IL71633A - Ergoline derivatives,their preparation and pharmaceutical compositions containing them - Google Patents
Ergoline derivatives,their preparation and pharmaceutical compositions containing themInfo
- Publication number
- IL71633A IL71633A IL71633A IL7163384A IL71633A IL 71633 A IL71633 A IL 71633A IL 71633 A IL71633 A IL 71633A IL 7163384 A IL7163384 A IL 7163384A IL 71633 A IL71633 A IL 71633A
- Authority
- IL
- Israel
- Prior art keywords
- preparation
- pharmaceutical compositions
- compositions containing
- ergoline derivatives
- ergoline
- Prior art date
Links
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical class O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/10—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hetero atoms directly attached in position 8
- C07D457/12—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838311679A GB8311679D0 (en) | 1983-04-28 | 1983-04-28 | Ergoline derivatives |
| GB838314816A GB8314816D0 (en) | 1983-05-27 | 1983-05-27 | Ergoline derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL71633A0 IL71633A0 (en) | 1984-07-31 |
| IL71633A true IL71633A (en) | 1987-12-20 |
Family
ID=26285978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL71633A IL71633A (en) | 1983-04-28 | 1984-04-25 | Ergoline derivatives,their preparation and pharmaceutical compositions containing them |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4690929A (da) |
| EP (1) | EP0126968B1 (da) |
| KR (1) | KR900008696B1 (da) |
| AU (1) | AU556968B2 (da) |
| CA (1) | CA1205801A (da) |
| DE (1) | DE3475709D1 (da) |
| DK (1) | DK162996C (da) |
| ES (1) | ES531906A0 (da) |
| FI (1) | FI81349C (da) |
| GR (1) | GR79575B (da) |
| HU (1) | HU198713B (da) |
| IE (1) | IE57240B1 (da) |
| IL (1) | IL71633A (da) |
| NO (1) | NO161562C (da) |
| PH (1) | PH21123A (da) |
| PT (1) | PT78496B (da) |
| SU (1) | SU1327788A3 (da) |
| YU (1) | YU43357B (da) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8714767D0 (en) * | 1987-06-24 | 1987-07-29 | Erba Farmitalia | Egoline derivatives |
| HU196399B (en) * | 1983-02-16 | 1988-11-28 | Sandoz Ag | Process for producing ergoline derivatives and pharmaceutical compositions comprising such compounds |
| GB8501078D0 (en) * | 1985-01-16 | 1985-02-20 | Erba Farmitalia | Piperazin-1-yl-ergo-line derivatives |
| GB2173189B (en) * | 1985-02-21 | 1988-04-27 | Maruko Pharmaceutical Co | Ergoline derivatives and salts thereof and pharmaceutical compositions thereof |
| GB8515528D0 (en) * | 1985-06-19 | 1985-07-24 | Erba Farmitalia | Ergoline derivatives |
| US4801712A (en) * | 1985-06-24 | 1989-01-31 | Eli Lilly And Company | 2-Alkyl(or phenyl)thio-6-n-alkylergolines are dopamine D-1 antagonists without D-2 agonist activity |
| DE3528576A1 (de) * | 1985-08-06 | 1987-02-19 | Schering Ag | Verfahren zur herstellung von ergolin-thioharnstoffen |
| DE3535929A1 (de) * | 1985-10-04 | 1987-04-09 | Schering Ag | 1,2-disubstituierte ergolinderivate |
| GB8617907D0 (en) * | 1986-07-22 | 1986-08-28 | Erba Farmitalia | Tetracyclic indole derivatives |
| GB8702364D0 (en) * | 1987-02-03 | 1987-03-11 | Erba Farmitalia | Ergolinyl heterocycles |
| DK338789A (da) * | 1988-07-15 | 1990-01-16 | Schering Ag | 2-substituerede ergolinylurinstofderivater og fremgangsmaade til fremstilling deraf, deres anvendelse som laegemidler samt mellemprodukter til fremstilling deraf |
| RU2074857C1 (ru) * | 1990-01-25 | 1997-03-10 | Фармиталиа Карло Эрба С.Р.Л. | Способ получения производных эрголина |
