IT1127360B - Procedimento di preparazione di aniline metacrilate - Google Patents
Procedimento di preparazione di aniline metacrilateInfo
- Publication number
- IT1127360B IT1127360B IT47892/80A IT4789280A IT1127360B IT 1127360 B IT1127360 B IT 1127360B IT 47892/80 A IT47892/80 A IT 47892/80A IT 4789280 A IT4789280 A IT 4789280A IT 1127360 B IT1127360 B IT 1127360B
- Authority
- IT
- Italy
- Prior art keywords
- methacrylate
- preparation procedure
- aniline preparation
- aniline
- procedure
- Prior art date
Links
- OQSVRIBETKPGRG-UHFFFAOYSA-N aniline 2-methylprop-2-enoic acid Chemical compound NC1=CC=CC=C1.CC(C(=O)O)=C OQSVRIBETKPGRG-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7904483A FR2449077A2 (fr) | 1979-02-15 | 1979-02-15 | Procede de preparation d'anilines metachlorees |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IT8047892A0 IT8047892A0 (it) | 1980-02-13 |
| IT1127360B true IT1127360B (it) | 1986-05-21 |
Family
ID=9222292
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT47892/80A IT1127360B (it) | 1979-02-15 | 1980-02-13 | Procedimento di preparazione di aniline metacrilate |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4324914A (enExample) |
| JP (1) | JPS5928544B2 (enExample) |
| AT (1) | AT372370B (enExample) |
| BE (1) | BE881754A (enExample) |
| BR (1) | BR8000910A (enExample) |
| CA (1) | CA1139313A (enExample) |
| CH (1) | CH642049A5 (enExample) |
| DD (1) | DD149060A5 (enExample) |
| DE (1) | DE3003960A1 (enExample) |
| DK (1) | DK153392C (enExample) |
| ES (1) | ES488572A1 (enExample) |
| FR (1) | FR2449077A2 (enExample) |
| GB (1) | GB2042542B (enExample) |
| HU (1) | HU185214B (enExample) |
| IE (1) | IE49393B1 (enExample) |
| IL (1) | IL59190A (enExample) |
| IT (1) | IT1127360B (enExample) |
| LU (1) | LU82167A1 (enExample) |
| NL (1) | NL8000620A (enExample) |
| SE (1) | SE447897B (enExample) |
| SU (1) | SU1082316A3 (enExample) |
| YU (1) | YU42323B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3127026A1 (de) * | 1981-07-09 | 1983-01-20 | Bayer Ag, 5090 Leverkusen | Verrfahren zur herstellung von m-chlorsubstituiertenanilinen |
| FR2521132A1 (fr) * | 1982-02-05 | 1983-08-12 | Rhone Poulenc Agrochimie | Procede de preparation de metahalogeno-anilines |
| US4888425A (en) * | 1982-04-30 | 1989-12-19 | Union Carbide Chemicals And Plastics Company Inc. | Preparation of polyalkylene polyamines |
| JPS5955855A (ja) * | 1982-09-27 | 1984-03-31 | Mitsui Toatsu Chem Inc | 3,3′−ジアミノジフエニルメタンの製造方法 |
| JPS62132400U (enExample) * | 1986-02-14 | 1987-08-20 | ||
| USRE34745E (en) * | 1986-10-30 | 1994-09-27 | The Dow Chemical Company | High purity process for the preparation of 4,6-diamino-1,3-benzenediol |
| US5001279A (en) * | 1989-11-17 | 1991-03-19 | The Dow Chemical Company | Aqueous synthesis of 2-halo-4,6-dinitroresorcinol and 4,6-diaminoresorcinol |
| US5294742A (en) * | 1992-03-21 | 1994-03-15 | Hoechst Atkiengesellschaft | Process for preparing 3,5-difluoroaniline |
| WO2009111306A2 (en) * | 2008-02-29 | 2009-09-11 | Cook Biotech Incorporated | Coated embolization device |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3148217A (en) * | 1961-11-16 | 1964-09-08 | Gen Aniline & Film Corp | Catalytic hydrogenation of halonitrobenzene compounds |
| DE2032565A1 (de) * | 1970-07-01 | 1972-01-05 | Farbwerke Hoechst AG, vormals Meister Lucius & Bruning, 6000 Frankfurt | Verfahren zur Herstellung von 3 Difluorchlormethylanihn |
| DE2036313C3 (de) * | 1970-07-22 | 1982-03-25 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Halogen-substituiertenaromatischen Aminen |
| CS188122B2 (en) * | 1971-02-08 | 1979-02-28 | Kurt Habig | Method of production the sulfide catalysts with the platinum on coal |
| DE2503187C3 (de) * | 1975-01-27 | 1979-05-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung durch Chlor meta-substituierte Aniline |
