ZA200404286B - [1.2]-oxazin-3,5-diones. - Google Patents
[1.2]-oxazin-3,5-diones. Download PDFInfo
- Publication number
- ZA200404286B ZA200404286B ZA200404286A ZA200404286A ZA200404286B ZA 200404286 B ZA200404286 B ZA 200404286B ZA 200404286 A ZA200404286 A ZA 200404286A ZA 200404286 A ZA200404286 A ZA 200404286A ZA 200404286 B ZA200404286 B ZA 200404286B
- Authority
- ZA
- South Africa
- Prior art keywords
- alkyl
- alkoxy
- optionally
- chlorine
- halogen
- Prior art date
Links
- 229910052739 hydrogen Inorganic materials 0.000 claims description 165
- 239000001257 hydrogen Substances 0.000 claims description 165
- 150000002431 hydrogen Chemical class 0.000 claims description 135
- 239000000460 chlorine Substances 0.000 claims description 128
- 229910052801 chlorine Inorganic materials 0.000 claims description 128
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 125
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 100
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 93
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 93
- 229910052794 bromium Inorganic materials 0.000 claims description 93
- 239000011737 fluorine Substances 0.000 claims description 87
- 229910052731 fluorine Inorganic materials 0.000 claims description 87
- 229910052736 halogen Inorganic materials 0.000 claims description 72
- 150000002367 halogens Chemical class 0.000 claims description 72
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 68
- 125000001153 fluoro group Chemical group F* 0.000 claims description 68
- -1 polyalkoxyalkyl Chemical group 0.000 claims description 54
- 150000001875 compounds Chemical class 0.000 claims description 52
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 48
- 229910052760 oxygen Inorganic materials 0.000 claims description 48
- 239000001301 oxygen Substances 0.000 claims description 48
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 43
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 42
- 239000005864 Sulphur Substances 0.000 claims description 42
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 38
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 36
- 125000000217 alkyl group Chemical group 0.000 claims description 31
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 28
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 26
- 125000005843 halogen group Chemical group 0.000 claims description 25
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 24
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 22
- 229910052799 carbon Inorganic materials 0.000 claims description 21
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 20
- 239000003085 diluting agent Substances 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 16
- 125000003545 alkoxy group Chemical group 0.000 claims description 16
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 14
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 14
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 14
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 12
- 239000011230 binding agent Substances 0.000 claims description 12
- 125000001188 haloalkyl group Chemical group 0.000 claims description 12
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 12
- 229920006395 saturated elastomer Polymers 0.000 claims description 12
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 11
- 125000003342 alkenyl group Chemical group 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 10
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 10
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 8
- 125000001072 heteroaryl group Chemical group 0.000 claims description 8
- 125000005842 heteroatom Chemical group 0.000 claims description 8
- 229910021645 metal ion Inorganic materials 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 8
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 8
- 239000004009 herbicide Substances 0.000 claims description 7
- 125000006677 (C1-C3) haloalkoxy group Chemical group 0.000 claims description 6
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 claims description 6
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 239000000575 pesticide Substances 0.000 claims description 6
- 125000002541 furyl group Chemical group 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 5
- 125000000335 thiazolyl group Chemical group 0.000 claims description 5
