JP2019532953A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2019532953A5 JP2019532953A5 JP2019517396A JP2019517396A JP2019532953A5 JP 2019532953 A5 JP2019532953 A5 JP 2019532953A5 JP 2019517396 A JP2019517396 A JP 2019517396A JP 2019517396 A JP2019517396 A JP 2019517396A JP 2019532953 A5 JP2019532953 A5 JP 2019532953A5
- Authority
- JP
- Japan
- Prior art keywords
- seq
- immune effector
- amino acid
- cancer
- effector cells
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 210000004027 cell Anatomy 0.000 claims description 217
- 239000012642 immune effector Substances 0.000 claims description 166
- 229940121354 immunomodulator Drugs 0.000 claims description 166
- 229940123628 Lysine (K)-specific demethylase 1A inhibitor Drugs 0.000 claims description 161
- 125000003275 alpha amino acid group Chemical group 0.000 claims description 114
- 238000000034 method Methods 0.000 claims description 86
- 206010028980 Neoplasm Diseases 0.000 claims description 57
- -1 3-Amino-2-methylphenyl Chemical group 0.000 claims description 55
- 210000001744 T-lymphocyte Anatomy 0.000 claims description 50
- 230000011664 signaling Effects 0.000 claims description 46
- 239000000427 antigen Substances 0.000 claims description 42
- 108091007433 antigens Proteins 0.000 claims description 42
- 102000036639 antigens Human genes 0.000 claims description 42
- 102100040678 Programmed cell death protein 1 Human genes 0.000 claims description 39
- 101710089372 Programmed cell death protein 1 Proteins 0.000 claims description 39
- 101001050886 Homo sapiens Lysine-specific histone demethylase 1A Proteins 0.000 claims description 38
- 102100024985 Lysine-specific histone demethylase 1A Human genes 0.000 claims description 38
- 102000039446 nucleic acids Human genes 0.000 claims description 31
- 108020004707 nucleic acids Proteins 0.000 claims description 31
- 150000007523 nucleic acids Chemical class 0.000 claims description 31
- 201000011510 cancer Diseases 0.000 claims description 26
- 102100024222 B-lymphocyte antigen CD19 Human genes 0.000 claims description 25
- 101000980825 Homo sapiens B-lymphocyte antigen CD19 Proteins 0.000 claims description 25
- 238000012986 modification Methods 0.000 claims description 23
- 230000004048 modification Effects 0.000 claims description 23
- 238000010362 genome editing Methods 0.000 claims description 21
- 108090000623 proteins and genes Proteins 0.000 claims description 21
- 230000000139 costimulatory effect Effects 0.000 claims description 19
- 230000004068 intracellular signaling Effects 0.000 claims description 19
- BPRGWKSMZBWWAY-UHFFFAOYSA-N 3-(3-amino-2-methylphenyl)-1-(4-methoxyphenyl)-6-methylindole-5-carbonitrile Chemical compound NC=1C(=C(C=CC=1)C1=CN(C2=CC(=C(C=C12)C#N)C)C1=CC=C(C=C1)OC)C BPRGWKSMZBWWAY-UHFFFAOYSA-N 0.000 claims description 17
- 102000004169 proteins and genes Human genes 0.000 claims description 17
- 102100029215 Signaling lymphocytic activation molecule Human genes 0.000 claims description 15
- 108091027967 Small hairpin RNA Proteins 0.000 claims description 15
- 239000004055 small Interfering RNA Substances 0.000 claims description 15
- 101150046249 Havcr2 gene Proteins 0.000 claims description 14
- 102100034458 Hepatitis A virus cellular receptor 2 Human genes 0.000 claims description 14
- 101001018097 Homo sapiens L-selectin Proteins 0.000 claims description 14
- 102100033467 L-selectin Human genes 0.000 claims description 14
- 101150030213 Lag3 gene Proteins 0.000 claims description 14
- BGFTWECWAICPDG-UHFFFAOYSA-N 2-[bis(4-chlorophenyl)methyl]-4-n-[3-[bis(4-chlorophenyl)methyl]-4-(dimethylamino)phenyl]-1-n,1-n-dimethylbenzene-1,4-diamine Chemical compound C1=C(C(C=2C=CC(Cl)=CC=2)C=2C=CC(Cl)=CC=2)C(N(C)C)=CC=C1NC(C=1)=CC=C(N(C)C)C=1C(C=1C=CC(Cl)=CC=1)C1=CC=C(Cl)C=C1 BGFTWECWAICPDG-UHFFFAOYSA-N 0.000 claims description 13
- 102000006942 B-Cell Maturation Antigen Human genes 0.000 claims description 13
- 108010008014 B-Cell Maturation Antigen Proteins 0.000 claims description 13
- 102100024263 CD160 antigen Human genes 0.000 claims description 12
- 101000761938 Homo sapiens CD160 antigen Proteins 0.000 claims description 12
- 101000994375 Homo sapiens Integrin alpha-4 Proteins 0.000 claims description 12
- 101000633786 Homo sapiens SLAM family member 6 Proteins 0.000 claims description 12
- 102100032818 Integrin alpha-4 Human genes 0.000 claims description 12
- 101150097636 LSD1 gene Proteins 0.000 claims description 12
- 102100029197 SLAM family member 6 Human genes 0.000 claims description 12
- 108010078373 tisagenlecleucel Proteins 0.000 claims description 11
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 claims description 10
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 claims description 10
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 claims description 10
- 206010039491 Sarcoma Diseases 0.000 claims description 10
- 239000012634 fragment Substances 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 10
- 108010017842 Telomerase Proteins 0.000 claims description 9
- 230000000295 complement effect Effects 0.000 claims description 9
- 230000001105 regulatory effect Effects 0.000 claims description 9
- 150000003384 small molecules Chemical class 0.000 claims description 9
- FWMNVWWHGCHHJJ-SKKKGAJSSA-N 4-amino-1-[(2r)-6-amino-2-[[(2r)-2-[[(2r)-2-[[(2r)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]piperidine-4-carboxylic acid Chemical compound C([C@H](C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N1CCC(N)(CC1)C(O)=O)NC(=O)[C@H](N)CC=1C=CC=CC=1)C1=CC=CC=C1 FWMNVWWHGCHHJJ-SKKKGAJSSA-N 0.000 claims description 8
- 102100026094 C-type lectin domain family 12 member A Human genes 0.000 claims description 8
- 102100038077 CD226 antigen Human genes 0.000 claims description 8
- 102100038078 CD276 antigen Human genes 0.000 claims description 8
- 102100024633 Carbonic anhydrase 2 Human genes 0.000 claims description 8
- 102100038083 Endosialin Human genes 0.000 claims description 8
- 101000884298 Homo sapiens CD226 antigen Proteins 0.000 claims description 8
- 101000760643 Homo sapiens Carbonic anhydrase 2 Proteins 0.000 claims description 8
- 101000884275 Homo sapiens Endosialin Proteins 0.000 claims description 8
- 101001078158 Homo sapiens Integrin alpha-1 Proteins 0.000 claims description 8
- 101001035237 Homo sapiens Integrin alpha-D Proteins 0.000 claims description 8
- 101001046687 Homo sapiens Integrin alpha-E Proteins 0.000 claims description 8
- 101000935043 Homo sapiens Integrin beta-1 Proteins 0.000 claims description 8
- 101000935040 Homo sapiens Integrin beta-2 Proteins 0.000 claims description 8
- 101000971538 Homo sapiens Killer cell lectin-like receptor subfamily F member 1 Proteins 0.000 claims description 8
- 101000633780 Homo sapiens Signaling lymphocytic activation molecule Proteins 0.000 claims description 8
- 101000716102 Homo sapiens T-cell surface glycoprotein CD4 Proteins 0.000 claims description 8
- 101000851376 Homo sapiens Tumor necrosis factor receptor superfamily member 8 Proteins 0.000 claims description 8
- 108010021625 Immunoglobulin Fragments Proteins 0.000 claims description 8
- 102000008394 Immunoglobulin Fragments Human genes 0.000 claims description 8
- 102100025323 Integrin alpha-1 Human genes 0.000 claims description 8
- 102100039904 Integrin alpha-D Human genes 0.000 claims description 8
- 102100022341 Integrin alpha-E Human genes 0.000 claims description 8
- 102100022338 Integrin alpha-M Human genes 0.000 claims description 8
- 102100022297 Integrin alpha-X Human genes 0.000 claims description 8
- 102100025304 Integrin beta-1 Human genes 0.000 claims description 8
- 102100025390 Integrin beta-2 Human genes 0.000 claims description 8
