JP2006508944A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2006508944A5 JP2006508944A5 JP2004549306A JP2004549306A JP2006508944A5 JP 2006508944 A5 JP2006508944 A5 JP 2006508944A5 JP 2004549306 A JP2004549306 A JP 2004549306A JP 2004549306 A JP2004549306 A JP 2004549306A JP 2006508944 A5 JP2006508944 A5 JP 2006508944A5
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- group
- formula
- amino
- ethoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 125000000217 alkyl group Chemical group 0.000 claims 159
- -1 cyano, isocyano, nitro, hydroxy, mercapto, amino, formyl Chemical group 0.000 claims 147
- 125000001424 substituent group Chemical group 0.000 claims 43
- 229910052757 nitrogen Inorganic materials 0.000 claims 24
- 125000000623 heterocyclic group Chemical group 0.000 claims 21
- 229910052760 oxygen Inorganic materials 0.000 claims 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 16
- 125000003545 alkoxy group Chemical group 0.000 claims 16
- 229910052739 hydrogen Inorganic materials 0.000 claims 16
- 239000001257 hydrogen Substances 0.000 claims 16
- 150000003839 salts Chemical class 0.000 claims 15
- 125000005236 alkanoylamino group Chemical group 0.000 claims 14
- 150000001875 compounds Chemical class 0.000 claims 14
- 125000000524 functional group Chemical group 0.000 claims 14
- 125000001072 heteroaryl group Chemical group 0.000 claims 14
- 150000003248 quinolines Chemical class 0.000 claims 14
- 125000003118 aryl group Chemical group 0.000 claims 12
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims 12
- 125000005843 halogen group Chemical group 0.000 claims 12
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims 11
- 125000001589 carboacyl group Chemical group 0.000 claims 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 11
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 10
- 125000003282 alkyl amino group Chemical group 0.000 claims 9
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 9
- 125000003342 alkenyl group Chemical group 0.000 claims 8
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims 8
- 125000004414 alkyl thio group Chemical group 0.000 claims 8
- 125000000304 alkynyl group Chemical group 0.000 claims 8
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims 8
- 229910052717 sulfur Inorganic materials 0.000 claims 8
- 125000004423 acyloxy group Chemical group 0.000 claims 7
- 125000005153 alkyl sulfamoyl group Chemical group 0.000 claims 7
- 125000001309 chloro group Chemical group Cl* 0.000 claims 7
- 125000006239 protecting group Chemical group 0.000 claims 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 7
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims 6
- 229910052799 carbon Inorganic materials 0.000 claims 6
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims 5
- 125000001153 fluoro group Chemical group F* 0.000 claims 5
- 238000002360 preparation method Methods 0.000 claims 5
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims 5
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims 4
- 239000002253 acid Substances 0.000 claims 4
- 125000003302 alkenyloxy group Chemical group 0.000 claims 4
- 125000005133 alkynyloxy group Chemical group 0.000 claims 4
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 claims 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 4
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 3
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 claims 3
- 241001465754 Metazoa Species 0.000 claims 3
- 206010028980 Neoplasm Diseases 0.000 claims 3
- 125000000392 cycloalkenyl group Chemical group 0.000 claims 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims 3
- 238000004519 manufacturing process Methods 0.000 claims 3
- 238000000034 method Methods 0.000 claims 3
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims 3
- 125000001064 morpholinomethyl group Chemical group [H]C([H])(*)N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 claims 3
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims 3
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 claims 3
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims 2
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 claims 2
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims 2