| GB9006772D0 (en) * | 1990-03-27 | 1990-05-23 | Erba Carlo Spa | 4-piperidinyl-ergoline derivatives |
| NZ258559A (en) * | 1992-12-24 | 1996-07-26 | Erba Carlo Spa | Ergoline derivatives; their preparation and pharmaceutical compositions containing them |
| DK2062914T3 (da) | 2001-06-08 | 2014-07-14 | Ipsen Pharma | Somatostatin-dopamin-chimære analoger |
| TWI523863B (zh) | 2012-11-01 | 2016-03-01 | 艾普森藥品公司 | 體抑素-多巴胺嵌合體類似物 |
| RU2015120570A (ru) | 2012-11-01 | 2016-12-20 | Ипсен Фарма С.А.С. | Аналоги соматостатина и их димеры |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3127269A (en) * | 1961-09-11 | 1964-03-31 | Colour photography | |
| DK140596B (da) * | 1971-05-19 | 1979-10-08 | Sandoz Ag | Analogifremgangsmåde til fremstilling af 8beta-(ureidomethyl)-ergolenderivater. |
| NL7416120A (nl) * | 1973-12-21 | 1975-06-24 | Farmaceutici Italia | Werkwijze voor het bereiden van pyrimidinoami- nomethylergolinederivaten. |
| US3996228A (en) * | 1973-12-21 | 1976-12-07 | Societa' Farmaceutici Italia S.P.A. | Pyrimidinoaminoethyl ergoline derivatives |
| DE2456930A1 (de) * | 1974-12-02 | 1976-08-12 | Tesch Kg E | Elektronisches zeitspeicherrelais |
| CH615181A5 (en) * | 1975-05-21 | 1980-01-15 | Sandoz Ag | Process for the preparation of novel ergolene derivatives |
| GB2056437A (en) * | 1979-08-07 | 1981-03-18 | Erba Farmitalia | Secoergoline derivatives |
| DE3001752A1 (de) * | 1980-01-16 | 1981-07-30 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | Verfahren zur herstellung von 8(alpha)-substituierten 6-methylergolinen |
| DD154897A1 (de) * | 1980-12-02 | 1982-04-28 | Seifert Karlheinz Dipl Chem Dr | Verfahren zur herstellung von 8-substituierten ergolinen |
| DE3101535A1 (de) * | 1981-01-14 | 1982-08-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue (2-halogen-ergolinyl)-n'.n'-diethyl-harnstoffderivate, verfahren zu ihrer herstellung und deren verwendung als arzneimittel |
| GB2112382B (en) * | 1981-11-06 | 1985-03-06 | Erba Farmitalia | Ergoline derivatives |
-
1984
- 1984-04-23 PH PH30590A patent/PH21123A/en unknown
- 1984-04-24 DE DE8484104568T patent/DE3475709D1/de not_active Expired
- 1984-04-24 SU SU843728545A patent/SU1327788A3/ru active
- 1984-04-24 EP EP84104568A patent/EP0126968B1/en not_active Expired
- 1984-04-24 CA CA000452664A patent/CA1205801A/en not_active Expired
- 1984-04-25 FI FI841631A patent/FI81349C/fi not_active IP Right Cessation
- 1984-04-25 ES ES531906A patent/ES531906A0/es active Granted
- 1984-04-25 IL IL71633A patent/IL71633A/xx not_active IP Right Cessation
- 1984-04-26 GR GR74511A patent/GR79575B/el unknown
- 1984-04-26 PT PT78496A patent/PT78496B/pt not_active IP Right Cessation
- 1984-04-26 YU YU742/84A patent/YU43357B/xx unknown
- 1984-04-26 NO NO841657A patent/NO161562C/no unknown
- 1984-04-26 IE IE1018/84A patent/IE57240B1/en not_active IP Right Cessation
- 1984-04-26 US US06/604,041 patent/US4690929A/en not_active Expired - Fee Related
- 1984-04-27 AU AU27421/84A patent/AU556968B2/en not_active Ceased
- 1984-04-27 KR KR1019840002271A patent/KR900008696B1/ko not_active Expired
- 1984-04-27 HU HU841656A patent/HU198713B/hu not_active IP Right Cessation
- 1984-04-27 DK DK212784A patent/DK162996C/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GR79575B (da) | 1984-10-30 |
| NO161562B (no) | 1989-05-22 |
| ES8506031A1 (es) | 1985-06-01 |
| YU43357B (en) | 1989-06-30 |
| FI841631A0 (da) | 1984-04-25 |