- 102100021458 Killer cell lectin-like receptor subfamily F member 1 Human genes 0.000 claims description 8
- 102100038082 Natural killer cell receptor 2B4 Human genes 0.000 claims description 8
- 102000014128 RANK Ligand Human genes 0.000 claims description 8
- 108010025832 RANK Ligand Proteins 0.000 claims description 8
- 102100027744 Semaphorin-4D Human genes 0.000 claims description 8
- 102100036011 T-cell surface glycoprotein CD4 Human genes 0.000 claims description 8
- 102100036857 Tumor necrosis factor receptor superfamily member 8 Human genes 0.000 claims description 8
- 208000035269 cancer or benign tumor Diseases 0.000 claims description 8
- 102000004127 Cytokines Human genes 0.000 claims description 7
- 108090000695 Cytokines Proteins 0.000 claims description 7
- 101000633782 Homo sapiens SLAM family member 8 Proteins 0.000 claims description 7
- 101150106931 IFNG gene Proteins 0.000 claims description 7
- 108010002350 Interleukin-2 Proteins 0.000 claims description 7
- 102100029214 SLAM family member 8 Human genes 0.000 claims description 7
- 108010074687 Signaling Lymphocytic Activation Molecule Family Member 1 Proteins 0.000 claims description 7
- 102100028785 Tumor necrosis factor receptor superfamily member 14 Human genes 0.000 claims description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 7
- 230000037431 insertion Effects 0.000 claims description 7
- 238000003780 insertion Methods 0.000 claims description 7
- 201000001441 melanoma Diseases 0.000 claims description 7
- 230000035755 proliferation Effects 0.000 claims description 7
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 6
- 108091033409 CRISPR Proteins 0.000 claims description 6
- 238000010354 CRISPR gene editing Methods 0.000 claims description 6
- 102000003964 Histone deacetylase Human genes 0.000 claims description 6
- 108090000353 Histone deacetylase Proteins 0.000 claims description 6
- 208000017604 Hodgkin disease Diseases 0.000 claims description 6
- 208000010747 Hodgkins lymphoma Diseases 0.000 claims description 6
- 201000003793 Myelodysplastic syndrome Diseases 0.000 claims description 6
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 claims description 6
- 208000015634 Rectal Neoplasms Diseases 0.000 claims description 6
- 108020004459 Small interfering RNA Proteins 0.000 claims description 6
- 208000006593 Urologic Neoplasms Diseases 0.000 claims description 6
- 208000002495 Uterine Neoplasms Diseases 0.000 claims description 6
- 210000003169 central nervous system Anatomy 0.000 claims description 6
- 201000003444 follicular lymphoma Diseases 0.000 claims description 6
- 206010038038 rectal cancer Diseases 0.000 claims description 6
- 201000001275 rectum cancer Diseases 0.000 claims description 6
- 206010046766 uterine cancer Diseases 0.000 claims description 6
- 208000010839 B-cell chronic lymphocytic leukemia Diseases 0.000 claims description 5
- 208000010833 Chronic myeloid leukaemia Diseases 0.000 claims description 5
- 101000608769 Homo sapiens Galectin-8 Proteins 0.000 claims description 5
- 206010025323 Lymphomas Diseases 0.000 claims description 5
- 241000700584 Simplexvirus Species 0.000 claims description 5
- 201000010099 disease Diseases 0.000 claims description 5
- 210000005134 plasmacytoid dendritic cell Anatomy 0.000 claims description 5
- 230000001225 therapeutic effect Effects 0.000 claims description 5
- LKKMLIBUAXYLOY-UHFFFAOYSA-N 3-Amino-1-methyl-5H-pyrido[4,3-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=C(N)N=C2C LKKMLIBUAXYLOY-UHFFFAOYSA-N 0.000 claims description 4
- WEVYNIUIFUYDGI-UHFFFAOYSA-N 3-[6-[4-(trifluoromethoxy)anilino]-4-pyrimidinyl]benzamide Chemical compound NC(=O)C1=CC=CC(C=2N=CN=C(NC=3C=CC(OC(F)(F)F)=CC=3)C=2)=C1 WEVYNIUIFUYDGI-UHFFFAOYSA-N 0.000 claims description 4
- 102100040079 A-kinase anchor protein 4 Human genes 0.000 claims description 4
- 101710109924 A-kinase anchor protein 4 Proteins 0.000 claims description 4
- 102100031585 ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1 Human genes 0.000 claims description 4
- 102000017918 ADRB3 Human genes 0.000 claims description 4
- 108060003355 ADRB3 Proteins 0.000 claims description 4
- 102100026402 Adhesion G protein-coupled receptor E2 Human genes 0.000 claims description 4
- 102100026423 Adhesion G protein-coupled receptor E5 Human genes 0.000 claims description 4
- 102100032187 Androgen receptor Human genes 0.000 claims description 4
- 102100023003 Ankyrin repeat domain-containing protein 30A Human genes 0.000 claims description 4
- 101710145634 Antigen 1 Proteins 0.000 claims description 4
- 102100024003 Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Human genes 0.000 claims description 4
- 102100025218 B-cell differentiation antigen CD72 Human genes 0.000 claims description 4
- 102100038080 B-cell receptor CD22 Human genes 0.000 claims description 4
- 102100022005 B-lymphocyte antigen CD20 Human genes 0.000 claims description 4
- 102100027522 Baculoviral IAP repeat-containing protein 7 Human genes 0.000 claims description 4
- 102100037086 Bone marrow stromal antigen 2 Human genes 0.000 claims description 4
- 101710188619 C-type lectin domain family 12 member A Proteins 0.000 claims description 4
- 108700012439 CA9 Proteins 0.000 claims description 4
- 108010056102 CD100 antigen Proteins 0.000 claims description 4
- 108010017009 CD11b Antigen Proteins 0.000 claims description 4
- 102100027207 CD27 antigen Human genes 0.000 claims description 4
- 101710185679 CD276 antigen Proteins 0.000 claims description 4
- 101150013553 CD40 gene Proteins 0.000 claims description 4
- 108010058905 CD44v6 antigen Proteins 0.000 claims description 4
- 108010062802 CD66 antigens Proteins 0.000 claims description 4
- 102100027217 CD82 antigen Human genes 0.000 claims description 4
- 101710139831 CD82 antigen Proteins 0.000 claims description 4
- 102100035793 CD83 antigen Human genes 0.000 claims description 4
- 102100029390 CMRF35-like molecule 1 Human genes 0.000 claims description 4
- 102100025570 Cancer/testis antigen 1 Human genes 0.000 claims description 4
- 102100039510 Cancer/testis antigen 2 Human genes 0.000 claims description 4
- 102100024423 Carbonic anhydrase 9 Human genes 0.000 claims description 4
- 102000013392 Carboxylesterase Human genes 0.000 claims description 4
- 108010051152 Carboxylesterase Proteins 0.000 claims description 4
- 102100024533 Carcinoembryonic antigen-related cell adhesion molecule 1 Human genes 0.000 claims description 4
- 101710178046 Chorismate synthase 1 Proteins 0.000 claims description 4
- 102100038449 Claudin-6 Human genes 0.000 claims description 4
- 102100035167 Coiled-coil domain-containing protein 54 Human genes 0.000 claims description 4
- 101710152695 Cysteine synthase 1 Proteins 0.000 claims description 4
- 102100027417 Cytochrome P450 1B1 Human genes 0.000 claims description 4
- 102100027816 Cytotoxic and regulatory T-cell molecule Human genes 0.000 claims description 4
- 101100481408 Danio rerio tie2 gene Proteins 0.000 claims description 4
- 102000012804 EPCAM Human genes 0.000 claims description 4
- 101150084967 EPCAM gene Proteins 0.000 claims description 4
- 101150029707 ERBB2 gene Proteins 0.000 claims description 4
- 102100025137 Early activation antigen CD69 Human genes 0.000 claims description 4
- 108010055196 EphA2 Receptor Proteins 0.000 claims description 4
- 102100030340 Ephrin type-A receptor 2 Human genes 0.000 claims description 4
- 101000585551 Equus caballus Pregnancy-associated glycoprotein Proteins 0.000 claims description 4
- 108010021468 Fc gamma receptor IIA Proteins 0.000 claims description 4