- 125000002947 alkylene group Chemical group 0.000 claims 2
- 150000001412 amines Chemical class 0.000 claims 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims 2
- 239000003814 drug Substances 0.000 claims 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 238000003780 insertion Methods 0.000 claims 2
- 230000037431 insertion Effects 0.000 claims 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 2
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 claims 2
- 125000006518 morpholino carbonyl group Chemical group [H]C1([H])OC([H])([H])C([H])([H])N(C(*)=O)C1([H])[H] 0.000 claims 2
- HNEGJTWNOOWEMH-UHFFFAOYSA-N 1-fluoropropane Chemical group [CH2]CCF HNEGJTWNOOWEMH-UHFFFAOYSA-N 0.000 claims 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 claims 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 claims 1
- JXJJDKLHAOQQLB-UHFFFAOYSA-N COCCN(C(C(OCCCC#C)(OCCCC)OC(C)C)(OCCC)OCC)C(C(=O)N(NC)OCCCCC#C)(N(C)C)NCC Chemical compound COCCN(C(C(OCCCC#C)(OCCCC)OC(C)C)(OCCC)OCC)C(C(=O)N(NC)OCCCCC#C)(N(C)C)NCC JXJJDKLHAOQQLB-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims 1
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 claims 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims 1
- 230000002152 alkylating effect Effects 0.000 claims 1
- 125000005530 alkylenedioxy group Chemical group 0.000 claims 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims 1
- 230000001740 anti-invasion Effects 0.000 claims 1
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 201000011510 cancer Diseases 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 239000012024 dehydrating agents Substances 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 125000006534 ethyl amino methyl group Chemical group [H]N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims 1
- 239000003966 growth inhibitor Substances 0.000 claims 1
- 238000009830 intercalation Methods 0.000 claims 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims 1
- 230000001590 oxidative effect Effects 0.000 claims 1
- 125000004043 oxo group Chemical group O=* 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- 239000006187 pill Substances 0.000 claims 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 claims 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 claims 1
- 229940080818 propionamide Drugs 0.000 claims 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 claims 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims 1
- 125000000547 substituted alkyl group Chemical group 0.000 claims 1
- 238000002560 therapeutic procedure Methods 0.000 claims 1
- 125000000464 thioxo group Chemical group S=* 0.000 claims 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims 1
- 229920002554 vinyl polymer Polymers 0.000 claims 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB0225579.2A GB0225579D0 (en) | 2002-11-02 | 2002-11-02 | Chemical compounds |
| PCT/GB2003/004661 WO2004041811A1 (en) | 2002-11-02 | 2003-10-28 | 3-cyano-quinoline derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2006508944A JP2006508944A (ja) | 2006-03-16 |
| JP2006508944A5 true JP2006508944A5 (OSRAM) | 2006-11-24 |
Family
ID=9947091
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2004549306A Pending JP2006508944A (ja) | 2002-11-02 | 2003-10-28 | 3−シアノ−キノリン誘導体 |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US7173136B2 (OSRAM) |
| EP (1) | EP1575943A1 (OSRAM) |
| JP (1) | JP2006508944A (OSRAM) |
| AU (1) | AU2003278369A1 (OSRAM) |
| GB (1) | GB0225579D0 (OSRAM) |
| WO (1) | WO2004041811A1 (OSRAM) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB0215823D0 (en) * | 2002-07-09 | 2002-08-14 | Astrazeneca Ab | Quinazoline derivatives |
| GB0225579D0 (en) * | 2002-11-02 | 2002-12-11 | Astrazeneca Ab | Chemical compounds |
| WO2008135886A2 (en) * | 2007-05-02 | 2008-11-13 | University Of Pretoria | Quinoline derivatives for use in the inhibition of the growth of tumour cells |
| BRPI0819624B1 (pt) | 2007-11-19 | 2017-12-12 | Shell Internationale Research Maatschappij B.V. | Method for determining a hydrotrating process using a metallic battery catalyst |
| WO2009151910A2 (en) * | 2008-05-25 | 2009-12-17 | Wyeth | Combination product of receptor tyrosine kinase inhibitor and fatty acid synthase inhibitor for treating cancer |
