JP2866478B2 - プリンヌクレオシドホスホリラーゼの阻害剤 - Google Patents
プリンヌクレオシドホスホリラーゼの阻害剤Info
- Publication number
- JP2866478B2 JP2866478B2 JP2515550A JP51555090A JP2866478B2 JP 2866478 B2 JP2866478 B2 JP 2866478B2 JP 2515550 A JP2515550 A JP 2515550A JP 51555090 A JP51555090 A JP 51555090A JP 2866478 B2 JP2866478 B2 JP 2866478B2
- Authority
- JP
- Japan
- Prior art keywords
- cyclo
- compound
- amino
- give
- pyrrolo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000784 purine nucleoside phosphorylase inhibitor Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 211
- -1 3-tetrahydrofuranyl Chemical group 0.000 claims description 156
- 239000000203 mixture Substances 0.000 claims description 72
- 238000000034 method Methods 0.000 claims description 67
- 239000011734 sodium Substances 0.000 claims description 42
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 claims description 27
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 25
- 125000000217 alkyl group Chemical group 0.000 claims description 25
- 238000006243 chemical reaction Methods 0.000 claims description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 20
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- 230000000694 effects Effects 0.000 claims description 13
- 229910021529 ammonia Inorganic materials 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 claims description 10
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 claims description 10
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- CPEKAXYCDKETEN-UHFFFAOYSA-N benzoyl isothiocyanate Chemical compound S=C=NC(=O)C1=CC=CC=C1 CPEKAXYCDKETEN-UHFFFAOYSA-N 0.000 claims description 9
- COQRGFWWJBEXRC-UHFFFAOYSA-N hydron;methyl 2-aminoacetate;chloride Chemical compound Cl.COC(=O)CN COQRGFWWJBEXRC-UHFFFAOYSA-N 0.000 claims description 9
- 125000002723 alicyclic group Chemical group 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 claims description 6
- 239000005695 Ammonium acetate Substances 0.000 claims description 6
- 229940043376 ammonium acetate Drugs 0.000 claims description 6
- 235000019257 ammonium acetate Nutrition 0.000 claims description 6
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 6
- 125000003670 adamantan-2-yl group Chemical group [H]C1([H])C(C2([H])[H])([H])C([H])([H])C3([H])C([*])([H])C1([H])C([H])([H])C2([H])C3([H])[H] 0.000 claims description 5
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 5
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 claims description 5
- 150000003536 tetrazoles Chemical class 0.000 claims description 5
- 150000003852 triazoles Chemical class 0.000 claims description 5
- 239000004471 Glycine Substances 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 claims description 3
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 claims description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims description 3
- 125000001072 heteroaryl group Chemical group 0.000 claims description 3
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 claims description 3
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 claims description 3
- 239000001632 sodium acetate Substances 0.000 claims description 3
- 235000017281 sodium acetate Nutrition 0.000 claims description 3
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 claims description 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 2
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 2
- 125000004487 4-tetrahydropyranyl group Chemical group [H]C1([H])OC([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical compound [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 claims description 2
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 claims description 2
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 claims description 2
- 125000002757 morpholinyl group Chemical group 0.000 claims description 2
- 239000007800 oxidant agent Substances 0.000 claims description 2
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 claims description 2
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 claims description 2
- 125000005750 substituted cyclic group Chemical group 0.000 claims description 2
- 150000001350 alkyl halides Chemical class 0.000 claims 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims 1
- SDDKIZNHOCEXTF-UHFFFAOYSA-N methyl carbamimidothioate Chemical compound CSC(N)=N SDDKIZNHOCEXTF-UHFFFAOYSA-N 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 125000004944 pyrazin-3-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 174
- 239000000243 solution Substances 0.000 description 128
- 239000000543 intermediate Substances 0.000 description 61
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 51
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 47
- 239000000741 silica gel Substances 0.000 description 46
- 229910002027 silica gel Inorganic materials 0.000 description 46
- 239000007787 solid Substances 0.000 description 43
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 42
- 239000003921 oil Substances 0.000 description 35
- 239000007858 starting material Substances 0.000 description 35
- 239000000284 extract Substances 0.000 description 33
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 30
- 230000002401 inhibitory effect Effects 0.000 description 30
- 239000000047 product Substances 0.000 description 29
- 229910019142 PO4 Inorganic materials 0.000 description 28
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 28
