JP2005518370A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2005518370A5 JP2005518370A5 JP2003549330A JP2003549330A JP2005518370A5 JP 2005518370 A5 JP2005518370 A5 JP 2005518370A5 JP 2003549330 A JP2003549330 A JP 2003549330A JP 2003549330 A JP2003549330 A JP 2003549330A JP 2005518370 A5 JP2005518370 A5 JP 2005518370A5
- Authority
- JP
- Japan
- Prior art keywords
- group
- atom
- alkyl
- optionally
- alkoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 83
- 229910052801 chlorine Inorganic materials 0.000 claims 64
- 125000001309 chloro group Chemical group Cl* 0.000 claims 63
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 52
- 125000000217 alkyl group Chemical group 0.000 claims 51
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 44
- 125000004093 cyano group Chemical group *C#N 0.000 claims 40
- 125000001153 fluoro group Chemical group F* 0.000 claims 37
- 229910052731 fluorine Inorganic materials 0.000 claims 35
- 125000005843 halogen group Chemical group 0.000 claims 35
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 32
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 28
- 150000001875 compounds Chemical class 0.000 claims 26
- 125000004430 oxygen atom Chemical group O* 0.000 claims 26
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 25
- 125000001188 haloalkyl group Chemical group 0.000 claims 24
- 125000003545 alkoxy group Chemical group 0.000 claims 22
- 125000000753 cycloalkyl group Chemical group 0.000 claims 22
- 125000004434 sulfur atom Chemical group 0.000 claims 21
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 19
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 19
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 19
- 229910052717 sulfur Inorganic materials 0.000 claims 19
- 125000004438 haloalkoxy group Chemical group 0.000 claims 18
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 17
- 229910052736 halogen Inorganic materials 0.000 claims 15
- 150000002367 halogens Chemical group 0.000 claims 15
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims 14
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims 14
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 12
- -1 polyalkoxyalkyl Chemical group 0.000 claims 12
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 claims 11
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 11
- 125000003342 alkenyl group Chemical group 0.000 claims 10
- 239000003085 diluting agent Substances 0.000 claims 9
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 8
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims 8
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 7
- 239000002253 acid Substances 0.000 claims 7
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 7
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 7
- 125000006583 (C1-C3) haloalkyl group Chemical group 0.000 claims 6
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 6
- 239000011230 binding agent Substances 0.000 claims 6
- 125000004414 alkyl thio group Chemical group 0.000 claims 5
- 229910052799 carbon Inorganic materials 0.000 claims 5
- 125000004432 carbon atom Chemical group C* 0.000 claims 5
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 5
- 229920006395 saturated elastomer Polymers 0.000 claims 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims 5
- 125000006677 (C1-C3) haloalkoxy group Chemical group 0.000 claims 4
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims 4
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 4
- 125000001072 heteroaryl group Chemical group 0.000 claims 4
- 125000005842 heteroatom Chemical group 0.000 claims 4
- 229910021645 metal ion Inorganic materials 0.000 claims 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 4
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims 3
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims 3
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 3
- 241000607479 Yersinia pestis Species 0.000 claims 3
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 3
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 claims 3