| EP2370568B1 (en) | 2008-12-10 | 2017-07-19 | Dana-Farber Cancer Institute, Inc. | Mek mutations conferring resistance to mek inhibitors |
| EP3028699B1 (en) | 2010-02-25 | 2018-03-21 | Dana-Farber Cancer Institute, Inc. | Braf mutations conferring resistance to braf inhibitors |
| EP2545187B1 (en) | 2010-03-09 | 2018-09-05 | Dana-Farber Cancer Institute, Inc. | Methods of diagnosing and treating cancer in patients having or developing resistance to a first cancer therapy |
| WO2012166654A1 (en) * | 2011-05-27 | 2012-12-06 | The Regents Of The University Of California | Cyanoquinoline compounds having activity in correcting mutant-cftr processing and increasing ion transport and uses thereof |
| CA2754237A1 (en) | 2011-05-27 | 2012-11-27 | The Regents Of The University Of California | Cyanoquinoline compounds having activity in correcting mutant-cftr processing and increasing ion transport and uses thereof |
| WO2013169858A1 (en) | 2012-05-08 | 2013-11-14 | The Broad Institute, Inc. | Diagnostic and treatment methods in patients having or at risk of developing resistance to cancer therapy |
| US20190112317A1 (en) | 2015-10-05 | 2019-04-18 | The Trustees Of Columbia University In The City Of New York | Activators of autophagic flux and phospholipase d and clearance of protein aggregates including tau and treatment of proteinopathies |
| PH12022553024A1 (en) | 2020-05-08 | 2024-05-20 | Halia Therapeutics Inc | Inhibitors of nek7 kinase |
| WO2024059200A1 (en) | 2022-09-14 | 2024-03-21 | Halia Therapeutics, Inc. | Nek7 inhibitors |
Family Cites Families (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE317376B (OSRAM) * | 1961-07-10 | 1969-11-17 | Roussel Uclaf | |
| FR2077455A1 (en) | 1969-09-03 | 1971-10-29 | Aries Robert | 5-haloveratryl-4-aminoquinoles - antimalarials amoebicides anthelmintics anticoccidials |
| US3936461A (en) * | 1973-09-24 | 1976-02-03 | Warner-Lambert Company | Substituted 4-benzylquinolines |
| FR2498187A1 (fr) * | 1981-01-16 | 1982-07-23 | Rhone Poulenc Sante | Procede de preparation d'amino-4 chloro-7 quinoleines |
| IL89029A (en) * | 1988-01-29 | 1993-01-31 | Lilly Co Eli | Fungicidal quinoline and cinnoline derivatives, compositions containing them, and fungicidal methods of using them |
| CA2102780C (en) * | 1991-05-10 | 2007-01-09 | Alfred P. Spada | Bis mono-and bicyclic aryl and heteroaryl compounds which inhibit egf and/or pdgf receptor tyrosine kinase |
| US5480883A (en) * | 1991-05-10 | 1996-01-02 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Bis mono- and bicyclic aryl and heteroaryl compounds which inhibit EGF and/or PDGF receptor tyrosine kinase |
| JPH06504294A (ja) * | 1991-08-02 | 1994-05-19 | ファイザー・インコーポレーテッド | 免疫刺激剤としてのキノリン誘導体 |
| PT100905A (pt) * | 1991-09-30 | 1994-02-28 | Eisai Co Ltd | Compostos heterociclicos azotados biciclicos contendo aneis de benzeno, ciclo-hexano ou piridina e de pirimidina, piridina ou imidazol substituidos e composicoes farmaceuticas que os contem |
| US5656643A (en) * | 1993-11-08 | 1997-08-12 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Bis mono-and bicyclic aryl and heteroaryl compounds which inhibit EGF and/or PDGF receptor tyrosine kinase |
| GB9510757D0 (en) | 1994-09-19 | 1995-07-19 | Wellcome Found | Therapeuticaly active compounds |
| US5650415A (en) * | 1995-06-07 | 1997-07-22 | Sugen, Inc. | Quinoline compounds |
| GB9514265D0 (en) | 1995-07-13 | 1995-09-13 | Wellcome Found | Hetrocyclic compounds |
| WO1997017329A1 (en) | 1995-11-07 | 1997-05-15 | Kirin Beer Kabushiki Kaisha | Quinoline derivatives and quinazoline derivatives inhibiting autophosphorylation of growth factor receptor originating in platelet and pharmaceutical compositions containing the same |
| DE69716916T2 (de) | 1996-07-13 | 2003-07-03 | Glaxo Group Ltd., Greenford | Kondensierte heterozyklische verbindungen als protein kinase inhibitoren |
| AU733551B2 (en) * | 1996-09-25 | 2001-05-17 | Astrazeneca Ab | Qinoline derivatives inhibiting the effect of growth factors such as VEGF |
| US6225318B1 (en) * | 1996-10-17 | 2001-05-01 | Pfizer Inc | 4-aminoquinazolone derivatives |
| EP0837063A1 (en) | 1996-10-17 | 1998-04-22 | Pfizer Inc. | 4-Aminoquinazoline derivatives |
| UA73073C2 (uk) * | 1997-04-03 | 2005-06-15 | Уайт Холдінгз Корпорейшн | Заміщені 3-ціанохіноліни, спосіб їх одержання та фармацевтична композиція |
| US6002008A (en) * | 1997-04-03 | 1999-12-14 | American Cyanamid Company | Substituted 3-cyano quinolines |
| RS49779B (sr) * | 1998-01-12 | 2008-06-05 | Glaxo Group Limited, | Biciklična heteroaromatična jedinjenja kao inhibitori protein tirozin kinaze |
| HUP0103520A3 (en) | 1998-09-29 | 2003-01-28 | Wyeth Holdings Corp Madison | Substituted 3-cyanoquinolines as protein tyrosine kinases inhibitors and pharmaceutical compositions containing them |
| GB9904103D0 (en) * | 1999-02-24 | 1999-04-14 | Zeneca Ltd | Quinoline derivatives |
| GB9910579D0 (en) * | 1999-05-08 | 1999-07-07 | Zeneca Ltd | Chemical compounds |
| GB9910577D0 (en) * | 1999-05-08 | 1999-07-07 | Zeneca Ltd | Chemical compounds |
| GB9910580D0 (en) * | 1999-05-08 | 1999-07-07 | Zeneca Ltd | Chemical compounds |
| UA73993C2 (uk) | 2000-06-06 | 2005-10-17 | Астразенека Аб | Хіназолінові похідні для лікування пухлин та фармацевтична композиція |
| US7115615B2 (en) * | 2000-08-21 | 2006-10-03 | Astrazeneca | Quinazoline derivatives |
| AU2002210714A1 (en) | 2000-11-02 | 2002-06-11 | Astrazeneca Ab | Substituted quinolines as antitumor agents |
| AU2001295791A1 (en) | 2000-11-02 | 2002-05-15 | Astrazeneca Ab | 4-substituted quinolines as antitumor agents |
| WO2002085895A1 (en) | 2001-04-19 | 2002-10-31 | Astrazeneca Ab | Quinazoline derivatives |
| US7501516B2 (en) | 2001-07-16 | 2009-03-10 | Astrazeneca Ab | Quinoline derivatives and their use as tyrosine kinase inhibitors |
| AU2002347360A1 (en) | 2001-12-05 | 2003-06-17 | Astrazeneca Ab | Pharmaceutical compositions comprising benzofuranyl substituted 3-cyanoquinoline derivatives and their use for the treatment of solid tumours |
| WO2003047583A1 (en) | 2001-12-05 | 2003-06-12 | Astrazeneca Ab | Pharmaceutical compositions comprising benzofuranyl substituted 3-cyanoquinoline derivatives and their use for the treatment of solid tumours |
| WO2003047584A1 (en) | 2001-12-05 | 2003-06-12 | Astrazeneca Ab | Quinoline derivatives |
| GB0129099D0 (en) | 2001-12-05 | 2002-01-23 | Astrazeneca Ab | Chemical compounds |
| AU2002365664A1 (en) | 2001-12-05 | 2003-06-17 | Astrazeneca Ab | Quinoline derivatives as antitumour agents |
| WO2003048159A1 (en) | 2001-12-05 | 2003-06-12 | Astrazeneca Ab | Quinoline derivatives |
| DE60327323D1 (de) | 2002-07-09 | 2009-06-04 | Astrazeneca Ab | Chinazoline derivative und ihre anwendung in der krebsbehandlung |
| GB0215823D0 (en) | 2002-07-09 | 2002-08-14 | Astrazeneca Ab | Quinazoline derivatives |
| GB0225579D0 (en) * | 2002-11-02 | 2002-12-11 | Astrazeneca Ab | Chemical compounds |
-
2002
- 2002-11-02 GB GBGB0225579.2A patent/GB0225579D0/en not_active Ceased
-
2003
- 2003-10-28 EP EP03769677A patent/EP1575943A1/en not_active Withdrawn
- 2003-10-28 WO PCT/GB2003/004661 patent/WO2004041811A1/en not_active Ceased
- 2003-10-28 JP JP2004549306A patent/JP2006508944A/ja active Pending
- 2003-10-28 US US10/532,958 patent/US7173136B2/en not_active Expired - Fee Related
- 2003-10-28 AU AU2003278369A patent/AU2003278369A1/en not_active Abandoned
-
2006
- 2006-12-21 US US11/642,978 patent/US20070191346A1/en not_active Abandoned
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2419301C (en) | Quinazoline derivatives | |
| RU2003107683A (ru) | Производные хиназолина | |
| DE60105295T2 (de) | Chinazolinderivate zur behandlung von tumoren | |
| JP2003535859A5 (OSRAM) | ||
| DE60215178T2 (de) | Quinolin-derivate und ihre verwendung als inhibitoren der tyrosine kinase | |
| US20050038050A1 (en) | Quinazoline derivatives for the treatment of t cell mediated diseases | |
| US20040048881A1 (en) | Quinazoline derivatives with anti-tumour activity | |
| AU2001278609A1 (en) | Quinazoline derivatives | |
| JP2004511480A (ja) | キナゾリン誘導体 | |
| JP2006506463A5 (OSRAM) | ||
| RU2005117337A (ru) | Производные хиназолина в качестве ингибиторов src тирозинкиназы | |
| JP2006508944A (ja) | 3−シアノ−キノリン誘導体 | |
| US7157467B2 (en) | Therapeutic use | |
| WO2003047582A1 (en) | Quinoline derivatives as antitumour agents | |
| TH66058A (th) | อนุพันธ์ควินาโซลีน |