- 239000010452 phosphate Substances 0.000 description 28
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 26
- 102000004190 Enzymes Human genes 0.000 description 26
- 108090000790 Enzymes Proteins 0.000 description 26
- 238000000746 purification Methods 0.000 description 26
- 101710101148 Probable 6-oxopurine nucleoside phosphorylase Proteins 0.000 description 25
- 102000030764 Purine-nucleoside phosphorylase Human genes 0.000 description 25
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- 238000003756 stirring Methods 0.000 description 22
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- 239000000706 filtrate Substances 0.000 description 20
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- 238000009835 boiling Methods 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 17
- 241001465754 Metazoa Species 0.000 description 16
- 239000012299 nitrogen atmosphere Substances 0.000 description 16
- 239000003039 volatile agent Substances 0.000 description 16
- 239000006227 byproduct Substances 0.000 description 15
- 229960003786 inosine Drugs 0.000 description 15
- 229930010555 Inosine Natural products 0.000 description 14
- UGQMRVRMYYASKQ-KQYNXXCUSA-N Inosine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC=NC(O)=C2N=C1 UGQMRVRMYYASKQ-KQYNXXCUSA-N 0.000 description 14
- 230000015572 biosynthetic process Effects 0.000 description 14
- 239000003480 eluent Substances 0.000 description 14
- 150000002081 enamines Chemical class 0.000 description 14
- 239000007928 intraperitoneal injection Substances 0.000 description 14
- 239000008194 pharmaceutical composition Substances 0.000 description 14
- 238000012360 testing method Methods 0.000 description 14
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 13
- 229910000104 sodium hydride Inorganic materials 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 12
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 11
- 238000001914 filtration Methods 0.000 description 11
- 150000002825 nitriles Chemical class 0.000 description 11
- 229920006395 saturated elastomer Polymers 0.000 description 11
- 241000124008 Mammalia Species 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 9
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 9
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 9
- 229940011051 isopropyl acetate Drugs 0.000 description 9
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- 230000002829 reductive effect Effects 0.000 description 9
- 229910001220 stainless steel Inorganic materials 0.000 description 9
- 239000010935 stainless steel Substances 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 8
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 150000001408 amides Chemical class 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 238000000921 elemental analysis Methods 0.000 description 8
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- 238000003786 synthesis reaction Methods 0.000 description 8
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 210000001744 T-lymphocyte Anatomy 0.000 description 7
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 7
- 235000019439 ethyl acetate Nutrition 0.000 description 7
- 238000000605 extraction Methods 0.000 description 7
- 238000011694 lewis rat Methods 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- KWGZNYCFTYOQHV-UHFFFAOYSA-N 3-pyridin-2-ylpropanenitrile Chemical compound N#CCCC1=CC=CC=N1 KWGZNYCFTYOQHV-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 229910004373 HOAc Inorganic materials 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 239000008365 aqueous carrier Substances 0.000 description 6
- DDKMFOUTRRODRE-UHFFFAOYSA-N chloromethanone Chemical compound Cl[C]=O DDKMFOUTRRODRE-UHFFFAOYSA-N 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- 239000003937 drug carrier Substances 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- FDGQSTZJBFJUBT-UHFFFAOYSA-N hypoxanthine Chemical compound O=C1NC=NC2=C1NC=N2 FDGQSTZJBFJUBT-UHFFFAOYSA-N 0.000 description 6
- 239000007924 injection Substances 0.000 description 6
- 238000002347 injection Methods 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- KANSEWMVEJOUAE-UHFFFAOYSA-N 3-(2-adamantyl)propanenitrile Chemical compound C1C(C2)CC3CC1C(CCC#N)C2C3 KANSEWMVEJOUAE-UHFFFAOYSA-N 0.000 description 5
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- 150000001299 aldehydes Chemical class 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 210000004027 cell Anatomy 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 238000010828 elution Methods 0.000 description 5
- 238000001952 enzyme assay Methods 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 230000004727 humoral immunity Effects 0.000 description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 235000010755 mineral Nutrition 0.000 description 5
- 239000011707 mineral Substances 0.000 description 5
- 239000002777 nucleoside Substances 0.000 description 5
- 125000003835 nucleoside group Chemical group 0.000 description 5
- 239000006072 paste Substances 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 210000000952 spleen Anatomy 0.000 description 5
- UWMXUDUWVFWJPX-UHFFFAOYSA-N 1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound OC1=NC=NC2=C1NC=C2 UWMXUDUWVFWJPX-UHFFFAOYSA-N 0.000 description 4
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 4