- 125000001544 thienyl group Chemical group 0.000 claims description 5
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical compound COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 claims description 4
- 230000003641 microbiacidal effect Effects 0.000 claims description 4
- 229940124561 microbicide Drugs 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 125000003107 substituted aryl group Chemical group 0.000 claims description 4
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 4
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 3
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 claims description 2
- 125000005108 alkenylthio group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- NBYQXBYMEUOBON-UHFFFAOYSA-N carbamothioyl chloride Chemical class NC(Cl)=S NBYQXBYMEUOBON-UHFFFAOYSA-N 0.000 claims description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims description 2
- 125000005366 cycloalkylthio group Chemical group 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 claims description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 239000012948 isocyanate Substances 0.000 claims description 2
- 150000002513 isocyanates Chemical class 0.000 claims description 2
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 claims description 2
- 150000002540 isothiocyanates Chemical class 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000002736 metal compounds Chemical class 0.000 claims description 2
- 125000005359 phenoxyalkyl group Chemical group 0.000 claims description 2
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 2
- 150000003018 phosphorus compounds Chemical class 0.000 claims description 2
- 125000006413 ring segment Chemical group 0.000 claims description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims description 2
- 150000007970 thio esters Chemical class 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 4
- 241000607479 Yersinia pestis Species 0.000 claims 3
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims 2
- 241000233866 Fungi Species 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims 1
- 125000004455 (C1-C3) alkylthio group Chemical group 0.000 claims 1
- 239000004606 Fillers/Extenders Substances 0.000 claims 1
- 239000004094 surface-active agent Substances 0.000 claims 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 3
- 150000002085 enols Chemical class 0.000 description 2
- KDZFOYZCCXIDJJ-UHFFFAOYSA-N oxazinane-3,5-dione Chemical class O=C1CONC(=O)C1 KDZFOYZCCXIDJJ-UHFFFAOYSA-N 0.000 description 2
- DUWKJWZMEWEALH-UHFFFAOYSA-N 4-phenyloxazinane-3,5-dione Chemical class O=C1CONC(=O)C1C1=CC=CC=C1 DUWKJWZMEWEALH-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 101100001677 Emericella variicolor andL gene Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 238000000053 physical method Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/02—1,2-Oxazines; Hydrogenated 1,2-oxazines
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/04—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids
- C07C259/06—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids having carbon atoms of hydroxamic groups bound to hydrogen atoms or to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Wood Science & Technology (AREA)
- Environmental Sciences (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Zoology (AREA)
- Pest Control & Pesticides (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Indole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10160007A DE10160007A1 (de) | 2001-12-06 | 2001-12-06 | [1.2]-Oxazin-3,5-dione |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA200404286B true ZA200404286B (en) | 2005-06-01 |
Family
ID=7708295
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA200404286A ZA200404286B (en) | 2001-12-06 | 2004-06-01 | [1.2]-oxazin-3,5-diones. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US7183238B2 (enExample) |
| EP (1) | EP1456185A1 (enExample) |
| JP (1) | JP4542340B2 (enExample) |
| KR (1) | KR100861483B1 (enExample) |
| CN (1) | CN100506806C (enExample) |
| AU (1) | AU2002358053B2 (enExample) |
| BR (1) | BR0214759A (enExample) |
| CA (1) | CA2469191C (enExample) |
| DE (1) | DE10160007A1 (enExample) |
| MX (1) | MXPA04005371A (enExample) |
| PL (1) | PL370715A1 (enExample) |
| RU (1) | RU2004120559A (enExample) |