- 239000011737 fluorine Substances 0.000 claims 3
- 239000004009 herbicide Substances 0.000 claims 3
- 239000002917 insecticide Substances 0.000 claims 3
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 claims 3
- 238000000034 method Methods 0.000 claims 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims 3
- 229910052757 nitrogen Inorganic materials 0.000 claims 3
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims 3
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims 2
- 125000004738 (C1-C6) alkyl sulfinyl group Chemical group 0.000 claims 2
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims 2
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 claims 2
- 125000006374 C2-C10 alkenyl group Chemical group 0.000 claims 2
- 125000003358 C2-C20 alkenyl group Chemical group 0.000 claims 2
- 241000233866 Fungi Species 0.000 claims 2
- 125000005108 alkenylthio group Chemical group 0.000 claims 2
- 125000003282 alkyl amino group Chemical group 0.000 claims 2
- 125000003277 amino group Chemical group 0.000 claims 2
- 125000005366 cycloalkylthio group Chemical group 0.000 claims 2
- 239000000417 fungicide Substances 0.000 claims 2
- 125000002541 furyl group Chemical group 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 claims 2
- 229910052760 oxygen Inorganic materials 0.000 claims 2
- 239000001301 oxygen Substances 0.000 claims 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 2
- 125000003226 pyrazolyl group Chemical group 0.000 claims 2
- 125000004076 pyridyl group Chemical group 0.000 claims 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims 2
- 125000003107 substituted aryl group Chemical group 0.000 claims 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims 2
- 125000000335 thiazolyl group Chemical group 0.000 claims 2
- 125000001544 thienyl group Chemical group 0.000 claims 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 125000004455 (C1-C3) alkylthio group Chemical group 0.000 claims 1
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims 1
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims 1
- 125000004737 (C1-C6) haloalkoxy group Chemical group 0.000 claims 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 239000004606 Fillers/Extenders Substances 0.000 claims 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 1
- 150000001412 amines Chemical class 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims 1
- NBYQXBYMEUOBON-UHFFFAOYSA-N carbamothioyl chloride Chemical compound NC(Cl)=S NBYQXBYMEUOBON-UHFFFAOYSA-N 0.000 claims 1
- 239000003054 catalyst Substances 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 claims 1
- 238000009833 condensation Methods 0.000 claims 1
- 230000005494 condensation Effects 0.000 claims 1
- 239000000470 constituent Substances 0.000 claims 1
- 125000005112 cycloalkylalkoxy group Chemical group 0.000 claims 1
- 239000000645 desinfectant Substances 0.000 claims 1
- 125000004663 dialkyl amino group Chemical group 0.000 claims 1
- 150000002148 esters Chemical class 0.000 claims 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 claims 1
- 125000004428 fluoroalkoxy group Chemical group 0.000 claims 1
- 125000003709 fluoroalkyl group Chemical group 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 claims 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 150000002736 metal compounds Chemical class 0.000 claims 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims 1
- 125000005359 phenoxyalkyl group Chemical group 0.000 claims 1
- 125000003884 phenylalkyl group Chemical group 0.000 claims 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims 1
- 125000006413 ring segment Chemical group 0.000 claims 1
- 125000000547 substituted alkyl group Chemical group 0.000 claims 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims 1
- 239000004094 surface-active agent Substances 0.000 claims 1
- 125000004149 thio group Chemical group *S* 0.000 claims 1
- 125000003652 trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 claims 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10160007A DE10160007A1 (de) | 2001-12-06 | 2001-12-06 | [1.2]-Oxazin-3,5-dione |