- OYEXEQFKIPJKJK-UHFFFAOYSA-N 2-(cyclohexen-1-yl)acetonitrile Chemical compound N#CCC1=CCCCC1 OYEXEQFKIPJKJK-UHFFFAOYSA-N 0.000 description 4
- MHLIWISGWFMRES-UHFFFAOYSA-N 3-cycloheptylpropanenitrile Chemical compound N#CCCC1CCCCCC1 MHLIWISGWFMRES-UHFFFAOYSA-N 0.000 description 4
- DFCILIYDUNACSC-UHFFFAOYSA-N 3-cyclohexylpropanenitrile Chemical compound N#CCCC1CCCCC1 DFCILIYDUNACSC-UHFFFAOYSA-N 0.000 description 4
- PPUBMRYNGIUSBF-UHFFFAOYSA-N 3-cyclopentylpropanenitrile Chemical compound N#CCCC1CCCC1 PPUBMRYNGIUSBF-UHFFFAOYSA-N 0.000 description 4
- HLLQLVYVGPYYBK-UHFFFAOYSA-N 3-pyridin-3-ylpropanenitrile Chemical compound N#CCCC1=CC=CN=C1 HLLQLVYVGPYYBK-UHFFFAOYSA-N 0.000 description 4
- 241000283690 Bos taurus Species 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 206010038997 Retroviral infections Diseases 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 125000001309 chloro group Chemical group Cl* 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 125000001153 fluoro group Chemical group F* 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 125000002560 nitrile group Chemical group 0.000 description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 4
- 239000002212 purine nucleoside Substances 0.000 description 4
- 230000002441 reversible effect Effects 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 239000003981 vehicle Substances 0.000 description 4
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 3
- ZHKAQNFBQHPERX-UHFFFAOYSA-N 3-(furan-2-yl)prop-2-enenitrile Chemical compound N#CC=CC1=CC=CO1 ZHKAQNFBQHPERX-UHFFFAOYSA-N 0.000 description 3
- YFCIFWOJYYFDQP-PTWZRHHISA-N 4-[3-amino-6-[(1S,3S,4S)-3-fluoro-4-hydroxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-(methylamino)ethyl]-2-fluorobenzamide Chemical compound CNC[C@@H](NC(=O)c1ccc(cc1F)-c1nc(cnc1N)[C@H]1CC[C@H](O)[C@@H](F)C1)c1cc(F)cc(Br)c1 YFCIFWOJYYFDQP-PTWZRHHISA-N 0.000 description 3
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229940126062 Compound A Drugs 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- BXZVVICBKDXVGW-NKWVEPMBSA-N Didanosine Chemical compound O1[C@H](CO)CC[C@@H]1N1C(NC=NC2=O)=C2N=C1 BXZVVICBKDXVGW-NKWVEPMBSA-N 0.000 description 3
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 3
- UGQMRVRMYYASKQ-UHFFFAOYSA-N Hypoxanthine nucleoside Natural products OC1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 UGQMRVRMYYASKQ-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000000840 anti-viral effect Effects 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- IYYIVELXUANFED-UHFFFAOYSA-N bromo(trimethyl)silane Chemical compound C[Si](C)(C)Br IYYIVELXUANFED-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000003467 diminishing effect Effects 0.000 description 3
- 208000035475 disorder Diseases 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 3
- 238000003818 flash chromatography Methods 0.000 description 3
- 239000000295 fuel oil Substances 0.000 description 3
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 230000002503 metabolic effect Effects 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- XVHFAJKXXPJYDW-UHFFFAOYSA-N pyrrolo[3,2-d]pyrimidin-4-one Chemical compound O=C1N=CN=C2C=CN=C12 XVHFAJKXXPJYDW-UHFFFAOYSA-N 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- 235000015424 sodium Nutrition 0.000 description 3
- 238000010189 synthetic method Methods 0.000 description 3
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 2
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 2
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 2
- MZBIWKMCTWJLPT-UHFFFAOYSA-N 1-[chloromethyl(ethoxy)phosphoryl]oxyethane Chemical compound CCOP(=O)(CCl)OCC MZBIWKMCTWJLPT-UHFFFAOYSA-N 0.000 description 2
- WVXRAFOPTSTNLL-NKWVEPMBSA-N 2',3'-dideoxyadenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@H]1CC[C@@H](CO)O1 WVXRAFOPTSTNLL-NKWVEPMBSA-N 0.000 description 2
- YKBGVTZYEHREMT-KVQBGUIXSA-N 2'-deoxyguanosine Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 YKBGVTZYEHREMT-KVQBGUIXSA-N 0.000 description 2
- YKBGVTZYEHREMT-UHFFFAOYSA-N 2'-deoxyguanosine Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1CC(O)C(CO)O1 YKBGVTZYEHREMT-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- UDYUORZNPCNNCU-UHFFFAOYSA-N 2-amino-7-(oxan-2-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1CCCCO1 UDYUORZNPCNNCU-UHFFFAOYSA-N 0.000 description 2
- OCLZPNCLRLDXJC-NTSWFWBYSA-N 2-amino-9-[(2r,5s)-5-(hydroxymethyl)oxolan-2-yl]-3h-purin-6-one Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@H]1CC[C@@H](CO)O1 OCLZPNCLRLDXJC-NTSWFWBYSA-N 0.000 description 2
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 2
- VHTUKWXCIFHXKN-UHFFFAOYSA-N 3-(furan-2-yl)propanenitrile Chemical compound N#CCCC1=CC=CO1 VHTUKWXCIFHXKN-UHFFFAOYSA-N 0.000 description 2
- 125000006180 3-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C([H])([H])* 0.000 description 2
- OQRXBXNATIHDQO-UHFFFAOYSA-N 6-chloropyridine-3,4-diamine Chemical compound NC1=CN=C(Cl)C=C1N OQRXBXNATIHDQO-UHFFFAOYSA-N 0.000 description 2
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 2
- 208000030507 AIDS Diseases 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- GISRWBROCYNDME-PELMWDNLSA-N F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C Chemical compound F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C GISRWBROCYNDME-PELMWDNLSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- 102100036286 Purine nucleoside phosphorylase Human genes 0.000 description 2
- 102000005583 Pyrin Human genes 0.000 description 2
- 108010059278 Pyrin Proteins 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 230000000259 anti-tumor effect Effects 0.000 description 2
- 239000002246 antineoplastic agent Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- LURYMYITPCOQAU-UHFFFAOYSA-N benzoyl isocyanate Chemical compound O=C=NC(=O)C1=CC=CC=C1 LURYMYITPCOQAU-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000011260 co-administration Methods 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 239000002178 crystalline material Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- VGONTNSXDCQUGY-UHFFFAOYSA-N desoxyinosine Natural products C1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 VGONTNSXDCQUGY-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- CUILPNURFADTPE-UHFFFAOYSA-N hypobromous acid Chemical compound BrO CUILPNURFADTPE-UHFFFAOYSA-N 0.000 description 2
- 230000036039 immunity Effects 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- BKIMMITUMNQMOS-UHFFFAOYSA-N nonane Chemical compound CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 2
- 108010009099 nucleoside phosphorylase Proteins 0.000 description 2
- DOHVAKFYAHLCJP-UHFFFAOYSA-N peldesine Chemical compound C1=2NC(N)=NC(=O)C=2NC=C1CC1=CC=CN=C1 DOHVAKFYAHLCJP-UHFFFAOYSA-N 0.000 description 2
- ZTOMUSMDRMJOTH-MQIHXRCWSA-N pentanedinitrile Chemical class N#[13C]CCC[13C]#N ZTOMUSMDRMJOTH-MQIHXRCWSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 2
- 150000003230 pyrimidines Chemical class 0.000 description 2
- ZSKGQVFRTSEPJT-UHFFFAOYSA-N pyrrole-2-carboxaldehyde Chemical compound O=CC1=CC=CN1 ZSKGQVFRTSEPJT-UHFFFAOYSA-N 0.000 description 2
- 238000010583 slow cooling Methods 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000006104 solid solution Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- QAHVHSLSRLSVGS-UHFFFAOYSA-N sulfamoyl chloride Chemical compound NS(Cl)(=O)=O QAHVHSLSRLSVGS-UHFFFAOYSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- GYZSXGFOIMANOA-UHFFFAOYSA-N 1-[diethoxyphosphorylmethoxymethyl(ethoxy)phosphoryl]oxyethane Chemical compound CCOP(=O)(OCC)COCP(=O)(OCC)OCC GYZSXGFOIMANOA-UHFFFAOYSA-N 0.000 description 1
- CHNYVNOFAWYUEG-UHFFFAOYSA-N 1h-pyrrole-3-carbaldehyde Chemical compound O=CC=1C=CNC=1 CHNYVNOFAWYUEG-UHFFFAOYSA-N 0.000 description 1
- DJYRZTCLVDKWBL-UHFFFAOYSA-N 2,3,5-trichlorobenzaldehyde Chemical compound ClC1=CC(Cl)=C(Cl)C(C=O)=C1 DJYRZTCLVDKWBL-UHFFFAOYSA-N 0.000 description 1
- BSWWXRFVMJHFBN-UHFFFAOYSA-N 2,4,6-tribromophenol Chemical compound OC1=C(Br)C=C(Br)C=C1Br BSWWXRFVMJHFBN-UHFFFAOYSA-N 0.000 description 1
- FFYPRJYSJODFFD-UHFFFAOYSA-N 2-amino-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical class O=C1NC(N)=NC2=C1NC=C2 FFYPRJYSJODFFD-UHFFFAOYSA-N 0.000 description 1
- APLOAWCINWKSAU-UHFFFAOYSA-N 2-amino-7-(1h-pyrrol-2-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1=CC=CN1 APLOAWCINWKSAU-UHFFFAOYSA-N 0.000 description 1
- IBBAQFFRWYAJRN-UHFFFAOYSA-N 2-amino-7-(1h-pyrrol-3-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC=1C=CNC=1 IBBAQFFRWYAJRN-UHFFFAOYSA-N 0.000 description 1
- WQICSJVYEIENAY-UHFFFAOYSA-N 2-amino-7-(4-bicyclo[2.2.1]hept-2-enylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound N1C(N)=NC(=O)C2=C1C(CC13CC(CC1)C=C3)=CN2 WQICSJVYEIENAY-UHFFFAOYSA-N 0.000 description 1
- OGZAOADBAIEEDA-UHFFFAOYSA-N 2-amino-7-(4-bicyclo[2.2.1]heptanylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound O=C1NC(N)=NC2=C1NC=C2CC1(C2)CCC2CC1 OGZAOADBAIEEDA-UHFFFAOYSA-N 0.000 description 1
- PNRJECMSZJPEOV-UHFFFAOYSA-N 2-amino-7-(4-bicyclo[2.2.2]octanylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C1CC(CC2)CCC12CC1=CNC2=C1N=C(N)NC2=O PNRJECMSZJPEOV-UHFFFAOYSA-N 0.000 description 1
- YETOLZGZWJOIJS-UHFFFAOYSA-N 2-amino-7-(5-bicyclo[3.2.1]octanylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C1C(CCC2)CCC12CC1=CNC2=C1N=C(N)NC2=O YETOLZGZWJOIJS-UHFFFAOYSA-N 0.000 description 1
- NUQBTQMVHRKTRO-UHFFFAOYSA-N 2-amino-7-(cycloheptylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1CCCCCC1 NUQBTQMVHRKTRO-UHFFFAOYSA-N 0.000 description 1
- VWZFXCVUFKBULH-UHFFFAOYSA-N 2-amino-7-(cyclohexen-1-yl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1C1=CCCCC1 VWZFXCVUFKBULH-UHFFFAOYSA-N 0.000 description 1
- ZEWVUZXPYBZKSJ-UHFFFAOYSA-N 2-amino-7-(cyclohexylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1CCCCC1 ZEWVUZXPYBZKSJ-UHFFFAOYSA-N 0.000 description 1
- SZYOVQIYDOFIQD-UHFFFAOYSA-N 2-amino-7-(oxan-4-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1CCOCC1 SZYOVQIYDOFIQD-UHFFFAOYSA-N 0.000 description 1
- FFFFDFWPELSFCP-UHFFFAOYSA-N 2-amino-7-(oxolan-2-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1CCCO1 FFFFDFWPELSFCP-UHFFFAOYSA-N 0.000 description 1
- PBLZNLXBRHBQJH-UHFFFAOYSA-N 2-amino-7-(oxolan-3-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1CCOC1 PBLZNLXBRHBQJH-UHFFFAOYSA-N 0.000 description 1
- BABDEQWVUOFVMU-UHFFFAOYSA-N 2-amino-7-(piperidin-2-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1CCCCN1 BABDEQWVUOFVMU-UHFFFAOYSA-N 0.000 description 1
- IWUYDPBODHDBML-UHFFFAOYSA-N 2-amino-7-(piperidin-3-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1CCCNC1 IWUYDPBODHDBML-UHFFFAOYSA-N 0.000 description 1
- YLWLHXYZTJYVER-UHFFFAOYSA-N 2-amino-7-(piperidin-4-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1CCNCC1 YLWLHXYZTJYVER-UHFFFAOYSA-N 0.000 description 1
- MQHSZSQKICPGTQ-UHFFFAOYSA-N 2-amino-7-(pyridin-2-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1=CC=CC=N1 MQHSZSQKICPGTQ-UHFFFAOYSA-N 0.000 description 1
- MABQSTXKBLIFAR-UHFFFAOYSA-N 2-amino-7-(pyridin-4-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1=CC=NC=C1 MABQSTXKBLIFAR-UHFFFAOYSA-N 0.000 description 1
- CVQAECOXCSPYPX-UHFFFAOYSA-N 2-amino-7-(pyrrolidin-2-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1CCCN1 CVQAECOXCSPYPX-UHFFFAOYSA-N 0.000 description 1
- VOXZHNHGSDRLGG-UHFFFAOYSA-N 2-amino-7-(pyrrolidin-3-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1CCNC1 VOXZHNHGSDRLGG-UHFFFAOYSA-N 0.000 description 1
- YYFKQPPPFQYGFO-UHFFFAOYSA-N 2-amino-7-(thiolan-2-ylmethyl)-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1CC1CCCS1 YYFKQPPPFQYGFO-UHFFFAOYSA-N 0.000 description 1
- ASPVOVZDVGTFBP-UHFFFAOYSA-N 2-amino-7-cyclohex-2-en-1-yl-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1C1CCCC=C1 ASPVOVZDVGTFBP-UHFFFAOYSA-N 0.000 description 1
- JGVNFQKRFUJJSZ-UHFFFAOYSA-N 2-amino-7-cyclohex-3-en-1-yl-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1C1CCC=CC1 JGVNFQKRFUJJSZ-UHFFFAOYSA-N 0.000 description 1
- ROKDRQZSBSPKDT-UHFFFAOYSA-N 2-amino-7-cyclohexyl-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1C1CCCCC1 ROKDRQZSBSPKDT-UHFFFAOYSA-N 0.000 description 1
- RCXJARRRXOPXBC-UHFFFAOYSA-N 2-bromoadamantane Chemical compound C1C(C2)CC3CC1C(Br)C2C3 RCXJARRRXOPXBC-UHFFFAOYSA-N 0.000 description 1
- DTAVQLQPRZSLID-UHFFFAOYSA-N 2-cyclohex-3-en-1-ylacetonitrile Chemical compound N#CCC1CCC=CC1 DTAVQLQPRZSLID-UHFFFAOYSA-N 0.000 description 1
- RLAHVWISADDSMD-UHFFFAOYSA-N 2-formyl-3-pyridin-3-ylpropanenitrile Chemical compound O=CC(C#N)CC1=CC=CN=C1 RLAHVWISADDSMD-UHFFFAOYSA-N 0.000 description 1
- WXWQJUNPKFWAEX-UHFFFAOYSA-N 2h-pyran-2-carbaldehyde Chemical compound O=CC1OC=CC=C1 WXWQJUNPKFWAEX-UHFFFAOYSA-N 0.000 description 1
- JNAMVBQCQXZUTA-UHFFFAOYSA-N 2h-pyran-3-carbaldehyde Chemical compound O=CC1=CC=COC1 JNAMVBQCQXZUTA-UHFFFAOYSA-N 0.000 description 1
- MCFYQEDDIWDFPJ-UHFFFAOYSA-N 2h-pyran-4-carbaldehyde Chemical compound O=CC1=CCOC=C1 MCFYQEDDIWDFPJ-UHFFFAOYSA-N 0.000 description 1
- OFVQKRSFAJZMKT-UHFFFAOYSA-N 3-(1-adamantyl)propanenitrile Chemical compound C1C(C2)CC3CC2CC1(CCC#N)C3 OFVQKRSFAJZMKT-UHFFFAOYSA-N 0.000 description 1
- MGVNWVRFYLTILM-UHFFFAOYSA-N 3-(2-amino-4-oxo-1,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)-3-phenylpropanamide Chemical compound C=1NC(C(NC(N)=N2)=O)=C2C=1C(CC(=O)N)C1=CC=CC=C1 MGVNWVRFYLTILM-UHFFFAOYSA-N 0.000 description 1
- XOEJFHLULPTTDD-UHFFFAOYSA-N 3-(2-amino-4-oxo-1,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)-3-phenylpropanenitrile Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1C(CC#N)C1=CC=CC=C1 XOEJFHLULPTTDD-UHFFFAOYSA-N 0.000 description 1
- VEDWLJMIJINPSJ-UHFFFAOYSA-N 3-(2-amino-4-oxo-1,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)-3-phenylpropanoic acid Chemical compound C=1NC=2C(=O)NC(N)=NC=2C=1C(CC(O)=O)C1=CC=CC=C1 VEDWLJMIJINPSJ-UHFFFAOYSA-N 0.000 description 1
- FHIREINWQNIRIN-UHFFFAOYSA-N 3-(2h-pyran-2-yl)propanenitrile Chemical compound N#CCCC1OC=CC=C1 FHIREINWQNIRIN-UHFFFAOYSA-N 0.000 description 1
- BPVJQLPIRZNEDO-UHFFFAOYSA-N 3-(2h-pyran-3-yl)propanenitrile Chemical compound N#CCCC1=CC=COC1 BPVJQLPIRZNEDO-UHFFFAOYSA-N 0.000 description 1
- KKFDWYIRXIBCAL-UHFFFAOYSA-N 3-(2h-pyran-4-yl)propanenitrile Chemical compound N#CCCC1=CCOC=C1 KKFDWYIRXIBCAL-UHFFFAOYSA-N 0.000 description 1
- PTUWXKPZLMKPRI-UHFFFAOYSA-N 3-(3-bicyclo[2.2.1]heptanyl)propanenitrile Chemical compound C1CC2C(CCC#N)CC1C2 PTUWXKPZLMKPRI-UHFFFAOYSA-N 0.000 description 1
- VULKWRJGNYFTFX-UHFFFAOYSA-N 3-(3-bicyclo[2.2.2]octanyl)propanenitrile Chemical compound C1CC2C(CCC#N)CC1CC2 VULKWRJGNYFTFX-UHFFFAOYSA-N 0.000 description 1
- XIRPXXXBROXIRK-UHFFFAOYSA-N 3-(3-bicyclo[3.2.1]octanyl)propanenitrile Chemical compound C1C(CCC#N)CC2CCC1C2 XIRPXXXBROXIRK-UHFFFAOYSA-N 0.000 description 1
- MYRGCHDQUWCHAA-UHFFFAOYSA-N 3-(3-bicyclo[3.3.1]nonanyl)propanenitrile Chemical compound C1CCC2CC(CCC#N)CC1C2 MYRGCHDQUWCHAA-UHFFFAOYSA-N 0.000 description 1
- ISRDHMXBDIGJQX-UHFFFAOYSA-N 3-(3-chlorophenyl)pentanedinitrile Chemical compound ClC1=CC=CC(C(CC#N)CC#N)=C1 ISRDHMXBDIGJQX-UHFFFAOYSA-N 0.000 description 1
- XVFJTUWWYKRTGI-UHFFFAOYSA-N 3-(4-bicyclo[2.2.1]hept-2-enyl)propanenitrile Chemical compound C1CC2C=CC1(CCC#N)C2 XVFJTUWWYKRTGI-UHFFFAOYSA-N 0.000 description 1
- NHKGSKKUXIWDNS-UHFFFAOYSA-N 3-(4-bicyclo[2.2.1]heptanyl)propanenitrile Chemical compound C1CC2CCC1(CCC#N)C2 NHKGSKKUXIWDNS-UHFFFAOYSA-N 0.000 description 1
- GPCMMCYJNSBSDB-UHFFFAOYSA-N 3-(4-bicyclo[2.2.2]octanyl)propanenitrile Chemical compound C1CC2CCC1(CCC#N)CC2 GPCMMCYJNSBSDB-UHFFFAOYSA-N 0.000 description 1
- YLUQBQVJUJPVCB-UHFFFAOYSA-N 3-(4-bicyclo[3.2.1]octanyl)propanenitrile Chemical compound N#CCCC1CCC2CCC1C2 YLUQBQVJUJPVCB-UHFFFAOYSA-N 0.000 description 1
- LLWVCUMDENBBDU-UHFFFAOYSA-N 3-(5-bicyclo[3.2.1]octanyl)propanenitrile Chemical compound C1C2CCC1(CCC#N)CCC2 LLWVCUMDENBBDU-UHFFFAOYSA-N 0.000 description 1
- MIEXVGLAIIFUIC-UHFFFAOYSA-N 3-(5-bicyclo[3.3.1]nonanyl)propanenitrile Chemical compound C1CCC2CCCC1(CCC#N)C2 MIEXVGLAIIFUIC-UHFFFAOYSA-N 0.000 description 1
- DFFDTYCJRZHOGQ-UHFFFAOYSA-N 3-(6-bicyclo[3.2.1]octanyl)propanenitrile Chemical compound C1C2C(CCC#N)CC1CCC2 DFFDTYCJRZHOGQ-UHFFFAOYSA-N 0.000 description 1