| WO (1) | WO2003048138A1 (enExample) |
| ZA (1) | ZA200404286B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102004032421A1 (de) * | 2004-07-05 | 2006-01-26 | Bayer Cropscience Ag | Phenylsubstituierte [1.2]-Oxazin-3,5-dion-und Dihydropyron-Derivate |
| NZ577571A (en) * | 2006-12-14 | 2012-03-30 | Syngenta Participations Ag | 4-phenyl-pyrane-3,5-diones, 4-phenyl-thiopyrane-3,5-diones and cyclohexanetriones as novel herbicides |
| NZ585790A (en) * | 2007-12-13 | 2012-02-24 | Syngenta Ltd | 4-Phenylpyrane-3,5-diones, 4-phenylthiopyrane-3,5-diones and 2-phenylcyclohexane-1,3,5-triones as herbicides |
| GB0821010D0 (en) * | 2008-11-17 | 2008-12-24 | Univ Warwick | Plant development control composition |
| CN103641709B (zh) * | 2009-03-11 | 2017-08-25 | 拜耳知识产权有限责任公司 | 被卤代烷基亚甲基氧基苯基取代的酮烯醇 |
| EP2523555A2 (en) * | 2009-12-17 | 2012-11-21 | Syngenta Limited | Herbicidal compositions comprising, and methods of use of, herbicidally active pyrandiones |
| DE102010008644A1 (de) | 2010-02-15 | 2011-08-18 | Bayer Schering Pharma Aktiengesellschaft, 13353 | Zyklische Ketoenole zur Therapie |
| CN103857661B (zh) | 2011-08-11 | 2016-11-16 | 拜耳知识产权有限责任公司 | 1,2,4‑三唑基取代的酮烯醇 |
| US9089137B2 (en) | 2012-01-26 | 2015-07-28 | Bayer Intellectual Property Gmbh | Phenyl-substituted ketoenols for controlling fish parasites |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5336662A (en) | 1989-04-25 | 1994-08-09 | Sandoz Ltd. | Heterocyclic diones as plant growth regulators |
| TR24452A (tr) | 1989-04-25 | 1991-11-01 | Sandoz Ltd | Pestisidler ve bitki bueyueme duezenleyicileri olarak heterosiklik dionlar |
| IL99834A0 (en) | 1990-10-25 | 1992-08-18 | Sandoz Ag | Heterocyclic dione derivatives,their preparation and their use as pesticides and plant growth regulators |
| DE4109208A1 (de) * | 1991-03-21 | 1992-09-24 | Bayer Ag | 3-hydroxy-4-aryl-5-oxo-pyrazolin-derivate |
| US5358924A (en) * | 1991-03-21 | 1994-10-25 | Bayer Aktiengesellschaft | 3-hydroxy-4-aryl-5-oxo-pyrozoline derivatives, compositions and use |
| WO1994029268A1 (de) | 1993-06-07 | 1994-12-22 | Bayer Aktiengesellschaft | Iodpropargylcarbamate und ihre verwendung als biozide im pflanzen- und materialschutz |
| DE4425617A1 (de) | 1994-01-28 | 1995-08-03 | Bayer Ag | 1-H-3-Aryl-pyrrolidin-2,4-dion-Derivate |
| DE4431730A1 (de) | 1994-02-09 | 1995-08-10 | Bayer Ag | Substituierte 1H-3-Aryl-pyrrolidin-2,4-dion-Derivate |
| CN1075060C (zh) | 1994-04-05 | 2001-11-21 | 拜尔公司 | 用作除草剂和农药的烷氧基－烷基取代的1－h－3－芳基－吡咯烷－2,4－二酮 |
| JP4036470B2 (ja) | 1995-02-13 | 2008-01-23 | バイエル・アクチエンゲゼルシヤフト | 除草剤および有害生物防除剤としての２−フェニル置換複素環式１，３−ケトエノール |
| BR9608229A (pt) | 1995-05-09 | 1998-12-29 | Bayer Ag | Cetoenóis alquil-dihalogenofenil-substituídos |
| GB9510459D0 (en) | 1995-05-24 | 1995-07-19 | Zeneca Ltd | Bicyclic amines |
| RU2195449C2 (ru) | 1995-06-28 | 2002-12-27 | Байер Акциенгезельшафт | 2,4,5-тризамещенные фенилкетоенолы, промежуточные соединения для их получения, способ и средство для борьбы с насекомыми и паукообразными на их основе |
| ES2189877T3 (es) | 1995-06-30 | 2003-07-16 | Bayer Cropscience Ag | Cetoenoles dialquil-halogenofenilsubstituidos para el empleo como herbicidas y pesticidas. |
| CA2250417A1 (en) | 1996-04-02 | 1997-10-09 | Bayer Aktiengesellschaft | Substituted phenyl keto enols as pesticides and herbicides |
| ATE263765T1 (de) | 1996-05-13 | 2004-04-15 | Syngenta Ltd | Bicyclische amine als insektizide |
| DK1277734T3 (da) | 1996-08-05 | 2007-06-04 | Bayer Cropscience Ag | 2- og 2,5-substituerede phenylketoenoler |
| WO1998025924A1 (en) | 1996-11-26 | 1998-06-18 | Zeneca Limited | 8-azabicyclo[3.2.1]octane-, 8-azabicyclo[3.2.1]oct-6-ene-, 9-azabicyclo[3.3.1]nonane-, 9-aza-3-oxabicyclo[3.3.1]nonane- and 9-aza-3-thiabicyclo[3.3.1]nonane derivatives, their preparation and their use as insecticides |
| GB9624611D0 (en) | 1996-11-26 | 1997-01-15 | Zeneca Ltd | Bicyclic amine compounds |
| DE19808261A1 (de) | 1998-02-27 | 1999-10-28 | Bayer Ag | Arylphenylsubstituierte cyclische Ketoenole |
| DE19813354A1 (de) | 1998-03-26 | 1999-09-30 | Bayer Ag | Arylphenylsubstituierte cyclische Ketoenole |
| DE19818732A1 (de) | 1998-04-27 | 1999-10-28 | Bayer Ag | Arylphenylsubstituierte cyclische Ketoenole |
| CA2382435C (en) * | 1999-09-07 | 2009-02-03 | Syngenta Participations Ag | Novel herbicidally active phenyl-substituted heterocycles |
-