| PCT/EP2002/013382 WO2003048138A1 (de) | 2001-12-06 | 2002-11-27 | [1.2]-oxazin-3,5-dione |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JP2005518370A JP2005518370A (ja) | 2005-06-23 |
| JP2005518370A5 true JP2005518370A5 (enExample) | 2006-01-05 |
| JP4542340B2 JP4542340B2 (ja) | 2010-09-15 |
Family
ID=7708295
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2003549330A Expired - Fee Related JP4542340B2 (ja) | 2001-12-06 | 2002-11-27 | [1,2]−オキサジン−3,5−ジオン類 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US7183238B2 (enExample) |
| EP (1) | EP1456185A1 (enExample) |
| JP (1) | JP4542340B2 (enExample) |
| KR (1) | KR100861483B1 (enExample) |
| CN (1) | CN100506806C (enExample) |
| AU (1) | AU2002358053B2 (enExample) |
| BR (1) | BR0214759A (enExample) |
| CA (1) | CA2469191C (enExample) |
| DE (1) | DE10160007A1 (enExample) |
| MX (1) | MXPA04005371A (enExample) |
| PL (1) | PL370715A1 (enExample) |
| RU (1) | RU2004120559A (enExample) |
| WO (1) | WO2003048138A1 (enExample) |
| ZA (1) | ZA200404286B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102004032421A1 (de) * | 2004-07-05 | 2006-01-26 | Bayer Cropscience Ag | Phenylsubstituierte [1.2]-Oxazin-3,5-dion-und Dihydropyron-Derivate |
| EP2102181B1 (en) | 2006-12-14 | 2014-06-18 | Syngenta Participations AG | 4-phenyl-pyrane-3,5-diones, 4-phenyl-thiopyrane-3,5-diones and cyclohexanetriones as novel herbicides |
| CN101918386B (zh) | 2007-12-13 | 2013-11-13 | 辛根塔有限公司 | 用作除草剂的4-苯基吡喃-3,5-二酮、4-苯基噻喃-3,5-二酮和2-苯基环己-1,3,5-三酮 |
| GB0821010D0 (en) | 2008-11-17 | 2008-12-24 | Univ Warwick | Plant development control composition |
| EP2406216B1 (de) | 2009-03-11 | 2017-04-19 | Bayer Intellectual Property GmbH | Halogenalkylmethylenoxy-phenyl-substituierte ketoenole |
| BR112012014571A2 (pt) * | 2009-12-17 | 2015-09-15 | Syngenta Ltd | "composições herbicidas que compreendem, e métodos de uso de, pirandionas ativas como herbicida". |
| DE102010008644A1 (de) | 2010-02-15 | 2011-08-18 | Bayer Schering Pharma Aktiengesellschaft, 13353 | Zyklische Ketoenole zur Therapie |
| WO2013021044A1 (de) | 2011-08-11 | 2013-02-14 | Bayer Intellectual Property Gmbh | 1,2,4-triazolyl-substituierte ketoenole |
| CA2862335C (en) | 2012-01-26 | 2021-04-13 | Bayer Intellectual Property Gmbh | Phenyl-substituted ketoenols for controlling fish parasites |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TR24452A (tr) * | 1989-04-25 | 1991-11-01 | Sandoz Ltd | Pestisidler ve bitki bueyueme duezenleyicileri olarak heterosiklik dionlar |
| US5336662A (en) | 1989-04-25 | 1994-08-09 | Sandoz Ltd. | Heterocyclic diones as plant growth regulators |
| KR927003554A (ko) * | 1990-10-25 | 1992-12-18 | 예안 크레이머 | 살충제 및 식물 생장 조절제로서의 헤테로 사이클계 디온 유도체 |
| DE4109208A1 (de) * | 1991-03-21 | 1992-09-24 | Bayer Ag | 3-hydroxy-4-aryl-5-oxo-pyrazolin-derivate |
| US5358924A (en) * | 1991-03-21 | 1994-10-25 | Bayer Aktiengesellschaft | 3-hydroxy-4-aryl-5-oxo-pyrozoline derivatives, compositions and use |
| AU6845094A (en) | 1993-06-07 | 1995-01-03 | Bayer Aktiengesellschaft | Iodopropargyl carbamates and their use as biocides in the protection of plants and materials |
| DE4425617A1 (de) | 1994-01-28 | 1995-08-03 | Bayer Ag | 1-H-3-Aryl-pyrrolidin-2,4-dion-Derivate |
| DE4431730A1 (de) | 1994-02-09 | 1995-08-10 | Bayer Ag | Substituierte 1H-3-Aryl-pyrrolidin-2,4-dion-Derivate |
| WO1995026954A1 (de) | 1994-04-05 | 1995-10-12 | Bayer Aktiengesellschaft | Alkoxy-alkyl-substituierte 1-h-3-aryl-pyrrolidin-2,4-dione als herbizide und pestizide |
| BR9606956B1 (pt) | 1995-02-13 | 2010-10-05 | cetoenóis cìclicos substituìdos com fenila, processo para a preparação dos mesmos, seus usos na preparação de pesticidas e herbicidas, pesticidas e herbicidas compreendendo os mesmos, processo para a preparação de pesticidas e herbicidas e uso e método de combate de pragas e ervas daninhas empregando os referidos compostos. | |
| EP0825982B1 (de) | 1995-05-09 | 2002-11-27 | Bayer CropScience AG | Alkyl-dihalogenphenylsubstituierte ketoenole als schädlingsbekämpfungsmittel und herbizide |
| GB9510459D0 (en) | 1995-05-24 | 1995-07-19 | Zeneca Ltd | Bicyclic amines |
| MX9710373A (es) | 1995-06-28 | 1998-07-31 | Bayer Ag | Fenilcetoenoles 2,4,5-trisubstituidos para el empleo como pesticidas y herbicidas. |
| DK0835243T3 (da) | 1995-06-30 | 2003-05-19 | Bayer Cropscience Ag | Dialkyl-halogenphenylsubstituerede ketoenoler til anvendelse som herbicider og pesticider |
| CA2250417A1 (en) | 1996-04-02 | 1997-10-09 | Bayer Aktiengesellschaft | Substituted phenyl keto enols as pesticides and herbicides |
| EP0901490B1 (en) | 1996-05-13 | 2004-04-07 | Syngenta Limited | Bicyclic amines as insecticides |
| AU726090B2 (en) | 1996-08-05 | 2000-11-02 | Bayer Intellectual Property Gmbh | 2- and 2,5-substituted phenylketoenols |
| IL130058A0 (en) | 1996-11-26 | 2000-02-29 | Zeneca Ltd | 8-Azabicyclo(3.2.1)octane-8-azabicyclo(3.2.1)oct-6-ene-9-azabicyclo(3.3.1)nonane-9-aza-3-oxabicyclo (3.3.1)nonane- and 9-aza-3-thiabicyclo(3.3.1)nonane derivatives their preparation and their use as insecticides |
| GB9624611D0 (en) | 1996-11-26 | 1997-01-15 | Zeneca Ltd | Bicyclic amine compounds |
| DE19808261A1 (de) | 1998-02-27 | 1999-10-28 | Bayer Ag | Arylphenylsubstituierte cyclische Ketoenole |
| DE19813354A1 (de) | 1998-03-26 | 1999-09-30 | Bayer Ag | Arylphenylsubstituierte cyclische Ketoenole |
| DE19818732A1 (de) | 1998-04-27 | 1999-10-28 | Bayer Ag | Arylphenylsubstituierte cyclische Ketoenole |
| WO2001017972A2 (de) | 1999-09-07 | 2001-03-15 | Syngenta Participations Ag | Neue herbizide |
-
2001
- 2001-12-06 DE DE10160007A patent/DE10160007A1/de not_active Withdrawn
-
2002
- 2002-11-27 KR KR1020047007909A patent/KR100861483B1/ko not_active Expired - Fee Related
- 2002-11-27 US US10/497,479 patent/US7183238B2/en not_active Expired - Fee Related
- 2002-11-27 MX MXPA04005371A patent/MXPA04005371A/es active IP Right Grant
- 2002-11-27 RU RU2004120559/04A patent/RU2004120559A/ru not_active Application Discontinuation
- 2002-11-27 WO PCT/EP2002/013382 patent/WO2003048138A1/de not_active Ceased
- 2002-11-27 CN CN02827658.2A patent/CN100506806C/zh not_active Expired - Fee Related
- 2002-11-27 BR BR0214759-9A patent/BR0214759A/pt not_active Application Discontinuation
- 2002-11-27 CA CA2469191A patent/CA2469191C/en not_active Expired - Fee Related
- 2002-11-27 JP JP2003549330A patent/JP4542340B2/ja not_active Expired - Fee Related
- 2002-11-27 PL PL02370715A patent/PL370715A1/xx unknown
- 2002-11-27 EP EP02791728A patent/EP1456185A1/de not_active Withdrawn
- 2002-11-27 AU AU2002358053A patent/AU2002358053B2/en not_active Ceased
-
2004
- 2004-06-01 ZA ZA200404286A patent/ZA200404286B/en unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0201852B1 (de) | Schädlingsbekämpfungsmittel auf Basis von Pyrazolderivaten | |
| MX281941B (en) | Anthranilamide compounds, process for their production and pesticides containing them | |
| KR930002334A (ko) | 3-아릴-4-하이드록시-△³-디하이드로푸라논 및 3-아릴-4-하이드록시-△³-디하이드로티오페논 유도체 | |
| DE4109208A1 (de) | 3-hydroxy-4-aryl-5-oxo-pyrazolin-derivate | |
| JP2002518389A5 (enExample) | ||
| RU2006129638A (ru) | Производные малононитрила и их применение | |
| JP2005522484A5 (enExample) | ||
| EP0154115A1 (de) | Herbizide Mittel auf Basis von Pyrazolderivaten | |
| DD261085A5 (de) | Schaedlingsbekaempfungsmittel, insbesondere insektizide und akarizide mittel | |
| JPS62164669A (ja) | 1−アリ−ルピラゾ−ル | |
| JP2005518370A5 (enExample) | ||
| US6433002B2 (en) | Pesticidal 1-polyarylpyrroles | |
| EP0472925B1 (de) | Substituierte Pyridine | |
| JP2004528350A5 (enExample) | ||
| RU2004120559A (ru) | (1,2)-оксазин-3,5-дионы | |
| US5981438A (en) | 1-phenyl-5-anilinotetrazoles | |
| JP2004503552A5 (enExample) | ||
| JP2005516906A5 (enExample) | ||
| KR900014330A (ko) | 헤테로고리 화합물, 그의 제조방법 및 용도 | |
| JP2015518817A5 (enExample) | ||
| MXPA04002040A (es) | Pirazoles 3-sustituidos de accion insecticida y acariciada. | |
| EP0839809A1 (en) | Pesticidal 1-arylpyrazole-5-sulfinilimine derivatives | |
| DD254131A5 (de) | Herbizide mittel | |
| KR20040004413A (ko) | 치환된 4,5-디하이드로-1,2,4-트리아진-3-온,1,2,4-트리아진-3-온 및 살균제 및 살충제로서의 이들의용도 | |
| JP2005089383A (ja) | 新規チアジアゾール含有ジフルオロアルケン類及び有害生物防除剤としての利用 |