- ACXHQVCRXQPZAR-UHFFFAOYSA-N 3-(8-bicyclo[3.2.1]octanyl)propanenitrile Chemical compound C1CCC2CCC1C2CCC#N ACXHQVCRXQPZAR-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- QXYOAWHKJRWNID-UHFFFAOYSA-N 3-bromobicyclo[2.2.1]heptane Chemical compound C1CC2C(Br)CC1C2 QXYOAWHKJRWNID-UHFFFAOYSA-N 0.000 description 1
- SFAAKNFUDVMJAE-UHFFFAOYSA-N 3-bromobicyclo[2.2.2]octane Chemical group C1CC2C(Br)CC1CC2 SFAAKNFUDVMJAE-UHFFFAOYSA-N 0.000 description 1
- UQEMCUFBIHKAEI-UHFFFAOYSA-N 3-bromobicyclo[3.2.1]octane Chemical compound C1C(Br)CC2CCC1C2 UQEMCUFBIHKAEI-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- DCUFUDCBTIJNDU-UHFFFAOYSA-N 3-pyridin-2-ylpropanoyl chloride Chemical compound ClC(=O)CCC1=CC=CC=N1 DCUFUDCBTIJNDU-UHFFFAOYSA-N 0.000 description 1
- CNHMTMHYYONLOV-UHFFFAOYSA-N 3-pyridin-3-ylprop-2-enenitrile Chemical compound N#CC=CC1=CC=CN=C1 CNHMTMHYYONLOV-UHFFFAOYSA-N 0.000 description 1
- GCAVYPNOOWBODM-UHFFFAOYSA-N 4-[4-hydroxy-3-[(4-hydroxy-3-methoxyphenyl)methyl]-2-(hydroxymethyl)butyl]benzene-1,2-diol Chemical compound C1=C(O)C(OC)=CC(CC(CO)C(CO)CC=2C=C(O)C(O)=CC=2)=C1 GCAVYPNOOWBODM-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- WZFDQEVHTWNVHQ-UHFFFAOYSA-N 4-bromobicyclo[2.2.1]hept-2-ene Chemical compound C1CC2C=CC1(Br)C2 WZFDQEVHTWNVHQ-UHFFFAOYSA-N 0.000 description 1
- IBGQMFDJANKDLZ-UHFFFAOYSA-N 4-bromobicyclo[2.2.1]heptane Chemical compound C1CC2CCC1(Br)C2 IBGQMFDJANKDLZ-UHFFFAOYSA-N 0.000 description 1
- GKIJLFQCRFWQCZ-UHFFFAOYSA-N 4-bromobicyclo[2.2.2]octane Chemical compound C1CC2CCC1(Br)CC2 GKIJLFQCRFWQCZ-UHFFFAOYSA-N 0.000 description 1
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 1
- AMGNUIPDCBVJPO-UHFFFAOYSA-N 5-bromobicyclo[3.2.1]octane Chemical compound C1C2CCC1(Br)CCC2 AMGNUIPDCBVJPO-UHFFFAOYSA-N 0.000 description 1
- TUBDWQVBXFHXSS-UHFFFAOYSA-N 5-bromobicyclo[3.3.1]nonane Chemical compound C1CCC2CCCC1(Br)C2 TUBDWQVBXFHXSS-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- YXEVAMHJUOPSFO-UHFFFAOYSA-N 8-bromobicyclo[3.2.1]octane Chemical compound C1CCC2CCC1C2Br YXEVAMHJUOPSFO-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 239000004368 Modified starch Substances 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- QPFYXYFORQJZEC-FOCLMDBBSA-N Phenazopyridine Chemical class NC1=NC(N)=CC=C1\N=N\C1=CC=CC=C1 QPFYXYFORQJZEC-FOCLMDBBSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 239000012980 RPMI-1640 medium Substances 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 241000172502 Thryothorus mystacalis Species 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 206010052779 Transplant rejections Diseases 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- UGQMRVRMYYASKQ-RTCWRAIWSA-N [14C@@H]1([C@H](O)[C@H](O)[C@@H](CO)O1)N1C=NC=2C(O)=NC=NC12 Chemical compound [14C@@H]1([C@H](O)[C@H](O)[C@@H](CO)O1)N1C=NC=2C(O)=NC=NC12 UGQMRVRMYYASKQ-RTCWRAIWSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000008360 acrylonitriles Chemical class 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000002820 allylidene group Chemical group [H]C(=[*])C([H])=C([H])[H] 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000005915 ammonolysis reaction Methods 0.000 description 1
- WFKAJVHLWXSISD-UHFFFAOYSA-N anhydrous dimethyl-acetamide Natural products CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 1
- 239000002259 anti human immunodeficiency virus agent Substances 0.000 description 1
- 229940041181 antineoplastic drug Drugs 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- AAMATCKFMHVIDO-UHFFFAOYSA-N azane;1h-pyrrole Chemical compound N.C=1C=CNC=1 AAMATCKFMHVIDO-UHFFFAOYSA-N 0.000 description 1
- 210000003719 b-lymphocyte Anatomy 0.000 description 1
- 229940054066 benzamide antipsychotics Drugs 0.000 description 1
- 150000003936 benzamides Chemical class 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- HMCGOXDZKSJAIR-UHFFFAOYSA-N bicyclo[3.2.1]octane-5-carbaldehyde Chemical compound C1C2CCC1(C=O)CCC2 HMCGOXDZKSJAIR-UHFFFAOYSA-N 0.000 description 1
- SKTMMSQPXGWCAP-UHFFFAOYSA-N bicyclo[3.3.1]nonan-9-one Chemical compound C1CCC2CCCC1C2=O SKTMMSQPXGWCAP-UHFFFAOYSA-N 0.000 description 1
- BRAXXURPTXSRSZ-UHFFFAOYSA-N bicyclo[3.3.1]nonane-4-carbaldehyde Chemical compound C1CCC2C(C=O)CCC1C2 BRAXXURPTXSRSZ-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- LOXORFRCPXUORP-UHFFFAOYSA-N bromo-Cycloheptane Chemical compound BrC1CCCCCC1 LOXORFRCPXUORP-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 230000007969 cellular immunity Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- QSKWJTXWJJOJFP-UHFFFAOYSA-N chloroform;ethoxyethane Chemical compound ClC(Cl)Cl.CCOCC QSKWJTXWJJOJFP-UHFFFAOYSA-N 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 150000001925 cycloalkenes Chemical class 0.000 description 1
- HJZLEGIHUQOJBA-UHFFFAOYSA-N cyclohexane propionic acid Chemical compound OC(=O)CCC1CCCCC1 HJZLEGIHUQOJBA-UHFFFAOYSA-N 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- 239000000644 isotonic solution Substances 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- GUWHRJQTTVADPB-UHFFFAOYSA-N lithium azide Chemical compound [Li+].[N-]=[N+]=[N-] GUWHRJQTTVADPB-UHFFFAOYSA-N 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- DKGYLXHIKYLDKL-UHFFFAOYSA-N methyl 3-(2-amino-4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidin-7-yl)-3-phenylpropanoate Chemical compound COC(CC(C1=CC=CC=C1)C1=CNC2=C1N=C(NC2=O)N)=O DKGYLXHIKYLDKL-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000004312 morpholin-2-yl group Chemical group [H]N1C([H])([H])C([H])([H])OC([H])(*)C1([H])[H] 0.000 description 1