2001
- 2001-12-06 DE DE10160007A patent/DE10160007A1/de not_active Withdrawn
-
2002
- 2002-11-27 JP JP2003549330A patent/JP4542340B2/ja not_active Expired - Fee Related
- 2002-11-27 RU RU2004120559/04A patent/RU2004120559A/ru not_active Application Discontinuation
- 2002-11-27 AU AU2002358053A patent/AU2002358053B2/en not_active Ceased
- 2002-11-27 KR KR1020047007909A patent/KR100861483B1/ko not_active Expired - Fee Related
- 2002-11-27 CA CA2469191A patent/CA2469191C/en not_active Expired - Fee Related
- 2002-11-27 MX MXPA04005371A patent/MXPA04005371A/es active IP Right Grant
- 2002-11-27 CN CN02827658.2A patent/CN100506806C/zh not_active Expired - Fee Related
- 2002-11-27 EP EP02791728A patent/EP1456185A1/de not_active Withdrawn
- 2002-11-27 US US10/497,479 patent/US7183238B2/en not_active Expired - Fee Related
- 2002-11-27 WO PCT/EP2002/013382 patent/WO2003048138A1/de not_active Ceased
- 2002-11-27 BR BR0214759-9A patent/BR0214759A/pt not_active Application Discontinuation
- 2002-11-27 PL PL02370715A patent/PL370715A1/xx unknown
-
2004
- 2004-06-01 ZA ZA200404286A patent/ZA200404286B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU2002358053A1 (en) | 2003-06-17 |
| AU2002358053B2 (en) | 2008-05-08 |
| CA2469191C (en) | 2012-07-10 |
| US20050070707A1 (en) | 2005-03-31 |
| JP2005518370A (ja) | 2005-06-23 |
| RU2004120559A (ru) | 2006-01-10 |
| KR20050044597A (ko) | 2005-05-12 |
| DE10160007A1 (de) | 2003-06-18 |
| EP1456185A1 (de) | 2004-09-15 |
| BR0214759A (pt) | 2004-12-14 |
| KR100861483B1 (ko) | 2008-10-02 |
| PL370715A1 (en) | 2005-05-30 |
| CN100506806C (zh) | 2009-07-01 |
| MXPA04005371A (es) | 2004-09-27 |
| US7183238B2 (en) | 2007-02-27 |
| CN1617860A (zh) | 2005-05-18 |
| CA2469191A1 (en) | 2003-06-12 |
| WO2003048138A1 (de) | 2003-06-12 |
| JP4542340B2 (ja) | 2010-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0769001B1 (de) | 2-arylcyclopentan-1,3-dion-derivate | |
| EP0456063B1 (de) | 1-H-3-Aryl-pyrrolidin-2,4-dion-Derivate | |
| LUC00068I2 (en) | Heterocyclic amide derivatives useful as microbiocides | |
| CA2187015A1 (en) | Alkoxy-alkyl-substituted 1-h-3-aryl-pyrrolidine-2,4-diones used as herbicides and pesticides | |
| EP1418811A1 (de) | Selektive herbizide auf basis von substituierten, cyclischen ketoenolen und safenern | |
| EP0690861A1 (de) | Substituierte, heteroanellierte imidazole und ihre verwendung als herbizide | |
| EP0647637A1 (de) | 3-Aryl-4-hydroxy-3-dihydrofuranon-Derivate | |
| WO2001017972A2 (de) | Neue herbizide | |
| DE4431730A1 (de) | Substituierte 1H-3-Aryl-pyrrolidin-2,4-dion-Derivate | |
| EP3310759A1 (de) | Neue alkinyl-substituierte- 3-phenylpyrrolidin-2,4-dione und deren verwendung als herbizide | |
| UA86391C2 (ru) | 2-галоген-6-алкилфенилзамещённые производные тетрамовой кислоты, средство для борьбы с вредителями или нежелательным ростом растений, промежуточное соединение | |
| DE4216814A1 (de) | 3-aryl-4-hydroxy-(delta)(pfeil hoch)3(pfeil hoch)-dihydrofuranon- und 3-aryl-4-hydroxy-(delta)(pfeil hoch)3(pfeil hoch)-dihydrothiophenon-derivate | |
| EP2844649A1 (de) | Salze von n-(tetrazol-5-yl)- und n-(triazol-5-yl)arylcarbonsäureamiden und ihre verwendung als herbizide | |
| ZA200404286B (en) | [1.2]-oxazin-3,5-diones. | |
| MX2023013978A (es) | Composicion fungicida que contiene compuestos de oxadiazol. | |
| EP0415185B1 (de) | 4-Alkoxy- bzw. 4-(substituierte)Amino-3-arylpyrrolinon-Derivate | |
| DD155231A5 (de) | Herbizide und pflanzenwuchsregulierende mittel | |
| EP4132916B1 (de) | Substituierte isophtalsäurediamide und ihre verwendung als herbizide | |
| EP1587367B1 (de) | Selektive herbizide auf basis von substituierten, cyclischen dicarbonylverbindungen und safenern | |
| JP2005518370A5 (enExample) | ||
| EP3442978A1 (de) | Anellierte 3-phenyltetramsäure-derivate mit herbizider wirkung | |
| PH12022550233A1 (en) | Oxazepinone derivative, insecticide for agricultural and horticultural use containing said derivative, and method for using same | |
| DE3422346A1 (de) | Neue herbizid wirksame 5-amino-3-oxo-4-(subst.-phenyl)-2,3-dihydrofurane und derivate davon, verfahren zu ihrer herstellung sowie diese verbindungen enthaltende herbizide mittel | |
| EP4132917B1 (de) | Substituierte isophtalsäurediamide | |
| DE2919293A1 (de) | N-(2,5-diazolyl)alkyl-halogenacetanilide, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |