@H](CC)O[C@@]21O[C@H](C\C=C(C)\C[C@@H](C)\C=C\C=C/1[C@]3([C@H](C(=O)O4)C=C(C)C(=N/O)/[C@H]3OC\1)O)C[C@H]4C2 CKVMAPHTVCTEMM-ALPQRHTBSA-N 0.000 description 1
 - 229940099245 milbemycin oxime Drugs 0.000 description 1
 - 239000002480 mineral oil Substances 0.000 description 1
 - 235000010446 mineral oil Nutrition 0.000 description 1
 - 150000007522 mineralic acids Chemical class 0.000 description 1
 - 230000002438 mitochondrial effect Effects 0.000 description 1
 - 230000004898 mitochondrial function Effects 0.000 description 1
 - 230000000394 mitotic effect Effects 0.000 description 1
 - 229910052901 montmorillonite Inorganic materials 0.000 description 1
 - 238000003541 multi-stage reaction Methods 0.000 description 1
 - 230000003551 muscarinic effect Effects 0.000 description 1
 - PBMIETCUUSQZCG-UHFFFAOYSA-N n'-cyclohexylmethanediimine Chemical compound N=C=NC1CCCCC1 PBMIETCUUSQZCG-UHFFFAOYSA-N 0.000 description 1
 - TVMXDCGIABBOFY-UHFFFAOYSA-N n-Octanol Natural products CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
 - SKEAGJWUKCNICJ-LSDHHAIUSA-N n-[(4-fluoro-3-methoxyphenyl)methyl]-6-[2-[[(2s,5r)-5-(hydroxymethyl)-1,4-dioxan-2-yl]methyl]tetrazol-5-yl]-2-methylpyrimidine-4-carboxamide Chemical compound C1=C(F)C(OC)=CC(CNC(=O)C=2N=C(C)N=C(C=2)C2=NN(C[C@@H]3OC[C@@H](CO)OC3)N=N2)=C1 SKEAGJWUKCNICJ-LSDHHAIUSA-N 0.000 description 1
 - HQUIFHINFGFWLJ-UHFFFAOYSA-N n-[(cyclopropylmethoxyamino)-[6-(difluoromethoxy)-2,3-difluorophenyl]methylidene]-2-phenylacetamide Chemical compound FC(F)OC1=CC=C(F)C(F)=C1C(NOCC1CC1)=NC(=O)CC1=CC=CC=C1 HQUIFHINFGFWLJ-UHFFFAOYSA-N 0.000 description 1
 - BOBIZDGUDNVINH-UHFFFAOYSA-N n-[2-[4-[3-(4-chlorophenyl)prop-2-ynoxy]-3-methoxyphenyl]ethyl]-2-(methanesulfonamido)-3-methylbutanamide Chemical compound COC1=CC(CCNC(=O)C(NS(C)(=O)=O)C(C)C)=CC=C1OCC#CC1=CC=C(Cl)C=C1 BOBIZDGUDNVINH-UHFFFAOYSA-N 0.000 description 1
 - AHAXISXGFCFQGE-UHFFFAOYSA-N n-oxoformamide Chemical compound O=CN=O AHAXISXGFCFQGE-UHFFFAOYSA-N 0.000 description 1
 - 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
 - 229950006238 nadide Drugs 0.000 description 1
 - PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
 - CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical group C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
 - RJMUSRYZPJIFPJ-UHFFFAOYSA-N niclosamide Chemical compound OC1=CC=C(Cl)C=C1C(=O)NC1=CC=C([N+]([O-])=O)C=C1Cl RJMUSRYZPJIFPJ-UHFFFAOYSA-N 0.000 description 1
 - 229960002715 nicotine Drugs 0.000 description 1
 - SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 1
 - 229940079888 nitenpyram Drugs 0.000 description 1
 - 229910017604 nitric acid Inorganic materials 0.000 description 1
 - ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical class O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 1
 - 125000006574 non-aromatic ring group Chemical group 0.000 description 1
 - 229920000847 nonoxynol Polymers 0.000 description 1
 - YTYGAJLZOJPJGH-UHFFFAOYSA-N noviflumuron Chemical compound FC1=C(Cl)C(OC(F)(F)C(C(F)(F)F)F)=C(Cl)C=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F YTYGAJLZOJPJGH-UHFFFAOYSA-N 0.000 description 1
 - 238000001668 nucleic acid synthesis Methods 0.000 description 1
 - 230000000269 nucleophilic effect Effects 0.000 description 1
 - 235000015097 nutrients Nutrition 0.000 description 1
 - 229920002113 octoxynol Polymers 0.000 description 1
 - 229940055577 oleyl alcohol Drugs 0.000 description 1
 - XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
 - 239000010502 orange oil Substances 0.000 description 1
 - 210000000056 organ Anatomy 0.000 description 1
 - 150000007524 organic acids Chemical class 0.000 description 1
 - 235000005985 organic acids Nutrition 0.000 description 1
 - 150000007530 organic bases Chemical class 0.000 description 1
 - 238000006053 organic reaction Methods 0.000 description 1
 - 125000002524 organometallic group Chemical group 0.000 description 1
 - 238000010653 organometallic reaction Methods 0.000 description 1
 - 230000009106 osmotic signaling Effects 0.000 description 1
 - KZAUOCCYDRDERY-UHFFFAOYSA-N oxamyl Chemical compound CNC(=O)ON=C(SC)C(=O)N(C)C KZAUOCCYDRDERY-UHFFFAOYSA-N 0.000 description 1
 - IMTNSEPDLICZMZ-UHFFFAOYSA-N oxathiine-3-carboxamide Chemical compound NC(=O)C1=CC=COS1 IMTNSEPDLICZMZ-UHFFFAOYSA-N 0.000 description 1
 - COWNFYYYZFRNOY-UHFFFAOYSA-N oxazolidinedione Chemical compound O=C1COC(=O)N1 COWNFYYYZFRNOY-UHFFFAOYSA-N 0.000 description 1
 - 150000002924 oxiranes Chemical class 0.000 description 1
 - AMEKQAFGQBKLKX-UHFFFAOYSA-N oxycarboxin Chemical compound O=S1(=O)CCOC(C)=C1C(=O)NC1=CC=CC=C1 AMEKQAFGQBKLKX-UHFFFAOYSA-N 0.000 description 1
 - IWVCMVBTMGNXQD-PXOLEDIWSA-N oxytetracycline Chemical group C1=CC=C2[C@](O)(C)[C@H]3[C@H](O)[C@H]4[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O IWVCMVBTMGNXQD-PXOLEDIWSA-N 0.000 description 1
 - 229960000625 oxytetracycline Drugs 0.000 description 1
 - 235000019366 oxytetracycline Nutrition 0.000 description 1