- 125000004572 morpholin-3-yl group Chemical group N1C(COCC1)* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- MRWXACSTFXYYMV-FDDDBJFASA-N nebularine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC=NC=C2N=C1 MRWXACSTFXYYMV-FDDDBJFASA-N 0.000 description 1
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 229940021222 peritoneal dialysis isotonic solution Drugs 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 1
- 125000006513 pyridinyl methyl group Chemical group 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- WVIICGIFSIBFOG-UHFFFAOYSA-N pyrylium Chemical class C1=CC=[O+]C=C1 WVIICGIFSIBFOG-UHFFFAOYSA-N 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 1
- 238000004114 suspension culture Methods 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- PCFIPYFVXDCWBW-UHFFFAOYSA-N tricyclo[3.3.1.03,7]nonane Chemical compound C1C(C2)C3CC2CC1C3 PCFIPYFVXDCWBW-UHFFFAOYSA-N 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- YRYSAWZMIRQUBO-UHFFFAOYSA-N trimethylsulfoxonium Chemical compound C[S+](C)(C)=O YRYSAWZMIRQUBO-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/31—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/32—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring
- C07C255/35—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring the carbon skeleton being further substituted by halogen atoms, or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/32—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring
- C07C255/40—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring the carbon skeleton being further substituted by doubly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/32—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring
- C07C255/42—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring the carbon skeleton being further substituted by singly-bound nitrogen atoms, not being further bound to other hetero atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Virology (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Pyrrole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/429,100 US4985433A (en) | 1989-10-31 | 1989-10-31 | 2-amino-7-(pyridinylmethyl)-3H,5H-pyrrolo[3,2-d]pyrimidin-4-ones and pharmaceutical uses and compositions containing the same |
| US07/429,099 US5008265A (en) | 1989-10-31 | 1989-10-31 | 2-amino-7-(alicyclomethyl)-3H,5H,-pyrrolo[3,2-d]pyrimidin-4-ones and pharmaceutical uses and compositions containing the same |
| US429,099 | 1989-10-31 | ||
| US429,098 | 1989-10-31 | ||
| US07/429,098 US4985434A (en) | 1989-10-31 | 1989-10-31 | 7-substituted derivatives of 2-amino-3H,5H-pyrrolo(3,2-d)pyrimidin-4-ones and pharamceutical uses and compositions containing the same |
| US07/429,097 US5008270A (en) | 1989-10-31 | 1989-10-31 | 2-amino-7-(heterocyclomethyl)-3H,5H-pyrrolo[3,2-d]pyrimidin-4-ones and pharmaceutical uses and compositions containing the same |
| US429,097 | 1989-10-31 | ||
| US429,100 | 1989-10-31 | ||
| US44279889A | 1989-11-29 | 1989-11-29 | |
| US442,798 | 1989-11-29 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPH05504551A JPH05504551A (ja) | 1993-07-15 |
| JP2866478B2 true JP2866478B2 (ja) | 1999-03-08 |
Family
ID=27541578
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2515550A Expired - Lifetime JP2866478B2 (ja) | 1989-10-31 | 1990-10-12 | プリンヌクレオシドホスホリラーゼの阻害剤 |
Country Status (9)
| Country | Link |
|---|---|
| EP (1) | EP0500653A4 (fi) |
| JP (1) | JP2866478B2 (fi) |
| AU (1) | AU654264B2 (fi) |
| CA (1) | CA2072123C (fi) |
| FI (1) | FI103972B (fi) |
| HU (1) | HUT61765A (fi) |
| LV (1) | LV10100B (fi) |
| NO (1) | NO301423B1 (fi) |
| WO (1) | WO1991006548A1 (fi) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5726311A (en) * | 1989-11-29 | 1998-03-10 | Biocryst Pharmaceuticals, Inc. | 7-disubstituted-methyl-4-oxo-3H,5H-pyrrolo 3,2-d!pyrimidine and pharmaceutical uses and compositions containing the same |
| US5236926A (en) * | 1992-02-03 | 1993-08-17 | Warner-Lambert Company | 9-substituted-8-halo or -8-hydroxy-9-deazaguanines as inhibitors or PNP for pharmaceutical compositions |
| RU94046387A (ru) * | 1992-04-21 | 1996-09-27 | Биокрист Фармасьютикалз | Производные пиримидина, способ их получения, фармацевтическая композиция, ее применение и промежуточные продукты |
| BR9509236A (pt) * | 1994-10-05 | 1997-10-21 | Chiroscience Ltd | Compostos purina e guanina como inibidores de pnp |
| GB9520363D0 (en) * | 1995-10-05 | 1995-12-06 | Chiroscience Ltd | Compounds |
| GB9520364D0 (en) * | 1995-10-05 | 1995-12-06 | Chiroscience Ltd | Compouundds |
| BR9809178A (pt) * | 1997-05-29 | 2000-08-01 | Novartis Ag | 2-amino-7-(1-substituìdo-2-hidroxietil)-3,5-dihidro-pir rolo[3,2-d]pirimidin-4-onas |
| US6174888B1 (en) | 1998-05-28 | 2001-01-16 | Novartis Ag | 2-amino-7-(1-substituted-2-hydroxyethyl)-3,5-dihydropyrrolo[3,2-D]pyrimidin-4-ones |
| JP4496586B2 (ja) * | 2000-01-24 | 2010-07-07 | 日産化学工業株式会社 | キノリルアクリロニトリルの製造法及びその中間体 |
| CN100379750C (zh) * | 2002-08-21 | 2008-04-09 | 阿尔伯爱因斯坦医科叶希瓦大学 | 核苷磷酸化酶和核苷酶抑制剂 |
| NZ523970A (en) * | 2003-02-04 | 2005-02-25 | Ind Res Ltd | Process for preparing inhibitors of nucleoside phoshorylases and nucleosidases |
| CA2710039C (en) | 2007-12-26 | 2018-07-03 | Critical Outcome Technologies, Inc. | Semicarbazones, thiosemicarbazones and related compounds and methods for treatment of cancer |