- 102100031507 Fc receptor-like protein 5 Human genes 0.000 claims description 4
- 101150032879 Fcrl5 gene Proteins 0.000 claims description 4
- 102000010449 Folate receptor beta Human genes 0.000 claims description 4
- 108050001930 Folate receptor beta Proteins 0.000 claims description 4
- 102100021197 G-protein coupled receptor family C group 5 member D Human genes 0.000 claims description 4
- 102100022086 GRB2-related adapter protein 2 Human genes 0.000 claims description 4
- 102100039554 Galectin-8 Human genes 0.000 claims description 4
- 101710088083 Glomulin Proteins 0.000 claims description 4
- 102100041003 Glutamate carboxypeptidase 2 Human genes 0.000 claims description 4
- 102100032530 Glypican-3 Human genes 0.000 claims description 4
- 102100029360 Hematopoietic cell signal transducer Human genes 0.000 claims description 4
- 108010007712 Hepatitis A Virus Cellular Receptor 1 Proteins 0.000 claims description 4
- 102100034459 Hepatitis A virus cellular receptor 1 Human genes 0.000 claims description 4
- 102100022132 High affinity immunoglobulin epsilon receptor subunit gamma Human genes 0.000 claims description 4
- 101000777636 Homo sapiens ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1 Proteins 0.000 claims description 4
- 101000718211 Homo sapiens Adhesion G protein-coupled receptor E2 Proteins 0.000 claims description 4
- 101000718243 Homo sapiens Adhesion G protein-coupled receptor E5 Proteins 0.000 claims description 4
- 101000757191 Homo sapiens Ankyrin repeat domain-containing protein 30A Proteins 0.000 claims description 4
- 101000934359 Homo sapiens B-cell differentiation antigen CD72 Proteins 0.000 claims description 4
- 101000884305 Homo sapiens B-cell receptor CD22 Proteins 0.000 claims description 4
- 101000897405 Homo sapiens B-lymphocyte antigen CD20 Proteins 0.000 claims description 4
- 101000936083 Homo sapiens Baculoviral IAP repeat-containing protein 7 Proteins 0.000 claims description 4
- 101000740785 Homo sapiens Bone marrow stromal antigen 2 Proteins 0.000 claims description 4
- 101000912622 Homo sapiens C-type lectin domain family 12 member A Proteins 0.000 claims description 4
- 101000914511 Homo sapiens CD27 antigen Proteins 0.000 claims description 4
- 101000884279 Homo sapiens CD276 antigen Proteins 0.000 claims description 4
- 101000946856 Homo sapiens CD83 antigen Proteins 0.000 claims description 4
- 101000990055 Homo sapiens CMRF35-like molecule 1 Proteins 0.000 claims description 4
- 101000856237 Homo sapiens Cancer/testis antigen 1 Proteins 0.000 claims description 4
- 101000889345 Homo sapiens Cancer/testis antigen 2 Proteins 0.000 claims description 4
- 101000914324 Homo sapiens Carcinoembryonic antigen-related cell adhesion molecule 5 Proteins 0.000 claims description 4
- 101000914321 Homo sapiens Carcinoembryonic antigen-related cell adhesion molecule 7 Proteins 0.000 claims description 4
- 101000882898 Homo sapiens Claudin-6 Proteins 0.000 claims description 4
- 101000737052 Homo sapiens Coiled-coil domain-containing protein 54 Proteins 0.000 claims description 4
- 101000725164 Homo sapiens Cytochrome P450 1B1 Proteins 0.000 claims description 4
- 101000954709 Homo sapiens Doublecortin domain-containing protein 2 Proteins 0.000 claims description 4
- 101000934374 Homo sapiens Early activation antigen CD69 Proteins 0.000 claims description 4
- 101001040713 Homo sapiens G-protein coupled receptor family C group 5 member D Proteins 0.000 claims description 4
- 101000900690 Homo sapiens GRB2-related adapter protein 2 Proteins 0.000 claims description 4
- 101000892862 Homo sapiens Glutamate carboxypeptidase 2 Proteins 0.000 claims description 4
- 101001014668 Homo sapiens Glypican-3 Proteins 0.000 claims description 4
- 101000990188 Homo sapiens Hematopoietic cell signal transducer Proteins 0.000 claims description 4
- 101000985516 Homo sapiens Hermansky-Pudlak syndrome 5 protein Proteins 0.000 claims description 4
- 101000824104 Homo sapiens High affinity immunoglobulin epsilon receptor subunit gamma Proteins 0.000 claims description 4
- 101000878602 Homo sapiens Immunoglobulin alpha Fc receptor Proteins 0.000 claims description 4
- 101000840267 Homo sapiens Immunoglobulin lambda-like polypeptide 1 Proteins 0.000 claims description 4
- 101001103039 Homo sapiens Inactive tyrosine-protein kinase transmembrane receptor ROR1 Proteins 0.000 claims description 4
- 101000994365 Homo sapiens Integrin alpha-6 Proteins 0.000 claims description 4
- 101001046683 Homo sapiens Integrin alpha-L Proteins 0.000 claims description 4
- 101001046686 Homo sapiens Integrin alpha-M Proteins 0.000 claims description 4
- 101001046668 Homo sapiens Integrin alpha-X Proteins 0.000 claims description 4
- 101001015037 Homo sapiens Integrin beta-7 Proteins 0.000 claims description 4
- 101000998120 Homo sapiens Interleukin-3 receptor subunit alpha Proteins 0.000 claims description 4
- 101000614481 Homo sapiens Kidney-associated antigen 1 Proteins 0.000 claims description 4
- 101000984197 Homo sapiens Leukocyte immunoglobulin-like receptor subfamily A member 2 Proteins 0.000 claims description 4
- 101001138062 Homo sapiens Leukocyte-associated immunoglobulin-like receptor 1 Proteins 0.000 claims description 4
- 101001047640 Homo sapiens Linker for activation of T-cells family member 1 Proteins 0.000 claims description 4
- 101001065550 Homo sapiens Lymphocyte antigen 6K Proteins 0.000 claims description 4
- 101001018034 Homo sapiens Lymphocyte antigen 75 Proteins 0.000 claims description 4
- 101001090688 Homo sapiens Lymphocyte cytosolic protein 2 Proteins 0.000 claims description 4
- 101001014223 Homo sapiens MAPK/MAK/MRK overlapping kinase Proteins 0.000 claims description 4
- 101000578784 Homo sapiens Melanoma antigen recognized by T-cells 1 Proteins 0.000 claims description 4
- 101001133056 Homo sapiens Mucin-1 Proteins 0.000 claims description 4
- 101000934338 Homo sapiens Myeloid cell surface antigen CD33 Proteins 0.000 claims description 4
- 101001109503 Homo sapiens NKG2-C type II integral membrane protein Proteins 0.000 claims description 4
- 101001109501 Homo sapiens NKG2-D type II integral membrane protein Proteins 0.000 claims description 4
- 101000589305 Homo sapiens Natural cytotoxicity triggering receptor 2 Proteins 0.000 claims description 4
- 101001051490 Homo sapiens Neural cell adhesion molecule L1 Proteins 0.000 claims description 4
- 101001103036 Homo sapiens Nuclear receptor ROR-alpha Proteins 0.000 claims description 4
- 101000721757 Homo sapiens Olfactory receptor 51E2 Proteins 0.000 claims description 4
- 101000873418 Homo sapiens P-selectin glycoprotein ligand 1 Proteins 0.000 claims description 4
- 101000613490 Homo sapiens Paired box protein Pax-3 Proteins 0.000 claims description 4
- 101000601724 Homo sapiens Paired box protein Pax-5 Proteins 0.000 claims description 4
- 101000589399 Homo sapiens Pannexin-3 Proteins 0.000 claims description 4
- 101001124867 Homo sapiens Peroxiredoxin-1 Proteins 0.000 claims description 4
- 101000692259 Homo sapiens Phosphoprotein associated with glycosphingolipid-enriched microdomains 1 Proteins 0.000 claims description 4
- 101000691463 Homo sapiens Placenta-specific protein 1 Proteins 0.000 claims description 4
- 101001064779 Homo sapiens Plexin domain-containing protein 2 Proteins 0.000 claims description 4
- 101000617725 Homo sapiens Pregnancy-specific beta-1-glycoprotein 2 Proteins 0.000 claims description 4
- 101001136592 Homo sapiens Prostate stem cell antigen Proteins 0.000 claims description 4
- 101001136981 Homo sapiens Proteasome subunit beta type-9 Proteins 0.000 claims description 4
- 101000880770 Homo sapiens Protein SSX2 Proteins 0.000 claims description 4