 - 229910052625 palygorskite Inorganic materials 0.000 description 1
 - FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
 - LCCNCVORNKJIRZ-UHFFFAOYSA-N parathion Chemical compound CCOP(=S)(OCC)OC1=CC=C([N+]([O-])=O)C=C1 LCCNCVORNKJIRZ-UHFFFAOYSA-N 0.000 description 1
 - RLBIQVVOMOPOHC-UHFFFAOYSA-N parathion-methyl Chemical group COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C=C1 RLBIQVVOMOPOHC-UHFFFAOYSA-N 0.000 description 1
 - 235000010603 pastilles Nutrition 0.000 description 1
 - 230000037361 pathway Effects 0.000 description 1
 - 235000020232 peanut Nutrition 0.000 description 1
 - 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
 - 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
 - 125000005981 pentynyl group Chemical group 0.000 description 1
 - 230000035699 permeability Effects 0.000 description 1
 - 238000005502 peroxidation Methods 0.000 description 1
 - 150000004965 peroxy acids Chemical class 0.000 description 1
 - 235000020030 perry Nutrition 0.000 description 1
 - 230000003094 perturbing effect Effects 0.000 description 1
 - 150000002989 phenols Chemical class 0.000 description 1
 - PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical compound OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 1
 - 239000003016 pheromone Substances 0.000 description 1
 - LMNZTLDVJIUSHT-UHFFFAOYSA-N phosmet Chemical compound C1=CC=C2C(=O)N(CSP(=S)(OC)OC)C(=O)C2=C1 LMNZTLDVJIUSHT-UHFFFAOYSA-N 0.000 description 1
 - RGCLLPNLLBQHPF-HJWRWDBZSA-N phosphamidon Chemical compound CCN(CC)C(=O)C(\Cl)=C(/C)OP(=O)(OC)OC RGCLLPNLLBQHPF-HJWRWDBZSA-N 0.000 description 1
 - UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
 - 230000004962 physiological condition Effects 0.000 description 1
 - 239000000049 pigment Substances 0.000 description 1
 - 230000008635 plant growth Effects 0.000 description 1
 - 150000004291 polyenes Chemical class 0.000 description 1
 - 229920001451 polypropylene glycol Polymers 0.000 description 1
 - 229920001282 polysaccharide Polymers 0.000 description 1
 - 239000005017 polysaccharide Substances 0.000 description 1
 - 229920001296 polysiloxane Polymers 0.000 description 1
 - 235000019448 polyvinylpyrrolidone-vinyl acetate copolymer Nutrition 0.000 description 1
 - 239000011591 potassium Substances 0.000 description 1
 - 229910052700 potassium Inorganic materials 0.000 description 1
 - 235000015497 potassium bicarbonate Nutrition 0.000 description 1
 - 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
 - 239000011736 potassium bicarbonate Substances 0.000 description 1
 - TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
 - LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
 - 239000002244 precipitate Substances 0.000 description 1
 - 238000001556 precipitation Methods 0.000 description 1
 - 230000003449 preventive effect Effects 0.000 description 1
 - WHHIPMZEDGBUCC-UHFFFAOYSA-N probenazole Chemical compound C1=CC=C2C(OCC=C)=NS(=O)(=O)C2=C1 WHHIPMZEDGBUCC-UHFFFAOYSA-N 0.000 description 1
 - QYMMJNLHFKGANY-UHFFFAOYSA-N profenofos Chemical compound CCCSP(=O)(OCC)OC1=CC=C(Br)C=C1Cl QYMMJNLHFKGANY-UHFFFAOYSA-N 0.000 description 1
 - WZZLDXDUQPOXNW-UHFFFAOYSA-N propamocarb Chemical compound CCCOC(=O)NCCCN(C)C WZZLDXDUQPOXNW-UHFFFAOYSA-N 0.000 description 1
 - 239000001294 propane Substances 0.000 description 1
 - 235000019260 propionic acid Nutrition 0.000 description 1
 - RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 description 1
 - FLVBXVXXXMLMOX-UHFFFAOYSA-N proquinazid Chemical compound C1=C(I)C=C2C(=O)N(CCC)C(OCCC)=NC2=C1 FLVBXVXXXMLMOX-UHFFFAOYSA-N 0.000 description 1
 - 239000011814 protection agent Substances 0.000 description 1
 - 108060006633 protein kinase Proteins 0.000 description 1
 - 238000001243 protein synthesis Methods 0.000 description 1
 - 230000003161 proteinsynthetic effect Effects 0.000 description 1
 - YRRBXJLFCBCKNW-UHFFFAOYSA-N prothiocarb Chemical compound CCSC(=O)NCCCN(C)C YRRBXJLFCBCKNW-UHFFFAOYSA-N 0.000 description 1
 - 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
 - 239000008213 purified water Substances 0.000 description 1
 - QHMTXANCGGJZRX-WUXMJOGZSA-N pymetrozine Chemical compound C1C(C)=NNC(=O)N1\N=C\C1=CC=CN=C1 QHMTXANCGGJZRX-WUXMJOGZSA-N 0.000 description 1
 - 150000003217 pyrazoles Chemical class 0.000 description 1
 - JOOMJVFZQRQWKR-UHFFFAOYSA-N pyrazophos Chemical compound N1=C(C)C(C(=O)OCC)=CN2N=C(OP(=S)(OCC)OCC)C=C21 JOOMJVFZQRQWKR-UHFFFAOYSA-N 0.000 description 1
 - CRFYLQMIDWBKRT-LPYMAVHISA-N pyribencarb Chemical compound C1=C(Cl)C(CNC(=O)OC)=CC(C(\C)=N\OCC=2N=C(C)C=CC=2)=C1 CRFYLQMIDWBKRT-LPYMAVHISA-N 0.000 description 1
 - VTRWMTJQBQJKQH-UHFFFAOYSA-N pyributicarb Chemical group COC1=CC=CC(N(C)C(=S)OC=2C=C(C=CC=2)C(C)(C)C)=N1 VTRWMTJQBQJKQH-UHFFFAOYSA-N 0.000 description 1
 - MIOBBYRMXGNORL-UHFFFAOYSA-N pyrifluquinazon Chemical compound C1C2=CC(C(F)(C(F)(F)F)C(F)(F)F)=CC=C2N(C(=O)C)C(=O)N1NCC1=CC=CN=C1 MIOBBYRMXGNORL-UHFFFAOYSA-N 0.000 description 1
 - ZLIBICFPKPWGIZ-UHFFFAOYSA-N pyrimethanil Chemical compound CC1=CC(C)=NC(NC=2C=CC=CC=2)=N1 ZLIBICFPKPWGIZ-UHFFFAOYSA-N 0.000 description 1
 - NHDHVHZZCFYRSB-UHFFFAOYSA-N pyriproxyfen Chemical compound C=1C=CC=NC=1OC(C)COC(C=C1)=CC=C1OC1=CC=CC=C1 NHDHVHZZCFYRSB-UHFFFAOYSA-N 0.000 description 1
 - WRHZVMBBRYBTKZ-UHFFFAOYSA-N pyrrole-2-carboxylic acid Chemical compound OC(=O)C1=CC=CN1 WRHZVMBBRYBTKZ-UHFFFAOYSA-N 0.000 description 1
 - 229960002132 pyrrolnitrin Drugs 0.000 description 1
 - 238000010791 quenching Methods 0.000 description 1
 - 230000000171 quenching effect Effects 0.000 description 1
 - IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
 - FBQQHUGEACOBDN-UHFFFAOYSA-N quinomethionate Chemical compound N1=C2SC(=O)SC2=NC2=CC(C)=CC=C21 FBQQHUGEACOBDN-UHFFFAOYSA-N 0.000 description 1
 - WRPIRSINYZBGPK-UHFFFAOYSA-N quinoxyfen Chemical compound C1=CC(F)=CC=C1OC1=CC=NC2=CC(Cl)=CC(Cl)=C12 WRPIRSINYZBGPK-UHFFFAOYSA-N 0.000 description 1
 - 238000007348 radical reaction Methods 0.000 description 1
 - 229920005604 random copolymer Polymers 0.000 description 1
 - 239000005871 repellent Substances 0.000 description 1
 - 230000002940 repellent Effects 0.000 description 1
 - 230000001850 reproductive effect Effects 0.000 description 1
 - 229920005989 resin Polymers 0.000 description 1
 - 239000011347 resin Substances 0.000 description 1
 - 230000000241 respiratory effect Effects 0.000 description 1
 - 210000002345 respiratory system Anatomy 0.000 description 1
 - 230000002441 reversible effect Effects 0.000 description 1
 - 238000012552 review Methods 0.000 description 1
 - 238000007142 ring opening reaction Methods 0.000 description 1
 - 229940080817 rotenone Drugs 0.000 description 1
 - JUVIOZPCNVVQFO-UHFFFAOYSA-N rotenone Natural products O1C2=C3CC(C(C)=C)OC3=CC=C2C(=O)C2C1COC1=C2C=C(OC)C(OC)=C1 JUVIOZPCNVVQFO-UHFFFAOYSA-N 0.000 description 1
 - JJSYXNQGLHBRRK-SFEDZAPPSA-N ryanodine Chemical compound O([C@@H]1[C@]([C@@]2([C@]3(O)[C@]45O[C@@]2(O)C[C@]([C@]4(CC[C@H](C)[C@H]5O)O)(C)[C@@]31O)C)(O)C(C)C)C(=O)C1=CC=CN1 JJSYXNQGLHBRRK-SFEDZAPPSA-N 0.000 description 1
 - 229960004889 salicylic acid Drugs 0.000 description 1
 - 239000004576 sand Substances 0.000 description 1
 - FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical class C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 1
 - 150000004671 saturated fatty acids Chemical class 0.000 description 1
 - 235000003441 saturated fatty acids Nutrition 0.000 description 1
 - 230000028327 secretion Effects 0.000 description 1
 - 230000011664 signaling Effects 0.000 description 1
 - 229910052710 silicon Inorganic materials 0.000 description 1
 - 239000000377 silicon dioxide Substances 0.000 description 1
 - MXMXHPPIGKYTAR-UHFFFAOYSA-N silthiofam Chemical group CC=1SC([Si](C)(C)C)=C(C(=O)NCC=C)C=1C MXMXHPPIGKYTAR-UHFFFAOYSA-N 0.000 description 1
 - 239000011734 sodium Substances 0.000 description 1
 - 229910052708 sodium Inorganic materials 0.000 description 1
 - 239000012279 sodium borohydride Substances 0.000 description 1
 - 229910000033 sodium borohydride Inorganic materials 0.000 description 1
 - 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
 - 229960001922 sodium perborate Drugs 0.000 description 1
 - 229910052938 sodium sulfate Inorganic materials 0.000 description 1
 - 235000011152 sodium sulphate Nutrition 0.000 description 1
 - YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
 - 239000004550 soluble concentrate Substances 0.000 description 1
 - JNYAEWCLZODPBN-CTQIIAAMSA-N sorbitan Polymers OCC(O)C1OCC(O)[C@@H]1O JNYAEWCLZODPBN-CTQIIAAMSA-N 0.000 description 1
 - 239000000600 sorbitol Substances 0.000 description 1
 - 235000010356 sorbitol Nutrition 0.000 description 1
 - 235000012424 soybean oil Nutrition 0.000 description 1
 - 239000003549 soybean oil Substances 0.000 description 1
 - 108010025009 spectrin-like proteins Proteins 0.000 description 1
 - 229940014213 spinosad Drugs 0.000 description 1
 - 125000003003 spiro group Chemical group 0.000 description 1
 - 238000001694 spray drying Methods 0.000 description 1
 - 230000007480 spreading Effects 0.000 description 1
 - 238000003892 spreading Methods 0.000 description 1
 - 239000008107 starch Substances 0.000 description 1
 - 235000019698 starch Nutrition 0.000 description 1
 - 239000007858 starting material Substances 0.000 description 1
 - 238000004659 sterilization and disinfection Methods 0.000 description 1
 - 239000000021 stimulant Substances 0.000 description 1
 - 229960005322 streptomycin Drugs 0.000 description 1
 - 239000005720 sucrose Substances 0.000 description 1
 - 150000003445 sucroses Chemical class 0.000 description 1
 - 150000005846 sugar alcohols Polymers 0.000 description 1
 - 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
 - BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
 - 150000003462 sulfoxides Chemical class 0.000 description 1
 - YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
 - JXHJNEJVUNHLKO-UHFFFAOYSA-N sulprofos Chemical compound CCCSP(=S)(OCC)OC1=CC=C(SC)C=C1 JXHJNEJVUNHLKO-UHFFFAOYSA-N 0.000 description 1
 - 239000000375 suspending agent Substances 0.000 description 1
 - 239000000271 synthetic detergent Substances 0.000 description 1
 - 238000010189 synthetic method Methods 0.000 description 1
 - 230000009885 systemic effect Effects 0.000 description 1
 - 239000000454 talc Substances 0.000 description 1
 - 229910052623 talc Inorganic materials 0.000 description 1
 - 239000003760 tallow Substances 0.000 description 1
 - 239000011975 tartaric acid Substances 0.000 description 1
 - 235000002906 tartaric acid Nutrition 0.000 description 1
 - QYPNKSZPJQQLRK-UHFFFAOYSA-N tebufenozide Chemical compound C1=CC(CC)=CC=C1C(=O)NN(C(C)(C)C)C(=O)C1=CC(C)=CC(C)=C1 QYPNKSZPJQQLRK-UHFFFAOYSA-N 0.000 description 1
 - LWLJEQHTPVPKSJ-UHFFFAOYSA-N tebufloquin Chemical compound C1=C(C(C)(C)C)C=C2C(OC(=O)C)=C(C)C(C)=NC2=C1F LWLJEQHTPVPKSJ-UHFFFAOYSA-N 0.000 description 1
 - CJDWRQLODFKPEL-UHFFFAOYSA-N teflubenzuron Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC1=CC(Cl)=C(F)C(Cl)=C1F CJDWRQLODFKPEL-UHFFFAOYSA-N 0.000 description 1
 - DOMXUEMWDBAQBQ-WEVVVXLNSA-N terbinafine Chemical compound C1=CC=C2C(CN(C\C=C\C#CC(C)(C)C)C)=CC=CC2=C1 DOMXUEMWDBAQBQ-WEVVVXLNSA-N 0.000 description 1
 - 229960002722 terbinafine Drugs 0.000 description 1
 - IWVCMVBTMGNXQD-UHFFFAOYSA-N terramycin dehydrate Natural products C1=CC=C2C(O)(C)C3C(O)C4C(N(C)C)C(O)=C(C(N)=O)C(=O)C4(O)C(O)=C3C(=O)C2=C1O IWVCMVBTMGNXQD-UHFFFAOYSA-N 0.000 description 1
 - ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
 - AQJUNRQALUWKSH-UHFFFAOYSA-N tert-butyl 2-carbamothioyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate Chemical compound C1N(C(N)=S)CC2CN(C(=O)OC(C)(C)C)CC21 AQJUNRQALUWKSH-UHFFFAOYSA-N 0.000 description 1
 - WMOVHXAZOJBABW-UHFFFAOYSA-N tert-butyl acetate Chemical compound CC(=O)OC(C)(C)C WMOVHXAZOJBABW-UHFFFAOYSA-N 0.000 description 1
 - IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 1
 - ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 1
 - BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
 - UBCKGWBNUIFUST-YHYXMXQVSA-N tetrachlorvinphos Chemical compound COP(=O)(OC)O\C(=C/Cl)C1=CC(Cl)=C(Cl)C=C1Cl UBCKGWBNUIFUST-YHYXMXQVSA-N 0.000 description 1
 - BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 1
 - 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
 - CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
 - 239000004308 thiabendazole Substances 0.000 description 1
 - WJCNZQLZVWNLKY-UHFFFAOYSA-N thiabendazole Chemical compound S1C=NC(C=2NC3=CC=CC=C3N=2)=C1 WJCNZQLZVWNLKY-UHFFFAOYSA-N 0.000 description 1
 - 235000010296 thiabendazole Nutrition 0.000 description 1
 - 229960004546 thiabendazole Drugs 0.000 description 1
 - NWWZPOKUUAIXIW-FLIBITNWSA-N thiamethoxam Chemical compound [O-][N+](=O)\N=C/1N(C)COCN\1CC1=CN=C(Cl)S1 NWWZPOKUUAIXIW-FLIBITNWSA-N 0.000 description 1
 - 125000004305 thiazinyl group Chemical group S1NC(=CC=C1)* 0.000 description 1
 - 239000002562 thickening agent Substances 0.000 description 1
 - YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 1
 - DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
 - 125000001391 thioamide group Chemical group 0.000 description 1
 - 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
 - BAKXBZPQTXCKRR-UHFFFAOYSA-N thiodicarb Chemical compound CSC(C)=NOC(=O)NSNC(=O)ON=C(C)SC BAKXBZPQTXCKRR-UHFFFAOYSA-N 0.000 description 1
 - QGHREAKMXXNCOA-UHFFFAOYSA-N thiophanate-methyl Chemical compound COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC QGHREAKMXXNCOA-UHFFFAOYSA-N 0.000 description 1
 - 229930192474 thiophene Natural products 0.000 description 1
 - ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
 - QSOHVSNIQHGFJU-UHFFFAOYSA-L thiosultap disodium Chemical compound [Na+].[Na+].[O-]S(=O)(=O)SCC(N(C)C)CSS([O-])(=O)=O QSOHVSNIQHGFJU-UHFFFAOYSA-L 0.000 description 1
 - 229960002447 thiram Drugs 0.000 description 1
 - KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 1
 - 230000009974 thixotropic effect Effects 0.000 description 1
 - 239000004408 titanium dioxide Substances 0.000 description 1
 - 235000010215 titanium dioxide Nutrition 0.000 description 1
 - WPALTCMYPARVNV-UHFFFAOYSA-N tolfenpyrad Chemical compound CCC1=NN(C)C(C(=O)NCC=2C=CC(OC=3C=CC(C)=CC=3)=CC=2)=C1Cl WPALTCMYPARVNV-UHFFFAOYSA-N 0.000 description 1
 - CFOAUYCPAUGDFF-UHFFFAOYSA-N tosmic Chemical compound CC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 CFOAUYCPAUGDFF-UHFFFAOYSA-N 0.000 description 1
 - 231100000419 toxicity Toxicity 0.000 description 1
 - 230000001988 toxicity Effects 0.000 description 1
 - 108700012359 toxins Proteins 0.000 description 1
 - YWSCPYYRJXKUDB-KAKFPZCNSA-N tralomethrin Chemical compound CC1(C)[C@@H](C(Br)C(Br)(Br)Br)[C@H]1C(=O)O[C@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 YWSCPYYRJXKUDB-KAKFPZCNSA-N 0.000 description 1
 - XQJQCBDIXRIYRP-STQMWFEESA-N trans-(1S,2R)-sedaxane Chemical compound FC(F)C1=NN(C)C=C1C(=O)NC1=CC=CC=C1[C@H]1[C@H](C2CC2)C1 XQJQCBDIXRIYRP-STQMWFEESA-N 0.000 description 1
 - 238000012546 transfer Methods 0.000 description 1
 - 229960002622 triacetin Drugs 0.000 description 1
 - 150000003626 triacylglycerols Chemical class 0.000 description 1
 - NKNFWVNSBIXGLL-UHFFFAOYSA-N triazamate Chemical compound CCOC(=O)CSC1=NC(C(C)(C)C)=NN1C(=O)N(C)C NKNFWVNSBIXGLL-UHFFFAOYSA-N 0.000 description 1
 - IQGKIPDJXCAMSM-UHFFFAOYSA-N triazoxide Chemical compound N=1C2=CC=C(Cl)C=C2[N+]([O-])=NC=1N1C=CN=C1 IQGKIPDJXCAMSM-UHFFFAOYSA-N 0.000 description 1
 - NFACJZMKEDPNKN-UHFFFAOYSA-N trichlorfon Chemical compound COP(=O)(OC)C(O)C(Cl)(Cl)Cl NFACJZMKEDPNKN-UHFFFAOYSA-N 0.000 description 1
 - DQJCHOQLCLEDLL-UHFFFAOYSA-N tricyclazole Chemical group CC1=CC=CC2=C1N1C=NN=C1S2 DQJCHOQLCLEDLL-UHFFFAOYSA-N 0.000 description 1
 - ZDRNMODJXFOYMN-UHFFFAOYSA-N tridecyl acetate Chemical compound CCCCCCCCCCCCCOC(C)=O ZDRNMODJXFOYMN-UHFFFAOYSA-N 0.000 description 1
 - 229940087291 tridecyl alcohol Drugs 0.000 description 1
 - GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
 - XAIPTRIXGHTTNT-UHFFFAOYSA-N triflumuron Chemical compound C1=CC(OC(F)(F)F)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl XAIPTRIXGHTTNT-UHFFFAOYSA-N 0.000 description 1
 - UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
 - 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
 - 150000004072 triols Chemical group 0.000 description 1
 - 108010013280 ubiquinol oxidase Proteins 0.000 description 1
 - 241000701447 unidentified baculovirus Species 0.000 description 1
 - 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
 - 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
 - DRTQHJPVMGBUCF-UHFFFAOYSA-N uracil arabinoside Natural products OC1C(O)C(CO)OC1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-UHFFFAOYSA-N 0.000 description 1
 - 229940045145 uridine Drugs 0.000 description 1
 - 229940005605 valeric acid Drugs 0.000 description 1
 - JARYYMUOCXVXNK-IMTORBKUSA-N validamycin Chemical group N([C@H]1C[C@@H]([C@H]([C@H](O)[C@H]1O)O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)CO)[C@H]1C=C(CO)[C@H](O)[C@H](O)[C@H]1O JARYYMUOCXVXNK-IMTORBKUSA-N 0.000 description 1
 - 238000006175 van Leusen reaction Methods 0.000 description 1
 - 235000015112 vegetable and seed oil Nutrition 0.000 description 1
 - 230000009105 vegetative growth Effects 0.000 description 1
 - 229920002554 vinyl polymer Polymers 0.000 description 1
 - 239000004562 water dispersible granule Substances 0.000 description 1
 - 239000000080 wetting agent Substances 0.000 description 1
 - 239000002023 wood Substances 0.000 description 1
 - 239000011787 zinc oxide Substances 0.000 description 1
 - 235000014692 zinc oxide Nutrition 0.000 description 1
 - DUBNHZYBDBBJHD-UHFFFAOYSA-L ziram Chemical compound [Zn+2].CN(C)C([S-])=S.CN(C)C([S-])=S DUBNHZYBDBBJHD-UHFFFAOYSA-L 0.000 description 1
 - PQHXFGUTAAIHOC-XZZSYSLUSA-N α-(methoxyimino)-n-methyl-2-[[[1-[3-(trifluoromethyl)phenyl]ethoxy]imino]methyl]benzeneacetamide Chemical compound CNC(=O)C(=N\OC)\C1=CC=CC=C1\C=N\OC(C)C1=CC=CC(C(F)(F)F)=C1 PQHXFGUTAAIHOC-XZZSYSLUSA-N 0.000 description 1
 
Classifications
- 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
 - C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
 - C07D487/04—Ortho-condensed systems
 
 - 
        
- A—HUMAN NECESSITIES
 - A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
 - A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
 - A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
 - A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
 - A01N43/74—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,3
 - A01N43/78—1,3-Thiazoles; Hydrogenated 1,3-thiazoles
 
 - 
        
- A—HUMAN NECESSITIES
 - A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
 - A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
 - A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
 - A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
 - A01N43/80—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,2
 
 - 
        
- A—HUMAN NECESSITIES
 - A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
 - A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
 - A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
 - A01N43/90—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having two or more relevant hetero rings, condensed among themselves or with a common carbocyclic ring system
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
 - C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
 - C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
 
 
Landscapes
- Chemical & Material Sciences (AREA)
 - Organic Chemistry (AREA)
 - Life Sciences & Earth Sciences (AREA)
 - Dentistry (AREA)
 - Wood Science & Technology (AREA)
 - Plant Pathology (AREA)
 - Health & Medical Sciences (AREA)
 - Engineering & Computer Science (AREA)
 - Agronomy & Crop Science (AREA)
 - General Health & Medical Sciences (AREA)
 - Pest Control & Pesticides (AREA)
 - Zoology (AREA)
 - Environmental Sciences (AREA)
 - Plural Heterocyclic Compounds (AREA)
 - Agricultural Chemicals And Associated Chemicals (AREA)
 - Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
 - Nitrogen Condensed Heterocyclic Rings (AREA)
 - Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
 
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| US29309510P | 2010-01-07 | 2010-01-07 | |
| US61/293,095 | 2010-01-07 | ||
| PCT/US2011/020473 WO2011085170A1 (en) | 2010-01-07 | 2011-01-07 | Fungicidal heterocyclic compounds | 
Publications (3)
| Publication Number | Publication Date | 
|---|---|
| JP2013516483A JP2013516483A (ja) | 2013-05-13 | 
| JP2013516483A5 JP2013516483A5 (enEXAMPLES) | 2014-02-20 | 
| JP5715646B2 true JP5715646B2 (ja) | 2015-05-13 | 
Family
ID=43598305
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| JP2012548142A Expired - Fee Related JP5715646B2 (ja) | 2010-01-07 | 2011-01-07 | 殺菌・殺カビ性ヘテロ環式化合物 | 
Country Status (13)
| Country | Link | 
|---|---|
| US (1) | US8835427B2 (enEXAMPLES) | 
| EP (1) | EP2521450B1 (enEXAMPLES) | 
| JP (1) | JP5715646B2 (enEXAMPLES) | 
| KR (1) | KR20120112755A (enEXAMPLES) | 
| CN (1) | CN102791133B (enEXAMPLES) | 
| AU (1) | AU2011204323B2 (enEXAMPLES) | 
| BR (1) | BR112012016733A2 (enEXAMPLES) | 
| CL (1) | CL2012001805A1 (enEXAMPLES) | 
| ES (1) | ES2534516T3 (enEXAMPLES) | 
| IN (1) | IN2012DN05233A (enEXAMPLES) | 
| MX (1) | MX2012007935A (enEXAMPLES) | 
| PL (1) | PL2521450T3 (enEXAMPLES) | 
| WO (1) | WO2011085170A1 (enEXAMPLES) | 
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| HK1198385A1 (en) | 2011-09-15 | 2015-04-17 | Bayer Intellectual Property Gmbh | Piperidine pyrazoles as fungicides | 
| DK2819518T3 (en) | 2012-02-27 | 2017-12-11 | Bayer Ip Gmbh | COMBINATIONS OF ACTIVE COMPOUNDS CONTAINING A THIAZOYLISOXAZOLINE AND A FUNGICIDE | 
| TWI633087B (zh) | 2012-06-13 | 2018-08-21 | 赫孚孟拉羅股份公司 | 新穎二氮雜螺環烷及氮雜螺環烷 | 
| AU2013277673A1 (en) | 2012-06-22 | 2015-01-22 | E. I. Du Pont De Nemours And Company | Fungicidal heterocyclic compounds | 
| DK2890682T3 (en) | 2012-08-30 | 2016-09-12 | Bayer Cropscience Ag | METHOD OF DECARBOXYLATION OF 3,5-BIS (HALOGENALKYL) -PYRAZOL-4-CARBOXYLIC ACID DERIVATIVES | 
| HRP20191937T1 (hr) | 2012-09-25 | 2020-01-10 | F. Hoffmann - La Roche Ag | Derivati heksahidropirolo [3,4-c]pirola i srodni spojevi kao inhibitori autotaksina (atx) i kao inhibitori proizvodnje lizofosfatidne kiseline (lpa) za liječenje npr. bubrežnih bolesti | 
| AR095079A1 (es) | 2013-03-12 | 2015-09-16 | Hoffmann La Roche | Derivados de octahidro-pirrolo[3,4-c]-pirrol y piridina-fenilo | 
| EP3461827B1 (en) | 2013-09-26 | 2022-02-23 | Cadent Therapeutics, Inc. | Selective octahydro-cyclopenta[c]pyrrole negative modulators of nr2b | 
| US9077321B2 (en) | 2013-10-23 | 2015-07-07 | Corning Optical Communications Wireless Ltd. | Variable amplitude signal generators for generating a sinusoidal signal having limited direct current (DC) offset variation, and related devices, systems, and methods | 
| JP6496730B2 (ja) | 2013-11-26 | 2019-04-03 | エフ.ホフマン−ラ ロシュ アーゲーF. Hoffmann−La Roche Aktiengesellschaft | 新規なオクタヒドロ−シクロブタ[1,2−c;3,4−c’]ジピロール−2−イル | 
| CN106132202B (zh) | 2014-03-20 | 2021-12-31 | 三井化学Agro株式会社 | 植物病害防除组合物及应用该组合物以防除植物病害的方法 | 
| WO2015144605A1 (en) | 2014-03-26 | 2015-10-01 | F. Hoffmann-La Roche Ag | Bicyclic compounds as autotaxin (atx) and lysophosphatidic acid (lpa) production inhibitors | 
| SG11201607845RA (en) | 2014-03-26 | 2016-10-28 | Hoffmann La Roche | Condensed [1,4]diazepine compounds as autotaxin (atx) and lysophosphatidic acid (lpa) production inhibitors | 
| TWI665192B (zh) | 2014-05-28 | 2019-07-11 | 德商拜耳作物科學股份有限公司 | 製備二氫異唑衍生物之方法 | 
| WO2016024350A1 (ja) | 2014-08-13 | 2016-02-18 | 株式会社エス・ディー・エス バイオテック | 縮合11員環化合物及びそれらを含有する農園芸用殺菌剤 | 
| JO3579B1 (ar) | 2014-09-26 | 2020-07-05 | Luc Therapeutics Inc | مُعدِلات تفاغرية سالبة لمستقبل nr2b من المركب n-ألكيل أريل-5-أوكسي أريل-ثامن هيدرو-خماسي الحلقة [c] بيرول | 
| ES2749900T3 (es) | 2015-03-05 | 2020-03-24 | Bayer Cropscience Ag | Procedimiento de preparación de derivados de fenilisoxazolina sustituidos | 
| MA41898A (fr) | 2015-04-10 | 2018-02-13 | Hoffmann La Roche | Dérivés de quinazolinone bicyclique | 
| WO2016202761A1 (en) | 2015-06-17 | 2016-12-22 | Bayer Cropscience Aktiengesellschaft | Active compound combinations | 
| CA2992889A1 (en) | 2015-09-04 | 2017-03-09 | F. Hoffmann-La Roche Ag | Phenoxymethyl derivatives | 
| CN107922412B (zh) | 2015-09-24 | 2021-02-23 | 豪夫迈·罗氏有限公司 | 作为atx抑制剂的二环化合物 | 
| KR20180053408A (ko) | 2015-09-24 | 2018-05-21 | 에프. 호프만-라 로슈 아게 | 이중 오토탁신(atx)/탄산 무수화효소(ca) 억제제로서의 신규한 이환형 화합물 | 
| WO2017050791A1 (en) | 2015-09-24 | 2017-03-30 | F. Hoffmann-La Roche Ag | New bicyclic compounds as dual atx/ca inhibitors | 
| CN107635995B (zh) | 2015-09-24 | 2022-08-19 | 豪夫迈·罗氏有限公司 | 作为atx抑制剂的二环化合物 | 
| EP3415008A4 (en) | 2016-02-08 | 2019-09-11 | SDS Biotech K. K. | GERMIC COMPOSITION | 
| US11274076B2 (en) | 2016-02-08 | 2022-03-15 | Gowan Company, L.L.C. | Process for preparing 1, 2-benzenedimethanol compound | 
| MA49879A (fr) | 2017-03-16 | 2020-06-24 | Hoffmann La Roche | Composés hétérocycliques utiles en tant qu'inhibiteurs doubles d'atx/ca | 
| WO2018167113A1 (en) | 2017-03-16 | 2018-09-20 | F. Hoffmann-La Roche Ag | New bicyclic compounds as atx inhibitors | 
| TW201838974A (zh) | 2017-04-19 | 2018-11-01 | 印度商Pi工業公司 | 具殺菌性質之雜環化合物 | 
| MX2020002449A (es) | 2017-09-08 | 2020-11-06 | Pi Industries Ltd | Nuevos compuestos heterociclicos fungicidas. | 
| WO2019048988A1 (en) | 2017-09-08 | 2019-03-14 | Pi Industries Ltd. | Novel fungidal heterocyclic compounds | 
| CN109516962A (zh) * | 2018-12-13 | 2019-03-26 | 天津雅奥泰克科技有限公司 | 一种合成2,6-二氟苯基-1-(4,5-二氢异恶唑)-3-乙基酮的新方法 | 
| CN115594670B (zh) * | 2021-06-28 | 2025-07-04 | 浙江省化工研究院有限公司 | 一类含三氟甲基噁二唑类衍生物、其制备方法及应用 | 
| EP4509511A1 (en) | 2023-08-17 | 2025-02-19 | Bayer Aktiengesellschaft | Substituted spiro-isoxazolinyl lactams, salts thereof and their use as herbicidally active substances | 
| CN118878474A (zh) * | 2024-07-01 | 2024-11-01 | 盐城工学院 | 一种合成2,6-二氟苯基-1-(4,5-二氢异恶唑)-3-乙基酮的方法 | 
Family Cites Families (43)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| US2891855A (en) | 1954-08-16 | 1959-06-23 | Geigy Ag J R | Compositions and methods for influencing the growth of plants | 
| US3235361A (en) | 1962-10-29 | 1966-02-15 | Du Pont | Method for the control of undesirable vegetation | 
| US3060084A (en) | 1961-06-09 | 1962-10-23 | Du Pont | Improved homogeneous, readily dispersed, pesticidal concentrate | 
| US3251838A (en) | 1962-08-15 | 1966-05-17 | Searle & Co | Optionally substituted 5-methyl-6-phenyltetrahydro-1, 3, 4-oxadiazines | 
| US3299566A (en) | 1964-06-01 | 1967-01-24 | Olin Mathieson | Water soluble film containing agricultural chemicals | 
| US3309192A (en) | 1964-12-02 | 1967-03-14 | Du Pont | Method of controlling seedling weed grasses | 
| US4144050A (en) | 1969-02-05 | 1979-03-13 | Hoechst Aktiengesellschaft | Micro granules for pesticides and process for their manufacture | 
| US3920442A (en) | 1972-09-18 | 1975-11-18 | Du Pont | Water-dispersible pesticide aggregates | 
| US4089672A (en) | 1972-12-20 | 1978-05-16 | The Upjohn Company | 1-(Substituted-hydrocarbyl)-di- and trihalopyrazoles | 
| US4172714A (en) | 1976-12-20 | 1979-10-30 | E. I. Du Pont De Nemours And Company | Dry compactible, swellable herbicidal compositions and pellets produced therefrom | 
| US4151279A (en) | 1978-06-19 | 1979-04-24 | Chevron Research Company | Fungicidal N-carbamyloxy-2,3-disubstituted 4-trihalomethyl-6-oxotetrahydro-1,3-oxazines | 
| GB2095558B (en) | 1981-03-30 | 1984-10-24 | Avon Packers Ltd | Formulation of agricultural chemicals | 
| DE3246493A1 (de) | 1982-12-16 | 1984-06-20 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von wasserdispergierbaren granulaten | 
| US4584014A (en) | 1984-07-02 | 1986-04-22 | Rohm And Haas Company | Ethylideneaminooxyacetic acids and esters | 
| DE3675209D1 (de) | 1986-05-22 | 1990-11-29 | Wolfgang Nohlen | Verfahren und vorrichtung zur herstellung von mindestens einseitig offenen gefaessen aus zement, gegebenenfalls aus zementmoertel und aus einer bewehrung. | 
| US5180587A (en) | 1988-06-28 | 1993-01-19 | E. I. Du Pont De Nemours And Company | Tablet formulations of pesticides | 
| DK0415688T3 (da) | 1989-08-30 | 1999-08-23 | Aeci Ltd | Fremgangsmåde til fremstilling af et doseringssystem samt fremgangsmåde til behandling af en genstand eller et locus | 
| ES2065680T3 (es) | 1990-03-12 | 1995-02-16 | Du Pont | Granulos de plaguicida dispersables en agua o solubles en agua a partir de aglutinantes activados por calor. | 
| GB9016800D0 (en) | 1990-07-31 | 1990-09-12 | Shell Int Research | Tetrahydropyrimidine derivatives | 
| DE69122201T2 (de) | 1990-10-11 | 1997-02-06 | Sumitomo Chemical Co | Pestizide Zusammensetzung | 
| ATE206406T1 (de) | 1993-05-12 | 2001-10-15 | Du Pont | Fungizide kondensierte bizyklische pyrimidinone | 
| GB9416364D0 (en) | 1994-08-12 | 1994-10-05 | Fine Organics Ltd | Preparation of thioamides | 
| BR9609613A (pt) | 1995-07-05 | 1999-05-25 | Du Pont | Composto composição fungicida e método de controle de doenças de plantas | 
| KR100482919B1 (ko) | 1996-03-11 | 2005-10-12 | 신젠타 파티서페이션즈 아게 | 살충제로서의피리미딘-4-온유도체 | 
| GB9719411D0 (en) | 1997-09-12 | 1997-11-12 | Ciba Geigy Ag | New Pesticides | 
| DE10136065A1 (de) | 2001-07-25 | 2003-02-13 | Bayer Cropscience Ag | Pyrazolylcarboxanilide | 
| TW200724033A (en) | 2001-09-21 | 2007-07-01 | Du Pont | Anthranilamide arthropodicide treatment | 
| PL1761542T3 (pl) | 2004-06-09 | 2008-06-30 | Hoffmann La Roche | Pochodne oktahydropirolo[3,4-c]pirolu i ich zastosowanie jako środków przeciwwirusowych | 
| US7691850B2 (en) | 2004-06-15 | 2010-04-06 | Glaxo Group Limited | Antibacterial agents | 
| EP1790640A4 (en) * | 2004-09-09 | 2009-07-29 | Chugai Pharmaceutical Co Ltd | NEW IMIDAZOLIDINE DERIVATIVE AND APPLICATION THEREOF | 
| WO2006081264A1 (en) | 2005-01-25 | 2006-08-03 | Glaxo Group Limited | Antibacterial agents | 
| WO2007005510A1 (en) * | 2005-06-30 | 2007-01-11 | Janssen Pharmaceutica N.V. | N-heteroarylpiperazinyl ureas as modulators of fatty acid amide hydrolase | 
| TW200738701A (en) | 2005-07-26 | 2007-10-16 | Du Pont | Fungicidal carboxamides | 
| US20090143413A1 (en) * | 2005-11-29 | 2009-06-04 | Adams Alan D | Thiazole Derivatives as CXCR3 Receptor Modulators | 
| US20090012011A1 (en) | 2006-01-11 | 2009-01-08 | Smithkline Beecham Corporation | Novel Compounds | 
| JPWO2007111323A1 (ja) | 2006-03-27 | 2009-08-13 | 東レ株式会社 | ウレイド誘導体およびその医薬用途 | 
| WO2008013622A2 (en) * | 2006-07-27 | 2008-01-31 | E. I. Du Pont De Nemours And Company | Fungicidal azocyclic amides | 
| WO2008091594A2 (en) * | 2007-01-24 | 2008-07-31 | E. I. Du Pont De Nemours And Company | Fungicidal mixtures | 
| KR20100015975A (ko) | 2007-04-27 | 2010-02-12 | 사노피-아벤티스 | 2-헤테로아릴-피롤로[3,4-c]피롤 유도체 및 SCD 억제제로서의 이들의 용도 | 
| MX2010003563A (es) | 2007-10-03 | 2010-06-02 | Vertex Pharma | Inhibidores de proteina cinasa de c-met. | 
| US20100286147A1 (en) * | 2008-01-25 | 2010-11-11 | E.I. Dupont De Nemours And Company | Fungicidal amides | 
| AU2009206468B2 (en) | 2008-01-25 | 2014-01-09 | E. I. Du Pont De Nemours And Company | Fungicidal heterocyclic compounds | 
| DE102009015919A1 (de) | 2009-03-25 | 2010-10-07 | Chiron-Werke Gmbh & Co Kg | Vorrichtung und Verfahren zur Herstellung zumindest eines Werkstücks | 
- 
        2011
        
- 2011-01-07 WO PCT/US2011/020473 patent/WO2011085170A1/en active Application Filing
 - 2011-01-07 PL PL11701172T patent/PL2521450T3/pl unknown
 - 2011-01-07 ES ES11701172.6T patent/ES2534516T3/es active Active
 - 2011-01-07 US US13/518,943 patent/US8835427B2/en not_active Expired - Fee Related
 - 2011-01-07 MX MX2012007935A patent/MX2012007935A/es active IP Right Grant
 - 2011-01-07 AU AU2011204323A patent/AU2011204323B2/en not_active Ceased
 - 2011-01-07 CN CN201180013011.8A patent/CN102791133B/zh not_active Expired - Fee Related
 - 2011-01-07 IN IN5233DEN2012 patent/IN2012DN05233A/en unknown
 - 2011-01-07 BR BRBR112012016733-2A patent/BR112012016733A2/pt not_active Application Discontinuation
 - 2011-01-07 KR KR1020127020596A patent/KR20120112755A/ko not_active Withdrawn
 - 2011-01-07 JP JP2012548142A patent/JP5715646B2/ja not_active Expired - Fee Related
 - 2011-01-07 EP EP11701172.6A patent/EP2521450B1/en not_active Not-in-force
 
 - 
        2012
        
- 2012-07-04 CL CL2012001805A patent/CL2012001805A1/es unknown
 
 
Also Published As
| Publication number | Publication date | 
|---|---|
| CN102791133B (zh) | 2015-09-23 | 
| WO2011085170A1 (en) | 2011-07-14 | 
| AU2011204323A1 (en) | 2012-06-28 | 
| AU2011204323B2 (en) | 2013-12-12 | 
| KR20120112755A (ko) | 2012-10-11 | 
| CL2012001805A1 (es) | 2013-02-22 | 
| EP2521450B1 (en) | 2015-02-25 | 
| IN2012DN05233A (enEXAMPLES) | 2015-10-23 | 
| US20120309752A1 (en) | 2012-12-06 | 
| MX2012007935A (es) | 2012-08-15 | 
| CN102791133A (zh) | 2012-11-21 | 
| ES2534516T3 (es) | 2015-04-23 | 
| EP2521450A1 (en) | 2012-11-14 | 
| JP2013516483A (ja) | 2013-05-13 | 
| PL2521450T3 (pl) | 2015-07-31 | 
| BR112012016733A2 (pt) | 2015-09-01 | 
| US8835427B2 (en) | 2014-09-16 | 
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| JP5715646B2 (ja) | 殺菌・殺カビ性ヘテロ環式化合物 | |
| JP5592894B2 (ja) | 殺真菌性複素環化合物 | |
| JP5535941B2 (ja) | 殺菌性アミド | |
| JP5769799B2 (ja) | 殺菌・殺カビオキシムおよびヒドラゾン | |
| JP6572294B2 (ja) | 殺菌・殺カビ性アゾ環式アミド | |
| JP5529044B2 (ja) | 殺菌性複素環化合物 | |
| JP5364712B2 (ja) | 殺菌性混合物 | |
| JP5337711B2 (ja) | 殺菌性アミド | |
| JP2014501246A (ja) | 殺菌・殺カビ性アゾ環式アミド | |
| JP2015525241A (ja) | 殺菌・殺カビ性ヘテロ環式化合物 | 
Legal Events
| Date | Code | Title | Description | 
|---|---|---|---|
| A521 | Request for written amendment filed | 
             Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20131225  | 
        |
| A621 | Written request for application examination | 
             Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20131225  | 
        |
| A131 | Notification of reasons for refusal | 
             Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20141111  | 
        |
| A977 | Report on retrieval | 
             Free format text: JAPANESE INTERMEDIATE CODE: A971007 Effective date: 20141113  | 
        |
| A521 | Request for written amendment filed | 
             Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20150129  | 
        |
| TRDD | Decision of grant or rejection written | ||
| A01 | Written decision to grant a patent or to grant a registration (utility model) | 
             Free format text: JAPANESE INTERMEDIATE CODE: A01 Effective date: 20150224  | 
        |
| A61 | First payment of annual fees (during grant procedure) | 
             Free format text: JAPANESE INTERMEDIATE CODE: A61 Effective date: 20150313  | 
        |
| R150 | Certificate of patent or registration of utility model | 
             Ref document number: 5715646 Country of ref document: JP Free format text: JAPANESE INTERMEDIATE CODE: R150  | 
        |
| LAPS | Cancellation because of no payment of annual fees |