| WO2010006438A1 (en) | 2008-07-17 | 2010-01-21 | Critical Outcome Technologies Inc. | Thiosemicarbazone inhibitor compounds and cancer treatment methods |
| US8987272B2 (en) | 2010-04-01 | 2015-03-24 | Critical Outcome Technologies Inc. | Compounds and method for treatment of HIV |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5988484A (ja) * | 1982-11-09 | 1984-05-22 | Takeda Chem Ind Ltd | 新規７−デアザプリン誘導体 |
| CA1293727C (en) * | 1986-08-26 | 1991-12-31 | Catherine Rose Kostlan | 9-deazaguanines |
| US4921858A (en) * | 1986-10-24 | 1990-05-01 | Warner-Lambert Company | 7-deazaguanines as immunomodulators |
| CA1294960C (en) * | 1986-10-24 | 1992-01-28 | Thomas C. Malone | 7-deazaguanines as immunomodulators |
| DE3726044A1 (de) * | 1987-02-11 | 1988-08-25 | Bayer Ag | Akarizide mittel auf basis von azomethinderivaten und azomethine des 2,3-diaminomaleinsaeurenitrils |
| US4927830A (en) * | 1988-04-08 | 1990-05-22 | The Regents Of The University Of Michigan | Acyclic pyrrolo[2,3-D]pyrimidine analogs as antiviral agents |
| JP2760364B2 (ja) * | 1989-02-27 | 1998-05-28 | バイオクライシス・ファーマシューティカルズ、インコーポレイテッド | ９―置換―８―非置換―９―デアザグアニン類 |
| US4985434A (en) * | 1989-10-31 | 1991-01-15 | Biocryst, Inc. | 7-substituted derivatives of 2-amino-3H,5H-pyrrolo(3,2-d)pyrimidin-4-ones and pharamceutical uses and compositions containing the same |
| US4985433A (en) * | 1989-10-31 | 1991-01-15 | Biocryst, Inc. | 2-amino-7-(pyridinylmethyl)-3H,5H-pyrrolo[3,2-d]pyrimidin-4-ones and pharmaceutical uses and compositions containing the same |
-
1990
- 1990-10-12 CA CA002072123A patent/CA2072123C/en not_active Expired - Fee Related
- 1990-10-12 HU HU9201450A patent/HUT61765A/hu unknown
- 1990-10-12 WO PCT/US1990/005756 patent/WO1991006548A1/en not_active Application Discontinuation
- 1990-10-12 JP JP2515550A patent/JP2866478B2/ja not_active Expired - Lifetime
- 1990-10-12 EP EP90916628A patent/EP0500653A4/en not_active Withdrawn
- 1990-10-12 AU AU67125/90A patent/AU654264B2/en not_active Ceased
-
1992
- 1992-04-28 FI FI921900A patent/FI103972B/fi active
- 1992-04-29 NO NO921679A patent/NO301423B1/no not_active IP Right Cessation
-
1993
- 1993-05-14 LV LVP-93-342A patent/LV10100B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| LV10100A (lv) | 1994-05-10 |
| EP0500653A1 (en) | 1992-09-02 |
| FI103972B1 (fi) | 1999-10-29 |
| HUT61765A (en) | 1993-03-01 |
| FI921900A0 (fi) | 1992-04-28 |
| LV10100B (en) | 1995-08-20 |
| WO1991006548A1 (en) | 1991-05-16 |
| CA2072123A1 (en) | 1991-05-01 |
| AU654264B2 (en) | 1994-11-03 |
| AU6712590A (en) | 1991-05-31 |
| NO301423B1 (no) | 1997-10-27 |
| FI921900A (fi) | 1992-04-28 |
| EP0500653A4 (en) | 1995-08-23 |
| NO921679L (no) | 1992-06-17 |
| HU9201450D0 (en) | 1992-09-28 |
| CA2072123C (en) | 2001-06-12 |
| FI103972B (fi) | 1999-10-29 |
| NO921679D0 (no) | 1992-04-29 |
| JPH05504551A (ja) | 1993-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2866478B2 (ja) | プリンヌクレオシドホスホリラーゼの阻害剤 | |
| RU2493157C2 (ru) | ПРОИЗВОДНЫЕ ПИРРОЛО[2,3-d]ПИРИМИДИНА | |
| US7196111B2 (en) | Pyrazolo[1,5a]pyrimidine compounds as antiviral agents | |
| WO2012046030A2 (en) | Phosphodiesterase inhibitors | |
| KR20120102604A (ko) | 3-（4-（7Ｈ-피롤로〔2,3-ｄ〕피리미딘-4-일）-1Ｈ-피라졸-1-일）-3-사이클로펜틸프로판니트릴의 하이드록실, 케토 및 글루쿠로나이드 유도체 | |
| AU2022216707B2 (en) | Heterocyclic compound, and intermediate thereof, preparation method therefor and use thereof | |
| LT3448B (en) | Inhibitors of purine nucleoside phosphorylase and process for preparing thereof | |
| US5008265A (en) | 2-amino-7-(alicyclomethyl)-3H,5H,-pyrrolo[3,2-d]pyrimidin-4-ones and pharmaceutical uses and compositions containing the same | |
| EP0460116B1 (en) | 9-substituted-8-unsubstituted-9-deazaguanines | |
| JP2595254B2 (ja) | 新規な９−デアザグアニン類 | |
| JP2001520655A (ja) | ５，７−ジ置換４−アミノピリド［２，３−ｄ］ピリミジン化合物およびアデノシンキナーゼ阻害剤としてのその用途 | |
| US4985433A (en) | 2-amino-7-(pyridinylmethyl)-3H,5H-pyrrolo[3,2-d]pyrimidin-4-ones and pharmaceutical uses and compositions containing the same | |
| US5189039A (en) | 7-disubstituted-methyl-4-oxo-3H,5H-pyrrolo[3,2d]pyrimidine and pharmaceutical uses and compositions containing the same | |
| AU4276693A (en) | 7-disubstituted-methyl-4-oxo-3H,5H-pyrrolo(3,2-d)pyrim idine and pharmaceutical uses and compositions containing the same | |
| Szennyes et al. | The first general synthesis of 2-C-(β-D-glycopyranosyl) pyrimidines and their evaluation as inhibitors of some glycoenzymes | |
| KR20070015372A (ko) | 인지, 집중력, 학습 효율 및/또는 기억력을 개선하기위하여 사용되는 6-아미노-5-시아노-피리미딘-4-온 | |
| KR20060036396A (ko) | 2-치환페닐-5,7-디알킬-3,7-디하이드로피롤[2,3-ｄ]피리미딘-4-온유도체, 그의 제법 및 약학적 용도 | |
| US5726311A (en) | 7-disubstituted-methyl-4-oxo-3H,5H-pyrrolo 3,2-d!pyrimidine and pharmaceutical uses and compositions containing the same | |
| RU2097384C1 (ru) | Производные 2-амино-7-(chr2r3)-3н,5н-пирроло[3,2-d]-пиримидин-4-она, способы их получения и способ селективного ингибирования пролиферации т-лимфоцитов млекопитающего и не оказывающий воздействия на b-лимфоциты | |
| Su et al. | Pyrimidines. 21. Novel reactions of 5‐cyano‐1, 3‐dimethyluracil with carbon nucleophiles. A facile preparation of certain pyrido [2, 3‐d] pyrimidines | |
| JPH0417195B2 (fi) | ||
| CN115916217A (zh) | 用于治疗戊型肝炎的炔基核苷类似物 | |
| AT395156B (de) | Neue 9-deazaguanine | |
| CZ360199A3 (cs) | Sloučeniny 6,7-disubstituovaného-4- aminopyrido [2,3-dJ pyrimidinu | |
| CN103848835A (zh) | 二肽基肽酶-iv抑制剂、其用途及其中间体和中间体的制备方法 |