- 101000702132 Homo sapiens Protein spinster homolog 1 Proteins 0.000 claims description 4
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 claims description 4
- 101000932478 Homo sapiens Receptor-type tyrosine-protein kinase FLT3 Proteins 0.000 claims description 4
- 101001094545 Homo sapiens Retrotransposon-like protein 1 Proteins 0.000 claims description 4
- 101000633778 Homo sapiens SLAM family member 5 Proteins 0.000 claims description 4
- 101000633784 Homo sapiens SLAM family member 7 Proteins 0.000 claims description 4
- 101000665137 Homo sapiens Scm-like with four MBT domains protein 1 Proteins 0.000 claims description 4
- 101000884271 Homo sapiens Signal transducer CD24 Proteins 0.000 claims description 4
- 101000824971 Homo sapiens Sperm surface protein Sp17 Proteins 0.000 claims description 4
- 101000873927 Homo sapiens Squamous cell carcinoma antigen recognized by T-cells 3 Proteins 0.000 claims description 4
- 101000946860 Homo sapiens T-cell surface glycoprotein CD3 epsilon chain Proteins 0.000 claims description 4
- 101000596234 Homo sapiens T-cell surface protein tactile Proteins 0.000 claims description 4
- 101000914514 Homo sapiens T-cell-specific surface glycoprotein CD28 Proteins 0.000 claims description 4
- 101000809875 Homo sapiens TYRO protein tyrosine kinase-binding protein Proteins 0.000 claims description 4
- 101000655352 Homo sapiens Telomerase reverse transcriptase Proteins 0.000 claims description 4
- 101000714168 Homo sapiens Testisin Proteins 0.000 claims description 4
- 101000772267 Homo sapiens Thyrotropin receptor Proteins 0.000 claims description 4
- 101000894428 Homo sapiens Transcriptional repressor CTCFL Proteins 0.000 claims description 4
- 101000638154 Homo sapiens Transmembrane protease serine 2 Proteins 0.000 claims description 4
- 101000795169 Homo sapiens Tumor necrosis factor receptor superfamily member 13C Proteins 0.000 claims description 4
- 101000801234 Homo sapiens Tumor necrosis factor receptor superfamily member 18 Proteins 0.000 claims description 4
- 101000679857 Homo sapiens Tumor necrosis factor receptor superfamily member 3 Proteins 0.000 claims description 4
- 101000851370 Homo sapiens Tumor necrosis factor receptor superfamily member 9 Proteins 0.000 claims description 4
- 101001047681 Homo sapiens Tyrosine-protein kinase Lck Proteins 0.000 claims description 4
- 101000808105 Homo sapiens Uroplakin-2 Proteins 0.000 claims description 4
- 101000851007 Homo sapiens Vascular endothelial growth factor receptor 2 Proteins 0.000 claims description 4
- 101000814512 Homo sapiens X antigen family member 1 Proteins 0.000 claims description 4
- 108010031794 IGF Type 1 Receptor Proteins 0.000 claims description 4
- 102100038005 Immunoglobulin alpha Fc receptor Human genes 0.000 claims description 4
- 102100029616 Immunoglobulin lambda-like polypeptide 1 Human genes 0.000 claims description 4
- 102100039615 Inactive tyrosine-protein kinase transmembrane receptor ROR1 Human genes 0.000 claims description 4
- 102100039688 Insulin-like growth factor 1 receptor Human genes 0.000 claims description 4
- 102100032816 Integrin alpha-6 Human genes 0.000 claims description 4
- 102100022339 Integrin alpha-L Human genes 0.000 claims description 4
- 102100033016 Integrin beta-7 Human genes 0.000 claims description 4
- 108010064593 Intercellular Adhesion Molecule-1 Proteins 0.000 claims description 4
- 102100037877 Intercellular adhesion molecule 1 Human genes 0.000 claims description 4
- 102100033493 Interleukin-3 receptor subunit alpha Human genes 0.000 claims description 4
- 102100034872 Kallikrein-4 Human genes 0.000 claims description 4
- 102100031413 L-dopachrome tautomerase Human genes 0.000 claims description 4
- 101710093778 L-dopachrome tautomerase Proteins 0.000 claims description 4
- 102100025586 Leukocyte immunoglobulin-like receptor subfamily A member 2 Human genes 0.000 claims description 4
- 102100020943 Leukocyte-associated immunoglobulin-like receptor 1 Human genes 0.000 claims description 4
- 102100024032 Linker for activation of T-cells family member 1 Human genes 0.000 claims description 4
- 102100029204 Low affinity immunoglobulin gamma Fc region receptor II-a Human genes 0.000 claims description 4
- 102100032129 Lymphocyte antigen 6K Human genes 0.000 claims description 4
- 102100033486 Lymphocyte antigen 75 Human genes 0.000 claims description 4
- 102100034709 Lymphocyte cytosolic protein 2 Human genes 0.000 claims description 4
- 102100031520 MAPK/MAK/MRK overlapping kinase Human genes 0.000 claims description 4
- 108010010995 MART-1 Antigen Proteins 0.000 claims description 4
- 102000016200 MART-1 Antigen Human genes 0.000 claims description 4
- 108700012912 MYCN Proteins 0.000 claims description 4
- 101150022024 MYCN gene Proteins 0.000 claims description 4
- 102100022430 Melanocyte protein PMEL Human genes 0.000 claims description 4
- 102100028389 Melanoma antigen recognized by T-cells 1 Human genes 0.000 claims description 4
- 108010061593 Member 14 Tumor Necrosis Factor Receptors Proteins 0.000 claims description 4
- 102100034256 Mucin-1 Human genes 0.000 claims description 4
- 101100236305 Mus musculus Ly9 gene Proteins 0.000 claims description 4
- 101100481410 Mus musculus Tek gene Proteins 0.000 claims description 4
- 102100025243 Myeloid cell surface antigen CD33 Human genes 0.000 claims description 4
- 108700026495 N-Myc Proto-Oncogene Proteins 0.000 claims description 4
- 102100030124 N-myc proto-oncogene protein Human genes 0.000 claims description 4
- 102100022683 NKG2-C type II integral membrane protein Human genes 0.000 claims description 4
- 102100022680 NKG2-D type II integral membrane protein Human genes 0.000 claims description 4
- 108010004217 Natural Cytotoxicity Triggering Receptor 1 Proteins 0.000 claims description 4
- 108010004222 Natural Cytotoxicity Triggering Receptor 3 Proteins 0.000 claims description 4
- 102100032870 Natural cytotoxicity triggering receptor 1 Human genes 0.000 claims description 4
- 102100032851 Natural cytotoxicity triggering receptor 2 Human genes 0.000 claims description 4
- 102100032852 Natural cytotoxicity triggering receptor 3 Human genes 0.000 claims description 4
- 101710141230 Natural killer cell receptor 2B4 Proteins 0.000 claims description 4
- 108010069196 Neural Cell Adhesion Molecules Proteins 0.000 claims description 4
- 102100027347 Neural cell adhesion molecule 1 Human genes 0.000 claims description 4
- 102100024964 Neural cell adhesion molecule L1 Human genes 0.000 claims description 4
- 102100025128 Olfactory receptor 51E2 Human genes 0.000 claims description 4
- 102100034925 P-selectin glycoprotein ligand 1 Human genes 0.000 claims description 4
- 102100040891 Paired box protein Pax-3 Human genes 0.000 claims description 4
- 102100037504 Paired box protein Pax-5 Human genes 0.000 claims description 4
- 102100032364 Pannexin-3 Human genes 0.000 claims description 4
- 102100026066 Phosphoprotein associated with glycosphingolipid-enriched microdomains 1 Human genes 0.000 claims description 4
- 102100026181 Placenta-specific protein 1 Human genes 0.000 claims description 4
- 108010051742 Platelet-Derived Growth Factor beta Receptor Proteins 0.000 claims description 4
- 102100026547 Platelet-derived growth factor receptor beta Human genes 0.000 claims description 4
- 102100031889 Plexin domain-containing protein 2 Human genes 0.000 claims description 4
- 102100022019 Pregnancy-specific beta-1-glycoprotein 2 Human genes 0.000 claims description 4
- 102100023832 Prolyl endopeptidase FAP Human genes 0.000 claims description 4
- 102100036735 Prostate stem cell antigen Human genes 0.000 claims description 4
- 102100035764 Proteasome subunit beta type-9 Human genes 0.000 claims description 4
- 102100032831 Protein ITPRID2 Human genes 0.000 claims description 4
- 102100037686 Protein SSX2 Human genes 0.000 claims description 4
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 claims description 4
- 102100020718 Receptor-type tyrosine-protein kinase FLT3 Human genes 0.000 claims description 4
- 102100029216 SLAM family member 5 Human genes 0.000 claims description 4
- 102100029198 SLAM family member 7 Human genes 0.000 claims description 4
- 101710173694 Short transient receptor potential channel 2 Proteins 0.000 claims description 4
- 102100038081 Signal transducer CD24 Human genes 0.000 claims description 4
- 102100035748 Squamous cell carcinoma antigen recognized by T-cells 3 Human genes 0.000 claims description 4
- 101800001271 Surface protein Proteins 0.000 claims description 4
- 102100035794 T-cell surface glycoprotein CD3 epsilon chain Human genes 0.000 claims description 4
- 102100035268 T-cell surface protein tactile Human genes 0.000 claims description 4
- 102100027213 T-cell-specific surface glycoprotein CD28 Human genes 0.000 claims description 4
- 101150057140 TACSTD1 gene Proteins 0.000 claims description 4
- 108010032166 TARP Proteins 0.000 claims description 4
- 102100038717 TYRO protein tyrosine kinase-binding protein Human genes 0.000 claims description 4
- 102100036494 Testisin Human genes 0.000 claims description 4
- 102100029337 Thyrotropin receptor Human genes 0.000 claims description 4
- 102100021393 Transcriptional repressor CTCFL Human genes 0.000 claims description 4
- 102100031989 Transmembrane protease serine 2 Human genes 0.000 claims description 4
- 102100029690 Tumor necrosis factor receptor superfamily member 13C Human genes 0.000 claims description 4
- 102100033728 Tumor necrosis factor receptor superfamily member 18 Human genes 0.000 claims description 4
- 102100033733 Tumor necrosis factor receptor superfamily member 1B Human genes 0.000 claims description 4
- 101710187830 Tumor necrosis factor receptor superfamily member 1B Proteins 0.000 claims description 4
- 102100022156 Tumor necrosis factor receptor superfamily member 3 Human genes 0.000 claims description 4
- 102100022153 Tumor necrosis factor receptor superfamily member 4 Human genes 0.000 claims description 4
- 101710165473 Tumor necrosis factor receptor superfamily member 4 Proteins 0.000 claims description 4
- 102100040245 Tumor necrosis factor receptor superfamily member 5 Human genes 0.000 claims description 4
- 102100036856 Tumor necrosis factor receptor superfamily member 9 Human genes 0.000 claims description 4
- 102100024036 Tyrosine-protein kinase Lck Human genes 0.000 claims description 4
- 102100038851 Uroplakin-2 Human genes 0.000 claims description 4
- 102100033177 Vascular endothelial growth factor receptor 2 Human genes 0.000 claims description 4
- 108700020467 WT1 Proteins 0.000 claims description 4
- 101150084041 WT1 gene Proteins 0.000 claims description 4
- 102100022748 Wilms tumor protein Human genes 0.000 claims description 4
- 102100039490 X antigen family member 1 Human genes 0.000 claims description 4
- 101001038499 Yarrowia lipolytica (strain CLIB 122 / E 150) Lysine acetyltransferase Proteins 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 108010080146 androgen receptors Proteins 0.000 claims description 4
- 108010072917 class-I restricted T cell-associated molecule Proteins 0.000 claims description 4
- 108010087914 epidermal growth factor receptor VIII Proteins 0.000 claims description 4
- 102000052116 epidermal growth factor receptor activity proteins Human genes 0.000 claims description 4
- 108700015053 epidermal growth factor receptor activity proteins Proteins 0.000 claims description 4
- 102000006815 folate receptor Human genes 0.000 claims description 4
- 108020005243 folate receptor Proteins 0.000 claims description 4
- 125000002446 fucosyl group Chemical group C1([C@@H](O)[C@H](O)[C@H](O)[C@@H](O1)C)* 0.000 claims description 4
- 230000004927 fusion Effects 0.000 claims description 4
- 210000005260 human cell Anatomy 0.000 claims description 4
- 230000000968 intestinal effect Effects 0.000 claims description 4
- 230000003834 intracellular effect Effects 0.000 claims description 4
- 108010024383 kallikrein 4 Proteins 0.000 claims description 4
- 239000003446 ligand Substances 0.000 claims description 4
- 210000004698 lymphocyte Anatomy 0.000 claims description 4
- 238000012737 microarray-based gene expression Methods 0.000 claims description 4
- 238000012243 multiplex automated genomic engineering Methods 0.000 claims description 4
- YOHYSYJDKVYCJI-UHFFFAOYSA-N n-[3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide Chemical compound FC(F)(F)C1=CC=CC(NC=2N=CN=C(NC=3C=C(NC(=O)C4CC4)C=CC=3)C=2)=C1 YOHYSYJDKVYCJI-UHFFFAOYSA-N 0.000 claims description 4
- 210000000822 natural killer cell Anatomy 0.000 claims description 4
- 229920001481 poly(stearyl methacrylate) Polymers 0.000 claims description 4
- 229920001184 polypeptide Polymers 0.000 claims description 4
- 108040000983 polyphosphate:AMP phosphotransferase activity proteins Proteins 0.000 claims description 4
- 102000004196 processed proteins & peptides Human genes 0.000 claims description 4
- 108090000765 processed proteins & peptides Proteins 0.000 claims description 4
- 101150047061 tag-72 gene Proteins 0.000 claims description 4
- 230000005945 translocation Effects 0.000 claims description 4
- NPKNICGBPBZUFV-CABCVRRESA-N (1S,2R)-N-[(2-methoxypyridin-3-yl)methyl]-2-phenylcyclopropan-1-amine Chemical compound COC1=NC=CC=C1CN[C@@H]1[C@H](C1)C1=CC=CC=C1 NPKNICGBPBZUFV-CABCVRRESA-N 0.000 claims description 3
- 108091032973 (ribonucleotides)n+m Proteins 0.000 claims description 3
- IQVDLEXWAPYWDT-LJQANCHMSA-N 4-[2-(4-methylphenyl)-5-[[(3r)-pyrrolidin-3-yl]methoxy]pyridin-3-yl]benzonitrile Chemical compound C1=CC(C)=CC=C1C(C(=C1)C=2C=CC(=CC=2)C#N)=NC=C1OC[C@H]1CNCC1 IQVDLEXWAPYWDT-LJQANCHMSA-N 0.000 claims description 3
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 206010000830 Acute leukaemia Diseases 0.000 claims description 3
- 206010061424 Anal cancer Diseases 0.000 claims description 3
- 208000007860 Anus Neoplasms Diseases 0.000 claims description 3
- 208000036170 B-Cell Marginal Zone Lymphoma Diseases 0.000 claims description 3
- 102100021663 Baculoviral IAP repeat-containing protein 5 Human genes 0.000 claims description 3
- 206010005003 Bladder cancer Diseases 0.000 claims description 3
- 206010005949 Bone cancer Diseases 0.000 claims description 3
- 208000018084 Bone neoplasm Diseases 0.000 claims description 3
- 206010006143 Brain stem glioma Diseases 0.000 claims description 3
- 102000017420 CD3 protein, epsilon/gamma/delta subunit Human genes 0.000 claims description 3
- 108050005493 CD3 protein, epsilon/gamma/delta subunit Proteins 0.000 claims description 3
- 108010024755 CTL019 chimeric antigen receptor Proteins 0.000 claims description 3
- 235000002566 Capsicum Nutrition 0.000 claims description 3
- 206010007953 Central nervous system lymphoma Diseases 0.000 claims description 3
- 206010008342 Cervix carcinoma Diseases 0.000 claims description 3
- ZWLGCNFPHOUEMR-UHFFFAOYSA-N ClC1=CC=C(C=C1C1=CC=C(C=C1)S(=O)(=O)C)C1=CC(=C(N1)N1CCNCC1)C#N Chemical compound ClC1=CC=C(C=C1C1=CC=C(C=C1)S(=O)(=O)C)C1=CC(=C(N1)N1CCNCC1)C#N ZWLGCNFPHOUEMR-UHFFFAOYSA-N 0.000 claims description 3
- 206010009944 Colon cancer Diseases 0.000 claims description 3
- 241000702421 Dependoparvovirus Species 0.000 claims description 3
- 208000001976 Endocrine Gland Neoplasms Diseases 0.000 claims description 3
- 206010014733 Endometrial cancer Diseases 0.000 claims description 3