| FR2403990A1 (fr) * | 1977-09-22 | 1979-04-20 | Philagro Sa | Procede de deshalogenation d'amines aromatiques halogenees |
| DE2758111A1 (de) * | 1977-12-24 | 1979-07-05 | Basf Ag | Verfahren zur herstellung von halogenanilinen |
-
1979
- 1979-02-15 FR FR7904483A patent/FR2449077A2/fr active Granted
-
1980
- 1980-01-22 IL IL59190A patent/IL59190A/xx unknown
- 1980-01-23 US US06/114,651 patent/US4324914A/en not_active Expired - Lifetime
- 1980-01-31 NL NL8000620A patent/NL8000620A/nl not_active Application Discontinuation
- 1980-02-04 DE DE19803003960 patent/DE3003960A1/de active Granted
- 1980-02-13 IT IT47892/80A patent/IT1127360B/it active
- 1980-02-13 GB GB8004746A patent/GB2042542B/en not_active Expired
- 1980-02-13 CA CA000345561A patent/CA1139313A/en not_active Expired
- 1980-02-13 IE IE277/80A patent/IE49393B1/en unknown
- 1980-02-13 YU YU378/80A patent/YU42323B/xx unknown
- 1980-02-13 DD DD80219034A patent/DD149060A5/de not_active IP Right Cessation
- 1980-02-14 HU HU80337A patent/HU185214B/hu unknown
- 1980-02-14 ES ES488572A patent/ES488572A1/es not_active Expired
- 1980-02-14 SE SE8001166A patent/SE447897B/sv not_active IP Right Cessation
- 1980-02-14 LU LU82167A patent/LU82167A1/fr unknown
- 1980-02-14 JP JP55017165A patent/JPS5928544B2/ja not_active Expired
- 1980-02-14 BR BR8000910A patent/BR8000910A/pt unknown
- 1980-02-14 CH CH123780A patent/CH642049A5/fr not_active IP Right Cessation
- 1980-02-14 DK DK062880A patent/DK153392C/da active
- 1980-02-14 SU SU802882799A patent/SU1082316A3/ru active
- 1980-02-15 AT AT0085480A patent/AT372370B/de not_active IP Right Cessation
- 1980-02-15 BE BE0/199423A patent/BE881754A/fr unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE447897B (sv) | 1986-12-22 |
| IE49393B1 (en) | 1985-10-02 |
| CA1139313A (en) | 1983-01-11 |
| YU37880A (en) | 1983-01-21 |
| DK62880A (da) | 1980-08-16 |
| NL8000620A (nl) | 1980-08-19 |
| GB2042542A (en) | 1980-09-24 |
| DE3003960C2 (enExample) | 1990-07-05 |
| US4324914A (en) | 1982-04-13 |
| LU82167A1 (fr) | 1981-09-10 |
| AT372370B (de) | 1983-09-26 |
| JPS55149229A (en) | 1980-11-20 |
| DE3003960A1 (de) | 1980-08-28 |
| DD149060A5 (de) | 1981-06-24 |
| IL59190A0 (en) | 1980-05-30 |
| BE881754A (fr) | 1980-08-18 |
| FR2449077B2 (enExample) | 1983-04-29 |
| ES488572A1 (es) | 1980-10-01 |
| FR2449077A2 (fr) | 1980-09-12 |
| GB2042542B (en) | 1983-05-05 |
| IL59190A (en) | 1983-06-15 |
| SU1082316A3 (ru) | 1984-03-23 |
| CH642049A5 (fr) | 1984-03-30 |
| ATA85480A (de) | 1983-02-15 |
| DK153392C (da) | 1988-11-28 |
| SE8001166L (sv) | 1980-08-16 |
| YU42323B (en) | 1988-08-31 |
| IE800277L (en) | 1980-08-15 |
| DK153392B (da) | 1988-07-11 |
| JPS5928544B2 (ja) | 1984-07-13 |
| BR8000910A (pt) | 1980-10-29 |
| HU185214B (en) | 1984-12-28 |
| IT8047892A0 (it) | 1980-02-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK436280A (da) | Saebeautomat | |
| BE883277A (fr) | Sportinrichting | |
| DK55880A (da) | Telekopmast | |
| FI64225B (fi) | Centrifugalpump | |
| BE881469A (fr) | Kunststofkaasvat | |
| DD153995A3 (de) | Schaedlingsbekaempfungsmittel | |
| TR20825A (tr) | Feniluereler | |
| DK407779A (da) | Engangsslaas | |
| ATA76180A (de) | Verbandsmauerwerk | |
| DK163815C (da) | 3-brom-4-fluor-benzaldehyd | |
| BR8001470A (pt) | Junto homocinetica | |
| FI64249B (fi) | Resonansbotten | |
| DK347080A (da) | Hvirvellagesapparat | |
| IT1127360B (it) | Procedimento di preparazione di aniline metacrilate | |
| IT1145353B (it) | Caseinati di ologoelemento | |
| TR20812A (tr) | Feniluereler | |
| FI64228B (fi) | Lageranordning | |
| DK155753C (da) | Graveskovl | |
| BE882006A (fr) | Broyeur-agitateur | |
| DE3062232D1 (de) | 17-cyclopropylmethyl-3-methoxy-14-hydroxy-morphinan-6-one | |
| DK470380A (da) | Stabilisator-glittemiddel-praeparat | |
| DK400082A (da) | Anilinderivater | |
| FI65885B (fi) | Planteringsanordning | |
| FI63700B (fi) | Saekerhetsvimpel | |
| DK519480A (da) | Ureaderivat |