| AU2742184A (en) | 1984-11-01 |
| PH21123A (en) | 1987-07-27 |
| YU74284A (en) | 1986-10-31 |
| US4690929A (en) | 1987-09-01 |
| EP0126968B1 (en) | 1988-12-21 |
| IE57240B1 (en) | 1992-06-17 |
| HU198713B (en) | 1989-11-28 |
| IL71633A0 (en) | 1984-07-31 |
| FI81349B (fi) | 1990-06-29 |
| DK212784A (da) | 1984-10-29 |
| ES531906A0 (es) | 1985-06-01 |
| HUT34024A (en) | 1985-01-28 |
| SU1327788A3 (ru) | 1987-07-30 |
| PT78496A (en) | 1984-05-01 |
| PT78496B (en) | 1986-07-22 |
| NO161562C (no) | 1989-08-30 |
| NO841657L (no) | 1984-10-29 |
| KR840008353A (ko) | 1984-12-14 |
| DK162996B (da) | 1992-01-06 |
| CA1205801A (en) | 1986-06-10 |
| DE3475709D1 (en) | 1989-01-26 |
| AU556968B2 (en) | 1986-11-27 |
| EP0126968A1 (en) | 1984-12-05 |
| KR900008696B1 (ko) | 1990-11-27 |
| DK212784D0 (da) | 1984-04-27 |
| DK162996C (da) | 1992-06-01 |
| FI841631A7 (da) | 1984-10-29 |
| FI81349C (fi) | 1990-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL73756A0 (en) | Indole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL70756A0 (en) | 3-amino-pyridazine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL71249A0 (en) | Thiazolidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL72151A0 (en) | Tetrahydropyridazinone derivatives,their preparation and pharmaceutical compositions containing them | |
| IL73332A0 (en) | Triazine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL72298A0 (en) | Imidazole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL71633A (en) | Ergoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL70755A (en) | 3-amino-4-cyano-pyridazine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL67155A0 (en) | Ergoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL73222A0 (en) | Benzenesulfonyl-lactam derivatives,their preparation and pharmaceutical compositions containing them | |
| IL73259A0 (en) | Imidazoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL73902A (en) | Gonadoliberin derivatives,their preparation and pharmaceutical compositions containing them | |
| IL72480A0 (en) | Benzamidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL68496A0 (en) | Ergoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL72173A0 (en) | Guanine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL73776A (en) | N-phenyl-1h-tetrazole-5-carboxamide derivatives,their preparation and pharmaceutical compositions containing them | |
| IL72757A0 (en) | Benzodiazepine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL73899A0 (en) | Imidazole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL73231A0 (en) | 1-acetylaminophenyl-2-amino-propanone derivatives,their preparation and pharmaceutical compositions containing them | |
| IL62519A0 (en) | Ergoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL73429A0 (en) | Tricyclic thiadiazinone derivatives,their preparation and pharmaceutical compositions containing them | |
| IL70791A0 (en) | Substituted pyrrolidinone derivatives,their preparation and pharmaceutical compositions containing them | |
| DE3469176D1 (en) | 2,6-dioxopiperidine derivatives, their preparation and pharmaceutical compositions containing them | |
| GB2151226B (en) | 2, 6-dioxopiperidine derivatives, their preparation and pharmaceutical compositions containing them | |
| IL73011A0 (en) | Condensed as-triazine derivatives,their preparation and pharmaceutical compositions containing them |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RH | Patent void |