- 206010014759 Endometrial neoplasm Diseases 0.000 claims description 3
- 208000000461 Esophageal Neoplasms Diseases 0.000 claims description 3
- 206010061850 Extranodal marginal zone B-cell lymphoma (MALT type) Diseases 0.000 claims description 3
- 102100036939 G-protein coupled receptor 20 Human genes 0.000 claims description 3
- 108020005004 Guide RNA Proteins 0.000 claims description 3
- 208000021519 Hodgkin lymphoma Diseases 0.000 claims description 3
- 101001071355 Homo sapiens G-protein coupled receptor 20 Proteins 0.000 claims description 3
- 208000008839 Kidney Neoplasms Diseases 0.000 claims description 3
- 201000003791 MALT lymphoma Diseases 0.000 claims description 3
- 208000025205 Mantle-Cell Lymphoma Diseases 0.000 claims description 3
- 208000034578 Multiple myelomas Diseases 0.000 claims description 3
- OYAVBDAJSOIJJO-IYARVYRRSA-N NC=1C(=C(C=CC=1)C1=CN(C2=CC(=C(C=C12)C#N)C)[C@@H]1CC[C@H](CC1)O)C Chemical compound NC=1C(=C(C=CC=1)C1=CN(C2=CC(=C(C=C12)C#N)C)[C@@H]1CC[C@H](CC1)O)C OYAVBDAJSOIJJO-IYARVYRRSA-N 0.000 claims description 3
- 206010030155 Oesophageal carcinoma Diseases 0.000 claims description 3
- 206010033128 Ovarian cancer Diseases 0.000 claims description 3
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 3
- 206010061902 Pancreatic neoplasm Diseases 0.000 claims description 3
- 208000000821 Parathyroid Neoplasms Diseases 0.000 claims description 3
- 208000002471 Penile Neoplasms Diseases 0.000 claims description 3
- 206010034299 Penile cancer Diseases 0.000 claims description 3
- 208000007913 Pituitary Neoplasms Diseases 0.000 claims description 3
- 201000005746 Pituitary adenoma Diseases 0.000 claims description 3
- 206010061538 Pituitary tumour benign Diseases 0.000 claims description 3
- 206010035226 Plasma cell myeloma Diseases 0.000 claims description 3
- 208000007541 Preleukemia Diseases 0.000 claims description 3
- 102000007568 Proto-Oncogene Proteins c-fos Human genes 0.000 claims description 3
- 108010071563 Proto-Oncogene Proteins c-fos Proteins 0.000 claims description 3
- 206010038389 Renal cancer Diseases 0.000 claims description 3
- 208000006265 Renal cell carcinoma Diseases 0.000 claims description 3
- 208000000453 Skin Neoplasms Diseases 0.000 claims description 3
- 208000021712 Soft tissue sarcoma Diseases 0.000 claims description 3
- 208000005718 Stomach Neoplasms Diseases 0.000 claims description 3
- 108010002687 Survivin Proteins 0.000 claims description 3
- 206010042971 T-cell lymphoma Diseases 0.000 claims description 3
- 208000027585 T-cell non-Hodgkin lymphoma Diseases 0.000 claims description 3
- 238000010459 TALEN Methods 0.000 claims description 3
- 208000024313 Testicular Neoplasms Diseases 0.000 claims description 3
- 206010057644 Testis cancer Diseases 0.000 claims description 3
- 208000024770 Thyroid neoplasm Diseases 0.000 claims description 3
- 108010043645 Transcription Activator-Like Effector Nucleases Proteins 0.000 claims description 3
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 claims description 3
- 208000006105 Uterine Cervical Neoplasms Diseases 0.000 claims description 3
- 208000033559 Waldenström macroglobulinemia Diseases 0.000 claims description 3
- 108010017070 Zinc Finger Nucleases Proteins 0.000 claims description 3
- 239000012190 activator Substances 0.000 claims description 3
- 201000005188 adrenal gland cancer Diseases 0.000 claims description 3
- 208000024447 adrenal gland neoplasm Diseases 0.000 claims description 3
- 201000011165 anus cancer Diseases 0.000 claims description 3
- 239000001390 capsicum minimum Substances 0.000 claims description 3
- 201000010881 cervical cancer Diseases 0.000 claims description 3
- 208000029742 colonic neoplasm Diseases 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 208000035250 cutaneous malignant susceptibility to 1 melanoma Diseases 0.000 claims description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 3
- 230000000694 effects Effects 0.000 claims description 3
- 201000004101 esophageal cancer Diseases 0.000 claims description 3
- 206010017758 gastric cancer Diseases 0.000 claims description 3
- 210000004392 genitalia Anatomy 0.000 claims description 3
- 201000009277 hairy cell leukemia Diseases 0.000 claims description 3
- 201000010536 head and neck cancer Diseases 0.000 claims description 3
- 208000014829 head and neck neoplasm Diseases 0.000 claims description 3
- 201000002313 intestinal cancer Diseases 0.000 claims description 3
- 230000002427 irreversible effect Effects 0.000 claims description 3
- 201000010982 kidney cancer Diseases 0.000 claims description 3
- 230000003902 lesion Effects 0.000 claims description 3
- 201000007270 liver cancer Diseases 0.000 claims description 3
- 208000014018 liver neoplasm Diseases 0.000 claims description 3
- 230000001589 lymphoproliferative effect Effects 0.000 claims description 3
- 230000003211 malignant effect Effects 0.000 claims description 3
- 208000029559 malignant endocrine neoplasm Diseases 0.000 claims description 3
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 claims description 3
- 208000020984 malignant renal pelvis neoplasm Diseases 0.000 claims description 3
- 208000026045 malignant tumor of parathyroid gland Diseases 0.000 claims description 3
- 201000007924 marginal zone B-cell lymphoma Diseases 0.000 claims description 3
- 208000021937 marginal zone lymphoma Diseases 0.000 claims description 3
- 230000001394 metastastic effect Effects 0.000 claims description 3
- 206010061289 metastatic neoplasm Diseases 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 210000003101 oviduct Anatomy 0.000 claims description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 3
- 201000002528 pancreatic cancer Diseases 0.000 claims description 3
- 208000008443 pancreatic carcinoma Diseases 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical compound NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 claims description 3
- 208000021310 pituitary gland adenoma Diseases 0.000 claims description 3
- 239000013612 plasmid Substances 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 208000016800 primary central nervous system lymphoma Diseases 0.000 claims description 3
- 208000015347 renal cell adenocarcinoma Diseases 0.000 claims description 3
- 201000007444 renal pelvis carcinoma Diseases 0.000 claims description 3
- 230000002441 reversible effect Effects 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 201000000849 skin cancer Diseases 0.000 claims description 3
- 201000011549 stomach cancer Diseases 0.000 claims description 3
- 208000011580 syndromic disease Diseases 0.000 claims description 3
- 201000003120 testicular cancer Diseases 0.000 claims description 3
- 201000002510 thyroid cancer Diseases 0.000 claims description 3
- 230000005747 tumor angiogenesis Effects 0.000 claims description 3
- 201000005112 urinary bladder cancer Diseases 0.000 claims description 3
- 206010046885 vaginal cancer Diseases 0.000 claims description 3
- 208000013139 vaginal neoplasm Diseases 0.000 claims description 3
- 201000003741 Gastrointestinal carcinoma Diseases 0.000 claims description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 claims description 2
- 241000713666 Lentivirus Species 0.000 claims description 2
- 208000006994 Precancerous Conditions Diseases 0.000 claims description 2
- 230000000259 anti-tumor effect Effects 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 208000035475 disorder Diseases 0.000 claims description 2
- 230000031146 intracellular signal transduction Effects 0.000 claims description 2
- 230000002062 proliferating effect Effects 0.000 claims description 2
- 206010041823 squamous cell carcinoma Diseases 0.000 claims description 2
- 241000701161 unidentified adenovirus Species 0.000 claims description 2
- 241001430294 unidentified retrovirus Species 0.000 claims description 2
- 239000003112 inhibitor Substances 0.000 claims 5
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 claims 4
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 claims 4
- 101100398800 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) LDS1 gene Proteins 0.000 claims 4
- 101000648507 Homo sapiens Tumor necrosis factor receptor superfamily member 14 Proteins 0.000 claims 3
- 101710197062 Lectin 8 Proteins 0.000 claims 3
- 150000001413 amino acids Chemical class 0.000 claims 3
- 230000005540 biological transmission Effects 0.000 claims 3
- 208000004736 B-Cell Leukemia Diseases 0.000 claims 2
- 241000208293 Capsicum Species 0.000 claims 2
- 108091034117 Oligonucleotide Proteins 0.000 claims 2
- 210000003719 b-lymphocyte Anatomy 0.000 claims 2
- 230000002489 hematologic effect Effects 0.000 claims 2
- 210000004072 lung Anatomy 0.000 claims 2
- 208000007525 plasmablastic lymphoma Diseases 0.000 claims 2
- 208000000649 small cell carcinoma Diseases 0.000 claims 2
- 210000000278 spinal cord Anatomy 0.000 claims 2
- DYZZFEHAJOLDEX-UHFFFAOYSA-N 1-methylindole-5-carbonitrile Chemical compound N#CC1=CC=C2N(C)C=CC2=C1 DYZZFEHAJOLDEX-UHFFFAOYSA-N 0.000 claims 1
- YHYLDEVWYOFIJK-UHFFFAOYSA-N 1h-indole-5-carbonitrile Chemical compound N#CC1=CC=C2NC=CC2=C1 YHYLDEVWYOFIJK-UHFFFAOYSA-N 0.000 claims 1
- 208000003950 B-cell lymphoma Diseases 0.000 claims 1
- 201000009030 Carcinoma Diseases 0.000 claims 1
- 108010060385 Cyclin B1 Proteins 0.000 claims 1
- 102100031149 Deoxyribonuclease gamma Human genes 0.000 claims 1
- 206010058314 Dysplasia Diseases 0.000 claims 1
- 102000003817 Fos-related antigen 1 Human genes 0.000 claims 1
- 108090000123 Fos-related antigen 1 Proteins 0.000 claims 1
- 102100032340 G2/mitotic-specific cyclin-B1 Human genes 0.000 claims 1
- 102100034013 Gamma-glutamyl phosphate reductase Human genes 0.000 claims 1
- 101710198928 Gamma-glutamyl phosphate reductase Proteins 0.000 claims 1
- 101710159101 Green-light absorbing proteorhodopsin Proteins 0.000 claims 1
- 208000005016 Intestinal Neoplasms Diseases 0.000 claims 1
- 208000031422 Lymphocytic Chronic B-Cell Leukemia Diseases 0.000 claims 1
- 101100476214 Xenopus laevis runx1 gene Proteins 0.000 claims 1
- JLCPHMBAVCMARE-UHFFFAOYSA-N [3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl [5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate Polymers Cc1cn(C2CC(OP(O)(=O)OCC3OC(CC3OP(O)(=O)OCC3OC(CC3O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c3nc(N)[nH]c4=O)C(COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3CO)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cc(C)c(=O)[nH]c3=O)n3cc(C)c(=O)[nH]c3=O)n3ccc(N)nc3=O)n3cc(C)c(=O)[nH]c3=O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)O2)c(=O)[nH]c1=O JLCPHMBAVCMARE-UHFFFAOYSA-N 0.000 claims 1
- 230000002159 abnormal effect Effects 0.000 claims 1
- 101150066984 aml gene Proteins 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 230000001707 blastogenic effect Effects 0.000 claims 1
- 230000001413 cellular effect Effects 0.000 claims 1
- 210000004443 dendritic cell Anatomy 0.000 claims 1
- 230000035772 mutation Effects 0.000 claims 1
- 206010035485 plasmacytosis Diseases 0.000 claims 1
- 230000001177 retroviral effect Effects 0.000 claims 1
- 241001529453 unidentified herpesvirus Species 0.000 claims 1
- 108010019670 Chimeric Antigen Receptors Proteins 0.000 description 18
- 230000019491 signal transduction Effects 0.000 description 4
- 239000012636 effector Substances 0.000 description 3
- 208000025324 B-cell acute lymphoblastic leukemia Diseases 0.000 description 2
- 208000009052 Precursor T-Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 2
- 208000029052 T-cell acute lymphoblastic leukemia Diseases 0.000 description 2
- RKHWDANYXRMLOW-UHFFFAOYSA-N 6-methyl-1h-indole-5-carbonitrile Chemical compound C1=C(C#N)C(C)=CC2=C1C=CN2 RKHWDANYXRMLOW-UHFFFAOYSA-N 0.000 description 1
- 108020000948 Antisense Oligonucleotides Proteins 0.000 description 1
- 240000008574 Capsicum frutescens Species 0.000 description 1
- 102000044445 Galectin-8 Human genes 0.000 description 1
- 208000002250 Hematologic Neoplasms Diseases 0.000 description 1
- 101000775844 Homo sapiens AMP deaminase 1 Proteins 0.000 description 1
- 101000962483 Homo sapiens Max dimerization protein 1 Proteins 0.000 description 1
- 208000031671 Large B-Cell Diffuse Lymphoma Diseases 0.000 description 1
- 208000028018 Lymphocytic leukaemia Diseases 0.000 description 1
- 239000000074 antisense oligonucleotide Substances 0.000 description 1
- 238000012230 antisense oligonucleotides Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 208000030381 cutaneous melanoma Diseases 0.000 description 1
- 206010012818 diffuse large B-cell lymphoma Diseases 0.000 description 1
- 208000003747 lymphoid leukemia Diseases 0.000 description 1
- 201000000564 macroglobulinemia Diseases 0.000 description 1
- 208000025113 myeloid leukemia Diseases 0.000 description 1
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 1
- 201000003708 skin melanoma Diseases 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CN2016101213 | 2016-09-30 | ||
| CNPCT/CN2016/101213 | 2016-09-30 | ||
| PCT/CN2017/104422 WO2018059549A1 (en) | 2016-09-30 | 2017-09-29 | Immune effector cell therapies with enhanced efficacy |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2019532953A JP2019532953A (ja) | 2019-11-14 |
| JP2019532953A5 true JP2019532953A5 (enExample) | 2021-08-12 |
Family
ID=61763296
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2019517396A Pending JP2019532953A (ja) | 2016-09-30 | 2017-09-29 | 増強された有効性を有する免疫エフェクター細胞治療 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US20190298715A1 (enExample) |
| EP (1) | EP3523290A4 (enExample) |
| JP (1) | JP2019532953A (enExample) |
| CN (1) | CN110582488A (enExample) |
| WO (1) | WO2018059549A1 (enExample) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP2958943B1 (en) | 2013-02-20 | 2019-09-11 | The Trustees Of The University Of Pennsylvania | Treatment of cancer using humanized anti-egfrviii chimeric antigen receptor |
| UY35340A (es) | 2013-02-20 | 2014-09-30 | Novartis Ag | Marcaje efectivo de leucemia humana usando células diseñadas con un receptor quimérico de antígeno anti-cd123 |
| US9745368B2 (en) | 2013-03-15 | 2017-08-29 | The Trustees Of The University Of Pennsylvania | Targeting cytotoxic cells with chimeric receptors for adoptive immunotherapy |
| TWI654206B (zh) | 2013-03-16 | 2019-03-21 | 諾華公司 | 使用人類化抗－ｃｄ１９嵌合抗原受體治療癌症 |
| US10287354B2 (en) | 2013-12-20 | 2019-05-14 | Novartis Ag | Regulatable chimeric antigen receptor |
| EP4303229A3 (en) | 2014-01-21 | 2024-04-17 | Novartis AG | Enhanced antigen presenting ability of car t cells by co-introduction of costimulatory molecules |
| MX390943B (es) | 2014-07-21 | 2025-03-21 | Novartis Ag | Receptores de antígeno quimérico cd33 y usos de los mismos. |
| MY181834A (en) | 2014-07-21 | 2021-01-08 | Novartis Ag | Treatment of cancer using humanized anti-bcma chimeric antigen receptor |
| WO2016014553A1 (en) | 2014-07-21 | 2016-01-28 | Novartis Ag | Sortase synthesized chimeric antigen receptors |
| MY189028A (en) | 2014-08-19 | 2022-01-20 | Novartis Ag | Anti-cd123 chimeric antigen receptor (car) for use in cancer treatment |
| CN114107424A (zh) | 2014-10-08 | 2022-03-01 | 诺华股份有限公司 | 预测针对嵌合抗原受体疗法的治疗应答性的生物标志及其用途 |
| WO2016115482A1 (en) | 2015-01-16 | 2016-07-21 | Novartis Pharma Ag | Phosphoglycerate kinase 1 (pgk) promoters and methods of use for expressing chimeric antigen receptor |
| WO2016126608A1 (en) | 2015-02-02 | 2016-08-11 | Novartis Ag | Car-expressing cells against multiple tumor antigens and uses thereof |
| HUE059218T2 (hu) | 2015-04-08 | 2022-11-28 | Novartis Ag | CD20-terápiák, CD22-terápiák és kombinációs terápiák CD19 kiméra antigénreceptort (CAR-t) expresszáló sejttel |
| SG11201708516YA (en) | 2015-04-17 | 2017-11-29 | David Maxwell Barrett | Methods for improving the efficacy and expansion of chimeric antigen receptor-expressing cells |
| EP3286211A1 (en) | 2015-04-23 | 2018-02-28 | Novartis AG | Treatment of cancer using chimeric antigen receptor and protein kinase a blocker |
| SG10201912978PA (en) | 2015-07-21 | 2020-02-27 | Novartis Ag | Methods for improving the efficacy and expansion of immune cells |
| EP3331913A1 (en) | 2015-08-07 | 2018-06-13 | Novartis AG | Treatment of cancer using chimeric cd3 receptor proteins |
| EP3344996A2 (en) | 2015-09-03 | 2018-07-11 | The Trustees Of The University Of Pennsylvania | Biomarkers predictive of cytokine release syndrome |
| BR112018011089A2 (pt) | 2015-12-04 | 2018-12-04 | Intellia Therapeutics Inc | composições e métodos para a imuno-oncologia |
| AU2016382512A1 (en) * | 2015-12-30 | 2018-07-12 | Novartis Ag | Immune effector cell therapies with enhanced efficacy |
| WO2017165683A1 (en) | 2016-03-23 | 2017-09-28 | Novartis Ag | Cell secreted minibodies and uses thereof |
| MY200337A (en) | 2016-10-07 | 2023-12-20 | Novartis Ag | Nucleic acid molecules encoding chimeric antigen receptors comprising a cd20 binding domain |
| US11535662B2 (en) | 2017-01-26 | 2022-12-27 | Novartis Ag | CD28 compositions and methods for chimeric antigen receptor therapy |
| JP2020513832A (ja) | 2017-03-22 | 2020-05-21 | ノバルティス アーゲー | 免疫腫瘍学のための組成物および方法 |
| UY37774A (es) * | 2017-06-19 | 2019-01-31 | Novartis Ag | Compuestos 5-cianoindol sustituidos y usos de los mismos |
| SG11202003415XA (en) | 2017-10-18 | 2020-05-28 | Novartis Ag | Compositions and methods for selective protein degradation |
| US20220307087A1 (en) * | 2018-04-25 | 2022-09-29 | The Methodist Hospital System | Cancer neoantigens and their utilities in cancer vaccines and tcr-based cancer immunotherapy |
| MY208825A (en) | 2018-06-13 | 2025-05-30 | Novartis Ag | Bcma chimeric antigen receptors and uses thereof |
| PH12022551290A1 (en) | 2019-11-26 | 2023-11-29 | Novartis Ag | Cd19 and cd22 chimeric antigen receptors and uses thereof |
| AU2020393912B2 (en) | 2019-11-26 | 2025-11-20 | Novartis Ag | Chimeric antigen receptors binding BCMA and CD19 and uses thereof |
| AU2021225978A1 (en) * | 2020-02-27 | 2022-09-08 | Legend Biotech Ireland Limited | Antibodies and chimeric antigen receptors targeting glypican-3 (GPC3) and methods of use thereof |
| US12365871B2 (en) | 2020-04-28 | 2025-07-22 | Lyell Immunopharma, Inc. | Methods for culturing cells |
| MX2022016544A (es) | 2020-06-22 | 2023-04-05 | Ngm Biopharmaceuticals Inc | Agentes de union a lair-1 y metodos para su uso. |
| CN116710090A (zh) * | 2020-10-09 | 2023-09-05 | Napa医疗有限公司 | Cd38的杂芳基酰胺抑制剂 |
| CN114426952A (zh) * | 2020-10-29 | 2022-05-03 | 中国科学技术大学 | 用于白血病的car t细胞疗法的t细胞增效剂及获得增效t细胞的方法 |
| AU2022214429A1 (en) | 2021-02-01 | 2023-09-14 | Tern Therapeutics, Llc | Gene therapy for neuronal ceroid lipofuscinoses |
| WO2022254337A1 (en) | 2021-06-01 | 2022-12-08 | Novartis Ag | Cd19 and cd22 chimeric antigen receptors and uses thereof |
| CN113462723B (zh) * | 2021-07-05 | 2023-07-11 | 北京中医药大学 | 表达CAR和shRNA的逆转录病毒载体及其应用 |
| US20250288668A1 (en) * | 2022-05-20 | 2025-09-18 | Imago Biosciences, Inc. | Methods for the enhancement of therapeutic effect of car-t cells |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20050113564A1 (en) * | 2003-11-05 | 2005-05-26 | St. Jude Children's Research Hospital | Chimeric receptors with 4-1BB stimulatory signaling domain |
| DE102008052943A1 (de) * | 2008-10-23 | 2010-04-29 | Merck Patent Gmbh | Azaindolderivate |
| US20140163041A1 (en) * | 2011-02-08 | 2014-06-12 | Oryzon Genomics S.A. | Lysine demethylase inhibitors for myeloproliferative or lymphoproliferative diseases or disorders |
| US9289415B2 (en) * | 2011-09-01 | 2016-03-22 | The Brigham And Women's Hospital, Inc. | Treatment of cancer |
| US10316289B2 (en) * | 2012-09-06 | 2019-06-11 | The United States Of America, As Represented By The Secretary, Department Of Health And Human Services | Methods of producing T memory stem cell populations |
| WO2014165707A2 (en) * | 2013-04-03 | 2014-10-09 | Memorial Sloan-Kettering Cancer Center | Effective generation of tumor-targeted t-cells derived from pluripotent stem cells |
| AU2014302038B2 (en) * | 2013-06-25 | 2019-11-14 | Epiaxis Therapeutics Pty Ltd | Methods and compositions for modulating cancer stem cells |
| US9951118B2 (en) * | 2013-08-02 | 2018-04-24 | The Regents Of The University Of California | Engineering antiviral T cell immunity through stem cells and chimeric antigen receptors |
| CA2941716A1 (en) * | 2014-03-07 | 2015-09-11 | The Johns Hopkins University | Inhibitors of histone lysine specific demethylase (lsd1) and histone deacetylases (hdacs) |
| US20150250824A1 (en) * | 2014-03-07 | 2015-09-10 | The Research Foundation For The State University Of New York | Methods and compositions for expansion of stem cells and other cells |
| RS62874B1 (sr) * | 2014-05-01 | 2022-02-28 | Celgene Quanticel Research Inc | Inhibitori lizin specifične demetilaze-1 |
| US10233165B2 (en) * | 2014-05-30 | 2019-03-19 | Istituto Europeo Di Oncologia S.R.L. | Cyclopropylamine compounds as histone demethylase inhibitors |
| MY181834A (en) * | 2014-07-21 | 2021-01-08 | Novartis Ag | Treatment of cancer using humanized anti-bcma chimeric antigen receptor |
| US10485772B2 (en) * | 2014-08-25 | 2019-11-26 | EpiAxis Therapeutics Pty Ltd. | Compositions for modulating cancer stem cells and uses therefor |
| AU2016382512A1 (en) * | 2015-12-30 | 2018-07-12 | Novartis Ag | Immune effector cell therapies with enhanced efficacy |
| JP2019512474A (ja) * | 2016-03-01 | 2019-05-16 | ノバルティス アーゲー | シアノ置換インドール化合物およびｌｓｄ１阻害剤としてのその使用 |
-
2017
- 2017-09-29 US US16/338,085 patent/US20190298715A1/en not_active Abandoned
- 2017-09-29 CN CN201780073475.5A patent/CN110582488A/zh active Pending
- 2017-09-29 JP JP2019517396A patent/JP2019532953A/ja active Pending
- 2017-09-29 EP EP17854999.4A patent/EP3523290A4/en not_active Withdrawn
- 2017-09-29 WO PCT/CN2017/104422 patent/WO2018059549A1/en not_active Ceased
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2019532953A5 (enExample) | ||
| JP2019500394A5 (enExample) | ||
| RU2018127657A (ru) | Виды терапии на основе иммуноэффекторных клеток с улучшенной эффективностью | |
| JP2018527008A5 (enExample) | ||
| JP2020513828A5 (enExample) | ||
| RU2019133286A (ru) | Биомаркеры и средства терапии на основе т-клеток с car с повышенной эффективностью | |
| CN108276493B (zh) | 一种嵌合抗原受体及其应用 | |
| JP2017513818A5 (enExample) | ||
| JPWO2020047452A5 (enExample) | ||
| JP2020506700A5 (enExample) | ||
| JP2024045111A (ja) | ガイダンス及びナビゲーションコントロール蛋白質の生産及び使用方法 | |
| JP2019525956A5 (enExample) | ||
| JP2020500530A5 (enExample) | ||
| WO2018059549A1 (en) | Immune effector cell therapies with enhanced efficacy | |
| JPWO2016028896A5 (enExample) | ||
| JP2017522879A5 (enExample) | ||
| JP2016514462A5 (enExample) | ||
| JP2019537433A5 (enExample) | ||
| JP2017524367A5 (enExample) | ||
| JP2017527271A5 (enExample) | ||
| JP2022524906A (ja) | 細胞免疫療法の組み合わせ | |
| JP2022517301A (ja) | 腫瘍併用免疫療法 | |
| CN112040957A (zh) | 靶向表达cd99的癌症的组合物和方法 | |
| US20250145683A1 (en) | Engineered immune cells with dominant signals | |
| JP2021512875A (ja) | 細胞免疫療法の組み合わせ |